diff --git a/.claude/settings.local.json b/.claude/settings.local.json
new file mode 100644
index 0000000..48b5eab
--- /dev/null
+++ b/.claude/settings.local.json
@@ -0,0 +1,22 @@
+{
+  "permissions": {
+    "allow": [
+      "Bash(dotnet --version)",
+      "Bash(dotnet restore:*)",
+      "Bash(dotnet build)",
+      "Bash(dotnet test)",
+      "Bash(dotnet tool install:*)",
+      "Bash(~/.dotnet/tools/libman restore)",
+      "Bash(timeout:*)",
+      "Bash(ls:*)",
+      "Bash(mkdir:*)",
+      "Bash(dotnet clean:*)",
+      "Bash(find:*)",
+      "Bash(rg:*)",
+      "Bash(pkill:*)",
+      "Bash(sudo rm:*)",
+      "Bash(rm:*)"
+    ]
+  },
+  "enableAllProjectMcpServers": false
+}
\ No newline at end of file
diff --git a/.gitignore b/.gitignore
new file mode 100644
index 0000000..9bcaa5f
--- /dev/null
+++ b/.gitignore
@@ -0,0 +1,382 @@
+## Ignore Visual Studio temporary files, build results, and
+## files generated by popular Visual Studio add-ons.
+##
+## Get latest from https://github.com/github/gitignore/blob/master/VisualStudio.gitignore
+
+# User-specific files
+*.rsuser
+*.suo
+*.user
+*.userosscache
+*.sln.docstates
+
+# User-specific files (MonoDevelop/Xamarin Studio)
+*.userprefs
+
+# Mono auto generated files
+mono_crash.*
+
+# Build results
+[Dd]ebug/
+[Dd]ebugPublic/
+[Rr]elease/
+[Rr]eleases/
+x64/
+x86/
+[Ww][Ii][Nn]32/
+[Aa][Rr][Mm]/
+[Aa][Rr][Mm]64/
+bld/
+[Bb]in/
+[Oo]bj/
+[Oo]ut/
+[Ll]og/
+[Ll]ogs/
+
+# Visual Studio 2015/2017 cache/options directory
+.vs/
+# Uncomment if you have tasks that create the project's static files in wwwroot
+#wwwroot/
+
+# Visual Studio 2017 auto generated files
+Generated\ Files/
+
+# MSTest test Results
+[Tt]est[Rr]esult*/
+[Bb]uild[Ll]og.*
+
+# NUnit
+*.VisualState.xml
+TestResult.xml
+nunit-*.xml
+
+# Build Results of an ATL Project
+[Dd]ebugPS/
+[Rr]eleasePS/
+dlldata.c
+
+# Benchmark Results
+BenchmarkDotNet.Artifacts/
+
+# .NET Core
+project.lock.json
+project.fragment.lock.json
+artifacts/
+
+# ASP.NET Scaffolding
+ScaffoldingReadMe.txt
+
+# StyleCop
+StyleCopReport.xml
+
+# Files built by Visual Studio
+*_i.c
+*_p.c
+*_h.h
+*.ilk
+*.meta
+*.obj
+*.iobj
+*.pch
+*.pdb
+*.ipdb
+*.pgc
+*.pgd
+*.rsp
+*.sbr
+*.tlb
+*.tli
+*.tlh
+*.tmp
+*.tmp_proj
+*_wpftmp.csproj
+*.log
+*.vspscc
+*.vssscc
+.builds
+*.pidb
+*.svclog
+*.scc
+
+# Chutzpah Test files
+_Chutzpah*
+
+# Visual C++ cache files
+ipch/
+*.aps
+*.ncb
+*.opendb
+*.opensdf
+*.sdf
+*.cachefile
+*.VC.db
+*.VC.VC.opendb
+
+# Visual Studio profiler
+*.psess
+*.vsp
+*.vspx
+*.sap
+
+# Visual Studio Trace Files
+*.e2e
+
+# TFS 2012 Local Workspace
+$tf/
+
+# Guidance Automation Toolkit
+*.gpState
+
+# ReSharper is a .NET coding add-in
+_ReSharper*/
+*.[Rr]e[Ss]harper
+*.DotSettings.user
+
+# TeamCity is a build add-in
+_TeamCity*
+
+# DotCover is a Code Coverage Tool
+*.dotCover
+
+# AxoCover is a Code Coverage Tool
+.axoCover/*
+!.axoCover/settings.json
+
+# Coverlet is a free, cross platform Code Coverage Tool
+coverage*.json
+coverage*.xml
+coverage*.info
+
+# Visual Studio code coverage results
+*.coverage
+*.coveragexml
+
+# NCrunch
+_NCrunch_*
+.*crunch*.local.xml
+nCrunchTemp_*
+
+# MightyMoose
+*.mm.*
+AutoTest.Net/
+
+# Web workbench (sass)
+.sass-cache/
+
+# Installshield output folder
+[Ee]xpress/
+
+# DocProject is a documentation generator add-in
+DocProject/buildhelp/
+DocProject/Help/*.HxT
+DocProject/Help/*.HxC
+DocProject/Help/*.hhc
+DocProject/Help/*.hhk
+DocProject/Help/*.hhp
+DocProject/Help/*.HxS
+DocProject/Help/Html2
+DocProject/Help/html
+
+# Click-Once directory
+publish/
+
+# Publish Web Output
+*.[Pp]ublish.xml
+*.azurePubxml
+# Note: Comment the next line if you want to checkin your web deploy settings,
+# but database connection strings (with potential passwords) will be unencrypted
+*.pubxml
+*.publishproj
+
+# Microsoft Azure Web App publish settings. Comment the next line if you want to
+# checkin your Azure Web App publish settings, but sensitive information contained
+# in these files may be disclosed. Comment the next line if you want to checkin
+# your web deploy settings, but sensitive information contained in these files may
+# be disclosed. Comment the next line if you want to checkin your web deploy settings, 
+# but database connection strings (with potential passwords) will be unencrypted
+*.azurePubxml
+
+# Microsoft Azure Build Output
+csx/
+*.build.csdef
+
+# Microsoft Azure Emulator
+ecf/
+rcf/
+
+# Windows Store app package directories and files
+AppPackages/
+BundleArtifacts/
+Package.StoreAssociation.xml
+_pkginfo.txt
+*.appx
+*.appxbundle
+*.appxupload
+
+# Visual Studio cache files
+# files ending in .cache can be ignored
+*.[Cc]ache
+# but keep track of directories ending in .cache
+!?*.[Cc]ache/
+
+# Others
+ClientBin/
+~$*
+*~
+*.dbmdl
+*.dbproj.schemaview
+*.jfm
+*.pfx
+*.publishsettings
+orleans.codegen.cs
+
+# Including strong name files can present a security risk
+# (https://github.com/github/gitignore/pull/2483#issue-259490424)
+#*.snk
+
+# Since there are multiple workflows, uncomment the next line to ignore bower_components
+# (https://github.com/github/gitignore/pull/1529#issuecomment-104372622)
+#bower_components/
+
+# RIA/Silverlight projects
+Generated_Code/
+
+# Backup & report files from converting an old project file
+# to a newer Visual Studio version. Backup files are not needed,
+# because we have git ;-)
+_UpgradeReport_Files/
+Backup*/
+UpgradeLog*.XML
+UpgradeLog*.htm
+CConvertLog*.txt
+
+# SQL Server files
+*.mdf
+*.ldf
+*.ndf
+
+# Business Intelligence projects
+*.rdl.data
+*.bim.layout
+*.bim_*.settings
+*.rptproj.rsuser
+*- [Bb]ackup.rdl
+*- [Bb]ackup ([0-9]).rdl
+*- [Bb]ackup ([0-9][0-9]).rdl
+
+# Microsoft Fakes
+FakesAssemblies/
+
+# GhostDoc plugin setting file
+*.GhostDoc.xml
+
+# Node.js Tools for Visual Studio
+.ntvs_analysis.dat
+node_modules/
+
+# Visual Studio 6 build log
+*.plg
+
+# Visual Studio 6 workspace options file
+*.opt
+
+# Visual Studio 6 auto-generated workspace file (contains which files were open etc.)
+*.vbw
+
+# Visual Studio LightSwitch build output
+**/*.HTMLClient/GeneratedArtifacts
+**/*.DesktopClient/GeneratedArtifacts
+**/*.DesktopClient/ModelManifest.xml
+**/*.Server/GeneratedArtifacts
+**/*.Server/ModelManifest.xml
+_Pvt_Extensions
+
+# Paket dependency manager
+.paket/paket.exe
+paket-files/
+
+# FAKE - F# Make
+.fake/
+
+# CodeRush personal settings
+.cr/personal
+
+# Python Tools for Visual Studio (PTVS)
+__pycache__/
+*.pyc
+
+# Cake - Uncomment if you are using it
+# tools/**
+# !tools/packages.config
+
+# Tabs Studio
+*.tss
+
+# Telerik's JustMock configuration file
+*.jmconfig
+
+# BizTalk build output
+*.btp.cs
+*.btm.cs
+*.odx.cs
+*.xsd.cs
+
+# OpenCover UI analysis results
+OpenCover/
+
+# Azure Stream Analytics local run output
+ASALocalRun/
+
+# MSBuild Binary and Structured Log
+*.binlog
+
+# NVidia Nsight GPU debugger configuration file
+*.nvuser
+
+# MFractors (Xamarin productivity tool) working folder
+.mfractor/
+
+# Local History for Visual Studio
+.localhistory/
+
+# BeatPulse healthcheck temp database
+healthchecksdb
+
+# Backup folder for Package Reference Convert tool in Visual Studio 2017
+MigrationBackup/
+
+# Ionide (cross platform F# VS Code tools) working folder
+.ionide/
+
+# Fody - auto-generated XML schema
+FodyWeavers.xsd
+
+# Custom
+appsettings.Local.json
+appsettings.Production.json
+*.Development.json
+logs/
+uploads/
+temp/
+*.env
+.env.local
+.env.production
+
+# macOS
+.DS_Store
+
+# IDE
+.vscode/
+.idea/
+*.swp
+*.swo
+
+# Database
+*.db
+*.sqlite
+*.sqlite3
+
+# Certificates
+*.pfx
+*.crt
+*.key
\ No newline at end of file
diff --git a/BCards.sln b/BCards.sln
new file mode 100644
index 0000000..9b1a83d
--- /dev/null
+++ b/BCards.sln
@@ -0,0 +1,27 @@
+Microsoft Visual Studio Solution File, Format Version 12.00
+# Visual Studio Version 17
+VisualStudioVersion = 17.0.31903.59
+MinimumVisualStudioVersion = 10.0.40219.1
+Project("{9A19103F-16F7-4668-BE54-9A1E7A4F7556}") = "BCards.Web", "src\BCards.Web\BCards.Web.csproj", "{2E8F4B5C-9B3A-4F8E-8C7D-1A2B3C4D5E6F}"
+EndProject
+Project("{9A19103F-16F7-4668-BE54-9A1E7A4F7556}") = "BCards.Tests", "tests\BCards.Tests\BCards.Tests.csproj", "{5E64FFFD-4D6F-4C5A-A4BC-AF93A1C603A3}"
+EndProject
+Global
+	GlobalSection(SolutionConfigurationPlatforms) = preSolution
+		Debug|Any CPU = Debug|Any CPU
+		Release|Any CPU = Release|Any CPU
+	EndGlobalSection
+	GlobalSection(ProjectConfigurationPlatforms) = postSolution
+		{2E8F4B5C-9B3A-4F8E-8C7D-1A2B3C4D5E6F}.Debug|Any CPU.ActiveCfg = Debug|Any CPU
+		{2E8F4B5C-9B3A-4F8E-8C7D-1A2B3C4D5E6F}.Debug|Any CPU.Build.0 = Debug|Any CPU
+		{2E8F4B5C-9B3A-4F8E-8C7D-1A2B3C4D5E6F}.Release|Any CPU.ActiveCfg = Release|Any CPU
+		{2E8F4B5C-9B3A-4F8E-8C7D-1A2B3C4D5E6F}.Release|Any CPU.Build.0 = Release|Any CPU
+		{5E64FFFD-4D6F-4C5A-A4BC-AF93A1C603A3}.Debug|Any CPU.ActiveCfg = Debug|Any CPU
+		{5E64FFFD-4D6F-4C5A-A4BC-AF93A1C603A3}.Debug|Any CPU.Build.0 = Debug|Any CPU
+		{5E64FFFD-4D6F-4C5A-A4BC-AF93A1C603A3}.Release|Any CPU.ActiveCfg = Release|Any CPU
+		{5E64FFFD-4D6F-4C5A-A4BC-AF93A1C603A3}.Release|Any CPU.Build.0 = Release|Any CPU
+	EndGlobalSection
+	GlobalSection(SolutionProperties) = preSolution
+		HideSolutionNode = FALSE
+	EndGlobalSection
+EndGlobal
diff --git a/docker-compose.yml b/docker-compose.yml
new file mode 100644
index 0000000..0fd2c38
--- /dev/null
+++ b/docker-compose.yml
@@ -0,0 +1,55 @@
+version: '3.8'
+
+services:
+  mongodb:
+    image: mongo:7.0
+    container_name: bcards-mongodb
+    ports:
+      - "27017:27017"
+    environment:
+      MONGO_INITDB_ROOT_USERNAME: admin
+      MONGO_INITDB_ROOT_PASSWORD: password123
+      MONGO_INITDB_DATABASE: BCardsDB
+    volumes:
+      - mongodb_data:/data/db
+      - ./scripts/init-mongo.js:/docker-entrypoint-initdb.d/init-mongo.js:ro
+    networks:
+      - bcards-network
+
+  bcards-web:
+    build:
+      context: .
+      dockerfile: src/BCards.Web/Dockerfile
+    container_name: bcards-web
+    ports:
+      - "8080:80"
+      - "8443:443"
+    environment:
+      - ASPNETCORE_ENVIRONMENT=Development
+      - MongoDb__ConnectionString=mongodb://admin:password123@mongodb:27017/BCardsDB?authSource=admin
+      - MongoDb__DatabaseName=BCardsDB
+    depends_on:
+      - mongodb
+    networks:
+      - bcards-network
+    volumes:
+      - ./uploads:/app/uploads
+
+  redis:
+    image: redis:7-alpine
+    container_name: bcards-redis
+    ports:
+      - "6379:6379"
+    networks:
+      - bcards-network
+    command: redis-server --appendonly yes
+    volumes:
+      - redis_data:/data
+
+volumes:
+  mongodb_data:
+  redis_data:
+
+networks:
+  bcards-network:
+    driver: bridge
\ No newline at end of file
diff --git a/scripts/init-mongo.js b/scripts/init-mongo.js
new file mode 100644
index 0000000..16765a3
--- /dev/null
+++ b/scripts/init-mongo.js
@@ -0,0 +1,194 @@
+// MongoDB initialization script
+db = db.getSiblingDB('BCardsDB');
+
+// Create collections
+db.createCollection('users');
+db.createCollection('userpages');
+db.createCollection('categories');
+db.createCollection('subscriptions');
+db.createCollection('themes');
+
+// Create indexes for users
+db.users.createIndex({ "email": 1 }, { unique: true });
+db.users.createIndex({ "stripeCustomerId": 1 });
+
+// Create indexes for userpages
+db.userpages.createIndex({ "userId": 1 });
+db.userpages.createIndex({ "category": 1, "slug": 1 }, { unique: true });
+db.userpages.createIndex({ "category": 1 });
+db.userpages.createIndex({ "isActive": 1 });
+db.userpages.createIndex({ "publishedAt": -1 });
+
+// Create indexes for categories
+db.categories.createIndex({ "slug": 1 }, { unique: true });
+db.categories.createIndex({ "isActive": 1 });
+
+// Create indexes for subscriptions
+db.subscriptions.createIndex({ "userId": 1 });
+db.subscriptions.createIndex({ "stripeSubscriptionId": 1 });
+db.subscriptions.createIndex({ "status": 1 });
+
+// Create indexes for themes
+db.themes.createIndex({ "isActive": 1 });
+db.themes.createIndex({ "isPremium": 1 });
+
+// Insert default categories
+db.categories.insertMany([
+  {
+    name: "Corretor de Imóveis",
+    slug: "corretor",
+    icon: "🏠",
+    description: "Profissionais especializados em compra, venda e locação de imóveis",
+    seoKeywords: ["corretor", "imóveis", "casa", "apartamento", "venda", "locação"],
+    isActive: true,
+    createdAt: new Date()
+  },
+  {
+    name: "Tecnologia",
+    slug: "tecnologia",
+    icon: "💻",
+    description: "Empresas e profissionais de tecnologia, desenvolvimento e TI",
+    seoKeywords: ["desenvolvimento", "software", "programação", "tecnologia", "TI"],
+    isActive: true,
+    createdAt: new Date()
+  },
+  {
+    name: "Saúde",
+    slug: "saude",
+    icon: "🏥",
+    description: "Profissionais da saúde, clínicas e consultórios médicos",
+    seoKeywords: ["médico", "saúde", "clínica", "consulta", "tratamento"],
+    isActive: true,
+    createdAt: new Date()
+  },
+  {
+    name: "Educação",
+    slug: "educacao",
+    icon: "📚",
+    description: "Professores, escolas, cursos e instituições de ensino",
+    seoKeywords: ["educação", "ensino", "professor", "curso", "escola"],
+    isActive: true,
+    createdAt: new Date()
+  },
+  {
+    name: "Comércio",
+    slug: "comercio",
+    icon: "🛍️",
+    description: "Lojas, e-commerce e estabelecimentos comerciais",
+    seoKeywords: ["loja", "comércio", "venda", "produtos", "e-commerce"],
+    isActive: true,
+    createdAt: new Date()
+  },
+  {
+    name: "Serviços",
+    slug: "servicos",
+    icon: "🔧",
+    description: "Prestadores de serviços gerais e especializados",
+    seoKeywords: ["serviços", "prestador", "profissional", "especializado"],
+    isActive: true,
+    createdAt: new Date()
+  },
+  {
+    name: "Alimentação",
+    slug: "alimentacao",
+    icon: "🍽️",
+    description: "Restaurantes, delivery, food trucks e estabelecimentos alimentícios",
+    seoKeywords: ["restaurante", "comida", "delivery", "alimentação", "gastronomia"],
+    isActive: true,
+    createdAt: new Date()
+  },
+  {
+    name: "Beleza",
+    slug: "beleza",
+    icon: "💄",
+    description: "Salões de beleza, barbearias, estética e cuidados pessoais",
+    seoKeywords: ["beleza", "salão", "estética", "cabeleireiro", "manicure"],
+    isActive: true,
+    createdAt: new Date()
+  },
+  {
+    name: "Advocacia",
+    slug: "advocacia",
+    icon: "⚖️",
+    description: "Advogados, escritórios jurídicos e consultoria legal",
+    seoKeywords: ["advogado", "jurídico", "direito", "advocacia", "legal"],
+    isActive: true,
+    createdAt: new Date()
+  },
+  {
+    name: "Arquitetura",
+    slug: "arquitetura",
+    icon: "🏗️",
+    description: "Arquitetos, engenheiros e profissionais da construção",
+    seoKeywords: ["arquiteto", "engenheiro", "construção", "projeto", "reforma"],
+    isActive: true,
+    createdAt: new Date()
+  }
+]);
+
+// Insert default themes
+db.themes.insertMany([
+  {
+    name: "Minimalista",
+    primaryColor: "#2563eb",
+    secondaryColor: "#1d4ed8",
+    backgroundColor: "#ffffff",
+    textColor: "#1f2937",
+    backgroundImage: "",
+    isPremium: false,
+    cssTemplate: "minimal",
+    isActive: true,
+    createdAt: new Date()
+  },
+  {
+    name: "Dark Mode",
+    primaryColor: "#10b981",
+    secondaryColor: "#059669",
+    backgroundColor: "#111827",
+    textColor: "#f9fafb",
+    backgroundImage: "",
+    isPremium: false,
+    cssTemplate: "dark",
+    isActive: true,
+    createdAt: new Date()
+  },
+  {
+    name: "Natureza",
+    primaryColor: "#16a34a",
+    secondaryColor: "#15803d",
+    backgroundColor: "#f0fdf4",
+    textColor: "#166534",
+    backgroundImage: "/images/themes/nature-bg.jpg",
+    isPremium: false,
+    cssTemplate: "nature",
+    isActive: true,
+    createdAt: new Date()
+  },
+  {
+    name: "Corporativo",
+    primaryColor: "#1e40af",
+    secondaryColor: "#1e3a8a",
+    backgroundColor: "#f8fafc",
+    textColor: "#0f172a",
+    backgroundImage: "",
+    isPremium: false,
+    cssTemplate: "corporate",
+    isActive: true,
+    createdAt: new Date()
+  },
+  {
+    name: "Vibrante",
+    primaryColor: "#dc2626",
+    secondaryColor: "#b91c1c",
+    backgroundColor: "#fef2f2",
+    textColor: "#7f1d1d",
+    backgroundImage: "",
+    isPremium: true,
+    cssTemplate: "vibrant",
+    isActive: true,
+    createdAt: new Date()
+  }
+]);
+
+print("Database initialized successfully!");
+print("Collections created with indexes and default data inserted.");
\ No newline at end of file
diff --git a/src/BCards.Web/BCards.Web.csproj b/src/BCards.Web/BCards.Web.csproj
new file mode 100644
index 0000000..f5427fc
--- /dev/null
+++ b/src/BCards.Web/BCards.Web.csproj
@@ -0,0 +1,30 @@
+<Project Sdk="Microsoft.NET.Sdk.Web">
+
+  <PropertyGroup>
+    <TargetFramework>net8.0</TargetFramework>
+    <Nullable>enable</Nullable>
+    <ImplicitUsings>enable</ImplicitUsings>
+	<EnableDefaultEmbeddedResourceItems>false</EnableDefaultEmbeddedResourceItems>
+  </PropertyGroup>
+
+  <ItemGroup>
+    <PackageReference Include="MongoDB.Driver" Version="2.25.0" />
+    <PackageReference Include="Stripe.net" Version="44.7.0" />
+    <PackageReference Include="Microsoft.AspNetCore.Authentication.Google" Version="8.0.4" />
+    <PackageReference Include="Microsoft.AspNetCore.Authentication.MicrosoftAccount" Version="8.0.4" />
+    <PackageReference Include="Microsoft.AspNetCore.Localization" Version="2.2.0" />
+    <PackageReference Include="Microsoft.Extensions.Localization" Version="8.0.4" />
+    <PackageReference Include="Microsoft.AspNetCore.Mvc.Razor.RuntimeCompilation" Version="8.0.4" />
+    <PackageReference Include="SixLabors.ImageSharp.Web" Version="3.1.0" />
+    <PackageReference Include="Microsoft.AspNetCore.ResponseCaching" Version="2.2.0" />
+  </ItemGroup>
+
+  <ItemGroup>
+    <EmbeddedResource Include="Resources\**\*.resx" />
+  </ItemGroup>
+
+  <ItemGroup>
+    <Folder Include="Views\Payment\" />
+  </ItemGroup>
+
+</Project>
\ No newline at end of file
diff --git a/src/BCards.Web/Configuration/GoogleAuthSettings.cs b/src/BCards.Web/Configuration/GoogleAuthSettings.cs
new file mode 100644
index 0000000..de94ad5
--- /dev/null
+++ b/src/BCards.Web/Configuration/GoogleAuthSettings.cs
@@ -0,0 +1,13 @@
+namespace BCards.Web.Configuration;
+
+public class GoogleAuthSettings
+{
+    public string ClientId { get; set; } = string.Empty;
+    public string ClientSecret { get; set; } = string.Empty;
+}
+
+public class MicrosoftAuthSettings
+{
+    public string ClientId { get; set; } = string.Empty;
+    public string ClientSecret { get; set; } = string.Empty;
+}
\ No newline at end of file
diff --git a/src/BCards.Web/Configuration/MongoDbSettings.cs b/src/BCards.Web/Configuration/MongoDbSettings.cs
new file mode 100644
index 0000000..ef2c320
--- /dev/null
+++ b/src/BCards.Web/Configuration/MongoDbSettings.cs
@@ -0,0 +1,7 @@
+namespace BCards.Web.Configuration;
+
+public class MongoDbSettings
+{
+    public string ConnectionString { get; set; } = string.Empty;
+    public string DatabaseName { get; set; } = string.Empty;
+}
\ No newline at end of file
diff --git a/src/BCards.Web/Configuration/StripeSettings.cs b/src/BCards.Web/Configuration/StripeSettings.cs
new file mode 100644
index 0000000..73b157a
--- /dev/null
+++ b/src/BCards.Web/Configuration/StripeSettings.cs
@@ -0,0 +1,8 @@
+namespace BCards.Web.Configuration;
+
+public class StripeSettings
+{
+    public string PublishableKey { get; set; } = string.Empty;
+    public string SecretKey { get; set; } = string.Empty;
+    public string WebhookSecret { get; set; } = string.Empty;
+}
\ No newline at end of file
diff --git a/src/BCards.Web/Controllers/AdminController.cs b/src/BCards.Web/Controllers/AdminController.cs
new file mode 100644
index 0000000..77f547a
--- /dev/null
+++ b/src/BCards.Web/Controllers/AdminController.cs
@@ -0,0 +1,673 @@
+using BCards.Web.Models;
+using BCards.Web.Services;
+using BCards.Web.ViewModels;
+using Microsoft.AspNetCore.Authorization;
+using Microsoft.AspNetCore.Mvc;
+using System.Security.Claims;
+
+namespace BCards.Web.Controllers;
+
+[Authorize]
+[Route("Admin")]
+public class AdminController : Controller
+{
+    private readonly IAuthService _authService;
+    private readonly IUserPageService _userPageService;
+    private readonly ICategoryService _categoryService;
+    private readonly IThemeService _themeService;
+    private readonly ILogger<AdminController> _logger;
+
+    public AdminController(
+        IAuthService authService,
+        IUserPageService userPageService,
+        ICategoryService categoryService,
+        IThemeService themeService,
+        ILogger<AdminController> logger)
+    {
+        _authService = authService;
+        _userPageService = userPageService;
+        _categoryService = categoryService;
+        _themeService = themeService;
+        _logger = logger;
+    }
+
+
+    [HttpGet]
+    [Route("Dashboard")]
+    public async Task<IActionResult> Dashboard()
+    {
+        var user = await _authService.GetCurrentUserAsync(User);
+        if (user == null)
+            return RedirectToAction("Login", "Auth");
+
+        var userPlanType = Enum.TryParse<PlanType>(user.CurrentPlan, true, out var planType) ? planType : PlanType.Trial;
+        var userPages = await _userPageService.GetUserPagesAsync(user.Id);
+        
+        var dashboardModel = new DashboardViewModel
+        {
+            CurrentUser = user,
+            UserPages = userPages.Select(p => new UserPageSummary
+            {
+                Id = p.Id,
+                DisplayName = p.DisplayName,
+                Slug = p.Slug,
+                Category = p.Category,
+                Status = p.Status,
+                TotalClicks = p.Analytics?.TotalClicks ?? 0,
+                TotalViews = p.Analytics?.TotalViews ?? 0,
+                CreatedAt = p.CreatedAt
+            }).ToList(),
+            CurrentPlan = new PlanInfo
+            {
+                Type = userPlanType,
+                Name = userPlanType.GetDisplayName(),
+                MaxPages = userPlanType.GetMaxPages(),
+                MaxLinksPerPage = userPlanType.GetMaxLinksPerPage(),
+                DurationDays = userPlanType.GetTrialDays(),
+                Price = userPlanType.GetPrice(),
+                AllowsAnalytics = userPlanType.AllowsAnalytics(),
+                AllowsCustomThemes = userPlanType.AllowsCustomThemes()
+            },
+            CanCreateNewPage = userPages.Count < userPlanType.GetMaxPages(),
+            DaysRemaining = userPlanType == PlanType.Trial ? CalculateTrialDaysRemaining(user) : 0
+        };
+        
+        return View(dashboardModel);
+    }
+
+    private int CalculateTrialDaysRemaining(User user)
+    {
+        // This would be calculated based on subscription data
+        // For now, return a default value
+        return 7;
+    }
+
+    [HttpGet]
+    [Route("ManagePage")]
+    public async Task<IActionResult> ManagePage(string id = null)
+    {
+        var user = await _authService.GetCurrentUserAsync(User);
+        if (user == null)
+            return RedirectToAction("Login", "Auth");
+
+        var userPlanType = Enum.TryParse<PlanType>(user.CurrentPlan, true, out var planType) ? planType : PlanType.Trial;
+        var categories = await _categoryService.GetAllCategoriesAsync();
+        var themes = await _themeService.GetAvailableThemesAsync();
+
+        if (string.IsNullOrEmpty(id) || id == "new")
+        {
+            // Check if user can create new page
+            var existingPages = await _userPageService.GetUserPagesAsync(user.Id);
+            var maxPages = userPlanType.GetMaxPages();
+            
+            if (existingPages.Count >= maxPages)
+            {
+                TempData["Error"] = $"Você já atingiu o limite de {maxPages} página(s) do seu plano atual. Faça upgrade para criar mais páginas.";
+                return RedirectToAction("Dashboard");
+            }
+
+            // CRIAR NOVA PÁGINA
+            var model = new ManagePageViewModel
+            {
+                IsNewPage = true,
+                AvailableCategories = categories,
+                AvailableThemes = themes.Where(t => !t.IsPremium || userPlanType.AllowsCustomThemes()).ToList(),
+                MaxLinksAllowed = userPlanType.GetMaxLinksPerPage()
+            };
+            return View(model);
+        }
+        else
+        {
+            // EDITAR PÁGINA EXISTENTE
+            var page = await _userPageService.GetPageByIdAsync(id);
+            if (page == null || page.UserId != user.Id)
+                return NotFound();
+
+            var model = MapToManageViewModel(page, categories, themes, userPlanType);
+            return View(model);
+        }
+    }
+
+    [HttpPost]
+    [Route("ManagePage")]
+    public async Task<IActionResult> ManagePage(ManagePageViewModel model)
+    {
+        var user = await _authService.GetCurrentUserAsync(User);
+        if (user == null)
+            return RedirectToAction("Login", "Auth");
+
+        _logger.LogInformation($"ManagePage POST: IsNewPage={model.IsNewPage}, DisplayName={model.DisplayName}, Category={model.Category}, Links={model.Links?.Count ?? 0}");
+
+        if (!ModelState.IsValid)
+        {
+            _logger.LogWarning("ModelState is invalid:");
+            foreach (var error in ModelState)
+            {
+                _logger.LogWarning($"Key: {error.Key}, Errors: {string.Join(", ", error.Value.Errors.Select(e => e.ErrorMessage))}");
+            }
+            
+            // Repopulate dropdowns
+            model.AvailableCategories = await _categoryService.GetAllCategoriesAsync();
+            model.AvailableThemes = await _themeService.GetAvailableThemesAsync();
+            return View(model);
+        }
+
+        if (model.IsNewPage)
+        {
+            // Generate slug if not provided
+            if (string.IsNullOrEmpty(model.Slug))
+            {
+                model.Slug = await _userPageService.GenerateSlugAsync(model.Category, model.DisplayName);
+            }
+
+            // Check if slug is available
+            if (!await _userPageService.ValidateSlugAsync(model.Category, model.Slug))
+            {
+                ModelState.AddModelError("Slug", "Esta URL já está em uso. Tente outra.");
+                model.AvailableCategories = await _categoryService.GetAllCategoriesAsync();
+                model.AvailableThemes = await _themeService.GetAvailableThemesAsync();
+                return View(model);
+            }
+
+            // Check if user can create the requested number of links
+            var activeLinksCount = model.Links?.Count ?? 0;
+            if (activeLinksCount > model.MaxLinksAllowed)
+            {
+                ModelState.AddModelError("", $"Você excedeu o limite de {model.MaxLinksAllowed} links do seu plano atual.");
+                model.AvailableCategories = await _categoryService.GetAllCategoriesAsync();
+                model.AvailableThemes = await _themeService.GetAvailableThemesAsync();
+                return View(model);
+            }
+
+            try
+            {
+                // Create new page
+                var userPage = await MapToUserPage(model, user.Id);
+                _logger.LogInformation($"Mapped to UserPage: {userPage.DisplayName}, Category: {userPage.Category}, Slug: {userPage.Slug}");
+                
+                await _userPageService.CreatePageAsync(userPage);
+                _logger.LogInformation("Page created successfully!");
+                
+                TempData["Success"] = "Página criada com sucesso!";
+            }
+            catch (Exception ex)
+            {
+                _logger.LogError(ex, "Error creating page");
+                ModelState.AddModelError("", "Erro ao criar página. Tente novamente.");
+                model.AvailableCategories = await _categoryService.GetAllCategoriesAsync();
+                model.AvailableThemes = await _themeService.GetAvailableThemesAsync();
+                return View(model);
+            }
+        }
+        else
+        {
+            // Update existing page
+            var existingPage = await _userPageService.GetPageByIdAsync(model.Id);
+            if (existingPage == null || existingPage.UserId != user.Id)
+                return NotFound();
+
+            UpdateUserPageFromModel(existingPage, model);
+            await _userPageService.UpdatePageAsync(existingPage);
+            TempData["Success"] = "Página atualizada com sucesso!";
+        }
+
+        return RedirectToAction("Dashboard");
+    }
+
+    [HttpPost]
+    [Route("CreatePage")]
+    public async Task<IActionResult> CreatePage(CreatePageViewModel model)
+    {
+        var user = await _authService.GetCurrentUserAsync(User);
+        if (user == null)
+            return RedirectToAction("Login", "Auth");
+
+        // Check if user already has a page
+        var existingPage = await _userPageService.GetUserPageAsync(user.Id);
+        if (existingPage != null)
+            return RedirectToAction("EditPage");
+
+        if (!ModelState.IsValid)
+        {
+            var categories = await _categoryService.GetAllCategoriesAsync();
+            var themes = await _themeService.GetAvailableThemesAsync();
+            ViewBag.Categories = categories;
+            ViewBag.Themes = themes;
+            return View(model);
+        }
+
+        // Generate slug if not provided
+        if (string.IsNullOrEmpty(model.Slug))
+        {
+            model.Slug = await _userPageService.GenerateSlugAsync(model.Category, model.DisplayName);
+        }
+
+        // Check if slug is available
+        if (!await _userPageService.ValidateSlugAsync(model.Category, model.Slug))
+        {
+            ModelState.AddModelError("Slug", "Esta URL já está em uso. Tente outra.");
+            var categories = await _categoryService.GetAllCategoriesAsync();
+            var themes = await _themeService.GetAvailableThemesAsync();
+            ViewBag.Categories = categories;
+            ViewBag.Themes = themes;
+            return View(model);
+        }
+
+        // Check if user can create the requested number of links
+        var activeLinksCount = model.Links?.Count ?? 0;
+        if (!await _userPageService.CanCreateLinksAsync(user.Id, activeLinksCount))
+        {
+            ModelState.AddModelError("", "Você excedeu o limite de links do seu plano atual.");
+            var categories = await _categoryService.GetAllCategoriesAsync();
+            var themes = await _themeService.GetAvailableThemesAsync();
+            ViewBag.Categories = categories;
+            ViewBag.Themes = themes;
+            return View(model);
+        }
+
+        // Convert ViewModel to UserPage
+        var userPage = new UserPage
+        {
+            UserId = user.Id,
+            DisplayName = model.DisplayName,
+            Category = model.Category,
+            BusinessType = model.BusinessType,
+            Bio = model.Bio,
+            Slug = model.Slug,
+            Theme = await _themeService.GetThemeByNameAsync(model.SelectedTheme) ?? _themeService.GetDefaultTheme(),
+            Links = model.Links?.Select(l => new LinkItem
+            {
+                Title = l.Title,
+                Url = l.Url,
+                Description = l.Description,
+                Icon = l.Icon,
+                IsActive = true,
+                Order = model.Links.IndexOf(l)
+            }).ToList() ?? new List<LinkItem>()
+        };
+
+        // Add social media links
+        var socialLinks = new List<LinkItem>();
+        if (!string.IsNullOrEmpty(model.WhatsAppNumber))
+        {
+            socialLinks.Add(new LinkItem
+            {
+                Title = "WhatsApp",
+                Url = $"https://wa.me/{model.WhatsAppNumber.Replace("+", "").Replace(" ", "").Replace("-", "").Replace("(", "").Replace(")", "")}",
+                Icon = "fab fa-whatsapp",
+                IsActive = true,
+                Order = userPage.Links.Count + socialLinks.Count
+            });
+        }
+
+        if (!string.IsNullOrEmpty(model.FacebookUrl))
+        {
+            socialLinks.Add(new LinkItem
+            {
+                Title = "Facebook",
+                Url = model.FacebookUrl,
+                Icon = "fab fa-facebook",
+                IsActive = true,
+                Order = userPage.Links.Count + socialLinks.Count
+            });
+        }
+
+        if (!string.IsNullOrEmpty(model.TwitterUrl))
+        {
+            socialLinks.Add(new LinkItem
+            {
+                Title = "X / Twitter",
+                Url = model.TwitterUrl,
+                Icon = "fab fa-x-twitter",
+                IsActive = true,
+                Order = userPage.Links.Count + socialLinks.Count
+            });
+        }
+
+        if (!string.IsNullOrEmpty(model.InstagramUrl))
+        {
+            socialLinks.Add(new LinkItem
+            {
+                Title = "Instagram",
+                Url = model.InstagramUrl,
+                Icon = "fab fa-instagram",
+                IsActive = true,
+                Order = userPage.Links.Count + socialLinks.Count
+            });
+        }
+
+        userPage.Links.AddRange(socialLinks);
+
+        await _userPageService.CreatePageAsync(userPage);
+
+        TempData["Success"] = "Página criada com sucesso!";
+        return RedirectToAction("Dashboard");
+    }
+
+    [HttpGet]
+    [Route("EditPage")]
+    public async Task<IActionResult> EditPage()
+    {
+        var user = await _authService.GetCurrentUserAsync(User);
+        if (user == null)
+            return RedirectToAction("Login", "Auth");
+
+        var userPage = await _userPageService.GetUserPageAsync(user.Id);
+        var categories = await _categoryService.GetAllCategoriesAsync();
+        var themes = await _themeService.GetAvailableThemesAsync();
+
+        ViewBag.Categories = categories;
+        ViewBag.Themes = themes;
+        ViewBag.IsNew = userPage == null;
+
+        return View(userPage ?? new UserPage { UserId = user.Id });
+    }
+
+    [HttpPost]
+    [Route("EditPage")]
+    public async Task<IActionResult> EditPage(UserPage model)
+    {
+        var user = await _authService.GetCurrentUserAsync(User);
+        if (user == null)
+            return RedirectToAction("Login", "Auth");
+
+        if (!ModelState.IsValid)
+        {
+            var categories = await _categoryService.GetAllCategoriesAsync();
+            var themes = await _themeService.GetAvailableThemesAsync();
+            ViewBag.Categories = categories;
+            ViewBag.Themes = themes;
+            return View(model);
+        }
+
+        // Check if user can create the requested number of links
+        var activeLinksCount = model.Links?.Count(l => l.IsActive) ?? 0;
+        if (!await _userPageService.CanCreateLinksAsync(user.Id, activeLinksCount))
+        {
+            ModelState.AddModelError("", "Você excedeu o limite de links do seu plano atual.");
+            var categories = await _categoryService.GetAllCategoriesAsync();
+            var themes = await _themeService.GetAvailableThemesAsync();
+            ViewBag.Categories = categories;
+            ViewBag.Themes = themes;
+            return View(model);
+        }
+
+        model.UserId = user.Id;
+        
+        // Check if slug is available
+        if (!await _userPageService.ValidateSlugAsync(model.Category, model.Slug, model.Id))
+        {
+            ModelState.AddModelError("Slug", "Esta URL já está em uso. Tente outra.");
+            var categories = await _categoryService.GetAllCategoriesAsync();
+            var themes = await _themeService.GetAvailableThemesAsync();
+            ViewBag.Categories = categories;
+            ViewBag.Themes = themes;
+            return View(model);
+        }
+
+        if (string.IsNullOrEmpty(model.Id))
+        {
+            await _userPageService.CreatePageAsync(model);
+        }
+        else
+        {
+            await _userPageService.UpdatePageAsync(model);
+        }
+
+        TempData["Success"] = "Página salva com sucesso!";
+        return RedirectToAction("Dashboard");
+    }
+
+    [HttpPost]
+    [Route("CheckSlugAvailability")]
+    public async Task<IActionResult> CheckSlugAvailability(string category, string slug, string? excludeId = null)
+    {
+        if (string.IsNullOrWhiteSpace(category) || string.IsNullOrWhiteSpace(slug))
+            return Json(new { available = false, message = "Categoria e slug são obrigatórios." });
+
+        var isValid = await _userPageService.ValidateSlugAsync(category, slug, excludeId);
+        
+        return Json(new { available = isValid, message = isValid ? "URL disponível!" : "Esta URL já está em uso." });
+    }
+
+    [HttpPost]
+    [Route("GenerateSlug")]
+    public async Task<IActionResult> GenerateSlug(string category, string name)
+    {
+        if (string.IsNullOrWhiteSpace(category) || string.IsNullOrWhiteSpace(name))
+            return Json(new { slug = "" });
+
+        var slug = await _userPageService.GenerateSlugAsync(category, name);
+        return Json(new { slug });
+    }
+
+    [HttpGet]
+    [Route("Analytics")]
+    public async Task<IActionResult> Analytics()
+    {
+        var user = await _authService.GetCurrentUserAsync(User);
+        if (user == null)
+            return RedirectToAction("Login", "Auth");
+
+        var userPage = await _userPageService.GetUserPageAsync(user.Id);
+        if (userPage == null || !userPage.PlanLimitations.AllowAnalytics)
+            return RedirectToAction("Dashboard");
+
+        return View(userPage);
+    }
+
+    [HttpPost]
+    public async Task<IActionResult> DeletePage()
+    {
+        var user = await _authService.GetCurrentUserAsync(User);
+        if (user == null)
+            return RedirectToAction("Login", "Auth");
+
+        var userPage = await _userPageService.GetUserPageAsync(user.Id);
+        if (userPage != null)
+        {
+            await _userPageService.DeletePageAsync(userPage.Id);
+            TempData["Success"] = "Página excluída com sucesso!";
+        }
+
+        return RedirectToAction("Dashboard");
+    }
+
+    private ManagePageViewModel MapToManageViewModel(UserPage page, List<Category> categories, List<PageTheme> themes, PlanType userPlanType)
+    {
+        return new ManagePageViewModel
+        {
+            Id = page.Id,
+            IsNewPage = false,
+            DisplayName = page.DisplayName,
+            Category = page.Category,
+            BusinessType = page.BusinessType,
+            Bio = page.Bio,
+            Slug = page.Slug,
+            SelectedTheme = page.Theme?.Name ?? "minimalist",
+            Links = page.Links?.Select((l, index) => new ManageLinkViewModel
+            {
+                Id = $"link_{index}",
+                Title = l.Title,
+                Url = l.Url,
+                Description = l.Description,
+                Icon = l.Icon,
+                Order = l.Order,
+                IsActive = l.IsActive
+            }).ToList() ?? new List<ManageLinkViewModel>(),
+            AvailableCategories = categories,
+            AvailableThemes = themes.Where(t => !t.IsPremium || userPlanType.AllowsCustomThemes()).ToList(),
+            MaxLinksAllowed = userPlanType.GetMaxLinksPerPage()
+        };
+    }
+
+    private async Task<UserPage> MapToUserPage(ManagePageViewModel model, string userId)
+    {
+        var theme = await _themeService.GetThemeByNameAsync(model.SelectedTheme) ?? _themeService.GetDefaultTheme();
+        
+        var userPage = new UserPage
+        {
+            UserId = userId,
+            DisplayName = model.DisplayName,
+            Category = model.Category.ToLower(),
+            BusinessType = model.BusinessType,
+            Bio = model.Bio,
+            Slug = model.Slug.ToLower(),
+            Theme = theme,
+            Status = ViewModels.PageStatus.Active,
+            Links = new List<LinkItem>()
+        };
+
+        // Add regular links
+        if (model.Links?.Any() == true)
+        {
+            userPage.Links.AddRange(model.Links.Where(l => !string.IsNullOrEmpty(l.Title) && !string.IsNullOrEmpty(l.Url))
+                .Select((l, index) => new LinkItem
+                {
+                    Title = l.Title,
+                    Url = l.Url.ToLower(),
+                    Description = l.Description,
+                    Icon = l.Icon,
+                    IsActive = l.IsActive,
+                    Order = index
+                }));
+        }
+
+        // Add social media links
+        var socialLinks = new List<LinkItem>();
+        var currentOrder = userPage.Links.Count;
+
+        if (!string.IsNullOrEmpty(model.WhatsAppNumber))
+        {
+            socialLinks.Add(new LinkItem
+            {
+                Title = "WhatsApp",
+                Url = $"https://wa.me/{model.WhatsAppNumber.Replace("+", "").Replace(" ", "").Replace("-", "").Replace("(", "").Replace(")", "")}",
+                Icon = "fab fa-whatsapp",
+                IsActive = true,
+                Order = currentOrder++
+            });
+        }
+
+        if (!string.IsNullOrEmpty(model.FacebookUrl))
+        {
+            socialLinks.Add(new LinkItem
+            {
+                Title = "Facebook",
+                Url = model.FacebookUrl,
+                Icon = "fab fa-facebook",
+                IsActive = true,
+                Order = currentOrder++
+            });
+        }
+
+        if (!string.IsNullOrEmpty(model.TwitterUrl))
+        {
+            socialLinks.Add(new LinkItem
+            {
+                Title = "X / Twitter",
+                Url = model.TwitterUrl,
+                Icon = "fab fa-x-twitter",
+                IsActive = true,
+                Order = currentOrder++
+            });
+        }
+
+        if (!string.IsNullOrEmpty(model.InstagramUrl))
+        {
+            socialLinks.Add(new LinkItem
+            {
+                Title = "Instagram",
+                Url = model.InstagramUrl,
+                Icon = "fab fa-instagram",
+                IsActive = true,
+                Order = currentOrder++
+            });
+        }
+
+        userPage.Links.AddRange(socialLinks);
+        return userPage;
+    }
+
+    private void UpdateUserPageFromModel(UserPage page, ManagePageViewModel model)
+    {
+        page.DisplayName = model.DisplayName;
+        page.Category = model.Category;
+        page.BusinessType = model.BusinessType;
+        page.Bio = model.Bio;
+        page.Slug = model.Slug;
+        page.UpdatedAt = DateTime.UtcNow;
+
+        // Update links
+        page.Links = new List<LinkItem>();
+        
+        // Add regular links
+        if (model.Links?.Any() == true)
+        {
+            page.Links.AddRange(model.Links.Where(l => !string.IsNullOrEmpty(l.Title) && !string.IsNullOrEmpty(l.Url))
+                .Select((l, index) => new LinkItem
+                {
+                    Title = l.Title,
+                    Url = l.Url,
+                    Description = l.Description,
+                    Icon = l.Icon,
+                    IsActive = l.IsActive,
+                    Order = index
+                }));
+        }
+
+        // Add social media links (same logic as create)
+        var socialLinks = new List<LinkItem>();
+        var currentOrder = page.Links.Count;
+
+        if (!string.IsNullOrEmpty(model.WhatsAppNumber))
+        {
+            socialLinks.Add(new LinkItem
+            {
+                Title = "WhatsApp",
+                Url = $"https://wa.me/{model.WhatsAppNumber.Replace("+", "").Replace(" ", "").Replace("-", "").Replace("(", "").Replace(")", "")}",
+                Icon = "fab fa-whatsapp",
+                IsActive = true,
+                Order = currentOrder++
+            });
+        }
+
+        if (!string.IsNullOrEmpty(model.FacebookUrl))
+        {
+            socialLinks.Add(new LinkItem
+            {
+                Title = "Facebook",
+                Url = model.FacebookUrl,
+                Icon = "fab fa-facebook",
+                IsActive = true,
+                Order = currentOrder++
+            });
+        }
+
+        if (!string.IsNullOrEmpty(model.TwitterUrl))
+        {
+            socialLinks.Add(new LinkItem
+            {
+                Title = "X / Twitter",
+                Url = model.TwitterUrl,
+                Icon = "fab fa-x-twitter",
+                IsActive = true,
+                Order = currentOrder++
+            });
+        }
+
+        if (!string.IsNullOrEmpty(model.InstagramUrl))
+        {
+            socialLinks.Add(new LinkItem
+            {
+                Title = "Instagram",
+                Url = model.InstagramUrl,
+                Icon = "fab fa-instagram",
+                IsActive = true,
+                Order = currentOrder++
+            });
+        }
+
+        page.Links.AddRange(socialLinks);
+    }
+}
\ No newline at end of file
diff --git a/src/BCards.Web/Controllers/AuthController.cs b/src/BCards.Web/Controllers/AuthController.cs
new file mode 100644
index 0000000..7c4a359
--- /dev/null
+++ b/src/BCards.Web/Controllers/AuthController.cs
@@ -0,0 +1,125 @@
+using BCards.Web.Services;
+using Microsoft.AspNetCore.Authentication;
+using Microsoft.AspNetCore.Authentication.Cookies;
+using Microsoft.AspNetCore.Authentication.Google;
+using Microsoft.AspNetCore.Authentication.MicrosoftAccount;
+using Microsoft.AspNetCore.Authorization;
+using Microsoft.AspNetCore.Mvc;
+using System.Security.Claims;
+
+namespace BCards.Web.Controllers;
+
+[Route("Auth")]
+public class AuthController : Controller
+{
+    private readonly IAuthService _authService;
+
+    public AuthController(IAuthService authService)
+    {
+        _authService = authService;
+    }
+
+    [HttpGet]
+    [Route("Login")]
+    public IActionResult Login(string? returnUrl = null)
+    {
+        ViewBag.ReturnUrl = returnUrl;
+        return View();
+    }
+
+    [HttpPost]
+    [Route("LoginWithGoogle")]
+    public IActionResult LoginWithGoogle(string? returnUrl = null)
+    {
+        var redirectUrl = Url.Action("GoogleCallback", "Auth", new { returnUrl });
+        var properties = new AuthenticationProperties { RedirectUri = redirectUrl };
+        return Challenge(properties, GoogleDefaults.AuthenticationScheme);
+    }
+
+    [HttpPost]
+    [Route("LoginWithMicrosoft")]
+    public IActionResult LoginWithMicrosoft(string? returnUrl = null)
+    {
+        var redirectUrl = Url.Action("MicrosoftCallback", "Auth", new { returnUrl });
+        var properties = new AuthenticationProperties { RedirectUri = redirectUrl };
+        return Challenge(properties, MicrosoftAccountDefaults.AuthenticationScheme);
+    }
+
+    [HttpGet]
+    [Route("GoogleCallback")]
+    public async Task<IActionResult> GoogleCallback(string? returnUrl = null)
+    {
+        var result = await HttpContext.AuthenticateAsync(GoogleDefaults.AuthenticationScheme);
+        if (!result.Succeeded)
+        {
+            TempData["Error"] = "Falha na autentica��o com Google";
+            return RedirectToAction("Login");
+        }
+
+        var user = await _authService.CreateOrUpdateUserFromClaimsAsync(result.Principal);
+
+        var claims = new[]
+        {
+            new Claim(ClaimTypes.NameIdentifier, user.Id),
+            new Claim(ClaimTypes.Name, user.Name),
+            new Claim(ClaimTypes.Email, user.Email),
+            new Claim("picture", user.ProfileImage ?? "")
+        };
+
+        var identity = new ClaimsIdentity(claims, CookieAuthenticationDefaults.AuthenticationScheme);
+        var principal = new ClaimsPrincipal(identity);
+
+        await HttpContext.SignInAsync(CookieAuthenticationDefaults.AuthenticationScheme, principal);
+
+        TempData["Success"] = $"Bem-vindo, {user.Name}!";
+        return RedirectToLocal(returnUrl);
+    }
+
+    [HttpGet]
+    [Route("MicrosoftCallback")]
+    public async Task<IActionResult> MicrosoftCallback(string? returnUrl = null)
+    {
+        var result = await HttpContext.AuthenticateAsync(MicrosoftAccountDefaults.AuthenticationScheme);
+        if (!result.Succeeded)
+        {
+            TempData["Error"] = "Falha na autentica��o com Microsoft";
+            return RedirectToAction("Login");
+        }
+
+        var user = await _authService.CreateOrUpdateUserFromClaimsAsync(result.Principal);
+
+        var claims = new[]
+        {
+            new Claim(ClaimTypes.NameIdentifier, user.Id),
+            new Claim(ClaimTypes.Name, user.Name),
+            new Claim(ClaimTypes.Email, user.Email),
+            new Claim("picture", user.ProfileImage ?? "")
+        };
+
+        var identity = new ClaimsIdentity(claims, CookieAuthenticationDefaults.AuthenticationScheme);
+        var principal = new ClaimsPrincipal(identity);
+
+        await HttpContext.SignInAsync(CookieAuthenticationDefaults.AuthenticationScheme, principal);
+
+        TempData["Success"] = $"Bem-vindo, {user.Name}!";
+        return RedirectToLocal(returnUrl);
+    }
+
+    [HttpGet]
+    [Route("Logout")]
+    [Authorize]
+    public async Task<IActionResult> Logout()
+    {
+        await HttpContext.SignOutAsync(CookieAuthenticationDefaults.AuthenticationScheme);
+        TempData["Success"] = "Logout realizado com sucesso";
+        return RedirectToAction("Index", "Home");
+    }
+
+    private IActionResult RedirectToLocal(string? returnUrl)
+    {
+        if (Url.IsLocalUrl(returnUrl))
+            return Redirect(returnUrl);
+
+        return RedirectToAction("Dashboard", "Admin");
+    }
+}
\ No newline at end of file
diff --git a/src/BCards.Web/Controllers/HomeController.cs b/src/BCards.Web/Controllers/HomeController.cs
new file mode 100644
index 0000000..55fd817
--- /dev/null
+++ b/src/BCards.Web/Controllers/HomeController.cs
@@ -0,0 +1,56 @@
+using BCards.Web.Services;
+using Microsoft.AspNetCore.Mvc;
+
+namespace BCards.Web.Controllers;
+
+public class HomeController : Controller
+{
+    private readonly ICategoryService _categoryService;
+    private readonly IUserPageService _userPageService;
+
+    public HomeController(ICategoryService categoryService, IUserPageService userPageService)
+    {
+        _categoryService = categoryService;
+        _userPageService = userPageService;
+    }
+
+    public async Task<IActionResult> Index()
+    {
+        ViewBag.Categories = await _categoryService.GetAllCategoriesAsync();
+        ViewBag.RecentPages = await _userPageService.GetRecentPagesAsync(6);
+        return View();
+    }
+
+    [Route("Privacy")]
+    public IActionResult Privacy()
+    {
+        return View();
+    }
+
+    [Route("Pricing")]
+    public IActionResult Pricing()
+    {
+        return View();
+    }
+
+    [Route("categoria/{categorySlug}")]
+    public async Task<IActionResult> Category(string categorySlug)
+    {
+        var category = await _categoryService.GetCategoryBySlugAsync(categorySlug);
+        if (category == null)
+            return NotFound();
+
+        var pages = await _userPageService.GetPagesByCategoryAsync(categorySlug, 20);
+        
+        ViewBag.Category = category;
+        ViewBag.Pages = pages;
+        
+        return View();
+    }
+
+    [ResponseCache(Duration = 0, Location = ResponseCacheLocation.None, NoStore = true)]
+    public IActionResult Error()
+    {
+        return View();
+    }
+}
\ No newline at end of file
diff --git a/src/BCards.Web/Controllers/PaymentController.cs b/src/BCards.Web/Controllers/PaymentController.cs
new file mode 100644
index 0000000..ee25573
--- /dev/null
+++ b/src/BCards.Web/Controllers/PaymentController.cs
@@ -0,0 +1,113 @@
+using BCards.Web.Services;
+using Microsoft.AspNetCore.Authorization;
+using Microsoft.AspNetCore.Mvc;
+
+namespace BCards.Web.Controllers;
+
+[Authorize]
+public class PaymentController : Controller
+{
+    private readonly IPaymentService _paymentService;
+    private readonly IAuthService _authService;
+
+    public PaymentController(IPaymentService paymentService, IAuthService authService)
+    {
+        _paymentService = paymentService;
+        _authService = authService;
+    }
+
+    public IActionResult Plans()
+    {
+        return View();
+    }
+
+    [HttpPost]
+    public async Task<IActionResult> CreateCheckoutSession(string planType)
+    {
+        var user = await _authService.GetCurrentUserAsync(User);
+        if (user == null)
+            return RedirectToAction("Login", "Auth");
+
+        var successUrl = Url.Action("Success", "Payment", null, Request.Scheme);
+        var cancelUrl = Url.Action("Cancel", "Payment", null, Request.Scheme);
+
+        try
+        {
+            var checkoutUrl = await _paymentService.CreateCheckoutSessionAsync(
+                user.Id,
+                planType,
+                successUrl!,
+                cancelUrl!);
+
+            return Redirect(checkoutUrl);
+        }
+        catch (Exception ex)
+        {
+            TempData["Error"] = $"Erro ao processar pagamento: {ex.Message}";
+            return RedirectToAction("Plans");
+        }
+    }
+
+    public IActionResult Success()
+    {
+        TempData["Success"] = "Assinatura ativada com sucesso! Agora você pode aproveitar todos os recursos do seu plano.";
+        return RedirectToAction("Dashboard", "Admin");
+    }
+
+    public IActionResult Cancel()
+    {
+        TempData["Info"] = "Pagamento cancelado. Você pode tentar novamente quando quiser.";
+        return RedirectToAction("Plans");
+    }
+
+    [HttpPost]
+    [Route("webhook/stripe")]
+    [AllowAnonymous]
+    public async Task<IActionResult> StripeWebhook()
+    {
+        var signature = Request.Headers["Stripe-Signature"].FirstOrDefault();
+        if (string.IsNullOrEmpty(signature))
+            return BadRequest();
+
+        string requestBody;
+        using (var reader = new StreamReader(Request.Body))
+        {
+            requestBody = await reader.ReadToEndAsync();
+        }
+
+        try
+        {
+            await _paymentService.HandleWebhookAsync(requestBody, signature);
+            return Ok();
+        }
+        catch (Exception ex)
+        {
+            return BadRequest($"Webhook error: {ex.Message}");
+        }
+    }
+
+    public async Task<IActionResult> ManageSubscription()
+    {
+        var user = await _authService.GetCurrentUserAsync(User);
+        if (user == null)
+            return RedirectToAction("Login", "Auth");
+
+        return View(user);
+    }
+
+    [HttpPost]
+    public async Task<IActionResult> CancelSubscription(string subscriptionId)
+    {
+        try
+        {
+            await _paymentService.CancelSubscriptionAsync(subscriptionId);
+            TempData["Success"] = "Sua assinatura será cancelada no final do período atual.";
+        }
+        catch (Exception ex)
+        {
+            TempData["Error"] = $"Erro ao cancelar assinatura: {ex.Message}";
+        }
+
+        return RedirectToAction("ManageSubscription");
+    }
+}
\ No newline at end of file
diff --git a/src/BCards.Web/Controllers/SitemapController.cs b/src/BCards.Web/Controllers/SitemapController.cs
new file mode 100644
index 0000000..400ef62
--- /dev/null
+++ b/src/BCards.Web/Controllers/SitemapController.cs
@@ -0,0 +1,86 @@
+using Microsoft.AspNetCore.Mvc;
+using System.Text;
+using System.Xml.Linq;
+using BCards.Web.Services;
+
+namespace BCards.Web.Controllers;
+
+public class SitemapController : Controller
+{
+    private readonly IUserPageService _userPageService;
+    private readonly ILogger<SitemapController> _logger;
+
+    public SitemapController(IUserPageService userPageService, ILogger<SitemapController> logger)
+    {
+        _userPageService = userPageService;
+        _logger = logger;
+    }
+
+    [Route("sitemap.xml")]
+    [ResponseCache(Duration = 86400)] // Cache for 24 hours
+    public async Task<IActionResult> Index()
+    {
+        try
+        {
+            var activePages = await _userPageService.GetActivePagesAsync();
+            
+            var sitemap = new XDocument(
+                new XDeclaration("1.0", "utf-8", "yes"),
+                new XElement("urlset",
+                    new XAttribute("xmlns", "http://www.sitemaps.org/schemas/sitemap/0.9"),
+                    
+                    // Add static pages
+                    new XElement("url",
+                        new XElement("loc", $"{Request.Scheme}://{Request.Host}/"),
+                        new XElement("lastmod", DateTime.UtcNow.ToString("yyyy-MM-dd")),
+                        new XElement("changefreq", "daily"),
+                        new XElement("priority", "1.0")
+                    ),
+                    new XElement("url",
+                        new XElement("loc", $"{Request.Scheme}://{Request.Host}/Home/Pricing"),
+                        new XElement("lastmod", DateTime.UtcNow.ToString("yyyy-MM-dd")),
+                        new XElement("changefreq", "weekly"),
+                        new XElement("priority", "0.9")
+                    ),
+                    
+                    // Add user pages (only active ones)
+                    activePages.Select(page => 
+                        new XElement("url",
+                            new XElement("loc", $"{Request.Scheme}://{Request.Host}/page/{page.Category}/{page.Slug}"),
+                            new XElement("lastmod", page.UpdatedAt.ToString("yyyy-MM-dd")),
+                            new XElement("changefreq", "weekly"),
+                            new XElement("priority", "0.8")
+                        )
+                    )
+                )
+            );
+            
+            _logger.LogInformation($"Generated sitemap with {activePages.Count} user pages");
+            
+            return Content(sitemap.ToString(), "application/xml", Encoding.UTF8);
+        }
+        catch (Exception ex)
+        {
+            _logger.LogError(ex, "Error generating sitemap");
+            return StatusCode(500, "Error generating sitemap");
+        }
+    }
+
+    [Route("robots.txt")]
+    [ResponseCache(Duration = 86400)] // Cache for 24 hours
+    public IActionResult RobotsTxt()
+    {
+        var robotsTxt = $@"User-agent: *
+Allow: /
+Allow: /page/
+
+Disallow: /Admin/
+Disallow: /Auth/
+Disallow: /Payment/
+Disallow: /api/
+
+Sitemap: {Request.Scheme}://{Request.Host}/sitemap.xml";
+
+        return Content(robotsTxt, "text/plain", Encoding.UTF8);
+    }
+}
\ No newline at end of file
diff --git a/src/BCards.Web/Controllers/StripeWebhookController.cs b/src/BCards.Web/Controllers/StripeWebhookController.cs
new file mode 100644
index 0000000..d165c7e
--- /dev/null
+++ b/src/BCards.Web/Controllers/StripeWebhookController.cs
@@ -0,0 +1,219 @@
+using Microsoft.AspNetCore.Mvc;
+using Stripe;
+using BCards.Web.Services;
+using BCards.Web.Repositories;
+using BCards.Web.Configuration;
+using Microsoft.Extensions.Options;
+
+namespace BCards.Web.Controllers;
+
+[ApiController]
+[Route("api/stripe")]
+public class StripeWebhookController : ControllerBase
+{
+    private readonly ILogger<StripeWebhookController> _logger;
+    private readonly ISubscriptionRepository _subscriptionRepository;
+    private readonly IUserPageService _userPageService;
+    private readonly string _webhookSecret;
+
+    public StripeWebhookController(
+        ILogger<StripeWebhookController> logger,
+        ISubscriptionRepository subscriptionRepository,
+        IUserPageService userPageService,
+        IOptions<StripeSettings> stripeSettings)
+    {
+        _logger = logger;
+        _subscriptionRepository = subscriptionRepository;
+        _userPageService = userPageService;
+        _webhookSecret = stripeSettings.Value.WebhookSecret ?? "";
+    }
+
+    [HttpPost("webhook")]
+    public async Task<IActionResult> HandleWebhook()
+    {
+        try
+        {
+            var json = await new StreamReader(HttpContext.Request.Body).ReadToEndAsync();
+            
+            if (string.IsNullOrEmpty(_webhookSecret))
+            {
+                _logger.LogWarning("Webhook secret not configured");
+                return BadRequest("Webhook secret not configured");
+            }
+
+            var stripeSignature = Request.Headers["Stripe-Signature"].FirstOrDefault();
+            if (string.IsNullOrEmpty(stripeSignature))
+            {
+                _logger.LogWarning("Missing Stripe signature");
+                return BadRequest("Missing Stripe signature");
+            }
+
+            var stripeEvent = EventUtility.ConstructEvent(
+                json, 
+                stripeSignature, 
+                _webhookSecret,
+                throwOnApiVersionMismatch: false
+            );
+
+            _logger.LogInformation($"Processing Stripe webhook: {stripeEvent.Type}");
+
+            switch (stripeEvent.Type)
+            {
+                case Events.InvoicePaymentSucceeded:
+                    await HandlePaymentSucceeded(stripeEvent);
+                    break;
+                    
+                case Events.InvoicePaymentFailed:
+                    await HandlePaymentFailed(stripeEvent);
+                    break;
+                    
+                case Events.CustomerSubscriptionDeleted:
+                    await HandleSubscriptionDeleted(stripeEvent);
+                    break;
+                    
+                case Events.CustomerSubscriptionUpdated:
+                    await HandleSubscriptionUpdated(stripeEvent);
+                    break;
+                    
+                default:
+                    _logger.LogInformation($"Unhandled webhook event type: {stripeEvent.Type}");
+                    break;
+            }
+
+            return Ok();
+        }
+        catch (StripeException ex)
+        {
+            _logger.LogError(ex, "Stripe webhook error");
+            return BadRequest($"Stripe error: {ex.Message}");
+        }
+        catch (Exception ex)
+        {
+            _logger.LogError(ex, "Webhook processing error");
+            return StatusCode(500, "Internal server error");
+        }
+    }
+
+    private async Task HandlePaymentSucceeded(Event stripeEvent)
+    {
+        if (stripeEvent.Data.Object is Invoice invoice)
+        {
+            _logger.LogInformation($"Payment succeeded for customer: {invoice.CustomerId}");
+            
+            var subscription = await _subscriptionRepository.GetByStripeSubscriptionIdAsync(invoice.SubscriptionId);
+            if (subscription != null)
+            {
+                subscription.Status = "active";
+                subscription.UpdatedAt = DateTime.UtcNow;
+                await _subscriptionRepository.UpdateAsync(subscription);
+
+                // Reactivate user pages
+                var userPages = await _userPageService.GetUserPagesAsync(subscription.UserId);
+                foreach (var page in userPages.Where(p => p.Status == ViewModels.PageStatus.PendingPayment))
+                {
+                    page.Status = ViewModels.PageStatus.Active;
+                    page.UpdatedAt = DateTime.UtcNow;
+                    await _userPageService.UpdatePageAsync(page);
+                }
+
+                _logger.LogInformation($"Reactivated {userPages.Count} pages for user {subscription.UserId}");
+            }
+        }
+    }
+
+    private async Task HandlePaymentFailed(Event stripeEvent)
+    {
+        if (stripeEvent.Data.Object is Invoice invoice)
+        {
+            _logger.LogInformation($"Payment failed for customer: {invoice.CustomerId}");
+            
+            var subscription = await _subscriptionRepository.GetByStripeSubscriptionIdAsync(invoice.SubscriptionId);
+            if (subscription != null)
+            {
+                subscription.Status = "past_due";
+                subscription.UpdatedAt = DateTime.UtcNow;
+                await _subscriptionRepository.UpdateAsync(subscription);
+
+                // Set pages to pending payment
+                var userPages = await _userPageService.GetUserPagesAsync(subscription.UserId);
+                foreach (var page in userPages.Where(p => p.Status == ViewModels.PageStatus.Active))
+                {
+                    page.Status = ViewModels.PageStatus.PendingPayment;
+                    page.UpdatedAt = DateTime.UtcNow;
+                    await _userPageService.UpdatePageAsync(page);
+                }
+
+                _logger.LogInformation($"Set {userPages.Count} pages to pending payment for user {subscription.UserId}");
+            }
+        }
+    }
+
+    private async Task HandleSubscriptionDeleted(Event stripeEvent)
+    {
+        if (stripeEvent.Data.Object is Subscription stripeSubscription)
+        {
+            _logger.LogInformation($"Subscription cancelled: {stripeSubscription.Id}");
+            
+            var subscription = await _subscriptionRepository.GetByStripeSubscriptionIdAsync(stripeSubscription.Id);
+            if (subscription != null)
+            {
+                subscription.Status = "cancelled";
+                subscription.UpdatedAt = DateTime.UtcNow;
+                await _subscriptionRepository.UpdateAsync(subscription);
+
+                // Downgrade to trial or deactivate pages
+                var userPages = await _userPageService.GetUserPagesAsync(subscription.UserId);
+                foreach (var page in userPages.Where(p => p.Status == ViewModels.PageStatus.Active))
+                {
+                    page.Status = ViewModels.PageStatus.Expired;
+                    page.UpdatedAt = DateTime.UtcNow;
+                    await _userPageService.UpdatePageAsync(page);
+                }
+
+                _logger.LogInformation($"Deactivated {userPages.Count} pages for cancelled subscription {subscription.UserId}");
+            }
+        }
+    }
+
+    private async Task HandleSubscriptionUpdated(Event stripeEvent)
+    {
+        if (stripeEvent.Data.Object is Subscription stripeSubscription)
+        {
+            _logger.LogInformation($"Subscription updated: {stripeSubscription.Id}");
+            
+            var subscription = await _subscriptionRepository.GetByStripeSubscriptionIdAsync(stripeSubscription.Id);
+            if (subscription != null)
+            {
+                subscription.Status = stripeSubscription.Status;
+                subscription.CurrentPeriodStart = stripeSubscription.CurrentPeriodStart;
+                subscription.CurrentPeriodEnd = stripeSubscription.CurrentPeriodEnd;
+                subscription.CancelAtPeriodEnd = stripeSubscription.CancelAtPeriodEnd;
+                subscription.UpdatedAt = DateTime.UtcNow;
+                
+                // Update plan type based on Stripe price ID
+                var priceId = stripeSubscription.Items.Data.FirstOrDefault()?.Price.Id;
+                if (!string.IsNullOrEmpty(priceId))
+                {
+                    subscription.PlanType = MapPriceIdToPlanType(priceId);
+                }
+                
+                await _subscriptionRepository.UpdateAsync(subscription);
+                
+                _logger.LogInformation($"Updated subscription for user {subscription.UserId}");
+            }
+        }
+    }
+
+    private string MapPriceIdToPlanType(string priceId)
+    {
+        // Map Stripe price IDs to plan types
+        // This would be configured based on your actual Stripe price IDs
+        return priceId switch
+        {
+            var id when id.Contains("basic") => "basic",
+            var id when id.Contains("professional") => "professional", 
+            var id when id.Contains("premium") => "premium",
+            _ => "trial"
+        };
+    }
+}
\ No newline at end of file
diff --git a/src/BCards.Web/Controllers/UserPageController.cs b/src/BCards.Web/Controllers/UserPageController.cs
new file mode 100644
index 0000000..81cb418
--- /dev/null
+++ b/src/BCards.Web/Controllers/UserPageController.cs
@@ -0,0 +1,73 @@
+using BCards.Web.Services;
+using Microsoft.AspNetCore.Mvc;
+
+namespace BCards.Web.Controllers;
+
+//[Route("[controller]")]
+public class UserPageController : Controller
+{
+    private readonly IUserPageService _userPageService;
+    private readonly ICategoryService _categoryService;
+    private readonly ISeoService _seoService;
+
+    public UserPageController(
+        IUserPageService userPageService,
+        ICategoryService categoryService,
+        ISeoService seoService)
+    {
+        _userPageService = userPageService;
+        _categoryService = categoryService;
+        _seoService = seoService;
+    }
+
+    //[Route("{category}/{slug}")]
+    [ResponseCache(Duration = 300, VaryByQueryKeys = new[] { "category", "slug" })]
+    public async Task<IActionResult> Display(string category, string slug)
+    {
+        var userPage = await _userPageService.GetPageAsync(category, slug);
+        if (userPage == null || !userPage.IsActive)
+            return NotFound();
+
+        var categoryObj = await _categoryService.GetCategoryBySlugAsync(category);
+        if (categoryObj == null)
+            return NotFound();
+
+        // Generate SEO settings
+        var seoSettings = _seoService.GenerateSeoSettings(userPage, categoryObj);
+        
+        // Record page view (async, don't wait)
+        var referrer = Request.Headers["Referer"].FirstOrDefault();
+        var userAgent = Request.Headers["User-Agent"].FirstOrDefault();
+        _ = Task.Run(() => _userPageService.RecordPageViewAsync(userPage.Id, referrer, userAgent));
+
+        ViewBag.SeoSettings = seoSettings;
+        ViewBag.Category = categoryObj;
+        
+        return View(userPage);
+    }
+
+    [HttpPost]
+    [Route("click/{pageId}")]
+    public async Task<IActionResult> RecordClick(string pageId, int linkIndex)
+    {
+        await _userPageService.RecordLinkClickAsync(pageId, linkIndex);
+        return Ok();
+    }
+
+    [Route("preview/{category}/{slug}")]
+    public async Task<IActionResult> Preview(string category, string slug)
+    {
+        var userPage = await _userPageService.GetPageAsync(category, slug);
+        if (userPage == null)
+            return NotFound();
+
+        var categoryObj = await _categoryService.GetCategoryBySlugAsync(category);
+        if (categoryObj == null)
+            return NotFound();
+
+        ViewBag.Category = categoryObj;
+        ViewBag.IsPreview = true;
+        
+        return View("Display", userPage);
+    }
+}
\ No newline at end of file
diff --git a/src/BCards.Web/Dockerfile b/src/BCards.Web/Dockerfile
new file mode 100644
index 0000000..d7dc062
--- /dev/null
+++ b/src/BCards.Web/Dockerfile
@@ -0,0 +1,29 @@
+FROM mcr.microsoft.com/dotnet/aspnet:8.0 AS base
+WORKDIR /app
+EXPOSE 80
+EXPOSE 443
+
+FROM mcr.microsoft.com/dotnet/sdk:8.0 AS build
+WORKDIR /src
+COPY ["src/BCards.Web/BCards.Web.csproj", "src/BCards.Web/"]
+RUN dotnet restore "src/BCards.Web/BCards.Web.csproj"
+COPY . .
+WORKDIR "/src/src/BCards.Web"
+RUN dotnet build "BCards.Web.csproj" -c Release -o /app/build
+
+FROM build AS publish
+RUN dotnet publish "BCards.Web.csproj" -c Release -o /app/publish /p:UseAppHost=false
+
+FROM base AS final
+WORKDIR /app
+COPY --from=publish /app/publish .
+
+# Create uploads directory
+RUN mkdir -p /app/uploads && chmod 755 /app/uploads
+
+# Install dependencies for image processing
+RUN apt-get update && apt-get install -y \
+    libgdiplus \
+    && rm -rf /var/lib/apt/lists/*
+
+ENTRYPOINT ["dotnet", "BCards.Web.dll"]
\ No newline at end of file
diff --git a/src/BCards.Web/Middleware/PageStatusMiddleware.cs b/src/BCards.Web/Middleware/PageStatusMiddleware.cs
new file mode 100644
index 0000000..6d6ca76
--- /dev/null
+++ b/src/BCards.Web/Middleware/PageStatusMiddleware.cs
@@ -0,0 +1,128 @@
+using BCards.Web.Services;
+using BCards.Web.ViewModels;
+using System.Text.RegularExpressions;
+
+namespace BCards.Web.Middleware;
+
+public class PageStatusMiddleware
+{
+    private readonly RequestDelegate _next;
+    private readonly ILogger<PageStatusMiddleware> _logger;
+
+    public PageStatusMiddleware(RequestDelegate next, ILogger<PageStatusMiddleware> logger)
+    {
+        _next = next;
+        _logger = logger;
+    }
+
+    public async Task InvokeAsync(HttpContext context, IUserPageService userPageService)
+    {
+        // Check if this is a user page route (page/{category}/{slug})
+        if (IsUserPageRoute(context.Request.Path))
+        {
+            try
+            {
+                var (category, slug) = ExtractRouteParameters(context.Request.Path);
+                
+                if (!string.IsNullOrEmpty(category) && !string.IsNullOrEmpty(slug))
+                {
+                    var page = await userPageService.GetPageAsync(category, slug);
+                    
+                    if (page != null)
+                    {
+                        switch (page.Status)
+                        {
+                            case PageStatus.Expired:
+                                // 301 Redirect para não prejudicar SEO
+                                _logger.LogInformation($"Redirecting expired page {category}/{slug} to upgrade page");
+                                context.Response.Redirect($"/Home/Pricing?expired={slug}&category={category}", permanent: true);
+                                return;
+                                
+                            case PageStatus.PendingPayment:
+                                // Mostrar página com aviso de pagamento
+                                _logger.LogInformation($"Showing payment warning for page {category}/{slug}");
+                                await ShowPaymentWarning(context, page);
+                                return;
+                                
+                            case PageStatus.Inactive:
+                                // 404 temporário
+                                _logger.LogInformation($"Page {category}/{slug} is inactive, returning 404");
+                                context.Response.StatusCode = 404;
+                                await context.Response.WriteAsync("Página temporariamente indisponível.");
+                                return;
+                                
+                            case PageStatus.Active:
+                                // Continuar processamento normal
+                                break;
+                        }
+                    }
+                }
+            }
+            catch (Exception ex)
+            {
+                _logger.LogError(ex, "Error in PageStatusMiddleware");
+            }
+        }
+        
+        await _next(context);
+    }
+
+    private static bool IsUserPageRoute(PathString path)
+    {
+        // Check if path matches pattern: /page/{category}/{slug}
+        return Regex.IsMatch(path.Value ?? "", @"^/page/[a-z-]+/[a-z0-9-]+/?$", RegexOptions.IgnoreCase);
+    }
+
+    private static (string category, string slug) ExtractRouteParameters(PathString path)
+    {
+        var match = Regex.Match(path.Value ?? "", @"^/page/([a-z-]+)/([a-z0-9-]+)/?$", RegexOptions.IgnoreCase);
+        
+        if (match.Success)
+        {
+            return (match.Groups[1].Value, match.Groups[2].Value);
+        }
+        
+        return (string.Empty, string.Empty);
+    }
+
+    private async Task ShowPaymentWarning(HttpContext context, BCards.Web.Models.UserPage page)
+    {
+        // Generate a simple HTML page with payment warning
+        var html = $@"
+<!DOCTYPE html>
+<html>
+<head>
+    <title>{page.DisplayName} - Pagamento Pendente</title>
+    <meta charset='utf-8'>
+    <meta name='viewport' content='width=device-width, initial-scale=1'>
+    <link href='https://cdn.jsdelivr.net/npm/bootstrap@5.1.3/dist/css/bootstrap.min.css' rel='stylesheet'>
+</head>
+<body class='bg-light'>
+    <div class='container mt-5'>
+        <div class='row justify-content-center'>
+            <div class='col-md-6'>
+                <div class='card border-warning'>
+                    <div class='card-header bg-warning text-dark'>
+                        <h5 class='mb-0'>
+                            <i class='fas fa-exclamation-triangle me-2'></i>
+                            Pagamento Pendente
+                        </h5>
+                    </div>
+                    <div class='card-body text-center'>
+                        <h4>{page.DisplayName}</h4>
+                        <p class='text-muted mb-4'>Esta página está temporariamente indisponível devido a um pagamento pendente.</p>
+                        <p class='mb-4'>Para reativar esta página, o proprietário deve regularizar o pagamento.</p>
+                        <a href='/Home/Pricing' class='btn btn-primary'>Ver Planos</a>
+                    </div>
+                </div>
+            </div>
+        </div>
+    </div>
+</body>
+</html>";
+
+        context.Response.ContentType = "text/html";
+        context.Response.StatusCode = 200; // Keep as 200 for SEO, but show warning
+        await context.Response.WriteAsync(html);
+    }
+}
\ No newline at end of file
diff --git a/src/BCards.Web/Middleware/PlanLimitationMiddleware.cs b/src/BCards.Web/Middleware/PlanLimitationMiddleware.cs
new file mode 100644
index 0000000..4bad512
--- /dev/null
+++ b/src/BCards.Web/Middleware/PlanLimitationMiddleware.cs
@@ -0,0 +1,127 @@
+using BCards.Web.Services;
+using BCards.Web.Repositories;
+using System.Security.Claims;
+
+namespace BCards.Web.Middleware;
+
+public class PlanLimitationMiddleware
+{
+    private readonly RequestDelegate _next;
+    private readonly ILogger<PlanLimitationMiddleware> _logger;
+
+    public PlanLimitationMiddleware(RequestDelegate next, ILogger<PlanLimitationMiddleware> logger)
+    {
+        _next = next;
+        _logger = logger;
+    }
+
+    public async Task InvokeAsync(HttpContext context, IServiceProvider serviceProvider)
+    {
+        // Only check for authenticated users on specific endpoints
+        if (context.User.Identity?.IsAuthenticated == true && ShouldCheckLimitations(context))
+        {
+            using var scope = serviceProvider.CreateScope();
+            var authService = scope.ServiceProvider.GetRequiredService<IAuthService>();
+            var subscriptionRepository = scope.ServiceProvider.GetRequiredService<ISubscriptionRepository>();
+            var userPageRepository = scope.ServiceProvider.GetRequiredService<IUserPageRepository>();
+
+            try
+            {
+                var user = await authService.GetCurrentUserAsync(context.User);
+                if (user != null)
+                {
+                    var subscription = await subscriptionRepository.GetByUserIdAsync(user.Id);
+                    var limitations = GetPlanLimitations(subscription?.PlanType ?? "free");
+
+                    // Check specific limitations based on the request
+                    if (IsLinkCreationRequest(context))
+                    {
+                        var userPage = await userPageRepository.GetByUserIdAsync(user.Id);
+                        var currentLinksCount = userPage?.Links?.Count(l => l.IsActive) ?? 0;
+                        
+                        if (limitations.MaxLinks != -1 && currentLinksCount >= limitations.MaxLinks)
+                        {
+                            context.Response.StatusCode = 403;
+                            await context.Response.WriteAsync("Limite de links atingido. Faça upgrade do seu plano.");
+                            return;
+                        }
+                    }
+
+                    // Add limitations to context for use in controllers
+                    context.Items["PlanLimitations"] = limitations;
+                    context.Items["CurrentSubscription"] = subscription;
+                }
+            }
+            catch (Exception ex)
+            {
+                _logger.LogError(ex, "Error checking plan limitations for user");
+                // Continue without blocking the request
+            }
+        }
+
+        await _next(context);
+    }
+
+    private static bool ShouldCheckLimitations(HttpContext context)
+    {
+        var path = context.Request.Path.Value?.ToLowerInvariant() ?? "";
+        
+        return path.StartsWith("/admin/") || 
+               path.StartsWith("/api/") ||
+               (context.Request.Method == "POST" && path.Contains("/editpage"));
+    }
+
+    private static bool IsLinkCreationRequest(HttpContext context)
+    {
+        var path = context.Request.Path.Value?.ToLowerInvariant() ?? "";
+        return context.Request.Method == "POST" && 
+               (path.Contains("/editpage") || path.Contains("/addlink"));
+    }
+
+    private static Models.PlanLimitations GetPlanLimitations(string planType)
+    {
+        return planType.ToLower() switch
+        {
+            "basic" => new Models.PlanLimitations
+            {
+                MaxLinks = 5,
+                AllowCustomThemes = false,
+                AllowAnalytics = true,
+                AllowCustomDomain = false,
+                AllowMultipleDomains = false,
+                PrioritySupport = false,
+                PlanType = "basic"
+            },
+            "professional" => new Models.PlanLimitations
+            {
+                MaxLinks = 15,
+                AllowCustomThemes = false,
+                AllowAnalytics = true,
+                AllowCustomDomain = true,
+                AllowMultipleDomains = false,
+                PrioritySupport = false,
+                PlanType = "professional"
+            },
+            "premium" => new Models.PlanLimitations
+            {
+                MaxLinks = -1, // Unlimited
+                AllowCustomThemes = true,
+                AllowAnalytics = true,
+                AllowCustomDomain = true,
+                AllowMultipleDomains = true,
+                PrioritySupport = true,
+                PlanType = "premium"
+            },
+            _ => new Models.PlanLimitations
+            {
+                MaxLinks = 5,
+                AllowCustomThemes = false,
+                AllowAnalytics = false,
+                AllowCustomDomain = false,
+                AllowMultipleDomains = false,
+                PrioritySupport = false,
+                PlanType = "free"
+            }
+        };
+    }
+}
\ No newline at end of file
diff --git a/src/BCards.Web/Models/Category.cs b/src/BCards.Web/Models/Category.cs
new file mode 100644
index 0000000..2365d44
--- /dev/null
+++ b/src/BCards.Web/Models/Category.cs
@@ -0,0 +1,32 @@
+using MongoDB.Bson;
+using MongoDB.Bson.Serialization.Attributes;
+
+namespace BCards.Web.Models;
+
+public class Category
+{
+    [BsonId]
+    [BsonRepresentation(BsonType.ObjectId)]
+    public string Id { get; set; } = string.Empty;
+
+    [BsonElement("name")]
+    public string Name { get; set; } = string.Empty;
+
+    [BsonElement("slug")]
+    public string Slug { get; set; } = string.Empty;
+
+    [BsonElement("icon")]
+    public string Icon { get; set; } = string.Empty;
+
+    [BsonElement("seoKeywords")]
+    public List<string> SeoKeywords { get; set; } = new();
+
+    [BsonElement("description")]
+    public string Description { get; set; } = string.Empty;
+
+    [BsonElement("isActive")]
+    public bool IsActive { get; set; } = true;
+
+    [BsonElement("createdAt")]
+    public DateTime CreatedAt { get; set; } = DateTime.UtcNow;
+}
\ No newline at end of file
diff --git a/src/BCards.Web/Models/LinkItem.cs b/src/BCards.Web/Models/LinkItem.cs
new file mode 100644
index 0000000..5dd05ce
--- /dev/null
+++ b/src/BCards.Web/Models/LinkItem.cs
@@ -0,0 +1,30 @@
+using MongoDB.Bson.Serialization.Attributes;
+
+namespace BCards.Web.Models;
+
+public class LinkItem
+{
+    [BsonElement("title")]
+    public string Title { get; set; } = string.Empty;
+
+    [BsonElement("url")]
+    public string Url { get; set; } = string.Empty;
+
+    [BsonElement("description")]
+    public string Description { get; set; } = string.Empty;
+
+    [BsonElement("icon")]
+    public string Icon { get; set; } = string.Empty;
+
+    [BsonElement("isActive")]
+    public bool IsActive { get; set; } = true;
+
+    [BsonElement("order")]
+    public int Order { get; set; }
+
+    [BsonElement("clicks")]
+    public int Clicks { get; set; } = 0;
+
+    [BsonElement("createdAt")]
+    public DateTime CreatedAt { get; set; } = DateTime.UtcNow;
+}
\ No newline at end of file
diff --git a/src/BCards.Web/Models/PageAnalytics.cs b/src/BCards.Web/Models/PageAnalytics.cs
new file mode 100644
index 0000000..8fa77b1
--- /dev/null
+++ b/src/BCards.Web/Models/PageAnalytics.cs
@@ -0,0 +1,30 @@
+using MongoDB.Bson.Serialization.Attributes;
+
+namespace BCards.Web.Models;
+
+public class PageAnalytics
+{
+    [BsonElement("totalViews")]
+    public int TotalViews { get; set; } = 0;
+
+    [BsonElement("totalClicks")]
+    public int TotalClicks { get; set; } = 0;
+
+    [BsonElement("lastViewedAt")]
+    public DateTime? LastViewedAt { get; set; }
+
+    [BsonElement("monthlyViews")]
+    public Dictionary<string, int> MonthlyViews { get; set; } = new(); // "2024-01" -> count
+
+    [BsonElement("monthlyClicks")]
+    public Dictionary<string, int> MonthlyClicks { get; set; } = new();
+
+    [BsonElement("topReferrers")]
+    public Dictionary<string, int> TopReferrers { get; set; } = new();
+
+    [BsonElement("deviceStats")]
+    public Dictionary<string, int> DeviceStats { get; set; } = new(); // mobile, desktop, tablet
+
+    [BsonElement("countryStats")]
+    public Dictionary<string, int> CountryStats { get; set; } = new();
+}
\ No newline at end of file
diff --git a/src/BCards.Web/Models/PageTheme.cs b/src/BCards.Web/Models/PageTheme.cs
new file mode 100644
index 0000000..78d036b
--- /dev/null
+++ b/src/BCards.Web/Models/PageTheme.cs
@@ -0,0 +1,41 @@
+using MongoDB.Bson;
+using MongoDB.Bson.Serialization.Attributes;
+
+namespace BCards.Web.Models;
+
+public class PageTheme
+{
+    [BsonId]
+    [BsonRepresentation(BsonType.ObjectId)]
+    public string Id { get; set; } = string.Empty;
+
+    [BsonElement("name")]
+    public string Name { get; set; } = string.Empty;
+
+    [BsonElement("primaryColor")]
+    public string PrimaryColor { get; set; } = "#007bff";
+
+    [BsonElement("secondaryColor")]
+    public string SecondaryColor { get; set; } = "#6c757d";
+
+    [BsonElement("backgroundColor")]
+    public string BackgroundColor { get; set; } = "#ffffff";
+
+    [BsonElement("textColor")]
+    public string TextColor { get; set; } = "#212529";
+
+    [BsonElement("backgroundImage")]
+    public string BackgroundImage { get; set; } = string.Empty;
+
+    [BsonElement("isPremium")]
+    public bool IsPremium { get; set; } = false;
+
+    [BsonElement("cssTemplate")]
+    public string CssTemplate { get; set; } = string.Empty;
+
+    [BsonElement("isActive")]
+    public bool IsActive { get; set; } = true;
+
+    [BsonElement("createdAt")]
+    public DateTime CreatedAt { get; set; } = DateTime.UtcNow;
+}
\ No newline at end of file
diff --git a/src/BCards.Web/Models/PlanLimitations.cs b/src/BCards.Web/Models/PlanLimitations.cs
new file mode 100644
index 0000000..f2d0585
--- /dev/null
+++ b/src/BCards.Web/Models/PlanLimitations.cs
@@ -0,0 +1,27 @@
+using MongoDB.Bson.Serialization.Attributes;
+
+namespace BCards.Web.Models;
+
+public class PlanLimitations
+{
+    [BsonElement("maxLinks")]
+    public int MaxLinks { get; set; } = 5;
+
+    [BsonElement("allowCustomThemes")]
+    public bool AllowCustomThemes { get; set; } = false;
+
+    [BsonElement("allowAnalytics")]
+    public bool AllowAnalytics { get; set; } = false;
+
+    [BsonElement("allowCustomDomain")]
+    public bool AllowCustomDomain { get; set; } = false;
+
+    [BsonElement("allowMultipleDomains")]
+    public bool AllowMultipleDomains { get; set; } = false;
+
+    [BsonElement("prioritySupport")]
+    public bool PrioritySupport { get; set; } = false;
+
+    [BsonElement("planType")]
+    public string PlanType { get; set; } = "free";
+}
\ No newline at end of file
diff --git a/src/BCards.Web/Models/PlanType.cs b/src/BCards.Web/Models/PlanType.cs
new file mode 100644
index 0000000..e6db8e9
--- /dev/null
+++ b/src/BCards.Web/Models/PlanType.cs
@@ -0,0 +1,94 @@
+namespace BCards.Web.Models;
+
+public enum PlanType
+{
+    Trial = 0,       // Gratuito por 7 dias
+    Basic = 1,       // R$ 9,90
+    Professional = 2, // R$ 24,90 (Decoy)
+    Premium = 3      // R$ 29,90
+}
+
+public static class PlanTypeExtensions
+{
+    public static string GetDisplayName(this PlanType planType)
+    {
+        return planType switch
+        {
+            PlanType.Trial => "Trial Gratuito",
+            PlanType.Basic => "Básico",
+            PlanType.Professional => "Profissional",
+            PlanType.Premium => "Premium",
+            _ => "Desconhecido"
+        };
+    }
+
+    public static decimal GetPrice(this PlanType planType)
+    {
+        return planType switch
+        {
+            PlanType.Trial => 0.00m,
+            PlanType.Basic => 9.90m,
+            PlanType.Professional => 24.90m,
+            PlanType.Premium => 29.90m,
+            _ => 0.00m
+        };
+    }
+
+    public static int GetMaxPages(this PlanType planType)
+    {
+        return planType switch
+        {
+            PlanType.Trial => 1,
+            PlanType.Basic => 3,
+            PlanType.Professional => 5, // DECOY - not attractive
+            PlanType.Premium => 15,
+            _ => 1
+        };
+    }
+
+    public static int GetMaxLinksPerPage(this PlanType planType)
+    {
+        return planType switch
+        {
+            PlanType.Trial => 3,
+            PlanType.Basic => 8,
+            PlanType.Professional => 20, // DECOY - too expensive for the benefit
+            PlanType.Premium => int.MaxValue, // Unlimited
+            _ => 3
+        };
+    }
+
+    public static int GetMaxLinks(this PlanType planType)
+    {
+        return GetMaxLinksPerPage(planType);
+    }
+
+    public static bool AllowsAnalytics(this PlanType planType)
+    {
+        return planType switch
+        {
+            PlanType.Trial => false,
+            PlanType.Basic => true,
+            PlanType.Professional => true,
+            PlanType.Premium => true,
+            _ => false
+        };
+    }
+
+    public static bool AllowsCustomThemes(this PlanType planType)
+    {
+        return planType switch
+        {
+            PlanType.Trial => false,
+            PlanType.Basic => false,
+            PlanType.Professional => true,
+            PlanType.Premium => true,
+            _ => false
+        };
+    }
+
+    public static int GetTrialDays(this PlanType planType)
+    {
+        return planType == PlanType.Trial ? 7 : 0;
+    }
+}
\ No newline at end of file
diff --git a/src/BCards.Web/Models/SeoSettings.cs b/src/BCards.Web/Models/SeoSettings.cs
new file mode 100644
index 0000000..fc137a3
--- /dev/null
+++ b/src/BCards.Web/Models/SeoSettings.cs
@@ -0,0 +1,30 @@
+using MongoDB.Bson.Serialization.Attributes;
+
+namespace BCards.Web.Models;
+
+public class SeoSettings
+{
+    [BsonElement("title")]
+    public string Title { get; set; } = string.Empty;
+
+    [BsonElement("description")]
+    public string Description { get; set; } = string.Empty;
+
+    [BsonElement("keywords")]
+    public List<string> Keywords { get; set; } = new();
+
+    [BsonElement("ogImage")]
+    public string OgImage { get; set; } = string.Empty;
+
+    [BsonElement("ogTitle")]
+    public string OgTitle { get; set; } = string.Empty;
+
+    [BsonElement("ogDescription")]
+    public string OgDescription { get; set; } = string.Empty;
+
+    [BsonElement("twitterCard")]
+    public string TwitterCard { get; set; } = "summary_large_image";
+
+    [BsonElement("canonicalUrl")]
+    public string CanonicalUrl { get; set; } = string.Empty;
+}
\ No newline at end of file
diff --git a/src/BCards.Web/Models/Subscription.cs b/src/BCards.Web/Models/Subscription.cs
new file mode 100644
index 0000000..733b5f2
--- /dev/null
+++ b/src/BCards.Web/Models/Subscription.cs
@@ -0,0 +1,57 @@
+using MongoDB.Bson;
+using MongoDB.Bson.Serialization.Attributes;
+
+namespace BCards.Web.Models;
+
+public class Subscription
+{
+    [BsonId]
+    [BsonRepresentation(BsonType.ObjectId)]
+    public string Id { get; set; } = string.Empty;
+
+    [BsonElement("userId")]
+    [BsonRepresentation(BsonType.ObjectId)]
+    public string UserId { get; set; } = string.Empty;
+
+    [BsonElement("stripeSubscriptionId")]
+    public string StripeSubscriptionId { get; set; } = string.Empty;
+
+    [BsonElement("planType")]
+    public string PlanType { get; set; } = "free";
+
+    [BsonElement("status")]
+    public string Status { get; set; } = "active";
+
+    [BsonElement("currentPeriodStart")]
+    public DateTime CurrentPeriodStart { get; set; }
+
+    [BsonElement("currentPeriodEnd")]
+    public DateTime CurrentPeriodEnd { get; set; }
+
+    [BsonElement("cancelAtPeriodEnd")]
+    public bool CancelAtPeriodEnd { get; set; } = false;
+
+    [BsonElement("maxLinks")]
+    public int MaxLinks { get; set; } = 5;
+
+    [BsonElement("allowCustomThemes")]
+    public bool AllowCustomThemes { get; set; } = false;
+
+    [BsonElement("allowAnalytics")]
+    public bool AllowAnalytics { get; set; } = false;
+
+    [BsonElement("allowCustomDomain")]
+    public bool AllowCustomDomain { get; set; } = false;
+
+    [BsonElement("allowMultipleDomains")]
+    public bool AllowMultipleDomains { get; set; } = false;
+
+    [BsonElement("prioritySupport")]
+    public bool PrioritySupport { get; set; } = false;
+
+    [BsonElement("createdAt")]
+    public DateTime CreatedAt { get; set; } = DateTime.UtcNow;
+
+    [BsonElement("updatedAt")]
+    public DateTime UpdatedAt { get; set; } = DateTime.UtcNow;
+}
\ No newline at end of file
diff --git a/src/BCards.Web/Models/User.cs b/src/BCards.Web/Models/User.cs
new file mode 100644
index 0000000..739b19d
--- /dev/null
+++ b/src/BCards.Web/Models/User.cs
@@ -0,0 +1,44 @@
+using MongoDB.Bson;
+using MongoDB.Bson.Serialization.Attributes;
+
+namespace BCards.Web.Models;
+
+public class User
+{
+    [BsonId]
+    [BsonRepresentation(BsonType.ObjectId)]
+    public string Id { get; set; } = string.Empty;
+
+    [BsonElement("email")]
+    public string Email { get; set; } = string.Empty;
+
+    [BsonElement("name")]
+    public string Name { get; set; } = string.Empty;
+
+    [BsonElement("profileImage")]
+    public string ProfileImage { get; set; } = string.Empty;
+
+    [BsonElement("authProvider")]
+    public string AuthProvider { get; set; } = string.Empty;
+
+    [BsonElement("stripeCustomerId")]
+    public string StripeCustomerId { get; set; } = string.Empty;
+
+    [BsonElement("subscriptionStatus")]
+    public string SubscriptionStatus { get; set; } = "free";
+
+    [BsonElement("currentPlan")]
+    public string CurrentPlan { get; set; } = "free";
+
+    [BsonElement("createdAt")]
+    public DateTime CreatedAt { get; set; } = DateTime.UtcNow;
+
+    [BsonElement("updatedAt")]
+    public DateTime UpdatedAt { get; set; } = DateTime.UtcNow;
+
+    [BsonElement("isActive")]
+    public bool IsActive { get; set; } = true;
+
+    [BsonElement("notifiedOfExpiration")]
+    public bool NotifiedOfExpiration { get; set; } = false;
+}
\ No newline at end of file
diff --git a/src/BCards.Web/Models/UserPage.cs b/src/BCards.Web/Models/UserPage.cs
new file mode 100644
index 0000000..3a4e2be
--- /dev/null
+++ b/src/BCards.Web/Models/UserPage.cs
@@ -0,0 +1,69 @@
+using MongoDB.Bson;
+using MongoDB.Bson.Serialization.Attributes;
+using BCards.Web.ViewModels;
+
+namespace BCards.Web.Models;
+
+public class UserPage
+{
+    [BsonId]
+    [BsonRepresentation(BsonType.ObjectId)]
+    public string Id { get; set; } = string.Empty;
+
+    [BsonElement("userId")]
+    [BsonRepresentation(BsonType.ObjectId)]
+    public string UserId { get; set; } = string.Empty;
+
+    [BsonElement("slug")]
+    public string Slug { get; set; } = string.Empty;
+
+    [BsonElement("category")]
+    public string Category { get; set; } = string.Empty;
+
+    [BsonElement("businessType")]
+    public string BusinessType { get; set; } = "individual"; // individual, company
+
+    [BsonElement("displayName")]
+    public string DisplayName { get; set; } = string.Empty;
+
+    [BsonElement("bio")]
+    public string Bio { get; set; } = string.Empty;
+
+    [BsonElement("profileImage")]
+    public string ProfileImage { get; set; } = string.Empty;
+
+    [BsonElement("theme")]
+    public PageTheme Theme { get; set; } = new();
+
+    [BsonElement("links")]
+    public List<LinkItem> Links { get; set; } = new();
+
+    [BsonElement("seoSettings")]
+    public SeoSettings SeoSettings { get; set; } = new();
+
+    [BsonElement("language")]
+    public string Language { get; set; } = "pt-BR";
+
+    [BsonElement("analytics")]
+    public PageAnalytics Analytics { get; set; } = new();
+
+    [BsonElement("isActive")]
+    public bool IsActive { get; set; } = true;
+
+    [BsonElement("planLimitations")]
+    public PlanLimitations PlanLimitations { get; set; } = new();
+
+    [BsonElement("createdAt")]
+    public DateTime CreatedAt { get; set; } = DateTime.UtcNow;
+
+    [BsonElement("updatedAt")]
+    public DateTime UpdatedAt { get; set; } = DateTime.UtcNow;
+
+    [BsonElement("publishedAt")]
+    public DateTime? PublishedAt { get; set; }
+
+    [BsonElement("status")]
+    public PageStatus Status { get; set; } = PageStatus.Active;
+
+    public string FullUrl => $"page/{Category}/{Slug}";
+}
\ No newline at end of file
diff --git a/src/BCards.Web/Program.cs b/src/BCards.Web/Program.cs
new file mode 100644
index 0000000..5c55c74
--- /dev/null
+++ b/src/BCards.Web/Program.cs
@@ -0,0 +1,202 @@
+using BCards.Web.Configuration;
+using BCards.Web.Services;
+using BCards.Web.Repositories;
+using Microsoft.AspNetCore.Authentication.Cookies;
+using Microsoft.AspNetCore.Authentication.Google;
+using Microsoft.AspNetCore.Authentication.MicrosoftAccount;
+using Microsoft.AspNetCore.Localization;
+using Microsoft.Extensions.Options;
+using MongoDB.Driver;
+using System.Globalization;
+
+var builder = WebApplication.CreateBuilder(args);
+
+// Add services to the container.
+builder.Services.AddControllersWithViews()
+    .AddRazorRuntimeCompilation()
+    .AddViewLocalization()
+    .AddDataAnnotationsLocalization();
+
+// MongoDB Configuration
+builder.Services.Configure<MongoDbSettings>(
+    builder.Configuration.GetSection("MongoDb"));
+
+builder.Services.AddSingleton<IMongoClient>(serviceProvider =>
+{
+    var settings = serviceProvider.GetRequiredService<IOptions<MongoDbSettings>>().Value;
+    return new MongoClient(settings.ConnectionString);
+});
+
+builder.Services.AddScoped(serviceProvider =>
+{
+    var client = serviceProvider.GetRequiredService<IMongoClient>();
+    var settings = serviceProvider.GetRequiredService<IOptions<MongoDbSettings>>().Value;
+    return client.GetDatabase(settings.DatabaseName);
+});
+
+// Stripe Configuration
+builder.Services.Configure<StripeSettings>(
+    builder.Configuration.GetSection("Stripe"));
+
+// OAuth Configuration
+builder.Services.Configure<GoogleAuthSettings>(
+    builder.Configuration.GetSection("Authentication:Google"));
+
+builder.Services.Configure<MicrosoftAuthSettings>(
+    builder.Configuration.GetSection("Authentication:Microsoft"));
+
+// Authentication
+builder.Services.AddAuthentication(options =>
+{
+    options.DefaultScheme = CookieAuthenticationDefaults.AuthenticationScheme;
+    options.DefaultChallengeScheme = GoogleDefaults.AuthenticationScheme;
+})
+.AddCookie(options =>
+{
+    options.LoginPath = "/Auth/Login";
+    options.LogoutPath = "/Auth/Logout";
+    options.ExpireTimeSpan = TimeSpan.FromDays(30);
+    options.SlidingExpiration = true;
+})
+.AddGoogle(options =>
+{
+    var googleAuth = builder.Configuration.GetSection("Authentication:Google");
+    options.ClientId = googleAuth["ClientId"] ?? "";
+    options.ClientSecret = googleAuth["ClientSecret"] ?? "";
+})
+.AddMicrosoftAccount(options =>
+{
+    var msAuth = builder.Configuration.GetSection("Authentication:Microsoft");
+    options.ClientId = msAuth["ClientId"] ?? "";
+    options.ClientSecret = msAuth["ClientSecret"] ?? "";
+});
+
+// Localization
+builder.Services.AddLocalization(options => options.ResourcesPath = "Resources");
+
+builder.Services.Configure<RequestLocalizationOptions>(options =>
+{
+    var supportedCultures = new[]
+    {
+        new CultureInfo("pt-BR"),
+        new CultureInfo("es-ES")
+    };
+
+    options.DefaultRequestCulture = new RequestCulture("pt-BR");
+    options.SupportedCultures = supportedCultures;
+    options.SupportedUICultures = supportedCultures;
+});
+
+// Register Services
+builder.Services.AddScoped<IUserRepository, UserRepository>();
+builder.Services.AddScoped<IUserPageRepository, UserPageRepository>();
+builder.Services.AddScoped<ICategoryRepository, CategoryRepository>();
+builder.Services.AddScoped<ISubscriptionRepository, SubscriptionRepository>();
+
+builder.Services.AddScoped<IUserPageService, UserPageService>();
+builder.Services.AddScoped<IThemeService, ThemeService>();
+builder.Services.AddScoped<ISeoService, SeoService>();
+builder.Services.AddScoped<IAuthService, AuthService>();
+builder.Services.AddScoped<IPaymentService, PaymentService>();
+builder.Services.AddScoped<ICategoryService, CategoryService>();
+
+// Background Services
+builder.Services.AddHostedService<TrialExpirationService>();
+
+// Response Caching
+builder.Services.AddResponseCaching();
+builder.Services.AddMemoryCache();
+
+builder.Services.AddRazorPages();
+
+var app = builder.Build();
+
+// Configure the HTTP request pipeline.
+if (!app.Environment.IsDevelopment())
+{
+    app.UseExceptionHandler("/Home/Error");
+    app.UseHsts();
+}
+
+app.UseHttpsRedirection();
+app.UseStaticFiles();
+
+app.UseRouting();
+
+app.UseRequestLocalization();
+
+app.UseAuthentication();
+app.UseAuthorization();
+
+// Add custom middleware
+app.UseMiddleware<BCards.Web.Middleware.PlanLimitationMiddleware>();
+app.UseMiddleware<BCards.Web.Middleware.PageStatusMiddleware>();
+
+app.UseResponseCaching();
+
+// Rota padr�o primeiro (mais espec�fica)
+app.MapControllerRoute(
+    name: "default",
+    pattern: "{controller=Home}/{action=Index}/{id?}");
+
+//Rota customizada depois (mais gen�rica)
+//app.MapControllerRoute(
+//    name: "userpage",
+//    pattern: "page/{category}/{slug}",
+//    defaults: new { controller = "UserPage", action = "Display" },
+//    constraints: new { category = @"^[a-zA-Z-]+$", slug = @"^[a-z0-9-]+$" });
+// Rota para preview
+app.MapControllerRoute(
+    name: "userpage-preview",
+    pattern: "page/preview/{category}/{slug}",
+    defaults: new { controller = "UserPage", action = "Preview" },
+    constraints: new { category = @"^[a-zA-Z-]+$", slug = @"^[a-z0-9-]+$" });
+
+// Rota para click
+app.MapControllerRoute(
+    name: "userpage-click",
+    pattern: "page/click/{pageId}",
+    defaults: new { controller = "UserPage", action = "RecordClick" });
+
+// Rota principal (deve vir por último)
+app.MapControllerRoute(
+    name: "userpage",
+    pattern: "page/{category}/{slug}",
+    defaults: new { controller = "UserPage", action = "Display" },
+    constraints: new { category = @"^[a-zA-Z-]+$", slug = @"^[a-z0-9-]+$" });
+
+// Rota padrão
+app.MapControllerRoute(
+    name: "default",
+    pattern: "{controller=Home}/{action=Index}/{id?}");
+
+// Initialize default data
+using (var scope = app.Services.CreateScope())
+{
+    var themeService = scope.ServiceProvider.GetRequiredService<IThemeService>();
+    var categoryService = scope.ServiceProvider.GetRequiredService<ICategoryService>();
+    
+    try
+    {
+        // Initialize themes
+        var existingThemes = await themeService.GetAvailableThemesAsync();
+        if (!existingThemes.Any())
+        {
+            await themeService.InitializeDefaultThemesAsync();
+        }
+        
+        // Initialize categories
+        var existingCategories = await categoryService.GetAllCategoriesAsync();
+        if (!existingCategories.Any())
+        {
+            await categoryService.InitializeDefaultCategoriesAsync();
+        }
+    }
+    catch (Exception ex)
+    {
+        var logger = scope.ServiceProvider.GetRequiredService<ILogger<Program>>();
+        logger.LogError(ex, "Error initializing default data");
+    }
+}
+
+app.Run();
\ No newline at end of file
diff --git a/src/BCards.Web/Properties/launchSettings.json b/src/BCards.Web/Properties/launchSettings.json
new file mode 100644
index 0000000..b12dbb0
--- /dev/null
+++ b/src/BCards.Web/Properties/launchSettings.json
@@ -0,0 +1,12 @@
+{
+  "profiles": {
+    "BCards.Web": {
+      "commandName": "Project",
+      "launchBrowser": true,
+      "environmentVariables": {
+        "ASPNETCORE_ENVIRONMENT": "Development"
+      },
+      "applicationUrl": "https://localhost:49178;http://localhost:49179"
+    }
+  }
+}
\ No newline at end of file
diff --git a/src/BCards.Web/Repositories/CategoryRepository.cs b/src/BCards.Web/Repositories/CategoryRepository.cs
new file mode 100644
index 0000000..ba45496
--- /dev/null
+++ b/src/BCards.Web/Repositories/CategoryRepository.cs
@@ -0,0 +1,70 @@
+using BCards.Web.Models;
+using MongoDB.Driver;
+
+namespace BCards.Web.Repositories;
+
+public class CategoryRepository : ICategoryRepository
+{
+    private readonly IMongoCollection<Category> _categories;
+
+    public CategoryRepository(IMongoDatabase database)
+    {
+        _categories = database.GetCollection<Category>("categories");
+        
+        // Create indexes
+        var slugIndex = Builders<Category>.IndexKeys.Ascending(x => x.Slug);
+        _categories.Indexes.CreateOneAsync(new CreateIndexModel<Category>(slugIndex, new CreateIndexOptions { Unique = true }));
+    }
+
+    public async Task<List<Category>> GetAllActiveAsync()
+    {
+        return await _categories.Find(x => x.IsActive).SortBy(x => x.Name).ToListAsync();
+    }
+
+    public async Task<Category?> GetBySlugAsync(string slug)
+    {
+        return await _categories.Find(x => x.Slug == slug && x.IsActive).FirstOrDefaultAsync();
+    }
+
+    public async Task<Category?> GetByIdAsync(string id)
+    {
+        return await _categories.Find(x => x.Id == id && x.IsActive).FirstOrDefaultAsync();
+    }
+
+    public async Task<Category> CreateAsync(Category category)
+    {
+        category.CreatedAt = DateTime.UtcNow;
+        await _categories.InsertOneAsync(category);
+        return category;
+    }
+
+    public async Task<Category> UpdateAsync(Category category)
+    {
+        await _categories.ReplaceOneAsync(x => x.Id == category.Id, category);
+        return category;
+    }
+
+    public async Task DeleteAsync(string id)
+    {
+        await _categories.UpdateOneAsync(
+            x => x.Id == id,
+            Builders<Category>.Update.Set(x => x.IsActive, false)
+        );
+    }
+
+    public async Task<bool> SlugExistsAsync(string slug, string? excludeId = null)
+    {
+        var filter = Builders<Category>.Filter.And(
+            Builders<Category>.Filter.Eq(x => x.Slug, slug),
+            Builders<Category>.Filter.Eq(x => x.IsActive, true)
+        );
+
+        if (!string.IsNullOrEmpty(excludeId))
+        {
+            filter = Builders<Category>.Filter.And(filter, 
+                Builders<Category>.Filter.Ne(x => x.Id, excludeId));
+        }
+
+        return await _categories.Find(filter).AnyAsync();
+    }
+}
\ No newline at end of file
diff --git a/src/BCards.Web/Repositories/ICategoryRepository.cs b/src/BCards.Web/Repositories/ICategoryRepository.cs
new file mode 100644
index 0000000..4e03eac
--- /dev/null
+++ b/src/BCards.Web/Repositories/ICategoryRepository.cs
@@ -0,0 +1,14 @@
+using BCards.Web.Models;
+
+namespace BCards.Web.Repositories;
+
+public interface ICategoryRepository
+{
+    Task<List<Category>> GetAllActiveAsync();
+    Task<Category?> GetBySlugAsync(string slug);
+    Task<Category?> GetByIdAsync(string id);
+    Task<Category> CreateAsync(Category category);
+    Task<Category> UpdateAsync(Category category);
+    Task DeleteAsync(string id);
+    Task<bool> SlugExistsAsync(string slug, string? excludeId = null);
+}
\ No newline at end of file
diff --git a/src/BCards.Web/Repositories/ISubscriptionRepository.cs b/src/BCards.Web/Repositories/ISubscriptionRepository.cs
new file mode 100644
index 0000000..49a9c82
--- /dev/null
+++ b/src/BCards.Web/Repositories/ISubscriptionRepository.cs
@@ -0,0 +1,14 @@
+using BCards.Web.Models;
+
+namespace BCards.Web.Repositories;
+
+public interface ISubscriptionRepository
+{
+    Task<Subscription?> GetByUserIdAsync(string userId);
+    Task<Subscription?> GetByStripeSubscriptionIdAsync(string stripeSubscriptionId);
+    Task<Subscription> CreateAsync(Subscription subscription);
+    Task<Subscription> UpdateAsync(Subscription subscription);
+    Task DeleteAsync(string id);
+    Task<List<Subscription>> GetExpiringSoonAsync(int days = 7);
+    Task<List<Subscription>> GetTrialSubscriptionsAsync();
+}
\ No newline at end of file
diff --git a/src/BCards.Web/Repositories/IUserPageRepository.cs b/src/BCards.Web/Repositories/IUserPageRepository.cs
new file mode 100644
index 0000000..4b2baf4
--- /dev/null
+++ b/src/BCards.Web/Repositories/IUserPageRepository.cs
@@ -0,0 +1,19 @@
+using BCards.Web.Models;
+
+namespace BCards.Web.Repositories;
+
+public interface IUserPageRepository
+{
+    Task<UserPage?> GetByIdAsync(string id);
+    Task<UserPage?> GetBySlugAsync(string category, string slug);
+    Task<UserPage?> GetByUserIdAsync(string userId);
+    Task<List<UserPage>> GetByUserIdAllAsync(string userId);
+    Task<List<UserPage>> GetActivePagesAsync();
+    Task<UserPage> CreateAsync(UserPage userPage);
+    Task<UserPage> UpdateAsync(UserPage userPage);
+    Task DeleteAsync(string id);
+    Task<bool> SlugExistsAsync(string category, string slug, string? excludeId = null);
+    Task<List<UserPage>> GetRecentPagesAsync(int limit = 10);
+    Task<List<UserPage>> GetByCategoryAsync(string category, int limit = 20);
+    Task UpdateAnalyticsAsync(string id, PageAnalytics analytics);
+}
\ No newline at end of file
diff --git a/src/BCards.Web/Repositories/IUserRepository.cs b/src/BCards.Web/Repositories/IUserRepository.cs
new file mode 100644
index 0000000..8c1ee13
--- /dev/null
+++ b/src/BCards.Web/Repositories/IUserRepository.cs
@@ -0,0 +1,13 @@
+using BCards.Web.Models;
+
+namespace BCards.Web.Repositories;
+
+public interface IUserRepository
+{
+    Task<User?> GetByIdAsync(string id);
+    Task<User?> GetByEmailAsync(string email);
+    Task<User> CreateAsync(User user);
+    Task<User> UpdateAsync(User user);
+    Task DeleteAsync(string id);
+    Task<bool> ExistsAsync(string email);
+}
\ No newline at end of file
diff --git a/src/BCards.Web/Repositories/SubscriptionRepository.cs b/src/BCards.Web/Repositories/SubscriptionRepository.cs
new file mode 100644
index 0000000..80dc345
--- /dev/null
+++ b/src/BCards.Web/Repositories/SubscriptionRepository.cs
@@ -0,0 +1,64 @@
+using BCards.Web.Models;
+using MongoDB.Driver;
+
+namespace BCards.Web.Repositories;
+
+public class SubscriptionRepository : ISubscriptionRepository
+{
+    private readonly IMongoCollection<Subscription> _subscriptions;
+
+    public SubscriptionRepository(IMongoDatabase database)
+    {
+        _subscriptions = database.GetCollection<Subscription>("subscriptions");
+        
+        // Create indexes
+        var userIndex = Builders<Subscription>.IndexKeys.Ascending(x => x.UserId);
+        _subscriptions.Indexes.CreateOneAsync(new CreateIndexModel<Subscription>(userIndex));
+        
+        var stripeIndex = Builders<Subscription>.IndexKeys.Ascending(x => x.StripeSubscriptionId);
+        _subscriptions.Indexes.CreateOneAsync(new CreateIndexModel<Subscription>(stripeIndex));
+    }
+
+    public async Task<Subscription?> GetByUserIdAsync(string userId)
+    {
+        return await _subscriptions.Find(x => x.UserId == userId).FirstOrDefaultAsync();
+    }
+
+    public async Task<Subscription?> GetByStripeSubscriptionIdAsync(string stripeSubscriptionId)
+    {
+        return await _subscriptions.Find(x => x.StripeSubscriptionId == stripeSubscriptionId).FirstOrDefaultAsync();
+    }
+
+    public async Task<Subscription> CreateAsync(Subscription subscription)
+    {
+        subscription.CreatedAt = DateTime.UtcNow;
+        subscription.UpdatedAt = DateTime.UtcNow;
+        await _subscriptions.InsertOneAsync(subscription);
+        return subscription;
+    }
+
+    public async Task<Subscription> UpdateAsync(Subscription subscription)
+    {
+        subscription.UpdatedAt = DateTime.UtcNow;
+        await _subscriptions.ReplaceOneAsync(x => x.Id == subscription.Id, subscription);
+        return subscription;
+    }
+
+    public async Task DeleteAsync(string id)
+    {
+        await _subscriptions.DeleteOneAsync(x => x.Id == id);
+    }
+
+    public async Task<List<Subscription>> GetExpiringSoonAsync(int days = 7)
+    {
+        var cutoffDate = DateTime.UtcNow.AddDays(days);
+        return await _subscriptions.Find(x => x.CurrentPeriodEnd <= cutoffDate && x.Status == "active")
+            .ToListAsync();
+    }
+
+    public async Task<List<Subscription>> GetTrialSubscriptionsAsync()
+    {
+        return await _subscriptions.Find(x => x.PlanType == "trial" && x.Status == "active")
+            .ToListAsync();
+    }
+}
\ No newline at end of file
diff --git a/src/BCards.Web/Repositories/UserPageRepository.cs b/src/BCards.Web/Repositories/UserPageRepository.cs
new file mode 100644
index 0000000..5954196
--- /dev/null
+++ b/src/BCards.Web/Repositories/UserPageRepository.cs
@@ -0,0 +1,119 @@
+using BCards.Web.Models;
+using MongoDB.Driver;
+
+namespace BCards.Web.Repositories;
+
+public class UserPageRepository : IUserPageRepository
+{
+    private readonly IMongoCollection<UserPage> _pages;
+
+    public UserPageRepository(IMongoDatabase database)
+    {
+        _pages = database.GetCollection<UserPage>("userpages");
+        
+        // Create indexes
+        var slugIndex = Builders<UserPage>.IndexKeys
+            .Ascending(x => x.Category)
+            .Ascending(x => x.Slug);
+        _pages.Indexes.CreateOneAsync(new CreateIndexModel<UserPage>(slugIndex, new CreateIndexOptions { Unique = true }));
+        
+        var userIndex = Builders<UserPage>.IndexKeys.Ascending(x => x.UserId);
+        _pages.Indexes.CreateOneAsync(new CreateIndexModel<UserPage>(userIndex));
+        
+        var categoryIndex = Builders<UserPage>.IndexKeys.Ascending(x => x.Category);
+        _pages.Indexes.CreateOneAsync(new CreateIndexModel<UserPage>(categoryIndex));
+    }
+
+    public async Task<UserPage?> GetByIdAsync(string id)
+    {
+        return await _pages.Find(x => x.Id == id && x.IsActive).FirstOrDefaultAsync();
+    }
+
+    public async Task<UserPage?> GetBySlugAsync(string category, string slug)
+    {
+        return await _pages.Find(x => x.Category == category.ToLower() && x.Slug == slug && x.IsActive).FirstOrDefaultAsync();
+    }
+
+    public async Task<UserPage?> GetByUserIdAsync(string userId)
+    {
+        return await _pages.Find(x => x.UserId == userId && x.IsActive).FirstOrDefaultAsync();
+    }
+
+    public async Task<List<UserPage>> GetByUserIdAllAsync(string userId)
+    {
+        return await _pages.Find(x => x.UserId == userId && x.IsActive).ToListAsync();
+    }
+
+    public async Task<UserPage> CreateAsync(UserPage userPage)
+    {
+        userPage.CreatedAt = DateTime.UtcNow;
+        userPage.UpdatedAt = DateTime.UtcNow;
+        await _pages.InsertOneAsync(userPage);
+        return userPage;
+    }
+
+    public async Task<UserPage> UpdateAsync(UserPage userPage)
+    {
+        userPage.UpdatedAt = DateTime.UtcNow;
+        await _pages.ReplaceOneAsync(x => x.Id == userPage.Id, userPage);
+        return userPage;
+    }
+
+    public async Task DeleteAsync(string id)
+    {
+        await _pages.UpdateOneAsync(
+            x => x.Id == id,
+            Builders<UserPage>.Update.Set(x => x.IsActive, false).Set(x => x.UpdatedAt, DateTime.UtcNow)
+        );
+    }
+
+    public async Task<bool> SlugExistsAsync(string category, string slug, string? excludeId = null)
+    {
+        var filter = Builders<UserPage>.Filter.And(
+            Builders<UserPage>.Filter.Eq(x => x.Category, category),
+            Builders<UserPage>.Filter.Eq(x => x.Slug, slug),
+            Builders<UserPage>.Filter.Eq(x => x.IsActive, true)
+        );
+
+        if (!string.IsNullOrEmpty(excludeId))
+        {
+            filter = Builders<UserPage>.Filter.And(filter, 
+                Builders<UserPage>.Filter.Ne(x => x.Id, excludeId));
+        }
+
+        return await _pages.Find(filter).AnyAsync();
+    }
+
+    public async Task<List<UserPage>> GetRecentPagesAsync(int limit = 10)
+    {
+        return await _pages.Find(x => x.IsActive && x.PublishedAt != null)
+            .SortByDescending(x => x.PublishedAt)
+            .Limit(limit)
+            .ToListAsync();
+    }
+
+    public async Task<List<UserPage>> GetByCategoryAsync(string category, int limit = 20)
+    {
+        return await _pages.Find(x => x.Category == category && x.IsActive && x.PublishedAt != null)
+            .SortByDescending(x => x.PublishedAt)
+            .Limit(limit)
+            .ToListAsync();
+    }
+
+    public async Task<List<UserPage>> GetActivePagesAsync()
+    {
+        return await _pages.Find(x => x.IsActive && x.Status == BCards.Web.ViewModels.PageStatus.Active)
+            .SortByDescending(x => x.UpdatedAt)
+            .ToListAsync();
+    }
+
+    public async Task UpdateAnalyticsAsync(string id, PageAnalytics analytics)
+    {
+        await _pages.UpdateOneAsync(
+            x => x.Id == id,
+            Builders<UserPage>.Update
+                .Set(x => x.Analytics, analytics)
+                .Set(x => x.UpdatedAt, DateTime.UtcNow)
+        );
+    }
+}
\ No newline at end of file
diff --git a/src/BCards.Web/Repositories/UserRepository.cs b/src/BCards.Web/Repositories/UserRepository.cs
new file mode 100644
index 0000000..48b6a28
--- /dev/null
+++ b/src/BCards.Web/Repositories/UserRepository.cs
@@ -0,0 +1,57 @@
+using BCards.Web.Models;
+using MongoDB.Driver;
+
+namespace BCards.Web.Repositories;
+
+public class UserRepository : IUserRepository
+{
+    private readonly IMongoCollection<User> _users;
+
+    public UserRepository(IMongoDatabase database)
+    {
+        _users = database.GetCollection<User>("users");
+        
+        // Create indexes
+        var indexKeys = Builders<User>.IndexKeys.Ascending(x => x.Email);
+        var indexOptions = new CreateIndexOptions { Unique = true };
+        _users.Indexes.CreateOneAsync(new CreateIndexModel<User>(indexKeys, indexOptions));
+    }
+
+    public async Task<User?> GetByIdAsync(string id)
+    {
+        return await _users.Find(x => x.Id == id && x.IsActive).FirstOrDefaultAsync();
+    }
+
+    public async Task<User?> GetByEmailAsync(string email)
+    {
+        return await _users.Find(x => x.Email == email && x.IsActive).FirstOrDefaultAsync();
+    }
+
+    public async Task<User> CreateAsync(User user)
+    {
+        user.CreatedAt = DateTime.UtcNow;
+        user.UpdatedAt = DateTime.UtcNow;
+        await _users.InsertOneAsync(user);
+        return user;
+    }
+
+    public async Task<User> UpdateAsync(User user)
+    {
+        user.UpdatedAt = DateTime.UtcNow;
+        await _users.ReplaceOneAsync(x => x.Id == user.Id, user);
+        return user;
+    }
+
+    public async Task DeleteAsync(string id)
+    {
+        await _users.UpdateOneAsync(
+            x => x.Id == id,
+            Builders<User>.Update.Set(x => x.IsActive, false).Set(x => x.UpdatedAt, DateTime.UtcNow)
+        );
+    }
+
+    public async Task<bool> ExistsAsync(string email)
+    {
+        return await _users.Find(x => x.Email == email && x.IsActive).AnyAsync();
+    }
+}
\ No newline at end of file
diff --git a/src/BCards.Web/Resources/pt-BR/SharedResource.resx b/src/BCards.Web/Resources/pt-BR/SharedResource.resx
new file mode 100644
index 0000000..5621468
--- /dev/null
+++ b/src/BCards.Web/Resources/pt-BR/SharedResource.resx
@@ -0,0 +1,130 @@
+<?xml version="1.0" encoding="utf-8"?>
+<root>
+  <xsd:schema id="root" xmlns="" xmlns:xsd="http://www.w3.org/2001/XMLSchema" xmlns:msdata="urn:schemas-microsoft-com:xml-msdata">
+    <xsd:import namespace="http://www.w3.org/XML/1998/namespace" />
+    <xsd:element name="root" msdata:IsDataSet="true">
+      <xsd:complexType>
+        <xsd:choice maxOccurs="unbounded">
+          <xsd:element name="metadata">
+            <xsd:complexType>
+              <xsd:sequence>
+                <xsd:element name="value" type="xsd:string" minOccurs="0" />
+              </xsd:sequence>
+              <xsd:attribute name="name" use="required" type="xsd:string" />
+              <xsd:attribute name="type" type="xsd:string" />
+              <xsd:attribute name="mimetype" type="xsd:string" />
+              <xsd:attribute ref="xml:space" />
+            </xsd:complexType>
+          </xsd:element>
+          <xsd:element name="assembly">
+            <xsd:complexType>
+              <xsd:attribute name="alias" type="xsd:string" />
+              <xsd:attribute name="name" type="xsd:string" />
+            </xsd:complexType>
+          </xsd:element>
+          <xsd:element name="data">
+            <xsd:complexType>
+              <xsd:sequence>
+                <xsd:element name="value" type="xsd:string" minOccurs="0" msdata:Ordinal="1" />
+                <xsd:element name="comment" type="xsd:string" minOccurs="0" msdata:Ordinal="2" />
+              </xsd:sequence>
+              <xsd:attribute name="name" use="required" type="xsd:string" />
+              <xsd:attribute name="type" type="xsd:string" />
+              <xsd:attribute name="mimetype" type="xsd:string" />
+              <xsd:attribute ref="xml:space" />
+            </xsd:complexType>
+          </xsd:element>
+          <xsd:element name="resheader">
+            <xsd:complexType>
+              <xsd:sequence>
+                <xsd:element name="value" type="xsd:string" minOccurs="0" msdata:Ordinal="1" />
+              </xsd:sequence>
+              <xsd:attribute name="name" use="required" type="xsd:string" />
+            </xsd:complexType>
+          </xsd:element>
+        </xsd:choice>
+      </xsd:complexType>
+    </xsd:element>
+  </xsd:schema>
+  <resheader name="resmimetype">
+    <value>text/microsoft-resx</value>
+  </resheader>
+  <resheader name="version">
+    <value>2.0</value>
+  </resheader>
+  <resheader name="reader">
+    <value>System.Resources.ResXResourceReader, System.Windows.Forms, Version=4.0.0.0, Culture=neutral, PublicKeyToken=b77a5c561934e089</value>
+  </resheader>
+  <resheader name="writer">
+    <value>System.Resources.ResXResourceWriter, System.Windows.Forms, Version=4.0.0.0, Culture=neutral, PublicKeyToken=b77a5c561934e089</value>
+  </resheader>
+  <data name="Home" xml:space="preserve">
+    <value>Início</value>
+  </data>
+  <data name="Plans" xml:space="preserve">
+    <value>Planos</value>
+  </data>
+  <data name="Login" xml:space="preserve">
+    <value>Entrar</value>
+  </data>
+  <data name="Dashboard" xml:space="preserve">
+    <value>Dashboard</value>
+  </data>
+  <data name="Logout" xml:space="preserve">
+    <value>Sair</value>
+  </data>
+  <data name="CreatePage" xml:space="preserve">
+    <value>Criar Página</value>
+  </data>
+  <data name="EditPage" xml:space="preserve">
+    <value>Editar Página</value>
+  </data>
+  <data name="Save" xml:space="preserve">
+    <value>Salvar</value>
+  </data>
+  <data name="Cancel" xml:space="preserve">
+    <value>Cancelar</value>
+  </data>
+  <data name="Delete" xml:space="preserve">
+    <value>Excluir</value>
+  </data>
+  <data name="Name" xml:space="preserve">
+    <value>Nome</value>
+  </data>
+  <data name="Email" xml:space="preserve">
+    <value>E-mail</value>
+  </data>
+  <data name="Bio" xml:space="preserve">
+    <value>Biografia</value>
+  </data>
+  <data name="Category" xml:space="preserve">
+    <value>Categoria</value>
+  </data>
+  <data name="Slug" xml:space="preserve">
+    <value>URL</value>
+  </data>
+  <data name="Links" xml:space="preserve">
+    <value>Links</value>
+  </data>
+  <data name="Title" xml:space="preserve">
+    <value>Título</value>
+  </data>
+  <data name="URL" xml:space="preserve">
+    <value>URL</value>
+  </data>
+  <data name="Description" xml:space="preserve">
+    <value>Descrição</value>
+  </data>
+  <data name="Theme" xml:space="preserve">
+    <value>Tema</value>
+  </data>
+  <data name="Analytics" xml:space="preserve">
+    <value>Analytics</value>
+  </data>
+  <data name="Views" xml:space="preserve">
+    <value>Visualizações</value>
+  </data>
+  <data name="Clicks" xml:space="preserve">
+    <value>Cliques</value>
+  </data>
+</root>
\ No newline at end of file
diff --git a/src/BCards.Web/Services/AuthService.cs b/src/BCards.Web/Services/AuthService.cs
new file mode 100644
index 0000000..a579f26
--- /dev/null
+++ b/src/BCards.Web/Services/AuthService.cs
@@ -0,0 +1,66 @@
+using BCards.Web.Models;
+using BCards.Web.Repositories;
+using System.Security.Claims;
+
+namespace BCards.Web.Services;
+
+public class AuthService : IAuthService
+{
+    private readonly IUserRepository _userRepository;
+
+    public AuthService(IUserRepository userRepository)
+    {
+        _userRepository = userRepository;
+    }
+
+    public async Task<User> CreateOrUpdateUserFromClaimsAsync(ClaimsPrincipal claimsPrincipal)
+    {
+        var email = claimsPrincipal.FindFirst(ClaimTypes.Email)?.Value ?? "";
+        var name = claimsPrincipal.FindFirst(ClaimTypes.Name)?.Value ?? "";
+        var provider = claimsPrincipal.Identity?.AuthenticationType ?? "";
+        var profileImage = claimsPrincipal.FindFirst("picture")?.Value ?? "";
+
+        var existingUser = await _userRepository.GetByEmailAsync(email);
+        
+        if (existingUser != null)
+        {
+            // Update existing user
+            existingUser.Name = name;
+            existingUser.ProfileImage = profileImage;
+            existingUser.UpdatedAt = DateTime.UtcNow;
+            return await _userRepository.UpdateAsync(existingUser);
+        }
+
+        // Create new user
+        var newUser = new User
+        {
+            Email = email,
+            Name = name,
+            ProfileImage = profileImage,
+            AuthProvider = provider,
+            CreatedAt = DateTime.UtcNow,
+            UpdatedAt = DateTime.UtcNow
+        };
+
+        return await _userRepository.CreateAsync(newUser);
+    }
+
+    public async Task<User?> GetCurrentUserAsync(ClaimsPrincipal claimsPrincipal)
+    {
+        var email = claimsPrincipal.FindFirst(ClaimTypes.Email)?.Value;
+        if (string.IsNullOrEmpty(email))
+            return null;
+
+        return await _userRepository.GetByEmailAsync(email);
+    }
+
+    public async Task<User?> GetUserByIdAsync(string userId)
+    {
+        return await _userRepository.GetByIdAsync(userId);
+    }
+
+    public async Task<User> UpdateUserAsync(User user)
+    {
+        return await _userRepository.UpdateAsync(user);
+    }
+}
\ No newline at end of file
diff --git a/src/BCards.Web/Services/CategoryService.cs b/src/BCards.Web/Services/CategoryService.cs
new file mode 100644
index 0000000..90032c1
--- /dev/null
+++ b/src/BCards.Web/Services/CategoryService.cs
@@ -0,0 +1,191 @@
+using BCards.Web.Models;
+using BCards.Web.Repositories;
+using System.Text.RegularExpressions;
+using System.Globalization;
+using System.Text;
+
+namespace BCards.Web.Services;
+
+public class CategoryService : ICategoryService
+{
+    private readonly ICategoryRepository _categoryRepository;
+
+    public CategoryService(ICategoryRepository categoryRepository)
+    {
+        _categoryRepository = categoryRepository;
+    }
+
+    public async Task<List<Category>> GetAllCategoriesAsync()
+    {
+        return await _categoryRepository.GetAllActiveAsync();
+    }
+
+    public async Task<Category?> GetCategoryBySlugAsync(string slug)
+    {
+        return await _categoryRepository.GetBySlugAsync(slug);
+    }
+
+    public async Task<string> GenerateSlugAsync(string name)
+    {
+        var slug = GenerateSlug(name);
+        var originalSlug = slug;
+        var counter = 1;
+
+        while (await _categoryRepository.SlugExistsAsync(slug))
+        {
+            slug = $"{originalSlug}-{counter}";
+            counter++;
+        }
+
+        return slug;
+    }
+
+    public async Task<bool> ValidateSlugAsync(string slug, string? excludeId = null)
+    {
+        if (string.IsNullOrWhiteSpace(slug))
+            return false;
+
+        if (!IsValidSlugFormat(slug))
+            return false;
+
+        return !await _categoryRepository.SlugExistsAsync(slug, excludeId);
+    }
+
+    public async Task InitializeDefaultCategoriesAsync()
+    {
+        var categories = await _categoryRepository.GetAllActiveAsync();
+        if (categories.Any()) return;
+
+        var defaultCategories = new[]
+        {
+            new Category
+            {
+                Name = "Corretor de Imóveis",
+                Slug = "corretor",
+                Icon = "🏠",
+                Description = "Profissionais especializados em compra, venda e locação de imóveis",
+                SeoKeywords = new List<string> { "corretor", "imóveis", "casa", "apartamento", "venda", "locação" }
+            },
+            new Category
+            {
+                Name = "Tecnologia",
+                Slug = "tecnologia",
+                Icon = "💻",
+                Description = "Empresas e profissionais de tecnologia, desenvolvimento e TI",
+                SeoKeywords = new List<string> { "desenvolvimento", "software", "programação", "tecnologia", "TI" }
+            },
+            new Category
+            {
+                Name = "Saúde",
+                Slug = "saude",
+                Icon = "🏥",
+                Description = "Profissionais da saúde, clínicas e consultórios médicos",
+                SeoKeywords = new List<string> { "médico", "saúde", "clínica", "consulta", "tratamento" }
+            },
+            new Category
+            {
+                Name = "Educação",
+                Slug = "educacao",
+                Icon = "📚",
+                Description = "Professores, escolas, cursos e instituições de ensino",
+                SeoKeywords = new List<string> { "educação", "ensino", "professor", "curso", "escola" }
+            },
+            new Category
+            {
+                Name = "Comércio",
+                Slug = "comercio",
+                Icon = "🛍️",
+                Description = "Lojas, e-commerce e estabelecimentos comerciais",
+                SeoKeywords = new List<string> { "loja", "comércio", "venda", "produtos", "e-commerce" }
+            },
+            new Category
+            {
+                Name = "Serviços",
+                Slug = "servicos",
+                Icon = "🔧",
+                Description = "Prestadores de serviços gerais e especializados",
+                SeoKeywords = new List<string> { "serviços", "prestador", "profissional", "especializado" }
+            },
+            new Category
+            {
+                Name = "Alimentação",
+                Slug = "alimentacao",
+                Icon = "🍽️",
+                Description = "Restaurantes, delivery, food trucks e estabelecimentos alimentícios",
+                SeoKeywords = new List<string> { "restaurante", "comida", "delivery", "alimentação", "gastronomia" }
+            },
+            new Category
+            {
+                Name = "Beleza",
+                Slug = "beleza",
+                Icon = "💄",
+                Description = "Salões de beleza, barbearias, estética e cuidados pessoais",
+                SeoKeywords = new List<string> { "beleza", "salão", "estética", "cabeleireiro", "manicure" }
+            },
+            new Category
+            {
+                Name = "Advocacia",
+                Slug = "advocacia",
+                Icon = "⚖️",
+                Description = "Advogados, escritórios jurídicos e consultoria legal",
+                SeoKeywords = new List<string> { "advogado", "jurídico", "direito", "advocacia", "legal" }
+            },
+            new Category
+            {
+                Name = "Arquitetura",
+                Slug = "arquitetura",
+                Icon = "🏗️",
+                Description = "Arquitetos, engenheiros e profissionais da construção",
+                SeoKeywords = new List<string> { "arquiteto", "engenheiro", "construção", "projeto", "reforma" }
+            }
+        };
+
+        foreach (var category in defaultCategories)
+        {
+            await _categoryRepository.CreateAsync(category);
+        }
+    }
+
+    private static string GenerateSlug(string text)
+    {
+        if (string.IsNullOrWhiteSpace(text))
+            return string.Empty;
+
+        // Remove acentos
+        text = RemoveDiacritics(text);
+        
+        // Converter para minúsculas
+        text = text.ToLowerInvariant();
+        
+        // Substituir espaços e caracteres especiais por hífens
+        text = Regex.Replace(text, @"[^a-z0-9\s-]", "");
+        text = Regex.Replace(text, @"[\s-]+", "-");
+        
+        // Remover hífens do início e fim
+        text = text.Trim('-');
+        
+        return text;
+    }
+
+    private static string RemoveDiacritics(string text)
+    {
+        var normalizedString = text.Normalize(NormalizationForm.FormD);
+        var stringBuilder = new StringBuilder();
+
+        foreach (var c in normalizedString)
+        {
+            var unicodeCategory = CharUnicodeInfo.GetUnicodeCategory(c);
+            if (unicodeCategory != UnicodeCategory.NonSpacingMark)
+            {
+                stringBuilder.Append(c);
+            }
+        }
+
+        return stringBuilder.ToString().Normalize(NormalizationForm.FormC);
+    }
+
+    private static bool IsValidSlugFormat(string slug)
+    {
+        return Regex.IsMatch(slug, @"^[a-z0-9-]+$") && !slug.StartsWith('-') && !slug.EndsWith('-');
+    }
+}
\ No newline at end of file
diff --git a/src/BCards.Web/Services/IAuthService.cs b/src/BCards.Web/Services/IAuthService.cs
new file mode 100644
index 0000000..d624a2e
--- /dev/null
+++ b/src/BCards.Web/Services/IAuthService.cs
@@ -0,0 +1,12 @@
+using BCards.Web.Models;
+using System.Security.Claims;
+
+namespace BCards.Web.Services;
+
+public interface IAuthService
+{
+    Task<User> CreateOrUpdateUserFromClaimsAsync(ClaimsPrincipal claimsPrincipal);
+    Task<User?> GetCurrentUserAsync(ClaimsPrincipal claimsPrincipal);
+    Task<User?> GetUserByIdAsync(string userId);
+    Task<User> UpdateUserAsync(User user);
+}
\ No newline at end of file
diff --git a/src/BCards.Web/Services/ICategoryService.cs b/src/BCards.Web/Services/ICategoryService.cs
new file mode 100644
index 0000000..6f48f7b
--- /dev/null
+++ b/src/BCards.Web/Services/ICategoryService.cs
@@ -0,0 +1,12 @@
+using BCards.Web.Models;
+
+namespace BCards.Web.Services;
+
+public interface ICategoryService
+{
+    Task<List<Category>> GetAllCategoriesAsync();
+    Task<Category?> GetCategoryBySlugAsync(string slug);
+    Task InitializeDefaultCategoriesAsync();
+    Task<string> GenerateSlugAsync(string name);
+    Task<bool> ValidateSlugAsync(string slug, string? excludeId = null);
+}
\ No newline at end of file
diff --git a/src/BCards.Web/Services/IPaymentService.cs b/src/BCards.Web/Services/IPaymentService.cs
new file mode 100644
index 0000000..ea8cd0c
--- /dev/null
+++ b/src/BCards.Web/Services/IPaymentService.cs
@@ -0,0 +1,15 @@
+using BCards.Web.Models;
+using Stripe;
+
+namespace BCards.Web.Services;
+
+public interface IPaymentService
+{
+    Task<string> CreateCheckoutSessionAsync(string userId, string planType, string returnUrl, string cancelUrl);
+    Task<Customer> CreateOrGetCustomerAsync(string userId, string email, string name);
+    Task<Stripe.Subscription> HandleWebhookAsync(string requestBody, string signature);
+    Task<List<Price>> GetPricesAsync();
+    Task<bool> CancelSubscriptionAsync(string subscriptionId);
+    Task<Stripe.Subscription> UpdateSubscriptionAsync(string subscriptionId, string newPriceId);
+    Task<PlanLimitations> GetPlanLimitationsAsync(string planType);
+}
\ No newline at end of file
diff --git a/src/BCards.Web/Services/ISeoService.cs b/src/BCards.Web/Services/ISeoService.cs
new file mode 100644
index 0000000..ea4da09
--- /dev/null
+++ b/src/BCards.Web/Services/ISeoService.cs
@@ -0,0 +1,12 @@
+using BCards.Web.Models;
+
+namespace BCards.Web.Services;
+
+public interface ISeoService
+{
+    SeoSettings GenerateSeoSettings(UserPage userPage, Category category);
+    string GeneratePageTitle(UserPage userPage, Category category);
+    string GeneratePageDescription(UserPage userPage, Category category);
+    List<string> GenerateKeywords(UserPage userPage, Category category);
+    string GenerateCanonicalUrl(UserPage userPage);
+}
\ No newline at end of file
diff --git a/src/BCards.Web/Services/IThemeService.cs b/src/BCards.Web/Services/IThemeService.cs
new file mode 100644
index 0000000..bed15e8
--- /dev/null
+++ b/src/BCards.Web/Services/IThemeService.cs
@@ -0,0 +1,13 @@
+using BCards.Web.Models;
+
+namespace BCards.Web.Services;
+
+public interface IThemeService
+{
+    Task<List<PageTheme>> GetAvailableThemesAsync();
+    Task<PageTheme?> GetThemeByIdAsync(string themeId);
+    Task<PageTheme?> GetThemeByNameAsync(string themeName);
+    Task<string> GenerateCustomCssAsync(PageTheme theme);
+    Task InitializeDefaultThemesAsync();
+    PageTheme GetDefaultTheme();
+}
\ No newline at end of file
diff --git a/src/BCards.Web/Services/IUserPageService.cs b/src/BCards.Web/Services/IUserPageService.cs
new file mode 100644
index 0000000..d5be8f6
--- /dev/null
+++ b/src/BCards.Web/Services/IUserPageService.cs
@@ -0,0 +1,22 @@
+using BCards.Web.Models;
+
+namespace BCards.Web.Services;
+
+public interface IUserPageService
+{
+    Task<UserPage?> GetPageAsync(string category, string slug);
+    Task<UserPage?> GetUserPageAsync(string userId);
+    Task<UserPage?> GetPageByIdAsync(string id);
+    Task<List<UserPage>> GetUserPagesAsync(string userId);
+    Task<List<UserPage>> GetActivePagesAsync();
+    Task<UserPage> CreatePageAsync(UserPage userPage);
+    Task<UserPage> UpdatePageAsync(UserPage userPage);
+    Task DeletePageAsync(string id);
+    Task<bool> ValidateSlugAsync(string category, string slug, string? excludeId = null);
+    Task<string> GenerateSlugAsync(string category, string name);
+    Task<bool> CanCreateLinksAsync(string userId, int newLinksCount = 1);
+    Task RecordPageViewAsync(string pageId, string? referrer = null, string? userAgent = null);
+    Task RecordLinkClickAsync(string pageId, int linkIndex);
+    Task<List<UserPage>> GetRecentPagesAsync(int limit = 10);
+    Task<List<UserPage>> GetPagesByCategoryAsync(string category, int limit = 20);
+}
\ No newline at end of file
diff --git a/src/BCards.Web/Services/PaymentService.cs b/src/BCards.Web/Services/PaymentService.cs
new file mode 100644
index 0000000..bdbccb8
--- /dev/null
+++ b/src/BCards.Web/Services/PaymentService.cs
@@ -0,0 +1,322 @@
+using BCards.Web.Configuration;
+using BCards.Web.Models;
+using BCards.Web.Repositories;
+using Microsoft.Extensions.Options;
+using Stripe;
+using Stripe.Checkout;
+
+namespace BCards.Web.Services;
+
+public class PaymentService : IPaymentService
+{
+    private readonly StripeSettings _stripeSettings;
+    private readonly IUserRepository _userRepository;
+    private readonly ISubscriptionRepository _subscriptionRepository;
+    private readonly IConfiguration _configuration;
+
+    public PaymentService(
+        IOptions<StripeSettings> stripeSettings,
+        IUserRepository userRepository,
+        ISubscriptionRepository subscriptionRepository,
+        IConfiguration configuration)
+    {
+        _stripeSettings = stripeSettings.Value;
+        _userRepository = userRepository;
+        _subscriptionRepository = subscriptionRepository;
+        _configuration = configuration;
+        
+        StripeConfiguration.ApiKey = _stripeSettings.SecretKey;
+    }
+
+    public async Task<string> CreateCheckoutSessionAsync(string userId, string planType, string returnUrl, string cancelUrl)
+    {
+        var user = await _userRepository.GetByIdAsync(userId);
+        if (user == null) throw new InvalidOperationException("User not found");
+
+        var planConfig = _configuration.GetSection($"Plans:{planType}");
+        var priceId = planConfig["PriceId"];
+        
+        if (string.IsNullOrEmpty(priceId))
+            throw new InvalidOperationException($"Price ID not found for plan: {planType}");
+
+        var customer = await CreateOrGetCustomerAsync(userId, user.Email, user.Name);
+
+        var options = new SessionCreateOptions
+        {
+            PaymentMethodTypes = new List<string> { "card" },
+            Mode = "subscription",
+            Customer = customer.Id,
+            LineItems = new List<SessionLineItemOptions>
+            {
+                new()
+                {
+                    Price = priceId,
+                    Quantity = 1
+                }
+            },
+            SuccessUrl = returnUrl,
+            CancelUrl = cancelUrl,
+            Metadata = new Dictionary<string, string>
+            {
+                { "user_id", userId },
+                { "plan_type", planType }
+            }
+        };
+
+        var service = new SessionService();
+        var session = await service.CreateAsync(options);
+        
+        return session.Url;
+    }
+
+    public async Task<Customer> CreateOrGetCustomerAsync(string userId, string email, string name)
+    {
+        var user = await _userRepository.GetByIdAsync(userId);
+        
+        if (!string.IsNullOrEmpty(user?.StripeCustomerId))
+        {
+            var customerService = new CustomerService();
+            try
+            {
+                return await customerService.GetAsync(user.StripeCustomerId);
+            }
+            catch (StripeException)
+            {
+                // Customer doesn't exist, create new one
+            }
+        }
+
+        // Create new customer
+        var options = new CustomerCreateOptions
+        {
+            Email = email,
+            Name = name,
+            Metadata = new Dictionary<string, string>
+            {
+                { "user_id", userId }
+            }
+        };
+
+        var service = new CustomerService();
+        var customer = await service.CreateAsync(options);
+
+        // Update user with customer ID
+        if (user != null)
+        {
+            user.StripeCustomerId = customer.Id;
+            await _userRepository.UpdateAsync(user);
+        }
+
+        return customer;
+    }
+
+    public async Task<Stripe.Subscription> HandleWebhookAsync(string requestBody, string signature)
+    {
+        try
+        {
+            var stripeEvent = EventUtility.ConstructEvent(requestBody, signature, _stripeSettings.WebhookSecret);
+
+            switch (stripeEvent.Type)
+            {
+                case Events.CheckoutSessionCompleted:
+                    var session = stripeEvent.Data.Object as Session;
+                    await HandleCheckoutSessionCompletedAsync(session!);
+                    break;
+
+                case Events.InvoicePaymentSucceeded:
+                    var invoice = stripeEvent.Data.Object as Invoice;
+                    await HandleInvoicePaymentSucceededAsync(invoice!);
+                    break;
+
+                case Events.CustomerSubscriptionUpdated:
+                case Events.CustomerSubscriptionDeleted:
+                    var subscription = stripeEvent.Data.Object as Stripe.Subscription;
+                    await HandleSubscriptionUpdatedAsync(subscription!);
+                    break;
+            }
+
+            return stripeEvent.Data.Object as Stripe.Subscription ?? new Stripe.Subscription();
+        }
+        catch (StripeException ex)
+        {
+            throw new InvalidOperationException($"Webhook signature verification failed: {ex.Message}");
+        }
+    }
+
+    public async Task<List<Price>> GetPricesAsync()
+    {
+        var service = new PriceService();
+        var options = new PriceListOptions
+        {
+            Active = true,
+            Type = "recurring"
+        };
+
+        var prices = await service.ListAsync(options);
+        return prices.Data;
+    }
+
+    public async Task<bool> CancelSubscriptionAsync(string subscriptionId)
+    {
+        var service = new SubscriptionService();
+        var options = new SubscriptionUpdateOptions
+        {
+            CancelAtPeriodEnd = true
+        };
+
+        var subscription = await service.UpdateAsync(subscriptionId, options);
+        
+        // Update local subscription
+        var localSubscription = await _subscriptionRepository.GetByStripeSubscriptionIdAsync(subscriptionId);
+        if (localSubscription != null)
+        {
+            localSubscription.CancelAtPeriodEnd = true;
+            await _subscriptionRepository.UpdateAsync(localSubscription);
+        }
+
+        return subscription.CancelAtPeriodEnd;
+    }
+
+    public async Task<Stripe.Subscription> UpdateSubscriptionAsync(string subscriptionId, string newPriceId)
+    {
+        var service = new SubscriptionService();
+        var subscription = await service.GetAsync(subscriptionId);
+
+        var options = new SubscriptionUpdateOptions
+        {
+            Items = new List<SubscriptionItemOptions>
+            {
+                new()
+                {
+                    Id = subscription.Items.Data[0].Id,
+                    Price = newPriceId
+                }
+            }
+        };
+
+        return await service.UpdateAsync(subscriptionId, options);
+    }
+
+    public Task<PlanLimitations> GetPlanLimitationsAsync(string planType)
+    {
+        var limitations = planType.ToLower() switch
+        {
+            "basic" => new PlanLimitations
+            {
+                MaxLinks = 5,
+                AllowCustomThemes = false,
+                AllowAnalytics = true,
+                AllowCustomDomain = false,
+                AllowMultipleDomains = false,
+                PrioritySupport = false,
+                PlanType = "basic"
+            },
+            "professional" => new PlanLimitations
+            {
+                MaxLinks = 15,
+                AllowCustomThemes = false,
+                AllowAnalytics = true,
+                AllowCustomDomain = true,
+                AllowMultipleDomains = false,
+                PrioritySupport = false,
+                PlanType = "professional"
+            },
+            "premium" => new PlanLimitations
+            {
+                MaxLinks = -1, // Unlimited
+                AllowCustomThemes = true,
+                AllowAnalytics = true,
+                AllowCustomDomain = true,
+                AllowMultipleDomains = true,
+                PrioritySupport = true,
+                PlanType = "premium"
+            },
+            _ => new PlanLimitations
+            {
+                MaxLinks = 5,
+                AllowCustomThemes = false,
+                AllowAnalytics = false,
+                AllowCustomDomain = false,
+                AllowMultipleDomains = false,
+                PrioritySupport = false,
+                PlanType = "free"
+            }
+        };
+
+        return Task.FromResult(limitations);
+    }
+
+    private async Task HandleCheckoutSessionCompletedAsync(Session session)
+    {
+        var userId = session.Metadata["user_id"];
+        var planType = session.Metadata["plan_type"];
+
+        var subscriptionService = new SubscriptionService();
+        var stripeSubscription = await subscriptionService.GetAsync(session.SubscriptionId);
+
+        var limitations = await GetPlanLimitationsAsync(planType);
+
+        var subscription = new Models.Subscription
+        {
+            UserId = userId,
+            StripeSubscriptionId = session.SubscriptionId,
+            PlanType = planType,
+            Status = stripeSubscription.Status,
+            CurrentPeriodStart = stripeSubscription.CurrentPeriodStart,
+            CurrentPeriodEnd = stripeSubscription.CurrentPeriodEnd,
+            MaxLinks = limitations.MaxLinks,
+            AllowCustomThemes = limitations.AllowCustomThemes,
+            AllowAnalytics = limitations.AllowAnalytics,
+            AllowCustomDomain = limitations.AllowCustomDomain,
+            AllowMultipleDomains = limitations.AllowMultipleDomains,
+            PrioritySupport = limitations.PrioritySupport
+        };
+
+        await _subscriptionRepository.CreateAsync(subscription);
+
+        // Update user
+        var user = await _userRepository.GetByIdAsync(userId);
+        if (user != null)
+        {
+            user.CurrentPlan = planType;
+            user.SubscriptionStatus = "active";
+            await _userRepository.UpdateAsync(user);
+        }
+    }
+
+    private async Task HandleInvoicePaymentSucceededAsync(Invoice invoice)
+    {
+        var subscription = await _subscriptionRepository.GetByStripeSubscriptionIdAsync(invoice.SubscriptionId);
+        if (subscription != null)
+        {
+            subscription.Status = "active";
+            await _subscriptionRepository.UpdateAsync(subscription);
+        }
+    }
+
+    private async Task HandleSubscriptionUpdatedAsync(Stripe.Subscription stripeSubscription)
+    {
+        var subscription = await _subscriptionRepository.GetByStripeSubscriptionIdAsync(stripeSubscription.Id);
+        if (subscription != null)
+        {
+            subscription.Status = stripeSubscription.Status;
+            subscription.CurrentPeriodStart = stripeSubscription.CurrentPeriodStart;
+            subscription.CurrentPeriodEnd = stripeSubscription.CurrentPeriodEnd;
+            subscription.CancelAtPeriodEnd = stripeSubscription.CancelAtPeriodEnd;
+            
+            await _subscriptionRepository.UpdateAsync(subscription);
+
+            // Update user status
+            var user = await _userRepository.GetByIdAsync(subscription.UserId);
+            if (user != null)
+            {
+                user.SubscriptionStatus = stripeSubscription.Status;
+                if (stripeSubscription.Status != "active")
+                {
+                    user.CurrentPlan = "free";
+                }
+                await _userRepository.UpdateAsync(user);
+            }
+        }
+    }
+}
\ No newline at end of file
diff --git a/src/BCards.Web/Services/SeoService.cs b/src/BCards.Web/Services/SeoService.cs
new file mode 100644
index 0000000..51e2016
--- /dev/null
+++ b/src/BCards.Web/Services/SeoService.cs
@@ -0,0 +1,79 @@
+using BCards.Web.Models;
+
+namespace BCards.Web.Services;
+
+public class SeoService : ISeoService
+{
+    private readonly string _baseUrl;
+
+    public SeoService(IConfiguration configuration)
+    {
+        _baseUrl = configuration["BaseUrl"] ?? "https://vcart.me";
+    }
+
+    public SeoSettings GenerateSeoSettings(UserPage userPage, Category category)
+    {
+        return new SeoSettings
+        {
+            Title = GeneratePageTitle(userPage, category),
+            Description = GeneratePageDescription(userPage, category),
+            Keywords = GenerateKeywords(userPage, category),
+            OgTitle = GeneratePageTitle(userPage, category),
+            OgDescription = GeneratePageDescription(userPage, category),
+            OgImage = !string.IsNullOrEmpty(userPage.ProfileImage) ? userPage.ProfileImage : $"{_baseUrl}/images/default-og.png",
+            CanonicalUrl = GenerateCanonicalUrl(userPage),
+            TwitterCard = "summary_large_image"
+        };
+    }
+
+    public string GeneratePageTitle(UserPage userPage, Category category)
+    {
+        var businessTypeText = userPage.BusinessType == "company" ? "Empresa" : "Profissional";
+        return $"{userPage.DisplayName} - {businessTypeText} de {category.Name} | BCards";
+    }
+
+    public string GeneratePageDescription(UserPage userPage, Category category)
+    {
+        if (!string.IsNullOrEmpty(userPage.Bio))
+        {
+            var bio = userPage.Bio.Length > 150 ? userPage.Bio[..147] + "..." : userPage.Bio;
+            return $"{bio} Conheça mais sobre {userPage.DisplayName}, {category.Name.ToLower()}.";
+        }
+
+        var businessTypeText = userPage.BusinessType == "company" ? "empresa" : "profissional";
+        return $"Conheça {userPage.DisplayName}, {businessTypeText} especializado em {category.Name.ToLower()}. Acesse os links e entre em contato.";
+    }
+
+    public List<string> GenerateKeywords(UserPage userPage, Category category)
+    {
+        var keywords = new List<string>
+        {
+            userPage.DisplayName.ToLower(),
+            category.Name.ToLower(),
+            userPage.BusinessType == "company" ? "empresa" : "profissional"
+        };
+
+        // Add category SEO keywords
+        keywords.AddRange(category.SeoKeywords);
+
+        // Add business type specific keywords
+        if (userPage.BusinessType == "company")
+        {
+            keywords.AddRange(new[] { "empresa", "negócio", "serviços", "contato" });
+        }
+        else
+        {
+            keywords.AddRange(new[] { "profissional", "especialista", "consultor", "contato" });
+        }
+
+        // Add location-based keywords if available
+        keywords.AddRange(new[] { "brasil", "br", "online", "digital" });
+
+        return keywords.Distinct().ToList();
+    }
+
+    public string GenerateCanonicalUrl(UserPage userPage)
+    {
+        return $"{_baseUrl}/{userPage.Category}/{userPage.Slug}";
+    }
+}
\ No newline at end of file
diff --git a/src/BCards.Web/Services/ThemeService.cs b/src/BCards.Web/Services/ThemeService.cs
new file mode 100644
index 0000000..fd11302
--- /dev/null
+++ b/src/BCards.Web/Services/ThemeService.cs
@@ -0,0 +1,215 @@
+using BCards.Web.Models;
+using MongoDB.Driver;
+
+namespace BCards.Web.Services;
+
+public class ThemeService : IThemeService
+{
+    private readonly IMongoCollection<PageTheme> _themes;
+
+    public ThemeService(IMongoDatabase database)
+    {
+        _themes = database.GetCollection<PageTheme>("themes");
+    }
+
+    public async Task<List<PageTheme>> GetAvailableThemesAsync()
+    {
+        return await _themes.Find(x => x.IsActive).ToListAsync();
+    }
+
+    public async Task<PageTheme?> GetThemeByIdAsync(string themeId)
+    {
+        return await _themes.Find(x => x.Id == themeId && x.IsActive).FirstOrDefaultAsync();
+    }
+
+    public async Task<PageTheme?> GetThemeByNameAsync(string themeName)
+    {
+        var theme = await _themes.Find(x => x.Name.ToLower() == themeName.ToLower() && x.IsActive).FirstOrDefaultAsync();
+        return theme ?? GetDefaultTheme();
+    }
+
+    public Task<string> GenerateCustomCssAsync(PageTheme theme)
+    {
+        var css = $@"
+            :root {{
+                --primary-color: {theme.PrimaryColor};
+                --secondary-color: {theme.SecondaryColor};
+                --background-color: {theme.BackgroundColor};
+                --text-color: {theme.TextColor};
+            }}
+            
+            .user-page {{
+                background-color: var(--background-color);
+                color: var(--text-color);
+                {(!string.IsNullOrEmpty(theme.BackgroundImage) ? $"background-image: url('{theme.BackgroundImage}');" : "")}
+                background-size: cover;
+                background-position: center;
+                background-attachment: fixed;
+            }}
+            
+            .profile-card {{
+                background-color: rgba(255, 255, 255, 0.95);
+                backdrop-filter: blur(10px);
+                border-radius: 20px;
+                padding: 2rem;
+                box-shadow: 0 8px 32px rgba(0, 0, 0, 0.1);
+            }}
+            
+            .profile-image {{
+                width: 120px;
+                height: 120px;
+                border-radius: 50%;
+                border: 4px solid var(--primary-color);
+                object-fit: cover;
+            }}
+            
+            .profile-name {{
+                color: var(--primary-color);
+                font-size: 2rem;
+                font-weight: 600;
+                margin-bottom: 0.5rem;
+            }}
+            
+            .profile-bio {{
+                color: var(--text-color);
+                opacity: 0.8;
+                margin-bottom: 2rem;
+            }}
+            
+            .link-button {{
+                background-color: var(--primary-color);
+                color: white;
+                border: none;
+                padding: 1rem 2rem;
+                border-radius: 50px;
+                text-decoration: none;
+                display: block;
+                margin-bottom: 1rem;
+                text-align: center;
+                font-weight: 500;
+                transition: all 0.3s ease;
+                box-shadow: 0 4px 15px rgba(0, 0, 0, 0.1);
+            }}
+            
+            .link-button:hover {{
+                background-color: var(--secondary-color);
+                transform: translateY(-2px);
+                box-shadow: 0 6px 20px rgba(0, 0, 0, 0.15);
+                color: white;
+                text-decoration: none;
+            }}
+            
+            .link-title {{
+                font-size: 1.1rem;
+                margin-bottom: 0.25rem;
+            }}
+            
+            .link-description {{
+                font-size: 0.9rem;
+                opacity: 0.9;
+            }}
+            
+            @media (max-width: 768px) {{
+                .profile-card {{
+                    padding: 1.5rem;
+                    margin: 1rem;
+                }}
+                
+                .profile-image {{
+                    width: 100px;
+                    height: 100px;
+                }}
+                
+                .profile-name {{
+                    font-size: 1.75rem;
+                }}
+                
+                .link-button {{
+                    padding: 0.875rem 1.5rem;
+                }}
+            }}
+        ";
+
+        return Task.FromResult(css);
+    }
+
+    public async Task InitializeDefaultThemesAsync()
+    {
+        var existingThemes = await _themes.Find(x => x.IsActive).ToListAsync();
+        if (existingThemes.Any()) return;
+
+        var defaultThemes = new[]
+        {
+            new PageTheme
+            {
+                Name = "Minimalista",
+                PrimaryColor = "#2563eb",
+                SecondaryColor = "#1d4ed8",
+                BackgroundColor = "#ffffff",
+                TextColor = "#1f2937",
+                IsPremium = false,
+                CssTemplate = "minimal"
+            },
+            new PageTheme
+            {
+                Name = "Dark Mode",
+                PrimaryColor = "#10b981",
+                SecondaryColor = "#059669",
+                BackgroundColor = "#111827",
+                TextColor = "#f9fafb",
+                IsPremium = false,
+                CssTemplate = "dark"
+            },
+            new PageTheme
+            {
+                Name = "Natureza",
+                PrimaryColor = "#16a34a",
+                SecondaryColor = "#15803d",
+                BackgroundColor = "#f0fdf4",
+                TextColor = "#166534",
+                BackgroundImage = "/images/themes/nature-bg.jpg",
+                IsPremium = false,
+                CssTemplate = "nature"
+            },
+            new PageTheme
+            {
+                Name = "Corporativo",
+                PrimaryColor = "#1e40af",
+                SecondaryColor = "#1e3a8a",
+                BackgroundColor = "#f8fafc",
+                TextColor = "#0f172a",
+                IsPremium = false,
+                CssTemplate = "corporate"
+            },
+            new PageTheme
+            {
+                Name = "Vibrante",
+                PrimaryColor = "#dc2626",
+                SecondaryColor = "#b91c1c",
+                BackgroundColor = "#fef2f2",
+                TextColor = "#7f1d1d",
+                IsPremium = true,
+                CssTemplate = "vibrant"
+            }
+        };
+
+        foreach (var theme in defaultThemes)
+        {
+            await _themes.InsertOneAsync(theme);
+        }
+    }
+
+    public PageTheme GetDefaultTheme()
+    {
+        return new PageTheme
+        {
+            Name = "Padrão",
+            PrimaryColor = "#2563eb",
+            SecondaryColor = "#1d4ed8",
+            BackgroundColor = "#ffffff",
+            TextColor = "#1f2937",
+            IsPremium = false,
+            CssTemplate = "default"
+        };
+    }
+}
\ No newline at end of file
diff --git a/src/BCards.Web/Services/TrialExpirationService.cs b/src/BCards.Web/Services/TrialExpirationService.cs
new file mode 100644
index 0000000..04313df
--- /dev/null
+++ b/src/BCards.Web/Services/TrialExpirationService.cs
@@ -0,0 +1,178 @@
+using BCards.Web.Models;
+using BCards.Web.Repositories;
+using MongoDB.Driver;
+
+namespace BCards.Web.Services;
+
+public class TrialExpirationService : BackgroundService
+{
+    private readonly IServiceProvider _serviceProvider;
+    private readonly ILogger<TrialExpirationService> _logger;
+    private readonly TimeSpan _checkInterval = TimeSpan.FromHours(1); // Check every hour
+
+    public TrialExpirationService(
+        IServiceProvider serviceProvider,
+        ILogger<TrialExpirationService> logger)
+    {
+        _serviceProvider = serviceProvider;
+        _logger = logger;
+    }
+
+    protected override async Task ExecuteAsync(CancellationToken stoppingToken)
+    {
+        while (!stoppingToken.IsCancellationRequested)
+        {
+            try
+            {
+                await ProcessTrialExpirationsAsync();
+                await Task.Delay(_checkInterval, stoppingToken);
+            }
+            catch (Exception ex)
+            {
+                _logger.LogError(ex, "Error processing trial expirations");
+                await Task.Delay(TimeSpan.FromMinutes(5), stoppingToken); // Wait 5 minutes on error
+            }
+        }
+    }
+
+    private async Task ProcessTrialExpirationsAsync()
+    {
+        using var scope = _serviceProvider.CreateScope();
+        var subscriptionRepository = scope.ServiceProvider.GetRequiredService<ISubscriptionRepository>();
+        var userPageRepository = scope.ServiceProvider.GetRequiredService<IUserPageRepository>();
+        var userRepository = scope.ServiceProvider.GetRequiredService<IUserRepository>();
+
+        _logger.LogInformation("Checking for expired trials...");
+
+        // Get all active trial subscriptions
+        var trialSubscriptions = await subscriptionRepository.GetTrialSubscriptionsAsync();
+        var now = DateTime.UtcNow;
+
+        foreach (var subscription in trialSubscriptions)
+        {
+            try
+            {
+                var user = await userRepository.GetByIdAsync(subscription.UserId);
+                if (user == null) continue;
+
+                var daysUntilExpiration = (subscription.CurrentPeriodEnd - now).TotalDays;
+
+                if (daysUntilExpiration <= 0)
+                {
+                    // Trial expired - deactivate page
+                    _logger.LogInformation($"Trial expired for user {user.Email}");
+                    await HandleTrialExpiredAsync(user, subscription, userPageRepository);
+                }
+                else if (daysUntilExpiration <= 2 && !user.NotifiedOfExpiration)
+                {
+                    // Trial expiring soon - send notification
+                    _logger.LogInformation($"Trial expiring in {daysUntilExpiration:F1} days for user {user.Email}");
+                    await SendExpirationWarningAsync(user, subscription, daysUntilExpiration);
+                    
+                    // Mark as notified
+                    user.NotifiedOfExpiration = true;
+                    await userRepository.UpdateAsync(user);
+                }
+            }
+            catch (Exception ex)
+            {
+                _logger.LogError(ex, $"Error processing trial for subscription {subscription.Id}");
+            }
+        }
+
+        _logger.LogInformation("Finished checking trial expirations");
+    }
+
+    private async Task HandleTrialExpiredAsync(
+        User user, 
+        Subscription subscription, 
+        IUserPageRepository userPageRepository)
+    {
+        // Deactivate user page
+        var userPage = await userPageRepository.GetByUserIdAsync(user.Id);
+        if (userPage != null)
+        {
+            userPage.IsActive = false;
+            userPage.UpdatedAt = DateTime.UtcNow;
+            await userPageRepository.UpdateAsync(userPage);
+        }
+
+        // Update subscription status
+        subscription.Status = "expired";
+        subscription.UpdatedAt = DateTime.UtcNow;
+        
+        using var scope = _serviceProvider.CreateScope();
+        var subscriptionRepository = scope.ServiceProvider.GetRequiredService<ISubscriptionRepository>();
+        await subscriptionRepository.UpdateAsync(subscription);
+
+        // Send expiration email
+        await SendTrialExpiredEmailAsync(user);
+
+        _logger.LogInformation($"Deactivated trial page for user {user.Email}");
+    }
+
+    private async Task SendExpirationWarningAsync(
+        User user, 
+        Subscription subscription, 
+        double daysRemaining)
+    {
+        // TODO: Implement email service
+        // For now, just log
+        _logger.LogInformation($"Should send expiration warning to {user.Email} - {daysRemaining:F1} days remaining");
+        
+        // Example email content:
+        var subject = "Seu trial do BCards expira em breve!";
+        var message = $@"
+            Olá {user.Name},
+            
+            Seu trial gratuito do BCards expira em {Math.Ceiling(daysRemaining)} dia(s).
+            
+            Para continuar usando sua página de links, escolha um de nossos planos:
+            
+            • Básico - R$ 9,90/mês
+            • Profissional - R$ 24,90/mês  
+            • Premium - R$ 29,90/mês
+            
+            Acesse: {GetUpgradeUrl()}
+            
+            Equipe BCards
+        ";
+
+        // TODO: Send actual email when email service is implemented
+        await Task.CompletedTask;
+    }
+
+    private async Task SendTrialExpiredEmailAsync(User user)
+    {
+        // TODO: Implement email service
+        _logger.LogInformation($"Should send trial expired email to {user.Email}");
+        
+        var subject = "Seu trial do BCards expirou";
+        var message = $@"
+            Olá {user.Name},
+            
+            Seu trial gratuito do BCards expirou e sua página foi temporariamente desativada.
+            
+            Para reativar sua página, escolha um de nossos planos:
+            
+            • Básico - R$ 9,90/mês - 5 links, analytics básicos
+            • Profissional - R$ 24,90/mês - 15 links, todos os temas, analytics avançados
+            • Premium - R$ 29,90/mês - Links ilimitados, temas customizáveis, analytics completos
+            
+            Seus dados estão seguros e serão restaurados assim que você escolher um plano.
+            
+            Acesse: {GetUpgradeUrl()}
+            
+            Equipe BCards
+        ";
+
+        // TODO: Send actual email when email service is implemented
+        await Task.CompletedTask;
+    }
+
+    private string GetUpgradeUrl()
+    {
+        // TODO: Get from configuration
+        return "https://bcards.com.br/pricing";
+    }
+}
\ No newline at end of file
diff --git a/src/BCards.Web/Services/UserPageService.cs b/src/BCards.Web/Services/UserPageService.cs
new file mode 100644
index 0000000..7c375ee
--- /dev/null
+++ b/src/BCards.Web/Services/UserPageService.cs
@@ -0,0 +1,249 @@
+using BCards.Web.Models;
+using BCards.Web.Repositories;
+using System.Text.RegularExpressions;
+using System.Globalization;
+using System.Text;
+
+namespace BCards.Web.Services;
+
+public class UserPageService : IUserPageService
+{
+    private readonly IUserPageRepository _userPageRepository;
+    private readonly IUserRepository _userRepository;
+    private readonly ISubscriptionRepository _subscriptionRepository;
+
+    public UserPageService(
+        IUserPageRepository userPageRepository,
+        IUserRepository userRepository,
+        ISubscriptionRepository subscriptionRepository)
+    {
+        _userPageRepository = userPageRepository;
+        _userRepository = userRepository;
+        _subscriptionRepository = subscriptionRepository;
+    }
+
+    public async Task<UserPage?> GetPageAsync(string category, string slug)
+    {
+        return await _userPageRepository.GetBySlugAsync(category, slug);
+    }
+
+    public async Task<UserPage?> GetUserPageAsync(string userId)
+    {
+        return await _userPageRepository.GetByUserIdAsync(userId);
+    }
+
+    public async Task<UserPage?> GetPageByIdAsync(string id)
+    {
+        return await _userPageRepository.GetByIdAsync(id);
+    }
+
+    public async Task<List<UserPage>> GetUserPagesAsync(string userId)
+    {
+        return await _userPageRepository.GetByUserIdAllAsync(userId);
+    }
+
+    public async Task<List<UserPage>> GetActivePagesAsync()
+    {
+        return await _userPageRepository.GetActivePagesAsync();
+    }
+
+    public async Task<UserPage> CreatePageAsync(UserPage userPage)
+    {
+        userPage.Slug = await GenerateSlugAsync(userPage.Category, userPage.DisplayName);
+        return await _userPageRepository.CreateAsync(userPage);
+    }
+
+    public async Task<UserPage> UpdatePageAsync(UserPage userPage)
+    {
+        return await _userPageRepository.UpdateAsync(userPage);
+    }
+
+    public async Task DeletePageAsync(string id)
+    {
+        await _userPageRepository.DeleteAsync(id);
+    }
+
+    public async Task<bool> ValidateSlugAsync(string category, string slug, string? excludeId = null)
+    {
+        if (string.IsNullOrWhiteSpace(slug) || string.IsNullOrWhiteSpace(category))
+            return false;
+
+        if (!IsValidSlugFormat(slug))
+            return false;
+
+        return !await _userPageRepository.SlugExistsAsync(category, slug, excludeId);
+    }
+
+    public async Task<string> GenerateSlugAsync(string category, string name)
+    {
+        var slug = GenerateSlug(name);
+        var originalSlug = slug;
+        var counter = 1;
+
+        while (await _userPageRepository.SlugExistsAsync(category, slug))
+        {
+            slug = $"{originalSlug}-{counter}";
+            counter++;
+        }
+
+        return slug;
+    }
+
+    public async Task<bool> CanCreateLinksAsync(string userId, int newLinksCount = 1)
+    {
+        var userPage = await _userPageRepository.GetByUserIdAsync(userId);
+        if (userPage == null) return true; // New page
+
+        var subscription = await _subscriptionRepository.GetByUserIdAsync(userId);
+        var maxLinks = subscription?.MaxLinks ?? 5; // Default free plan
+
+        if (maxLinks == -1) return true; // Unlimited
+
+        var currentLinksCount = userPage.Links?.Count(l => l.IsActive) ?? 0;
+        return (currentLinksCount + newLinksCount) <= maxLinks;
+    }
+
+    public async Task RecordPageViewAsync(string pageId, string? referrer = null, string? userAgent = null)
+    {
+        var page = await _userPageRepository.GetByIdAsync(pageId);
+        if (page?.PlanLimitations.AllowAnalytics != true) return;
+
+        var analytics = page.Analytics;
+        analytics.TotalViews++;
+        analytics.LastViewedAt = DateTime.UtcNow;
+
+        // Monthly stats
+        var monthKey = DateTime.UtcNow.ToString("yyyy-MM");
+        if (analytics.MonthlyViews.ContainsKey(monthKey))
+            analytics.MonthlyViews[monthKey]++;
+        else
+            analytics.MonthlyViews[monthKey] = 1;
+
+        // Referrer stats
+        if (!string.IsNullOrEmpty(referrer))
+        {
+            var domain = ExtractDomain(referrer);
+            if (!string.IsNullOrEmpty(domain))
+            {
+                if (analytics.TopReferrers.ContainsKey(domain))
+                    analytics.TopReferrers[domain]++;
+                else
+                    analytics.TopReferrers[domain] = 1;
+            }
+        }
+
+        // Device stats (simplified)
+        if (!string.IsNullOrEmpty(userAgent))
+        {
+            var deviceType = GetDeviceType(userAgent);
+            if (analytics.DeviceStats.ContainsKey(deviceType))
+                analytics.DeviceStats[deviceType]++;
+            else
+                analytics.DeviceStats[deviceType] = 1;
+        }
+
+        await _userPageRepository.UpdateAnalyticsAsync(pageId, analytics);
+    }
+
+    public async Task RecordLinkClickAsync(string pageId, int linkIndex)
+    {
+        var page = await _userPageRepository.GetByIdAsync(pageId);
+        if (page?.PlanLimitations.AllowAnalytics != true) return;
+
+        if (linkIndex >= 0 && linkIndex < page.Links.Count)
+        {
+            page.Links[linkIndex].Clicks++;
+        }
+
+        var analytics = page.Analytics;
+        analytics.TotalClicks++;
+
+        // Monthly clicks
+        var monthKey = DateTime.UtcNow.ToString("yyyy-MM");
+        if (analytics.MonthlyClicks.ContainsKey(monthKey))
+            analytics.MonthlyClicks[monthKey]++;
+        else
+            analytics.MonthlyClicks[monthKey] = 1;
+
+        await _userPageRepository.UpdateAsync(page);
+    }
+
+    public async Task<List<UserPage>> GetRecentPagesAsync(int limit = 10)
+    {
+        return await _userPageRepository.GetRecentPagesAsync(limit);
+    }
+
+    public async Task<List<UserPage>> GetPagesByCategoryAsync(string category, int limit = 20)
+    {
+        return await _userPageRepository.GetByCategoryAsync(category, limit);
+    }
+
+    private static string GenerateSlug(string text)
+    {
+        if (string.IsNullOrWhiteSpace(text))
+            return string.Empty;
+
+        // Remove acentos
+        text = RemoveDiacritics(text);
+        
+        // Converter para minúsculas
+        text = text.ToLowerInvariant();
+        
+        // Substituir espaços e caracteres especiais por hífens
+        text = Regex.Replace(text, @"[^a-z0-9\s-]", "");
+        text = Regex.Replace(text, @"[\s-]+", "-");
+        
+        // Remover hífens do início e fim
+        text = text.Trim('-');
+        
+        return text;
+    }
+
+    private static string RemoveDiacritics(string text)
+    {
+        var normalizedString = text.Normalize(NormalizationForm.FormD);
+        var stringBuilder = new StringBuilder();
+
+        foreach (var c in normalizedString)
+        {
+            var unicodeCategory = CharUnicodeInfo.GetUnicodeCategory(c);
+            if (unicodeCategory != UnicodeCategory.NonSpacingMark)
+            {
+                stringBuilder.Append(c);
+            }
+        }
+
+        return stringBuilder.ToString().Normalize(NormalizationForm.FormC);
+    }
+
+    private static bool IsValidSlugFormat(string slug)
+    {
+        return Regex.IsMatch(slug, @"^[a-z0-9-]+$") && !slug.StartsWith('-') && !slug.EndsWith('-');
+    }
+
+    private static string ExtractDomain(string url)
+    {
+        try
+        {
+            var uri = new Uri(url);
+            return uri.Host;
+        }
+        catch
+        {
+            return string.Empty;
+        }
+    }
+
+    private static string GetDeviceType(string userAgent)
+    {
+        userAgent = userAgent.ToLowerInvariant();
+        
+        if (userAgent.Contains("mobile") || userAgent.Contains("android") || userAgent.Contains("iphone"))
+            return "mobile";
+        
+        if (userAgent.Contains("tablet") || userAgent.Contains("ipad"))
+            return "tablet";
+        
+        return "desktop";
+    }
+}
\ No newline at end of file
diff --git a/src/BCards.Web/ViewModels/CreatePageViewModel.cs b/src/BCards.Web/ViewModels/CreatePageViewModel.cs
new file mode 100644
index 0000000..510be65
--- /dev/null
+++ b/src/BCards.Web/ViewModels/CreatePageViewModel.cs
@@ -0,0 +1,54 @@
+using System.ComponentModel.DataAnnotations;
+
+namespace BCards.Web.ViewModels;
+
+public class CreatePageViewModel
+{
+    [Required(ErrorMessage = "Nome é obrigatório")]
+    [StringLength(50, ErrorMessage = "Nome deve ter no máximo 50 caracteres")]
+    public string DisplayName { get; set; } = string.Empty;
+
+    [Required(ErrorMessage = "Categoria é obrigatória")]
+    public string Category { get; set; } = string.Empty;
+
+    [Required(ErrorMessage = "Tipo de negócio é obrigatório")]
+    public string BusinessType { get; set; } = "individual";
+
+    [StringLength(200, ErrorMessage = "Bio deve ter no máximo 200 caracteres")]
+    public string Bio { get; set; } = string.Empty;
+
+    [Required(ErrorMessage = "Tema é obrigatório")]
+    public string SelectedTheme { get; set; } = "minimalist";
+
+    [Phone(ErrorMessage = "Número de WhatsApp inválido")]
+    public string WhatsAppNumber { get; set; } = string.Empty;
+
+    [Url(ErrorMessage = "URL do Facebook inválida")]
+    public string FacebookUrl { get; set; } = string.Empty;
+
+    [Url(ErrorMessage = "URL do X/Twitter inválida")]
+    public string TwitterUrl { get; set; } = string.Empty;
+
+    [Url(ErrorMessage = "URL do Instagram inválida")]
+    public string InstagramUrl { get; set; } = string.Empty;
+
+    public List<CreateLinkViewModel> Links { get; set; } = new();
+
+    public string Slug { get; set; } = string.Empty;
+}
+
+public class CreateLinkViewModel
+{
+    [Required(ErrorMessage = "Título é obrigatório")]
+    [StringLength(50, ErrorMessage = "Título deve ter no máximo 50 caracteres")]
+    public string Title { get; set; } = string.Empty;
+
+    [Required(ErrorMessage = "URL é obrigatória")]
+    [Url(ErrorMessage = "URL inválida")]
+    public string Url { get; set; } = string.Empty;
+
+    [StringLength(100, ErrorMessage = "Descrição deve ter no máximo 100 caracteres")]
+    public string Description { get; set; } = string.Empty;
+
+    public string Icon { get; set; } = string.Empty;
+}
\ No newline at end of file
diff --git a/src/BCards.Web/ViewModels/ManagePageViewModel.cs b/src/BCards.Web/ViewModels/ManagePageViewModel.cs
new file mode 100644
index 0000000..5710c3e
--- /dev/null
+++ b/src/BCards.Web/ViewModels/ManagePageViewModel.cs
@@ -0,0 +1,108 @@
+using System.ComponentModel.DataAnnotations;
+using BCards.Web.Models;
+
+namespace BCards.Web.ViewModels;
+
+public class ManagePageViewModel
+{
+    public string Id { get; set; } = string.Empty;
+    public bool IsNewPage { get; set; } = true;
+
+    [Required(ErrorMessage = "Nome é obrigatório")]
+    [StringLength(50, ErrorMessage = "Nome deve ter no máximo 50 caracteres")]
+    public string DisplayName { get; set; } = string.Empty;
+
+    [Required(ErrorMessage = "Categoria é obrigatória")]
+    public string Category { get; set; } = string.Empty;
+
+    [Required(ErrorMessage = "Tipo de negócio é obrigatório")]
+    public string BusinessType { get; set; } = "individual";
+
+    [StringLength(200, ErrorMessage = "Bio deve ter no máximo 200 caracteres")]
+    public string Bio { get; set; } = string.Empty;
+
+    public string Slug { get; set; } = string.Empty;
+
+    [Required(ErrorMessage = "Tema é obrigatório")]
+    public string SelectedTheme { get; set; } = "minimalist";
+
+    public string WhatsAppNumber { get; set; } = string.Empty;
+
+    public string FacebookUrl { get; set; } = string.Empty;
+
+    public string TwitterUrl { get; set; } = string.Empty;
+
+    public string InstagramUrl { get; set; } = string.Empty;
+
+    public List<ManageLinkViewModel> Links { get; set; } = new();
+    
+    // Data for dropdowns and selections
+    public List<Category> AvailableCategories { get; set; } = new();
+    public List<PageTheme> AvailableThemes { get; set; } = new();
+    
+    // Plan limitations
+    public int MaxLinksAllowed { get; set; } = 3;
+    public bool CanUseTheme(string themeName) => AvailableThemes.Any(t => t.Name.ToLower() == themeName.ToLower());
+}
+
+public class ManageLinkViewModel
+{
+    public string Id { get; set; } = "new";
+
+    [Required(ErrorMessage = "Título é obrigatório")]
+    [StringLength(50, ErrorMessage = "Título deve ter no máximo 50 caracteres")]
+    public string Title { get; set; } = string.Empty;
+
+    [Required(ErrorMessage = "URL é obrigatória")]
+    [Url(ErrorMessage = "URL inválida")]
+    public string Url { get; set; } = string.Empty;
+
+    [StringLength(100, ErrorMessage = "Descrição deve ter no máximo 100 caracteres")]
+    public string Description { get; set; } = string.Empty;
+
+    public string Icon { get; set; } = string.Empty;
+    public int Order { get; set; } = 0;
+    public bool IsActive { get; set; } = true;
+}
+
+public class DashboardViewModel
+{
+    public User CurrentUser { get; set; } = new();
+    public List<UserPageSummary> UserPages { get; set; } = new();
+    public PlanInfo CurrentPlan { get; set; } = new();
+    public bool CanCreateNewPage { get; set; } = false;
+    public int DaysRemaining { get; set; } = 0;
+}
+
+public class UserPageSummary
+{
+    public string Id { get; set; } = string.Empty;
+    public string DisplayName { get; set; } = string.Empty;
+    public string Slug { get; set; } = string.Empty;
+    public string Category { get; set; } = string.Empty;
+    public PageStatus Status { get; set; } = PageStatus.Active;
+    public int TotalClicks { get; set; } = 0;
+    public int TotalViews { get; set; } = 0;
+    public DateTime CreatedAt { get; set; } = DateTime.UtcNow;
+    public string PublicUrl => $"/page/{Category.ToLower()}/{Slug.ToLower()}";
+}
+
+public class PlanInfo
+{
+    public PlanType Type { get; set; } = PlanType.Trial;
+    public string Name { get; set; } = string.Empty;
+    public int MaxPages { get; set; } = 1;
+    public int MaxLinksPerPage { get; set; } = 3;
+    public int DurationDays { get; set; } = 7;
+    public decimal Price { get; set; } = 0;
+    public bool AllowsAnalytics { get; set; } = false;
+    public bool AllowsCustomThemes { get; set; } = false;
+}
+
+public enum PageStatus
+{
+    Active,         // Funcionando normalmente
+    Expired,        // Trial vencido -> 301 redirect
+    PendingPayment, // Pagamento atrasado -> aviso na página  
+    Inactive        // Pausada pelo usuário
+}
\ No newline at end of file
diff --git a/src/BCards.Web/Views/Admin/CreatePage.cshtml b/src/BCards.Web/Views/Admin/CreatePage.cshtml
new file mode 100644
index 0000000..bba9113
--- /dev/null
+++ b/src/BCards.Web/Views/Admin/CreatePage.cshtml
@@ -0,0 +1,610 @@
+@model BCards.Web.ViewModels.CreatePageViewModel
+@{
+    ViewData["Title"] = "Criar Página";
+    Layout = "_Layout";
+}
+
+<div class="container-fluid">
+    <div class="row">
+        <div class="col-12 col-lg-8 mx-auto">
+            <div class="card shadow-sm">
+                <div class="card-header bg-primary text-white">
+                    <h4 class="mb-0">
+                        <i class="fas fa-magic"></i>
+                        Criar Sua Página de Links
+                    </h4>
+                </div>
+                
+                <div class="card-body">
+                    <!-- Progress Bar -->
+                    <div class="progress mb-4" style="height: 8px;">
+                        <div class="progress-bar" role="progressbar" style="width: 20%" id="wizardProgress"></div>
+                    </div>
+                    
+                    <form asp-action="CreatePage" method="post" id="createPageForm">
+                        
+                        <!-- Step 1: Informações Básicas -->
+                        <div class="wizard-step" id="step1">
+                            <h5 class="step-title">
+                                <span class="step-number">1</span>
+                                Informações Básicas
+                            </h5>
+                            
+                            <div class="row">
+                                <div class="col-md-6">
+                                    <div class="mb-3">
+                                        <label asp-for="DisplayName" class="form-label">Nome da Página</label>
+                                        <input asp-for="DisplayName" class="form-control" placeholder="Ex: João Silva">
+                                        <span asp-validation-for="DisplayName" class="text-danger"></span>
+                                    </div>
+                                </div>
+                                
+                                <div class="col-md-6">
+                                    <div class="mb-3">
+                                        <label asp-for="Category" class="form-label">Categoria</label>
+                                        <select asp-for="Category" class="form-select">
+                                            <option value="">Selecione uma categoria</option>
+                                            @foreach (var category in ViewBag.Categories as List<BCards.Web.Models.Category> ?? new List<BCards.Web.Models.Category>())
+                                            {
+                                                <option value="@category.Name">@category.Name</option>
+                                            }
+                                        </select>
+                                        <span asp-validation-for="Category" class="text-danger"></span>
+                                    </div>
+                                </div>
+                            </div>
+                            
+                            <div class="row">
+                                <div class="col-md-6">
+                                    <div class="mb-3">
+                                        <label asp-for="BusinessType" class="form-label">Tipo</label>
+                                        <select asp-for="BusinessType" class="form-select">
+                                            <option value="individual">Pessoa Física</option>
+                                            <option value="company">Empresa</option>
+                                        </select>
+                                    </div>
+                                </div>
+                                
+                                <div class="col-md-6">
+                                    <div class="mb-3">
+                                        <label for="slugPreview" class="form-label">URL da Página</label>
+                                        <div class="input-group">
+                                            <span class="input-group-text">page/</span>
+                                            <span class="input-group-text" id="categorySlug">categoria</span>
+                                            <span class="input-group-text">/</span>
+                                            <input type="text" class="form-control" id="slugPreview" readonly>
+                                            <input asp-for="Slug" type="hidden">
+                                        </div>
+                                        <small class="form-text text-muted">URL gerada automaticamente</small>
+                                    </div>
+                                </div>
+                            </div>
+                            
+                            <div class="mb-3">
+                                <label asp-for="Bio" class="form-label">Bio/Descrição</label>
+                                <textarea asp-for="Bio" class="form-control" rows="3" placeholder="Uma breve descrição sobre você ou sua empresa..."></textarea>
+                                <span asp-validation-for="Bio" class="text-danger"></span>
+                            </div>
+                        </div>
+                        
+                        <!-- Step 2: Seleção de Tema -->
+                        <div class="wizard-step d-none" id="step2">
+                            <h5 class="step-title">
+                                <span class="step-number">2</span>
+                                Escolha Seu Tema Visual
+                            </h5>
+                            
+                            <div class="row">
+                                @foreach (var theme in ViewBag.Themes as List<BCards.Web.Models.PageTheme> ?? new List<BCards.Web.Models.PageTheme>())
+                                {
+                                    <div class="col-md-4 mb-3">
+                                        <div class="theme-card" data-theme="@theme.Name.ToLower()">
+                                            <div class="theme-preview" style="background: @theme.BackgroundColor; color: @theme.TextColor;">
+                                                <div class="theme-header" style="background-color: @theme.PrimaryColor;">
+                                                    <div class="theme-avatar"></div>
+                                                    <h6>@theme.Name</h6>
+                                                </div>
+                                                <div class="theme-links">
+                                                    <div class="theme-link" style="background-color: @theme.PrimaryColor;"></div>
+                                                    <div class="theme-link" style="background-color: @theme.SecondaryColor;"></div>
+                                                </div>
+                                            </div>
+                                            <div class="theme-name">
+                                                @theme.Name
+                                                @if (theme.IsPremium)
+                                                {
+                                                    <span class="badge bg-warning">Premium</span>
+                                                }
+                                            </div>
+                                        </div>
+                                    </div>
+                                }
+                            </div>
+                            
+                            <input asp-for="SelectedTheme" type="hidden">
+                        </div>
+                        
+                        <!-- Step 3: Links Principais -->
+                        <div class="wizard-step d-none" id="step3">
+                            <h5 class="step-title">
+                                <span class="step-number">3</span>
+                                Links Principais
+                            </h5>
+                            
+                            <div id="linksContainer">
+                                <!-- Links will be added dynamically -->
+                            </div>
+                            
+                            <button type="button" class="btn btn-outline-primary" id="addLinkBtn">
+                                <i class="fas fa-plus"></i> Adicionar Link
+                            </button>
+                        </div>
+                        
+                        <!-- Step 4: Redes Sociais -->
+                        <div class="wizard-step d-none" id="step4">
+                            <h5 class="step-title">
+                                <span class="step-number">4</span>
+                                Redes Sociais
+                            </h5>
+                            
+                            <div class="row">
+                                <div class="col-md-6">
+                                    <div class="mb-3">
+                                        <label asp-for="WhatsAppNumber" class="form-label">
+                                            <i class="fab fa-whatsapp text-success"></i>
+                                            WhatsApp
+                                        </label>
+                                        <input asp-for="WhatsAppNumber" class="form-control" placeholder="+55 11 99999-9999">
+                                        <span asp-validation-for="WhatsAppNumber" class="text-danger"></span>
+                                    </div>
+                                </div>
+                                
+                                <div class="col-md-6">
+                                    <div class="mb-3">
+                                        <label asp-for="FacebookUrl" class="form-label">
+                                            <i class="fab fa-facebook text-primary"></i>
+                                            Facebook
+                                        </label>
+                                        <input asp-for="FacebookUrl" class="form-control" placeholder="https://facebook.com/seu-perfil">
+                                        <span asp-validation-for="FacebookUrl" class="text-danger"></span>
+                                    </div>
+                                </div>
+                            </div>
+                            
+                            <div class="row">
+                                <div class="col-md-6">
+                                    <div class="mb-3">
+                                        <label asp-for="TwitterUrl" class="form-label">
+                                            <i class="fab fa-x-twitter"></i>
+                                            X / Twitter
+                                        </label>
+                                        <input asp-for="TwitterUrl" class="form-control" placeholder="https://x.com/seu-perfil">
+                                        <span asp-validation-for="TwitterUrl" class="text-danger"></span>
+                                    </div>
+                                </div>
+                                
+                                <div class="col-md-6">
+                                    <div class="mb-3">
+                                        <label asp-for="InstagramUrl" class="form-label">
+                                            <i class="fab fa-instagram text-danger"></i>
+                                            Instagram
+                                        </label>
+                                        <input asp-for="InstagramUrl" class="form-control" placeholder="https://instagram.com/seu-perfil">
+                                        <span asp-validation-for="InstagramUrl" class="text-danger"></span>
+                                    </div>
+                                </div>
+                            </div>
+                        </div>
+                        
+                        <!-- Step 5: Preview e Finalização -->
+                        <div class="wizard-step d-none" id="step5">
+                            <h5 class="step-title">
+                                <span class="step-number">5</span>
+                                Preview e Finalização
+                            </h5>
+                            
+                            <div class="preview-container">
+                                <div class="preview-phone">
+                                    <div class="preview-screen" id="previewScreen">
+                                        <!-- Preview will be generated here -->
+                                    </div>
+                                </div>
+                            </div>
+                            
+                            <div class="text-center mt-4">
+                                <p class="text-muted">Sua página estará disponível em:</p>
+                                <strong id="finalUrl">page/categoria/seu-slug</strong>
+                            </div>
+                        </div>
+                        
+                        <!-- Navigation Buttons -->
+                        <div class="wizard-navigation mt-4">
+                            <button type="button" class="btn btn-secondary" id="prevBtn" style="display: none;">
+                                <i class="fas fa-arrow-left"></i> Anterior
+                            </button>
+                            
+                            <button type="button" class="btn btn-primary float-end" id="nextBtn">
+                                Próximo <i class="fas fa-arrow-right"></i>
+                            </button>
+                            
+                            <button type="submit" class="btn btn-success float-end d-none" id="submitBtn">
+                                <i class="fas fa-check"></i> Criar Página
+                            </button>
+                        </div>
+                    </form>
+                </div>
+            </div>
+        </div>
+    </div>
+</div>
+
+<style>
+.wizard-step {
+    min-height: 400px;
+}
+
+.step-title {
+    color: #495057;
+    margin-bottom: 2rem;
+    padding-bottom: 1rem;
+    border-bottom: 2px solid #e9ecef;
+}
+
+.step-number {
+    display: inline-block;
+    width: 30px;
+    height: 30px;
+    line-height: 30px;
+    background-color: #007bff;
+    color: white;
+    border-radius: 50%;
+    text-align: center;
+    margin-right: 0.5rem;
+    font-size: 0.875rem;
+    font-weight: 600;
+}
+
+.theme-card {
+    cursor: pointer;
+    border: 2px solid transparent;
+    border-radius: 8px;
+    overflow: hidden;
+    transition: all 0.3s ease;
+}
+
+.theme-card:hover,
+.theme-card.selected {
+    border-color: #007bff;
+    box-shadow: 0 4px 12px rgba(0, 123, 255, 0.3);
+}
+
+.theme-preview {
+    height: 120px;
+    position: relative;
+    padding: 1rem;
+}
+
+.theme-header {
+    display: flex;
+    align-items: center;
+    gap: 0.5rem;
+    padding: 0.5rem;
+    border-radius: 4px;
+    margin-bottom: 1rem;
+}
+
+.theme-avatar {
+    width: 20px;
+    height: 20px;
+    border-radius: 50%;
+    background-color: rgba(255, 255, 255, 0.3);
+}
+
+.theme-header h6 {
+    margin: 0;
+    font-size: 0.75rem;
+    color: white;
+}
+
+.theme-links {
+    display: flex;
+    flex-direction: column;
+    gap: 0.5rem;
+}
+
+.theme-link {
+    height: 8px;
+    border-radius: 4px;
+    opacity: 0.8;
+}
+
+.theme-name {
+    padding: 0.75rem;
+    text-align: center;
+    font-weight: 500;
+    background-color: #f8f9fa;
+}
+
+.link-input-group {
+    background-color: #f8f9fa;
+    border: 1px solid #dee2e6;
+    border-radius: 8px;
+    padding: 1rem;
+    margin-bottom: 1rem;
+}
+
+.preview-container {
+    display: flex;
+    justify-content: center;
+    align-items: center;
+    min-height: 300px;
+}
+
+.preview-phone {
+    width: 300px;
+    height: 400px;
+    border: 8px solid #333;
+    border-radius: 20px;
+    background-color: #000;
+    padding: 20px 10px;
+    position: relative;
+}
+
+.preview-screen {
+    width: 100%;
+    height: 100%;
+    background-color: #fff;
+    border-radius: 12px;
+    overflow-y: auto;
+    padding: 1rem;
+}
+
+.wizard-navigation {
+    border-top: 1px solid #dee2e6;
+    padding-top: 1rem;
+}
+</style>
+
+<script>
+let currentStep = 1;
+const totalSteps = 5;
+let linkCount = 0;
+
+$(document).ready(function() {
+    initializeWizard();
+    
+    // Generate slug when name or category changes
+    $('#DisplayName, #Category').on('input change', function() {
+        generateSlug();
+    });
+    
+    // Theme selection
+    $('.theme-card').on('click', function() {
+        $('.theme-card').removeClass('selected');
+        $(this).addClass('selected');
+        const themeName = $(this).data('theme');
+        $('#SelectedTheme').val(themeName);
+    });
+    
+    // Navigation
+    $('#nextBtn').on('click', function() {
+        if (validateCurrentStep()) {
+            nextStep();
+        }
+    });
+    
+    $('#prevBtn').on('click', function() {
+        prevStep();
+    });
+    
+    // Add link functionality
+    $('#addLinkBtn').on('click', function() {
+        addLinkInput();
+    });
+    
+    // Form submission
+    $('#createPageForm').on('submit', function(e) {
+        generateLinksData();
+    });
+});
+
+function initializeWizard() {
+    updateProgressBar();
+    updateNavigationButtons();
+    addLinkInput(); // Add first link input
+}
+
+function nextStep() {
+    if (currentStep < totalSteps) {
+        $(`#step${currentStep}`).addClass('d-none');
+        currentStep++;
+        $(`#step${currentStep}`).removeClass('d-none');
+        
+        if (currentStep === 5) {
+            generatePreview();
+        }
+        
+        updateProgressBar();
+        updateNavigationButtons();
+    }
+}
+
+function prevStep() {
+    if (currentStep > 1) {
+        $(`#step${currentStep}`).addClass('d-none');
+        currentStep--;
+        $(`#step${currentStep}`).removeClass('d-none');
+        updateProgressBar();
+        updateNavigationButtons();
+    }
+}
+
+function updateProgressBar() {
+    const progress = (currentStep / totalSteps) * 100;
+    $('#wizardProgress').css('width', progress + '%');
+}
+
+function updateNavigationButtons() {
+    $('#prevBtn').toggle(currentStep > 1);
+    
+    if (currentStep === totalSteps) {
+        $('#nextBtn').addClass('d-none');
+        $('#submitBtn').removeClass('d-none');
+    } else {
+        $('#nextBtn').removeClass('d-none');
+        $('#submitBtn').addClass('d-none');
+    }
+}
+
+function validateCurrentStep() {
+    let isValid = true;
+    
+    switch (currentStep) {
+        case 1:
+            if (!$('#DisplayName').val() || !$('#Category').val()) {
+                alert('Por favor, preencha o nome e a categoria.');
+                isValid = false;
+            }
+            break;
+        case 2:
+            if (!$('#SelectedTheme').val()) {
+                alert('Por favor, selecione um tema.');
+                isValid = false;
+            }
+            break;
+    }
+    
+    return isValid;
+}
+
+function generateSlug() {
+    const name = $('#DisplayName').val();
+    const category = $('#Category').val();
+    
+    if (name && category) {
+        $.post('/Admin/GenerateSlug', { category: category, name: name })
+            .done(function(data) {
+                $('#Slug').val(data.slug);
+                $('#slugPreview').val(data.slug);
+                $('#categorySlug').text(category);
+                $('#finalUrl').text(`page/${category}/${data.slug}`);
+            });
+    }
+}
+
+function addLinkInput() {
+    linkCount++;
+    const linkHtml = `
+        <div class="link-input-group" data-link="${linkCount}">
+            <div class="d-flex justify-content-between align-items-center mb-2">
+                <h6 class="mb-0">Link ${linkCount}</h6>
+                <button type="button" class="btn btn-sm btn-outline-danger remove-link-btn">
+                    <i class="fas fa-trash"></i>
+                </button>
+            </div>
+            <div class="row">
+                <div class="col-md-6">
+                    <div class="mb-2">
+                        <label class="form-label">Título</label>
+                        <input type="text" class="form-control link-title" placeholder="Ex: Meu Site">
+                    </div>
+                </div>
+                <div class="col-md-6">
+                    <div class="mb-2">
+                        <label class="form-label">URL</label>
+                        <input type="url" class="form-control link-url" placeholder="https://exemplo.com">
+                    </div>
+                </div>
+            </div>
+            <div class="mb-2">
+                <label class="form-label">Descrição (opcional)</label>
+                <input type="text" class="form-control link-description" placeholder="Breve descrição do link">
+            </div>
+        </div>
+    `;
+    
+    $('#linksContainer').append(linkHtml);
+    
+    // Add remove functionality
+    $('.remove-link-btn').off('click').on('click', function() {
+        $(this).closest('.link-input-group').remove();
+    });
+}
+
+function generateLinksData() {
+    const links = [];
+    $('.link-input-group').each(function() {
+        const title = $(this).find('.link-title').val();
+        const url = $(this).find('.link-url').val();
+        const description = $(this).find('.link-description').val();
+        
+        if (title && url) {
+            links.push({
+                Title: title,
+                Url: url,
+                Description: description,
+                Icon: ''
+            });
+        }
+    });
+    
+    // Create hidden inputs for links
+    $('#linksContainer').append('<div id="linksData"></div>');
+    $('#linksData').empty();
+    
+    links.forEach((link, index) => {
+        $('#linksData').append(`
+            <input type="hidden" name="Links[${index}].Title" value="${link.Title}" />
+            <input type="hidden" name="Links[${index}].Url" value="${link.Url}" />
+            <input type="hidden" name="Links[${index}].Description" value="${link.Description}" />
+            <input type="hidden" name="Links[${index}].Icon" value="${link.Icon}" />
+        `);
+    });
+}
+
+function generatePreview() {
+    const name = $('#DisplayName').val();
+    const bio = $('#Bio').val();
+    const selectedTheme = $('#SelectedTheme').val();
+    
+    let previewHtml = `
+        <div class="text-center">
+            <div class="mb-3">
+                <div style="width: 60px; height: 60px; background-color: #ddd; border-radius: 50%; margin: 0 auto;"></div>
+            </div>
+            <h5 class="mb-2">${name}</h5>
+            <p class="text-muted small mb-3">${bio}</p>
+            <div class="d-grid gap-2">
+    `;
+    
+    // Add links preview
+    $('.link-input-group').each(function() {
+        const title = $(this).find('.link-title').val();
+        if (title) {
+            previewHtml += `<div class="btn btn-primary btn-sm">${title}</div>`;
+        }
+    });
+    
+    // Add social media preview
+    if ($('#WhatsAppNumber').val()) {
+        previewHtml += `<div class="btn btn-success btn-sm"><i class="fab fa-whatsapp"></i> WhatsApp</div>`;
+    }
+    if ($('#FacebookUrl').val()) {
+        previewHtml += `<div class="btn btn-primary btn-sm"><i class="fab fa-facebook"></i> Facebook</div>`;
+    }
+    if ($('#TwitterUrl').val()) {
+        previewHtml += `<div class="btn btn-dark btn-sm"><i class="fab fa-x-twitter"></i> X / Twitter</div>`;
+    }
+    if ($('#InstagramUrl').val()) {
+        previewHtml += `<div class="btn btn-danger btn-sm"><i class="fab fa-instagram"></i> Instagram</div>`;
+    }
+    
+    previewHtml += `</div></div>`;
+    
+    $('#previewScreen').html(previewHtml);
+}
+</script>
+
+@section Scripts {
+    @{await Html.RenderPartialAsync("_ValidationScriptsPartial");}
+}
\ No newline at end of file
diff --git a/src/BCards.Web/Views/Admin/Dashboard.cshtml b/src/BCards.Web/Views/Admin/Dashboard.cshtml
new file mode 100644
index 0000000..1b2b3a8
--- /dev/null
+++ b/src/BCards.Web/Views/Admin/Dashboard.cshtml
@@ -0,0 +1,304 @@
+@model BCards.Web.ViewModels.DashboardViewModel
+@{
+    ViewData["Title"] = "Dashboard - BCards";
+    Layout = "_Layout";
+}
+
+<div class="container py-4">
+    <div class="row">
+        <div class="col-md-8">
+            <div class="d-flex justify-content-between align-items-center mb-4">
+                <div>
+                    <h1>Olá, @Model.CurrentUser.Name!</h1>
+                    <p class="text-muted mb-0">Gerencie suas páginas profissionais</p>
+                </div>
+                <div>
+                    @if (!string.IsNullOrEmpty(Model.CurrentUser.ProfileImage))
+                    {
+                        <img src="@Model.CurrentUser.ProfileImage" alt="@Model.CurrentUser.Name" 
+                             class="rounded-circle" style="width: 60px; height: 60px; object-fit: cover;">
+                    }
+                </div>
+            </div>
+
+            <!-- Lista de Páginas -->
+            <div class="row">
+                @foreach (var page in Model.UserPages)
+                {
+                    <div class="col-md-6 col-lg-4 mb-3">
+                        <div class="card h-100 @(page.Status == BCards.Web.ViewModels.PageStatus.Active ? "" : "border-warning")">
+                            <div class="card-body">
+                                <h6 class="card-title">@(page.DisplayName)</h6>
+                                <p class="text-muted small mb-2">@(page.Category)/@(page.Slug)</p>
+                                
+                                <div class="mb-2">
+                                    @switch (page.Status)
+                                    {
+                                        case BCards.Web.ViewModels.PageStatus.Active:
+                                            <span class="badge bg-success">Ativa</span>
+                                            break;
+                                        case BCards.Web.ViewModels.PageStatus.Expired:
+                                            <span class="badge bg-danger">Expirada</span>
+                                            break;
+                                        case BCards.Web.ViewModels.PageStatus.PendingPayment:
+                                            <span class="badge bg-warning">Pagamento Pendente</span>
+                                            break;
+                                        case BCards.Web.ViewModels.PageStatus.Inactive:
+                                            <span class="badge bg-secondary">Inativa</span>
+                                            break;
+                                    }
+                                </div>
+
+                                @if (Model.CurrentPlan.AllowsAnalytics)
+                                {
+                                    <div class="row text-center small mb-3">
+                                        <div class="col-6">
+                                            <div class="text-primary fw-bold">@(page.TotalViews)</div>
+                                            <div class="text-muted">Visualizações</div>
+                                        </div>
+                                        <div class="col-6">
+                                            <div class="text-success fw-bold">@(page.TotalClicks)</div>
+                                            <div class="text-muted">Cliques</div>
+                                        </div>
+                                    </div>
+                                }
+                                
+                                <div class="d-flex gap-1 flex-wrap">
+                                    <a href="@Url.Action("ManagePage", new { id = page.Id })" 
+                                       class="btn btn-sm btn-outline-primary flex-fill">Editar</a>
+                                    <a href="@(page.PublicUrl)" target="_blank" 
+                                       class="btn btn-sm btn-outline-success flex-fill">Ver</a>
+                                </div>
+                            </div>
+                            <div class="card-footer bg-transparent">
+                                <small class="text-muted">Criada em @(page.CreatedAt.ToString("dd/MM/yyyy"))</small>
+                            </div>
+                        </div>
+                    </div>
+                }
+                
+                <!-- Card para Criar Nova Página -->
+                @if (Model.CanCreateNewPage)
+                {
+                    <div class="col-md-6 col-lg-4 mb-3">
+                        <div class="card h-100 border-dashed text-center" style="border: 2px dashed #dee2e6;">
+                            <div class="card-body d-flex align-items-center justify-content-center">
+                                <div>
+                                    <i class="fas fa-plus fa-2x text-muted mb-3"></i>
+                                    <h6 class="text-muted">Criar Nova Página</h6>
+                                    <a href="@Url.Action("ManagePage", new { id = "new" })" 
+                                       class="btn btn-primary">Começar</a>
+                                </div>
+                            </div>
+                        </div>
+                    </div>
+                }
+                else if (!Model.UserPages.Any())
+                {
+                    <!-- Primeira Página -->
+                    <div class="col-12">
+                        <div class="card border-primary">
+                            <div class="card-body text-center p-5">
+                                <div class="mb-4">
+                                    <i class="display-1 text-primary">🚀</i>
+                                </div>
+                                <h3>Crie sua primeira página!</h3>
+                                <p class="text-muted mb-4">
+                                    Comece criando sua página profissional personalizada com seus links organizados.
+                                </p>
+                                <a href="@Url.Action("ManagePage", new { id = "new" })" class="btn btn-primary btn-lg">
+                                    Criar Minha Página
+                                </a>
+                            </div>
+                        </div>
+                    </div>
+                }
+                else
+                {
+                    <!-- Limite atingido -->
+                    <div class="col-12">
+                        <div class="alert alert-warning d-flex align-items-center">
+                            <i class="fas fa-exclamation-triangle me-3"></i>
+                            <div>
+                                <strong>Limite atingido!</strong> 
+                                Você já criou o máximo de @Model.CurrentPlan.MaxPages página(s) para seu plano atual.
+                                <a href="@Url.Action("Pricing", "Home")" class="alert-link ms-2">Fazer upgrade</a>
+                            </div>
+                        </div>
+                    </div>
+                }
+            </div>
+        </div>
+
+        <div class="col-md-4">
+            <!-- Plano Atual -->
+            <div class="card mb-4 @(Model.CurrentPlan.Type == BCards.Web.Models.PlanType.Trial ? "border-warning" : "")">
+                <div class="card-header @(Model.CurrentPlan.Type == BCards.Web.Models.PlanType.Trial ? "bg-warning" : "bg-primary") text-white">
+                    <h6 class="mb-0">
+                        <i class="fas fa-crown me-2"></i>
+                        Plano Atual
+                    </h6>
+                </div>
+                <div class="card-body">
+                    <h5 class="text-capitalize mb-1">@Model.CurrentPlan.Name</h5>
+                    
+                    @if (Model.CurrentPlan.Type == BCards.Web.Models.PlanType.Trial)
+                    {
+                        <p class="text-warning mb-2">
+                            <i class="fas fa-clock me-1"></i>
+                            @Model.DaysRemaining dia(s) restante(s)
+                        </p>
+                    }
+                    else
+                    {
+                        <p class="text-muted small mb-2">R$ @Model.CurrentPlan.Price.ToString("F2")/mês</p>
+                    }
+                    
+                    <div class="mb-3">
+                        <div class="d-flex justify-content-between small mb-1">
+                            <span>Páginas</span>
+                            <span>@Model.UserPages.Count/@Model.CurrentPlan.MaxPages</span>
+                        </div>
+                        <div class="progress" style="height: 6px;">
+                            @{
+                                var pagesPercentage = Model.CurrentPlan.MaxPages > 0 ? 
+                                    (double)Model.UserPages.Count / Model.CurrentPlan.MaxPages * 100 : 0;
+                            }
+                            <div class="progress-bar @(pagesPercentage >= 80 ? "bg-warning" : "bg-primary")" 
+                                 style="width: @pagesPercentage%"></div>
+                        </div>
+                    </div>
+                    
+                    <div class="small mb-2">
+                        <i class="fas fa-link me-2"></i>
+                        Links por página: @(Model.CurrentPlan.MaxLinksPerPage == int.MaxValue ? "Ilimitado" : Model.CurrentPlan.MaxLinksPerPage.ToString())
+                    </div>
+                    <div class="small mb-2">
+                        <i class="fas fa-chart-bar me-2"></i>
+                        Analytics: @(Model.CurrentPlan.AllowsAnalytics ? "✅" : "❌")
+                    </div>
+                    <div class="small mb-3">
+                        <i class="fas fa-palette me-2"></i>
+                        Temas customizáveis: @(Model.CurrentPlan.AllowsCustomThemes ? "✅" : "❌")
+                    </div>
+                    
+                    @if (Model.CurrentPlan.Type == BCards.Web.Models.PlanType.Trial)
+                    {
+                        <a href="@Url.Action("Pricing", "Home")" class="btn btn-warning w-100">
+                            <i class="fas fa-rocket me-2"></i>
+                            Fazer Upgrade
+                        </a>
+                    }
+                    else
+                    {
+                        <a href="@Url.Action("ManageSubscription", "Payment")" class="btn btn-outline-secondary w-100">
+                            <i class="fas fa-cog me-2"></i>
+                            Gerenciar Assinatura
+                        </a>
+                    }
+                </div>
+            </div>
+
+            <!-- Estatísticas Rápidas -->
+            @if (Model.CurrentPlan.AllowsAnalytics && Model.UserPages.Any())
+            {
+                <div class="card mb-4">
+                    <div class="card-header">
+                        <h6 class="mb-0">
+                            <i class="fas fa-chart-line me-2"></i>
+                            Estatísticas Gerais
+                        </h6>
+                    </div>
+                    <div class="card-body">
+                        <div class="row text-center">
+                            <div class="col-6">
+                                <div class="h4 text-primary mb-0">@Model.UserPages.Sum(p => p.TotalViews)</div>
+                                <small class="text-muted">Total de Visualizações</small>
+                            </div>
+                            <div class="col-6">
+                                <div class="h4 text-success mb-0">@Model.UserPages.Sum(p => p.TotalClicks)</div>
+                                <small class="text-muted">Total de Cliques</small>
+                            </div>
+                        </div>
+                        @if (Model.UserPages.Sum(p => p.TotalViews) > 0)
+                        {
+                            <hr class="my-3">
+                            <div class="text-center">
+                                <div class="h5 text-info mb-0">
+                                    @((Model.UserPages.Sum(p => p.TotalClicks) * 100.0 / Model.UserPages.Sum(p => p.TotalViews)).ToString("F1"))%
+                                </div>
+                                <small class="text-muted">Taxa de Cliques</small>
+                            </div>
+                        }
+                    </div>
+                </div>
+            }
+
+            <!-- Dicas -->
+            <div class="card">
+                <div class="card-header">
+                    <h6 class="mb-0">
+                        <i class="fas fa-lightbulb me-2"></i>
+                        💡 Dicas
+                    </h6>
+                </div>
+                <div class="card-body">
+                    <ul class="list-unstyled small mb-0">
+                        <li class="mb-2">
+                            <i class="fas fa-check text-success me-2"></i>
+                            Use uma bio clara e objetiva
+                        </li>
+                        <li class="mb-2">
+                            <i class="fas fa-check text-success me-2"></i>
+                            Organize seus links por importância
+                        </li>
+                        <li class="mb-2">
+                            <i class="fas fa-check text-success me-2"></i>
+                            Escolha URLs fáceis de lembrar
+                        </li>
+                        <li class="mb-2">
+                            <i class="fas fa-check text-success me-2"></i>
+                            Atualize regularmente seus links
+                        </li>
+                        <li class="mb-0">
+                            <i class="fas fa-check text-success me-2"></i>
+                            Monitore suas estatísticas
+                        </li>
+                    </ul>
+                </div>
+            </div>
+        </div>
+    </div>
+</div>
+
+@if (TempData["Success"] != null)
+{
+    <div class="toast-container position-fixed top-0 end-0 p-3">
+        <div class="toast show" role="alert">
+            <div class="toast-header">
+                <i class="fas fa-check-circle text-success me-2"></i>
+                <strong class="me-auto">Sucesso</strong>
+                <button type="button" class="btn-close" data-bs-dismiss="toast"></button>
+            </div>
+            <div class="toast-body">
+                @TempData["Success"]
+            </div>
+        </div>
+    </div>
+}
+
+@if (TempData["Error"] != null)
+{
+    <div class="toast-container position-fixed top-0 end-0 p-3">
+        <div class="toast show" role="alert">
+            <div class="toast-header">
+                <i class="fas fa-exclamation-triangle text-warning me-2"></i>
+                <strong class="me-auto">Atenção</strong>
+                <button type="button" class="btn-close" data-bs-dismiss="toast"></button>
+            </div>
+            <div class="toast-body">
+                @TempData["Error"]
+            </div>
+        </div>
+    </div>
+}
\ No newline at end of file
diff --git a/src/BCards.Web/Views/Admin/ManagePage.cshtml b/src/BCards.Web/Views/Admin/ManagePage.cshtml
new file mode 100644
index 0000000..690f6f3
--- /dev/null
+++ b/src/BCards.Web/Views/Admin/ManagePage.cshtml
@@ -0,0 +1,716 @@
+@model BCards.Web.ViewModels.ManagePageViewModel
+@{
+    ViewData["Title"] = Model.IsNewPage ? "Criar Página" : "Editar Página";
+    Layout = "_Layout";
+}
+
+<div class="container-fluid">
+    <div class="row">
+        <div class="col-12 col-lg-8 mx-auto">
+            <div class="card shadow-sm">
+                <div class="card-header bg-primary text-white">
+                    <h4 class="mb-0">
+                        <i class="fas fa-@(Model.IsNewPage ? "plus" : "edit")"></i>
+                        @(Model.IsNewPage ? "Assistente de Criação de Página" : "Editar Página")
+                    </h4>
+                </div>
+
+                <div class="card-body">
+                    <form asp-action="ManagePage" method="post" id="managePageForm" novalidate>
+                        <input asp-for="Id" type="hidden">
+                        <input asp-for="IsNewPage" type="hidden">
+
+                        <!-- Progress Bar -->
+                        @if (Model.IsNewPage)
+                        {
+                            <div class="mb-4">
+                                <div class="progress" style="height: 6px;">
+                                    <div class="progress-bar" role="progressbar" style="width: 25%" aria-valuenow="25" aria-valuemin="0" aria-valuemax="100"></div>
+                                </div>
+                                <div class="d-flex justify-content-between mt-2">
+                                    <small class="text-muted">Passo 1 de 4</small>
+                                    <small class="text-muted">Informações Básicas</small>
+                                </div>
+                            </div>
+                        }
+
+                        <!-- Accordion -->
+                        <div class="accordion" id="pageWizard">
+
+                            <!-- Passo 1: Informações Básicas -->
+                            <div class="accordion-item">
+                                <h2 class="accordion-header" id="headingBasic">
+                                    <button class="accordion-button" type="button" data-bs-toggle="collapse" data-bs-target="#collapseBasic" aria-expanded="true" aria-controls="collapseBasic">
+                                        <i class="fas fa-info-circle me-2"></i>
+                                        Passo 1: Informações Básicas
+                                        <span class="badge bg-success ms-auto me-3" id="step1Status" style="display: none;">✓</span>
+                                    </button>
+                                </h2>
+                                <div id="collapseBasic" class="accordion-collapse collapse show" aria-labelledby="headingBasic" data-bs-parent="#pageWizard">
+                                    <div class="accordion-body">
+                                        <div class="row">
+                                            <div class="col-md-6">
+                                                <div class="mb-3">
+                                                    <label asp-for="DisplayName" class="form-label">Nome da Página <span class="text-danger">*</span></label>
+                                                    <input asp-for="DisplayName" class="form-control" placeholder="Ex: João Silva" required>
+                                                    <span asp-validation-for="DisplayName" class="text-danger"></span>
+                                                    <div class="form-text">Nome que aparecerá no topo da sua página</div>
+                                                </div>
+                                            </div>
+
+                                            <div class="col-md-6">
+                                                <div class="mb-3">
+                                                    <label asp-for="Category" class="form-label">Categoria <span class="text-danger">*</span></label>
+                                                    <select asp-for="Category" class="form-select" required>
+                                                        <option value="">Selecione uma categoria</option>
+                                                        @foreach (var category in Model.AvailableCategories)
+                                                        {
+                                                            <option value="@category.Name">@category.Name</option>
+                                                        }
+                                                    </select>
+                                                    <span asp-validation-for="Category" class="text-danger"></span>
+                                                    <div class="form-text">Categoria define o tipo da sua página</div>
+                                                </div>
+                                            </div>
+                                        </div>
+
+                                        <div class="row">
+                                            <div class="col-md-6">
+                                                <div class="mb-3">
+                                                    <label asp-for="BusinessType" class="form-label">Tipo</label>
+                                                    <select asp-for="BusinessType" class="form-select">
+                                                        <option value="individual" selected>Pessoa Física</option>
+                                                        <option value="company">Empresa</option>
+                                                    </select>
+                                                </div>
+                                            </div>
+
+                                            <div class="col-md-6">
+                                                <div class="mb-3">
+                                                    <label for="slugPreview" class="form-label">URL da Página</label>
+                                                    <div class="input-group">
+                                                        <span class="input-group-text">page/</span>
+                                                        <span class="input-group-text" id="categorySlug">categoria</span>
+                                                        <span class="input-group-text">/</span>
+                                                        <input type="text" class="form-control" id="slugPreview" value="@Model.Slug" readonly>
+                                                        <input asp-for="Slug" type="hidden">
+                                                    </div>
+                                                    <small class="form-text text-muted">URL gerada automaticamente</small>
+                                                </div>
+                                            </div>
+                                        </div>
+
+                                        <div class="mb-3">
+                                            <label asp-for="Bio" class="form-label">Bio/Descrição</label>
+                                            <textarea asp-for="Bio" class="form-control" rows="3" placeholder="Uma breve descrição sobre você ou sua empresa..."></textarea>
+                                            <span asp-validation-for="Bio" class="text-danger"></span>
+                                            <div class="form-text">Máximo 200 caracteres</div>
+                                        </div>
+
+                                        <div class="text-end">
+                                            <button type="button" class="btn btn-primary" onclick="nextStep(2)">
+                                                Próximo <i class="fas fa-arrow-right ms-1"></i>
+                                            </button>
+                                        </div>
+                                    </div>
+                                </div>
+                            </div>
+
+                            <!-- Passo 2: Tema Visual -->
+                            <div class="accordion-item">
+                                <h2 class="accordion-header" id="headingTheme">
+                                    <button class="accordion-button collapsed" type="button" data-bs-toggle="collapse" data-bs-target="#collapseTheme" aria-expanded="false" aria-controls="collapseTheme">
+                                        <i class="fas fa-palette me-2"></i>
+                                        Passo 2: Tema Visual
+                                        <span class="badge bg-success ms-auto me-3" id="step2Status" style="display: none;">✓</span>
+                                    </button>
+                                </h2>
+                                <div id="collapseTheme" class="accordion-collapse collapse" aria-labelledby="headingTheme" data-bs-parent="#pageWizard">
+                                    <div class="accordion-body">
+                                        <p class="text-muted mb-4">Escolha um tema que combine com sua personalidade ou marca:</p>
+
+                                        <div class="row">
+                                            @foreach (var theme in Model.AvailableThemes)
+                                            {
+                                                <div class="col-md-4 col-lg-3 mb-3">
+                                                    <div class="theme-card @(Model.SelectedTheme == theme.Name.ToLower() ? "selected" : "")" data-theme="@theme.Name.ToLower()">
+                                                        <div class="theme-preview" style="background: @theme.BackgroundColor; color: @theme.TextColor;">
+                                                            <div class="theme-header" style="background-color: @theme.PrimaryColor;">
+                                                                <div class="theme-avatar"></div>
+                                                                <h6>@theme.Name</h6>
+                                                            </div>
+                                                            <div class="theme-links">
+                                                                <div class="theme-link" style="background-color: @theme.PrimaryColor;"></div>
+                                                                <div class="theme-link" style="background-color: @theme.SecondaryColor;"></div>
+                                                            </div>
+                                                        </div>
+                                                        <div class="theme-name">
+                                                            @theme.Name
+                                                            @if (theme.IsPremium)
+                                                            {
+                                                                <span class="badge bg-warning">Premium</span>
+                                                            }
+                                                        </div>
+                                                    </div>
+                                                </div>
+                                            }
+                                        </div>
+
+                                        <input asp-for="SelectedTheme" type="hidden">
+
+                                        <div class="d-flex justify-content-between">
+                                            <button type="button" class="btn btn-outline-secondary" onclick="previousStep(1)">
+                                                <i class="fas fa-arrow-left me-1"></i> Anterior
+                                            </button>
+                                            <button type="button" class="btn btn-primary" onclick="nextStep(3)">
+                                                Próximo <i class="fas fa-arrow-right ms-1"></i>
+                                            </button>
+                                        </div>
+                                    </div>
+                                </div>
+                            </div>
+
+                            <!-- Passo 3: Links Principais -->
+                            <div class="accordion-item">
+                                <h2 class="accordion-header" id="headingLinks">
+                                    <button class="accordion-button collapsed" type="button" data-bs-toggle="collapse" data-bs-target="#collapseLinks" aria-expanded="false" aria-controls="collapseLinks">
+                                        <i class="fas fa-link me-2"></i>
+                                        Passo 3: Links Principais
+                                        <span class="badge bg-success ms-auto me-3" id="step3Status" style="display: none;">✓</span>
+                                    </button>
+                                </h2>
+                                <div id="collapseLinks" class="accordion-collapse collapse" aria-labelledby="headingLinks" data-bs-parent="#pageWizard">
+                                    <div class="accordion-body">
+                                        <p class="text-muted mb-4">Adicione os links mais importantes (Máximo: @Model.MaxLinksAllowed):</p>
+
+                                        <div id="linksContainer">
+                                            @for (int i = 0; i < Model.Links.Count; i++)
+                                            {
+                                                var myList = new List<string>()
+                                                {
+                                                    "facebook",
+                                                    "whatsapp",
+                                                    "twitter",
+                                                    "instagram"
+                                                };
+                                                var match = myList.FirstOrDefault(stringToCheck => Model.Links[i].Icon.Contains(stringToCheck));
+                                                if (match==null) {
+                                                <div class="link-input-group" data-link="@i">
+                                                    <div class="d-flex justify-content-between align-items-center mb-2">
+                                                        <h6 class="mb-0">Link @(i + 1)</h6>
+                                                        <button type="button" class="btn btn-sm btn-outline-danger remove-link-btn">
+                                                            <i class="fas fa-trash"></i>
+                                                        </button>
+                                                    </div>
+                                                    <div class="row">
+                                                        <div class="col-md-6">
+                                                            <div class="mb-2">
+                                                                <label class="form-label">Título</label>
+                                                                <input asp-for="Links[i].Title" class="form-control link-title" placeholder="Ex: Meu Site">
+                                                                <span asp-validation-for="Links[i].Title" class="text-danger"></span>
+                                                            </div>
+                                                        </div>
+                                                        <div class="col-md-6">
+                                                            <div class="mb-2">
+                                                                <label class="form-label">URL</label>
+                                                                <input asp-for="Links[i].Url" class="form-control link-url" placeholder="https://exemplo.com">
+                                                                <span asp-validation-for="Links[i].Url" class="text-danger"></span>
+                                                            </div>
+                                                        </div>
+                                                    </div>
+                                                    <div class="mb-2">
+                                                        <label class="form-label">Descrição (opcional)</label>
+                                                        <input asp-for="Links[i].Description" class="form-control link-description" placeholder="Breve descrição do link">
+                                                    </div>
+                                                    <input asp-for="Links[i].Id" type="hidden">
+                                                    <input asp-for="Links[i].Icon" type="hidden">
+                                                    <input asp-for="Links[i].Order" type="hidden">
+                                                    <input asp-for="Links[i].IsActive" type="hidden" value="true">
+                                                </div>
+                                                }
+                                            }
+                                        </div>
+                                        
+                                        <button type="button" class="btn btn-outline-primary mb-4" id="addLinkBtn" data-bs-toggle="modal" data-bs-target="#addLinkModal">
+                                            <i class="fas fa-plus"></i> Adicionar Link
+                                        </button>
+                                        
+                                        <div class="d-flex justify-content-between">
+                                            <button type="button" class="btn btn-outline-secondary" onclick="previousStep(2)">
+                                                <i class="fas fa-arrow-left me-1"></i> Anterior
+                                            </button>
+                                            <button type="button" class="btn btn-primary" onclick="nextStep(4)">
+                                                Próximo <i class="fas fa-arrow-right ms-1"></i>
+                                            </button>
+                                        </div>
+                                    </div>
+                                </div>
+                            </div>
+                            @{
+                                var facebook = Model.Links.Where(x => x.Icon.Contains("facebook")).FirstOrDefault();
+                                var twitter = Model.Links.Where(x => x.Icon.Contains("twitter")).FirstOrDefault();
+                                var whatsapp = Model.Links.Where(x => x.Icon.Contains("whatsapp")).FirstOrDefault();
+                                var instagram = Model.Links.Where(x => x.Icon.Contains("instagram")).FirstOrDefault();
+                                var facebookUrl = facebook !=null ? facebook.Url : "";
+                                var twitterUrl = twitter !=null ? twitter.Url : "";
+                                var whatsappUrl = whatsapp !=null ? whatsapp.Url : "";
+                                var instagramUrl = instagram !=null ? instagram.Url : "";
+                            }
+                            <!-- Passo 4: Redes Sociais (Opcional) -->
+                            <div class="accordion-item">
+                                <h2 class="accordion-header" id="headingSocial">
+                                    <button class="accordion-button collapsed" type="button" data-bs-toggle="collapse" data-bs-target="#collapseSocial" aria-expanded="false" aria-controls="collapseSocial">
+                                        <i class="fab fa-twitter me-2"></i>
+                                        Passo 4: Redes Sociais (Opcional)
+                                        <span class="badge bg-success ms-auto me-3" id="step4Status" style="display: none;">✓</span>
+                                    </button>
+                                </h2>
+                                <div id="collapseSocial" class="accordion-collapse collapse" aria-labelledby="headingSocial" data-bs-parent="#pageWizard">
+                                    <div class="accordion-body">
+                                        <p class="text-muted mb-4">Conecte suas redes sociais (todos os campos são opcionais):</p>
+                                        
+                                        <div class="row">
+                                            <div class="col-md-6">
+                                                <div class="mb-3">
+                                                    <label asp-for="WhatsAppNumber" class="form-label">
+                                                        <i class="fab fa-whatsapp text-success"></i>
+                                                        WhatsApp
+                                                    </label>
+                                                    <input asp-for="WhatsAppNumber" class="form-control" placeholder="+55 11 99999-9999" value="@whatsappUrl">
+                                                    <span asp-validation-for="WhatsAppNumber" class="text-danger"></span>
+                                                </div>
+                                            </div>
+                                            
+                                            <div class="col-md-6">
+                                                <div class="mb-3">
+                                                    <label asp-for="FacebookUrl" class="form-label">
+                                                        <i class="fab fa-facebook text-primary"></i>
+                                                        Facebook
+                                                    </label>
+                                                    <input asp-for="FacebookUrl" class="form-control" placeholder="https://facebook.com/seu-perfil" value="@facebookUrl">
+                                                    <span asp-validation-for="FacebookUrl" class="text-danger"></span>
+                                                </div>
+                                            </div>
+                                        </div>
+                                        
+                                        <div class="row">
+                                            <div class="col-md-6">
+                                                <div class="mb-3">
+                                                    <label asp-for="TwitterUrl" class="form-label">
+                                                        <i class="fab fa-x-twitter"></i>
+                                                        X / Twitter
+                                                    </label>
+                                                    <input asp-for="TwitterUrl" class="form-control" placeholder="https://x.com/seu-perfil" value="@twitterUrl">
+                                                    <span asp-validation-for="TwitterUrl" class="text-danger"></span>
+                                                </div>
+                                            </div>
+                                            
+                                            <div class="col-md-6">
+                                                <div class="mb-3">
+                                                    <label asp-for="InstagramUrl" class="form-label">
+                                                        <i class="fab fa-instagram text-danger"></i>
+                                                        Instagram
+                                                    </label>
+                                                    <input asp-for="InstagramUrl" class="form-control" placeholder="https://instagram.com/seu-perfil" value="@instagramUrl">
+                                                    <span asp-validation-for="InstagramUrl" class="text-danger"></span>
+                                                </div>
+                                            </div>
+                                        </div>
+                                        
+                                        <div class="d-flex justify-content-between">
+                                            <button type="button" class="btn btn-outline-secondary" onclick="previousStep(3)">
+                                                <i class="fas fa-arrow-left me-1"></i> Anterior
+                                            </button>
+                                            <div>
+                                                <button type="button" class="btn btn-outline-success me-2" onclick="skipStep(4)">
+                                                    Pular Etapa
+                                                </button>
+                                                <button type="submit" class="btn btn-success">
+                                                    <i class="fas fa-@(Model.IsNewPage ? "rocket" : "save") me-2"></i>
+                                                    @(Model.IsNewPage ? "Criar Página" : "Salvar Alterações")
+                                                </button>
+                                            </div>
+                                        </div>
+                                    </div>
+                                </div>
+                            </div>
+                        </div>
+                    </form>
+                </div>
+            </div>
+        </div>
+    </div>
+</div>
+
+<!-- Modal para Adicionar Link -->
+<div class="modal fade" id="addLinkModal" tabindex="-1" aria-labelledby="addLinkModalLabel" aria-hidden="true">
+    <div class="modal-dialog">
+        <div class="modal-content">
+            <div class="modal-header">
+                <h5 class="modal-title" id="addLinkModalLabel">
+                    <i class="fas fa-link me-2"></i>
+                    Adicionar Novo Link
+                </h5>
+                <button type="button" class="btn-close" data-bs-dismiss="modal" aria-label="Close"></button>
+            </div>
+            <div class="modal-body">
+                <form id="addLinkForm">
+                    <div class="mb-3">
+                        <label for="linkTitle" class="form-label">Título do Link</label>
+                        <input type="text" class="form-control" id="linkTitle" placeholder="Ex: Meu Site, Portfólio, Instagram..." required>
+                        <div class="form-text">Nome que aparecerá no botão</div>
+                    </div>
+                    
+                    <div class="mb-3">
+                        <label for="linkUrl" class="form-label">URL</label>
+                        <input type="url" class="form-control" id="linkUrl" placeholder="https://exemplo.com" required>
+                        <div class="form-text">Link completo incluindo https://</div>
+                    </div>
+                    
+                    <div class="mb-3">
+                        <label for="linkDescription" class="form-label">Descrição (opcional)</label>
+                        <input type="text" class="form-control" id="linkDescription" placeholder="Breve descrição do link">
+                        <div class="form-text">Texto adicional que aparece abaixo do título</div>
+                    </div>
+                    
+                    <div class="mb-3">
+                        <label for="linkIcon" class="form-label">Ícone (opcional)</label>
+                        <select class="form-select" id="linkIcon">
+                            <option value="">Sem ícone</option>
+                            <option value="fas fa-globe">🌐 Site</option>
+                            <option value="fas fa-shopping-cart">🛒 Loja</option>
+                            <option value="fas fa-briefcase">💼 Portfólio</option>
+                            <option value="fas fa-envelope">✉️ Email</option>
+                            <option value="fas fa-phone">📞 Telefone</option>
+                            <option value="fas fa-map-marker-alt">📍 Localização</option>
+                            <option value="fab fa-youtube">📺 YouTube</option>
+                            <option value="fab fa-linkedin">💼 LinkedIn</option>
+                            <option value="fab fa-github">💻 GitHub</option>
+                            <option value="fas fa-download">⬇️ Download</option>
+                            <option value="fas fa-calendar">📅 Agenda</option>
+                            <option value="fas fa-heart">❤️ Favorito</option>
+                        </select>
+                    </div>
+                </form>
+            </div>
+            <div class="modal-footer">
+                <button type="button" class="btn btn-secondary" data-bs-dismiss="modal">
+                    <i class="fas fa-times"></i> Cancelar
+                </button>
+                <button type="button" class="btn btn-primary" id="saveLinkBtn">
+                    <i class="fas fa-plus"></i> Adicionar Link
+                </button>
+            </div>
+        </div>
+    </div>
+</div>
+
+<style>
+.theme-card {
+    cursor: pointer;
+    border: 2px solid transparent;
+    border-radius: 8px;
+    overflow: hidden;
+    transition: all 0.3s ease;
+}
+
+.theme-card:hover,
+.theme-card.selected {
+    border-color: #007bff;
+    box-shadow: 0 4px 12px rgba(0, 123, 255, 0.3);
+    transform: translateY(-2px);
+}
+
+.theme-preview {
+    height: 100px;
+    position: relative;
+    padding: 0.75rem;
+}
+
+.theme-header {
+    display: flex;
+    align-items: center;
+    gap: 0.5rem;
+    padding: 0.5rem;
+    border-radius: 4px;
+    margin-bottom: 0.75rem;
+}
+
+.theme-avatar {
+    width: 16px;
+    height: 16px;
+    border-radius: 50%;
+    background-color: rgba(255, 255, 255, 0.3);
+}
+
+.theme-header h6 {
+    margin: 0;
+    font-size: 0.7rem;
+    color: white;
+}
+
+.theme-links {
+    display: flex;
+    flex-direction: column;
+    gap: 0.25rem;
+}
+
+.theme-link {
+    height: 6px;
+    border-radius: 3px;
+    opacity: 0.8;
+}
+
+.theme-name {
+    padding: 0.5rem;
+    text-align: center;
+    font-weight: 500;
+    background-color: #f8f9fa;
+    font-size: 0.85rem;
+}
+
+.link-input-group {
+    background-color: #f8f9fa;
+    border: 1px solid #dee2e6;
+    border-radius: 8px;
+    padding: 1rem;
+    margin-bottom: 1rem;
+    transition: all 0.3s ease;
+}
+
+.link-input-group:hover {
+    border-color: #007bff;
+    box-shadow: 0 2px 8px rgba(0, 123, 255, 0.1);
+}
+
+.accordion-button:not(.collapsed) {
+    background-color: rgba(13, 110, 253, 0.1);
+    border-color: rgba(13, 110, 253, 0.25);
+}
+
+.progress-bar {
+    transition: width 0.6s ease;
+}
+
+.btn {
+    border: none !important;
+    box-shadow: 0 2px 4px rgba(0,0,0,0.1);
+}
+
+.btn:hover {
+    transform: translateY(-1px);
+    box-shadow: 0 4px 8px rgba(0,0,0,0.15);
+}
+</style>
+
+@section Scripts {
+    @{await Html.RenderPartialAsync("_ValidationScriptsPartial");}
+    
+    <script>
+    let linkCount = @Model.Links.Count;
+    let currentStep = 1;
+
+    $(document).ready(function() {
+        // Generate slug when name or category changes
+        $('#DisplayName, #Category').on('input change', function() {
+            generateSlug();
+            updateProgress();
+        });
+        
+        // Theme selection
+        $('.theme-card').on('click', function() {
+            $('.theme-card').removeClass('selected');
+            $(this).addClass('selected');
+            const themeName = $(this).data('theme');
+            $('#SelectedTheme').val(themeName);
+            markStepComplete(2);
+        });
+        
+        // Add link functionality via modal
+        $('#addLinkBtn').on('click', function() {
+            if (linkCount >= @Model.MaxLinksAllowed) {
+                alert('Você atingiu o limite de links para seu plano atual.');
+                return false;
+            }
+        });
+        
+        // Save link from modal
+        $(document).on('click', '#saveLinkBtn', function() {
+            console.log('Save button clicked');
+            
+            const title = $('#linkTitle').val().trim();
+            const url = $('#linkUrl').val().trim();
+            const description = $('#linkDescription').val().trim();
+            const icon = $('#linkIcon').val();
+            
+            console.log('Values:', { title, url, description, icon });
+            
+            if (!title || !url) {
+                alert('Por favor, preencha pelo menos o título e a URL do link.');
+                return;
+            }
+            
+            // Basic URL validation
+            if (!url.startsWith('http://') && !url.startsWith('https://')) {
+                alert('Por favor, insira uma URL válida que comece com http:// ou https://');
+                return;
+            }
+            
+            addLinkInput(title, url, description, icon);
+            
+            // Clear modal form
+            $('#addLinkForm')[0].reset();
+            
+            // Close modal using Bootstrap 5 syntax
+            var modal = bootstrap.Modal.getInstance(document.getElementById('addLinkModal'));
+            if (modal) {
+                modal.hide();
+            }
+            
+            markStepComplete(3);
+        });
+        
+        // Remove link functionality
+        $(document).on('click', '.remove-link-btn', function() {
+            $(this).closest('.link-input-group').remove();
+            linkCount--;
+            updateLinkNumbers();
+        });
+        
+        // Form validation
+        $('#managePageForm').on('submit', function(e) {
+            console.log('Form submitted');
+            // Allow submission but add loading state
+            $(this).find('button[type="submit"]').prop('disabled', true).html('<i class="fas fa-spinner fa-spin me-2"></i>Criando...');
+        });
+    });
+
+    function nextStep(step) {
+        if (validateCurrentStep()) {
+            markStepComplete(currentStep);
+            currentStep = step;
+            updateProgress();
+            
+            // Close current accordion and open next
+            $('.accordion-collapse.show').collapse('hide');
+            setTimeout(() => {
+                $(`#collapse${getStepName(step)}`).collapse('show');
+            }, 300);
+        }
+    }
+
+    function previousStep(step) {
+        currentStep = step;
+        updateProgress();
+        
+        // Close current accordion and open previous
+        $('.accordion-collapse.show').collapse('hide');
+        setTimeout(() => {
+            $(`#collapse${getStepName(step)}`).collapse('show');
+        }, 300);
+    }
+
+    function skipStep(step) {
+        markStepComplete(step);
+        // Show create button or next step
+        updateProgress();
+    }
+
+    function getStepName(step) {
+        const names = ['', 'Basic', 'Theme', 'Links', 'Social'];
+        return names[step];
+    }
+
+    function validateCurrentStep() {
+        if (currentStep === 1) {
+            const name = $('#DisplayName').val().trim();
+            const category = $('#Category').val().trim();
+            if (!name || !category) {
+                alert('Por favor, preencha o nome da página e selecione uma categoria.');
+                return false;
+            }
+        } else if (currentStep === 2) {
+            const theme = $('#SelectedTheme').val();
+            if (!theme) {
+                alert('Por favor, selecione um tema visual.');
+                return false;
+            }
+        }
+        return true;
+    }
+
+    function markStepComplete(step) {
+        $(`#step${step}Status`).show();
+    }
+
+    function updateProgress() {
+        const progress = (currentStep / 4) * 100;
+        $('.progress-bar').css('width', `${progress}%`).attr('aria-valuenow', progress);
+        $('.progress').next().find('small').first().text(`Passo ${currentStep} de 4`);
+    }
+
+    function generateSlug() {
+        const name = $('#DisplayName').val();
+        const category = $('#Category').val();
+        
+        if (name && category) {
+            $.post('@Url.Action("GenerateSlug", "Admin")', { category: category, name: name })
+                .done(function(data) {
+                    $('#Slug').val(data.slug);
+                    $('#slugPreview').val(data.slug);
+                    $('#categorySlug').text(category);
+                });
+        }
+    }
+
+    function addLinkInput(title = '', url = '', description = '', icon = '') {
+        const iconHtml = icon ? `<i class="${icon} me-2"></i>` : '';
+        
+        const linkHtml = `
+            <div class="link-input-group" data-link="${linkCount}">
+                <div class="d-flex justify-content-between align-items-center mb-2">
+                    <h6 class="mb-0">
+                        ${iconHtml}Link ${linkCount + 1}: ${title || 'Novo Link'}
+                    </h6>
+                    <button type="button" class="btn btn-sm btn-outline-danger remove-link-btn">
+                        <i class="fas fa-trash"></i>
+                    </button>
+                </div>
+                <div class="row">
+                    <div class="col-md-6">
+                        <div class="mb-2">
+                            <input type="hidden" name="Links[${linkCount}].Id" value="new">
+                            <label class="form-label">Título</label>
+                            <input type="text" name="Links[${linkCount}].Title" class="form-control link-title" value="${title}" placeholder="Ex: Meu Site" readonly>
+                        </div>
+                    </div>
+                    <div class="col-md-6">
+                        <div class="mb-2">
+                            <label class="form-label">URL</label>
+                            <input type="url" name="Links[${linkCount}].Url" class="form-control link-url" value="${url}" placeholder="https://exemplo.com" readonly>
+                        </div>
+                    </div>
+                </div>
+                <div class="mb-2">
+                    <label class="form-label">Descrição (opcional)</label>
+                    <input type="text" name="Links[${linkCount}].Description" class="form-control link-description" value="${description}" placeholder="Breve descrição do link" readonly>
+                </div>
+                <input type="hidden" name="Links[${linkCount}].Id" value="">
+                <input type="hidden" name="Links[${linkCount}].Icon" value="${icon}">
+                <input type="hidden" name="Links[${linkCount}].Order" value="${linkCount}">
+                <input type="hidden" name="Links[${linkCount}].IsActive" value="true">
+            </div>
+        `;
+        
+        $('#linksContainer').append(linkHtml);
+        linkCount++;
+    }
+
+    function updateLinkNumbers() {
+        $('.link-input-group').each(function(index) {
+            $(this).find('h6').text('Link ' + (index + 1));
+            $(this).attr('data-link', index);
+        });
+    }
+    </script>
+}
\ No newline at end of file
diff --git a/src/BCards.Web/Views/Auth/Login.cshtml b/src/BCards.Web/Views/Auth/Login.cshtml
new file mode 100644
index 0000000..5d01978
--- /dev/null
+++ b/src/BCards.Web/Views/Auth/Login.cshtml
@@ -0,0 +1,89 @@
+@{
+    ViewData["Title"] = "Login - BCards";
+    var returnUrl = ViewBag.ReturnUrl as string;
+    var isPreview = ViewBag.IsPreview as bool? ?? false;
+    Layout = isPreview ? "_Layout" : "_UserPageLayout";
+}
+
+<div class="container py-5">
+    <div class="row justify-content-center">
+        <div class="col-md-6 col-lg-4">
+            <div class="card shadow">
+                <div class="card-body p-4">
+                    <div class="text-center mb-4">
+                        <h2 class="text-primary fw-bold">BCards</h2>
+                        <p class="text-muted">Entre na sua conta</p>
+                    </div>
+
+                    <form asp-controller="Auth" asp-action="LoginWithGoogle" method="post" class="mb-3">
+                        @if (!string.IsNullOrEmpty(returnUrl))
+                        {
+                            <input type="hidden" name="returnUrl" value="@returnUrl" />
+                        }
+                        <button type="submit" class="btn btn-danger w-100 mb-2 d-flex align-items-center justify-content-center">
+                            <i class="me-2">🔴</i>
+                            Entrar com Google
+                        </button>
+                    </form>
+
+                    <form asp-controller="Auth" asp-action="LoginWithMicrosoft" method="post" class="mb-3">
+                        @if (!string.IsNullOrEmpty(returnUrl))
+                        {
+                            <input type="hidden" name="returnUrl" value="@returnUrl" />
+                        }
+                        <button type="submit" class="btn btn-primary w-100 d-flex align-items-center justify-content-center">
+                            <i class="me-2">Ⓜ️</i>
+                            Entrar com Microsoft
+                        </button>
+                    </form>
+
+                    <div class="text-center">
+                        <small class="text-muted">
+                            Não temos acesso à sua senha. <br>
+                            Usamos apenas autenticação segura via OAuth.
+                        </small>
+                    </div>
+
+                    <hr class="my-4">
+
+                    <div class="text-center">
+                        <small class="text-muted">
+                            Não tem uma conta? É grátis para começar!
+                        </small>
+                    </div>
+                </div>
+            </div>
+
+            <div class="text-center mt-4">
+                <a asp-controller="Home" asp-action="Index" class="text-decoration-none">
+                    ← Voltar ao início
+                </a>
+            </div>
+        </div>
+    </div>
+</div>
+
+@section Styles {
+    <style>
+        .card {
+            border-radius: 15px;
+            border: none;
+        }
+        
+        .btn {
+            border-radius: 10px;
+            font-weight: 500;
+            padding: 0.75rem 1rem;
+        }
+        
+        .btn-danger {
+            background-color: #db4437;
+            border-color: #db4437;
+        }
+        
+        .btn-danger:hover {
+            background-color: #c23321;
+            border-color: #c23321;
+        }
+    </style>
+}
\ No newline at end of file
diff --git a/src/BCards.Web/Views/Home/Index.cshtml b/src/BCards.Web/Views/Home/Index.cshtml
new file mode 100644
index 0000000..984a901
--- /dev/null
+++ b/src/BCards.Web/Views/Home/Index.cshtml
@@ -0,0 +1,180 @@
+@{
+    var isPreview = ViewBag.IsPreview as bool? ?? false;
+    ViewData["Title"] = "BCards - Crie seu LinkTree Profissional";
+    var categories = ViewBag.Categories as List<BCards.Web.Models.Category> ?? new List<BCards.Web.Models.Category>();
+    var recentPages = ViewBag.RecentPages as List<BCards.Web.Models.UserPage> ?? new List<BCards.Web.Models.UserPage>();
+    Layout = isPreview ? "_Layout" : "_UserPageLayout";
+}
+
+<div class="hero-section bg-primary bg-gradient text-white py-5 mb-5">
+    <div class="container">
+        <div class="row align-items-center">
+            <div class="col-lg-6">
+                <h1 class="display-4 fw-bold mb-4">
+                    Crie sua página profissional em minutos
+                </h1>
+                <p class="lead mb-4">
+                    A melhor alternativa ao LinkTree para profissionais e empresas no Brasil. 
+                    Organize todos os seus links em uma página única e profissional.
+                </p>
+                <div class="d-flex gap-3 flex-wrap">
+                    @if (User.Identity?.IsAuthenticated == true)
+                    {
+                        <a asp-controller="Admin" asp-action="Dashboard" class="btn btn-light btn-lg px-4">
+                            Acessar Dashboard
+                        </a>
+                    }
+                    else
+                    {
+                        <a asp-controller="Auth" asp-action="Login" class="btn btn-light btn-lg px-4">
+                            Começar Grátis
+                        </a>
+                    }
+                    <a asp-controller="Home" asp-action="Pricing" class="btn btn-outline-light btn-lg px-4">
+                        Ver Planos
+                    </a>
+                </div>
+            </div>
+            <div class="col-lg-6 text-center">
+                <img src="~/images/hero-mockup.svg" alt="Exemplo de página BCards" class="img-fluid rounded shadow-lg" style="max-height: 400px;">
+            </div>
+        </div>
+    </div>
+</div>
+
+<div class="container">
+    <!-- Categorias Populares -->
+    @if (categories.Any())
+    {
+        <section class="mb-5">
+            <h2 class="text-center mb-4">Categorias Populares</h2>
+            <div class="row g-3">
+                @foreach (var category in categories.Take(8))
+                {
+                    <div class="col-6 col-md-3">
+                        <a href="@Url.Action("Category", "Home", new { categorySlug = category.Slug })" 
+                           class="text-decoration-none">
+                            <div class="card h-100 border-0 shadow-sm hover-card">
+                                <div class="card-body text-center">
+                                    <div class="fs-1 mb-2">@category.Icon</div>
+                                    <h6 class="card-title mb-0 text-dark">@category.Name</h6>
+                                </div>
+                            </div>
+                        </a>
+                    </div>
+                }
+            </div>
+        </section>
+    }
+
+    <!-- Funcionalidades -->
+    <section class="mb-5">
+        <h2 class="text-center mb-4">Por que escolher o BCards?</h2>
+        <div class="row g-4">
+            <div class="col-md-4">
+                <div class="text-center">
+                    <div class="bg-primary bg-opacity-10 rounded-circle d-inline-flex align-items-center justify-content-center mb-3" style="width: 80px; height: 80px;">
+                        <i class="fs-2 text-primary">🎨</i>
+                    </div>
+                    <h5>Temas Profissionais</h5>
+                    <p class="text-muted">Escolha entre diversos temas profissionais ou personalize as cores da sua página.</p>
+                </div>
+            </div>
+            <div class="col-md-4">
+                <div class="text-center">
+                    <div class="bg-primary bg-opacity-10 rounded-circle d-inline-flex align-items-center justify-content-center mb-3" style="width: 80px; height: 80px;">
+                        <i class="fs-2 text-primary">📊</i>
+                    </div>
+                    <h5>Analytics Avançado</h5>
+                    <p class="text-muted">Acompanhe quantas pessoas visitaram sua página e clicaram nos seus links.</p>
+                </div>
+            </div>
+            <div class="col-md-4">
+                <div class="text-center">
+                    <div class="bg-primary bg-opacity-10 rounded-circle d-inline-flex align-items-center justify-content-center mb-3" style="width: 80px; height: 80px;">
+                        <i class="fs-2 text-primary">🔗</i>
+                    </div>
+                    <h5>URLs Organizadas</h5>
+                    <p class="text-muted">Suas URLs são organizadas por categoria: vcart.me/corretor/seu-nome</p>
+                </div>
+            </div>
+        </div>
+    </section>
+
+    <!-- Páginas Recentes -->
+    @if (recentPages.Any())
+    {
+        <section class="mb-5">
+            <h2 class="text-center mb-4">Profissionais que confiam no BCards</h2>
+            <div class="row g-3">
+                @foreach (var page in recentPages)
+                {
+                    <div class="col-md-4">
+                        <div class="card h-100 border-0 shadow-sm">
+                            <div class="card-body text-center">
+                                @if (!string.IsNullOrEmpty(page.ProfileImage))
+                                {
+                                    <img src="@(page.ProfileImage)" alt="@(page.DisplayName)" 
+                                         class="rounded-circle mb-3" style="width: 60px; height: 60px; object-fit: cover;">
+                                }
+                                else
+                                {
+                                    <div class="bg-primary bg-opacity-10 rounded-circle d-inline-flex align-items-center justify-content-center mb-3" 
+                                         style="width: 60px; height: 60px;">
+                                        <i class="fs-4 text-primary">👤</i>
+                                    </div>
+                                }
+                                <h6 class="card-title">@(page.DisplayName)</h6>
+                                <small class="text-muted text-capitalize">@(page.Category)</small>
+                                <div class="mt-2">
+                                    <a href="~/@(page.Category)/@(page.Slug)" target="_blank" 
+                                       class="btn btn-sm btn-outline-primary">
+                                        Ver Página
+                                    </a>
+                                </div>
+                            </div>
+                        </div>
+                    </div>
+                }
+            </div>
+        </section>
+    }
+
+    <!-- CTA Final -->
+    <section class="text-center py-5 bg-light rounded-3 mb-5">
+        <div class="container">
+            <h2 class="mb-3">Pronto para começar?</h2>
+            <p class="lead mb-4 text-muted">
+                Crie sua página profissional agora mesmo e comece a organizar seus links.
+            </p>
+            @if (User.Identity?.IsAuthenticated == true)
+            {
+                <a asp-controller="Admin" asp-action="Dashboard" class="btn btn-primary btn-lg">
+                    Criar Minha Página
+                </a>
+            }
+            else
+            {
+                <a asp-controller="Auth" asp-action="Login" class="btn btn-primary btn-lg">
+                    Começar Grátis
+                </a>
+            }
+        </div>
+    </section>
+</div>
+
+@section Styles {
+    <style>
+        .hero-section {
+            background: linear-gradient(135deg, #667eea 0%, #764ba2 100%);
+        }
+        
+        .hover-card {
+            transition: transform 0.2s ease-in-out;
+        }
+        
+        .hover-card:hover {
+            transform: translateY(-5px);
+        }
+    </style>
+}
\ No newline at end of file
diff --git a/src/BCards.Web/Views/Home/Pricing.cshtml b/src/BCards.Web/Views/Home/Pricing.cshtml
new file mode 100644
index 0000000..52dc87a
--- /dev/null
+++ b/src/BCards.Web/Views/Home/Pricing.cshtml
@@ -0,0 +1,345 @@
+@{
+    ViewData["Title"] = "Planos e Preços - BCards";
+    var isPreview = ViewBag.IsPreview as bool? ?? false;
+    Layout = isPreview ? "_Layout" : "_UserPageLayout";
+}
+
+<div class="container py-5">
+    <div class="text-center mb-5">
+        <h1 class="display-5 fw-bold mb-3">Escolha o plano ideal para você</h1>
+        <p class="lead text-muted">Comece grátis e faça upgrade quando precisar de mais recursos</p>
+    </div>
+
+    <div class="row g-4 justify-content-center">
+        <!-- Plano Trial -->
+        <div class="col-lg-3 col-md-6">
+            <div class="card h-100 border-0 shadow-sm">
+                <div class="card-header bg-success bg-opacity-10 text-center py-4">
+                    <h4 class="mb-0">Trial Gratuito</h4>
+                    <div class="mt-3">
+                        <span class="display-4 fw-bold text-success">R$ 0</span>
+                        <span class="text-muted">/7 dias</span>
+                    </div>
+                </div>
+                <div class="card-body p-4">
+                    <ul class="list-unstyled">
+                        <li class="mb-3">
+                            <i class="text-success me-2">✓</i>
+                            Até <strong>3 links</strong>
+                        </li>
+                        <li class="mb-3">
+                            <i class="text-success me-2">✓</i>
+                            1 tema básico
+                        </li>
+                        <li class="mb-3">
+                            <i class="text-success me-2">✓</i>
+                            7 dias grátis
+                        </li>
+                        <li class="mb-3">
+                            <i class="text-muted me-2">✗</i>
+                            <span class="text-muted">Analytics</span>
+                        </li>
+                        <li class="mb-3">
+                            <i class="text-muted me-2">✗</i>
+                            <span class="text-muted">Domínio personalizado</span>
+                        </li>
+                    </ul>
+                </div>
+                <div class="card-footer bg-transparent p-4">
+                    @if (User.Identity?.IsAuthenticated == true)
+                    {
+                        <a asp-controller="Admin" asp-action="CreatePage" class="btn btn-success w-100">Começar Grátis</a>
+                    }
+                    else
+                    {
+                        <a asp-controller="Auth" asp-action="Login" class="btn btn-success w-100">Começar Grátis</a>
+                    }
+                </div>
+            </div>
+        </div>
+
+        <!-- Plano Básico -->
+        <div class="col-lg-3 col-md-6">
+            <div class="card h-100 border-0 shadow-sm">
+                <div class="card-header bg-light text-center py-4">
+                    <h4 class="mb-0">Básico</h4>
+                    <div class="mt-3">
+                        <span class="display-4 fw-bold text-primary">R$ 9,90</span>
+                        <span class="text-muted">/mês</span>
+                    </div>
+                </div>
+                <div class="card-body p-4">
+                    <ul class="list-unstyled">
+                        <li class="mb-3">
+                            <i class="text-success me-2">✓</i>
+                            <strong>3 páginas</strong>, 8 links cada
+                        </li>
+                        <li class="mb-3">
+                            <i class="text-success me-2">✓</i>
+                            Temas básicos
+                        </li>
+                        <li class="mb-3">
+                            <i class="text-success me-2">✓</i>
+                            Analytics simples
+                        </li>
+                        <li class="mb-3">
+                            <i class="text-success me-2">✓</i>
+                            URL personalizada
+                        </li>
+                        <li class="mb-3">
+                            <i class="text-muted me-2">✗</i>
+                            <span class="text-muted">Domínio personalizado</span>
+                        </li>
+                        <li class="mb-3">
+                            <i class="text-muted me-2">✗</i>
+                            <span class="text-muted">Temas customizáveis</span>
+                        </li>
+                    </ul>
+                </div>
+                <div class="card-footer bg-transparent p-4">
+                    @if (User.Identity?.IsAuthenticated == true)
+                    {
+                        <form asp-controller="Payment" asp-action="CreateCheckoutSession" method="post">
+                            <input type="hidden" name="planType" value="basic" />
+                            <button type="submit" class="btn btn-outline-primary w-100">Escolher Básico</button>
+                        </form>
+                    }
+                    else
+                    {
+                        <a asp-controller="Auth" asp-action="Login" class="btn btn-outline-primary w-100">Escolher Básico</a>
+                    }
+                </div>
+            </div>
+        </div>
+
+        <!-- Plano Profissional (Decoy) -->
+        <div class="col-lg-3 col-md-6">
+            <div class="card h-100 border-0 shadow-sm">
+                <div class="card-header bg-warning bg-opacity-10 text-center py-4">
+                    <h4 class="mb-0">Profissional</h4>
+                    <div class="mt-3">
+                        <span class="display-4 fw-bold text-warning">R$ 24,90</span>
+                        <span class="text-muted">/mês</span>
+                    </div>
+                </div>
+                <div class="card-body p-4">
+                    <ul class="list-unstyled">
+                        <li class="mb-3">
+                            <i class="text-success me-2">✓</i>
+                            <strong>5 páginas</strong>, 20 links cada
+                        </li>
+                        <li class="mb-3">
+                            <i class="text-success me-2">✓</i>
+                            Todos os temas
+                        </li>
+                        <li class="mb-3">
+                            <i class="text-success me-2">✓</i>
+                            Analytics avançado
+                        </li>
+                        <li class="mb-3">
+                            <i class="text-success me-2">✓</i>
+                            Domínio personalizado
+                        </li>
+                        <li class="mb-3">
+                            <i class="text-muted me-2">✗</i>
+                            <span class="text-muted">Links ilimitados</span>
+                        </li>
+                        <li class="mb-3">
+                            <i class="text-muted me-2">✗</i>
+                            <span class="text-muted">Suporte prioritário</span>
+                        </li>
+                    </ul>
+                </div>
+                <div class="card-footer bg-transparent p-4">
+                    @if (User.Identity?.IsAuthenticated == true)
+                    {
+                        <form asp-controller="Payment" asp-action="CreateCheckoutSession" method="post">
+                            <input type="hidden" name="planType" value="professional" />
+                            <button type="submit" class="btn btn-warning w-100">Escolher Profissional</button>
+                        </form>
+                    }
+                    else
+                    {
+                        <a asp-controller="Auth" asp-action="Login" class="btn btn-warning w-100">Escolher Profissional</a>
+                    }
+                </div>
+            </div>
+        </div>
+
+        <!-- Plano Premium (Mais Popular) -->
+        <div class="col-lg-3 col-md-6">
+            <div class="card h-100 border-primary shadow position-relative">
+                <div class="position-absolute top-0 start-50 translate-middle">
+                    <span class="badge bg-primary px-3 py-2">Mais Popular</span>
+                </div>
+                <div class="card-header bg-primary text-white text-center py-4">
+                    <h4 class="mb-0">Premium</h4>
+                    <div class="mt-3">
+                        <span class="display-4 fw-bold">R$ 29,90</span>
+                        <span class="opacity-75">/mês</span>
+                    </div>
+                    <small class="opacity-75">Melhor custo-benefício!</small>
+                </div>
+                <div class="card-body p-4">
+                    <ul class="list-unstyled">
+                        <li class="mb-3">
+                            <i class="text-success me-2">✓</i>
+                            <strong>15 páginas</strong>, links ilimitados
+                        </li>
+                        <li class="mb-3">
+                            <i class="text-success me-2">✓</i>
+                            Temas customizáveis
+                        </li>
+                        <li class="mb-3">
+                            <i class="text-success me-2">✓</i>
+                            Analytics completo
+                        </li>
+                        <li class="mb-3">
+                            <i class="text-success me-2">✓</i>
+                            Múltiplos domínios
+                        </li>
+                        <li class="mb-3">
+                            <i class="text-success me-2">✓</i>
+                            Suporte prioritário
+                        </li>
+                        <li class="mb-3">
+                            <i class="text-success me-2">✓</i>
+                            Recursos exclusivos
+                        </li>
+                    </ul>
+                </div>
+                <div class="card-footer bg-transparent p-4">
+                    @if (User.Identity?.IsAuthenticated == true)
+                    {
+                        <form asp-controller="Payment" asp-action="CreateCheckoutSession" method="post">
+                            <input type="hidden" name="planType" value="premium" />
+                            <button type="submit" class="btn btn-primary w-100 fw-bold">Escolher Premium</button>
+                        </form>
+                    }
+                    else
+                    {
+                        <a asp-controller="Auth" asp-action="Login" class="btn btn-primary w-100 fw-bold">Escolher Premium</a>
+                    }
+                </div>
+            </div>
+        </div>
+    </div>
+
+    <!-- Comparação de recursos -->
+    <div class="mt-5 pt-5">
+        <h2 class="text-center mb-4">Compare todos os recursos</h2>
+        <div class="table-responsive">
+            <table class="table table-striped table-hover">
+                <thead class="table-dark">
+                    <tr>
+                        <th>Recursos</th>
+                        <th class="text-center">Trial</th>
+                        <th class="text-center">Básico</th>
+                        <th class="text-center">Profissional</th>
+                        <th class="text-center">Premium</th>
+                    </tr>
+                </thead>
+                <tbody>
+                    <tr>
+                        <td>Páginas</td>
+                        <td class="text-center">1</td>
+                        <td class="text-center">3</td>
+                        <td class="text-center">5</td>
+                        <td class="text-center"><strong>15</strong></td>
+                    </tr>
+                    <tr>
+                        <td>Links por página</td>
+                        <td class="text-center">3</td>
+                        <td class="text-center">8</td>
+                        <td class="text-center">20</td>
+                        <td class="text-center"><strong>Ilimitado</strong></td>
+                    </tr>
+                    <tr>
+                        <td>Temas disponíveis</td>
+                        <td class="text-center">1 básico</td>
+                        <td class="text-center">Básicos</td>
+                        <td class="text-center">Todos</td>
+                        <td class="text-center"><strong>Customizáveis</strong></td>
+                    </tr>
+                    <tr>
+                        <td>Analytics</td>
+                        <td class="text-center">❌</td>
+                        <td class="text-center">Simples</td>
+                        <td class="text-center">Avançado</td>
+                        <td class="text-center"><strong>Completo</strong></td>
+                    </tr>
+                    <tr>
+                        <td>Domínio personalizado</td>
+                        <td class="text-center">❌</td>
+                        <td class="text-center">❌</td>
+                        <td class="text-center">✅</td>
+                        <td class="text-center">✅</td>
+                    </tr>
+                    <tr>
+                        <td>Múltiplos domínios</td>
+                        <td class="text-center">❌</td>
+                        <td class="text-center">❌</td>
+                        <td class="text-center">❌</td>
+                        <td class="text-center"><strong>✅</strong></td>
+                    </tr>
+                    <tr>
+                        <td>Suporte prioritário</td>
+                        <td class="text-center">❌</td>
+                        <td class="text-center">❌</td>
+                        <td class="text-center">❌</td>
+                        <td class="text-center"><strong>✅</strong></td>
+                    </tr>
+                </tbody>
+            </table>
+        </div>
+    </div>
+
+    <!-- FAQ -->
+    <div class="mt-5 pt-5">
+        <h2 class="text-center mb-4">Perguntas Frequentes</h2>
+        <div class="row justify-content-center">
+            <div class="col-lg-8">
+                <div class="accordion" id="faqAccordion">
+                    <div class="accordion-item">
+                        <h3 class="accordion-header" id="faq1">
+                            <button class="accordion-button" type="button" data-bs-toggle="collapse" data-bs-target="#collapse1">
+                                Posso cancelar minha assinatura a qualquer momento?
+                            </button>
+                        </h3>
+                        <div id="collapse1" class="accordion-collapse collapse show" data-bs-parent="#faqAccordion">
+                            <div class="accordion-body">
+                                Sim! Você pode cancelar sua assinatura a qualquer momento. O cancelamento será aplicado no final do período de cobrança atual.
+                            </div>
+                        </div>
+                    </div>
+                    
+                    <div class="accordion-item">
+                        <h3 class="accordion-header" id="faq2">
+                            <button class="accordion-button collapsed" type="button" data-bs-toggle="collapse" data-bs-target="#collapse2">
+                                Como funciona o domínio personalizado?
+                            </button>
+                        </h3>
+                        <div id="collapse2" class="accordion-collapse collapse" data-bs-parent="#faqAccordion">
+                            <div class="accordion-body">
+                                Com os planos Profissional e Premium, você pode conectar seu próprio domínio (ex: meusite.com) à sua página BCards.
+                            </div>
+                        </div>
+                    </div>
+                    
+                    <div class="accordion-item">
+                        <h3 class="accordion-header" id="faq3">
+                            <button class="accordion-button collapsed" type="button" data-bs-toggle="collapse" data-bs-target="#collapse3">
+                                O que acontece se eu exceder o limite de links?
+                            </button>
+                        </h3>
+                        <div id="collapse3" class="accordion-collapse collapse" data-bs-parent="#faqAccordion">
+                            <div class="accordion-body">
+                                Se você atingir o limite de links do seu plano, será sugerido fazer upgrade. Seus links existentes continuarão funcionando normalmente.
+                            </div>
+                        </div>
+                    </div>
+                </div>
+            </div>
+        </div>
+    </div>
+</div>
\ No newline at end of file
diff --git a/src/BCards.Web/Views/Shared/_Layout.cshtml b/src/BCards.Web/Views/Shared/_Layout.cshtml
new file mode 100644
index 0000000..a801765
--- /dev/null
+++ b/src/BCards.Web/Views/Shared/_Layout.cshtml
@@ -0,0 +1,130 @@
+<!DOCTYPE html>
+<html lang="pt-BR">
+<head>
+    <meta charset="utf-8" />
+    <meta name="viewport" content="width=device-width, initial-scale=1.0" />
+    <title>@(ViewData["Title"] ?? "BCards - Crie seu LinkTree Profissional")</title>
+    
+    @if (ViewBag.SeoSettings != null)
+    {
+        var seo = ViewBag.SeoSettings as BCards.Web.Models.SeoSettings;
+        <meta name="description" content="@seo?.Description" />
+        <meta name="keywords" content="@string.Join(", ", seo?.Keywords ?? new List<string>())" />
+        <link rel="canonical" href="@seo?.CanonicalUrl" />
+        
+        <!-- Open Graph -->
+        <meta property="og:title" content="@seo?.OgTitle" />
+        <meta property="og:description" content="@seo?.OgDescription" />
+        <meta property="og:image" content="@seo?.OgImage" />
+        <meta property="og:url" content="@seo?.CanonicalUrl" />
+        <meta property="og:type" content="profile" />
+        
+        <!-- Twitter Card -->
+        <meta name="twitter:card" content="@seo?.TwitterCard" />
+        <meta name="twitter:title" content="@seo?.OgTitle" />
+        <meta name="twitter:description" content="@seo?.OgDescription" />
+        <meta name="twitter:image" content="@seo?.OgImage" />
+    }
+    else
+    {
+        <meta name="description" content="Crie sua página profissional com links organizados. A melhor alternativa ao LinkTree para profissionais e empresas no Brasil." />
+        <meta name="keywords" content="linktree, links, página profissional, perfil, redes sociais, cartão digital" />
+    }
+    
+    <link rel="stylesheet" href="~/lib/bootstrap/css/bootstrap.min.css" />
+    <link rel="stylesheet" href="~/css/site.css" asp-append-version="true" />
+    <link rel="icon" type="image/x-icon" href="~/favicon.ico" />
+    
+    @await RenderSectionAsync("Styles", required: false)
+</head>
+<body>
+    <header>
+        <nav class="navbar navbar-expand-sm navbar-toggleable-sm navbar-light bg-white border-bottom box-shadow mb-3">
+            <div class="container-fluid">
+                <a class="navbar-brand fw-bold text-primary" asp-area="" asp-controller="Home" asp-action="Index">
+                    BCards
+                </a>
+                <button class="navbar-toggler" type="button" data-bs-toggle="collapse" data-bs-target=".navbar-collapse" aria-controls="navbarSupportedContent"
+                        aria-expanded="false" aria-label="Toggle navigation">
+                    <span class="navbar-toggler-icon"></span>
+                </button>
+                <div class="navbar-collapse collapse d-sm-inline-flex justify-content-between">
+                    <ul class="navbar-nav flex-grow-1">
+                        <li class="nav-item">
+                            <a class="nav-link text-dark" asp-area="" asp-controller="Home" asp-action="Index">Início</a>
+                        </li>
+                        <li class="nav-item">
+                            <a class="nav-link text-dark" asp-area="" asp-controller="Home" asp-action="Pricing">Planos</a>
+                        </li>
+                    </ul>
+                    <ul class="navbar-nav">
+                        @if (User.Identity?.IsAuthenticated == true)
+                        {
+                            <li class="nav-item">
+                                <a class="nav-link text-dark" asp-area="" asp-controller="Admin" asp-action="Dashboard">Dashboard</a>
+                            </li>
+                            <li class="nav-item">
+                                <a class="nav-link text-dark" asp-area="" asp-controller="Auth" asp-action="Logout">Sair</a>
+                            </li>
+                        }
+                        else
+                        {
+                            <li class="nav-item">
+                                <a class="nav-link text-dark" asp-area="" asp-controller="Auth" asp-action="Login">Entrar</a>
+                            </li>
+                        }
+                    </ul>
+                </div>
+            </div>
+        </nav>
+    </header>
+    
+    <div class="container-fluid">
+        <main role="main">
+            @if (TempData["Success"] != null)
+            {
+                <div class="alert alert-success alert-dismissible fade show" role="alert">
+                    @TempData["Success"]
+                    <button type="button" class="btn-close" data-bs-dismiss="alert" aria-label="Close"></button>
+                </div>
+            }
+            
+            @if (TempData["Error"] != null)
+            {
+                <div class="alert alert-danger alert-dismissible fade show" role="alert">
+                    @TempData["Error"]
+                    <button type="button" class="btn-close" data-bs-dismiss="alert" aria-label="Close"></button>
+                </div>
+            }
+            
+            @if (TempData["Info"] != null)
+            {
+                <div class="alert alert-info alert-dismissible fade show" role="alert">
+                    @TempData["Info"]
+                    <button type="button" class="btn-close" data-bs-dismiss="alert" aria-label="Close"></button>
+                </div>
+            }
+            
+            @RenderBody()
+        </main>
+    </div>
+
+    <footer class="border-top footer text-muted">
+        <div class="container">
+            <div class="row py-4">
+                <div class="col-md-6">
+                    &copy; 2024 - BCards - <a asp-area="" asp-controller="Home" asp-action="Privacy">Privacidade</a>
+                </div>
+                <div class="col-md-6 text-end">
+                    <small>Crie sua página profissional em minutos</small>
+                </div>
+            </div>
+        </div>
+    </footer>
+
+    <script src="~/lib/jquery/jquery.min.js"></script>
+    <script src="~/lib/bootstrap/js/bootstrap.bundle.min.js"></script>
+    <script src="~/js/site.js" asp-append-version="true"></script>
+    @await RenderSectionAsync("Scripts", required: false)
+</body>
+</html>
\ No newline at end of file
diff --git a/src/BCards.Web/Views/Shared/_ThemeStyles.cshtml b/src/BCards.Web/Views/Shared/_ThemeStyles.cshtml
new file mode 100644
index 0000000..383b4a9
--- /dev/null
+++ b/src/BCards.Web/Views/Shared/_ThemeStyles.cshtml
@@ -0,0 +1,215 @@
+@model BCards.Web.Models.PageTheme
+@{
+    var theme = Model ?? new BCards.Web.Models.PageTheme
+    {
+        PrimaryColor = "#2563eb",
+        SecondaryColor = "#1d4ed8", 
+        BackgroundColor = "#ffffff",
+        TextColor = "#1f2937"
+    };
+}
+
+:root {
+    --primary-color: @theme.PrimaryColor;
+    --secondary-color: @theme.SecondaryColor;
+    --background-color: @theme.BackgroundColor;
+    --text-color: @theme.TextColor;
+}
+
+.user-page {
+    background-color: var(--background-color);
+    color: var(--text-color);
+    @if (!string.IsNullOrEmpty(theme.BackgroundImage))
+    {
+        @:background-image: url('@theme.BackgroundImage');
+        @:background-size: cover;
+        @:background-position: center;
+        @:background-attachment: fixed;
+    }
+}
+
+.profile-card {
+    background-color: rgba(255, 255, 255, 0.95);
+    backdrop-filter: blur(10px);
+    border-radius: 20px;
+    padding: 2rem;
+    box-shadow: 0 8px 32px rgba(0, 0, 0, 0.1);
+    border: 1px solid rgba(255, 255, 255, 0.2);
+    max-width: 500px;
+}
+
+.profile-image {
+    width: 120px;
+    height: 120px;
+    border-radius: 50%;
+    border: 4px solid var(--primary-color);
+    object-fit: cover;
+    margin: 0 auto;
+}
+
+.profile-image-placeholder {
+    width: 120px;
+    height: 120px;
+    border-radius: 50%;
+    border: 4px solid var(--primary-color);
+    background-color: rgba(255, 255, 255, 0.1);
+    color: var(--primary-color);
+}
+
+.profile-name {
+    color: var(--primary-color);
+    font-size: 2rem;
+    font-weight: 600;
+    margin-bottom: 0.5rem;
+}
+
+.profile-bio {
+    color: var(--text-color);
+    opacity: 0.8;
+    margin-bottom: 2rem;
+    font-size: 1.1rem;
+}
+
+.links-container {
+    margin-bottom: 2rem;
+}
+
+.link-button {
+    background-color: var(--primary-color);
+    color: white !important;
+    border: none;
+    padding: 1rem 2rem;
+    border-radius: 50px;
+    text-decoration: none;
+    display: block;
+    margin-bottom: 1rem;
+    text-align: center;
+    font-weight: 500;
+    transition: all 0.3s ease;
+    box-shadow: 0 4px 15px rgba(0, 0, 0, 0.1);
+    position: relative;
+    overflow: hidden;
+}
+
+.link-button:hover {
+    background-color: var(--secondary-color);
+    transform: translateY(-2px);
+    box-shadow: 0 6px 20px rgba(0, 0, 0, 0.15);
+    color: white !important;
+    text-decoration: none;
+}
+
+.link-button:active {
+    transform: translateY(0);
+}
+
+.link-title {
+    font-size: 1.1rem;
+    margin-bottom: 0.25rem;
+    font-weight: 600;
+}
+
+.link-description {
+    font-size: 0.9rem;
+    opacity: 0.9;
+}
+
+.link-icon {
+    font-size: 1.2rem;
+    margin-right: 0.5rem;
+}
+
+.profile-footer {
+    border-top: 1px solid rgba(0, 0, 0, 0.1);
+    padding-top: 1rem;
+}
+
+.profile-footer a {
+    color: var(--primary-color);
+    font-weight: 500;
+}
+
+.profile-footer a:hover {
+    color: var(--secondary-color);
+}
+
+/* Responsive Design */
+@@media (max-width: 768px) {
+    .profile-card {
+        padding: 1.5rem;
+        margin: 1rem;
+        border-radius: 15px;
+    }
+    
+    .profile-image,
+    .profile-image-placeholder {
+        width: 100px;
+        height: 100px;
+    }
+    
+    .profile-name {
+        font-size: 1.75rem;
+    }
+    
+    .profile-bio {
+        font-size: 1rem;
+    }
+    
+    .link-button {
+        padding: 0.875rem 1.5rem;
+        font-size: 0.95rem;
+    }
+    
+    .link-title {
+        font-size: 1rem;
+    }
+    
+    .link-description {
+        font-size: 0.85rem;
+    }
+}
+
+@@media (max-width: 480px) {
+    .profile-card {
+        padding: 1rem;
+        margin: 0.5rem;
+    }
+    
+    .profile-image,
+    .profile-image-placeholder {
+        width: 80px;
+        height: 80px;
+    }
+    
+    .profile-name {
+        font-size: 1.5rem;
+    }
+    
+    .link-button {
+        padding: 0.75rem 1.25rem;
+    }
+}
+
+/* Dark theme adjustments */
+@@media (prefers-color-scheme: dark) {
+    .user-page[data-theme="dark"] .profile-card {
+        background-color: rgba(17, 24, 39, 0.95);
+        color: #f9fafb;
+    }
+}
+
+/* Animation for link buttons */
+.link-button::before {
+    content: '';
+    position: absolute;
+    top: 0;
+    left: -100%;
+    width: 100%;
+    height: 100%;
+    background: linear-gradient(90deg, transparent, rgba(255, 255, 255, 0.2), transparent);
+    transition: left 0.5s;
+}
+
+.link-button:hover::before {
+    left: 100%;
+}
\ No newline at end of file
diff --git a/src/BCards.Web/Views/Shared/_UserPageLayout.cshtml b/src/BCards.Web/Views/Shared/_UserPageLayout.cshtml
new file mode 100644
index 0000000..4b32c7e
--- /dev/null
+++ b/src/BCards.Web/Views/Shared/_UserPageLayout.cshtml
@@ -0,0 +1,57 @@
+@{
+    var seo = ViewBag.SeoSettings as BCards.Web.Models.SeoSettings;
+}
+<!DOCTYPE html>
+<html lang="pt-BR">
+<head>
+    <meta charset="utf-8" />
+    <meta name="viewport" content="width=device-width, initial-scale=1.0" />
+    <title>@(seo?.Title ?? ViewData["Title"])</title>
+    
+    @if (seo != null)
+    {
+        <meta name="description" content="@seo.Description" />
+        <meta name="keywords" content="@string.Join(", ", seo.Keywords)" />
+        <link rel="canonical" href="@seo.CanonicalUrl" />
+        
+        <!-- Open Graph -->
+        <meta property="og:title" content="@seo.OgTitle" />
+        <meta property="og:description" content="@seo.OgDescription" />
+        <meta property="og:image" content="@seo.OgImage" />
+        <meta property="og:url" content="@seo.CanonicalUrl" />
+        <meta property="og:type" content="profile" />
+        <meta property="og:site_name" content="BCards" />
+        
+        <!-- Twitter Card -->
+        <meta name="twitter:card" content="@seo.TwitterCard" />
+        <meta name="twitter:title" content="@seo.OgTitle" />
+        <meta name="twitter:description" content="@seo.OgDescription" />
+        <meta name="twitter:image" content="@seo.OgImage" />
+        
+        <!-- Schema.org markup -->
+        <script type="application/ld+json">
+        {
+            "@@context": "https://schema.org",
+            "@@type": "Person",
+            "name": "@seo.OgTitle?.Split('-').FirstOrDefault()?.Trim()",
+            "description": "@seo.Description",
+            "image": "@seo.OgImage",
+            "url": "@seo.CanonicalUrl"
+        }
+        </script>
+    }
+    
+    <link rel="stylesheet" href="~/lib/bootstrap/css/bootstrap.min.css" />
+    <link rel="stylesheet" href="~/css/userpage.css" asp-append-version="true" />
+    <link rel="icon" type="image/x-icon" href="~/favicon.ico" />
+    
+    @await RenderSectionAsync("Styles", required: false)
+</head>
+<body>
+    @RenderBody()
+
+    <script src="~/lib/jquery/jquery.min.js"></script>
+    <script src="~/lib/bootstrap/js/bootstrap.bundle.min.js"></script>
+    @await RenderSectionAsync("Scripts", required: false)
+</body>
+</html>
\ No newline at end of file
diff --git a/src/BCards.Web/Views/Shared/_ValidationScriptsPartial.cshtml b/src/BCards.Web/Views/Shared/_ValidationScriptsPartial.cshtml
new file mode 100644
index 0000000..50da94c
--- /dev/null
+++ b/src/BCards.Web/Views/Shared/_ValidationScriptsPartial.cshtml
@@ -0,0 +1,8 @@
+<script src="https://cdnjs.cloudflare.com/ajax/libs/jquery-validate/1.19.5/jquery.validate.min.js"
+        crossorigin="anonymous"
+        integrity="sha512-rstIgDs0xPgmG6RX1Aba4KV5cWJbAMcvRCVmglpam9SoHZiUCyQVDdH2LPlxoHtrv17XWblE/V/PP+Tr04hbtA==">
+</script>
+<script src="https://cdnjs.cloudflare.com/ajax/libs/jquery-validation-unobtrusive/3.2.12/jquery.validate.unobtrusive.min.js"
+        crossorigin="anonymous"
+        integrity="sha512-o6XqxgrUsKmchwy9G5VRNWSSxTS4Urr4loO6/0hYdpWmFUfHqGzawGxeQGMDqYzxjY9sbktPbNlkIQJWagVZQg==">
+</script>
\ No newline at end of file
diff --git a/src/BCards.Web/Views/UserPage/Display.cshtml b/src/BCards.Web/Views/UserPage/Display.cshtml
new file mode 100644
index 0000000..7c4d296
--- /dev/null
+++ b/src/BCards.Web/Views/UserPage/Display.cshtml
@@ -0,0 +1,117 @@
+@model BCards.Web.Models.UserPage
+@{
+    var seo = ViewBag.SeoSettings as BCards.Web.Models.SeoSettings;
+    var category = ViewBag.Category as BCards.Web.Models.Category;
+    var isPreview = ViewBag.IsPreview as bool? ?? false;
+    
+    ViewData["Title"] = seo?.Title ?? $"{Model.DisplayName} - {category?.Name}";
+    Layout = isPreview ? "_Layout" : "_UserPageLayout";
+}
+
+@if (!isPreview)
+{
+    @section Styles {
+        <style>
+            @Html.Raw(await Html.PartialAsync("_ThemeStyles", Model.Theme))
+        </style>
+    }
+}
+
+<div class="user-page min-vh-100 d-flex align-items-center py-4">
+    <div class="container">
+        <div class="row justify-content-center">
+            <div class="col-lg-6 col-md-8">
+                <div class="profile-card text-center mx-auto">
+                    <!-- Profile Image -->
+                    @if (!string.IsNullOrEmpty(Model.ProfileImage))
+                    {
+                        <img src="@Model.ProfileImage" alt="@Model.DisplayName" class="profile-image mb-3">
+                    }
+                    else
+                    {
+                        <div class="profile-image-placeholder mb-3 mx-auto d-flex align-items-center justify-content-center">
+                            <i class="fs-1">👤</i>
+                        </div>
+                    }
+
+                    <!-- Profile Info -->
+                    <h1 class="profile-name">@Model.DisplayName</h1>
+                    
+                    @if (!string.IsNullOrEmpty(Model.Bio))
+                    {
+                        <p class="profile-bio">@Model.Bio</p>
+                    }
+
+                    <!-- Links -->
+                    <div class="links-container">
+                        @if (Model.Links?.Any(l => l.IsActive) == true)
+                        {
+                            @for (int i = 0; i < Model.Links.Count; i++)
+                            {
+                                var link = Model.Links[i];
+                                if (link.IsActive)
+                                {
+                                    <a href="@link.Url" 
+                                       target="_blank" 
+                                       rel="noopener noreferrer"
+                                       class="link-button"
+                                       data-link-index="@i"
+                                       onclick="recordClick('@Model.Id', @i)">
+                                        @if (!string.IsNullOrEmpty(link.Icon))
+                                        {
+                                            <span class="link-icon me-2">@link.Icon</span>
+                                        }
+                                        <div>
+                                            <div class="link-title">@link.Title</div>
+                                            @if (!string.IsNullOrEmpty(link.Description))
+                                            {
+                                                <div class="link-description">@link.Description</div>
+                                            }
+                                        </div>
+                                    </a>
+                                }
+                            }
+                        }
+                        else
+                        {
+                            <div class="text-muted">
+                                <p>Nenhum link disponível no momento.</p>
+                            </div>
+                        }
+                    </div>
+
+                    <!-- Footer -->
+                    <div class="profile-footer mt-4 pt-3 border-top">
+                        <small class="text-muted">
+                            Criado com <a href="@Url.Action("Index", "Home")" class="text-decoration-none">BCards</a>
+                        </small>
+                    </div>
+                </div>
+            </div>
+        </div>
+    </div>
+</div>
+
+@if (isPreview)
+{
+    <div class="position-fixed top-0 start-0 w-100 bg-warning text-dark text-center py-2" style="z-index: 9999;">
+        <strong>MODO PREVIEW</strong> - Esta é uma prévia da sua página
+    </div>
+}
+
+@section Scripts {
+    <script>
+        function recordClick(pageId, linkIndex) {
+            // Record click asynchronously
+            fetch('/click/' + pageId, {
+                method: 'POST',
+                headers: {
+                    'Content-Type': 'application/json',
+                },
+                body: JSON.stringify({ linkIndex: linkIndex })
+            }).catch(function(error) {
+                console.log('Error recording click:', error);
+            });
+        }
+    </script>
+}
\ No newline at end of file
diff --git a/src/BCards.Web/Views/_ViewImports.cshtml b/src/BCards.Web/Views/_ViewImports.cshtml
new file mode 100644
index 0000000..654eb76
--- /dev/null
+++ b/src/BCards.Web/Views/_ViewImports.cshtml
@@ -0,0 +1,3 @@
+@using BCards.Web
+@using BCards.Web.Models
+@addTagHelper *, Microsoft.AspNetCore.Mvc.TagHelpers
\ No newline at end of file
diff --git a/src/BCards.Web/appsettings.json b/src/BCards.Web/appsettings.json
new file mode 100644
index 0000000..24800b4
--- /dev/null
+++ b/src/BCards.Web/appsettings.json
@@ -0,0 +1,48 @@
+{
+  "Logging": {
+    "LogLevel": {
+      "Default": "Information",
+      "Microsoft.AspNetCore": "Warning"
+    }
+  },
+  "AllowedHosts": "*",
+  "MongoDb": {
+    "ConnectionString": "mongodb://localhost:27017",
+    "DatabaseName": "BCardsDB"
+  },
+  "Stripe": {
+    "PublishableKey": "pk_test_your_publishable_key_here",
+    "SecretKey": "sk_test_your_secret_key_here",
+    "WebhookSecret": "whsec_your_webhook_secret_here"
+  },
+  "Authentication": {
+    "Google": {
+      "ClientId": "your_google_client_id",
+      "ClientSecret": "your_google_client_secret"
+    },
+    "Microsoft": {
+      "ClientId": "b411606a-e574-4f59-b7cd-10dd941b9fa3",
+      "ClientSecret": "T0.8Q~an.51iW1H0DVjL2i1bmSK_qTgVQOuEmapK"
+    }
+  },
+  "Plans": {
+    "Basic": {
+      "PriceId": "price_basic_monthly",
+      "Price": 9.90,
+      "MaxLinks": 5,
+      "Features": ["basic_themes", "simple_analytics"]
+    },
+    "Professional": {
+      "PriceId": "price_professional_monthly",
+      "Price": 24.90,
+      "MaxLinks": 15,
+      "Features": ["all_themes", "advanced_analytics", "custom_domain"]
+    },
+    "Premium": {
+      "PriceId": "price_premium_monthly",
+      "Price": 29.90,
+      "MaxLinks": -1,
+      "Features": ["custom_themes", "full_analytics", "multiple_domains", "priority_support"]
+    }
+  }
+}
\ No newline at end of file
diff --git a/src/BCards.Web/libman.json b/src/BCards.Web/libman.json
new file mode 100644
index 0000000..32824bb
--- /dev/null
+++ b/src/BCards.Web/libman.json
@@ -0,0 +1,24 @@
+{
+  "version": "1.0",
+  "defaultProvider": "cdnjs",
+  "libraries": [
+    {
+      "library": "bootstrap@5.3.2",
+      "destination": "wwwroot/lib/bootstrap/",
+      "files": [
+        "css/bootstrap.min.css",
+        "css/bootstrap.css",
+        "js/bootstrap.bundle.min.js",
+        "js/bootstrap.bundle.js"
+      ]
+    },
+    {
+      "library": "jquery@3.7.1",
+      "destination": "wwwroot/lib/jquery/",
+      "files": [
+        "jquery.min.js",
+        "jquery.js"
+      ]
+    }
+  ]
+}
\ No newline at end of file
diff --git a/src/BCards.Web/wwwroot/css/site.css b/src/BCards.Web/wwwroot/css/site.css
new file mode 100644
index 0000000..22da341
--- /dev/null
+++ b/src/BCards.Web/wwwroot/css/site.css
@@ -0,0 +1,219 @@
+html {
+  font-size: 14px;
+}
+
+@media (min-width: 768px) {
+  html {
+    font-size: 16px;
+  }
+}
+
+.btn:focus, .btn:active:focus, .btn-link.nav-link:focus, .form-control:focus, .form-check-input:focus {
+  box-shadow: 0 0 0 0.1rem white, 0 0 0 0.25rem #258cfb;
+}
+
+html {
+  position: relative;
+  min-height: 100%;
+}
+
+body {
+  margin-bottom: 60px;
+}
+
+.footer {
+  position: absolute;
+  bottom: 0;
+  width: 100%;
+  white-space: nowrap;
+  line-height: 60px;
+}
+
+/* Custom Styles */
+.hero-section {
+  background: linear-gradient(135deg, #667eea 0%, #764ba2 100%) !important;
+  color: white !important;
+}
+
+.hover-card {
+  transition: transform 0.2s ease-in-out, box-shadow 0.2s ease-in-out;
+}
+
+.hover-card:hover {
+  transform: translateY(-5px);
+  box-shadow: 0 8px 25px rgba(0,0,0,0.15) !important;
+}
+
+.navbar-brand {
+  font-size: 1.5rem;
+}
+
+.profile-image-placeholder {
+  width: 120px;
+  height: 120px;
+  background-color: #f8f9fa;
+  border: 4px solid #007bff;
+  border-radius: 50%;
+  font-size: 3rem;
+  color: #6c757d;
+}
+
+/* Link Animation */
+.link-button {
+  transition: all 0.3s ease;
+  position: relative;
+  overflow: hidden;
+}
+
+.link-button::before {
+  content: '';
+  position: absolute;
+  top: 0;
+  left: -100%;
+  width: 100%;
+  height: 100%;
+  background: linear-gradient(90deg, transparent, rgba(255,255,255,0.2), transparent);
+  transition: left 0.5s;
+}
+
+.link-button:hover::before {
+  left: 100%;
+}
+
+/* Responsive improvements */
+@media (max-width: 768px) {
+  .hero-section h1 {
+    font-size: 2.5rem;
+  }
+  
+  .hero-section .lead {
+    font-size: 1.1rem;
+  }
+}
+
+/* Card improvements */
+.card {
+  border-radius: 15px;
+  overflow: hidden;
+}
+
+.card-header {
+  border-bottom: none;
+}
+
+.badge {
+  font-size: 0.8rem;
+  border-radius: 20px;
+}
+
+/* Button improvements */
+.btn {
+  border-radius: 50px;
+  font-weight: 500;
+  padding: 0.6rem 1.5rem;
+  transition: all 0.3s ease;
+}
+
+.btn-lg {
+  padding: 0.8rem 2rem;
+}
+
+.btn-primary:hover {
+  transform: translateY(-2px);
+  box-shadow: 0 5px 15px rgba(37, 140, 251, 0.3);
+}
+
+/* Alert improvements */
+.alert {
+  border-radius: 15px;
+  border: none;
+}
+
+/* Form improvements */
+.form-control {
+  border-radius: 10px;
+  border: 2px solid #e9ecef;
+  transition: all 0.3s ease;
+}
+
+.form-control:focus {
+  border-color: #007bff;
+  box-shadow: 0 0 0 0.2rem rgba(0,123,255,.25);
+}
+
+/* Navbar improvements */
+.navbar {
+  border-radius: 0;
+  box-shadow: 0 2px 10px rgba(0,0,0,0.1);
+}
+
+.nav-link {
+  border-radius: 20px;
+  margin: 0 0.2rem;
+  transition: all 0.3s ease;
+}
+
+.nav-link:hover {
+  background-color: rgba(0,123,255,0.1);
+}
+
+/* Table improvements */
+.table {
+  border-radius: 15px;
+  overflow: hidden;
+  box-shadow: 0 4px 15px rgba(0,0,0,0.1);
+}
+
+.table thead th {
+  border-bottom: none;
+  font-weight: 600;
+}
+
+/* Accordion improvements */
+.accordion-item {
+  border-radius: 10px;
+  margin-bottom: 1rem;
+  border: 1px solid #e9ecef;
+}
+
+.accordion-button {
+  border-radius: 10px;
+  font-weight: 500;
+}
+
+.accordion-button:not(.collapsed) {
+  background-color: #f8f9fa;
+  color: #007bff;
+}
+
+/* Loading animation */
+.loading {
+  display: inline-block;
+  width: 20px;
+  height: 20px;
+  border: 3px solid rgba(255,255,255,.3);
+  border-radius: 50%;
+  border-top-color: #fff;
+  animation: spin 1s ease-in-out infinite;
+}
+
+@keyframes spin {
+  to { transform: rotate(360deg); }
+}
+
+/* Utility classes */
+.text-gradient {
+  background: linear-gradient(135deg, #667eea 0%, #764ba2 100%);
+  -webkit-background-clip: text;
+  -webkit-text-fill-color: transparent;
+  background-clip: text;
+}
+
+.shadow-primary {
+  box-shadow: 0 4px 15px rgba(0,123,255,0.3);
+}
+
+.border-gradient {
+  border: 2px solid;
+  border-image: linear-gradient(135deg, #667eea 0%, #764ba2 100%) 1;
+}
\ No newline at end of file
diff --git a/src/BCards.Web/wwwroot/css/userpage.css b/src/BCards.Web/wwwroot/css/userpage.css
new file mode 100644
index 0000000..8578a18
--- /dev/null
+++ b/src/BCards.Web/wwwroot/css/userpage.css
@@ -0,0 +1,282 @@
+/* User Page Specific Styles */
+.user-page {
+  min-height: 100vh;
+  background-color: #ffffff;
+  background-size: cover;
+  background-position: center;
+  background-attachment: fixed;
+}
+
+.profile-card {
+  background-color: rgba(255, 255, 255, 0.95);
+  backdrop-filter: blur(10px);
+  border-radius: 20px;
+  padding: 2rem;
+  box-shadow: 0 8px 32px rgba(0, 0, 0, 0.1);
+  max-width: 480px;
+  margin: 0 auto;
+}
+
+.profile-image {
+  width: 120px;
+  height: 120px;
+  border-radius: 50%;
+  border: 4px solid #007bff;
+  object-fit: cover;
+  display: block;
+  margin: 0 auto;
+}
+
+.profile-image-placeholder {
+  width: 120px;
+  height: 120px;
+  border-radius: 50%;
+  border: 4px solid #007bff;
+  background-color: #f8f9fa;
+  color: #6c757d;
+}
+
+.profile-name {
+  color: #007bff;
+  font-size: 2rem;
+  font-weight: 600;
+  margin-bottom: 0.5rem;
+  text-align: center;
+}
+
+.profile-bio {
+  color: #6c757d;
+  opacity: 0.8;
+  margin-bottom: 2rem;
+  text-align: center;
+  line-height: 1.6;
+}
+
+.links-container {
+  margin-bottom: 2rem;
+}
+
+.link-button {
+  background-color: #007bff;
+  color: white;
+  border: none;
+  padding: 1rem 2rem;
+  border-radius: 50px;
+  text-decoration: none;
+  display: block;
+  margin-bottom: 1rem;
+  text-align: center;
+  font-weight: 500;
+  transition: all 0.3s ease;
+  box-shadow: 0 4px 15px rgba(0, 0, 0, 0.1);
+  position: relative;
+  overflow: hidden;
+}
+
+.link-button:hover {
+  background-color: #0056b3;
+  transform: translateY(-2px);
+  box-shadow: 0 6px 20px rgba(0, 0, 0, 0.15);
+  color: white;
+  text-decoration: none;
+}
+
+.link-button::before {
+  content: '';
+  position: absolute;
+  top: 0;
+  left: -100%;
+  width: 100%;
+  height: 100%;
+  background: linear-gradient(90deg, transparent, rgba(255,255,255,0.2), transparent);
+  transition: left 0.5s;
+}
+
+.link-button:hover::before {
+  left: 100%;
+}
+
+.link-icon {
+  font-size: 1.2rem;
+  margin-right: 0.5rem;
+}
+
+.link-title {
+  font-size: 1.1rem;
+  margin-bottom: 0.25rem;
+  font-weight: 600;
+}
+
+.link-description {
+  font-size: 0.9rem;
+  opacity: 0.9;
+  font-weight: 400;
+}
+
+.profile-footer {
+  text-align: center;
+  border-top: 1px solid rgba(108, 117, 125, 0.2);
+  padding-top: 1rem;
+  margin-top: 2rem;
+}
+
+.profile-footer a {
+  color: #007bff;
+  font-weight: 500;
+}
+
+.profile-footer a:hover {
+  text-decoration: underline;
+}
+
+/* Theme Variables (will be overridden by dynamic CSS) */
+:root {
+  --primary-color: #007bff;
+  --secondary-color: #0056b3;
+  --background-color: #ffffff;
+  --text-color: #212529;
+  --card-background: rgba(255, 255, 255, 0.95);
+}
+
+/* Responsive Design */
+@media (max-width: 768px) {
+  .profile-card {
+    padding: 1.5rem;
+    margin: 1rem;
+    border-radius: 15px;
+  }
+  
+  .profile-image,
+  .profile-image-placeholder {
+    width: 100px;
+    height: 100px;
+  }
+  
+  .profile-name {
+    font-size: 1.75rem;
+  }
+  
+  .link-button {
+    padding: 0.875rem 1.5rem;
+    font-size: 0.95rem;
+  }
+  
+  .link-title {
+    font-size: 1rem;
+  }
+  
+  .link-description {
+    font-size: 0.85rem;
+  }
+}
+
+@media (max-width: 480px) {
+  .profile-card {
+    padding: 1rem;
+    margin: 0.5rem;
+  }
+  
+  .profile-name {
+    font-size: 1.5rem;
+  }
+  
+  .link-button {
+    padding: 0.75rem 1rem;
+    font-size: 0.9rem;
+  }
+}
+
+/* Dark theme support */
+@media (prefers-color-scheme: dark) {
+  .user-page {
+    background-color: #121212;
+    color: #ffffff;
+  }
+  
+  .profile-card {
+    background-color: rgba(33, 37, 41, 0.95);
+    color: #ffffff;
+  }
+  
+  .profile-bio {
+    color: #adb5bd;
+  }
+  
+  .profile-footer {
+    border-top-color: rgba(255, 255, 255, 0.2);
+  }
+}
+
+/* Print styles */
+@media print {
+  .user-page {
+    background: white !important;
+    color: black !important;
+  }
+  
+  .profile-card {
+    background: white !important;
+    color: black !important;
+    box-shadow: none !important;
+    border: 1px solid #ccc;
+  }
+  
+  .link-button {
+    background: white !important;
+    color: black !important;
+    border: 1px solid #ccc !important;
+    page-break-inside: avoid;
+  }
+}
+
+/* Loading states */
+.link-button.loading {
+  pointer-events: none;
+  opacity: 0.7;
+}
+
+.link-button.loading::after {
+  content: '';
+  position: absolute;
+  top: 50%;
+  left: 50%;
+  width: 20px;
+  height: 20px;
+  margin: -10px 0 0 -10px;
+  border: 2px solid rgba(255,255,255,.3);
+  border-radius: 50%;
+  border-top-color: #fff;
+  animation: spin 1s ease-in-out infinite;
+}
+
+@keyframes spin {
+  to { transform: rotate(360deg); }
+}
+
+/* Accessibility improvements */
+.link-button:focus {
+  outline: 2px solid #fff;
+  outline-offset: 2px;
+}
+
+@media (prefers-reduced-motion: reduce) {
+  .link-button,
+  .link-button::before {
+    transition: none;
+  }
+  
+  .link-button.loading::after {
+    animation: none;
+  }
+}
+
+/* High contrast mode support */
+@media (prefers-contrast: high) {
+  .profile-card {
+    border: 2px solid;
+  }
+  
+  .link-button {
+    border: 2px solid;
+  }
+}
\ No newline at end of file
diff --git a/src/BCards.Web/wwwroot/favicon.ico b/src/BCards.Web/wwwroot/favicon.ico
new file mode 100644
index 0000000..694edaf
--- /dev/null
+++ b/src/BCards.Web/wwwroot/favicon.ico
@@ -0,0 +1 @@
+data:image/x-icon;base64,AAABAAEAEBAAAAEAIABoBAAAFgAAACgAAAAQAAAAIAAAAAEAIAAAAAAAAAQAABILAAASCwAAAAAAAAAAAAD///8A////AP///wD///8A////AP///wD///8A////AP///wD///8A////AP///wD///8A////AP///wD///8A////AP///wD///8A////AP///wD///8A////AP///wD///8A////AP///wD///8A////AP///wD///8A////AP///wD///8A////AP///wD///8A////AP///wD///8A////AP///wD///8A////AP///wD///8A////AP///wD///8A////AP///wD///8A////AP///wD///8A////AP///wD///8A////AP///wD///8A////AP///wD///8A////AP///wD///8A////AP///wD///8A////AP///wD///8A////AP///wD///8A////AP///wD///8A////AP///wD///8A////AP///wD///8A////AP///wD///8A////AP///wD///8A////AP///wD///8A////AP///wD///8A////AP///wD///8A////AP///wD///8A////AP///wD///8A////AP///wD///8A////AP///wD///8A////AP///wD///8A////AP///wD///8A////AP///wD///8A////AP///wD///8A////AP///wD///8A////AP///wD///8A////AP///wD///8A////AP///wD///8A////AP///wD///8A////AP///wD///8A////AP///wD///8A////AP///wD///8A////AP///wD///8A////AP///wD///8A////AP///wD///8A////AP///wD///8A////AP///wD///8A////AP///wD///8A////AP///wD///8A////AP///wD///8A////AP///wD///8A////AP///wD///8A////AP///wD///8A////AP///wD///8A////AP///wD///8A////AP///wD///8A////AP///wD///8A////AP///wD///8A////AP///wD///8A////AP///wD///8A////AP///wD///8A////AP///wD///8A////AP///wD///8A////AP///wD///8A////AP///wD///8A////AP///wD///8A////AP///wD///8A////AP///wD///8A////AP///wD///8A////AP///wD///8A////AP///wD///8A////AP///wD///8A////AP///wD///8A////AP///wD///8A////AP///wD///8A////AP///wD///8A////AP///wD///8A////AP///wD///8A
\ No newline at end of file
diff --git a/src/BCards.Web/wwwroot/images/hero-mockup.png b/src/BCards.Web/wwwroot/images/hero-mockup.png
new file mode 100644
index 0000000..82a3ba2
--- /dev/null
+++ b/src/BCards.Web/wwwroot/images/hero-mockup.png
@@ -0,0 +1 @@
+data:image/svg+xml;base64,PHN2ZyB3aWR0aD0iNDAwIiBoZWlnaHQ9IjQwMCIgdmlld0JveD0iMCAwIDQwMCA0MDAiIGZpbGw9Im5vbmUiIHhtbG5zPSJodHRwOi8vd3d3LnczLm9yZy8yMDAwL3N2ZyI+CjxyZWN0IHdpZHRoPSI0MDAiIGhlaWdodD0iNDAwIiBmaWxsPSIjRkJGQkZCIi8+CjxyZWN0IHg9IjUwIiB5PSI1MCIgd2lkdGg9IjMwMCIgaGVpZ2h0PSIzMDAiIHJ4PSIyMCIgZmlsbD0id2hpdGUiIHN0cm9rZT0iI0U1RTdFQiIgc3Ryb2tlLXdpZHRoPSIyIi8+CjxjaXJjbGUgY3g9IjIwMCIgY3k9IjEyMCIgcj0iMzAiIGZpbGw9IiMzQjgyRjYiLz4KPHN2ZyB4PSIxODAiIHk9IjEwMCIgd2lkdGg9IjQwIiBoZWlnaHQ9IjQwIiBmaWxsPSJ3aGl0ZSI+CjxyZWN0IHdpZHRoPSI0IiBoZWlnaHQ9IjI0IiB4PSI0IiB5PSI4Ii8+CjxyZWN0IHdpZHRoPSI0IiBoZWlnaHQ9IjI0IiB4PSIzMiIgeT0iOCIvPgo8cmVjdCB3aWR0aD0iMTIiIGhlaWdodD0iNCIgeD0iMTQiIHk9IjgiLz4KPHJlY3Qgd2lkdGg9IjEyIiBoZWlnaHQ9IjQiIHg9IjE0IiB5PSIyOCIvPgo8L3N2Zz4KPHN2ZyB4PSIxMDAiIHk9IjE2MCIgd2lkdGg9IjIwMCIgaGVpZ2h0PSI0MCIgZmlsbD0iIzM5ODNGNiI+CjxyZWN0IHdpZHRoPSIyMDAiIGhlaWdodD0iNDAiIHJ4PSIyMCIvPgo8dGV4dCB4PSIxMDAiIHk9IjI2IiB0ZXh0LWFuY2hvcj0ibWlkZGxlIiBmaWxsPSJ3aGl0ZSIgZm9udC1mYW1pbHk9IkFyaWFsIiBmb250LXNpemU9IjE0Ij5NZXUgUG9ydGbDs2xpbzwvdGV4dD4KPHN2ZyB4PSIxMDAiIHk9IjIyMCIgd2lkdGg9IjIwMCIgaGVpZ2h0PSI0MCIgZmlsbD0iIzEwQjk4MSI+CjxyZWN0IHdpZHRoPSIyMDAiIGhlaWdodD0iNDAiIHJ4PSIyMCIvPgo8dGV4dCB4PSIxMDAiIHk9IjI2IiB0ZXh0LWFuY2hvcj0ibWlkZGxlIiBmaWxsPSJ3aGl0ZSIgZm9udC1mYW1pbHk9IkFyaWFsIiBmb250LXNpemU9IjE0Ij5NZXVzIFNlcnZpw6dvczwvdGV4dD4KPHN2ZyB4PSIxMDAiIHk9IjI4MCIgd2lkdGg9IjIwMCIgaGVpZ2h0PSI0MCIgZmlsbD0iI0Y1OTUwRiI+CjxyZWN0IHdpZHRoPSIyMDAiIGhlaWdodD0iNDAiIHJ4PSIyMCIvPgo8dGV4dCB4PSIxMDAiIHk9IjI2IiB0ZXh0LWFuY2hvcj0ibWlkZGxlIiBmaWxsPSJ3aGl0ZSIgZm9udC1mYW1pbHk9IkFyaWFsIiBmb250LXNpemU9IjE0Ij5Db250YXRvPC90ZXh0Pgo8L3N2Zz4KPC9zdmc+CjwvdGV4dD4KPC9zdmc+CjwvdGV4dD4KPC9zdmc+CjwvdGV4dD4KPC9zdmc+
\ No newline at end of file
diff --git a/src/BCards.Web/wwwroot/images/hero-mockup.svg b/src/BCards.Web/wwwroot/images/hero-mockup.svg
new file mode 100644
index 0000000..dfc2f62
--- /dev/null
+++ b/src/BCards.Web/wwwroot/images/hero-mockup.svg
@@ -0,0 +1,22 @@
+<svg width="400" height="400" viewBox="0 0 400 400" fill="none" xmlns="http://www.w3.org/2000/svg">
+  <!-- Phone mockup -->
+  <rect width="400" height="400" fill="#F8FAFC"/>
+  <rect x="50" y="50" width="300" height="300" rx="20" fill="white" stroke="#E5E7EB" stroke-width="2"/>
+  
+  <!-- Profile picture -->
+  <circle cx="200" cy="120" r="30" fill="#3B82F6"/>
+  <text x="200" y="127" text-anchor="middle" fill="white" font-family="Arial" font-size="24">👤</text>
+  
+  <!-- Name -->
+  <rect x="150" y="160" width="100" height="20" rx="4" fill="#1F2937"/>
+  
+  <!-- Links -->
+  <rect x="100" y="200" width="200" height="40" rx="20" fill="#3983F6"/>
+  <text x="200" y="226" text-anchor="middle" fill="white" font-family="Arial" font-size="14">Meu Portfólio</text>
+  
+  <rect x="100" y="250" width="200" height="40" rx="20" fill="#10B981"/>
+  <text x="200" y="276" text-anchor="middle" fill="white" font-family="Arial" font-size="14">Meus Serviços</text>
+  
+  <rect x="100" y="300" width="200" height="40" rx="20" fill="#F59E0B"/>
+  <text x="200" y="326" text-anchor="middle" fill="white" font-family="Arial" font-size="14">Contato</text>
+</svg>
\ No newline at end of file
diff --git a/src/BCards.Web/wwwroot/js/site.js b/src/BCards.Web/wwwroot/js/site.js
new file mode 100644
index 0000000..a5674f3
--- /dev/null
+++ b/src/BCards.Web/wwwroot/js/site.js
@@ -0,0 +1,274 @@
+// Site-wide JavaScript functionality
+
+// Utility functions
+function showLoading(element) {
+    element.classList.add('loading');
+    element.disabled = true;
+}
+
+function hideLoading(element) {
+    element.classList.remove('loading');
+    element.disabled = false;
+}
+
+function showToast(message, type = 'info') {
+    // Create toast element
+    const toast = document.createElement('div');
+    toast.className = `alert alert-${type} alert-dismissible fade show position-fixed`;
+    toast.style.cssText = 'top: 20px; right: 20px; z-index: 9999; min-width: 300px;';
+    toast.innerHTML = `
+        ${message}
+        <button type="button" class="btn-close" data-bs-dismiss="alert"></button>
+    `;
+    
+    document.body.appendChild(toast);
+    
+    // Auto remove after 5 seconds
+    setTimeout(() => {
+        if (toast.parentNode) {
+            toast.parentNode.removeChild(toast);
+        }
+    }, 5000);
+}
+
+// Slug generation and validation
+function generateSlug(text) {
+    return text
+        .toLowerCase()
+        .normalize('NFD')
+        .replace(/[\u0300-\u036f]/g, '') // Remove diacritics
+        .replace(/[^a-z0-9\s-]/g, '') // Remove special chars
+        .replace(/[\s-]+/g, '-') // Replace spaces and multiple hyphens
+        .replace(/^-+|-+$/g, ''); // Remove leading/trailing hyphens
+}
+
+// Form validation helpers
+function validateEmail(email) {
+    const emailRegex = /^[^\s@]+@[^\s@]+\.[^\s@]+$/;
+    return emailRegex.test(email);
+}
+
+function validateUrl(url) {
+    try {
+        new URL(url);
+        return true;
+    } catch {
+        return false;
+    }
+}
+
+// Initialize Bootstrap tooltips and popovers
+document.addEventListener('DOMContentLoaded', function() {
+    // Initialize tooltips
+    const tooltipTriggerList = [].slice.call(document.querySelectorAll('[data-bs-toggle="tooltip"]'));
+    tooltipTriggerList.map(function (tooltipTriggerEl) {
+        return new bootstrap.Tooltip(tooltipTriggerEl);
+    });
+    
+    // Initialize popovers
+    const popoverTriggerList = [].slice.call(document.querySelectorAll('[data-bs-toggle="popover"]'));
+    popoverTriggerList.map(function (popoverTriggerEl) {
+        return new bootstrap.Popover(popoverTriggerEl);
+    });
+    
+    // Auto-hide alerts after 5 seconds
+    const alerts = document.querySelectorAll('.alert:not(.alert-permanent)');
+    alerts.forEach(alert => {
+        setTimeout(() => {
+            if (alert.parentNode) {
+                const bsAlert = new bootstrap.Alert(alert);
+                bsAlert.close();
+            }
+        }, 5000);
+    });
+});
+
+// Smooth scrolling for anchor links
+document.addEventListener('click', function(e) {
+    const link = e.target.closest('a[href^="#"]');
+    if (link) {
+        e.preventDefault();
+        const targetId = link.getAttribute('href');
+        const targetElement = document.querySelector(targetId);
+        
+        if (targetElement) {
+            targetElement.scrollIntoView({
+                behavior: 'smooth',
+                block: 'start'
+            });
+        }
+    }
+});
+
+// Form submission helpers
+function submitFormWithLoading(form, button) {
+    showLoading(button);
+    
+    // Enable form submission
+    form.submit();
+    
+    // Keep loading state until page reload
+    return false;
+}
+
+// Copy to clipboard helper
+function copyToClipboard(text, successMessage = 'Copiado!') {
+    if (navigator.clipboard && window.isSecureContext) {
+        navigator.clipboard.writeText(text).then(() => {
+            showToast(successMessage, 'success');
+        });
+    } else {
+        // Fallback for older browsers
+        const textArea = document.createElement('textarea');
+        textArea.value = text;
+        textArea.style.position = 'fixed';
+        textArea.style.left = '-999999px';
+        textArea.style.top = '-999999px';
+        document.body.appendChild(textArea);
+        textArea.focus();
+        textArea.select();
+        
+        try {
+            document.execCommand('copy');
+            showToast(successMessage, 'success');
+        } catch (error) {
+            showToast('Erro ao copiar', 'error');
+        }
+        
+        document.body.removeChild(textArea);
+    }
+}
+
+// Analytics tracking (if enabled)
+function trackEvent(category, action, label = null, value = null) {
+    if (typeof gtag !== 'undefined') {
+        gtag('event', action, {
+            event_category: category,
+            event_label: label,
+            value: value
+        });
+    }
+}
+
+// Image lazy loading for older browsers
+if ('IntersectionObserver' in window) {
+    const imageObserver = new IntersectionObserver((entries, observer) => {
+        entries.forEach(entry => {
+            if (entry.isIntersecting) {
+                const img = entry.target;
+                if (img.dataset.src) {
+                    img.src = img.dataset.src;
+                    img.removeAttribute('data-src');
+                    observer.unobserve(img);
+                }
+            }
+        });
+    });
+    
+    document.addEventListener('DOMContentLoaded', () => {
+        const lazyImages = document.querySelectorAll('img[data-src]');
+        lazyImages.forEach(img => imageObserver.observe(img));
+    });
+}
+
+// Service Worker registration (for PWA support) - Commented out until sw.js is created
+/*
+if ('serviceWorker' in navigator) {
+    window.addEventListener('load', () => {
+        navigator.serviceWorker.register('/sw.js')
+            .then(registration => {
+                console.log('SW registered: ', registration);
+            })
+            .catch(registrationError => {
+                console.log('SW registration failed: ', registrationError);
+            });
+    });
+}
+*/
+
+// Dark mode toggle (if implemented)
+function toggleDarkMode() {
+    const body = document.body;
+    const isDark = body.classList.contains('dark-mode');
+    
+    if (isDark) {
+        body.classList.remove('dark-mode');
+        localStorage.setItem('theme', 'light');
+    } else {
+        body.classList.add('dark-mode');
+        localStorage.setItem('theme', 'dark');
+    }
+}
+
+// Initialize theme from localStorage
+document.addEventListener('DOMContentLoaded', () => {
+    const savedTheme = localStorage.getItem('theme');
+    if (savedTheme === 'dark') {
+        document.body.classList.add('dark-mode');
+    }
+});
+
+// Prevent form double submission
+document.addEventListener('submit', function(e) {
+    const form = e.target;
+    const submitButton = form.querySelector('button[type="submit"], input[type="submit"]');
+    
+    if (submitButton && !submitButton.disabled) {
+        setTimeout(() => {
+            showLoading(submitButton);
+        }, 100);
+    }
+});
+
+// Auto-resize textareas
+document.addEventListener('input', function(e) {
+    if (e.target.tagName === 'TEXTAREA' && e.target.classList.contains('auto-resize')) {
+        e.target.style.height = 'auto';
+        e.target.style.height = (e.target.scrollHeight) + 'px';
+    }
+});
+
+// Enhanced form validation
+function validateForm(formElement) {
+    const inputs = formElement.querySelectorAll('input[required], textarea[required], select[required]');
+    let isValid = true;
+    
+    inputs.forEach(input => {
+        if (!input.value.trim()) {
+            input.classList.add('is-invalid');
+            isValid = false;
+        } else {
+            input.classList.remove('is-invalid');
+            input.classList.add('is-valid');
+        }
+        
+        // Specific validations
+        if (input.type === 'email' && input.value && !validateEmail(input.value)) {
+            input.classList.add('is-invalid');
+            input.classList.remove('is-valid');
+            isValid = false;
+        }
+        
+        if (input.type === 'url' && input.value && !validateUrl(input.value)) {
+            input.classList.add('is-invalid');
+            input.classList.remove('is-valid');
+            isValid = false;
+        }
+    });
+    
+    return isValid;
+}
+
+// Export functions for use in other scripts
+window.BCards = {
+    showLoading,
+    hideLoading,
+    showToast,
+    generateSlug,
+    validateEmail,
+    validateUrl,
+    copyToClipboard,
+    trackEvent,
+    validateForm,
+    submitFormWithLoading
+};
\ No newline at end of file
diff --git a/src/BCards.Web/wwwroot/lib/bootstrap/css/bootstrap.css b/src/BCards.Web/wwwroot/lib/bootstrap/css/bootstrap.css
new file mode 100644
index 0000000..30aae55
--- /dev/null
+++ b/src/BCards.Web/wwwroot/lib/bootstrap/css/bootstrap.css
@@ -0,0 +1,12068 @@
+@charset "UTF-8";
+/*!
+ * Bootstrap  v5.3.2 (https://getbootstrap.com/)
+ * Copyright 2011-2023 The Bootstrap Authors
+ * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)
+ */
+:root,
+[data-bs-theme=light] {
+  --bs-blue: #0d6efd;
+  --bs-indigo: #6610f2;
+  --bs-purple: #6f42c1;
+  --bs-pink: #d63384;
+  --bs-red: #dc3545;
+  --bs-orange: #fd7e14;
+  --bs-yellow: #ffc107;
+  --bs-green: #198754;
+  --bs-teal: #20c997;
+  --bs-cyan: #0dcaf0;
+  --bs-black: #000;
+  --bs-white: #fff;
+  --bs-gray: #6c757d;
+  --bs-gray-dark: #343a40;
+  --bs-gray-100: #f8f9fa;
+  --bs-gray-200: #e9ecef;
+  --bs-gray-300: #dee2e6;
+  --bs-gray-400: #ced4da;
+  --bs-gray-500: #adb5bd;
+  --bs-gray-600: #6c757d;
+  --bs-gray-700: #495057;
+  --bs-gray-800: #343a40;
+  --bs-gray-900: #212529;
+  --bs-primary: #0d6efd;
+  --bs-secondary: #6c757d;
+  --bs-success: #198754;
+  --bs-info: #0dcaf0;
+  --bs-warning: #ffc107;
+  --bs-danger: #dc3545;
+  --bs-light: #f8f9fa;
+  --bs-dark: #212529;
+  --bs-primary-rgb: 13, 110, 253;
+  --bs-secondary-rgb: 108, 117, 125;
+  --bs-success-rgb: 25, 135, 84;
+  --bs-info-rgb: 13, 202, 240;
+  --bs-warning-rgb: 255, 193, 7;
+  --bs-danger-rgb: 220, 53, 69;
+  --bs-light-rgb: 248, 249, 250;
+  --bs-dark-rgb: 33, 37, 41;
+  --bs-primary-text-emphasis: #052c65;
+  --bs-secondary-text-emphasis: #2b2f32;
+  --bs-success-text-emphasis: #0a3622;
+  --bs-info-text-emphasis: #055160;
+  --bs-warning-text-emphasis: #664d03;
+  --bs-danger-text-emphasis: #58151c;
+  --bs-light-text-emphasis: #495057;
+  --bs-dark-text-emphasis: #495057;
+  --bs-primary-bg-subtle: #cfe2ff;
+  --bs-secondary-bg-subtle: #e2e3e5;
+  --bs-success-bg-subtle: #d1e7dd;
+  --bs-info-bg-subtle: #cff4fc;
+  --bs-warning-bg-subtle: #fff3cd;
+  --bs-danger-bg-subtle: #f8d7da;
+  --bs-light-bg-subtle: #fcfcfd;
+  --bs-dark-bg-subtle: #ced4da;
+  --bs-primary-border-subtle: #9ec5fe;
+  --bs-secondary-border-subtle: #c4c8cb;
+  --bs-success-border-subtle: #a3cfbb;
+  --bs-info-border-subtle: #9eeaf9;
+  --bs-warning-border-subtle: #ffe69c;
+  --bs-danger-border-subtle: #f1aeb5;
+  --bs-light-border-subtle: #e9ecef;
+  --bs-dark-border-subtle: #adb5bd;
+  --bs-white-rgb: 255, 255, 255;
+  --bs-black-rgb: 0, 0, 0;
+  --bs-font-sans-serif: system-ui, -apple-system, "Segoe UI", Roboto, "Helvetica Neue", "Noto Sans", "Liberation Sans", Arial, sans-serif, "Apple Color Emoji", "Segoe UI Emoji", "Segoe UI Symbol", "Noto Color Emoji";
+  --bs-font-monospace: SFMono-Regular, Menlo, Monaco, Consolas, "Liberation Mono", "Courier New", monospace;
+  --bs-gradient: linear-gradient(180deg, rgba(255, 255, 255, 0.15), rgba(255, 255, 255, 0));
+  --bs-body-font-family: var(--bs-font-sans-serif);
+  --bs-body-font-size: 1rem;
+  --bs-body-font-weight: 400;
+  --bs-body-line-height: 1.5;
+  --bs-body-color: #212529;
+  --bs-body-color-rgb: 33, 37, 41;
+  --bs-body-bg: #fff;
+  --bs-body-bg-rgb: 255, 255, 255;
+  --bs-emphasis-color: #000;
+  --bs-emphasis-color-rgb: 0, 0, 0;
+  --bs-secondary-color: rgba(33, 37, 41, 0.75);
+  --bs-secondary-color-rgb: 33, 37, 41;
+  --bs-secondary-bg: #e9ecef;
+  --bs-secondary-bg-rgb: 233, 236, 239;
+  --bs-tertiary-color: rgba(33, 37, 41, 0.5);
+  --bs-tertiary-color-rgb: 33, 37, 41;
+  --bs-tertiary-bg: #f8f9fa;
+  --bs-tertiary-bg-rgb: 248, 249, 250;
+  --bs-heading-color: inherit;
+  --bs-link-color: #0d6efd;
+  --bs-link-color-rgb: 13, 110, 253;
+  --bs-link-decoration: underline;
+  --bs-link-hover-color: #0a58ca;
+  --bs-link-hover-color-rgb: 10, 88, 202;
+  --bs-code-color: #d63384;
+  --bs-highlight-color: #212529;
+  --bs-highlight-bg: #fff3cd;
+  --bs-border-width: 1px;
+  --bs-border-style: solid;
+  --bs-border-color: #dee2e6;
+  --bs-border-color-translucent: rgba(0, 0, 0, 0.175);
+  --bs-border-radius: 0.375rem;
+  --bs-border-radius-sm: 0.25rem;
+  --bs-border-radius-lg: 0.5rem;
+  --bs-border-radius-xl: 1rem;
+  --bs-border-radius-xxl: 2rem;
+  --bs-border-radius-2xl: var(--bs-border-radius-xxl);
+  --bs-border-radius-pill: 50rem;
+  --bs-box-shadow: 0 0.5rem 1rem rgba(0, 0, 0, 0.15);
+  --bs-box-shadow-sm: 0 0.125rem 0.25rem rgba(0, 0, 0, 0.075);
+  --bs-box-shadow-lg: 0 1rem 3rem rgba(0, 0, 0, 0.175);
+  --bs-box-shadow-inset: inset 0 1px 2px rgba(0, 0, 0, 0.075);
+  --bs-focus-ring-width: 0.25rem;
+  --bs-focus-ring-opacity: 0.25;
+  --bs-focus-ring-color: rgba(13, 110, 253, 0.25);
+  --bs-form-valid-color: #198754;
+  --bs-form-valid-border-color: #198754;
+  --bs-form-invalid-color: #dc3545;
+  --bs-form-invalid-border-color: #dc3545;
+}
+
+[data-bs-theme=dark] {
+  color-scheme: dark;
+  --bs-body-color: #dee2e6;
+  --bs-body-color-rgb: 222, 226, 230;
+  --bs-body-bg: #212529;
+  --bs-body-bg-rgb: 33, 37, 41;
+  --bs-emphasis-color: #fff;
+  --bs-emphasis-color-rgb: 255, 255, 255;
+  --bs-secondary-color: rgba(222, 226, 230, 0.75);
+  --bs-secondary-color-rgb: 222, 226, 230;
+  --bs-secondary-bg: #343a40;
+  --bs-secondary-bg-rgb: 52, 58, 64;
+  --bs-tertiary-color: rgba(222, 226, 230, 0.5);
+  --bs-tertiary-color-rgb: 222, 226, 230;
+  --bs-tertiary-bg: #2b3035;
+  --bs-tertiary-bg-rgb: 43, 48, 53;
+  --bs-primary-text-emphasis: #6ea8fe;
+  --bs-secondary-text-emphasis: #a7acb1;
+  --bs-success-text-emphasis: #75b798;
+  --bs-info-text-emphasis: #6edff6;
+  --bs-warning-text-emphasis: #ffda6a;
+  --bs-danger-text-emphasis: #ea868f;
+  --bs-light-text-emphasis: #f8f9fa;
+  --bs-dark-text-emphasis: #dee2e6;
+  --bs-primary-bg-subtle: #031633;
+  --bs-secondary-bg-subtle: #161719;
+  --bs-success-bg-subtle: #051b11;
+  --bs-info-bg-subtle: #032830;
+  --bs-warning-bg-subtle: #332701;
+  --bs-danger-bg-subtle: #2c0b0e;
+  --bs-light-bg-subtle: #343a40;
+  --bs-dark-bg-subtle: #1a1d20;
+  --bs-primary-border-subtle: #084298;
+  --bs-secondary-border-subtle: #41464b;
+  --bs-success-border-subtle: #0f5132;
+  --bs-info-border-subtle: #087990;
+  --bs-warning-border-subtle: #997404;
+  --bs-danger-border-subtle: #842029;
+  --bs-light-border-subtle: #495057;
+  --bs-dark-border-subtle: #343a40;
+  --bs-heading-color: inherit;
+  --bs-link-color: #6ea8fe;
+  --bs-link-hover-color: #8bb9fe;
+  --bs-link-color-rgb: 110, 168, 254;
+  --bs-link-hover-color-rgb: 139, 185, 254;
+  --bs-code-color: #e685b5;
+  --bs-highlight-color: #dee2e6;
+  --bs-highlight-bg: #664d03;
+  --bs-border-color: #495057;
+  --bs-border-color-translucent: rgba(255, 255, 255, 0.15);
+  --bs-form-valid-color: #75b798;
+  --bs-form-valid-border-color: #75b798;
+  --bs-form-invalid-color: #ea868f;
+  --bs-form-invalid-border-color: #ea868f;
+}
+
+*,
+*::before,
+*::after {
+  box-sizing: border-box;
+}
+
+@media (prefers-reduced-motion: no-preference) {
+  :root {
+    scroll-behavior: smooth;
+  }
+}
+
+body {
+  margin: 0;
+  font-family: var(--bs-body-font-family);
+  font-size: var(--bs-body-font-size);
+  font-weight: var(--bs-body-font-weight);
+  line-height: var(--bs-body-line-height);
+  color: var(--bs-body-color);
+  text-align: var(--bs-body-text-align);
+  background-color: var(--bs-body-bg);
+  -webkit-text-size-adjust: 100%;
+  -webkit-tap-highlight-color: rgba(0, 0, 0, 0);
+}
+
+hr {
+  margin: 1rem 0;
+  color: inherit;
+  border: 0;
+  border-top: var(--bs-border-width) solid;
+  opacity: 0.25;
+}
+
+h6, .h6, h5, .h5, h4, .h4, h3, .h3, h2, .h2, h1, .h1 {
+  margin-top: 0;
+  margin-bottom: 0.5rem;
+  font-weight: 500;
+  line-height: 1.2;
+  color: var(--bs-heading-color);
+}
+
+h1, .h1 {
+  font-size: calc(1.375rem + 1.5vw);
+}
+@media (min-width: 1200px) {
+  h1, .h1 {
+    font-size: 2.5rem;
+  }
+}
+
+h2, .h2 {
+  font-size: calc(1.325rem + 0.9vw);
+}
+@media (min-width: 1200px) {
+  h2, .h2 {
+    font-size: 2rem;
+  }
+}
+
+h3, .h3 {
+  font-size: calc(1.3rem + 0.6vw);
+}
+@media (min-width: 1200px) {
+  h3, .h3 {
+    font-size: 1.75rem;
+  }
+}
+
+h4, .h4 {
+  font-size: calc(1.275rem + 0.3vw);
+}
+@media (min-width: 1200px) {
+  h4, .h4 {
+    font-size: 1.5rem;
+  }
+}
+
+h5, .h5 {
+  font-size: 1.25rem;
+}
+
+h6, .h6 {
+  font-size: 1rem;
+}
+
+p {
+  margin-top: 0;
+  margin-bottom: 1rem;
+}
+
+abbr[title] {
+  -webkit-text-decoration: underline dotted;
+  text-decoration: underline dotted;
+  cursor: help;
+  -webkit-text-decoration-skip-ink: none;
+  text-decoration-skip-ink: none;
+}
+
+address {
+  margin-bottom: 1rem;
+  font-style: normal;
+  line-height: inherit;
+}
+
+ol,
+ul {
+  padding-left: 2rem;
+}
+
+ol,
+ul,
+dl {
+  margin-top: 0;
+  margin-bottom: 1rem;
+}
+
+ol ol,
+ul ul,
+ol ul,
+ul ol {
+  margin-bottom: 0;
+}
+
+dt {
+  font-weight: 700;
+}
+
+dd {
+  margin-bottom: 0.5rem;
+  margin-left: 0;
+}
+
+blockquote {
+  margin: 0 0 1rem;
+}
+
+b,
+strong {
+  font-weight: bolder;
+}
+
+small, .small {
+  font-size: 0.875em;
+}
+
+mark, .mark {
+  padding: 0.1875em;
+  color: var(--bs-highlight-color);
+  background-color: var(--bs-highlight-bg);
+}
+
+sub,
+sup {
+  position: relative;
+  font-size: 0.75em;
+  line-height: 0;
+  vertical-align: baseline;
+}
+
+sub {
+  bottom: -0.25em;
+}
+
+sup {
+  top: -0.5em;
+}
+
+a {
+  color: rgba(var(--bs-link-color-rgb), var(--bs-link-opacity, 1));
+  text-decoration: underline;
+}
+a:hover {
+  --bs-link-color-rgb: var(--bs-link-hover-color-rgb);
+}
+
+a:not([href]):not([class]), a:not([href]):not([class]):hover {
+  color: inherit;
+  text-decoration: none;
+}
+
+pre,
+code,
+kbd,
+samp {
+  font-family: var(--bs-font-monospace);
+  font-size: 1em;
+}
+
+pre {
+  display: block;
+  margin-top: 0;
+  margin-bottom: 1rem;
+  overflow: auto;
+  font-size: 0.875em;
+}
+pre code {
+  font-size: inherit;
+  color: inherit;
+  word-break: normal;
+}
+
+code {
+  font-size: 0.875em;
+  color: var(--bs-code-color);
+  word-wrap: break-word;
+}
+a > code {
+  color: inherit;
+}
+
+kbd {
+  padding: 0.1875rem 0.375rem;
+  font-size: 0.875em;
+  color: var(--bs-body-bg);
+  background-color: var(--bs-body-color);
+  border-radius: 0.25rem;
+}
+kbd kbd {
+  padding: 0;
+  font-size: 1em;
+}
+
+figure {
+  margin: 0 0 1rem;
+}
+
+img,
+svg {
+  vertical-align: middle;
+}
+
+table {
+  caption-side: bottom;
+  border-collapse: collapse;
+}
+
+caption {
+  padding-top: 0.5rem;
+  padding-bottom: 0.5rem;
+  color: var(--bs-secondary-color);
+  text-align: left;
+}
+
+th {
+  text-align: inherit;
+  text-align: -webkit-match-parent;
+}
+
+thead,
+tbody,
+tfoot,
+tr,
+td,
+th {
+  border-color: inherit;
+  border-style: solid;
+  border-width: 0;
+}
+
+label {
+  display: inline-block;
+}
+
+button {
+  border-radius: 0;
+}
+
+button:focus:not(:focus-visible) {
+  outline: 0;
+}
+
+input,
+button,
+select,
+optgroup,
+textarea {
+  margin: 0;
+  font-family: inherit;
+  font-size: inherit;
+  line-height: inherit;
+}
+
+button,
+select {
+  text-transform: none;
+}
+
+[role=button] {
+  cursor: pointer;
+}
+
+select {
+  word-wrap: normal;
+}
+select:disabled {
+  opacity: 1;
+}
+
+[list]:not([type=date]):not([type=datetime-local]):not([type=month]):not([type=week]):not([type=time])::-webkit-calendar-picker-indicator {
+  display: none !important;
+}
+
+button,
+[type=button],
+[type=reset],
+[type=submit] {
+  -webkit-appearance: button;
+}
+button:not(:disabled),
+[type=button]:not(:disabled),
+[type=reset]:not(:disabled),
+[type=submit]:not(:disabled) {
+  cursor: pointer;
+}
+
+::-moz-focus-inner {
+  padding: 0;
+  border-style: none;
+}
+
+textarea {
+  resize: vertical;
+}
+
+fieldset {
+  min-width: 0;
+  padding: 0;
+  margin: 0;
+  border: 0;
+}
+
+legend {
+  float: left;
+  width: 100%;
+  padding: 0;
+  margin-bottom: 0.5rem;
+  font-size: calc(1.275rem + 0.3vw);
+  line-height: inherit;
+}
+@media (min-width: 1200px) {
+  legend {
+    font-size: 1.5rem;
+  }
+}
+legend + * {
+  clear: left;
+}
+
+::-webkit-datetime-edit-fields-wrapper,
+::-webkit-datetime-edit-text,
+::-webkit-datetime-edit-minute,
+::-webkit-datetime-edit-hour-field,
+::-webkit-datetime-edit-day-field,
+::-webkit-datetime-edit-month-field,
+::-webkit-datetime-edit-year-field {
+  padding: 0;
+}
+
+::-webkit-inner-spin-button {
+  height: auto;
+}
+
+[type=search] {
+  -webkit-appearance: textfield;
+  outline-offset: -2px;
+}
+
+/* rtl:raw:
+[type="tel"],
+[type="url"],
+[type="email"],
+[type="number"] {
+  direction: ltr;
+}
+*/
+::-webkit-search-decoration {
+  -webkit-appearance: none;
+}
+
+::-webkit-color-swatch-wrapper {
+  padding: 0;
+}
+
+::-webkit-file-upload-button {
+  font: inherit;
+  -webkit-appearance: button;
+}
+
+::file-selector-button {
+  font: inherit;
+  -webkit-appearance: button;
+}
+
+output {
+  display: inline-block;
+}
+
+iframe {
+  border: 0;
+}
+
+summary {
+  display: list-item;
+  cursor: pointer;
+}
+
+progress {
+  vertical-align: baseline;
+}
+
+[hidden] {
+  display: none !important;
+}
+
+.lead {
+  font-size: 1.25rem;
+  font-weight: 300;
+}
+
+.display-1 {
+  font-size: calc(1.625rem + 4.5vw);
+  font-weight: 300;
+  line-height: 1.2;
+}
+@media (min-width: 1200px) {
+  .display-1 {
+    font-size: 5rem;
+  }
+}
+
+.display-2 {
+  font-size: calc(1.575rem + 3.9vw);
+  font-weight: 300;
+  line-height: 1.2;
+}
+@media (min-width: 1200px) {
+  .display-2 {
+    font-size: 4.5rem;
+  }
+}
+
+.display-3 {
+  font-size: calc(1.525rem + 3.3vw);
+  font-weight: 300;
+  line-height: 1.2;
+}
+@media (min-width: 1200px) {
+  .display-3 {
+    font-size: 4rem;
+  }
+}
+
+.display-4 {
+  font-size: calc(1.475rem + 2.7vw);
+  font-weight: 300;
+  line-height: 1.2;
+}
+@media (min-width: 1200px) {
+  .display-4 {
+    font-size: 3.5rem;
+  }
+}
+
+.display-5 {
+  font-size: calc(1.425rem + 2.1vw);
+  font-weight: 300;
+  line-height: 1.2;
+}
+@media (min-width: 1200px) {
+  .display-5 {
+    font-size: 3rem;
+  }
+}
+
+.display-6 {
+  font-size: calc(1.375rem + 1.5vw);
+  font-weight: 300;
+  line-height: 1.2;
+}
+@media (min-width: 1200px) {
+  .display-6 {
+    font-size: 2.5rem;
+  }
+}
+
+.list-unstyled {
+  padding-left: 0;
+  list-style: none;
+}
+
+.list-inline {
+  padding-left: 0;
+  list-style: none;
+}
+
+.list-inline-item {
+  display: inline-block;
+}
+.list-inline-item:not(:last-child) {
+  margin-right: 0.5rem;
+}
+
+.initialism {
+  font-size: 0.875em;
+  text-transform: uppercase;
+}
+
+.blockquote {
+  margin-bottom: 1rem;
+  font-size: 1.25rem;
+}
+.blockquote > :last-child {
+  margin-bottom: 0;
+}
+
+.blockquote-footer {
+  margin-top: -1rem;
+  margin-bottom: 1rem;
+  font-size: 0.875em;
+  color: #6c757d;
+}
+.blockquote-footer::before {
+  content: "— ";
+}
+
+.img-fluid {
+  max-width: 100%;
+  height: auto;
+}
+
+.img-thumbnail {
+  padding: 0.25rem;
+  background-color: var(--bs-body-bg);
+  border: var(--bs-border-width) solid var(--bs-border-color);
+  border-radius: var(--bs-border-radius);
+  max-width: 100%;
+  height: auto;
+}
+
+.figure {
+  display: inline-block;
+}
+
+.figure-img {
+  margin-bottom: 0.5rem;
+  line-height: 1;
+}
+
+.figure-caption {
+  font-size: 0.875em;
+  color: var(--bs-secondary-color);
+}
+
+.container,
+.container-fluid,
+.container-xxl,
+.container-xl,
+.container-lg,
+.container-md,
+.container-sm {
+  --bs-gutter-x: 1.5rem;
+  --bs-gutter-y: 0;
+  width: 100%;
+  padding-right: calc(var(--bs-gutter-x) * 0.5);
+  padding-left: calc(var(--bs-gutter-x) * 0.5);
+  margin-right: auto;
+  margin-left: auto;
+}
+
+@media (min-width: 576px) {
+  .container-sm, .container {
+    max-width: 540px;
+  }
+}
+@media (min-width: 768px) {
+  .container-md, .container-sm, .container {
+    max-width: 720px;
+  }
+}
+@media (min-width: 992px) {
+  .container-lg, .container-md, .container-sm, .container {
+    max-width: 960px;
+  }
+}
+@media (min-width: 1200px) {
+  .container-xl, .container-lg, .container-md, .container-sm, .container {
+    max-width: 1140px;
+  }
+}
+@media (min-width: 1400px) {
+  .container-xxl, .container-xl, .container-lg, .container-md, .container-sm, .container {
+    max-width: 1320px;
+  }
+}
+:root {
+  --bs-breakpoint-xs: 0;
+  --bs-breakpoint-sm: 576px;
+  --bs-breakpoint-md: 768px;
+  --bs-breakpoint-lg: 992px;
+  --bs-breakpoint-xl: 1200px;
+  --bs-breakpoint-xxl: 1400px;
+}
+
+.row {
+  --bs-gutter-x: 1.5rem;
+  --bs-gutter-y: 0;
+  display: flex;
+  flex-wrap: wrap;
+  margin-top: calc(-1 * var(--bs-gutter-y));
+  margin-right: calc(-0.5 * var(--bs-gutter-x));
+  margin-left: calc(-0.5 * var(--bs-gutter-x));
+}
+.row > * {
+  flex-shrink: 0;
+  width: 100%;
+  max-width: 100%;
+  padding-right: calc(var(--bs-gutter-x) * 0.5);
+  padding-left: calc(var(--bs-gutter-x) * 0.5);
+  margin-top: var(--bs-gutter-y);
+}
+
+.col {
+  flex: 1 0 0%;
+}
+
+.row-cols-auto > * {
+  flex: 0 0 auto;
+  width: auto;
+}
+
+.row-cols-1 > * {
+  flex: 0 0 auto;
+  width: 100%;
+}
+
+.row-cols-2 > * {
+  flex: 0 0 auto;
+  width: 50%;
+}
+
+.row-cols-3 > * {
+  flex: 0 0 auto;
+  width: 33.33333333%;
+}
+
+.row-cols-4 > * {
+  flex: 0 0 auto;
+  width: 25%;
+}
+
+.row-cols-5 > * {
+  flex: 0 0 auto;
+  width: 20%;
+}
+
+.row-cols-6 > * {
+  flex: 0 0 auto;
+  width: 16.66666667%;
+}
+
+.col-auto {
+  flex: 0 0 auto;
+  width: auto;
+}
+
+.col-1 {
+  flex: 0 0 auto;
+  width: 8.33333333%;
+}
+
+.col-2 {
+  flex: 0 0 auto;
+  width: 16.66666667%;
+}
+
+.col-3 {
+  flex: 0 0 auto;
+  width: 25%;
+}
+
+.col-4 {
+  flex: 0 0 auto;
+  width: 33.33333333%;
+}
+
+.col-5 {
+  flex: 0 0 auto;
+  width: 41.66666667%;
+}
+
+.col-6 {
+  flex: 0 0 auto;
+  width: 50%;
+}
+
+.col-7 {
+  flex: 0 0 auto;
+  width: 58.33333333%;
+}
+
+.col-8 {
+  flex: 0 0 auto;
+  width: 66.66666667%;
+}
+
+.col-9 {
+  flex: 0 0 auto;
+  width: 75%;
+}
+
+.col-10 {
+  flex: 0 0 auto;
+  width: 83.33333333%;
+}
+
+.col-11 {
+  flex: 0 0 auto;
+  width: 91.66666667%;
+}
+
+.col-12 {
+  flex: 0 0 auto;
+  width: 100%;
+}
+
+.offset-1 {
+  margin-left: 8.33333333%;
+}
+
+.offset-2 {
+  margin-left: 16.66666667%;
+}
+
+.offset-3 {
+  margin-left: 25%;
+}
+
+.offset-4 {
+  margin-left: 33.33333333%;
+}
+
+.offset-5 {
+  margin-left: 41.66666667%;
+}
+
+.offset-6 {
+  margin-left: 50%;
+}
+
+.offset-7 {
+  margin-left: 58.33333333%;
+}
+
+.offset-8 {
+  margin-left: 66.66666667%;
+}
+
+.offset-9 {
+  margin-left: 75%;
+}
+
+.offset-10 {
+  margin-left: 83.33333333%;
+}
+
+.offset-11 {
+  margin-left: 91.66666667%;
+}
+
+.g-0,
+.gx-0 {
+  --bs-gutter-x: 0;
+}
+
+.g-0,
+.gy-0 {
+  --bs-gutter-y: 0;
+}
+
+.g-1,
+.gx-1 {
+  --bs-gutter-x: 0.25rem;
+}
+
+.g-1,
+.gy-1 {
+  --bs-gutter-y: 0.25rem;
+}
+
+.g-2,
+.gx-2 {
+  --bs-gutter-x: 0.5rem;
+}
+
+.g-2,
+.gy-2 {
+  --bs-gutter-y: 0.5rem;
+}
+
+.g-3,
+.gx-3 {
+  --bs-gutter-x: 1rem;
+}
+
+.g-3,
+.gy-3 {
+  --bs-gutter-y: 1rem;
+}
+
+.g-4,
+.gx-4 {
+  --bs-gutter-x: 1.5rem;
+}
+
+.g-4,
+.gy-4 {
+  --bs-gutter-y: 1.5rem;
+}
+
+.g-5,
+.gx-5 {
+  --bs-gutter-x: 3rem;
+}
+
+.g-5,
+.gy-5 {
+  --bs-gutter-y: 3rem;
+}
+
+@media (min-width: 576px) {
+  .col-sm {
+    flex: 1 0 0%;
+  }
+  .row-cols-sm-auto > * {
+    flex: 0 0 auto;
+    width: auto;
+  }
+  .row-cols-sm-1 > * {
+    flex: 0 0 auto;
+    width: 100%;
+  }
+  .row-cols-sm-2 > * {
+    flex: 0 0 auto;
+    width: 50%;
+  }
+  .row-cols-sm-3 > * {
+    flex: 0 0 auto;
+    width: 33.33333333%;
+  }
+  .row-cols-sm-4 > * {
+    flex: 0 0 auto;
+    width: 25%;
+  }
+  .row-cols-sm-5 > * {
+    flex: 0 0 auto;
+    width: 20%;
+  }
+  .row-cols-sm-6 > * {
+    flex: 0 0 auto;
+    width: 16.66666667%;
+  }
+  .col-sm-auto {
+    flex: 0 0 auto;
+    width: auto;
+  }
+  .col-sm-1 {
+    flex: 0 0 auto;
+    width: 8.33333333%;
+  }
+  .col-sm-2 {
+    flex: 0 0 auto;
+    width: 16.66666667%;
+  }
+  .col-sm-3 {
+    flex: 0 0 auto;
+    width: 25%;
+  }
+  .col-sm-4 {
+    flex: 0 0 auto;
+    width: 33.33333333%;
+  }
+  .col-sm-5 {
+    flex: 0 0 auto;
+    width: 41.66666667%;
+  }
+  .col-sm-6 {
+    flex: 0 0 auto;
+    width: 50%;
+  }
+  .col-sm-7 {
+    flex: 0 0 auto;
+    width: 58.33333333%;
+  }
+  .col-sm-8 {
+    flex: 0 0 auto;
+    width: 66.66666667%;
+  }
+  .col-sm-9 {
+    flex: 0 0 auto;
+    width: 75%;
+  }
+  .col-sm-10 {
+    flex: 0 0 auto;
+    width: 83.33333333%;
+  }
+  .col-sm-11 {
+    flex: 0 0 auto;
+    width: 91.66666667%;
+  }
+  .col-sm-12 {
+    flex: 0 0 auto;
+    width: 100%;
+  }
+  .offset-sm-0 {
+    margin-left: 0;
+  }
+  .offset-sm-1 {
+    margin-left: 8.33333333%;
+  }
+  .offset-sm-2 {
+    margin-left: 16.66666667%;
+  }
+  .offset-sm-3 {
+    margin-left: 25%;
+  }
+  .offset-sm-4 {
+    margin-left: 33.33333333%;
+  }
+  .offset-sm-5 {
+    margin-left: 41.66666667%;
+  }
+  .offset-sm-6 {
+    margin-left: 50%;
+  }
+  .offset-sm-7 {
+    margin-left: 58.33333333%;
+  }
+  .offset-sm-8 {
+    margin-left: 66.66666667%;
+  }
+  .offset-sm-9 {
+    margin-left: 75%;
+  }
+  .offset-sm-10 {
+    margin-left: 83.33333333%;
+  }
+  .offset-sm-11 {
+    margin-left: 91.66666667%;
+  }
+  .g-sm-0,
+  .gx-sm-0 {
+    --bs-gutter-x: 0;
+  }
+  .g-sm-0,
+  .gy-sm-0 {
+    --bs-gutter-y: 0;
+  }
+  .g-sm-1,
+  .gx-sm-1 {
+    --bs-gutter-x: 0.25rem;
+  }
+  .g-sm-1,
+  .gy-sm-1 {
+    --bs-gutter-y: 0.25rem;
+  }
+  .g-sm-2,
+  .gx-sm-2 {
+    --bs-gutter-x: 0.5rem;
+  }
+  .g-sm-2,
+  .gy-sm-2 {
+    --bs-gutter-y: 0.5rem;
+  }
+  .g-sm-3,
+  .gx-sm-3 {
+    --bs-gutter-x: 1rem;
+  }
+  .g-sm-3,
+  .gy-sm-3 {
+    --bs-gutter-y: 1rem;
+  }
+  .g-sm-4,
+  .gx-sm-4 {
+    --bs-gutter-x: 1.5rem;
+  }
+  .g-sm-4,
+  .gy-sm-4 {
+    --bs-gutter-y: 1.5rem;
+  }
+  .g-sm-5,
+  .gx-sm-5 {
+    --bs-gutter-x: 3rem;
+  }
+  .g-sm-5,
+  .gy-sm-5 {
+    --bs-gutter-y: 3rem;
+  }
+}
+@media (min-width: 768px) {
+  .col-md {
+    flex: 1 0 0%;
+  }
+  .row-cols-md-auto > * {
+    flex: 0 0 auto;
+    width: auto;
+  }
+  .row-cols-md-1 > * {
+    flex: 0 0 auto;
+    width: 100%;
+  }
+  .row-cols-md-2 > * {
+    flex: 0 0 auto;
+    width: 50%;
+  }
+  .row-cols-md-3 > * {
+    flex: 0 0 auto;
+    width: 33.33333333%;
+  }
+  .row-cols-md-4 > * {
+    flex: 0 0 auto;
+    width: 25%;
+  }
+  .row-cols-md-5 > * {
+    flex: 0 0 auto;
+    width: 20%;
+  }
+  .row-cols-md-6 > * {
+    flex: 0 0 auto;
+    width: 16.66666667%;
+  }
+  .col-md-auto {
+    flex: 0 0 auto;
+    width: auto;
+  }
+  .col-md-1 {
+    flex: 0 0 auto;
+    width: 8.33333333%;
+  }
+  .col-md-2 {
+    flex: 0 0 auto;
+    width: 16.66666667%;
+  }
+  .col-md-3 {
+    flex: 0 0 auto;
+    width: 25%;
+  }
+  .col-md-4 {
+    flex: 0 0 auto;
+    width: 33.33333333%;
+  }
+  .col-md-5 {
+    flex: 0 0 auto;
+    width: 41.66666667%;
+  }
+  .col-md-6 {
+    flex: 0 0 auto;
+    width: 50%;
+  }
+  .col-md-7 {
+    flex: 0 0 auto;
+    width: 58.33333333%;
+  }
+  .col-md-8 {
+    flex: 0 0 auto;
+    width: 66.66666667%;
+  }
+  .col-md-9 {
+    flex: 0 0 auto;
+    width: 75%;
+  }
+  .col-md-10 {
+    flex: 0 0 auto;
+    width: 83.33333333%;
+  }
+  .col-md-11 {
+    flex: 0 0 auto;
+    width: 91.66666667%;
+  }
+  .col-md-12 {
+    flex: 0 0 auto;
+    width: 100%;
+  }
+  .offset-md-0 {
+    margin-left: 0;
+  }
+  .offset-md-1 {
+    margin-left: 8.33333333%;
+  }
+  .offset-md-2 {
+    margin-left: 16.66666667%;
+  }
+  .offset-md-3 {
+    margin-left: 25%;
+  }
+  .offset-md-4 {
+    margin-left: 33.33333333%;
+  }
+  .offset-md-5 {
+    margin-left: 41.66666667%;
+  }
+  .offset-md-6 {
+    margin-left: 50%;
+  }
+  .offset-md-7 {
+    margin-left: 58.33333333%;
+  }
+  .offset-md-8 {
+    margin-left: 66.66666667%;
+  }
+  .offset-md-9 {
+    margin-left: 75%;
+  }
+  .offset-md-10 {
+    margin-left: 83.33333333%;
+  }
+  .offset-md-11 {
+    margin-left: 91.66666667%;
+  }
+  .g-md-0,
+  .gx-md-0 {
+    --bs-gutter-x: 0;
+  }
+  .g-md-0,
+  .gy-md-0 {
+    --bs-gutter-y: 0;
+  }
+  .g-md-1,
+  .gx-md-1 {
+    --bs-gutter-x: 0.25rem;
+  }
+  .g-md-1,
+  .gy-md-1 {
+    --bs-gutter-y: 0.25rem;
+  }
+  .g-md-2,
+  .gx-md-2 {
+    --bs-gutter-x: 0.5rem;
+  }
+  .g-md-2,
+  .gy-md-2 {
+    --bs-gutter-y: 0.5rem;
+  }
+  .g-md-3,
+  .gx-md-3 {
+    --bs-gutter-x: 1rem;
+  }
+  .g-md-3,
+  .gy-md-3 {
+    --bs-gutter-y: 1rem;
+  }
+  .g-md-4,
+  .gx-md-4 {
+    --bs-gutter-x: 1.5rem;
+  }
+  .g-md-4,
+  .gy-md-4 {
+    --bs-gutter-y: 1.5rem;
+  }
+  .g-md-5,
+  .gx-md-5 {
+    --bs-gutter-x: 3rem;
+  }
+  .g-md-5,
+  .gy-md-5 {
+    --bs-gutter-y: 3rem;
+  }
+}
+@media (min-width: 992px) {
+  .col-lg {
+    flex: 1 0 0%;
+  }
+  .row-cols-lg-auto > * {
+    flex: 0 0 auto;
+    width: auto;
+  }
+  .row-cols-lg-1 > * {
+    flex: 0 0 auto;
+    width: 100%;
+  }
+  .row-cols-lg-2 > * {
+    flex: 0 0 auto;
+    width: 50%;
+  }
+  .row-cols-lg-3 > * {
+    flex: 0 0 auto;
+    width: 33.33333333%;
+  }
+  .row-cols-lg-4 > * {
+    flex: 0 0 auto;
+    width: 25%;
+  }
+  .row-cols-lg-5 > * {
+    flex: 0 0 auto;
+    width: 20%;
+  }
+  .row-cols-lg-6 > * {
+    flex: 0 0 auto;
+    width: 16.66666667%;
+  }
+  .col-lg-auto {
+    flex: 0 0 auto;
+    width: auto;
+  }
+  .col-lg-1 {
+    flex: 0 0 auto;
+    width: 8.33333333%;
+  }
+  .col-lg-2 {
+    flex: 0 0 auto;
+    width: 16.66666667%;
+  }
+  .col-lg-3 {
+    flex: 0 0 auto;
+    width: 25%;
+  }
+  .col-lg-4 {
+    flex: 0 0 auto;
+    width: 33.33333333%;
+  }
+  .col-lg-5 {
+    flex: 0 0 auto;
+    width: 41.66666667%;
+  }
+  .col-lg-6 {
+    flex: 0 0 auto;
+    width: 50%;
+  }
+  .col-lg-7 {
+    flex: 0 0 auto;
+    width: 58.33333333%;
+  }
+  .col-lg-8 {
+    flex: 0 0 auto;
+    width: 66.66666667%;
+  }
+  .col-lg-9 {
+    flex: 0 0 auto;
+    width: 75%;
+  }
+  .col-lg-10 {
+    flex: 0 0 auto;
+    width: 83.33333333%;
+  }
+  .col-lg-11 {
+    flex: 0 0 auto;
+    width: 91.66666667%;
+  }
+  .col-lg-12 {
+    flex: 0 0 auto;
+    width: 100%;
+  }
+  .offset-lg-0 {
+    margin-left: 0;
+  }
+  .offset-lg-1 {
+    margin-left: 8.33333333%;
+  }
+  .offset-lg-2 {
+    margin-left: 16.66666667%;
+  }
+  .offset-lg-3 {
+    margin-left: 25%;
+  }
+  .offset-lg-4 {
+    margin-left: 33.33333333%;
+  }
+  .offset-lg-5 {
+    margin-left: 41.66666667%;
+  }
+  .offset-lg-6 {
+    margin-left: 50%;
+  }
+  .offset-lg-7 {
+    margin-left: 58.33333333%;
+  }
+  .offset-lg-8 {
+    margin-left: 66.66666667%;
+  }
+  .offset-lg-9 {
+    margin-left: 75%;
+  }
+  .offset-lg-10 {
+    margin-left: 83.33333333%;
+  }
+  .offset-lg-11 {
+    margin-left: 91.66666667%;
+  }
+  .g-lg-0,
+  .gx-lg-0 {
+    --bs-gutter-x: 0;
+  }
+  .g-lg-0,
+  .gy-lg-0 {
+    --bs-gutter-y: 0;
+  }
+  .g-lg-1,
+  .gx-lg-1 {
+    --bs-gutter-x: 0.25rem;
+  }
+  .g-lg-1,
+  .gy-lg-1 {
+    --bs-gutter-y: 0.25rem;
+  }
+  .g-lg-2,
+  .gx-lg-2 {
+    --bs-gutter-x: 0.5rem;
+  }
+  .g-lg-2,
+  .gy-lg-2 {
+    --bs-gutter-y: 0.5rem;
+  }
+  .g-lg-3,
+  .gx-lg-3 {
+    --bs-gutter-x: 1rem;
+  }
+  .g-lg-3,
+  .gy-lg-3 {
+    --bs-gutter-y: 1rem;
+  }
+  .g-lg-4,
+  .gx-lg-4 {
+    --bs-gutter-x: 1.5rem;
+  }
+  .g-lg-4,
+  .gy-lg-4 {
+    --bs-gutter-y: 1.5rem;
+  }
+  .g-lg-5,
+  .gx-lg-5 {
+    --bs-gutter-x: 3rem;
+  }
+  .g-lg-5,
+  .gy-lg-5 {
+    --bs-gutter-y: 3rem;
+  }
+}
+@media (min-width: 1200px) {
+  .col-xl {
+    flex: 1 0 0%;
+  }
+  .row-cols-xl-auto > * {
+    flex: 0 0 auto;
+    width: auto;
+  }
+  .row-cols-xl-1 > * {
+    flex: 0 0 auto;
+    width: 100%;
+  }
+  .row-cols-xl-2 > * {
+    flex: 0 0 auto;
+    width: 50%;
+  }
+  .row-cols-xl-3 > * {
+    flex: 0 0 auto;
+    width: 33.33333333%;
+  }
+  .row-cols-xl-4 > * {
+    flex: 0 0 auto;
+    width: 25%;
+  }
+  .row-cols-xl-5 > * {
+    flex: 0 0 auto;
+    width: 20%;
+  }
+  .row-cols-xl-6 > * {
+    flex: 0 0 auto;
+    width: 16.66666667%;
+  }
+  .col-xl-auto {
+    flex: 0 0 auto;
+    width: auto;
+  }
+  .col-xl-1 {
+    flex: 0 0 auto;
+    width: 8.33333333%;
+  }
+  .col-xl-2 {
+    flex: 0 0 auto;
+    width: 16.66666667%;
+  }
+  .col-xl-3 {
+    flex: 0 0 auto;
+    width: 25%;
+  }
+  .col-xl-4 {
+    flex: 0 0 auto;
+    width: 33.33333333%;
+  }
+  .col-xl-5 {
+    flex: 0 0 auto;
+    width: 41.66666667%;
+  }
+  .col-xl-6 {
+    flex: 0 0 auto;
+    width: 50%;
+  }
+  .col-xl-7 {
+    flex: 0 0 auto;
+    width: 58.33333333%;
+  }
+  .col-xl-8 {
+    flex: 0 0 auto;
+    width: 66.66666667%;
+  }
+  .col-xl-9 {
+    flex: 0 0 auto;
+    width: 75%;
+  }
+  .col-xl-10 {
+    flex: 0 0 auto;
+    width: 83.33333333%;
+  }
+  .col-xl-11 {
+    flex: 0 0 auto;
+    width: 91.66666667%;
+  }
+  .col-xl-12 {
+    flex: 0 0 auto;
+    width: 100%;
+  }
+  .offset-xl-0 {
+    margin-left: 0;
+  }
+  .offset-xl-1 {
+    margin-left: 8.33333333%;
+  }
+  .offset-xl-2 {
+    margin-left: 16.66666667%;
+  }
+  .offset-xl-3 {
+    margin-left: 25%;
+  }
+  .offset-xl-4 {
+    margin-left: 33.33333333%;
+  }
+  .offset-xl-5 {
+    margin-left: 41.66666667%;
+  }
+  .offset-xl-6 {
+    margin-left: 50%;
+  }
+  .offset-xl-7 {
+    margin-left: 58.33333333%;
+  }
+  .offset-xl-8 {
+    margin-left: 66.66666667%;
+  }
+  .offset-xl-9 {
+    margin-left: 75%;
+  }
+  .offset-xl-10 {
+    margin-left: 83.33333333%;
+  }
+  .offset-xl-11 {
+    margin-left: 91.66666667%;
+  }
+  .g-xl-0,
+  .gx-xl-0 {
+    --bs-gutter-x: 0;
+  }
+  .g-xl-0,
+  .gy-xl-0 {
+    --bs-gutter-y: 0;
+  }
+  .g-xl-1,
+  .gx-xl-1 {
+    --bs-gutter-x: 0.25rem;
+  }
+  .g-xl-1,
+  .gy-xl-1 {
+    --bs-gutter-y: 0.25rem;
+  }
+  .g-xl-2,
+  .gx-xl-2 {
+    --bs-gutter-x: 0.5rem;
+  }
+  .g-xl-2,
+  .gy-xl-2 {
+    --bs-gutter-y: 0.5rem;
+  }
+  .g-xl-3,
+  .gx-xl-3 {
+    --bs-gutter-x: 1rem;
+  }
+  .g-xl-3,
+  .gy-xl-3 {
+    --bs-gutter-y: 1rem;
+  }
+  .g-xl-4,
+  .gx-xl-4 {
+    --bs-gutter-x: 1.5rem;
+  }
+  .g-xl-4,
+  .gy-xl-4 {
+    --bs-gutter-y: 1.5rem;
+  }
+  .g-xl-5,
+  .gx-xl-5 {
+    --bs-gutter-x: 3rem;
+  }
+  .g-xl-5,
+  .gy-xl-5 {
+    --bs-gutter-y: 3rem;
+  }
+}
+@media (min-width: 1400px) {
+  .col-xxl {
+    flex: 1 0 0%;
+  }
+  .row-cols-xxl-auto > * {
+    flex: 0 0 auto;
+    width: auto;
+  }
+  .row-cols-xxl-1 > * {
+    flex: 0 0 auto;
+    width: 100%;
+  }
+  .row-cols-xxl-2 > * {
+    flex: 0 0 auto;
+    width: 50%;
+  }
+  .row-cols-xxl-3 > * {
+    flex: 0 0 auto;
+    width: 33.33333333%;
+  }
+  .row-cols-xxl-4 > * {
+    flex: 0 0 auto;
+    width: 25%;
+  }
+  .row-cols-xxl-5 > * {
+    flex: 0 0 auto;
+    width: 20%;
+  }
+  .row-cols-xxl-6 > * {
+    flex: 0 0 auto;
+    width: 16.66666667%;
+  }
+  .col-xxl-auto {
+    flex: 0 0 auto;
+    width: auto;
+  }
+  .col-xxl-1 {
+    flex: 0 0 auto;
+    width: 8.33333333%;
+  }
+  .col-xxl-2 {
+    flex: 0 0 auto;
+    width: 16.66666667%;
+  }
+  .col-xxl-3 {
+    flex: 0 0 auto;
+    width: 25%;
+  }
+  .col-xxl-4 {
+    flex: 0 0 auto;
+    width: 33.33333333%;
+  }
+  .col-xxl-5 {
+    flex: 0 0 auto;
+    width: 41.66666667%;
+  }
+  .col-xxl-6 {
+    flex: 0 0 auto;
+    width: 50%;
+  }
+  .col-xxl-7 {
+    flex: 0 0 auto;
+    width: 58.33333333%;
+  }
+  .col-xxl-8 {
+    flex: 0 0 auto;
+    width: 66.66666667%;
+  }
+  .col-xxl-9 {
+    flex: 0 0 auto;
+    width: 75%;
+  }
+  .col-xxl-10 {
+    flex: 0 0 auto;
+    width: 83.33333333%;
+  }
+  .col-xxl-11 {
+    flex: 0 0 auto;
+    width: 91.66666667%;
+  }
+  .col-xxl-12 {
+    flex: 0 0 auto;
+    width: 100%;
+  }
+  .offset-xxl-0 {
+    margin-left: 0;
+  }
+  .offset-xxl-1 {
+    margin-left: 8.33333333%;
+  }
+  .offset-xxl-2 {
+    margin-left: 16.66666667%;
+  }
+  .offset-xxl-3 {
+    margin-left: 25%;
+  }
+  .offset-xxl-4 {
+    margin-left: 33.33333333%;
+  }
+  .offset-xxl-5 {
+    margin-left: 41.66666667%;
+  }
+  .offset-xxl-6 {
+    margin-left: 50%;
+  }
+  .offset-xxl-7 {
+    margin-left: 58.33333333%;
+  }
+  .offset-xxl-8 {
+    margin-left: 66.66666667%;
+  }
+  .offset-xxl-9 {
+    margin-left: 75%;
+  }
+  .offset-xxl-10 {
+    margin-left: 83.33333333%;
+  }
+  .offset-xxl-11 {
+    margin-left: 91.66666667%;
+  }
+  .g-xxl-0,
+  .gx-xxl-0 {
+    --bs-gutter-x: 0;
+  }
+  .g-xxl-0,
+  .gy-xxl-0 {
+    --bs-gutter-y: 0;
+  }
+  .g-xxl-1,
+  .gx-xxl-1 {
+    --bs-gutter-x: 0.25rem;
+  }
+  .g-xxl-1,
+  .gy-xxl-1 {
+    --bs-gutter-y: 0.25rem;
+  }
+  .g-xxl-2,
+  .gx-xxl-2 {
+    --bs-gutter-x: 0.5rem;
+  }
+  .g-xxl-2,
+  .gy-xxl-2 {
+    --bs-gutter-y: 0.5rem;
+  }
+  .g-xxl-3,
+  .gx-xxl-3 {
+    --bs-gutter-x: 1rem;
+  }
+  .g-xxl-3,
+  .gy-xxl-3 {
+    --bs-gutter-y: 1rem;
+  }
+  .g-xxl-4,
+  .gx-xxl-4 {
+    --bs-gutter-x: 1.5rem;
+  }
+  .g-xxl-4,
+  .gy-xxl-4 {
+    --bs-gutter-y: 1.5rem;
+  }
+  .g-xxl-5,
+  .gx-xxl-5 {
+    --bs-gutter-x: 3rem;
+  }
+  .g-xxl-5,
+  .gy-xxl-5 {
+    --bs-gutter-y: 3rem;
+  }
+}
+.table {
+  --bs-table-color-type: initial;
+  --bs-table-bg-type: initial;
+  --bs-table-color-state: initial;
+  --bs-table-bg-state: initial;
+  --bs-table-color: var(--bs-emphasis-color);
+  --bs-table-bg: var(--bs-body-bg);
+  --bs-table-border-color: var(--bs-border-color);
+  --bs-table-accent-bg: transparent;
+  --bs-table-striped-color: var(--bs-emphasis-color);
+  --bs-table-striped-bg: rgba(var(--bs-emphasis-color-rgb), 0.05);
+  --bs-table-active-color: var(--bs-emphasis-color);
+  --bs-table-active-bg: rgba(var(--bs-emphasis-color-rgb), 0.1);
+  --bs-table-hover-color: var(--bs-emphasis-color);
+  --bs-table-hover-bg: rgba(var(--bs-emphasis-color-rgb), 0.075);
+  width: 100%;
+  margin-bottom: 1rem;
+  vertical-align: top;
+  border-color: var(--bs-table-border-color);
+}
+.table > :not(caption) > * > * {
+  padding: 0.5rem 0.5rem;
+  color: var(--bs-table-color-state, var(--bs-table-color-type, var(--bs-table-color)));
+  background-color: var(--bs-table-bg);
+  border-bottom-width: var(--bs-border-width);
+  box-shadow: inset 0 0 0 9999px var(--bs-table-bg-state, var(--bs-table-bg-type, var(--bs-table-accent-bg)));
+}
+.table > tbody {
+  vertical-align: inherit;
+}
+.table > thead {
+  vertical-align: bottom;
+}
+
+.table-group-divider {
+  border-top: calc(var(--bs-border-width) * 2) solid currentcolor;
+}
+
+.caption-top {
+  caption-side: top;
+}
+
+.table-sm > :not(caption) > * > * {
+  padding: 0.25rem 0.25rem;
+}
+
+.table-bordered > :not(caption) > * {
+  border-width: var(--bs-border-width) 0;
+}
+.table-bordered > :not(caption) > * > * {
+  border-width: 0 var(--bs-border-width);
+}
+
+.table-borderless > :not(caption) > * > * {
+  border-bottom-width: 0;
+}
+.table-borderless > :not(:first-child) {
+  border-top-width: 0;
+}
+
+.table-striped > tbody > tr:nth-of-type(odd) > * {
+  --bs-table-color-type: var(--bs-table-striped-color);
+  --bs-table-bg-type: var(--bs-table-striped-bg);
+}
+
+.table-striped-columns > :not(caption) > tr > :nth-child(even) {
+  --bs-table-color-type: var(--bs-table-striped-color);
+  --bs-table-bg-type: var(--bs-table-striped-bg);
+}
+
+.table-active {
+  --bs-table-color-state: var(--bs-table-active-color);
+  --bs-table-bg-state: var(--bs-table-active-bg);
+}
+
+.table-hover > tbody > tr:hover > * {
+  --bs-table-color-state: var(--bs-table-hover-color);
+  --bs-table-bg-state: var(--bs-table-hover-bg);
+}
+
+.table-primary {
+  --bs-table-color: #000;
+  --bs-table-bg: #cfe2ff;
+  --bs-table-border-color: #a6b5cc;
+  --bs-table-striped-bg: #c5d7f2;
+  --bs-table-striped-color: #000;
+  --bs-table-active-bg: #bacbe6;
+  --bs-table-active-color: #000;
+  --bs-table-hover-bg: #bfd1ec;
+  --bs-table-hover-color: #000;
+  color: var(--bs-table-color);
+  border-color: var(--bs-table-border-color);
+}
+
+.table-secondary {
+  --bs-table-color: #000;
+  --bs-table-bg: #e2e3e5;
+  --bs-table-border-color: #b5b6b7;
+  --bs-table-striped-bg: #d7d8da;
+  --bs-table-striped-color: #000;
+  --bs-table-active-bg: #cbccce;
+  --bs-table-active-color: #000;
+  --bs-table-hover-bg: #d1d2d4;
+  --bs-table-hover-color: #000;
+  color: var(--bs-table-color);
+  border-color: var(--bs-table-border-color);
+}
+
+.table-success {
+  --bs-table-color: #000;
+  --bs-table-bg: #d1e7dd;
+  --bs-table-border-color: #a7b9b1;
+  --bs-table-striped-bg: #c7dbd2;
+  --bs-table-striped-color: #000;
+  --bs-table-active-bg: #bcd0c7;
+  --bs-table-active-color: #000;
+  --bs-table-hover-bg: #c1d6cc;
+  --bs-table-hover-color: #000;
+  color: var(--bs-table-color);
+  border-color: var(--bs-table-border-color);
+}
+
+.table-info {
+  --bs-table-color: #000;
+  --bs-table-bg: #cff4fc;
+  --bs-table-border-color: #a6c3ca;
+  --bs-table-striped-bg: #c5e8ef;
+  --bs-table-striped-color: #000;
+  --bs-table-active-bg: #badce3;
+  --bs-table-active-color: #000;
+  --bs-table-hover-bg: #bfe2e9;
+  --bs-table-hover-color: #000;
+  color: var(--bs-table-color);
+  border-color: var(--bs-table-border-color);
+}
+
+.table-warning {
+  --bs-table-color: #000;
+  --bs-table-bg: #fff3cd;
+  --bs-table-border-color: #ccc2a4;
+  --bs-table-striped-bg: #f2e7c3;
+  --bs-table-striped-color: #000;
+  --bs-table-active-bg: #e6dbb9;
+  --bs-table-active-color: #000;
+  --bs-table-hover-bg: #ece1be;
+  --bs-table-hover-color: #000;
+  color: var(--bs-table-color);
+  border-color: var(--bs-table-border-color);
+}
+
+.table-danger {
+  --bs-table-color: #000;
+  --bs-table-bg: #f8d7da;
+  --bs-table-border-color: #c6acae;
+  --bs-table-striped-bg: #eccccf;
+  --bs-table-striped-color: #000;
+  --bs-table-active-bg: #dfc2c4;
+  --bs-table-active-color: #000;
+  --bs-table-hover-bg: #e5c7ca;
+  --bs-table-hover-color: #000;
+  color: var(--bs-table-color);
+  border-color: var(--bs-table-border-color);
+}
+
+.table-light {
+  --bs-table-color: #000;
+  --bs-table-bg: #f8f9fa;
+  --bs-table-border-color: #c6c7c8;
+  --bs-table-striped-bg: #ecedee;
+  --bs-table-striped-color: #000;
+  --bs-table-active-bg: #dfe0e1;
+  --bs-table-active-color: #000;
+  --bs-table-hover-bg: #e5e6e7;
+  --bs-table-hover-color: #000;
+  color: var(--bs-table-color);
+  border-color: var(--bs-table-border-color);
+}
+
+.table-dark {
+  --bs-table-color: #fff;
+  --bs-table-bg: #212529;
+  --bs-table-border-color: #4d5154;
+  --bs-table-striped-bg: #2c3034;
+  --bs-table-striped-color: #fff;
+  --bs-table-active-bg: #373b3e;
+  --bs-table-active-color: #fff;
+  --bs-table-hover-bg: #323539;
+  --bs-table-hover-color: #fff;
+  color: var(--bs-table-color);
+  border-color: var(--bs-table-border-color);
+}
+
+.table-responsive {
+  overflow-x: auto;
+  -webkit-overflow-scrolling: touch;
+}
+
+@media (max-width: 575.98px) {
+  .table-responsive-sm {
+    overflow-x: auto;
+    -webkit-overflow-scrolling: touch;
+  }
+}
+@media (max-width: 767.98px) {
+  .table-responsive-md {
+    overflow-x: auto;
+    -webkit-overflow-scrolling: touch;
+  }
+}
+@media (max-width: 991.98px) {
+  .table-responsive-lg {
+    overflow-x: auto;
+    -webkit-overflow-scrolling: touch;
+  }
+}
+@media (max-width: 1199.98px) {
+  .table-responsive-xl {
+    overflow-x: auto;
+    -webkit-overflow-scrolling: touch;
+  }
+}
+@media (max-width: 1399.98px) {
+  .table-responsive-xxl {
+    overflow-x: auto;
+    -webkit-overflow-scrolling: touch;
+  }
+}
+.form-label {
+  margin-bottom: 0.5rem;
+}
+
+.col-form-label {
+  padding-top: calc(0.375rem + var(--bs-border-width));
+  padding-bottom: calc(0.375rem + var(--bs-border-width));
+  margin-bottom: 0;
+  font-size: inherit;
+  line-height: 1.5;
+}
+
+.col-form-label-lg {
+  padding-top: calc(0.5rem + var(--bs-border-width));
+  padding-bottom: calc(0.5rem + var(--bs-border-width));
+  font-size: 1.25rem;
+}
+
+.col-form-label-sm {
+  padding-top: calc(0.25rem + var(--bs-border-width));
+  padding-bottom: calc(0.25rem + var(--bs-border-width));
+  font-size: 0.875rem;
+}
+
+.form-text {
+  margin-top: 0.25rem;
+  font-size: 0.875em;
+  color: var(--bs-secondary-color);
+}
+
+.form-control {
+  display: block;
+  width: 100%;
+  padding: 0.375rem 0.75rem;
+  font-size: 1rem;
+  font-weight: 400;
+  line-height: 1.5;
+  color: var(--bs-body-color);
+  -webkit-appearance: none;
+  -moz-appearance: none;
+  appearance: none;
+  background-color: var(--bs-body-bg);
+  background-clip: padding-box;
+  border: var(--bs-border-width) solid var(--bs-border-color);
+  border-radius: var(--bs-border-radius);
+  transition: border-color 0.15s ease-in-out, box-shadow 0.15s ease-in-out;
+}
+@media (prefers-reduced-motion: reduce) {
+  .form-control {
+    transition: none;
+  }
+}
+.form-control[type=file] {
+  overflow: hidden;
+}
+.form-control[type=file]:not(:disabled):not([readonly]) {
+  cursor: pointer;
+}
+.form-control:focus {
+  color: var(--bs-body-color);
+  background-color: var(--bs-body-bg);
+  border-color: #86b7fe;
+  outline: 0;
+  box-shadow: 0 0 0 0.25rem rgba(13, 110, 253, 0.25);
+}
+.form-control::-webkit-date-and-time-value {
+  min-width: 85px;
+  height: 1.5em;
+  margin: 0;
+}
+.form-control::-webkit-datetime-edit {
+  display: block;
+  padding: 0;
+}
+.form-control::-moz-placeholder {
+  color: var(--bs-secondary-color);
+  opacity: 1;
+}
+.form-control::placeholder {
+  color: var(--bs-secondary-color);
+  opacity: 1;
+}
+.form-control:disabled {
+  background-color: var(--bs-secondary-bg);
+  opacity: 1;
+}
+.form-control::-webkit-file-upload-button {
+  padding: 0.375rem 0.75rem;
+  margin: -0.375rem -0.75rem;
+  -webkit-margin-end: 0.75rem;
+  margin-inline-end: 0.75rem;
+  color: var(--bs-body-color);
+  background-color: var(--bs-tertiary-bg);
+  pointer-events: none;
+  border-color: inherit;
+  border-style: solid;
+  border-width: 0;
+  border-inline-end-width: var(--bs-border-width);
+  border-radius: 0;
+  -webkit-transition: color 0.15s ease-in-out, background-color 0.15s ease-in-out, border-color 0.15s ease-in-out, box-shadow 0.15s ease-in-out;
+  transition: color 0.15s ease-in-out, background-color 0.15s ease-in-out, border-color 0.15s ease-in-out, box-shadow 0.15s ease-in-out;
+}
+.form-control::file-selector-button {
+  padding: 0.375rem 0.75rem;
+  margin: -0.375rem -0.75rem;
+  -webkit-margin-end: 0.75rem;
+  margin-inline-end: 0.75rem;
+  color: var(--bs-body-color);
+  background-color: var(--bs-tertiary-bg);
+  pointer-events: none;
+  border-color: inherit;
+  border-style: solid;
+  border-width: 0;
+  border-inline-end-width: var(--bs-border-width);
+  border-radius: 0;
+  transition: color 0.15s ease-in-out, background-color 0.15s ease-in-out, border-color 0.15s ease-in-out, box-shadow 0.15s ease-in-out;
+}
+@media (prefers-reduced-motion: reduce) {
+  .form-control::-webkit-file-upload-button {
+    -webkit-transition: none;
+    transition: none;
+  }
+  .form-control::file-selector-button {
+    transition: none;
+  }
+}
+.form-control:hover:not(:disabled):not([readonly])::-webkit-file-upload-button {
+  background-color: var(--bs-secondary-bg);
+}
+.form-control:hover:not(:disabled):not([readonly])::file-selector-button {
+  background-color: var(--bs-secondary-bg);
+}
+
+.form-control-plaintext {
+  display: block;
+  width: 100%;
+  padding: 0.375rem 0;
+  margin-bottom: 0;
+  line-height: 1.5;
+  color: var(--bs-body-color);
+  background-color: transparent;
+  border: solid transparent;
+  border-width: var(--bs-border-width) 0;
+}
+.form-control-plaintext:focus {
+  outline: 0;
+}
+.form-control-plaintext.form-control-sm, .form-control-plaintext.form-control-lg {
+  padding-right: 0;
+  padding-left: 0;
+}
+
+.form-control-sm {
+  min-height: calc(1.5em + 0.5rem + calc(var(--bs-border-width) * 2));
+  padding: 0.25rem 0.5rem;
+  font-size: 0.875rem;
+  border-radius: var(--bs-border-radius-sm);
+}
+.form-control-sm::-webkit-file-upload-button {
+  padding: 0.25rem 0.5rem;
+  margin: -0.25rem -0.5rem;
+  -webkit-margin-end: 0.5rem;
+  margin-inline-end: 0.5rem;
+}
+.form-control-sm::file-selector-button {
+  padding: 0.25rem 0.5rem;
+  margin: -0.25rem -0.5rem;
+  -webkit-margin-end: 0.5rem;
+  margin-inline-end: 0.5rem;
+}
+
+.form-control-lg {
+  min-height: calc(1.5em + 1rem + calc(var(--bs-border-width) * 2));
+  padding: 0.5rem 1rem;
+  font-size: 1.25rem;
+  border-radius: var(--bs-border-radius-lg);
+}
+.form-control-lg::-webkit-file-upload-button {
+  padding: 0.5rem 1rem;
+  margin: -0.5rem -1rem;
+  -webkit-margin-end: 1rem;
+  margin-inline-end: 1rem;
+}
+.form-control-lg::file-selector-button {
+  padding: 0.5rem 1rem;
+  margin: -0.5rem -1rem;
+  -webkit-margin-end: 1rem;
+  margin-inline-end: 1rem;
+}
+
+textarea.form-control {
+  min-height: calc(1.5em + 0.75rem + calc(var(--bs-border-width) * 2));
+}
+textarea.form-control-sm {
+  min-height: calc(1.5em + 0.5rem + calc(var(--bs-border-width) * 2));
+}
+textarea.form-control-lg {
+  min-height: calc(1.5em + 1rem + calc(var(--bs-border-width) * 2));
+}
+
+.form-control-color {
+  width: 3rem;
+  height: calc(1.5em + 0.75rem + calc(var(--bs-border-width) * 2));
+  padding: 0.375rem;
+}
+.form-control-color:not(:disabled):not([readonly]) {
+  cursor: pointer;
+}
+.form-control-color::-moz-color-swatch {
+  border: 0 !important;
+  border-radius: var(--bs-border-radius);
+}
+.form-control-color::-webkit-color-swatch {
+  border: 0 !important;
+  border-radius: var(--bs-border-radius);
+}
+.form-control-color.form-control-sm {
+  height: calc(1.5em + 0.5rem + calc(var(--bs-border-width) * 2));
+}
+.form-control-color.form-control-lg {
+  height: calc(1.5em + 1rem + calc(var(--bs-border-width) * 2));
+}
+
+.form-select {
+  --bs-form-select-bg-img: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16'%3e%3cpath fill='none' stroke='%23343a40' stroke-linecap='round' stroke-linejoin='round' stroke-width='2' d='m2 5 6 6 6-6'/%3e%3c/svg%3e");
+  display: block;
+  width: 100%;
+  padding: 0.375rem 2.25rem 0.375rem 0.75rem;
+  font-size: 1rem;
+  font-weight: 400;
+  line-height: 1.5;
+  color: var(--bs-body-color);
+  -webkit-appearance: none;
+  -moz-appearance: none;
+  appearance: none;
+  background-color: var(--bs-body-bg);
+  background-image: var(--bs-form-select-bg-img), var(--bs-form-select-bg-icon, none);
+  background-repeat: no-repeat;
+  background-position: right 0.75rem center;
+  background-size: 16px 12px;
+  border: var(--bs-border-width) solid var(--bs-border-color);
+  border-radius: var(--bs-border-radius);
+  transition: border-color 0.15s ease-in-out, box-shadow 0.15s ease-in-out;
+}
+@media (prefers-reduced-motion: reduce) {
+  .form-select {
+    transition: none;
+  }
+}
+.form-select:focus {
+  border-color: #86b7fe;
+  outline: 0;
+  box-shadow: 0 0 0 0.25rem rgba(13, 110, 253, 0.25);
+}
+.form-select[multiple], .form-select[size]:not([size="1"]) {
+  padding-right: 0.75rem;
+  background-image: none;
+}
+.form-select:disabled {
+  background-color: var(--bs-secondary-bg);
+}
+.form-select:-moz-focusring {
+  color: transparent;
+  text-shadow: 0 0 0 var(--bs-body-color);
+}
+
+.form-select-sm {
+  padding-top: 0.25rem;
+  padding-bottom: 0.25rem;
+  padding-left: 0.5rem;
+  font-size: 0.875rem;
+  border-radius: var(--bs-border-radius-sm);
+}
+
+.form-select-lg {
+  padding-top: 0.5rem;
+  padding-bottom: 0.5rem;
+  padding-left: 1rem;
+  font-size: 1.25rem;
+  border-radius: var(--bs-border-radius-lg);
+}
+
+[data-bs-theme=dark] .form-select {
+  --bs-form-select-bg-img: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16'%3e%3cpath fill='none' stroke='%23dee2e6' stroke-linecap='round' stroke-linejoin='round' stroke-width='2' d='m2 5 6 6 6-6'/%3e%3c/svg%3e");
+}
+
+.form-check {
+  display: block;
+  min-height: 1.5rem;
+  padding-left: 1.5em;
+  margin-bottom: 0.125rem;
+}
+.form-check .form-check-input {
+  float: left;
+  margin-left: -1.5em;
+}
+
+.form-check-reverse {
+  padding-right: 1.5em;
+  padding-left: 0;
+  text-align: right;
+}
+.form-check-reverse .form-check-input {
+  float: right;
+  margin-right: -1.5em;
+  margin-left: 0;
+}
+
+.form-check-input {
+  --bs-form-check-bg: var(--bs-body-bg);
+  flex-shrink: 0;
+  width: 1em;
+  height: 1em;
+  margin-top: 0.25em;
+  vertical-align: top;
+  -webkit-appearance: none;
+  -moz-appearance: none;
+  appearance: none;
+  background-color: var(--bs-form-check-bg);
+  background-image: var(--bs-form-check-bg-image);
+  background-repeat: no-repeat;
+  background-position: center;
+  background-size: contain;
+  border: var(--bs-border-width) solid var(--bs-border-color);
+  -webkit-print-color-adjust: exact;
+  color-adjust: exact;
+  print-color-adjust: exact;
+}
+.form-check-input[type=checkbox] {
+  border-radius: 0.25em;
+}
+.form-check-input[type=radio] {
+  border-radius: 50%;
+}
+.form-check-input:active {
+  filter: brightness(90%);
+}
+.form-check-input:focus {
+  border-color: #86b7fe;
+  outline: 0;
+  box-shadow: 0 0 0 0.25rem rgba(13, 110, 253, 0.25);
+}
+.form-check-input:checked {
+  background-color: #0d6efd;
+  border-color: #0d6efd;
+}
+.form-check-input:checked[type=checkbox] {
+  --bs-form-check-bg-image: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 20 20'%3e%3cpath fill='none' stroke='%23fff' stroke-linecap='round' stroke-linejoin='round' stroke-width='3' d='m6 10 3 3 6-6'/%3e%3c/svg%3e");
+}
+.form-check-input:checked[type=radio] {
+  --bs-form-check-bg-image: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='-4 -4 8 8'%3e%3ccircle r='2' fill='%23fff'/%3e%3c/svg%3e");
+}
+.form-check-input[type=checkbox]:indeterminate {
+  background-color: #0d6efd;
+  border-color: #0d6efd;
+  --bs-form-check-bg-image: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 20 20'%3e%3cpath fill='none' stroke='%23fff' stroke-linecap='round' stroke-linejoin='round' stroke-width='3' d='M6 10h8'/%3e%3c/svg%3e");
+}
+.form-check-input:disabled {
+  pointer-events: none;
+  filter: none;
+  opacity: 0.5;
+}
+.form-check-input[disabled] ~ .form-check-label, .form-check-input:disabled ~ .form-check-label {
+  cursor: default;
+  opacity: 0.5;
+}
+
+.form-switch {
+  padding-left: 2.5em;
+}
+.form-switch .form-check-input {
+  --bs-form-switch-bg: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='-4 -4 8 8'%3e%3ccircle r='3' fill='rgba%280, 0, 0, 0.25%29'/%3e%3c/svg%3e");
+  width: 2em;
+  margin-left: -2.5em;
+  background-image: var(--bs-form-switch-bg);
+  background-position: left center;
+  border-radius: 2em;
+  transition: background-position 0.15s ease-in-out;
+}
+@media (prefers-reduced-motion: reduce) {
+  .form-switch .form-check-input {
+    transition: none;
+  }
+}
+.form-switch .form-check-input:focus {
+  --bs-form-switch-bg: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='-4 -4 8 8'%3e%3ccircle r='3' fill='%2386b7fe'/%3e%3c/svg%3e");
+}
+.form-switch .form-check-input:checked {
+  background-position: right center;
+  --bs-form-switch-bg: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='-4 -4 8 8'%3e%3ccircle r='3' fill='%23fff'/%3e%3c/svg%3e");
+}
+.form-switch.form-check-reverse {
+  padding-right: 2.5em;
+  padding-left: 0;
+}
+.form-switch.form-check-reverse .form-check-input {
+  margin-right: -2.5em;
+  margin-left: 0;
+}
+
+.form-check-inline {
+  display: inline-block;
+  margin-right: 1rem;
+}
+
+.btn-check {
+  position: absolute;
+  clip: rect(0, 0, 0, 0);
+  pointer-events: none;
+}
+.btn-check[disabled] + .btn, .btn-check:disabled + .btn {
+  pointer-events: none;
+  filter: none;
+  opacity: 0.65;
+}
+
+[data-bs-theme=dark] .form-switch .form-check-input:not(:checked):not(:focus) {
+  --bs-form-switch-bg: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='-4 -4 8 8'%3e%3ccircle r='3' fill='rgba%28255, 255, 255, 0.25%29'/%3e%3c/svg%3e");
+}
+
+.form-range {
+  width: 100%;
+  height: 1.5rem;
+  padding: 0;
+  -webkit-appearance: none;
+  -moz-appearance: none;
+  appearance: none;
+  background-color: transparent;
+}
+.form-range:focus {
+  outline: 0;
+}
+.form-range:focus::-webkit-slider-thumb {
+  box-shadow: 0 0 0 1px #fff, 0 0 0 0.25rem rgba(13, 110, 253, 0.25);
+}
+.form-range:focus::-moz-range-thumb {
+  box-shadow: 0 0 0 1px #fff, 0 0 0 0.25rem rgba(13, 110, 253, 0.25);
+}
+.form-range::-moz-focus-outer {
+  border: 0;
+}
+.form-range::-webkit-slider-thumb {
+  width: 1rem;
+  height: 1rem;
+  margin-top: -0.25rem;
+  -webkit-appearance: none;
+  appearance: none;
+  background-color: #0d6efd;
+  border: 0;
+  border-radius: 1rem;
+  -webkit-transition: background-color 0.15s ease-in-out, border-color 0.15s ease-in-out, box-shadow 0.15s ease-in-out;
+  transition: background-color 0.15s ease-in-out, border-color 0.15s ease-in-out, box-shadow 0.15s ease-in-out;
+}
+@media (prefers-reduced-motion: reduce) {
+  .form-range::-webkit-slider-thumb {
+    -webkit-transition: none;
+    transition: none;
+  }
+}
+.form-range::-webkit-slider-thumb:active {
+  background-color: #b6d4fe;
+}
+.form-range::-webkit-slider-runnable-track {
+  width: 100%;
+  height: 0.5rem;
+  color: transparent;
+  cursor: pointer;
+  background-color: var(--bs-secondary-bg);
+  border-color: transparent;
+  border-radius: 1rem;
+}
+.form-range::-moz-range-thumb {
+  width: 1rem;
+  height: 1rem;
+  -moz-appearance: none;
+  appearance: none;
+  background-color: #0d6efd;
+  border: 0;
+  border-radius: 1rem;
+  -moz-transition: background-color 0.15s ease-in-out, border-color 0.15s ease-in-out, box-shadow 0.15s ease-in-out;
+  transition: background-color 0.15s ease-in-out, border-color 0.15s ease-in-out, box-shadow 0.15s ease-in-out;
+}
+@media (prefers-reduced-motion: reduce) {
+  .form-range::-moz-range-thumb {
+    -moz-transition: none;
+    transition: none;
+  }
+}
+.form-range::-moz-range-thumb:active {
+  background-color: #b6d4fe;
+}
+.form-range::-moz-range-track {
+  width: 100%;
+  height: 0.5rem;
+  color: transparent;
+  cursor: pointer;
+  background-color: var(--bs-secondary-bg);
+  border-color: transparent;
+  border-radius: 1rem;
+}
+.form-range:disabled {
+  pointer-events: none;
+}
+.form-range:disabled::-webkit-slider-thumb {
+  background-color: var(--bs-secondary-color);
+}
+.form-range:disabled::-moz-range-thumb {
+  background-color: var(--bs-secondary-color);
+}
+
+.form-floating {
+  position: relative;
+}
+.form-floating > .form-control,
+.form-floating > .form-control-plaintext,
+.form-floating > .form-select {
+  height: calc(3.5rem + calc(var(--bs-border-width) * 2));
+  min-height: calc(3.5rem + calc(var(--bs-border-width) * 2));
+  line-height: 1.25;
+}
+.form-floating > label {
+  position: absolute;
+  top: 0;
+  left: 0;
+  z-index: 2;
+  height: 100%;
+  padding: 1rem 0.75rem;
+  overflow: hidden;
+  text-align: start;
+  text-overflow: ellipsis;
+  white-space: nowrap;
+  pointer-events: none;
+  border: var(--bs-border-width) solid transparent;
+  transform-origin: 0 0;
+  transition: opacity 0.1s ease-in-out, transform 0.1s ease-in-out;
+}
+@media (prefers-reduced-motion: reduce) {
+  .form-floating > label {
+    transition: none;
+  }
+}
+.form-floating > .form-control,
+.form-floating > .form-control-plaintext {
+  padding: 1rem 0.75rem;
+}
+.form-floating > .form-control::-moz-placeholder, .form-floating > .form-control-plaintext::-moz-placeholder {
+  color: transparent;
+}
+.form-floating > .form-control::placeholder,
+.form-floating > .form-control-plaintext::placeholder {
+  color: transparent;
+}
+.form-floating > .form-control:not(:-moz-placeholder-shown), .form-floating > .form-control-plaintext:not(:-moz-placeholder-shown) {
+  padding-top: 1.625rem;
+  padding-bottom: 0.625rem;
+}
+.form-floating > .form-control:focus, .form-floating > .form-control:not(:placeholder-shown),
+.form-floating > .form-control-plaintext:focus,
+.form-floating > .form-control-plaintext:not(:placeholder-shown) {
+  padding-top: 1.625rem;
+  padding-bottom: 0.625rem;
+}
+.form-floating > .form-control:-webkit-autofill,
+.form-floating > .form-control-plaintext:-webkit-autofill {
+  padding-top: 1.625rem;
+  padding-bottom: 0.625rem;
+}
+.form-floating > .form-select {
+  padding-top: 1.625rem;
+  padding-bottom: 0.625rem;
+}
+.form-floating > .form-control:not(:-moz-placeholder-shown) ~ label {
+  color: rgba(var(--bs-body-color-rgb), 0.65);
+  transform: scale(0.85) translateY(-0.5rem) translateX(0.15rem);
+}
+.form-floating > .form-control:focus ~ label,
+.form-floating > .form-control:not(:placeholder-shown) ~ label,
+.form-floating > .form-control-plaintext ~ label,
+.form-floating > .form-select ~ label {
+  color: rgba(var(--bs-body-color-rgb), 0.65);
+  transform: scale(0.85) translateY(-0.5rem) translateX(0.15rem);
+}
+.form-floating > .form-control:not(:-moz-placeholder-shown) ~ label::after {
+  position: absolute;
+  inset: 1rem 0.375rem;
+  z-index: -1;
+  height: 1.5em;
+  content: "";
+  background-color: var(--bs-body-bg);
+  border-radius: var(--bs-border-radius);
+}
+.form-floating > .form-control:focus ~ label::after,
+.form-floating > .form-control:not(:placeholder-shown) ~ label::after,
+.form-floating > .form-control-plaintext ~ label::after,
+.form-floating > .form-select ~ label::after {
+  position: absolute;
+  inset: 1rem 0.375rem;
+  z-index: -1;
+  height: 1.5em;
+  content: "";
+  background-color: var(--bs-body-bg);
+  border-radius: var(--bs-border-radius);
+}
+.form-floating > .form-control:-webkit-autofill ~ label {
+  color: rgba(var(--bs-body-color-rgb), 0.65);
+  transform: scale(0.85) translateY(-0.5rem) translateX(0.15rem);
+}
+.form-floating > .form-control-plaintext ~ label {
+  border-width: var(--bs-border-width) 0;
+}
+.form-floating > :disabled ~ label,
+.form-floating > .form-control:disabled ~ label {
+  color: #6c757d;
+}
+.form-floating > :disabled ~ label::after,
+.form-floating > .form-control:disabled ~ label::after {
+  background-color: var(--bs-secondary-bg);
+}
+
+.input-group {
+  position: relative;
+  display: flex;
+  flex-wrap: wrap;
+  align-items: stretch;
+  width: 100%;
+}
+.input-group > .form-control,
+.input-group > .form-select,
+.input-group > .form-floating {
+  position: relative;
+  flex: 1 1 auto;
+  width: 1%;
+  min-width: 0;
+}
+.input-group > .form-control:focus,
+.input-group > .form-select:focus,
+.input-group > .form-floating:focus-within {
+  z-index: 5;
+}
+.input-group .btn {
+  position: relative;
+  z-index: 2;
+}
+.input-group .btn:focus {
+  z-index: 5;
+}
+
+.input-group-text {
+  display: flex;
+  align-items: center;
+  padding: 0.375rem 0.75rem;
+  font-size: 1rem;
+  font-weight: 400;
+  line-height: 1.5;
+  color: var(--bs-body-color);
+  text-align: center;
+  white-space: nowrap;
+  background-color: var(--bs-tertiary-bg);
+  border: var(--bs-border-width) solid var(--bs-border-color);
+  border-radius: var(--bs-border-radius);
+}
+
+.input-group-lg > .form-control,
+.input-group-lg > .form-select,
+.input-group-lg > .input-group-text,
+.input-group-lg > .btn {
+  padding: 0.5rem 1rem;
+  font-size: 1.25rem;
+  border-radius: var(--bs-border-radius-lg);
+}
+
+.input-group-sm > .form-control,
+.input-group-sm > .form-select,
+.input-group-sm > .input-group-text,
+.input-group-sm > .btn {
+  padding: 0.25rem 0.5rem;
+  font-size: 0.875rem;
+  border-radius: var(--bs-border-radius-sm);
+}
+
+.input-group-lg > .form-select,
+.input-group-sm > .form-select {
+  padding-right: 3rem;
+}
+
+.input-group:not(.has-validation) > :not(:last-child):not(.dropdown-toggle):not(.dropdown-menu):not(.form-floating),
+.input-group:not(.has-validation) > .dropdown-toggle:nth-last-child(n+3),
+.input-group:not(.has-validation) > .form-floating:not(:last-child) > .form-control,
+.input-group:not(.has-validation) > .form-floating:not(:last-child) > .form-select {
+  border-top-right-radius: 0;
+  border-bottom-right-radius: 0;
+}
+.input-group.has-validation > :nth-last-child(n+3):not(.dropdown-toggle):not(.dropdown-menu):not(.form-floating),
+.input-group.has-validation > .dropdown-toggle:nth-last-child(n+4),
+.input-group.has-validation > .form-floating:nth-last-child(n+3) > .form-control,
+.input-group.has-validation > .form-floating:nth-last-child(n+3) > .form-select {
+  border-top-right-radius: 0;
+  border-bottom-right-radius: 0;
+}
+.input-group > :not(:first-child):not(.dropdown-menu):not(.valid-tooltip):not(.valid-feedback):not(.invalid-tooltip):not(.invalid-feedback) {
+  margin-left: calc(var(--bs-border-width) * -1);
+  border-top-left-radius: 0;
+  border-bottom-left-radius: 0;
+}
+.input-group > .form-floating:not(:first-child) > .form-control,
+.input-group > .form-floating:not(:first-child) > .form-select {
+  border-top-left-radius: 0;
+  border-bottom-left-radius: 0;
+}
+
+.valid-feedback {
+  display: none;
+  width: 100%;
+  margin-top: 0.25rem;
+  font-size: 0.875em;
+  color: var(--bs-form-valid-color);
+}
+
+.valid-tooltip {
+  position: absolute;
+  top: 100%;
+  z-index: 5;
+  display: none;
+  max-width: 100%;
+  padding: 0.25rem 0.5rem;
+  margin-top: 0.1rem;
+  font-size: 0.875rem;
+  color: #fff;
+  background-color: var(--bs-success);
+  border-radius: var(--bs-border-radius);
+}
+
+.was-validated :valid ~ .valid-feedback,
+.was-validated :valid ~ .valid-tooltip,
+.is-valid ~ .valid-feedback,
+.is-valid ~ .valid-tooltip {
+  display: block;
+}
+
+.was-validated .form-control:valid, .form-control.is-valid {
+  border-color: var(--bs-form-valid-border-color);
+  padding-right: calc(1.5em + 0.75rem);
+  background-image: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 8 8'%3e%3cpath fill='%23198754' d='M2.3 6.73.6 4.53c-.4-1.04.46-1.4 1.1-.8l1.1 1.4 3.4-3.8c.6-.63 1.6-.27 1.2.7l-4 4.6c-.43.5-.8.4-1.1.1z'/%3e%3c/svg%3e");
+  background-repeat: no-repeat;
+  background-position: right calc(0.375em + 0.1875rem) center;
+  background-size: calc(0.75em + 0.375rem) calc(0.75em + 0.375rem);
+}
+.was-validated .form-control:valid:focus, .form-control.is-valid:focus {
+  border-color: var(--bs-form-valid-border-color);
+  box-shadow: 0 0 0 0.25rem rgba(var(--bs-success-rgb), 0.25);
+}
+
+.was-validated textarea.form-control:valid, textarea.form-control.is-valid {
+  padding-right: calc(1.5em + 0.75rem);
+  background-position: top calc(0.375em + 0.1875rem) right calc(0.375em + 0.1875rem);
+}
+
+.was-validated .form-select:valid, .form-select.is-valid {
+  border-color: var(--bs-form-valid-border-color);
+}
+.was-validated .form-select:valid:not([multiple]):not([size]), .was-validated .form-select:valid:not([multiple])[size="1"], .form-select.is-valid:not([multiple]):not([size]), .form-select.is-valid:not([multiple])[size="1"] {
+  --bs-form-select-bg-icon: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 8 8'%3e%3cpath fill='%23198754' d='M2.3 6.73.6 4.53c-.4-1.04.46-1.4 1.1-.8l1.1 1.4 3.4-3.8c.6-.63 1.6-.27 1.2.7l-4 4.6c-.43.5-.8.4-1.1.1z'/%3e%3c/svg%3e");
+  padding-right: 4.125rem;
+  background-position: right 0.75rem center, center right 2.25rem;
+  background-size: 16px 12px, calc(0.75em + 0.375rem) calc(0.75em + 0.375rem);
+}
+.was-validated .form-select:valid:focus, .form-select.is-valid:focus {
+  border-color: var(--bs-form-valid-border-color);
+  box-shadow: 0 0 0 0.25rem rgba(var(--bs-success-rgb), 0.25);
+}
+
+.was-validated .form-control-color:valid, .form-control-color.is-valid {
+  width: calc(3rem + calc(1.5em + 0.75rem));
+}
+
+.was-validated .form-check-input:valid, .form-check-input.is-valid {
+  border-color: var(--bs-form-valid-border-color);
+}
+.was-validated .form-check-input:valid:checked, .form-check-input.is-valid:checked {
+  background-color: var(--bs-form-valid-color);
+}
+.was-validated .form-check-input:valid:focus, .form-check-input.is-valid:focus {
+  box-shadow: 0 0 0 0.25rem rgba(var(--bs-success-rgb), 0.25);
+}
+.was-validated .form-check-input:valid ~ .form-check-label, .form-check-input.is-valid ~ .form-check-label {
+  color: var(--bs-form-valid-color);
+}
+
+.form-check-inline .form-check-input ~ .valid-feedback {
+  margin-left: 0.5em;
+}
+
+.was-validated .input-group > .form-control:not(:focus):valid, .input-group > .form-control:not(:focus).is-valid,
+.was-validated .input-group > .form-select:not(:focus):valid,
+.input-group > .form-select:not(:focus).is-valid,
+.was-validated .input-group > .form-floating:not(:focus-within):valid,
+.input-group > .form-floating:not(:focus-within).is-valid {
+  z-index: 3;
+}
+
+.invalid-feedback {
+  display: none;
+  width: 100%;
+  margin-top: 0.25rem;
+  font-size: 0.875em;
+  color: var(--bs-form-invalid-color);
+}
+
+.invalid-tooltip {
+  position: absolute;
+  top: 100%;
+  z-index: 5;
+  display: none;
+  max-width: 100%;
+  padding: 0.25rem 0.5rem;
+  margin-top: 0.1rem;
+  font-size: 0.875rem;
+  color: #fff;
+  background-color: var(--bs-danger);
+  border-radius: var(--bs-border-radius);
+}
+
+.was-validated :invalid ~ .invalid-feedback,
+.was-validated :invalid ~ .invalid-tooltip,
+.is-invalid ~ .invalid-feedback,
+.is-invalid ~ .invalid-tooltip {
+  display: block;
+}
+
+.was-validated .form-control:invalid, .form-control.is-invalid {
+  border-color: var(--bs-form-invalid-border-color);
+  padding-right: calc(1.5em + 0.75rem);
+  background-image: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 12 12' width='12' height='12' fill='none' stroke='%23dc3545'%3e%3ccircle cx='6' cy='6' r='4.5'/%3e%3cpath stroke-linejoin='round' d='M5.8 3.6h.4L6 6.5z'/%3e%3ccircle cx='6' cy='8.2' r='.6' fill='%23dc3545' stroke='none'/%3e%3c/svg%3e");
+  background-repeat: no-repeat;
+  background-position: right calc(0.375em + 0.1875rem) center;
+  background-size: calc(0.75em + 0.375rem) calc(0.75em + 0.375rem);
+}
+.was-validated .form-control:invalid:focus, .form-control.is-invalid:focus {
+  border-color: var(--bs-form-invalid-border-color);
+  box-shadow: 0 0 0 0.25rem rgba(var(--bs-danger-rgb), 0.25);
+}
+
+.was-validated textarea.form-control:invalid, textarea.form-control.is-invalid {
+  padding-right: calc(1.5em + 0.75rem);
+  background-position: top calc(0.375em + 0.1875rem) right calc(0.375em + 0.1875rem);
+}
+
+.was-validated .form-select:invalid, .form-select.is-invalid {
+  border-color: var(--bs-form-invalid-border-color);
+}
+.was-validated .form-select:invalid:not([multiple]):not([size]), .was-validated .form-select:invalid:not([multiple])[size="1"], .form-select.is-invalid:not([multiple]):not([size]), .form-select.is-invalid:not([multiple])[size="1"] {
+  --bs-form-select-bg-icon: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 12 12' width='12' height='12' fill='none' stroke='%23dc3545'%3e%3ccircle cx='6' cy='6' r='4.5'/%3e%3cpath stroke-linejoin='round' d='M5.8 3.6h.4L6 6.5z'/%3e%3ccircle cx='6' cy='8.2' r='.6' fill='%23dc3545' stroke='none'/%3e%3c/svg%3e");
+  padding-right: 4.125rem;
+  background-position: right 0.75rem center, center right 2.25rem;
+  background-size: 16px 12px, calc(0.75em + 0.375rem) calc(0.75em + 0.375rem);
+}
+.was-validated .form-select:invalid:focus, .form-select.is-invalid:focus {
+  border-color: var(--bs-form-invalid-border-color);
+  box-shadow: 0 0 0 0.25rem rgba(var(--bs-danger-rgb), 0.25);
+}
+
+.was-validated .form-control-color:invalid, .form-control-color.is-invalid {
+  width: calc(3rem + calc(1.5em + 0.75rem));
+}
+
+.was-validated .form-check-input:invalid, .form-check-input.is-invalid {
+  border-color: var(--bs-form-invalid-border-color);
+}
+.was-validated .form-check-input:invalid:checked, .form-check-input.is-invalid:checked {
+  background-color: var(--bs-form-invalid-color);
+}
+.was-validated .form-check-input:invalid:focus, .form-check-input.is-invalid:focus {
+  box-shadow: 0 0 0 0.25rem rgba(var(--bs-danger-rgb), 0.25);
+}
+.was-validated .form-check-input:invalid ~ .form-check-label, .form-check-input.is-invalid ~ .form-check-label {
+  color: var(--bs-form-invalid-color);
+}
+
+.form-check-inline .form-check-input ~ .invalid-feedback {
+  margin-left: 0.5em;
+}
+
+.was-validated .input-group > .form-control:not(:focus):invalid, .input-group > .form-control:not(:focus).is-invalid,
+.was-validated .input-group > .form-select:not(:focus):invalid,
+.input-group > .form-select:not(:focus).is-invalid,
+.was-validated .input-group > .form-floating:not(:focus-within):invalid,
+.input-group > .form-floating:not(:focus-within).is-invalid {
+  z-index: 4;
+}
+
+.btn {
+  --bs-btn-padding-x: 0.75rem;
+  --bs-btn-padding-y: 0.375rem;
+  --bs-btn-font-family: ;
+  --bs-btn-font-size: 1rem;
+  --bs-btn-font-weight: 400;
+  --bs-btn-line-height: 1.5;
+  --bs-btn-color: var(--bs-body-color);
+  --bs-btn-bg: transparent;
+  --bs-btn-border-width: var(--bs-border-width);
+  --bs-btn-border-color: transparent;
+  --bs-btn-border-radius: var(--bs-border-radius);
+  --bs-btn-hover-border-color: transparent;
+  --bs-btn-box-shadow: inset 0 1px 0 rgba(255, 255, 255, 0.15), 0 1px 1px rgba(0, 0, 0, 0.075);
+  --bs-btn-disabled-opacity: 0.65;
+  --bs-btn-focus-box-shadow: 0 0 0 0.25rem rgba(var(--bs-btn-focus-shadow-rgb), .5);
+  display: inline-block;
+  padding: var(--bs-btn-padding-y) var(--bs-btn-padding-x);
+  font-family: var(--bs-btn-font-family);
+  font-size: var(--bs-btn-font-size);
+  font-weight: var(--bs-btn-font-weight);
+  line-height: var(--bs-btn-line-height);
+  color: var(--bs-btn-color);
+  text-align: center;
+  text-decoration: none;
+  vertical-align: middle;
+  cursor: pointer;
+  -webkit-user-select: none;
+  -moz-user-select: none;
+  user-select: none;
+  border: var(--bs-btn-border-width) solid var(--bs-btn-border-color);
+  border-radius: var(--bs-btn-border-radius);
+  background-color: var(--bs-btn-bg);
+  transition: color 0.15s ease-in-out, background-color 0.15s ease-in-out, border-color 0.15s ease-in-out, box-shadow 0.15s ease-in-out;
+}
+@media (prefers-reduced-motion: reduce) {
+  .btn {
+    transition: none;
+  }
+}
+.btn:hover {
+  color: var(--bs-btn-hover-color);
+  background-color: var(--bs-btn-hover-bg);
+  border-color: var(--bs-btn-hover-border-color);
+}
+.btn-check + .btn:hover {
+  color: var(--bs-btn-color);
+  background-color: var(--bs-btn-bg);
+  border-color: var(--bs-btn-border-color);
+}
+.btn:focus-visible {
+  color: var(--bs-btn-hover-color);
+  background-color: var(--bs-btn-hover-bg);
+  border-color: var(--bs-btn-hover-border-color);
+  outline: 0;
+  box-shadow: var(--bs-btn-focus-box-shadow);
+}
+.btn-check:focus-visible + .btn {
+  border-color: var(--bs-btn-hover-border-color);
+  outline: 0;
+  box-shadow: var(--bs-btn-focus-box-shadow);
+}
+.btn-check:checked + .btn, :not(.btn-check) + .btn:active, .btn:first-child:active, .btn.active, .btn.show {
+  color: var(--bs-btn-active-color);
+  background-color: var(--bs-btn-active-bg);
+  border-color: var(--bs-btn-active-border-color);
+}
+.btn-check:checked + .btn:focus-visible, :not(.btn-check) + .btn:active:focus-visible, .btn:first-child:active:focus-visible, .btn.active:focus-visible, .btn.show:focus-visible {
+  box-shadow: var(--bs-btn-focus-box-shadow);
+}
+.btn:disabled, .btn.disabled, fieldset:disabled .btn {
+  color: var(--bs-btn-disabled-color);
+  pointer-events: none;
+  background-color: var(--bs-btn-disabled-bg);
+  border-color: var(--bs-btn-disabled-border-color);
+  opacity: var(--bs-btn-disabled-opacity);
+}
+
+.btn-primary {
+  --bs-btn-color: #fff;
+  --bs-btn-bg: #0d6efd;
+  --bs-btn-border-color: #0d6efd;
+  --bs-btn-hover-color: #fff;
+  --bs-btn-hover-bg: #0b5ed7;
+  --bs-btn-hover-border-color: #0a58ca;
+  --bs-btn-focus-shadow-rgb: 49, 132, 253;
+  --bs-btn-active-color: #fff;
+  --bs-btn-active-bg: #0a58ca;
+  --bs-btn-active-border-color: #0a53be;
+  --bs-btn-active-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125);
+  --bs-btn-disabled-color: #fff;
+  --bs-btn-disabled-bg: #0d6efd;
+  --bs-btn-disabled-border-color: #0d6efd;
+}
+
+.btn-secondary {
+  --bs-btn-color: #fff;
+  --bs-btn-bg: #6c757d;
+  --bs-btn-border-color: #6c757d;
+  --bs-btn-hover-color: #fff;
+  --bs-btn-hover-bg: #5c636a;
+  --bs-btn-hover-border-color: #565e64;
+  --bs-btn-focus-shadow-rgb: 130, 138, 145;
+  --bs-btn-active-color: #fff;
+  --bs-btn-active-bg: #565e64;
+  --bs-btn-active-border-color: #51585e;
+  --bs-btn-active-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125);
+  --bs-btn-disabled-color: #fff;
+  --bs-btn-disabled-bg: #6c757d;
+  --bs-btn-disabled-border-color: #6c757d;
+}
+
+.btn-success {
+  --bs-btn-color: #fff;
+  --bs-btn-bg: #198754;
+  --bs-btn-border-color: #198754;
+  --bs-btn-hover-color: #fff;
+  --bs-btn-hover-bg: #157347;
+  --bs-btn-hover-border-color: #146c43;
+  --bs-btn-focus-shadow-rgb: 60, 153, 110;
+  --bs-btn-active-color: #fff;
+  --bs-btn-active-bg: #146c43;
+  --bs-btn-active-border-color: #13653f;
+  --bs-btn-active-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125);
+  --bs-btn-disabled-color: #fff;
+  --bs-btn-disabled-bg: #198754;
+  --bs-btn-disabled-border-color: #198754;
+}
+
+.btn-info {
+  --bs-btn-color: #000;
+  --bs-btn-bg: #0dcaf0;
+  --bs-btn-border-color: #0dcaf0;
+  --bs-btn-hover-color: #000;
+  --bs-btn-hover-bg: #31d2f2;
+  --bs-btn-hover-border-color: #25cff2;
+  --bs-btn-focus-shadow-rgb: 11, 172, 204;
+  --bs-btn-active-color: #000;
+  --bs-btn-active-bg: #3dd5f3;
+  --bs-btn-active-border-color: #25cff2;
+  --bs-btn-active-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125);
+  --bs-btn-disabled-color: #000;
+  --bs-btn-disabled-bg: #0dcaf0;
+  --bs-btn-disabled-border-color: #0dcaf0;
+}
+
+.btn-warning {
+  --bs-btn-color: #000;
+  --bs-btn-bg: #ffc107;
+  --bs-btn-border-color: #ffc107;
+  --bs-btn-hover-color: #000;
+  --bs-btn-hover-bg: #ffca2c;
+  --bs-btn-hover-border-color: #ffc720;
+  --bs-btn-focus-shadow-rgb: 217, 164, 6;
+  --bs-btn-active-color: #000;
+  --bs-btn-active-bg: #ffcd39;
+  --bs-btn-active-border-color: #ffc720;
+  --bs-btn-active-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125);
+  --bs-btn-disabled-color: #000;
+  --bs-btn-disabled-bg: #ffc107;
+  --bs-btn-disabled-border-color: #ffc107;
+}
+
+.btn-danger {
+  --bs-btn-color: #fff;
+  --bs-btn-bg: #dc3545;
+  --bs-btn-border-color: #dc3545;
+  --bs-btn-hover-color: #fff;
+  --bs-btn-hover-bg: #bb2d3b;
+  --bs-btn-hover-border-color: #b02a37;
+  --bs-btn-focus-shadow-rgb: 225, 83, 97;
+  --bs-btn-active-color: #fff;
+  --bs-btn-active-bg: #b02a37;
+  --bs-btn-active-border-color: #a52834;
+  --bs-btn-active-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125);
+  --bs-btn-disabled-color: #fff;
+  --bs-btn-disabled-bg: #dc3545;
+  --bs-btn-disabled-border-color: #dc3545;
+}
+
+.btn-light {
+  --bs-btn-color: #000;
+  --bs-btn-bg: #f8f9fa;
+  --bs-btn-border-color: #f8f9fa;
+  --bs-btn-hover-color: #000;
+  --bs-btn-hover-bg: #d3d4d5;
+  --bs-btn-hover-border-color: #c6c7c8;
+  --bs-btn-focus-shadow-rgb: 211, 212, 213;
+  --bs-btn-active-color: #000;
+  --bs-btn-active-bg: #c6c7c8;
+  --bs-btn-active-border-color: #babbbc;
+  --bs-btn-active-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125);
+  --bs-btn-disabled-color: #000;
+  --bs-btn-disabled-bg: #f8f9fa;
+  --bs-btn-disabled-border-color: #f8f9fa;
+}
+
+.btn-dark {
+  --bs-btn-color: #fff;
+  --bs-btn-bg: #212529;
+  --bs-btn-border-color: #212529;
+  --bs-btn-hover-color: #fff;
+  --bs-btn-hover-bg: #424649;
+  --bs-btn-hover-border-color: #373b3e;
+  --bs-btn-focus-shadow-rgb: 66, 70, 73;
+  --bs-btn-active-color: #fff;
+  --bs-btn-active-bg: #4d5154;
+  --bs-btn-active-border-color: #373b3e;
+  --bs-btn-active-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125);
+  --bs-btn-disabled-color: #fff;
+  --bs-btn-disabled-bg: #212529;
+  --bs-btn-disabled-border-color: #212529;
+}
+
+.btn-outline-primary {
+  --bs-btn-color: #0d6efd;
+  --bs-btn-border-color: #0d6efd;
+  --bs-btn-hover-color: #fff;
+  --bs-btn-hover-bg: #0d6efd;
+  --bs-btn-hover-border-color: #0d6efd;
+  --bs-btn-focus-shadow-rgb: 13, 110, 253;
+  --bs-btn-active-color: #fff;
+  --bs-btn-active-bg: #0d6efd;
+  --bs-btn-active-border-color: #0d6efd;
+  --bs-btn-active-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125);
+  --bs-btn-disabled-color: #0d6efd;
+  --bs-btn-disabled-bg: transparent;
+  --bs-btn-disabled-border-color: #0d6efd;
+  --bs-gradient: none;
+}
+
+.btn-outline-secondary {
+  --bs-btn-color: #6c757d;
+  --bs-btn-border-color: #6c757d;
+  --bs-btn-hover-color: #fff;
+  --bs-btn-hover-bg: #6c757d;
+  --bs-btn-hover-border-color: #6c757d;
+  --bs-btn-focus-shadow-rgb: 108, 117, 125;
+  --bs-btn-active-color: #fff;
+  --bs-btn-active-bg: #6c757d;
+  --bs-btn-active-border-color: #6c757d;
+  --bs-btn-active-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125);
+  --bs-btn-disabled-color: #6c757d;
+  --bs-btn-disabled-bg: transparent;
+  --bs-btn-disabled-border-color: #6c757d;
+  --bs-gradient: none;
+}
+
+.btn-outline-success {
+  --bs-btn-color: #198754;
+  --bs-btn-border-color: #198754;
+  --bs-btn-hover-color: #fff;
+  --bs-btn-hover-bg: #198754;
+  --bs-btn-hover-border-color: #198754;
+  --bs-btn-focus-shadow-rgb: 25, 135, 84;
+  --bs-btn-active-color: #fff;
+  --bs-btn-active-bg: #198754;
+  --bs-btn-active-border-color: #198754;
+  --bs-btn-active-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125);
+  --bs-btn-disabled-color: #198754;
+  --bs-btn-disabled-bg: transparent;
+  --bs-btn-disabled-border-color: #198754;
+  --bs-gradient: none;
+}
+
+.btn-outline-info {
+  --bs-btn-color: #0dcaf0;
+  --bs-btn-border-color: #0dcaf0;
+  --bs-btn-hover-color: #000;
+  --bs-btn-hover-bg: #0dcaf0;
+  --bs-btn-hover-border-color: #0dcaf0;
+  --bs-btn-focus-shadow-rgb: 13, 202, 240;
+  --bs-btn-active-color: #000;
+  --bs-btn-active-bg: #0dcaf0;
+  --bs-btn-active-border-color: #0dcaf0;
+  --bs-btn-active-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125);
+  --bs-btn-disabled-color: #0dcaf0;
+  --bs-btn-disabled-bg: transparent;
+  --bs-btn-disabled-border-color: #0dcaf0;
+  --bs-gradient: none;
+}
+
+.btn-outline-warning {
+  --bs-btn-color: #ffc107;
+  --bs-btn-border-color: #ffc107;
+  --bs-btn-hover-color: #000;
+  --bs-btn-hover-bg: #ffc107;
+  --bs-btn-hover-border-color: #ffc107;
+  --bs-btn-focus-shadow-rgb: 255, 193, 7;
+  --bs-btn-active-color: #000;
+  --bs-btn-active-bg: #ffc107;
+  --bs-btn-active-border-color: #ffc107;
+  --bs-btn-active-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125);
+  --bs-btn-disabled-color: #ffc107;
+  --bs-btn-disabled-bg: transparent;
+  --bs-btn-disabled-border-color: #ffc107;
+  --bs-gradient: none;
+}
+
+.btn-outline-danger {
+  --bs-btn-color: #dc3545;
+  --bs-btn-border-color: #dc3545;
+  --bs-btn-hover-color: #fff;
+  --bs-btn-hover-bg: #dc3545;
+  --bs-btn-hover-border-color: #dc3545;
+  --bs-btn-focus-shadow-rgb: 220, 53, 69;
+  --bs-btn-active-color: #fff;
+  --bs-btn-active-bg: #dc3545;
+  --bs-btn-active-border-color: #dc3545;
+  --bs-btn-active-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125);
+  --bs-btn-disabled-color: #dc3545;
+  --bs-btn-disabled-bg: transparent;
+  --bs-btn-disabled-border-color: #dc3545;
+  --bs-gradient: none;
+}
+
+.btn-outline-light {
+  --bs-btn-color: #f8f9fa;
+  --bs-btn-border-color: #f8f9fa;
+  --bs-btn-hover-color: #000;
+  --bs-btn-hover-bg: #f8f9fa;
+  --bs-btn-hover-border-color: #f8f9fa;
+  --bs-btn-focus-shadow-rgb: 248, 249, 250;
+  --bs-btn-active-color: #000;
+  --bs-btn-active-bg: #f8f9fa;
+  --bs-btn-active-border-color: #f8f9fa;
+  --bs-btn-active-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125);
+  --bs-btn-disabled-color: #f8f9fa;
+  --bs-btn-disabled-bg: transparent;
+  --bs-btn-disabled-border-color: #f8f9fa;
+  --bs-gradient: none;
+}
+
+.btn-outline-dark {
+  --bs-btn-color: #212529;
+  --bs-btn-border-color: #212529;
+  --bs-btn-hover-color: #fff;
+  --bs-btn-hover-bg: #212529;
+  --bs-btn-hover-border-color: #212529;
+  --bs-btn-focus-shadow-rgb: 33, 37, 41;
+  --bs-btn-active-color: #fff;
+  --bs-btn-active-bg: #212529;
+  --bs-btn-active-border-color: #212529;
+  --bs-btn-active-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125);
+  --bs-btn-disabled-color: #212529;
+  --bs-btn-disabled-bg: transparent;
+  --bs-btn-disabled-border-color: #212529;
+  --bs-gradient: none;
+}
+
+.btn-link {
+  --bs-btn-font-weight: 400;
+  --bs-btn-color: var(--bs-link-color);
+  --bs-btn-bg: transparent;
+  --bs-btn-border-color: transparent;
+  --bs-btn-hover-color: var(--bs-link-hover-color);
+  --bs-btn-hover-border-color: transparent;
+  --bs-btn-active-color: var(--bs-link-hover-color);
+  --bs-btn-active-border-color: transparent;
+  --bs-btn-disabled-color: #6c757d;
+  --bs-btn-disabled-border-color: transparent;
+  --bs-btn-box-shadow: 0 0 0 #000;
+  --bs-btn-focus-shadow-rgb: 49, 132, 253;
+  text-decoration: underline;
+}
+.btn-link:focus-visible {
+  color: var(--bs-btn-color);
+}
+.btn-link:hover {
+  color: var(--bs-btn-hover-color);
+}
+
+.btn-lg, .btn-group-lg > .btn {
+  --bs-btn-padding-y: 0.5rem;
+  --bs-btn-padding-x: 1rem;
+  --bs-btn-font-size: 1.25rem;
+  --bs-btn-border-radius: var(--bs-border-radius-lg);
+}
+
+.btn-sm, .btn-group-sm > .btn {
+  --bs-btn-padding-y: 0.25rem;
+  --bs-btn-padding-x: 0.5rem;
+  --bs-btn-font-size: 0.875rem;
+  --bs-btn-border-radius: var(--bs-border-radius-sm);
+}
+
+.fade {
+  transition: opacity 0.15s linear;
+}
+@media (prefers-reduced-motion: reduce) {
+  .fade {
+    transition: none;
+  }
+}
+.fade:not(.show) {
+  opacity: 0;
+}
+
+.collapse:not(.show) {
+  display: none;
+}
+
+.collapsing {
+  height: 0;
+  overflow: hidden;
+  transition: height 0.35s ease;
+}
+@media (prefers-reduced-motion: reduce) {
+  .collapsing {
+    transition: none;
+  }
+}
+.collapsing.collapse-horizontal {
+  width: 0;
+  height: auto;
+  transition: width 0.35s ease;
+}
+@media (prefers-reduced-motion: reduce) {
+  .collapsing.collapse-horizontal {
+    transition: none;
+  }
+}
+
+.dropup,
+.dropend,
+.dropdown,
+.dropstart,
+.dropup-center,
+.dropdown-center {
+  position: relative;
+}
+
+.dropdown-toggle {
+  white-space: nowrap;
+}
+.dropdown-toggle::after {
+  display: inline-block;
+  margin-left: 0.255em;
+  vertical-align: 0.255em;
+  content: "";
+  border-top: 0.3em solid;
+  border-right: 0.3em solid transparent;
+  border-bottom: 0;
+  border-left: 0.3em solid transparent;
+}
+.dropdown-toggle:empty::after {
+  margin-left: 0;
+}
+
+.dropdown-menu {
+  --bs-dropdown-zindex: 1000;
+  --bs-dropdown-min-width: 10rem;
+  --bs-dropdown-padding-x: 0;
+  --bs-dropdown-padding-y: 0.5rem;
+  --bs-dropdown-spacer: 0.125rem;
+  --bs-dropdown-font-size: 1rem;
+  --bs-dropdown-color: var(--bs-body-color);
+  --bs-dropdown-bg: var(--bs-body-bg);
+  --bs-dropdown-border-color: var(--bs-border-color-translucent);
+  --bs-dropdown-border-radius: var(--bs-border-radius);
+  --bs-dropdown-border-width: var(--bs-border-width);
+  --bs-dropdown-inner-border-radius: calc(var(--bs-border-radius) - var(--bs-border-width));
+  --bs-dropdown-divider-bg: var(--bs-border-color-translucent);
+  --bs-dropdown-divider-margin-y: 0.5rem;
+  --bs-dropdown-box-shadow: var(--bs-box-shadow);
+  --bs-dropdown-link-color: var(--bs-body-color);
+  --bs-dropdown-link-hover-color: var(--bs-body-color);
+  --bs-dropdown-link-hover-bg: var(--bs-tertiary-bg);
+  --bs-dropdown-link-active-color: #fff;
+  --bs-dropdown-link-active-bg: #0d6efd;
+  --bs-dropdown-link-disabled-color: var(--bs-tertiary-color);
+  --bs-dropdown-item-padding-x: 1rem;
+  --bs-dropdown-item-padding-y: 0.25rem;
+  --bs-dropdown-header-color: #6c757d;
+  --bs-dropdown-header-padding-x: 1rem;
+  --bs-dropdown-header-padding-y: 0.5rem;
+  position: absolute;
+  z-index: var(--bs-dropdown-zindex);
+  display: none;
+  min-width: var(--bs-dropdown-min-width);
+  padding: var(--bs-dropdown-padding-y) var(--bs-dropdown-padding-x);
+  margin: 0;
+  font-size: var(--bs-dropdown-font-size);
+  color: var(--bs-dropdown-color);
+  text-align: left;
+  list-style: none;
+  background-color: var(--bs-dropdown-bg);
+  background-clip: padding-box;
+  border: var(--bs-dropdown-border-width) solid var(--bs-dropdown-border-color);
+  border-radius: var(--bs-dropdown-border-radius);
+}
+.dropdown-menu[data-bs-popper] {
+  top: 100%;
+  left: 0;
+  margin-top: var(--bs-dropdown-spacer);
+}
+
+.dropdown-menu-start {
+  --bs-position: start;
+}
+.dropdown-menu-start[data-bs-popper] {
+  right: auto;
+  left: 0;
+}
+
+.dropdown-menu-end {
+  --bs-position: end;
+}
+.dropdown-menu-end[data-bs-popper] {
+  right: 0;
+  left: auto;
+}
+
+@media (min-width: 576px) {
+  .dropdown-menu-sm-start {
+    --bs-position: start;
+  }
+  .dropdown-menu-sm-start[data-bs-popper] {
+    right: auto;
+    left: 0;
+  }
+  .dropdown-menu-sm-end {
+    --bs-position: end;
+  }
+  .dropdown-menu-sm-end[data-bs-popper] {
+    right: 0;
+    left: auto;
+  }
+}
+@media (min-width: 768px) {
+  .dropdown-menu-md-start {
+    --bs-position: start;
+  }
+  .dropdown-menu-md-start[data-bs-popper] {
+    right: auto;
+    left: 0;
+  }
+  .dropdown-menu-md-end {
+    --bs-position: end;
+  }
+  .dropdown-menu-md-end[data-bs-popper] {
+    right: 0;
+    left: auto;
+  }
+}
+@media (min-width: 992px) {
+  .dropdown-menu-lg-start {
+    --bs-position: start;
+  }
+  .dropdown-menu-lg-start[data-bs-popper] {
+    right: auto;
+    left: 0;
+  }
+  .dropdown-menu-lg-end {
+    --bs-position: end;
+  }
+  .dropdown-menu-lg-end[data-bs-popper] {
+    right: 0;
+    left: auto;
+  }
+}
+@media (min-width: 1200px) {
+  .dropdown-menu-xl-start {
+    --bs-position: start;
+  }
+  .dropdown-menu-xl-start[data-bs-popper] {
+    right: auto;
+    left: 0;
+  }
+  .dropdown-menu-xl-end {
+    --bs-position: end;
+  }
+  .dropdown-menu-xl-end[data-bs-popper] {
+    right: 0;
+    left: auto;
+  }
+}
+@media (min-width: 1400px) {
+  .dropdown-menu-xxl-start {
+    --bs-position: start;
+  }
+  .dropdown-menu-xxl-start[data-bs-popper] {
+    right: auto;
+    left: 0;
+  }
+  .dropdown-menu-xxl-end {
+    --bs-position: end;
+  }
+  .dropdown-menu-xxl-end[data-bs-popper] {
+    right: 0;
+    left: auto;
+  }
+}
+.dropup .dropdown-menu[data-bs-popper] {
+  top: auto;
+  bottom: 100%;
+  margin-top: 0;
+  margin-bottom: var(--bs-dropdown-spacer);
+}
+.dropup .dropdown-toggle::after {
+  display: inline-block;
+  margin-left: 0.255em;
+  vertical-align: 0.255em;
+  content: "";
+  border-top: 0;
+  border-right: 0.3em solid transparent;
+  border-bottom: 0.3em solid;
+  border-left: 0.3em solid transparent;
+}
+.dropup .dropdown-toggle:empty::after {
+  margin-left: 0;
+}
+
+.dropend .dropdown-menu[data-bs-popper] {
+  top: 0;
+  right: auto;
+  left: 100%;
+  margin-top: 0;
+  margin-left: var(--bs-dropdown-spacer);
+}
+.dropend .dropdown-toggle::after {
+  display: inline-block;
+  margin-left: 0.255em;
+  vertical-align: 0.255em;
+  content: "";
+  border-top: 0.3em solid transparent;
+  border-right: 0;
+  border-bottom: 0.3em solid transparent;
+  border-left: 0.3em solid;
+}
+.dropend .dropdown-toggle:empty::after {
+  margin-left: 0;
+}
+.dropend .dropdown-toggle::after {
+  vertical-align: 0;
+}
+
+.dropstart .dropdown-menu[data-bs-popper] {
+  top: 0;
+  right: 100%;
+  left: auto;
+  margin-top: 0;
+  margin-right: var(--bs-dropdown-spacer);
+}
+.dropstart .dropdown-toggle::after {
+  display: inline-block;
+  margin-left: 0.255em;
+  vertical-align: 0.255em;
+  content: "";
+}
+.dropstart .dropdown-toggle::after {
+  display: none;
+}
+.dropstart .dropdown-toggle::before {
+  display: inline-block;
+  margin-right: 0.255em;
+  vertical-align: 0.255em;
+  content: "";
+  border-top: 0.3em solid transparent;
+  border-right: 0.3em solid;
+  border-bottom: 0.3em solid transparent;
+}
+.dropstart .dropdown-toggle:empty::after {
+  margin-left: 0;
+}
+.dropstart .dropdown-toggle::before {
+  vertical-align: 0;
+}
+
+.dropdown-divider {
+  height: 0;
+  margin: var(--bs-dropdown-divider-margin-y) 0;
+  overflow: hidden;
+  border-top: 1px solid var(--bs-dropdown-divider-bg);
+  opacity: 1;
+}
+
+.dropdown-item {
+  display: block;
+  width: 100%;
+  padding: var(--bs-dropdown-item-padding-y) var(--bs-dropdown-item-padding-x);
+  clear: both;
+  font-weight: 400;
+  color: var(--bs-dropdown-link-color);
+  text-align: inherit;
+  text-decoration: none;
+  white-space: nowrap;
+  background-color: transparent;
+  border: 0;
+  border-radius: var(--bs-dropdown-item-border-radius, 0);
+}
+.dropdown-item:hover, .dropdown-item:focus {
+  color: var(--bs-dropdown-link-hover-color);
+  background-color: var(--bs-dropdown-link-hover-bg);
+}
+.dropdown-item.active, .dropdown-item:active {
+  color: var(--bs-dropdown-link-active-color);
+  text-decoration: none;
+  background-color: var(--bs-dropdown-link-active-bg);
+}
+.dropdown-item.disabled, .dropdown-item:disabled {
+  color: var(--bs-dropdown-link-disabled-color);
+  pointer-events: none;
+  background-color: transparent;
+}
+
+.dropdown-menu.show {
+  display: block;
+}
+
+.dropdown-header {
+  display: block;
+  padding: var(--bs-dropdown-header-padding-y) var(--bs-dropdown-header-padding-x);
+  margin-bottom: 0;
+  font-size: 0.875rem;
+  color: var(--bs-dropdown-header-color);
+  white-space: nowrap;
+}
+
+.dropdown-item-text {
+  display: block;
+  padding: var(--bs-dropdown-item-padding-y) var(--bs-dropdown-item-padding-x);
+  color: var(--bs-dropdown-link-color);
+}
+
+.dropdown-menu-dark {
+  --bs-dropdown-color: #dee2e6;
+  --bs-dropdown-bg: #343a40;
+  --bs-dropdown-border-color: var(--bs-border-color-translucent);
+  --bs-dropdown-box-shadow: ;
+  --bs-dropdown-link-color: #dee2e6;
+  --bs-dropdown-link-hover-color: #fff;
+  --bs-dropdown-divider-bg: var(--bs-border-color-translucent);
+  --bs-dropdown-link-hover-bg: rgba(255, 255, 255, 0.15);
+  --bs-dropdown-link-active-color: #fff;
+  --bs-dropdown-link-active-bg: #0d6efd;
+  --bs-dropdown-link-disabled-color: #adb5bd;
+  --bs-dropdown-header-color: #adb5bd;
+}
+
+.btn-group,
+.btn-group-vertical {
+  position: relative;
+  display: inline-flex;
+  vertical-align: middle;
+}
+.btn-group > .btn,
+.btn-group-vertical > .btn {
+  position: relative;
+  flex: 1 1 auto;
+}
+.btn-group > .btn-check:checked + .btn,
+.btn-group > .btn-check:focus + .btn,
+.btn-group > .btn:hover,
+.btn-group > .btn:focus,
+.btn-group > .btn:active,
+.btn-group > .btn.active,
+.btn-group-vertical > .btn-check:checked + .btn,
+.btn-group-vertical > .btn-check:focus + .btn,
+.btn-group-vertical > .btn:hover,
+.btn-group-vertical > .btn:focus,
+.btn-group-vertical > .btn:active,
+.btn-group-vertical > .btn.active {
+  z-index: 1;
+}
+
+.btn-toolbar {
+  display: flex;
+  flex-wrap: wrap;
+  justify-content: flex-start;
+}
+.btn-toolbar .input-group {
+  width: auto;
+}
+
+.btn-group {
+  border-radius: var(--bs-border-radius);
+}
+.btn-group > :not(.btn-check:first-child) + .btn,
+.btn-group > .btn-group:not(:first-child) {
+  margin-left: calc(var(--bs-border-width) * -1);
+}
+.btn-group > .btn:not(:last-child):not(.dropdown-toggle),
+.btn-group > .btn.dropdown-toggle-split:first-child,
+.btn-group > .btn-group:not(:last-child) > .btn {
+  border-top-right-radius: 0;
+  border-bottom-right-radius: 0;
+}
+.btn-group > .btn:nth-child(n+3),
+.btn-group > :not(.btn-check) + .btn,
+.btn-group > .btn-group:not(:first-child) > .btn {
+  border-top-left-radius: 0;
+  border-bottom-left-radius: 0;
+}
+
+.dropdown-toggle-split {
+  padding-right: 0.5625rem;
+  padding-left: 0.5625rem;
+}
+.dropdown-toggle-split::after, .dropup .dropdown-toggle-split::after, .dropend .dropdown-toggle-split::after {
+  margin-left: 0;
+}
+.dropstart .dropdown-toggle-split::before {
+  margin-right: 0;
+}
+
+.btn-sm + .dropdown-toggle-split, .btn-group-sm > .btn + .dropdown-toggle-split {
+  padding-right: 0.375rem;
+  padding-left: 0.375rem;
+}
+
+.btn-lg + .dropdown-toggle-split, .btn-group-lg > .btn + .dropdown-toggle-split {
+  padding-right: 0.75rem;
+  padding-left: 0.75rem;
+}
+
+.btn-group-vertical {
+  flex-direction: column;
+  align-items: flex-start;
+  justify-content: center;
+}
+.btn-group-vertical > .btn,
+.btn-group-vertical > .btn-group {
+  width: 100%;
+}
+.btn-group-vertical > .btn:not(:first-child),
+.btn-group-vertical > .btn-group:not(:first-child) {
+  margin-top: calc(var(--bs-border-width) * -1);
+}
+.btn-group-vertical > .btn:not(:last-child):not(.dropdown-toggle),
+.btn-group-vertical > .btn-group:not(:last-child) > .btn {
+  border-bottom-right-radius: 0;
+  border-bottom-left-radius: 0;
+}
+.btn-group-vertical > .btn ~ .btn,
+.btn-group-vertical > .btn-group:not(:first-child) > .btn {
+  border-top-left-radius: 0;
+  border-top-right-radius: 0;
+}
+
+.nav {
+  --bs-nav-link-padding-x: 1rem;
+  --bs-nav-link-padding-y: 0.5rem;
+  --bs-nav-link-font-weight: ;
+  --bs-nav-link-color: var(--bs-link-color);
+  --bs-nav-link-hover-color: var(--bs-link-hover-color);
+  --bs-nav-link-disabled-color: var(--bs-secondary-color);
+  display: flex;
+  flex-wrap: wrap;
+  padding-left: 0;
+  margin-bottom: 0;
+  list-style: none;
+}
+
+.nav-link {
+  display: block;
+  padding: var(--bs-nav-link-padding-y) var(--bs-nav-link-padding-x);
+  font-size: var(--bs-nav-link-font-size);
+  font-weight: var(--bs-nav-link-font-weight);
+  color: var(--bs-nav-link-color);
+  text-decoration: none;
+  background: none;
+  border: 0;
+  transition: color 0.15s ease-in-out, background-color 0.15s ease-in-out, border-color 0.15s ease-in-out;
+}
+@media (prefers-reduced-motion: reduce) {
+  .nav-link {
+    transition: none;
+  }
+}
+.nav-link:hover, .nav-link:focus {
+  color: var(--bs-nav-link-hover-color);
+}
+.nav-link:focus-visible {
+  outline: 0;
+  box-shadow: 0 0 0 0.25rem rgba(13, 110, 253, 0.25);
+}
+.nav-link.disabled, .nav-link:disabled {
+  color: var(--bs-nav-link-disabled-color);
+  pointer-events: none;
+  cursor: default;
+}
+
+.nav-tabs {
+  --bs-nav-tabs-border-width: var(--bs-border-width);
+  --bs-nav-tabs-border-color: var(--bs-border-color);
+  --bs-nav-tabs-border-radius: var(--bs-border-radius);
+  --bs-nav-tabs-link-hover-border-color: var(--bs-secondary-bg) var(--bs-secondary-bg) var(--bs-border-color);
+  --bs-nav-tabs-link-active-color: var(--bs-emphasis-color);
+  --bs-nav-tabs-link-active-bg: var(--bs-body-bg);
+  --bs-nav-tabs-link-active-border-color: var(--bs-border-color) var(--bs-border-color) var(--bs-body-bg);
+  border-bottom: var(--bs-nav-tabs-border-width) solid var(--bs-nav-tabs-border-color);
+}
+.nav-tabs .nav-link {
+  margin-bottom: calc(-1 * var(--bs-nav-tabs-border-width));
+  border: var(--bs-nav-tabs-border-width) solid transparent;
+  border-top-left-radius: var(--bs-nav-tabs-border-radius);
+  border-top-right-radius: var(--bs-nav-tabs-border-radius);
+}
+.nav-tabs .nav-link:hover, .nav-tabs .nav-link:focus {
+  isolation: isolate;
+  border-color: var(--bs-nav-tabs-link-hover-border-color);
+}
+.nav-tabs .nav-link.active,
+.nav-tabs .nav-item.show .nav-link {
+  color: var(--bs-nav-tabs-link-active-color);
+  background-color: var(--bs-nav-tabs-link-active-bg);
+  border-color: var(--bs-nav-tabs-link-active-border-color);
+}
+.nav-tabs .dropdown-menu {
+  margin-top: calc(-1 * var(--bs-nav-tabs-border-width));
+  border-top-left-radius: 0;
+  border-top-right-radius: 0;
+}
+
+.nav-pills {
+  --bs-nav-pills-border-radius: var(--bs-border-radius);
+  --bs-nav-pills-link-active-color: #fff;
+  --bs-nav-pills-link-active-bg: #0d6efd;
+}
+.nav-pills .nav-link {
+  border-radius: var(--bs-nav-pills-border-radius);
+}
+.nav-pills .nav-link.active,
+.nav-pills .show > .nav-link {
+  color: var(--bs-nav-pills-link-active-color);
+  background-color: var(--bs-nav-pills-link-active-bg);
+}
+
+.nav-underline {
+  --bs-nav-underline-gap: 1rem;
+  --bs-nav-underline-border-width: 0.125rem;
+  --bs-nav-underline-link-active-color: var(--bs-emphasis-color);
+  gap: var(--bs-nav-underline-gap);
+}
+.nav-underline .nav-link {
+  padding-right: 0;
+  padding-left: 0;
+  border-bottom: var(--bs-nav-underline-border-width) solid transparent;
+}
+.nav-underline .nav-link:hover, .nav-underline .nav-link:focus {
+  border-bottom-color: currentcolor;
+}
+.nav-underline .nav-link.active,
+.nav-underline .show > .nav-link {
+  font-weight: 700;
+  color: var(--bs-nav-underline-link-active-color);
+  border-bottom-color: currentcolor;
+}
+
+.nav-fill > .nav-link,
+.nav-fill .nav-item {
+  flex: 1 1 auto;
+  text-align: center;
+}
+
+.nav-justified > .nav-link,
+.nav-justified .nav-item {
+  flex-basis: 0;
+  flex-grow: 1;
+  text-align: center;
+}
+
+.nav-fill .nav-item .nav-link,
+.nav-justified .nav-item .nav-link {
+  width: 100%;
+}
+
+.tab-content > .tab-pane {
+  display: none;
+}
+.tab-content > .active {
+  display: block;
+}
+
+.navbar {
+  --bs-navbar-padding-x: 0;
+  --bs-navbar-padding-y: 0.5rem;
+  --bs-navbar-color: rgba(var(--bs-emphasis-color-rgb), 0.65);
+  --bs-navbar-hover-color: rgba(var(--bs-emphasis-color-rgb), 0.8);
+  --bs-navbar-disabled-color: rgba(var(--bs-emphasis-color-rgb), 0.3);
+  --bs-navbar-active-color: rgba(var(--bs-emphasis-color-rgb), 1);
+  --bs-navbar-brand-padding-y: 0.3125rem;
+  --bs-navbar-brand-margin-end: 1rem;
+  --bs-navbar-brand-font-size: 1.25rem;
+  --bs-navbar-brand-color: rgba(var(--bs-emphasis-color-rgb), 1);
+  --bs-navbar-brand-hover-color: rgba(var(--bs-emphasis-color-rgb), 1);
+  --bs-navbar-nav-link-padding-x: 0.5rem;
+  --bs-navbar-toggler-padding-y: 0.25rem;
+  --bs-navbar-toggler-padding-x: 0.75rem;
+  --bs-navbar-toggler-font-size: 1.25rem;
+  --bs-navbar-toggler-icon-bg: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 30 30'%3e%3cpath stroke='rgba%2833, 37, 41, 0.75%29' stroke-linecap='round' stroke-miterlimit='10' stroke-width='2' d='M4 7h22M4 15h22M4 23h22'/%3e%3c/svg%3e");
+  --bs-navbar-toggler-border-color: rgba(var(--bs-emphasis-color-rgb), 0.15);
+  --bs-navbar-toggler-border-radius: var(--bs-border-radius);
+  --bs-navbar-toggler-focus-width: 0.25rem;
+  --bs-navbar-toggler-transition: box-shadow 0.15s ease-in-out;
+  position: relative;
+  display: flex;
+  flex-wrap: wrap;
+  align-items: center;
+  justify-content: space-between;
+  padding: var(--bs-navbar-padding-y) var(--bs-navbar-padding-x);
+}
+.navbar > .container,
+.navbar > .container-fluid,
+.navbar > .container-sm,
+.navbar > .container-md,
+.navbar > .container-lg,
+.navbar > .container-xl,
+.navbar > .container-xxl {
+  display: flex;
+  flex-wrap: inherit;
+  align-items: center;
+  justify-content: space-between;
+}
+.navbar-brand {
+  padding-top: var(--bs-navbar-brand-padding-y);
+  padding-bottom: var(--bs-navbar-brand-padding-y);
+  margin-right: var(--bs-navbar-brand-margin-end);
+  font-size: var(--bs-navbar-brand-font-size);
+  color: var(--bs-navbar-brand-color);
+  text-decoration: none;
+  white-space: nowrap;
+}
+.navbar-brand:hover, .navbar-brand:focus {
+  color: var(--bs-navbar-brand-hover-color);
+}
+
+.navbar-nav {
+  --bs-nav-link-padding-x: 0;
+  --bs-nav-link-padding-y: 0.5rem;
+  --bs-nav-link-font-weight: ;
+  --bs-nav-link-color: var(--bs-navbar-color);
+  --bs-nav-link-hover-color: var(--bs-navbar-hover-color);
+  --bs-nav-link-disabled-color: var(--bs-navbar-disabled-color);
+  display: flex;
+  flex-direction: column;
+  padding-left: 0;
+  margin-bottom: 0;
+  list-style: none;
+}
+.navbar-nav .nav-link.active, .navbar-nav .nav-link.show {
+  color: var(--bs-navbar-active-color);
+}
+.navbar-nav .dropdown-menu {
+  position: static;
+}
+
+.navbar-text {
+  padding-top: 0.5rem;
+  padding-bottom: 0.5rem;
+  color: var(--bs-navbar-color);
+}
+.navbar-text a,
+.navbar-text a:hover,
+.navbar-text a:focus {
+  color: var(--bs-navbar-active-color);
+}
+
+.navbar-collapse {
+  flex-basis: 100%;
+  flex-grow: 1;
+  align-items: center;
+}
+
+.navbar-toggler {
+  padding: var(--bs-navbar-toggler-padding-y) var(--bs-navbar-toggler-padding-x);
+  font-size: var(--bs-navbar-toggler-font-size);
+  line-height: 1;
+  color: var(--bs-navbar-color);
+  background-color: transparent;
+  border: var(--bs-border-width) solid var(--bs-navbar-toggler-border-color);
+  border-radius: var(--bs-navbar-toggler-border-radius);
+  transition: var(--bs-navbar-toggler-transition);
+}
+@media (prefers-reduced-motion: reduce) {
+  .navbar-toggler {
+    transition: none;
+  }
+}
+.navbar-toggler:hover {
+  text-decoration: none;
+}
+.navbar-toggler:focus {
+  text-decoration: none;
+  outline: 0;
+  box-shadow: 0 0 0 var(--bs-navbar-toggler-focus-width);
+}
+
+.navbar-toggler-icon {
+  display: inline-block;
+  width: 1.5em;
+  height: 1.5em;
+  vertical-align: middle;
+  background-image: var(--bs-navbar-toggler-icon-bg);
+  background-repeat: no-repeat;
+  background-position: center;
+  background-size: 100%;
+}
+
+.navbar-nav-scroll {
+  max-height: var(--bs-scroll-height, 75vh);
+  overflow-y: auto;
+}
+
+@media (min-width: 576px) {
+  .navbar-expand-sm {
+    flex-wrap: nowrap;
+    justify-content: flex-start;
+  }
+  .navbar-expand-sm .navbar-nav {
+    flex-direction: row;
+  }
+  .navbar-expand-sm .navbar-nav .dropdown-menu {
+    position: absolute;
+  }
+  .navbar-expand-sm .navbar-nav .nav-link {
+    padding-right: var(--bs-navbar-nav-link-padding-x);
+    padding-left: var(--bs-navbar-nav-link-padding-x);
+  }
+  .navbar-expand-sm .navbar-nav-scroll {
+    overflow: visible;
+  }
+  .navbar-expand-sm .navbar-collapse {
+    display: flex !important;
+    flex-basis: auto;
+  }
+  .navbar-expand-sm .navbar-toggler {
+    display: none;
+  }
+  .navbar-expand-sm .offcanvas {
+    position: static;
+    z-index: auto;
+    flex-grow: 1;
+    width: auto !important;
+    height: auto !important;
+    visibility: visible !important;
+    background-color: transparent !important;
+    border: 0 !important;
+    transform: none !important;
+    transition: none;
+  }
+  .navbar-expand-sm .offcanvas .offcanvas-header {
+    display: none;
+  }
+  .navbar-expand-sm .offcanvas .offcanvas-body {
+    display: flex;
+    flex-grow: 0;
+    padding: 0;
+    overflow-y: visible;
+  }
+}
+@media (min-width: 768px) {
+  .navbar-expand-md {
+    flex-wrap: nowrap;
+    justify-content: flex-start;
+  }
+  .navbar-expand-md .navbar-nav {
+    flex-direction: row;
+  }
+  .navbar-expand-md .navbar-nav .dropdown-menu {
+    position: absolute;
+  }
+  .navbar-expand-md .navbar-nav .nav-link {
+    padding-right: var(--bs-navbar-nav-link-padding-x);
+    padding-left: var(--bs-navbar-nav-link-padding-x);
+  }
+  .navbar-expand-md .navbar-nav-scroll {
+    overflow: visible;
+  }
+  .navbar-expand-md .navbar-collapse {
+    display: flex !important;
+    flex-basis: auto;
+  }
+  .navbar-expand-md .navbar-toggler {
+    display: none;
+  }
+  .navbar-expand-md .offcanvas {
+    position: static;
+    z-index: auto;
+    flex-grow: 1;
+    width: auto !important;
+    height: auto !important;
+    visibility: visible !important;
+    background-color: transparent !important;
+    border: 0 !important;
+    transform: none !important;
+    transition: none;
+  }
+  .navbar-expand-md .offcanvas .offcanvas-header {
+    display: none;
+  }
+  .navbar-expand-md .offcanvas .offcanvas-body {
+    display: flex;
+    flex-grow: 0;
+    padding: 0;
+    overflow-y: visible;
+  }
+}
+@media (min-width: 992px) {
+  .navbar-expand-lg {
+    flex-wrap: nowrap;
+    justify-content: flex-start;
+  }
+  .navbar-expand-lg .navbar-nav {
+    flex-direction: row;
+  }
+  .navbar-expand-lg .navbar-nav .dropdown-menu {
+    position: absolute;
+  }
+  .navbar-expand-lg .navbar-nav .nav-link {
+    padding-right: var(--bs-navbar-nav-link-padding-x);
+    padding-left: var(--bs-navbar-nav-link-padding-x);
+  }
+  .navbar-expand-lg .navbar-nav-scroll {
+    overflow: visible;
+  }
+  .navbar-expand-lg .navbar-collapse {
+    display: flex !important;
+    flex-basis: auto;
+  }
+  .navbar-expand-lg .navbar-toggler {
+    display: none;
+  }
+  .navbar-expand-lg .offcanvas {
+    position: static;
+    z-index: auto;
+    flex-grow: 1;
+    width: auto !important;
+    height: auto !important;
+    visibility: visible !important;
+    background-color: transparent !important;
+    border: 0 !important;
+    transform: none !important;
+    transition: none;
+  }
+  .navbar-expand-lg .offcanvas .offcanvas-header {
+    display: none;
+  }
+  .navbar-expand-lg .offcanvas .offcanvas-body {
+    display: flex;
+    flex-grow: 0;
+    padding: 0;
+    overflow-y: visible;
+  }
+}
+@media (min-width: 1200px) {
+  .navbar-expand-xl {
+    flex-wrap: nowrap;
+    justify-content: flex-start;
+  }
+  .navbar-expand-xl .navbar-nav {
+    flex-direction: row;
+  }
+  .navbar-expand-xl .navbar-nav .dropdown-menu {
+    position: absolute;
+  }
+  .navbar-expand-xl .navbar-nav .nav-link {
+    padding-right: var(--bs-navbar-nav-link-padding-x);
+    padding-left: var(--bs-navbar-nav-link-padding-x);
+  }
+  .navbar-expand-xl .navbar-nav-scroll {
+    overflow: visible;
+  }
+  .navbar-expand-xl .navbar-collapse {
+    display: flex !important;
+    flex-basis: auto;
+  }
+  .navbar-expand-xl .navbar-toggler {
+    display: none;
+  }
+  .navbar-expand-xl .offcanvas {
+    position: static;
+    z-index: auto;
+    flex-grow: 1;
+    width: auto !important;
+    height: auto !important;
+    visibility: visible !important;
+    background-color: transparent !important;
+    border: 0 !important;
+    transform: none !important;
+    transition: none;
+  }
+  .navbar-expand-xl .offcanvas .offcanvas-header {
+    display: none;
+  }
+  .navbar-expand-xl .offcanvas .offcanvas-body {
+    display: flex;
+    flex-grow: 0;
+    padding: 0;
+    overflow-y: visible;
+  }
+}
+@media (min-width: 1400px) {
+  .navbar-expand-xxl {
+    flex-wrap: nowrap;
+    justify-content: flex-start;
+  }
+  .navbar-expand-xxl .navbar-nav {
+    flex-direction: row;
+  }
+  .navbar-expand-xxl .navbar-nav .dropdown-menu {
+    position: absolute;
+  }
+  .navbar-expand-xxl .navbar-nav .nav-link {
+    padding-right: var(--bs-navbar-nav-link-padding-x);
+    padding-left: var(--bs-navbar-nav-link-padding-x);
+  }
+  .navbar-expand-xxl .navbar-nav-scroll {
+    overflow: visible;
+  }
+  .navbar-expand-xxl .navbar-collapse {
+    display: flex !important;
+    flex-basis: auto;
+  }
+  .navbar-expand-xxl .navbar-toggler {
+    display: none;
+  }
+  .navbar-expand-xxl .offcanvas {
+    position: static;
+    z-index: auto;
+    flex-grow: 1;
+    width: auto !important;
+    height: auto !important;
+    visibility: visible !important;
+    background-color: transparent !important;
+    border: 0 !important;
+    transform: none !important;
+    transition: none;
+  }
+  .navbar-expand-xxl .offcanvas .offcanvas-header {
+    display: none;
+  }
+  .navbar-expand-xxl .offcanvas .offcanvas-body {
+    display: flex;
+    flex-grow: 0;
+    padding: 0;
+    overflow-y: visible;
+  }
+}
+.navbar-expand {
+  flex-wrap: nowrap;
+  justify-content: flex-start;
+}
+.navbar-expand .navbar-nav {
+  flex-direction: row;
+}
+.navbar-expand .navbar-nav .dropdown-menu {
+  position: absolute;
+}
+.navbar-expand .navbar-nav .nav-link {
+  padding-right: var(--bs-navbar-nav-link-padding-x);
+  padding-left: var(--bs-navbar-nav-link-padding-x);
+}
+.navbar-expand .navbar-nav-scroll {
+  overflow: visible;
+}
+.navbar-expand .navbar-collapse {
+  display: flex !important;
+  flex-basis: auto;
+}
+.navbar-expand .navbar-toggler {
+  display: none;
+}
+.navbar-expand .offcanvas {
+  position: static;
+  z-index: auto;
+  flex-grow: 1;
+  width: auto !important;
+  height: auto !important;
+  visibility: visible !important;
+  background-color: transparent !important;
+  border: 0 !important;
+  transform: none !important;
+  transition: none;
+}
+.navbar-expand .offcanvas .offcanvas-header {
+  display: none;
+}
+.navbar-expand .offcanvas .offcanvas-body {
+  display: flex;
+  flex-grow: 0;
+  padding: 0;
+  overflow-y: visible;
+}
+
+.navbar-dark,
+.navbar[data-bs-theme=dark] {
+  --bs-navbar-color: rgba(255, 255, 255, 0.55);
+  --bs-navbar-hover-color: rgba(255, 255, 255, 0.75);
+  --bs-navbar-disabled-color: rgba(255, 255, 255, 0.25);
+  --bs-navbar-active-color: #fff;
+  --bs-navbar-brand-color: #fff;
+  --bs-navbar-brand-hover-color: #fff;
+  --bs-navbar-toggler-border-color: rgba(255, 255, 255, 0.1);
+  --bs-navbar-toggler-icon-bg: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 30 30'%3e%3cpath stroke='rgba%28255, 255, 255, 0.55%29' stroke-linecap='round' stroke-miterlimit='10' stroke-width='2' d='M4 7h22M4 15h22M4 23h22'/%3e%3c/svg%3e");
+}
+
+[data-bs-theme=dark] .navbar-toggler-icon {
+  --bs-navbar-toggler-icon-bg: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 30 30'%3e%3cpath stroke='rgba%28255, 255, 255, 0.55%29' stroke-linecap='round' stroke-miterlimit='10' stroke-width='2' d='M4 7h22M4 15h22M4 23h22'/%3e%3c/svg%3e");
+}
+
+.card {
+  --bs-card-spacer-y: 1rem;
+  --bs-card-spacer-x: 1rem;
+  --bs-card-title-spacer-y: 0.5rem;
+  --bs-card-title-color: ;
+  --bs-card-subtitle-color: ;
+  --bs-card-border-width: var(--bs-border-width);
+  --bs-card-border-color: var(--bs-border-color-translucent);
+  --bs-card-border-radius: var(--bs-border-radius);
+  --bs-card-box-shadow: ;
+  --bs-card-inner-border-radius: calc(var(--bs-border-radius) - (var(--bs-border-width)));
+  --bs-card-cap-padding-y: 0.5rem;
+  --bs-card-cap-padding-x: 1rem;
+  --bs-card-cap-bg: rgba(var(--bs-body-color-rgb), 0.03);
+  --bs-card-cap-color: ;
+  --bs-card-height: ;
+  --bs-card-color: ;
+  --bs-card-bg: var(--bs-body-bg);
+  --bs-card-img-overlay-padding: 1rem;
+  --bs-card-group-margin: 0.75rem;
+  position: relative;
+  display: flex;
+  flex-direction: column;
+  min-width: 0;
+  height: var(--bs-card-height);
+  color: var(--bs-body-color);
+  word-wrap: break-word;
+  background-color: var(--bs-card-bg);
+  background-clip: border-box;
+  border: var(--bs-card-border-width) solid var(--bs-card-border-color);
+  border-radius: var(--bs-card-border-radius);
+}
+.card > hr {
+  margin-right: 0;
+  margin-left: 0;
+}
+.card > .list-group {
+  border-top: inherit;
+  border-bottom: inherit;
+}
+.card > .list-group:first-child {
+  border-top-width: 0;
+  border-top-left-radius: var(--bs-card-inner-border-radius);
+  border-top-right-radius: var(--bs-card-inner-border-radius);
+}
+.card > .list-group:last-child {
+  border-bottom-width: 0;
+  border-bottom-right-radius: var(--bs-card-inner-border-radius);
+  border-bottom-left-radius: var(--bs-card-inner-border-radius);
+}
+.card > .card-header + .list-group,
+.card > .list-group + .card-footer {
+  border-top: 0;
+}
+
+.card-body {
+  flex: 1 1 auto;
+  padding: var(--bs-card-spacer-y) var(--bs-card-spacer-x);
+  color: var(--bs-card-color);
+}
+
+.card-title {
+  margin-bottom: var(--bs-card-title-spacer-y);
+  color: var(--bs-card-title-color);
+}
+
+.card-subtitle {
+  margin-top: calc(-0.5 * var(--bs-card-title-spacer-y));
+  margin-bottom: 0;
+  color: var(--bs-card-subtitle-color);
+}
+
+.card-text:last-child {
+  margin-bottom: 0;
+}
+
+.card-link + .card-link {
+  margin-left: var(--bs-card-spacer-x);
+}
+
+.card-header {
+  padding: var(--bs-card-cap-padding-y) var(--bs-card-cap-padding-x);
+  margin-bottom: 0;
+  color: var(--bs-card-cap-color);
+  background-color: var(--bs-card-cap-bg);
+  border-bottom: var(--bs-card-border-width) solid var(--bs-card-border-color);
+}
+.card-header:first-child {
+  border-radius: var(--bs-card-inner-border-radius) var(--bs-card-inner-border-radius) 0 0;
+}
+
+.card-footer {
+  padding: var(--bs-card-cap-padding-y) var(--bs-card-cap-padding-x);
+  color: var(--bs-card-cap-color);
+  background-color: var(--bs-card-cap-bg);
+  border-top: var(--bs-card-border-width) solid var(--bs-card-border-color);
+}
+.card-footer:last-child {
+  border-radius: 0 0 var(--bs-card-inner-border-radius) var(--bs-card-inner-border-radius);
+}
+
+.card-header-tabs {
+  margin-right: calc(-0.5 * var(--bs-card-cap-padding-x));
+  margin-bottom: calc(-1 * var(--bs-card-cap-padding-y));
+  margin-left: calc(-0.5 * var(--bs-card-cap-padding-x));
+  border-bottom: 0;
+}
+.card-header-tabs .nav-link.active {
+  background-color: var(--bs-card-bg);
+  border-bottom-color: var(--bs-card-bg);
+}
+
+.card-header-pills {
+  margin-right: calc(-0.5 * var(--bs-card-cap-padding-x));
+  margin-left: calc(-0.5 * var(--bs-card-cap-padding-x));
+}
+
+.card-img-overlay {
+  position: absolute;
+  top: 0;
+  right: 0;
+  bottom: 0;
+  left: 0;
+  padding: var(--bs-card-img-overlay-padding);
+  border-radius: var(--bs-card-inner-border-radius);
+}
+
+.card-img,
+.card-img-top,
+.card-img-bottom {
+  width: 100%;
+}
+
+.card-img,
+.card-img-top {
+  border-top-left-radius: var(--bs-card-inner-border-radius);
+  border-top-right-radius: var(--bs-card-inner-border-radius);
+}
+
+.card-img,
+.card-img-bottom {
+  border-bottom-right-radius: var(--bs-card-inner-border-radius);
+  border-bottom-left-radius: var(--bs-card-inner-border-radius);
+}
+
+.card-group > .card {
+  margin-bottom: var(--bs-card-group-margin);
+}
+@media (min-width: 576px) {
+  .card-group {
+    display: flex;
+    flex-flow: row wrap;
+  }
+  .card-group > .card {
+    flex: 1 0 0%;
+    margin-bottom: 0;
+  }
+  .card-group > .card + .card {
+    margin-left: 0;
+    border-left: 0;
+  }
+  .card-group > .card:not(:last-child) {
+    border-top-right-radius: 0;
+    border-bottom-right-radius: 0;
+  }
+  .card-group > .card:not(:last-child) .card-img-top,
+  .card-group > .card:not(:last-child) .card-header {
+    border-top-right-radius: 0;
+  }
+  .card-group > .card:not(:last-child) .card-img-bottom,
+  .card-group > .card:not(:last-child) .card-footer {
+    border-bottom-right-radius: 0;
+  }
+  .card-group > .card:not(:first-child) {
+    border-top-left-radius: 0;
+    border-bottom-left-radius: 0;
+  }
+  .card-group > .card:not(:first-child) .card-img-top,
+  .card-group > .card:not(:first-child) .card-header {
+    border-top-left-radius: 0;
+  }
+  .card-group > .card:not(:first-child) .card-img-bottom,
+  .card-group > .card:not(:first-child) .card-footer {
+    border-bottom-left-radius: 0;
+  }
+}
+
+.accordion {
+  --bs-accordion-color: var(--bs-body-color);
+  --bs-accordion-bg: var(--bs-body-bg);
+  --bs-accordion-transition: color 0.15s ease-in-out, background-color 0.15s ease-in-out, border-color 0.15s ease-in-out, box-shadow 0.15s ease-in-out, border-radius 0.15s ease;
+  --bs-accordion-border-color: var(--bs-border-color);
+  --bs-accordion-border-width: var(--bs-border-width);
+  --bs-accordion-border-radius: var(--bs-border-radius);
+  --bs-accordion-inner-border-radius: calc(var(--bs-border-radius) - (var(--bs-border-width)));
+  --bs-accordion-btn-padding-x: 1.25rem;
+  --bs-accordion-btn-padding-y: 1rem;
+  --bs-accordion-btn-color: var(--bs-body-color);
+  --bs-accordion-btn-bg: var(--bs-accordion-bg);
+  --bs-accordion-btn-icon: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16' fill='%23212529'%3e%3cpath fill-rule='evenodd' d='M1.646 4.646a.5.5 0 0 1 .708 0L8 10.293l5.646-5.647a.5.5 0 0 1 .708.708l-6 6a.5.5 0 0 1-.708 0l-6-6a.5.5 0 0 1 0-.708z'/%3e%3c/svg%3e");
+  --bs-accordion-btn-icon-width: 1.25rem;
+  --bs-accordion-btn-icon-transform: rotate(-180deg);
+  --bs-accordion-btn-icon-transition: transform 0.2s ease-in-out;
+  --bs-accordion-btn-active-icon: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16' fill='%23052c65'%3e%3cpath fill-rule='evenodd' d='M1.646 4.646a.5.5 0 0 1 .708 0L8 10.293l5.646-5.647a.5.5 0 0 1 .708.708l-6 6a.5.5 0 0 1-.708 0l-6-6a.5.5 0 0 1 0-.708z'/%3e%3c/svg%3e");
+  --bs-accordion-btn-focus-border-color: #86b7fe;
+  --bs-accordion-btn-focus-box-shadow: 0 0 0 0.25rem rgba(13, 110, 253, 0.25);
+  --bs-accordion-body-padding-x: 1.25rem;
+  --bs-accordion-body-padding-y: 1rem;
+  --bs-accordion-active-color: var(--bs-primary-text-emphasis);
+  --bs-accordion-active-bg: var(--bs-primary-bg-subtle);
+}
+
+.accordion-button {
+  position: relative;
+  display: flex;
+  align-items: center;
+  width: 100%;
+  padding: var(--bs-accordion-btn-padding-y) var(--bs-accordion-btn-padding-x);
+  font-size: 1rem;
+  color: var(--bs-accordion-btn-color);
+  text-align: left;
+  background-color: var(--bs-accordion-btn-bg);
+  border: 0;
+  border-radius: 0;
+  overflow-anchor: none;
+  transition: var(--bs-accordion-transition);
+}
+@media (prefers-reduced-motion: reduce) {
+  .accordion-button {
+    transition: none;
+  }
+}
+.accordion-button:not(.collapsed) {
+  color: var(--bs-accordion-active-color);
+  background-color: var(--bs-accordion-active-bg);
+  box-shadow: inset 0 calc(-1 * var(--bs-accordion-border-width)) 0 var(--bs-accordion-border-color);
+}
+.accordion-button:not(.collapsed)::after {
+  background-image: var(--bs-accordion-btn-active-icon);
+  transform: var(--bs-accordion-btn-icon-transform);
+}
+.accordion-button::after {
+  flex-shrink: 0;
+  width: var(--bs-accordion-btn-icon-width);
+  height: var(--bs-accordion-btn-icon-width);
+  margin-left: auto;
+  content: "";
+  background-image: var(--bs-accordion-btn-icon);
+  background-repeat: no-repeat;
+  background-size: var(--bs-accordion-btn-icon-width);
+  transition: var(--bs-accordion-btn-icon-transition);
+}
+@media (prefers-reduced-motion: reduce) {
+  .accordion-button::after {
+    transition: none;
+  }
+}
+.accordion-button:hover {
+  z-index: 2;
+}
+.accordion-button:focus {
+  z-index: 3;
+  border-color: var(--bs-accordion-btn-focus-border-color);
+  outline: 0;
+  box-shadow: var(--bs-accordion-btn-focus-box-shadow);
+}
+
+.accordion-header {
+  margin-bottom: 0;
+}
+
+.accordion-item {
+  color: var(--bs-accordion-color);
+  background-color: var(--bs-accordion-bg);
+  border: var(--bs-accordion-border-width) solid var(--bs-accordion-border-color);
+}
+.accordion-item:first-of-type {
+  border-top-left-radius: var(--bs-accordion-border-radius);
+  border-top-right-radius: var(--bs-accordion-border-radius);
+}
+.accordion-item:first-of-type .accordion-button {
+  border-top-left-radius: var(--bs-accordion-inner-border-radius);
+  border-top-right-radius: var(--bs-accordion-inner-border-radius);
+}
+.accordion-item:not(:first-of-type) {
+  border-top: 0;
+}
+.accordion-item:last-of-type {
+  border-bottom-right-radius: var(--bs-accordion-border-radius);
+  border-bottom-left-radius: var(--bs-accordion-border-radius);
+}
+.accordion-item:last-of-type .accordion-button.collapsed {
+  border-bottom-right-radius: var(--bs-accordion-inner-border-radius);
+  border-bottom-left-radius: var(--bs-accordion-inner-border-radius);
+}
+.accordion-item:last-of-type .accordion-collapse {
+  border-bottom-right-radius: var(--bs-accordion-border-radius);
+  border-bottom-left-radius: var(--bs-accordion-border-radius);
+}
+
+.accordion-body {
+  padding: var(--bs-accordion-body-padding-y) var(--bs-accordion-body-padding-x);
+}
+
+.accordion-flush .accordion-collapse {
+  border-width: 0;
+}
+.accordion-flush .accordion-item {
+  border-right: 0;
+  border-left: 0;
+  border-radius: 0;
+}
+.accordion-flush .accordion-item:first-child {
+  border-top: 0;
+}
+.accordion-flush .accordion-item:last-child {
+  border-bottom: 0;
+}
+.accordion-flush .accordion-item .accordion-button, .accordion-flush .accordion-item .accordion-button.collapsed {
+  border-radius: 0;
+}
+
+[data-bs-theme=dark] .accordion-button::after {
+  --bs-accordion-btn-icon: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16' fill='%236ea8fe'%3e%3cpath fill-rule='evenodd' d='M1.646 4.646a.5.5 0 0 1 .708 0L8 10.293l5.646-5.647a.5.5 0 0 1 .708.708l-6 6a.5.5 0 0 1-.708 0l-6-6a.5.5 0 0 1 0-.708z'/%3e%3c/svg%3e");
+  --bs-accordion-btn-active-icon: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16' fill='%236ea8fe'%3e%3cpath fill-rule='evenodd' d='M1.646 4.646a.5.5 0 0 1 .708 0L8 10.293l5.646-5.647a.5.5 0 0 1 .708.708l-6 6a.5.5 0 0 1-.708 0l-6-6a.5.5 0 0 1 0-.708z'/%3e%3c/svg%3e");
+}
+
+.breadcrumb {
+  --bs-breadcrumb-padding-x: 0;
+  --bs-breadcrumb-padding-y: 0;
+  --bs-breadcrumb-margin-bottom: 1rem;
+  --bs-breadcrumb-bg: ;
+  --bs-breadcrumb-border-radius: ;
+  --bs-breadcrumb-divider-color: var(--bs-secondary-color);
+  --bs-breadcrumb-item-padding-x: 0.5rem;
+  --bs-breadcrumb-item-active-color: var(--bs-secondary-color);
+  display: flex;
+  flex-wrap: wrap;
+  padding: var(--bs-breadcrumb-padding-y) var(--bs-breadcrumb-padding-x);
+  margin-bottom: var(--bs-breadcrumb-margin-bottom);
+  font-size: var(--bs-breadcrumb-font-size);
+  list-style: none;
+  background-color: var(--bs-breadcrumb-bg);
+  border-radius: var(--bs-breadcrumb-border-radius);
+}
+
+.breadcrumb-item + .breadcrumb-item {
+  padding-left: var(--bs-breadcrumb-item-padding-x);
+}
+.breadcrumb-item + .breadcrumb-item::before {
+  float: left;
+  padding-right: var(--bs-breadcrumb-item-padding-x);
+  color: var(--bs-breadcrumb-divider-color);
+  content: var(--bs-breadcrumb-divider, "/") /* rtl: var(--bs-breadcrumb-divider, "/") */;
+}
+.breadcrumb-item.active {
+  color: var(--bs-breadcrumb-item-active-color);
+}
+
+.pagination {
+  --bs-pagination-padding-x: 0.75rem;
+  --bs-pagination-padding-y: 0.375rem;
+  --bs-pagination-font-size: 1rem;
+  --bs-pagination-color: var(--bs-link-color);
+  --bs-pagination-bg: var(--bs-body-bg);
+  --bs-pagination-border-width: var(--bs-border-width);
+  --bs-pagination-border-color: var(--bs-border-color);
+  --bs-pagination-border-radius: var(--bs-border-radius);
+  --bs-pagination-hover-color: var(--bs-link-hover-color);
+  --bs-pagination-hover-bg: var(--bs-tertiary-bg);
+  --bs-pagination-hover-border-color: var(--bs-border-color);
+  --bs-pagination-focus-color: var(--bs-link-hover-color);
+  --bs-pagination-focus-bg: var(--bs-secondary-bg);
+  --bs-pagination-focus-box-shadow: 0 0 0 0.25rem rgba(13, 110, 253, 0.25);
+  --bs-pagination-active-color: #fff;
+  --bs-pagination-active-bg: #0d6efd;
+  --bs-pagination-active-border-color: #0d6efd;
+  --bs-pagination-disabled-color: var(--bs-secondary-color);
+  --bs-pagination-disabled-bg: var(--bs-secondary-bg);
+  --bs-pagination-disabled-border-color: var(--bs-border-color);
+  display: flex;
+  padding-left: 0;
+  list-style: none;
+}
+
+.page-link {
+  position: relative;
+  display: block;
+  padding: var(--bs-pagination-padding-y) var(--bs-pagination-padding-x);
+  font-size: var(--bs-pagination-font-size);
+  color: var(--bs-pagination-color);
+  text-decoration: none;
+  background-color: var(--bs-pagination-bg);
+  border: var(--bs-pagination-border-width) solid var(--bs-pagination-border-color);
+  transition: color 0.15s ease-in-out, background-color 0.15s ease-in-out, border-color 0.15s ease-in-out, box-shadow 0.15s ease-in-out;
+}
+@media (prefers-reduced-motion: reduce) {
+  .page-link {
+    transition: none;
+  }
+}
+.page-link:hover {
+  z-index: 2;
+  color: var(--bs-pagination-hover-color);
+  background-color: var(--bs-pagination-hover-bg);
+  border-color: var(--bs-pagination-hover-border-color);
+}
+.page-link:focus {
+  z-index: 3;
+  color: var(--bs-pagination-focus-color);
+  background-color: var(--bs-pagination-focus-bg);
+  outline: 0;
+  box-shadow: var(--bs-pagination-focus-box-shadow);
+}
+.page-link.active, .active > .page-link {
+  z-index: 3;
+  color: var(--bs-pagination-active-color);
+  background-color: var(--bs-pagination-active-bg);
+  border-color: var(--bs-pagination-active-border-color);
+}
+.page-link.disabled, .disabled > .page-link {
+  color: var(--bs-pagination-disabled-color);
+  pointer-events: none;
+  background-color: var(--bs-pagination-disabled-bg);
+  border-color: var(--bs-pagination-disabled-border-color);
+}
+
+.page-item:not(:first-child) .page-link {
+  margin-left: calc(var(--bs-border-width) * -1);
+}
+.page-item:first-child .page-link {
+  border-top-left-radius: var(--bs-pagination-border-radius);
+  border-bottom-left-radius: var(--bs-pagination-border-radius);
+}
+.page-item:last-child .page-link {
+  border-top-right-radius: var(--bs-pagination-border-radius);
+  border-bottom-right-radius: var(--bs-pagination-border-radius);
+}
+
+.pagination-lg {
+  --bs-pagination-padding-x: 1.5rem;
+  --bs-pagination-padding-y: 0.75rem;
+  --bs-pagination-font-size: 1.25rem;
+  --bs-pagination-border-radius: var(--bs-border-radius-lg);
+}
+
+.pagination-sm {
+  --bs-pagination-padding-x: 0.5rem;
+  --bs-pagination-padding-y: 0.25rem;
+  --bs-pagination-font-size: 0.875rem;
+  --bs-pagination-border-radius: var(--bs-border-radius-sm);
+}
+
+.badge {
+  --bs-badge-padding-x: 0.65em;
+  --bs-badge-padding-y: 0.35em;
+  --bs-badge-font-size: 0.75em;
+  --bs-badge-font-weight: 700;
+  --bs-badge-color: #fff;
+  --bs-badge-border-radius: var(--bs-border-radius);
+  display: inline-block;
+  padding: var(--bs-badge-padding-y) var(--bs-badge-padding-x);
+  font-size: var(--bs-badge-font-size);
+  font-weight: var(--bs-badge-font-weight);
+  line-height: 1;
+  color: var(--bs-badge-color);
+  text-align: center;
+  white-space: nowrap;
+  vertical-align: baseline;
+  border-radius: var(--bs-badge-border-radius);
+}
+.badge:empty {
+  display: none;
+}
+
+.btn .badge {
+  position: relative;
+  top: -1px;
+}
+
+.alert {
+  --bs-alert-bg: transparent;
+  --bs-alert-padding-x: 1rem;
+  --bs-alert-padding-y: 1rem;
+  --bs-alert-margin-bottom: 1rem;
+  --bs-alert-color: inherit;
+  --bs-alert-border-color: transparent;
+  --bs-alert-border: var(--bs-border-width) solid var(--bs-alert-border-color);
+  --bs-alert-border-radius: var(--bs-border-radius);
+  --bs-alert-link-color: inherit;
+  position: relative;
+  padding: var(--bs-alert-padding-y) var(--bs-alert-padding-x);
+  margin-bottom: var(--bs-alert-margin-bottom);
+  color: var(--bs-alert-color);
+  background-color: var(--bs-alert-bg);
+  border: var(--bs-alert-border);
+  border-radius: var(--bs-alert-border-radius);
+}
+
+.alert-heading {
+  color: inherit;
+}
+
+.alert-link {
+  font-weight: 700;
+  color: var(--bs-alert-link-color);
+}
+
+.alert-dismissible {
+  padding-right: 3rem;
+}
+.alert-dismissible .btn-close {
+  position: absolute;
+  top: 0;
+  right: 0;
+  z-index: 2;
+  padding: 1.25rem 1rem;
+}
+
+.alert-primary {
+  --bs-alert-color: var(--bs-primary-text-emphasis);
+  --bs-alert-bg: var(--bs-primary-bg-subtle);
+  --bs-alert-border-color: var(--bs-primary-border-subtle);
+  --bs-alert-link-color: var(--bs-primary-text-emphasis);
+}
+
+.alert-secondary {
+  --bs-alert-color: var(--bs-secondary-text-emphasis);
+  --bs-alert-bg: var(--bs-secondary-bg-subtle);
+  --bs-alert-border-color: var(--bs-secondary-border-subtle);
+  --bs-alert-link-color: var(--bs-secondary-text-emphasis);
+}
+
+.alert-success {
+  --bs-alert-color: var(--bs-success-text-emphasis);
+  --bs-alert-bg: var(--bs-success-bg-subtle);
+  --bs-alert-border-color: var(--bs-success-border-subtle);
+  --bs-alert-link-color: var(--bs-success-text-emphasis);
+}
+
+.alert-info {
+  --bs-alert-color: var(--bs-info-text-emphasis);
+  --bs-alert-bg: var(--bs-info-bg-subtle);
+  --bs-alert-border-color: var(--bs-info-border-subtle);
+  --bs-alert-link-color: var(--bs-info-text-emphasis);
+}
+
+.alert-warning {
+  --bs-alert-color: var(--bs-warning-text-emphasis);
+  --bs-alert-bg: var(--bs-warning-bg-subtle);
+  --bs-alert-border-color: var(--bs-warning-border-subtle);
+  --bs-alert-link-color: var(--bs-warning-text-emphasis);
+}
+
+.alert-danger {
+  --bs-alert-color: var(--bs-danger-text-emphasis);
+  --bs-alert-bg: var(--bs-danger-bg-subtle);
+  --bs-alert-border-color: var(--bs-danger-border-subtle);
+  --bs-alert-link-color: var(--bs-danger-text-emphasis);
+}
+
+.alert-light {
+  --bs-alert-color: var(--bs-light-text-emphasis);
+  --bs-alert-bg: var(--bs-light-bg-subtle);
+  --bs-alert-border-color: var(--bs-light-border-subtle);
+  --bs-alert-link-color: var(--bs-light-text-emphasis);
+}
+
+.alert-dark {
+  --bs-alert-color: var(--bs-dark-text-emphasis);
+  --bs-alert-bg: var(--bs-dark-bg-subtle);
+  --bs-alert-border-color: var(--bs-dark-border-subtle);
+  --bs-alert-link-color: var(--bs-dark-text-emphasis);
+}
+
+@keyframes progress-bar-stripes {
+  0% {
+    background-position-x: 1rem;
+  }
+}
+.progress,
+.progress-stacked {
+  --bs-progress-height: 1rem;
+  --bs-progress-font-size: 0.75rem;
+  --bs-progress-bg: var(--bs-secondary-bg);
+  --bs-progress-border-radius: var(--bs-border-radius);
+  --bs-progress-box-shadow: var(--bs-box-shadow-inset);
+  --bs-progress-bar-color: #fff;
+  --bs-progress-bar-bg: #0d6efd;
+  --bs-progress-bar-transition: width 0.6s ease;
+  display: flex;
+  height: var(--bs-progress-height);
+  overflow: hidden;
+  font-size: var(--bs-progress-font-size);
+  background-color: var(--bs-progress-bg);
+  border-radius: var(--bs-progress-border-radius);
+}
+
+.progress-bar {
+  display: flex;
+  flex-direction: column;
+  justify-content: center;
+  overflow: hidden;
+  color: var(--bs-progress-bar-color);
+  text-align: center;
+  white-space: nowrap;
+  background-color: var(--bs-progress-bar-bg);
+  transition: var(--bs-progress-bar-transition);
+}
+@media (prefers-reduced-motion: reduce) {
+  .progress-bar {
+    transition: none;
+  }
+}
+
+.progress-bar-striped {
+  background-image: linear-gradient(45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent);
+  background-size: var(--bs-progress-height) var(--bs-progress-height);
+}
+
+.progress-stacked > .progress {
+  overflow: visible;
+}
+
+.progress-stacked > .progress > .progress-bar {
+  width: 100%;
+}
+
+.progress-bar-animated {
+  animation: 1s linear infinite progress-bar-stripes;
+}
+@media (prefers-reduced-motion: reduce) {
+  .progress-bar-animated {
+    animation: none;
+  }
+}
+
+.list-group {
+  --bs-list-group-color: var(--bs-body-color);
+  --bs-list-group-bg: var(--bs-body-bg);
+  --bs-list-group-border-color: var(--bs-border-color);
+  --bs-list-group-border-width: var(--bs-border-width);
+  --bs-list-group-border-radius: var(--bs-border-radius);
+  --bs-list-group-item-padding-x: 1rem;
+  --bs-list-group-item-padding-y: 0.5rem;
+  --bs-list-group-action-color: var(--bs-secondary-color);
+  --bs-list-group-action-hover-color: var(--bs-emphasis-color);
+  --bs-list-group-action-hover-bg: var(--bs-tertiary-bg);
+  --bs-list-group-action-active-color: var(--bs-body-color);
+  --bs-list-group-action-active-bg: var(--bs-secondary-bg);
+  --bs-list-group-disabled-color: var(--bs-secondary-color);
+  --bs-list-group-disabled-bg: var(--bs-body-bg);
+  --bs-list-group-active-color: #fff;
+  --bs-list-group-active-bg: #0d6efd;
+  --bs-list-group-active-border-color: #0d6efd;
+  display: flex;
+  flex-direction: column;
+  padding-left: 0;
+  margin-bottom: 0;
+  border-radius: var(--bs-list-group-border-radius);
+}
+
+.list-group-numbered {
+  list-style-type: none;
+  counter-reset: section;
+}
+.list-group-numbered > .list-group-item::before {
+  content: counters(section, ".") ". ";
+  counter-increment: section;
+}
+
+.list-group-item-action {
+  width: 100%;
+  color: var(--bs-list-group-action-color);
+  text-align: inherit;
+}
+.list-group-item-action:hover, .list-group-item-action:focus {
+  z-index: 1;
+  color: var(--bs-list-group-action-hover-color);
+  text-decoration: none;
+  background-color: var(--bs-list-group-action-hover-bg);
+}
+.list-group-item-action:active {
+  color: var(--bs-list-group-action-active-color);
+  background-color: var(--bs-list-group-action-active-bg);
+}
+
+.list-group-item {
+  position: relative;
+  display: block;
+  padding: var(--bs-list-group-item-padding-y) var(--bs-list-group-item-padding-x);
+  color: var(--bs-list-group-color);
+  text-decoration: none;
+  background-color: var(--bs-list-group-bg);
+  border: var(--bs-list-group-border-width) solid var(--bs-list-group-border-color);
+}
+.list-group-item:first-child {
+  border-top-left-radius: inherit;
+  border-top-right-radius: inherit;
+}
+.list-group-item:last-child {
+  border-bottom-right-radius: inherit;
+  border-bottom-left-radius: inherit;
+}
+.list-group-item.disabled, .list-group-item:disabled {
+  color: var(--bs-list-group-disabled-color);
+  pointer-events: none;
+  background-color: var(--bs-list-group-disabled-bg);
+}
+.list-group-item.active {
+  z-index: 2;
+  color: var(--bs-list-group-active-color);
+  background-color: var(--bs-list-group-active-bg);
+  border-color: var(--bs-list-group-active-border-color);
+}
+.list-group-item + .list-group-item {
+  border-top-width: 0;
+}
+.list-group-item + .list-group-item.active {
+  margin-top: calc(-1 * var(--bs-list-group-border-width));
+  border-top-width: var(--bs-list-group-border-width);
+}
+
+.list-group-horizontal {
+  flex-direction: row;
+}
+.list-group-horizontal > .list-group-item:first-child:not(:last-child) {
+  border-bottom-left-radius: var(--bs-list-group-border-radius);
+  border-top-right-radius: 0;
+}
+.list-group-horizontal > .list-group-item:last-child:not(:first-child) {
+  border-top-right-radius: var(--bs-list-group-border-radius);
+  border-bottom-left-radius: 0;
+}
+.list-group-horizontal > .list-group-item.active {
+  margin-top: 0;
+}
+.list-group-horizontal > .list-group-item + .list-group-item {
+  border-top-width: var(--bs-list-group-border-width);
+  border-left-width: 0;
+}
+.list-group-horizontal > .list-group-item + .list-group-item.active {
+  margin-left: calc(-1 * var(--bs-list-group-border-width));
+  border-left-width: var(--bs-list-group-border-width);
+}
+
+@media (min-width: 576px) {
+  .list-group-horizontal-sm {
+    flex-direction: row;
+  }
+  .list-group-horizontal-sm > .list-group-item:first-child:not(:last-child) {
+    border-bottom-left-radius: var(--bs-list-group-border-radius);
+    border-top-right-radius: 0;
+  }
+  .list-group-horizontal-sm > .list-group-item:last-child:not(:first-child) {
+    border-top-right-radius: var(--bs-list-group-border-radius);
+    border-bottom-left-radius: 0;
+  }
+  .list-group-horizontal-sm > .list-group-item.active {
+    margin-top: 0;
+  }
+  .list-group-horizontal-sm > .list-group-item + .list-group-item {
+    border-top-width: var(--bs-list-group-border-width);
+    border-left-width: 0;
+  }
+  .list-group-horizontal-sm > .list-group-item + .list-group-item.active {
+    margin-left: calc(-1 * var(--bs-list-group-border-width));
+    border-left-width: var(--bs-list-group-border-width);
+  }
+}
+@media (min-width: 768px) {
+  .list-group-horizontal-md {
+    flex-direction: row;
+  }
+  .list-group-horizontal-md > .list-group-item:first-child:not(:last-child) {
+    border-bottom-left-radius: var(--bs-list-group-border-radius);
+    border-top-right-radius: 0;
+  }
+  .list-group-horizontal-md > .list-group-item:last-child:not(:first-child) {
+    border-top-right-radius: var(--bs-list-group-border-radius);
+    border-bottom-left-radius: 0;
+  }
+  .list-group-horizontal-md > .list-group-item.active {
+    margin-top: 0;
+  }
+  .list-group-horizontal-md > .list-group-item + .list-group-item {
+    border-top-width: var(--bs-list-group-border-width);
+    border-left-width: 0;
+  }
+  .list-group-horizontal-md > .list-group-item + .list-group-item.active {
+    margin-left: calc(-1 * var(--bs-list-group-border-width));
+    border-left-width: var(--bs-list-group-border-width);
+  }
+}
+@media (min-width: 992px) {
+  .list-group-horizontal-lg {
+    flex-direction: row;
+  }
+  .list-group-horizontal-lg > .list-group-item:first-child:not(:last-child) {
+    border-bottom-left-radius: var(--bs-list-group-border-radius);
+    border-top-right-radius: 0;
+  }
+  .list-group-horizontal-lg > .list-group-item:last-child:not(:first-child) {
+    border-top-right-radius: var(--bs-list-group-border-radius);
+    border-bottom-left-radius: 0;
+  }
+  .list-group-horizontal-lg > .list-group-item.active {
+    margin-top: 0;
+  }
+  .list-group-horizontal-lg > .list-group-item + .list-group-item {
+    border-top-width: var(--bs-list-group-border-width);
+    border-left-width: 0;
+  }
+  .list-group-horizontal-lg > .list-group-item + .list-group-item.active {
+    margin-left: calc(-1 * var(--bs-list-group-border-width));
+    border-left-width: var(--bs-list-group-border-width);
+  }
+}
+@media (min-width: 1200px) {
+  .list-group-horizontal-xl {
+    flex-direction: row;
+  }
+  .list-group-horizontal-xl > .list-group-item:first-child:not(:last-child) {
+    border-bottom-left-radius: var(--bs-list-group-border-radius);
+    border-top-right-radius: 0;
+  }
+  .list-group-horizontal-xl > .list-group-item:last-child:not(:first-child) {
+    border-top-right-radius: var(--bs-list-group-border-radius);
+    border-bottom-left-radius: 0;
+  }
+  .list-group-horizontal-xl > .list-group-item.active {
+    margin-top: 0;
+  }
+  .list-group-horizontal-xl > .list-group-item + .list-group-item {
+    border-top-width: var(--bs-list-group-border-width);
+    border-left-width: 0;
+  }
+  .list-group-horizontal-xl > .list-group-item + .list-group-item.active {
+    margin-left: calc(-1 * var(--bs-list-group-border-width));
+    border-left-width: var(--bs-list-group-border-width);
+  }
+}
+@media (min-width: 1400px) {
+  .list-group-horizontal-xxl {
+    flex-direction: row;
+  }
+  .list-group-horizontal-xxl > .list-group-item:first-child:not(:last-child) {
+    border-bottom-left-radius: var(--bs-list-group-border-radius);
+    border-top-right-radius: 0;
+  }
+  .list-group-horizontal-xxl > .list-group-item:last-child:not(:first-child) {
+    border-top-right-radius: var(--bs-list-group-border-radius);
+    border-bottom-left-radius: 0;
+  }
+  .list-group-horizontal-xxl > .list-group-item.active {
+    margin-top: 0;
+  }
+  .list-group-horizontal-xxl > .list-group-item + .list-group-item {
+    border-top-width: var(--bs-list-group-border-width);
+    border-left-width: 0;
+  }
+  .list-group-horizontal-xxl > .list-group-item + .list-group-item.active {
+    margin-left: calc(-1 * var(--bs-list-group-border-width));
+    border-left-width: var(--bs-list-group-border-width);
+  }
+}
+.list-group-flush {
+  border-radius: 0;
+}
+.list-group-flush > .list-group-item {
+  border-width: 0 0 var(--bs-list-group-border-width);
+}
+.list-group-flush > .list-group-item:last-child {
+  border-bottom-width: 0;
+}
+
+.list-group-item-primary {
+  --bs-list-group-color: var(--bs-primary-text-emphasis);
+  --bs-list-group-bg: var(--bs-primary-bg-subtle);
+  --bs-list-group-border-color: var(--bs-primary-border-subtle);
+  --bs-list-group-action-hover-color: var(--bs-emphasis-color);
+  --bs-list-group-action-hover-bg: var(--bs-primary-border-subtle);
+  --bs-list-group-action-active-color: var(--bs-emphasis-color);
+  --bs-list-group-action-active-bg: var(--bs-primary-border-subtle);
+  --bs-list-group-active-color: var(--bs-primary-bg-subtle);
+  --bs-list-group-active-bg: var(--bs-primary-text-emphasis);
+  --bs-list-group-active-border-color: var(--bs-primary-text-emphasis);
+}
+
+.list-group-item-secondary {
+  --bs-list-group-color: var(--bs-secondary-text-emphasis);
+  --bs-list-group-bg: var(--bs-secondary-bg-subtle);
+  --bs-list-group-border-color: var(--bs-secondary-border-subtle);
+  --bs-list-group-action-hover-color: var(--bs-emphasis-color);
+  --bs-list-group-action-hover-bg: var(--bs-secondary-border-subtle);
+  --bs-list-group-action-active-color: var(--bs-emphasis-color);
+  --bs-list-group-action-active-bg: var(--bs-secondary-border-subtle);
+  --bs-list-group-active-color: var(--bs-secondary-bg-subtle);
+  --bs-list-group-active-bg: var(--bs-secondary-text-emphasis);
+  --bs-list-group-active-border-color: var(--bs-secondary-text-emphasis);
+}
+
+.list-group-item-success {
+  --bs-list-group-color: var(--bs-success-text-emphasis);
+  --bs-list-group-bg: var(--bs-success-bg-subtle);
+  --bs-list-group-border-color: var(--bs-success-border-subtle);
+  --bs-list-group-action-hover-color: var(--bs-emphasis-color);
+  --bs-list-group-action-hover-bg: var(--bs-success-border-subtle);
+  --bs-list-group-action-active-color: var(--bs-emphasis-color);
+  --bs-list-group-action-active-bg: var(--bs-success-border-subtle);
+  --bs-list-group-active-color: var(--bs-success-bg-subtle);
+  --bs-list-group-active-bg: var(--bs-success-text-emphasis);
+  --bs-list-group-active-border-color: var(--bs-success-text-emphasis);
+}
+
+.list-group-item-info {
+  --bs-list-group-color: var(--bs-info-text-emphasis);
+  --bs-list-group-bg: var(--bs-info-bg-subtle);
+  --bs-list-group-border-color: var(--bs-info-border-subtle);
+  --bs-list-group-action-hover-color: var(--bs-emphasis-color);
+  --bs-list-group-action-hover-bg: var(--bs-info-border-subtle);
+  --bs-list-group-action-active-color: var(--bs-emphasis-color);
+  --bs-list-group-action-active-bg: var(--bs-info-border-subtle);
+  --bs-list-group-active-color: var(--bs-info-bg-subtle);
+  --bs-list-group-active-bg: var(--bs-info-text-emphasis);
+  --bs-list-group-active-border-color: var(--bs-info-text-emphasis);
+}
+
+.list-group-item-warning {
+  --bs-list-group-color: var(--bs-warning-text-emphasis);
+  --bs-list-group-bg: var(--bs-warning-bg-subtle);
+  --bs-list-group-border-color: var(--bs-warning-border-subtle);
+  --bs-list-group-action-hover-color: var(--bs-emphasis-color);
+  --bs-list-group-action-hover-bg: var(--bs-warning-border-subtle);
+  --bs-list-group-action-active-color: var(--bs-emphasis-color);
+  --bs-list-group-action-active-bg: var(--bs-warning-border-subtle);
+  --bs-list-group-active-color: var(--bs-warning-bg-subtle);
+  --bs-list-group-active-bg: var(--bs-warning-text-emphasis);
+  --bs-list-group-active-border-color: var(--bs-warning-text-emphasis);
+}
+
+.list-group-item-danger {
+  --bs-list-group-color: var(--bs-danger-text-emphasis);
+  --bs-list-group-bg: var(--bs-danger-bg-subtle);
+  --bs-list-group-border-color: var(--bs-danger-border-subtle);
+  --bs-list-group-action-hover-color: var(--bs-emphasis-color);
+  --bs-list-group-action-hover-bg: var(--bs-danger-border-subtle);
+  --bs-list-group-action-active-color: var(--bs-emphasis-color);
+  --bs-list-group-action-active-bg: var(--bs-danger-border-subtle);
+  --bs-list-group-active-color: var(--bs-danger-bg-subtle);
+  --bs-list-group-active-bg: var(--bs-danger-text-emphasis);
+  --bs-list-group-active-border-color: var(--bs-danger-text-emphasis);
+}
+
+.list-group-item-light {
+  --bs-list-group-color: var(--bs-light-text-emphasis);
+  --bs-list-group-bg: var(--bs-light-bg-subtle);
+  --bs-list-group-border-color: var(--bs-light-border-subtle);
+  --bs-list-group-action-hover-color: var(--bs-emphasis-color);
+  --bs-list-group-action-hover-bg: var(--bs-light-border-subtle);
+  --bs-list-group-action-active-color: var(--bs-emphasis-color);
+  --bs-list-group-action-active-bg: var(--bs-light-border-subtle);
+  --bs-list-group-active-color: var(--bs-light-bg-subtle);
+  --bs-list-group-active-bg: var(--bs-light-text-emphasis);
+  --bs-list-group-active-border-color: var(--bs-light-text-emphasis);
+}
+
+.list-group-item-dark {
+  --bs-list-group-color: var(--bs-dark-text-emphasis);
+  --bs-list-group-bg: var(--bs-dark-bg-subtle);
+  --bs-list-group-border-color: var(--bs-dark-border-subtle);
+  --bs-list-group-action-hover-color: var(--bs-emphasis-color);
+  --bs-list-group-action-hover-bg: var(--bs-dark-border-subtle);
+  --bs-list-group-action-active-color: var(--bs-emphasis-color);
+  --bs-list-group-action-active-bg: var(--bs-dark-border-subtle);
+  --bs-list-group-active-color: var(--bs-dark-bg-subtle);
+  --bs-list-group-active-bg: var(--bs-dark-text-emphasis);
+  --bs-list-group-active-border-color: var(--bs-dark-text-emphasis);
+}
+
+.btn-close {
+  --bs-btn-close-color: #000;
+  --bs-btn-close-bg: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16' fill='%23000'%3e%3cpath d='M.293.293a1 1 0 0 1 1.414 0L8 6.586 14.293.293a1 1 0 1 1 1.414 1.414L9.414 8l6.293 6.293a1 1 0 0 1-1.414 1.414L8 9.414l-6.293 6.293a1 1 0 0 1-1.414-1.414L6.586 8 .293 1.707a1 1 0 0 1 0-1.414z'/%3e%3c/svg%3e");
+  --bs-btn-close-opacity: 0.5;
+  --bs-btn-close-hover-opacity: 0.75;
+  --bs-btn-close-focus-shadow: 0 0 0 0.25rem rgba(13, 110, 253, 0.25);
+  --bs-btn-close-focus-opacity: 1;
+  --bs-btn-close-disabled-opacity: 0.25;
+  --bs-btn-close-white-filter: invert(1) grayscale(100%) brightness(200%);
+  box-sizing: content-box;
+  width: 1em;
+  height: 1em;
+  padding: 0.25em 0.25em;
+  color: var(--bs-btn-close-color);
+  background: transparent var(--bs-btn-close-bg) center/1em auto no-repeat;
+  border: 0;
+  border-radius: 0.375rem;
+  opacity: var(--bs-btn-close-opacity);
+}
+.btn-close:hover {
+  color: var(--bs-btn-close-color);
+  text-decoration: none;
+  opacity: var(--bs-btn-close-hover-opacity);
+}
+.btn-close:focus {
+  outline: 0;
+  box-shadow: var(--bs-btn-close-focus-shadow);
+  opacity: var(--bs-btn-close-focus-opacity);
+}
+.btn-close:disabled, .btn-close.disabled {
+  pointer-events: none;
+  -webkit-user-select: none;
+  -moz-user-select: none;
+  user-select: none;
+  opacity: var(--bs-btn-close-disabled-opacity);
+}
+
+.btn-close-white {
+  filter: var(--bs-btn-close-white-filter);
+}
+
+[data-bs-theme=dark] .btn-close {
+  filter: var(--bs-btn-close-white-filter);
+}
+
+.toast {
+  --bs-toast-zindex: 1090;
+  --bs-toast-padding-x: 0.75rem;
+  --bs-toast-padding-y: 0.5rem;
+  --bs-toast-spacing: 1.5rem;
+  --bs-toast-max-width: 350px;
+  --bs-toast-font-size: 0.875rem;
+  --bs-toast-color: ;
+  --bs-toast-bg: rgba(var(--bs-body-bg-rgb), 0.85);
+  --bs-toast-border-width: var(--bs-border-width);
+  --bs-toast-border-color: var(--bs-border-color-translucent);
+  --bs-toast-border-radius: var(--bs-border-radius);
+  --bs-toast-box-shadow: var(--bs-box-shadow);
+  --bs-toast-header-color: var(--bs-secondary-color);
+  --bs-toast-header-bg: rgba(var(--bs-body-bg-rgb), 0.85);
+  --bs-toast-header-border-color: var(--bs-border-color-translucent);
+  width: var(--bs-toast-max-width);
+  max-width: 100%;
+  font-size: var(--bs-toast-font-size);
+  color: var(--bs-toast-color);
+  pointer-events: auto;
+  background-color: var(--bs-toast-bg);
+  background-clip: padding-box;
+  border: var(--bs-toast-border-width) solid var(--bs-toast-border-color);
+  box-shadow: var(--bs-toast-box-shadow);
+  border-radius: var(--bs-toast-border-radius);
+}
+.toast.showing {
+  opacity: 0;
+}
+.toast:not(.show) {
+  display: none;
+}
+
+.toast-container {
+  --bs-toast-zindex: 1090;
+  position: absolute;
+  z-index: var(--bs-toast-zindex);
+  width: -webkit-max-content;
+  width: -moz-max-content;
+  width: max-content;
+  max-width: 100%;
+  pointer-events: none;
+}
+.toast-container > :not(:last-child) {
+  margin-bottom: var(--bs-toast-spacing);
+}
+
+.toast-header {
+  display: flex;
+  align-items: center;
+  padding: var(--bs-toast-padding-y) var(--bs-toast-padding-x);
+  color: var(--bs-toast-header-color);
+  background-color: var(--bs-toast-header-bg);
+  background-clip: padding-box;
+  border-bottom: var(--bs-toast-border-width) solid var(--bs-toast-header-border-color);
+  border-top-left-radius: calc(var(--bs-toast-border-radius) - var(--bs-toast-border-width));
+  border-top-right-radius: calc(var(--bs-toast-border-radius) - var(--bs-toast-border-width));
+}
+.toast-header .btn-close {
+  margin-right: calc(-0.5 * var(--bs-toast-padding-x));
+  margin-left: var(--bs-toast-padding-x);
+}
+
+.toast-body {
+  padding: var(--bs-toast-padding-x);
+  word-wrap: break-word;
+}
+
+.modal {
+  --bs-modal-zindex: 1055;
+  --bs-modal-width: 500px;
+  --bs-modal-padding: 1rem;
+  --bs-modal-margin: 0.5rem;
+  --bs-modal-color: ;
+  --bs-modal-bg: var(--bs-body-bg);
+  --bs-modal-border-color: var(--bs-border-color-translucent);
+  --bs-modal-border-width: var(--bs-border-width);
+  --bs-modal-border-radius: var(--bs-border-radius-lg);
+  --bs-modal-box-shadow: var(--bs-box-shadow-sm);
+  --bs-modal-inner-border-radius: calc(var(--bs-border-radius-lg) - (var(--bs-border-width)));
+  --bs-modal-header-padding-x: 1rem;
+  --bs-modal-header-padding-y: 1rem;
+  --bs-modal-header-padding: 1rem 1rem;
+  --bs-modal-header-border-color: var(--bs-border-color);
+  --bs-modal-header-border-width: var(--bs-border-width);
+  --bs-modal-title-line-height: 1.5;
+  --bs-modal-footer-gap: 0.5rem;
+  --bs-modal-footer-bg: ;
+  --bs-modal-footer-border-color: var(--bs-border-color);
+  --bs-modal-footer-border-width: var(--bs-border-width);
+  position: fixed;
+  top: 0;
+  left: 0;
+  z-index: var(--bs-modal-zindex);
+  display: none;
+  width: 100%;
+  height: 100%;
+  overflow-x: hidden;
+  overflow-y: auto;
+  outline: 0;
+}
+
+.modal-dialog {
+  position: relative;
+  width: auto;
+  margin: var(--bs-modal-margin);
+  pointer-events: none;
+}
+.modal.fade .modal-dialog {
+  transition: transform 0.3s ease-out;
+  transform: translate(0, -50px);
+}
+@media (prefers-reduced-motion: reduce) {
+  .modal.fade .modal-dialog {
+    transition: none;
+  }
+}
+.modal.show .modal-dialog {
+  transform: none;
+}
+.modal.modal-static .modal-dialog {
+  transform: scale(1.02);
+}
+
+.modal-dialog-scrollable {
+  height: calc(100% - var(--bs-modal-margin) * 2);
+}
+.modal-dialog-scrollable .modal-content {
+  max-height: 100%;
+  overflow: hidden;
+}
+.modal-dialog-scrollable .modal-body {
+  overflow-y: auto;
+}
+
+.modal-dialog-centered {
+  display: flex;
+  align-items: center;
+  min-height: calc(100% - var(--bs-modal-margin) * 2);
+}
+
+.modal-content {
+  position: relative;
+  display: flex;
+  flex-direction: column;
+  width: 100%;
+  color: var(--bs-modal-color);
+  pointer-events: auto;
+  background-color: var(--bs-modal-bg);
+  background-clip: padding-box;
+  border: var(--bs-modal-border-width) solid var(--bs-modal-border-color);
+  border-radius: var(--bs-modal-border-radius);
+  outline: 0;
+}
+
+.modal-backdrop {
+  --bs-backdrop-zindex: 1050;
+  --bs-backdrop-bg: #000;
+  --bs-backdrop-opacity: 0.5;
+  position: fixed;
+  top: 0;
+  left: 0;
+  z-index: var(--bs-backdrop-zindex);
+  width: 100vw;
+  height: 100vh;
+  background-color: var(--bs-backdrop-bg);
+}
+.modal-backdrop.fade {
+  opacity: 0;
+}
+.modal-backdrop.show {
+  opacity: var(--bs-backdrop-opacity);
+}
+
+.modal-header {
+  display: flex;
+  flex-shrink: 0;
+  align-items: center;
+  justify-content: space-between;
+  padding: var(--bs-modal-header-padding);
+  border-bottom: var(--bs-modal-header-border-width) solid var(--bs-modal-header-border-color);
+  border-top-left-radius: var(--bs-modal-inner-border-radius);
+  border-top-right-radius: var(--bs-modal-inner-border-radius);
+}
+.modal-header .btn-close {
+  padding: calc(var(--bs-modal-header-padding-y) * 0.5) calc(var(--bs-modal-header-padding-x) * 0.5);
+  margin: calc(-0.5 * var(--bs-modal-header-padding-y)) calc(-0.5 * var(--bs-modal-header-padding-x)) calc(-0.5 * var(--bs-modal-header-padding-y)) auto;
+}
+
+.modal-title {
+  margin-bottom: 0;
+  line-height: var(--bs-modal-title-line-height);
+}
+
+.modal-body {
+  position: relative;
+  flex: 1 1 auto;
+  padding: var(--bs-modal-padding);
+}
+
+.modal-footer {
+  display: flex;
+  flex-shrink: 0;
+  flex-wrap: wrap;
+  align-items: center;
+  justify-content: flex-end;
+  padding: calc(var(--bs-modal-padding) - var(--bs-modal-footer-gap) * 0.5);
+  background-color: var(--bs-modal-footer-bg);
+  border-top: var(--bs-modal-footer-border-width) solid var(--bs-modal-footer-border-color);
+  border-bottom-right-radius: var(--bs-modal-inner-border-radius);
+  border-bottom-left-radius: var(--bs-modal-inner-border-radius);
+}
+.modal-footer > * {
+  margin: calc(var(--bs-modal-footer-gap) * 0.5);
+}
+
+@media (min-width: 576px) {
+  .modal {
+    --bs-modal-margin: 1.75rem;
+    --bs-modal-box-shadow: var(--bs-box-shadow);
+  }
+  .modal-dialog {
+    max-width: var(--bs-modal-width);
+    margin-right: auto;
+    margin-left: auto;
+  }
+  .modal-sm {
+    --bs-modal-width: 300px;
+  }
+}
+@media (min-width: 992px) {
+  .modal-lg,
+  .modal-xl {
+    --bs-modal-width: 800px;
+  }
+}
+@media (min-width: 1200px) {
+  .modal-xl {
+    --bs-modal-width: 1140px;
+  }
+}
+.modal-fullscreen {
+  width: 100vw;
+  max-width: none;
+  height: 100%;
+  margin: 0;
+}
+.modal-fullscreen .modal-content {
+  height: 100%;
+  border: 0;
+  border-radius: 0;
+}
+.modal-fullscreen .modal-header,
+.modal-fullscreen .modal-footer {
+  border-radius: 0;
+}
+.modal-fullscreen .modal-body {
+  overflow-y: auto;
+}
+
+@media (max-width: 575.98px) {
+  .modal-fullscreen-sm-down {
+    width: 100vw;
+    max-width: none;
+    height: 100%;
+    margin: 0;
+  }
+  .modal-fullscreen-sm-down .modal-content {
+    height: 100%;
+    border: 0;
+    border-radius: 0;
+  }
+  .modal-fullscreen-sm-down .modal-header,
+  .modal-fullscreen-sm-down .modal-footer {
+    border-radius: 0;
+  }
+  .modal-fullscreen-sm-down .modal-body {
+    overflow-y: auto;
+  }
+}
+@media (max-width: 767.98px) {
+  .modal-fullscreen-md-down {
+    width: 100vw;
+    max-width: none;
+    height: 100%;
+    margin: 0;
+  }
+  .modal-fullscreen-md-down .modal-content {
+    height: 100%;
+    border: 0;
+    border-radius: 0;
+  }
+  .modal-fullscreen-md-down .modal-header,
+  .modal-fullscreen-md-down .modal-footer {
+    border-radius: 0;
+  }
+  .modal-fullscreen-md-down .modal-body {
+    overflow-y: auto;
+  }
+}
+@media (max-width: 991.98px) {
+  .modal-fullscreen-lg-down {
+    width: 100vw;
+    max-width: none;
+    height: 100%;
+    margin: 0;
+  }
+  .modal-fullscreen-lg-down .modal-content {
+    height: 100%;
+    border: 0;
+    border-radius: 0;
+  }
+  .modal-fullscreen-lg-down .modal-header,
+  .modal-fullscreen-lg-down .modal-footer {
+    border-radius: 0;
+  }
+  .modal-fullscreen-lg-down .modal-body {
+    overflow-y: auto;
+  }
+}
+@media (max-width: 1199.98px) {
+  .modal-fullscreen-xl-down {
+    width: 100vw;
+    max-width: none;
+    height: 100%;
+    margin: 0;
+  }
+  .modal-fullscreen-xl-down .modal-content {
+    height: 100%;
+    border: 0;
+    border-radius: 0;
+  }
+  .modal-fullscreen-xl-down .modal-header,
+  .modal-fullscreen-xl-down .modal-footer {
+    border-radius: 0;
+  }
+  .modal-fullscreen-xl-down .modal-body {
+    overflow-y: auto;
+  }
+}
+@media (max-width: 1399.98px) {
+  .modal-fullscreen-xxl-down {
+    width: 100vw;
+    max-width: none;
+    height: 100%;
+    margin: 0;
+  }
+  .modal-fullscreen-xxl-down .modal-content {
+    height: 100%;
+    border: 0;
+    border-radius: 0;
+  }
+  .modal-fullscreen-xxl-down .modal-header,
+  .modal-fullscreen-xxl-down .modal-footer {
+    border-radius: 0;
+  }
+  .modal-fullscreen-xxl-down .modal-body {
+    overflow-y: auto;
+  }
+}
+.tooltip {
+  --bs-tooltip-zindex: 1080;
+  --bs-tooltip-max-width: 200px;
+  --bs-tooltip-padding-x: 0.5rem;
+  --bs-tooltip-padding-y: 0.25rem;
+  --bs-tooltip-margin: ;
+  --bs-tooltip-font-size: 0.875rem;
+  --bs-tooltip-color: var(--bs-body-bg);
+  --bs-tooltip-bg: var(--bs-emphasis-color);
+  --bs-tooltip-border-radius: var(--bs-border-radius);
+  --bs-tooltip-opacity: 0.9;
+  --bs-tooltip-arrow-width: 0.8rem;
+  --bs-tooltip-arrow-height: 0.4rem;
+  z-index: var(--bs-tooltip-zindex);
+  display: block;
+  margin: var(--bs-tooltip-margin);
+  font-family: var(--bs-font-sans-serif);
+  font-style: normal;
+  font-weight: 400;
+  line-height: 1.5;
+  text-align: left;
+  text-align: start;
+  text-decoration: none;
+  text-shadow: none;
+  text-transform: none;
+  letter-spacing: normal;
+  word-break: normal;
+  white-space: normal;
+  word-spacing: normal;
+  line-break: auto;
+  font-size: var(--bs-tooltip-font-size);
+  word-wrap: break-word;
+  opacity: 0;
+}
+.tooltip.show {
+  opacity: var(--bs-tooltip-opacity);
+}
+.tooltip .tooltip-arrow {
+  display: block;
+  width: var(--bs-tooltip-arrow-width);
+  height: var(--bs-tooltip-arrow-height);
+}
+.tooltip .tooltip-arrow::before {
+  position: absolute;
+  content: "";
+  border-color: transparent;
+  border-style: solid;
+}
+
+.bs-tooltip-top .tooltip-arrow, .bs-tooltip-auto[data-popper-placement^=top] .tooltip-arrow {
+  bottom: calc(-1 * var(--bs-tooltip-arrow-height));
+}
+.bs-tooltip-top .tooltip-arrow::before, .bs-tooltip-auto[data-popper-placement^=top] .tooltip-arrow::before {
+  top: -1px;
+  border-width: var(--bs-tooltip-arrow-height) calc(var(--bs-tooltip-arrow-width) * 0.5) 0;
+  border-top-color: var(--bs-tooltip-bg);
+}
+
+/* rtl:begin:ignore */
+.bs-tooltip-end .tooltip-arrow, .bs-tooltip-auto[data-popper-placement^=right] .tooltip-arrow {
+  left: calc(-1 * var(--bs-tooltip-arrow-height));
+  width: var(--bs-tooltip-arrow-height);
+  height: var(--bs-tooltip-arrow-width);
+}
+.bs-tooltip-end .tooltip-arrow::before, .bs-tooltip-auto[data-popper-placement^=right] .tooltip-arrow::before {
+  right: -1px;
+  border-width: calc(var(--bs-tooltip-arrow-width) * 0.5) var(--bs-tooltip-arrow-height) calc(var(--bs-tooltip-arrow-width) * 0.5) 0;
+  border-right-color: var(--bs-tooltip-bg);
+}
+
+/* rtl:end:ignore */
+.bs-tooltip-bottom .tooltip-arrow, .bs-tooltip-auto[data-popper-placement^=bottom] .tooltip-arrow {
+  top: calc(-1 * var(--bs-tooltip-arrow-height));
+}
+.bs-tooltip-bottom .tooltip-arrow::before, .bs-tooltip-auto[data-popper-placement^=bottom] .tooltip-arrow::before {
+  bottom: -1px;
+  border-width: 0 calc(var(--bs-tooltip-arrow-width) * 0.5) var(--bs-tooltip-arrow-height);
+  border-bottom-color: var(--bs-tooltip-bg);
+}
+
+/* rtl:begin:ignore */
+.bs-tooltip-start .tooltip-arrow, .bs-tooltip-auto[data-popper-placement^=left] .tooltip-arrow {
+  right: calc(-1 * var(--bs-tooltip-arrow-height));
+  width: var(--bs-tooltip-arrow-height);
+  height: var(--bs-tooltip-arrow-width);
+}
+.bs-tooltip-start .tooltip-arrow::before, .bs-tooltip-auto[data-popper-placement^=left] .tooltip-arrow::before {
+  left: -1px;
+  border-width: calc(var(--bs-tooltip-arrow-width) * 0.5) 0 calc(var(--bs-tooltip-arrow-width) * 0.5) var(--bs-tooltip-arrow-height);
+  border-left-color: var(--bs-tooltip-bg);
+}
+
+/* rtl:end:ignore */
+.tooltip-inner {
+  max-width: var(--bs-tooltip-max-width);
+  padding: var(--bs-tooltip-padding-y) var(--bs-tooltip-padding-x);
+  color: var(--bs-tooltip-color);
+  text-align: center;
+  background-color: var(--bs-tooltip-bg);
+  border-radius: var(--bs-tooltip-border-radius);
+}
+
+.popover {
+  --bs-popover-zindex: 1070;
+  --bs-popover-max-width: 276px;
+  --bs-popover-font-size: 0.875rem;
+  --bs-popover-bg: var(--bs-body-bg);
+  --bs-popover-border-width: var(--bs-border-width);
+  --bs-popover-border-color: var(--bs-border-color-translucent);
+  --bs-popover-border-radius: var(--bs-border-radius-lg);
+  --bs-popover-inner-border-radius: calc(var(--bs-border-radius-lg) - var(--bs-border-width));
+  --bs-popover-box-shadow: var(--bs-box-shadow);
+  --bs-popover-header-padding-x: 1rem;
+  --bs-popover-header-padding-y: 0.5rem;
+  --bs-popover-header-font-size: 1rem;
+  --bs-popover-header-color: inherit;
+  --bs-popover-header-bg: var(--bs-secondary-bg);
+  --bs-popover-body-padding-x: 1rem;
+  --bs-popover-body-padding-y: 1rem;
+  --bs-popover-body-color: var(--bs-body-color);
+  --bs-popover-arrow-width: 1rem;
+  --bs-popover-arrow-height: 0.5rem;
+  --bs-popover-arrow-border: var(--bs-popover-border-color);
+  z-index: var(--bs-popover-zindex);
+  display: block;
+  max-width: var(--bs-popover-max-width);
+  font-family: var(--bs-font-sans-serif);
+  font-style: normal;
+  font-weight: 400;
+  line-height: 1.5;
+  text-align: left;
+  text-align: start;
+  text-decoration: none;
+  text-shadow: none;
+  text-transform: none;
+  letter-spacing: normal;
+  word-break: normal;
+  white-space: normal;
+  word-spacing: normal;
+  line-break: auto;
+  font-size: var(--bs-popover-font-size);
+  word-wrap: break-word;
+  background-color: var(--bs-popover-bg);
+  background-clip: padding-box;
+  border: var(--bs-popover-border-width) solid var(--bs-popover-border-color);
+  border-radius: var(--bs-popover-border-radius);
+}
+.popover .popover-arrow {
+  display: block;
+  width: var(--bs-popover-arrow-width);
+  height: var(--bs-popover-arrow-height);
+}
+.popover .popover-arrow::before, .popover .popover-arrow::after {
+  position: absolute;
+  display: block;
+  content: "";
+  border-color: transparent;
+  border-style: solid;
+  border-width: 0;
+}
+
+.bs-popover-top > .popover-arrow, .bs-popover-auto[data-popper-placement^=top] > .popover-arrow {
+  bottom: calc(-1 * (var(--bs-popover-arrow-height)) - var(--bs-popover-border-width));
+}
+.bs-popover-top > .popover-arrow::before, .bs-popover-auto[data-popper-placement^=top] > .popover-arrow::before, .bs-popover-top > .popover-arrow::after, .bs-popover-auto[data-popper-placement^=top] > .popover-arrow::after {
+  border-width: var(--bs-popover-arrow-height) calc(var(--bs-popover-arrow-width) * 0.5) 0;
+}
+.bs-popover-top > .popover-arrow::before, .bs-popover-auto[data-popper-placement^=top] > .popover-arrow::before {
+  bottom: 0;
+  border-top-color: var(--bs-popover-arrow-border);
+}
+.bs-popover-top > .popover-arrow::after, .bs-popover-auto[data-popper-placement^=top] > .popover-arrow::after {
+  bottom: var(--bs-popover-border-width);
+  border-top-color: var(--bs-popover-bg);
+}
+
+/* rtl:begin:ignore */
+.bs-popover-end > .popover-arrow, .bs-popover-auto[data-popper-placement^=right] > .popover-arrow {
+  left: calc(-1 * (var(--bs-popover-arrow-height)) - var(--bs-popover-border-width));
+  width: var(--bs-popover-arrow-height);
+  height: var(--bs-popover-arrow-width);
+}
+.bs-popover-end > .popover-arrow::before, .bs-popover-auto[data-popper-placement^=right] > .popover-arrow::before, .bs-popover-end > .popover-arrow::after, .bs-popover-auto[data-popper-placement^=right] > .popover-arrow::after {
+  border-width: calc(var(--bs-popover-arrow-width) * 0.5) var(--bs-popover-arrow-height) calc(var(--bs-popover-arrow-width) * 0.5) 0;
+}
+.bs-popover-end > .popover-arrow::before, .bs-popover-auto[data-popper-placement^=right] > .popover-arrow::before {
+  left: 0;
+  border-right-color: var(--bs-popover-arrow-border);
+}
+.bs-popover-end > .popover-arrow::after, .bs-popover-auto[data-popper-placement^=right] > .popover-arrow::after {
+  left: var(--bs-popover-border-width);
+  border-right-color: var(--bs-popover-bg);
+}
+
+/* rtl:end:ignore */
+.bs-popover-bottom > .popover-arrow, .bs-popover-auto[data-popper-placement^=bottom] > .popover-arrow {
+  top: calc(-1 * (var(--bs-popover-arrow-height)) - var(--bs-popover-border-width));
+}
+.bs-popover-bottom > .popover-arrow::before, .bs-popover-auto[data-popper-placement^=bottom] > .popover-arrow::before, .bs-popover-bottom > .popover-arrow::after, .bs-popover-auto[data-popper-placement^=bottom] > .popover-arrow::after {
+  border-width: 0 calc(var(--bs-popover-arrow-width) * 0.5) var(--bs-popover-arrow-height);
+}
+.bs-popover-bottom > .popover-arrow::before, .bs-popover-auto[data-popper-placement^=bottom] > .popover-arrow::before {
+  top: 0;
+  border-bottom-color: var(--bs-popover-arrow-border);
+}
+.bs-popover-bottom > .popover-arrow::after, .bs-popover-auto[data-popper-placement^=bottom] > .popover-arrow::after {
+  top: var(--bs-popover-border-width);
+  border-bottom-color: var(--bs-popover-bg);
+}
+.bs-popover-bottom .popover-header::before, .bs-popover-auto[data-popper-placement^=bottom] .popover-header::before {
+  position: absolute;
+  top: 0;
+  left: 50%;
+  display: block;
+  width: var(--bs-popover-arrow-width);
+  margin-left: calc(-0.5 * var(--bs-popover-arrow-width));
+  content: "";
+  border-bottom: var(--bs-popover-border-width) solid var(--bs-popover-header-bg);
+}
+
+/* rtl:begin:ignore */
+.bs-popover-start > .popover-arrow, .bs-popover-auto[data-popper-placement^=left] > .popover-arrow {
+  right: calc(-1 * (var(--bs-popover-arrow-height)) - var(--bs-popover-border-width));
+  width: var(--bs-popover-arrow-height);
+  height: var(--bs-popover-arrow-width);
+}
+.bs-popover-start > .popover-arrow::before, .bs-popover-auto[data-popper-placement^=left] > .popover-arrow::before, .bs-popover-start > .popover-arrow::after, .bs-popover-auto[data-popper-placement^=left] > .popover-arrow::after {
+  border-width: calc(var(--bs-popover-arrow-width) * 0.5) 0 calc(var(--bs-popover-arrow-width) * 0.5) var(--bs-popover-arrow-height);
+}
+.bs-popover-start > .popover-arrow::before, .bs-popover-auto[data-popper-placement^=left] > .popover-arrow::before {
+  right: 0;
+  border-left-color: var(--bs-popover-arrow-border);
+}
+.bs-popover-start > .popover-arrow::after, .bs-popover-auto[data-popper-placement^=left] > .popover-arrow::after {
+  right: var(--bs-popover-border-width);
+  border-left-color: var(--bs-popover-bg);
+}
+
+/* rtl:end:ignore */
+.popover-header {
+  padding: var(--bs-popover-header-padding-y) var(--bs-popover-header-padding-x);
+  margin-bottom: 0;
+  font-size: var(--bs-popover-header-font-size);
+  color: var(--bs-popover-header-color);
+  background-color: var(--bs-popover-header-bg);
+  border-bottom: var(--bs-popover-border-width) solid var(--bs-popover-border-color);
+  border-top-left-radius: var(--bs-popover-inner-border-radius);
+  border-top-right-radius: var(--bs-popover-inner-border-radius);
+}
+.popover-header:empty {
+  display: none;
+}
+
+.popover-body {
+  padding: var(--bs-popover-body-padding-y) var(--bs-popover-body-padding-x);
+  color: var(--bs-popover-body-color);
+}
+
+.carousel {
+  position: relative;
+}
+
+.carousel.pointer-event {
+  touch-action: pan-y;
+}
+
+.carousel-inner {
+  position: relative;
+  width: 100%;
+  overflow: hidden;
+}
+.carousel-inner::after {
+  display: block;
+  clear: both;
+  content: "";
+}
+
+.carousel-item {
+  position: relative;
+  display: none;
+  float: left;
+  width: 100%;
+  margin-right: -100%;
+  -webkit-backface-visibility: hidden;
+  backface-visibility: hidden;
+  transition: transform 0.6s ease-in-out;
+}
+@media (prefers-reduced-motion: reduce) {
+  .carousel-item {
+    transition: none;
+  }
+}
+
+.carousel-item.active,
+.carousel-item-next,
+.carousel-item-prev {
+  display: block;
+}
+
+.carousel-item-next:not(.carousel-item-start),
+.active.carousel-item-end {
+  transform: translateX(100%);
+}
+
+.carousel-item-prev:not(.carousel-item-end),
+.active.carousel-item-start {
+  transform: translateX(-100%);
+}
+
+.carousel-fade .carousel-item {
+  opacity: 0;
+  transition-property: opacity;
+  transform: none;
+}
+.carousel-fade .carousel-item.active,
+.carousel-fade .carousel-item-next.carousel-item-start,
+.carousel-fade .carousel-item-prev.carousel-item-end {
+  z-index: 1;
+  opacity: 1;
+}
+.carousel-fade .active.carousel-item-start,
+.carousel-fade .active.carousel-item-end {
+  z-index: 0;
+  opacity: 0;
+  transition: opacity 0s 0.6s;
+}
+@media (prefers-reduced-motion: reduce) {
+  .carousel-fade .active.carousel-item-start,
+  .carousel-fade .active.carousel-item-end {
+    transition: none;
+  }
+}
+
+.carousel-control-prev,
+.carousel-control-next {
+  position: absolute;
+  top: 0;
+  bottom: 0;
+  z-index: 1;
+  display: flex;
+  align-items: center;
+  justify-content: center;
+  width: 15%;
+  padding: 0;
+  color: #fff;
+  text-align: center;
+  background: none;
+  border: 0;
+  opacity: 0.5;
+  transition: opacity 0.15s ease;
+}
+@media (prefers-reduced-motion: reduce) {
+  .carousel-control-prev,
+  .carousel-control-next {
+    transition: none;
+  }
+}
+.carousel-control-prev:hover, .carousel-control-prev:focus,
+.carousel-control-next:hover,
+.carousel-control-next:focus {
+  color: #fff;
+  text-decoration: none;
+  outline: 0;
+  opacity: 0.9;
+}
+
+.carousel-control-prev {
+  left: 0;
+}
+
+.carousel-control-next {
+  right: 0;
+}
+
+.carousel-control-prev-icon,
+.carousel-control-next-icon {
+  display: inline-block;
+  width: 2rem;
+  height: 2rem;
+  background-repeat: no-repeat;
+  background-position: 50%;
+  background-size: 100% 100%;
+}
+
+/* rtl:options: {
+  "autoRename": true,
+  "stringMap":[ {
+    "name"    : "prev-next",
+    "search"  : "prev",
+    "replace" : "next"
+  } ]
+} */
+.carousel-control-prev-icon {
+  background-image: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16' fill='%23fff'%3e%3cpath d='M11.354 1.646a.5.5 0 0 1 0 .708L5.707 8l5.647 5.646a.5.5 0 0 1-.708.708l-6-6a.5.5 0 0 1 0-.708l6-6a.5.5 0 0 1 .708 0z'/%3e%3c/svg%3e");
+}
+
+.carousel-control-next-icon {
+  background-image: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16' fill='%23fff'%3e%3cpath d='M4.646 1.646a.5.5 0 0 1 .708 0l6 6a.5.5 0 0 1 0 .708l-6 6a.5.5 0 0 1-.708-.708L10.293 8 4.646 2.354a.5.5 0 0 1 0-.708z'/%3e%3c/svg%3e");
+}
+
+.carousel-indicators {
+  position: absolute;
+  right: 0;
+  bottom: 0;
+  left: 0;
+  z-index: 2;
+  display: flex;
+  justify-content: center;
+  padding: 0;
+  margin-right: 15%;
+  margin-bottom: 1rem;
+  margin-left: 15%;
+}
+.carousel-indicators [data-bs-target] {
+  box-sizing: content-box;
+  flex: 0 1 auto;
+  width: 30px;
+  height: 3px;
+  padding: 0;
+  margin-right: 3px;
+  margin-left: 3px;
+  text-indent: -999px;
+  cursor: pointer;
+  background-color: #fff;
+  background-clip: padding-box;
+  border: 0;
+  border-top: 10px solid transparent;
+  border-bottom: 10px solid transparent;
+  opacity: 0.5;
+  transition: opacity 0.6s ease;
+}
+@media (prefers-reduced-motion: reduce) {
+  .carousel-indicators [data-bs-target] {
+    transition: none;
+  }
+}
+.carousel-indicators .active {
+  opacity: 1;
+}
+
+.carousel-caption {
+  position: absolute;
+  right: 15%;
+  bottom: 1.25rem;
+  left: 15%;
+  padding-top: 1.25rem;
+  padding-bottom: 1.25rem;
+  color: #fff;
+  text-align: center;
+}
+
+.carousel-dark .carousel-control-prev-icon,
+.carousel-dark .carousel-control-next-icon {
+  filter: invert(1) grayscale(100);
+}
+.carousel-dark .carousel-indicators [data-bs-target] {
+  background-color: #000;
+}
+.carousel-dark .carousel-caption {
+  color: #000;
+}
+
+[data-bs-theme=dark] .carousel .carousel-control-prev-icon,
+[data-bs-theme=dark] .carousel .carousel-control-next-icon, [data-bs-theme=dark].carousel .carousel-control-prev-icon,
+[data-bs-theme=dark].carousel .carousel-control-next-icon {
+  filter: invert(1) grayscale(100);
+}
+[data-bs-theme=dark] .carousel .carousel-indicators [data-bs-target], [data-bs-theme=dark].carousel .carousel-indicators [data-bs-target] {
+  background-color: #000;
+}
+[data-bs-theme=dark] .carousel .carousel-caption, [data-bs-theme=dark].carousel .carousel-caption {
+  color: #000;
+}
+
+.spinner-grow,
+.spinner-border {
+  display: inline-block;
+  width: var(--bs-spinner-width);
+  height: var(--bs-spinner-height);
+  vertical-align: var(--bs-spinner-vertical-align);
+  border-radius: 50%;
+  animation: var(--bs-spinner-animation-speed) linear infinite var(--bs-spinner-animation-name);
+}
+
+@keyframes spinner-border {
+  to {
+    transform: rotate(360deg) /* rtl:ignore */;
+  }
+}
+.spinner-border {
+  --bs-spinner-width: 2rem;
+  --bs-spinner-height: 2rem;
+  --bs-spinner-vertical-align: -0.125em;
+  --bs-spinner-border-width: 0.25em;
+  --bs-spinner-animation-speed: 0.75s;
+  --bs-spinner-animation-name: spinner-border;
+  border: var(--bs-spinner-border-width) solid currentcolor;
+  border-right-color: transparent;
+}
+
+.spinner-border-sm {
+  --bs-spinner-width: 1rem;
+  --bs-spinner-height: 1rem;
+  --bs-spinner-border-width: 0.2em;
+}
+
+@keyframes spinner-grow {
+  0% {
+    transform: scale(0);
+  }
+  50% {
+    opacity: 1;
+    transform: none;
+  }
+}
+.spinner-grow {
+  --bs-spinner-width: 2rem;
+  --bs-spinner-height: 2rem;
+  --bs-spinner-vertical-align: -0.125em;
+  --bs-spinner-animation-speed: 0.75s;
+  --bs-spinner-animation-name: spinner-grow;
+  background-color: currentcolor;
+  opacity: 0;
+}
+
+.spinner-grow-sm {
+  --bs-spinner-width: 1rem;
+  --bs-spinner-height: 1rem;
+}
+
+@media (prefers-reduced-motion: reduce) {
+  .spinner-border,
+  .spinner-grow {
+    --bs-spinner-animation-speed: 1.5s;
+  }
+}
+.offcanvas, .offcanvas-xxl, .offcanvas-xl, .offcanvas-lg, .offcanvas-md, .offcanvas-sm {
+  --bs-offcanvas-zindex: 1045;
+  --bs-offcanvas-width: 400px;
+  --bs-offcanvas-height: 30vh;
+  --bs-offcanvas-padding-x: 1rem;
+  --bs-offcanvas-padding-y: 1rem;
+  --bs-offcanvas-color: var(--bs-body-color);
+  --bs-offcanvas-bg: var(--bs-body-bg);
+  --bs-offcanvas-border-width: var(--bs-border-width);
+  --bs-offcanvas-border-color: var(--bs-border-color-translucent);
+  --bs-offcanvas-box-shadow: var(--bs-box-shadow-sm);
+  --bs-offcanvas-transition: transform 0.3s ease-in-out;
+  --bs-offcanvas-title-line-height: 1.5;
+}
+
+@media (max-width: 575.98px) {
+  .offcanvas-sm {
+    position: fixed;
+    bottom: 0;
+    z-index: var(--bs-offcanvas-zindex);
+    display: flex;
+    flex-direction: column;
+    max-width: 100%;
+    color: var(--bs-offcanvas-color);
+    visibility: hidden;
+    background-color: var(--bs-offcanvas-bg);
+    background-clip: padding-box;
+    outline: 0;
+    transition: var(--bs-offcanvas-transition);
+  }
+}
+@media (max-width: 575.98px) and (prefers-reduced-motion: reduce) {
+  .offcanvas-sm {
+    transition: none;
+  }
+}
+@media (max-width: 575.98px) {
+  .offcanvas-sm.offcanvas-start {
+    top: 0;
+    left: 0;
+    width: var(--bs-offcanvas-width);
+    border-right: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);
+    transform: translateX(-100%);
+  }
+  .offcanvas-sm.offcanvas-end {
+    top: 0;
+    right: 0;
+    width: var(--bs-offcanvas-width);
+    border-left: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);
+    transform: translateX(100%);
+  }
+  .offcanvas-sm.offcanvas-top {
+    top: 0;
+    right: 0;
+    left: 0;
+    height: var(--bs-offcanvas-height);
+    max-height: 100%;
+    border-bottom: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);
+    transform: translateY(-100%);
+  }
+  .offcanvas-sm.offcanvas-bottom {
+    right: 0;
+    left: 0;
+    height: var(--bs-offcanvas-height);
+    max-height: 100%;
+    border-top: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);
+    transform: translateY(100%);
+  }
+  .offcanvas-sm.showing, .offcanvas-sm.show:not(.hiding) {
+    transform: none;
+  }
+  .offcanvas-sm.showing, .offcanvas-sm.hiding, .offcanvas-sm.show {
+    visibility: visible;
+  }
+}
+@media (min-width: 576px) {
+  .offcanvas-sm {
+    --bs-offcanvas-height: auto;
+    --bs-offcanvas-border-width: 0;
+    background-color: transparent !important;
+  }
+  .offcanvas-sm .offcanvas-header {
+    display: none;
+  }
+  .offcanvas-sm .offcanvas-body {
+    display: flex;
+    flex-grow: 0;
+    padding: 0;
+    overflow-y: visible;
+    background-color: transparent !important;
+  }
+}
+
+@media (max-width: 767.98px) {
+  .offcanvas-md {
+    position: fixed;
+    bottom: 0;
+    z-index: var(--bs-offcanvas-zindex);
+    display: flex;
+    flex-direction: column;
+    max-width: 100%;
+    color: var(--bs-offcanvas-color);
+    visibility: hidden;
+    background-color: var(--bs-offcanvas-bg);
+    background-clip: padding-box;
+    outline: 0;
+    transition: var(--bs-offcanvas-transition);
+  }
+}
+@media (max-width: 767.98px) and (prefers-reduced-motion: reduce) {
+  .offcanvas-md {
+    transition: none;
+  }
+}
+@media (max-width: 767.98px) {
+  .offcanvas-md.offcanvas-start {
+    top: 0;
+    left: 0;
+    width: var(--bs-offcanvas-width);
+    border-right: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);
+    transform: translateX(-100%);
+  }
+  .offcanvas-md.offcanvas-end {
+    top: 0;
+    right: 0;
+    width: var(--bs-offcanvas-width);
+    border-left: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);
+    transform: translateX(100%);
+  }
+  .offcanvas-md.offcanvas-top {
+    top: 0;
+    right: 0;
+    left: 0;
+    height: var(--bs-offcanvas-height);
+    max-height: 100%;
+    border-bottom: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);
+    transform: translateY(-100%);
+  }
+  .offcanvas-md.offcanvas-bottom {
+    right: 0;
+    left: 0;
+    height: var(--bs-offcanvas-height);
+    max-height: 100%;
+    border-top: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);
+    transform: translateY(100%);
+  }
+  .offcanvas-md.showing, .offcanvas-md.show:not(.hiding) {
+    transform: none;
+  }
+  .offcanvas-md.showing, .offcanvas-md.hiding, .offcanvas-md.show {
+    visibility: visible;
+  }
+}
+@media (min-width: 768px) {
+  .offcanvas-md {
+    --bs-offcanvas-height: auto;
+    --bs-offcanvas-border-width: 0;
+    background-color: transparent !important;
+  }
+  .offcanvas-md .offcanvas-header {
+    display: none;
+  }
+  .offcanvas-md .offcanvas-body {
+    display: flex;
+    flex-grow: 0;
+    padding: 0;
+    overflow-y: visible;
+    background-color: transparent !important;
+  }
+}
+
+@media (max-width: 991.98px) {
+  .offcanvas-lg {
+    position: fixed;
+    bottom: 0;
+    z-index: var(--bs-offcanvas-zindex);
+    display: flex;
+    flex-direction: column;
+    max-width: 100%;
+    color: var(--bs-offcanvas-color);
+    visibility: hidden;
+    background-color: var(--bs-offcanvas-bg);
+    background-clip: padding-box;
+    outline: 0;
+    transition: var(--bs-offcanvas-transition);
+  }
+}
+@media (max-width: 991.98px) and (prefers-reduced-motion: reduce) {
+  .offcanvas-lg {
+    transition: none;
+  }
+}
+@media (max-width: 991.98px) {
+  .offcanvas-lg.offcanvas-start {
+    top: 0;
+    left: 0;
+    width: var(--bs-offcanvas-width);
+    border-right: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);
+    transform: translateX(-100%);
+  }
+  .offcanvas-lg.offcanvas-end {
+    top: 0;
+    right: 0;
+    width: var(--bs-offcanvas-width);
+    border-left: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);
+    transform: translateX(100%);
+  }
+  .offcanvas-lg.offcanvas-top {
+    top: 0;
+    right: 0;
+    left: 0;
+    height: var(--bs-offcanvas-height);
+    max-height: 100%;
+    border-bottom: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);
+    transform: translateY(-100%);
+  }
+  .offcanvas-lg.offcanvas-bottom {
+    right: 0;
+    left: 0;
+    height: var(--bs-offcanvas-height);
+    max-height: 100%;
+    border-top: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);
+    transform: translateY(100%);
+  }
+  .offcanvas-lg.showing, .offcanvas-lg.show:not(.hiding) {
+    transform: none;
+  }
+  .offcanvas-lg.showing, .offcanvas-lg.hiding, .offcanvas-lg.show {
+    visibility: visible;
+  }
+}
+@media (min-width: 992px) {
+  .offcanvas-lg {
+    --bs-offcanvas-height: auto;
+    --bs-offcanvas-border-width: 0;
+    background-color: transparent !important;
+  }
+  .offcanvas-lg .offcanvas-header {
+    display: none;
+  }
+  .offcanvas-lg .offcanvas-body {
+    display: flex;
+    flex-grow: 0;
+    padding: 0;
+    overflow-y: visible;
+    background-color: transparent !important;
+  }
+}
+
+@media (max-width: 1199.98px) {
+  .offcanvas-xl {
+    position: fixed;
+    bottom: 0;
+    z-index: var(--bs-offcanvas-zindex);
+    display: flex;
+    flex-direction: column;
+    max-width: 100%;
+    color: var(--bs-offcanvas-color);
+    visibility: hidden;
+    background-color: var(--bs-offcanvas-bg);
+    background-clip: padding-box;
+    outline: 0;
+    transition: var(--bs-offcanvas-transition);
+  }
+}
+@media (max-width: 1199.98px) and (prefers-reduced-motion: reduce) {
+  .offcanvas-xl {
+    transition: none;
+  }
+}
+@media (max-width: 1199.98px) {
+  .offcanvas-xl.offcanvas-start {
+    top: 0;
+    left: 0;
+    width: var(--bs-offcanvas-width);
+    border-right: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);
+    transform: translateX(-100%);
+  }
+  .offcanvas-xl.offcanvas-end {
+    top: 0;
+    right: 0;
+    width: var(--bs-offcanvas-width);
+    border-left: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);
+    transform: translateX(100%);
+  }
+  .offcanvas-xl.offcanvas-top {
+    top: 0;
+    right: 0;
+    left: 0;
+    height: var(--bs-offcanvas-height);
+    max-height: 100%;
+    border-bottom: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);
+    transform: translateY(-100%);
+  }
+  .offcanvas-xl.offcanvas-bottom {
+    right: 0;
+    left: 0;
+    height: var(--bs-offcanvas-height);
+    max-height: 100%;
+    border-top: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);
+    transform: translateY(100%);
+  }
+  .offcanvas-xl.showing, .offcanvas-xl.show:not(.hiding) {
+    transform: none;
+  }
+  .offcanvas-xl.showing, .offcanvas-xl.hiding, .offcanvas-xl.show {
+    visibility: visible;
+  }
+}
+@media (min-width: 1200px) {
+  .offcanvas-xl {
+    --bs-offcanvas-height: auto;
+    --bs-offcanvas-border-width: 0;
+    background-color: transparent !important;
+  }
+  .offcanvas-xl .offcanvas-header {
+    display: none;
+  }
+  .offcanvas-xl .offcanvas-body {
+    display: flex;
+    flex-grow: 0;
+    padding: 0;
+    overflow-y: visible;
+    background-color: transparent !important;
+  }
+}
+
+@media (max-width: 1399.98px) {
+  .offcanvas-xxl {
+    position: fixed;
+    bottom: 0;
+    z-index: var(--bs-offcanvas-zindex);
+    display: flex;
+    flex-direction: column;
+    max-width: 100%;
+    color: var(--bs-offcanvas-color);
+    visibility: hidden;
+    background-color: var(--bs-offcanvas-bg);
+    background-clip: padding-box;
+    outline: 0;
+    transition: var(--bs-offcanvas-transition);
+  }
+}
+@media (max-width: 1399.98px) and (prefers-reduced-motion: reduce) {
+  .offcanvas-xxl {
+    transition: none;
+  }
+}
+@media (max-width: 1399.98px) {
+  .offcanvas-xxl.offcanvas-start {
+    top: 0;
+    left: 0;
+    width: var(--bs-offcanvas-width);
+    border-right: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);
+    transform: translateX(-100%);
+  }
+  .offcanvas-xxl.offcanvas-end {
+    top: 0;
+    right: 0;
+    width: var(--bs-offcanvas-width);
+    border-left: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);
+    transform: translateX(100%);
+  }
+  .offcanvas-xxl.offcanvas-top {
+    top: 0;
+    right: 0;
+    left: 0;
+    height: var(--bs-offcanvas-height);
+    max-height: 100%;
+    border-bottom: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);
+    transform: translateY(-100%);
+  }
+  .offcanvas-xxl.offcanvas-bottom {
+    right: 0;
+    left: 0;
+    height: var(--bs-offcanvas-height);
+    max-height: 100%;
+    border-top: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);
+    transform: translateY(100%);
+  }
+  .offcanvas-xxl.showing, .offcanvas-xxl.show:not(.hiding) {
+    transform: none;
+  }
+  .offcanvas-xxl.showing, .offcanvas-xxl.hiding, .offcanvas-xxl.show {
+    visibility: visible;
+  }
+}
+@media (min-width: 1400px) {
+  .offcanvas-xxl {
+    --bs-offcanvas-height: auto;
+    --bs-offcanvas-border-width: 0;
+    background-color: transparent !important;
+  }
+  .offcanvas-xxl .offcanvas-header {
+    display: none;
+  }
+  .offcanvas-xxl .offcanvas-body {
+    display: flex;
+    flex-grow: 0;
+    padding: 0;
+    overflow-y: visible;
+    background-color: transparent !important;
+  }
+}
+
+.offcanvas {
+  position: fixed;
+  bottom: 0;
+  z-index: var(--bs-offcanvas-zindex);
+  display: flex;
+  flex-direction: column;
+  max-width: 100%;
+  color: var(--bs-offcanvas-color);
+  visibility: hidden;
+  background-color: var(--bs-offcanvas-bg);
+  background-clip: padding-box;
+  outline: 0;
+  transition: var(--bs-offcanvas-transition);
+}
+@media (prefers-reduced-motion: reduce) {
+  .offcanvas {
+    transition: none;
+  }
+}
+.offcanvas.offcanvas-start {
+  top: 0;
+  left: 0;
+  width: var(--bs-offcanvas-width);
+  border-right: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);
+  transform: translateX(-100%);
+}
+.offcanvas.offcanvas-end {
+  top: 0;
+  right: 0;
+  width: var(--bs-offcanvas-width);
+  border-left: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);
+  transform: translateX(100%);
+}
+.offcanvas.offcanvas-top {
+  top: 0;
+  right: 0;
+  left: 0;
+  height: var(--bs-offcanvas-height);
+  max-height: 100%;
+  border-bottom: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);
+  transform: translateY(-100%);
+}
+.offcanvas.offcanvas-bottom {
+  right: 0;
+  left: 0;
+  height: var(--bs-offcanvas-height);
+  max-height: 100%;
+  border-top: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);
+  transform: translateY(100%);
+}
+.offcanvas.showing, .offcanvas.show:not(.hiding) {
+  transform: none;
+}
+.offcanvas.showing, .offcanvas.hiding, .offcanvas.show {
+  visibility: visible;
+}
+
+.offcanvas-backdrop {
+  position: fixed;
+  top: 0;
+  left: 0;
+  z-index: 1040;
+  width: 100vw;
+  height: 100vh;
+  background-color: #000;
+}
+.offcanvas-backdrop.fade {
+  opacity: 0;
+}
+.offcanvas-backdrop.show {
+  opacity: 0.5;
+}
+
+.offcanvas-header {
+  display: flex;
+  align-items: center;
+  justify-content: space-between;
+  padding: var(--bs-offcanvas-padding-y) var(--bs-offcanvas-padding-x);
+}
+.offcanvas-header .btn-close {
+  padding: calc(var(--bs-offcanvas-padding-y) * 0.5) calc(var(--bs-offcanvas-padding-x) * 0.5);
+  margin-top: calc(-0.5 * var(--bs-offcanvas-padding-y));
+  margin-right: calc(-0.5 * var(--bs-offcanvas-padding-x));
+  margin-bottom: calc(-0.5 * var(--bs-offcanvas-padding-y));
+}
+
+.offcanvas-title {
+  margin-bottom: 0;
+  line-height: var(--bs-offcanvas-title-line-height);
+}
+
+.offcanvas-body {
+  flex-grow: 1;
+  padding: var(--bs-offcanvas-padding-y) var(--bs-offcanvas-padding-x);
+  overflow-y: auto;
+}
+
+.placeholder {
+  display: inline-block;
+  min-height: 1em;
+  vertical-align: middle;
+  cursor: wait;
+  background-color: currentcolor;
+  opacity: 0.5;
+}
+.placeholder.btn::before {
+  display: inline-block;
+  content: "";
+}
+
+.placeholder-xs {
+  min-height: 0.6em;
+}
+
+.placeholder-sm {
+  min-height: 0.8em;
+}
+
+.placeholder-lg {
+  min-height: 1.2em;
+}
+
+.placeholder-glow .placeholder {
+  animation: placeholder-glow 2s ease-in-out infinite;
+}
+
+@keyframes placeholder-glow {
+  50% {
+    opacity: 0.2;
+  }
+}
+.placeholder-wave {
+  -webkit-mask-image: linear-gradient(130deg, #000 55%, rgba(0, 0, 0, 0.8) 75%, #000 95%);
+  mask-image: linear-gradient(130deg, #000 55%, rgba(0, 0, 0, 0.8) 75%, #000 95%);
+  -webkit-mask-size: 200% 100%;
+  mask-size: 200% 100%;
+  animation: placeholder-wave 2s linear infinite;
+}
+
+@keyframes placeholder-wave {
+  100% {
+    -webkit-mask-position: -200% 0%;
+    mask-position: -200% 0%;
+  }
+}
+.clearfix::after {
+  display: block;
+  clear: both;
+  content: "";
+}
+
+.text-bg-primary {
+  color: #fff !important;
+  background-color: RGBA(var(--bs-primary-rgb), var(--bs-bg-opacity, 1)) !important;
+}
+
+.text-bg-secondary {
+  color: #fff !important;
+  background-color: RGBA(var(--bs-secondary-rgb), var(--bs-bg-opacity, 1)) !important;
+}
+
+.text-bg-success {
+  color: #fff !important;
+  background-color: RGBA(var(--bs-success-rgb), var(--bs-bg-opacity, 1)) !important;
+}
+
+.text-bg-info {
+  color: #000 !important;
+  background-color: RGBA(var(--bs-info-rgb), var(--bs-bg-opacity, 1)) !important;
+}
+
+.text-bg-warning {
+  color: #000 !important;
+  background-color: RGBA(var(--bs-warning-rgb), var(--bs-bg-opacity, 1)) !important;
+}
+
+.text-bg-danger {
+  color: #fff !important;
+  background-color: RGBA(var(--bs-danger-rgb), var(--bs-bg-opacity, 1)) !important;
+}
+
+.text-bg-light {
+  color: #000 !important;
+  background-color: RGBA(var(--bs-light-rgb), var(--bs-bg-opacity, 1)) !important;
+}
+
+.text-bg-dark {
+  color: #fff !important;
+  background-color: RGBA(var(--bs-dark-rgb), var(--bs-bg-opacity, 1)) !important;
+}
+
+.link-primary {
+  color: RGBA(var(--bs-primary-rgb), var(--bs-link-opacity, 1)) !important;
+  -webkit-text-decoration-color: RGBA(var(--bs-primary-rgb), var(--bs-link-underline-opacity, 1)) !important;
+  text-decoration-color: RGBA(var(--bs-primary-rgb), var(--bs-link-underline-opacity, 1)) !important;
+}
+.link-primary:hover, .link-primary:focus {
+  color: RGBA(10, 88, 202, var(--bs-link-opacity, 1)) !important;
+  -webkit-text-decoration-color: RGBA(10, 88, 202, var(--bs-link-underline-opacity, 1)) !important;
+  text-decoration-color: RGBA(10, 88, 202, var(--bs-link-underline-opacity, 1)) !important;
+}
+
+.link-secondary {
+  color: RGBA(var(--bs-secondary-rgb), var(--bs-link-opacity, 1)) !important;
+  -webkit-text-decoration-color: RGBA(var(--bs-secondary-rgb), var(--bs-link-underline-opacity, 1)) !important;
+  text-decoration-color: RGBA(var(--bs-secondary-rgb), var(--bs-link-underline-opacity, 1)) !important;
+}
+.link-secondary:hover, .link-secondary:focus {
+  color: RGBA(86, 94, 100, var(--bs-link-opacity, 1)) !important;
+  -webkit-text-decoration-color: RGBA(86, 94, 100, var(--bs-link-underline-opacity, 1)) !important;
+  text-decoration-color: RGBA(86, 94, 100, var(--bs-link-underline-opacity, 1)) !important;
+}
+
+.link-success {
+  color: RGBA(var(--bs-success-rgb), var(--bs-link-opacity, 1)) !important;
+  -webkit-text-decoration-color: RGBA(var(--bs-success-rgb), var(--bs-link-underline-opacity, 1)) !important;
+  text-decoration-color: RGBA(var(--bs-success-rgb), var(--bs-link-underline-opacity, 1)) !important;
+}
+.link-success:hover, .link-success:focus {
+  color: RGBA(20, 108, 67, var(--bs-link-opacity, 1)) !important;
+  -webkit-text-decoration-color: RGBA(20, 108, 67, var(--bs-link-underline-opacity, 1)) !important;
+  text-decoration-color: RGBA(20, 108, 67, var(--bs-link-underline-opacity, 1)) !important;
+}
+
+.link-info {
+  color: RGBA(var(--bs-info-rgb), var(--bs-link-opacity, 1)) !important;
+  -webkit-text-decoration-color: RGBA(var(--bs-info-rgb), var(--bs-link-underline-opacity, 1)) !important;
+  text-decoration-color: RGBA(var(--bs-info-rgb), var(--bs-link-underline-opacity, 1)) !important;
+}
+.link-info:hover, .link-info:focus {
+  color: RGBA(61, 213, 243, var(--bs-link-opacity, 1)) !important;
+  -webkit-text-decoration-color: RGBA(61, 213, 243, var(--bs-link-underline-opacity, 1)) !important;
+  text-decoration-color: RGBA(61, 213, 243, var(--bs-link-underline-opacity, 1)) !important;
+}
+
+.link-warning {
+  color: RGBA(var(--bs-warning-rgb), var(--bs-link-opacity, 1)) !important;
+  -webkit-text-decoration-color: RGBA(var(--bs-warning-rgb), var(--bs-link-underline-opacity, 1)) !important;
+  text-decoration-color: RGBA(var(--bs-warning-rgb), var(--bs-link-underline-opacity, 1)) !important;
+}
+.link-warning:hover, .link-warning:focus {
+  color: RGBA(255, 205, 57, var(--bs-link-opacity, 1)) !important;
+  -webkit-text-decoration-color: RGBA(255, 205, 57, var(--bs-link-underline-opacity, 1)) !important;
+  text-decoration-color: RGBA(255, 205, 57, var(--bs-link-underline-opacity, 1)) !important;
+}
+
+.link-danger {
+  color: RGBA(var(--bs-danger-rgb), var(--bs-link-opacity, 1)) !important;
+  -webkit-text-decoration-color: RGBA(var(--bs-danger-rgb), var(--bs-link-underline-opacity, 1)) !important;
+  text-decoration-color: RGBA(var(--bs-danger-rgb), var(--bs-link-underline-opacity, 1)) !important;
+}
+.link-danger:hover, .link-danger:focus {
+  color: RGBA(176, 42, 55, var(--bs-link-opacity, 1)) !important;
+  -webkit-text-decoration-color: RGBA(176, 42, 55, var(--bs-link-underline-opacity, 1)) !important;
+  text-decoration-color: RGBA(176, 42, 55, var(--bs-link-underline-opacity, 1)) !important;
+}
+
+.link-light {
+  color: RGBA(var(--bs-light-rgb), var(--bs-link-opacity, 1)) !important;
+  -webkit-text-decoration-color: RGBA(var(--bs-light-rgb), var(--bs-link-underline-opacity, 1)) !important;
+  text-decoration-color: RGBA(var(--bs-light-rgb), var(--bs-link-underline-opacity, 1)) !important;
+}
+.link-light:hover, .link-light:focus {
+  color: RGBA(249, 250, 251, var(--bs-link-opacity, 1)) !important;
+  -webkit-text-decoration-color: RGBA(249, 250, 251, var(--bs-link-underline-opacity, 1)) !important;
+  text-decoration-color: RGBA(249, 250, 251, var(--bs-link-underline-opacity, 1)) !important;
+}
+
+.link-dark {
+  color: RGBA(var(--bs-dark-rgb), var(--bs-link-opacity, 1)) !important;
+  -webkit-text-decoration-color: RGBA(var(--bs-dark-rgb), var(--bs-link-underline-opacity, 1)) !important;
+  text-decoration-color: RGBA(var(--bs-dark-rgb), var(--bs-link-underline-opacity, 1)) !important;
+}
+.link-dark:hover, .link-dark:focus {
+  color: RGBA(26, 30, 33, var(--bs-link-opacity, 1)) !important;
+  -webkit-text-decoration-color: RGBA(26, 30, 33, var(--bs-link-underline-opacity, 1)) !important;
+  text-decoration-color: RGBA(26, 30, 33, var(--bs-link-underline-opacity, 1)) !important;
+}
+
+.link-body-emphasis {
+  color: RGBA(var(--bs-emphasis-color-rgb), var(--bs-link-opacity, 1)) !important;
+  -webkit-text-decoration-color: RGBA(var(--bs-emphasis-color-rgb), var(--bs-link-underline-opacity, 1)) !important;
+  text-decoration-color: RGBA(var(--bs-emphasis-color-rgb), var(--bs-link-underline-opacity, 1)) !important;
+}
+.link-body-emphasis:hover, .link-body-emphasis:focus {
+  color: RGBA(var(--bs-emphasis-color-rgb), var(--bs-link-opacity, 0.75)) !important;
+  -webkit-text-decoration-color: RGBA(var(--bs-emphasis-color-rgb), var(--bs-link-underline-opacity, 0.75)) !important;
+  text-decoration-color: RGBA(var(--bs-emphasis-color-rgb), var(--bs-link-underline-opacity, 0.75)) !important;
+}
+
+.focus-ring:focus {
+  outline: 0;
+  box-shadow: var(--bs-focus-ring-x, 0) var(--bs-focus-ring-y, 0) var(--bs-focus-ring-blur, 0) var(--bs-focus-ring-width) var(--bs-focus-ring-color);
+}
+
+.icon-link {
+  display: inline-flex;
+  gap: 0.375rem;
+  align-items: center;
+  -webkit-text-decoration-color: rgba(var(--bs-link-color-rgb), var(--bs-link-opacity, 0.5));
+  text-decoration-color: rgba(var(--bs-link-color-rgb), var(--bs-link-opacity, 0.5));
+  text-underline-offset: 0.25em;
+  -webkit-backface-visibility: hidden;
+  backface-visibility: hidden;
+}
+.icon-link > .bi {
+  flex-shrink: 0;
+  width: 1em;
+  height: 1em;
+  fill: currentcolor;
+  transition: 0.2s ease-in-out transform;
+}
+@media (prefers-reduced-motion: reduce) {
+  .icon-link > .bi {
+    transition: none;
+  }
+}
+
+.icon-link-hover:hover > .bi, .icon-link-hover:focus-visible > .bi {
+  transform: var(--bs-icon-link-transform, translate3d(0.25em, 0, 0));
+}
+
+.ratio {
+  position: relative;
+  width: 100%;
+}
+.ratio::before {
+  display: block;
+  padding-top: var(--bs-aspect-ratio);
+  content: "";
+}
+.ratio > * {
+  position: absolute;
+  top: 0;
+  left: 0;
+  width: 100%;
+  height: 100%;
+}
+
+.ratio-1x1 {
+  --bs-aspect-ratio: 100%;
+}
+
+.ratio-4x3 {
+  --bs-aspect-ratio: 75%;
+}
+
+.ratio-16x9 {
+  --bs-aspect-ratio: 56.25%;
+}
+
+.ratio-21x9 {
+  --bs-aspect-ratio: 42.8571428571%;
+}
+
+.fixed-top {
+  position: fixed;
+  top: 0;
+  right: 0;
+  left: 0;
+  z-index: 1030;
+}
+
+.fixed-bottom {
+  position: fixed;
+  right: 0;
+  bottom: 0;
+  left: 0;
+  z-index: 1030;
+}
+
+.sticky-top {
+  position: -webkit-sticky;
+  position: sticky;
+  top: 0;
+  z-index: 1020;
+}
+
+.sticky-bottom {
+  position: -webkit-sticky;
+  position: sticky;
+  bottom: 0;
+  z-index: 1020;
+}
+
+@media (min-width: 576px) {
+  .sticky-sm-top {
+    position: -webkit-sticky;
+    position: sticky;
+    top: 0;
+    z-index: 1020;
+  }
+  .sticky-sm-bottom {
+    position: -webkit-sticky;
+    position: sticky;
+    bottom: 0;
+    z-index: 1020;
+  }
+}
+@media (min-width: 768px) {
+  .sticky-md-top {
+    position: -webkit-sticky;
+    position: sticky;
+    top: 0;
+    z-index: 1020;
+  }
+  .sticky-md-bottom {
+    position: -webkit-sticky;
+    position: sticky;
+    bottom: 0;
+    z-index: 1020;
+  }
+}
+@media (min-width: 992px) {
+  .sticky-lg-top {
+    position: -webkit-sticky;
+    position: sticky;
+    top: 0;
+    z-index: 1020;
+  }
+  .sticky-lg-bottom {
+    position: -webkit-sticky;
+    position: sticky;
+    bottom: 0;
+    z-index: 1020;
+  }
+}
+@media (min-width: 1200px) {
+  .sticky-xl-top {
+    position: -webkit-sticky;
+    position: sticky;
+    top: 0;
+    z-index: 1020;
+  }
+  .sticky-xl-bottom {
+    position: -webkit-sticky;
+    position: sticky;
+    bottom: 0;
+    z-index: 1020;
+  }
+}
+@media (min-width: 1400px) {
+  .sticky-xxl-top {
+    position: -webkit-sticky;
+    position: sticky;
+    top: 0;
+    z-index: 1020;
+  }
+  .sticky-xxl-bottom {
+    position: -webkit-sticky;
+    position: sticky;
+    bottom: 0;
+    z-index: 1020;
+  }
+}
+.hstack {
+  display: flex;
+  flex-direction: row;
+  align-items: center;
+  align-self: stretch;
+}
+
+.vstack {
+  display: flex;
+  flex: 1 1 auto;
+  flex-direction: column;
+  align-self: stretch;
+}
+
+.visually-hidden,
+.visually-hidden-focusable:not(:focus):not(:focus-within) {
+  width: 1px !important;
+  height: 1px !important;
+  padding: 0 !important;
+  margin: -1px !important;
+  overflow: hidden !important;
+  clip: rect(0, 0, 0, 0) !important;
+  white-space: nowrap !important;
+  border: 0 !important;
+}
+.visually-hidden:not(caption),
+.visually-hidden-focusable:not(:focus):not(:focus-within):not(caption) {
+  position: absolute !important;
+}
+
+.stretched-link::after {
+  position: absolute;
+  top: 0;
+  right: 0;
+  bottom: 0;
+  left: 0;
+  z-index: 1;
+  content: "";
+}
+
+.text-truncate {
+  overflow: hidden;
+  text-overflow: ellipsis;
+  white-space: nowrap;
+}
+
+.vr {
+  display: inline-block;
+  align-self: stretch;
+  width: var(--bs-border-width);
+  min-height: 1em;
+  background-color: currentcolor;
+  opacity: 0.25;
+}
+
+.align-baseline {
+  vertical-align: baseline !important;
+}
+
+.align-top {
+  vertical-align: top !important;
+}
+
+.align-middle {
+  vertical-align: middle !important;
+}
+
+.align-bottom {
+  vertical-align: bottom !important;
+}
+
+.align-text-bottom {
+  vertical-align: text-bottom !important;
+}
+
+.align-text-top {
+  vertical-align: text-top !important;
+}
+
+.float-start {
+  float: left !important;
+}
+
+.float-end {
+  float: right !important;
+}
+
+.float-none {
+  float: none !important;
+}
+
+.object-fit-contain {
+  -o-object-fit: contain !important;
+  object-fit: contain !important;
+}
+
+.object-fit-cover {
+  -o-object-fit: cover !important;
+  object-fit: cover !important;
+}
+
+.object-fit-fill {
+  -o-object-fit: fill !important;
+  object-fit: fill !important;
+}
+
+.object-fit-scale {
+  -o-object-fit: scale-down !important;
+  object-fit: scale-down !important;
+}
+
+.object-fit-none {
+  -o-object-fit: none !important;
+  object-fit: none !important;
+}
+
+.opacity-0 {
+  opacity: 0 !important;
+}
+
+.opacity-25 {
+  opacity: 0.25 !important;
+}
+
+.opacity-50 {
+  opacity: 0.5 !important;
+}
+
+.opacity-75 {
+  opacity: 0.75 !important;
+}
+
+.opacity-100 {
+  opacity: 1 !important;
+}
+
+.overflow-auto {
+  overflow: auto !important;
+}
+
+.overflow-hidden {
+  overflow: hidden !important;
+}
+
+.overflow-visible {
+  overflow: visible !important;
+}
+
+.overflow-scroll {
+  overflow: scroll !important;
+}
+
+.overflow-x-auto {
+  overflow-x: auto !important;
+}
+
+.overflow-x-hidden {
+  overflow-x: hidden !important;
+}
+
+.overflow-x-visible {
+  overflow-x: visible !important;
+}
+
+.overflow-x-scroll {
+  overflow-x: scroll !important;
+}
+
+.overflow-y-auto {
+  overflow-y: auto !important;
+}
+
+.overflow-y-hidden {
+  overflow-y: hidden !important;
+}
+
+.overflow-y-visible {
+  overflow-y: visible !important;
+}
+
+.overflow-y-scroll {
+  overflow-y: scroll !important;
+}
+
+.d-inline {
+  display: inline !important;
+}
+
+.d-inline-block {
+  display: inline-block !important;
+}
+
+.d-block {
+  display: block !important;
+}
+
+.d-grid {
+  display: grid !important;
+}
+
+.d-inline-grid {
+  display: inline-grid !important;
+}
+
+.d-table {
+  display: table !important;
+}
+
+.d-table-row {
+  display: table-row !important;
+}
+
+.d-table-cell {
+  display: table-cell !important;
+}
+
+.d-flex {
+  display: flex !important;
+}
+
+.d-inline-flex {
+  display: inline-flex !important;
+}
+
+.d-none {
+  display: none !important;
+}
+
+.shadow {
+  box-shadow: var(--bs-box-shadow) !important;
+}
+
+.shadow-sm {
+  box-shadow: var(--bs-box-shadow-sm) !important;
+}
+
+.shadow-lg {
+  box-shadow: var(--bs-box-shadow-lg) !important;
+}
+
+.shadow-none {
+  box-shadow: none !important;
+}
+
+.focus-ring-primary {
+  --bs-focus-ring-color: rgba(var(--bs-primary-rgb), var(--bs-focus-ring-opacity));
+}
+
+.focus-ring-secondary {
+  --bs-focus-ring-color: rgba(var(--bs-secondary-rgb), var(--bs-focus-ring-opacity));
+}
+
+.focus-ring-success {
+  --bs-focus-ring-color: rgba(var(--bs-success-rgb), var(--bs-focus-ring-opacity));
+}
+
+.focus-ring-info {
+  --bs-focus-ring-color: rgba(var(--bs-info-rgb), var(--bs-focus-ring-opacity));
+}
+
+.focus-ring-warning {
+  --bs-focus-ring-color: rgba(var(--bs-warning-rgb), var(--bs-focus-ring-opacity));
+}
+
+.focus-ring-danger {
+  --bs-focus-ring-color: rgba(var(--bs-danger-rgb), var(--bs-focus-ring-opacity));
+}
+
+.focus-ring-light {
+  --bs-focus-ring-color: rgba(var(--bs-light-rgb), var(--bs-focus-ring-opacity));
+}
+
+.focus-ring-dark {
+  --bs-focus-ring-color: rgba(var(--bs-dark-rgb), var(--bs-focus-ring-opacity));
+}
+
+.position-static {
+  position: static !important;
+}
+
+.position-relative {
+  position: relative !important;
+}
+
+.position-absolute {
+  position: absolute !important;
+}
+
+.position-fixed {
+  position: fixed !important;
+}
+
+.position-sticky {
+  position: -webkit-sticky !important;
+  position: sticky !important;
+}
+
+.top-0 {
+  top: 0 !important;
+}
+
+.top-50 {
+  top: 50% !important;
+}
+
+.top-100 {
+  top: 100% !important;
+}
+
+.bottom-0 {
+  bottom: 0 !important;
+}
+
+.bottom-50 {
+  bottom: 50% !important;
+}
+
+.bottom-100 {
+  bottom: 100% !important;
+}
+
+.start-0 {
+  left: 0 !important;
+}
+
+.start-50 {
+  left: 50% !important;
+}
+
+.start-100 {
+  left: 100% !important;
+}
+
+.end-0 {
+  right: 0 !important;
+}
+
+.end-50 {
+  right: 50% !important;
+}
+
+.end-100 {
+  right: 100% !important;
+}
+
+.translate-middle {
+  transform: translate(-50%, -50%) !important;
+}
+
+.translate-middle-x {
+  transform: translateX(-50%) !important;
+}
+
+.translate-middle-y {
+  transform: translateY(-50%) !important;
+}
+
+.border {
+  border: var(--bs-border-width) var(--bs-border-style) var(--bs-border-color) !important;
+}
+
+.border-0 {
+  border: 0 !important;
+}
+
+.border-top {
+  border-top: var(--bs-border-width) var(--bs-border-style) var(--bs-border-color) !important;
+}
+
+.border-top-0 {
+  border-top: 0 !important;
+}
+
+.border-end {
+  border-right: var(--bs-border-width) var(--bs-border-style) var(--bs-border-color) !important;
+}
+
+.border-end-0 {
+  border-right: 0 !important;
+}
+
+.border-bottom {
+  border-bottom: var(--bs-border-width) var(--bs-border-style) var(--bs-border-color) !important;
+}
+
+.border-bottom-0 {
+  border-bottom: 0 !important;
+}
+
+.border-start {
+  border-left: var(--bs-border-width) var(--bs-border-style) var(--bs-border-color) !important;
+}
+
+.border-start-0 {
+  border-left: 0 !important;
+}
+
+.border-primary {
+  --bs-border-opacity: 1;
+  border-color: rgba(var(--bs-primary-rgb), var(--bs-border-opacity)) !important;
+}
+
+.border-secondary {
+  --bs-border-opacity: 1;
+  border-color: rgba(var(--bs-secondary-rgb), var(--bs-border-opacity)) !important;
+}
+
+.border-success {
+  --bs-border-opacity: 1;
+  border-color: rgba(var(--bs-success-rgb), var(--bs-border-opacity)) !important;
+}
+
+.border-info {
+  --bs-border-opacity: 1;
+  border-color: rgba(var(--bs-info-rgb), var(--bs-border-opacity)) !important;
+}
+
+.border-warning {
+  --bs-border-opacity: 1;
+  border-color: rgba(var(--bs-warning-rgb), var(--bs-border-opacity)) !important;
+}
+
+.border-danger {
+  --bs-border-opacity: 1;
+  border-color: rgba(var(--bs-danger-rgb), var(--bs-border-opacity)) !important;
+}
+
+.border-light {
+  --bs-border-opacity: 1;
+  border-color: rgba(var(--bs-light-rgb), var(--bs-border-opacity)) !important;
+}
+
+.border-dark {
+  --bs-border-opacity: 1;
+  border-color: rgba(var(--bs-dark-rgb), var(--bs-border-opacity)) !important;
+}
+
+.border-black {
+  --bs-border-opacity: 1;
+  border-color: rgba(var(--bs-black-rgb), var(--bs-border-opacity)) !important;
+}
+
+.border-white {
+  --bs-border-opacity: 1;
+  border-color: rgba(var(--bs-white-rgb), var(--bs-border-opacity)) !important;
+}
+
+.border-primary-subtle {
+  border-color: var(--bs-primary-border-subtle) !important;
+}
+
+.border-secondary-subtle {
+  border-color: var(--bs-secondary-border-subtle) !important;
+}
+
+.border-success-subtle {
+  border-color: var(--bs-success-border-subtle) !important;
+}
+
+.border-info-subtle {
+  border-color: var(--bs-info-border-subtle) !important;
+}
+
+.border-warning-subtle {
+  border-color: var(--bs-warning-border-subtle) !important;
+}
+
+.border-danger-subtle {
+  border-color: var(--bs-danger-border-subtle) !important;
+}
+
+.border-light-subtle {
+  border-color: var(--bs-light-border-subtle) !important;
+}
+
+.border-dark-subtle {
+  border-color: var(--bs-dark-border-subtle) !important;
+}
+
+.border-1 {
+  border-width: 1px !important;
+}
+
+.border-2 {
+  border-width: 2px !important;
+}
+
+.border-3 {
+  border-width: 3px !important;
+}
+
+.border-4 {
+  border-width: 4px !important;
+}
+
+.border-5 {
+  border-width: 5px !important;
+}
+
+.border-opacity-10 {
+  --bs-border-opacity: 0.1;
+}
+
+.border-opacity-25 {
+  --bs-border-opacity: 0.25;
+}
+
+.border-opacity-50 {
+  --bs-border-opacity: 0.5;
+}
+
+.border-opacity-75 {
+  --bs-border-opacity: 0.75;
+}
+
+.border-opacity-100 {
+  --bs-border-opacity: 1;
+}
+
+.w-25 {
+  width: 25% !important;
+}
+
+.w-50 {
+  width: 50% !important;
+}
+
+.w-75 {
+  width: 75% !important;
+}
+
+.w-100 {
+  width: 100% !important;
+}
+
+.w-auto {
+  width: auto !important;
+}
+
+.mw-100 {
+  max-width: 100% !important;
+}
+
+.vw-100 {
+  width: 100vw !important;
+}
+
+.min-vw-100 {
+  min-width: 100vw !important;
+}
+
+.h-25 {
+  height: 25% !important;
+}
+
+.h-50 {
+  height: 50% !important;
+}
+
+.h-75 {
+  height: 75% !important;
+}
+
+.h-100 {
+  height: 100% !important;
+}
+
+.h-auto {
+  height: auto !important;
+}
+
+.mh-100 {
+  max-height: 100% !important;
+}
+
+.vh-100 {
+  height: 100vh !important;
+}
+
+.min-vh-100 {
+  min-height: 100vh !important;
+}
+
+.flex-fill {
+  flex: 1 1 auto !important;
+}
+
+.flex-row {
+  flex-direction: row !important;
+}
+
+.flex-column {
+  flex-direction: column !important;
+}
+
+.flex-row-reverse {
+  flex-direction: row-reverse !important;
+}
+
+.flex-column-reverse {
+  flex-direction: column-reverse !important;
+}
+
+.flex-grow-0 {
+  flex-grow: 0 !important;
+}
+
+.flex-grow-1 {
+  flex-grow: 1 !important;
+}
+
+.flex-shrink-0 {
+  flex-shrink: 0 !important;
+}
+
+.flex-shrink-1 {
+  flex-shrink: 1 !important;
+}
+
+.flex-wrap {
+  flex-wrap: wrap !important;
+}
+
+.flex-nowrap {
+  flex-wrap: nowrap !important;
+}
+
+.flex-wrap-reverse {
+  flex-wrap: wrap-reverse !important;
+}
+
+.justify-content-start {
+  justify-content: flex-start !important;
+}
+
+.justify-content-end {
+  justify-content: flex-end !important;
+}
+
+.justify-content-center {
+  justify-content: center !important;
+}
+
+.justify-content-between {
+  justify-content: space-between !important;
+}
+
+.justify-content-around {
+  justify-content: space-around !important;
+}
+
+.justify-content-evenly {
+  justify-content: space-evenly !important;
+}
+
+.align-items-start {
+  align-items: flex-start !important;
+}
+
+.align-items-end {
+  align-items: flex-end !important;
+}
+
+.align-items-center {
+  align-items: center !important;
+}
+
+.align-items-baseline {
+  align-items: baseline !important;
+}
+
+.align-items-stretch {
+  align-items: stretch !important;
+}
+
+.align-content-start {
+  align-content: flex-start !important;
+}
+
+.align-content-end {
+  align-content: flex-end !important;
+}
+
+.align-content-center {
+  align-content: center !important;
+}
+
+.align-content-between {
+  align-content: space-between !important;
+}
+
+.align-content-around {
+  align-content: space-around !important;
+}
+
+.align-content-stretch {
+  align-content: stretch !important;
+}
+
+.align-self-auto {
+  align-self: auto !important;
+}
+
+.align-self-start {
+  align-self: flex-start !important;
+}
+
+.align-self-end {
+  align-self: flex-end !important;
+}
+
+.align-self-center {
+  align-self: center !important;
+}
+
+.align-self-baseline {
+  align-self: baseline !important;
+}
+
+.align-self-stretch {
+  align-self: stretch !important;
+}
+
+.order-first {
+  order: -1 !important;
+}
+
+.order-0 {
+  order: 0 !important;
+}
+
+.order-1 {
+  order: 1 !important;
+}
+
+.order-2 {
+  order: 2 !important;
+}
+
+.order-3 {
+  order: 3 !important;
+}
+
+.order-4 {
+  order: 4 !important;
+}
+
+.order-5 {
+  order: 5 !important;
+}
+
+.order-last {
+  order: 6 !important;
+}
+
+.m-0 {
+  margin: 0 !important;
+}
+
+.m-1 {
+  margin: 0.25rem !important;
+}
+
+.m-2 {
+  margin: 0.5rem !important;
+}
+
+.m-3 {
+  margin: 1rem !important;
+}
+
+.m-4 {
+  margin: 1.5rem !important;
+}
+
+.m-5 {
+  margin: 3rem !important;
+}
+
+.m-auto {
+  margin: auto !important;
+}
+
+.mx-0 {
+  margin-right: 0 !important;
+  margin-left: 0 !important;
+}
+
+.mx-1 {
+  margin-right: 0.25rem !important;
+  margin-left: 0.25rem !important;
+}
+
+.mx-2 {
+  margin-right: 0.5rem !important;
+  margin-left: 0.5rem !important;
+}
+
+.mx-3 {
+  margin-right: 1rem !important;
+  margin-left: 1rem !important;
+}
+
+.mx-4 {
+  margin-right: 1.5rem !important;
+  margin-left: 1.5rem !important;
+}
+
+.mx-5 {
+  margin-right: 3rem !important;
+  margin-left: 3rem !important;
+}
+
+.mx-auto {
+  margin-right: auto !important;
+  margin-left: auto !important;
+}
+
+.my-0 {
+  margin-top: 0 !important;
+  margin-bottom: 0 !important;
+}
+
+.my-1 {
+  margin-top: 0.25rem !important;
+  margin-bottom: 0.25rem !important;
+}
+
+.my-2 {
+  margin-top: 0.5rem !important;
+  margin-bottom: 0.5rem !important;
+}
+
+.my-3 {
+  margin-top: 1rem !important;
+  margin-bottom: 1rem !important;
+}
+
+.my-4 {
+  margin-top: 1.5rem !important;
+  margin-bottom: 1.5rem !important;
+}
+
+.my-5 {
+  margin-top: 3rem !important;
+  margin-bottom: 3rem !important;
+}
+
+.my-auto {
+  margin-top: auto !important;
+  margin-bottom: auto !important;
+}
+
+.mt-0 {
+  margin-top: 0 !important;
+}
+
+.mt-1 {
+  margin-top: 0.25rem !important;
+}
+
+.mt-2 {
+  margin-top: 0.5rem !important;
+}
+
+.mt-3 {
+  margin-top: 1rem !important;
+}
+
+.mt-4 {
+  margin-top: 1.5rem !important;
+}
+
+.mt-5 {
+  margin-top: 3rem !important;
+}
+
+.mt-auto {
+  margin-top: auto !important;
+}
+
+.me-0 {
+  margin-right: 0 !important;
+}
+
+.me-1 {
+  margin-right: 0.25rem !important;
+}
+
+.me-2 {
+  margin-right: 0.5rem !important;
+}
+
+.me-3 {
+  margin-right: 1rem !important;
+}
+
+.me-4 {
+  margin-right: 1.5rem !important;
+}
+
+.me-5 {
+  margin-right: 3rem !important;
+}
+
+.me-auto {
+  margin-right: auto !important;
+}
+
+.mb-0 {
+  margin-bottom: 0 !important;
+}
+
+.mb-1 {
+  margin-bottom: 0.25rem !important;
+}
+
+.mb-2 {
+  margin-bottom: 0.5rem !important;
+}
+
+.mb-3 {
+  margin-bottom: 1rem !important;
+}
+
+.mb-4 {
+  margin-bottom: 1.5rem !important;
+}
+
+.mb-5 {
+  margin-bottom: 3rem !important;
+}
+
+.mb-auto {
+  margin-bottom: auto !important;
+}
+
+.ms-0 {
+  margin-left: 0 !important;
+}
+
+.ms-1 {
+  margin-left: 0.25rem !important;
+}
+
+.ms-2 {
+  margin-left: 0.5rem !important;
+}
+
+.ms-3 {
+  margin-left: 1rem !important;
+}
+
+.ms-4 {
+  margin-left: 1.5rem !important;
+}
+
+.ms-5 {
+  margin-left: 3rem !important;
+}
+
+.ms-auto {
+  margin-left: auto !important;
+}
+
+.p-0 {
+  padding: 0 !important;
+}
+
+.p-1 {
+  padding: 0.25rem !important;
+}
+
+.p-2 {
+  padding: 0.5rem !important;
+}
+
+.p-3 {
+  padding: 1rem !important;
+}
+
+.p-4 {
+  padding: 1.5rem !important;
+}
+
+.p-5 {
+  padding: 3rem !important;
+}
+
+.px-0 {
+  padding-right: 0 !important;
+  padding-left: 0 !important;
+}
+
+.px-1 {
+  padding-right: 0.25rem !important;
+  padding-left: 0.25rem !important;
+}
+
+.px-2 {
+  padding-right: 0.5rem !important;
+  padding-left: 0.5rem !important;
+}
+
+.px-3 {
+  padding-right: 1rem !important;
+  padding-left: 1rem !important;
+}
+
+.px-4 {
+  padding-right: 1.5rem !important;
+  padding-left: 1.5rem !important;
+}
+
+.px-5 {
+  padding-right: 3rem !important;
+  padding-left: 3rem !important;
+}
+
+.py-0 {
+  padding-top: 0 !important;
+  padding-bottom: 0 !important;
+}
+
+.py-1 {
+  padding-top: 0.25rem !important;
+  padding-bottom: 0.25rem !important;
+}
+
+.py-2 {
+  padding-top: 0.5rem !important;
+  padding-bottom: 0.5rem !important;
+}
+
+.py-3 {
+  padding-top: 1rem !important;
+  padding-bottom: 1rem !important;
+}
+
+.py-4 {
+  padding-top: 1.5rem !important;
+  padding-bottom: 1.5rem !important;
+}
+
+.py-5 {
+  padding-top: 3rem !important;
+  padding-bottom: 3rem !important;
+}
+
+.pt-0 {
+  padding-top: 0 !important;
+}
+
+.pt-1 {
+  padding-top: 0.25rem !important;
+}
+
+.pt-2 {
+  padding-top: 0.5rem !important;
+}
+
+.pt-3 {
+  padding-top: 1rem !important;
+}
+
+.pt-4 {
+  padding-top: 1.5rem !important;
+}
+
+.pt-5 {
+  padding-top: 3rem !important;
+}
+
+.pe-0 {
+  padding-right: 0 !important;
+}
+
+.pe-1 {
+  padding-right: 0.25rem !important;
+}
+
+.pe-2 {
+  padding-right: 0.5rem !important;
+}
+
+.pe-3 {
+  padding-right: 1rem !important;
+}
+
+.pe-4 {
+  padding-right: 1.5rem !important;
+}
+
+.pe-5 {
+  padding-right: 3rem !important;
+}
+
+.pb-0 {
+  padding-bottom: 0 !important;
+}
+
+.pb-1 {
+  padding-bottom: 0.25rem !important;
+}
+
+.pb-2 {
+  padding-bottom: 0.5rem !important;
+}
+
+.pb-3 {
+  padding-bottom: 1rem !important;
+}
+
+.pb-4 {
+  padding-bottom: 1.5rem !important;
+}
+
+.pb-5 {
+  padding-bottom: 3rem !important;
+}
+
+.ps-0 {
+  padding-left: 0 !important;
+}
+
+.ps-1 {
+  padding-left: 0.25rem !important;
+}
+
+.ps-2 {
+  padding-left: 0.5rem !important;
+}
+
+.ps-3 {
+  padding-left: 1rem !important;
+}
+
+.ps-4 {
+  padding-left: 1.5rem !important;
+}
+
+.ps-5 {
+  padding-left: 3rem !important;
+}
+
+.gap-0 {
+  gap: 0 !important;
+}
+
+.gap-1 {
+  gap: 0.25rem !important;
+}
+
+.gap-2 {
+  gap: 0.5rem !important;
+}
+
+.gap-3 {
+  gap: 1rem !important;
+}
+
+.gap-4 {
+  gap: 1.5rem !important;
+}
+
+.gap-5 {
+  gap: 3rem !important;
+}
+
+.row-gap-0 {
+  row-gap: 0 !important;
+}
+
+.row-gap-1 {
+  row-gap: 0.25rem !important;
+}
+
+.row-gap-2 {
+  row-gap: 0.5rem !important;
+}
+
+.row-gap-3 {
+  row-gap: 1rem !important;
+}
+
+.row-gap-4 {
+  row-gap: 1.5rem !important;
+}
+
+.row-gap-5 {
+  row-gap: 3rem !important;
+}
+
+.column-gap-0 {
+  -moz-column-gap: 0 !important;
+  column-gap: 0 !important;
+}
+
+.column-gap-1 {
+  -moz-column-gap: 0.25rem !important;
+  column-gap: 0.25rem !important;
+}
+
+.column-gap-2 {
+  -moz-column-gap: 0.5rem !important;
+  column-gap: 0.5rem !important;
+}
+
+.column-gap-3 {
+  -moz-column-gap: 1rem !important;
+  column-gap: 1rem !important;
+}
+
+.column-gap-4 {
+  -moz-column-gap: 1.5rem !important;
+  column-gap: 1.5rem !important;
+}
+
+.column-gap-5 {
+  -moz-column-gap: 3rem !important;
+  column-gap: 3rem !important;
+}
+
+.font-monospace {
+  font-family: var(--bs-font-monospace) !important;
+}
+
+.fs-1 {
+  font-size: calc(1.375rem + 1.5vw) !important;
+}
+
+.fs-2 {
+  font-size: calc(1.325rem + 0.9vw) !important;
+}
+
+.fs-3 {
+  font-size: calc(1.3rem + 0.6vw) !important;
+}
+
+.fs-4 {
+  font-size: calc(1.275rem + 0.3vw) !important;
+}
+
+.fs-5 {
+  font-size: 1.25rem !important;
+}
+
+.fs-6 {
+  font-size: 1rem !important;
+}
+
+.fst-italic {
+  font-style: italic !important;
+}
+
+.fst-normal {
+  font-style: normal !important;
+}
+
+.fw-lighter {
+  font-weight: lighter !important;
+}
+
+.fw-light {
+  font-weight: 300 !important;
+}
+
+.fw-normal {
+  font-weight: 400 !important;
+}
+
+.fw-medium {
+  font-weight: 500 !important;
+}
+
+.fw-semibold {
+  font-weight: 600 !important;
+}
+
+.fw-bold {
+  font-weight: 700 !important;
+}
+
+.fw-bolder {
+  font-weight: bolder !important;
+}
+
+.lh-1 {
+  line-height: 1 !important;
+}
+
+.lh-sm {
+  line-height: 1.25 !important;
+}
+
+.lh-base {
+  line-height: 1.5 !important;
+}
+
+.lh-lg {
+  line-height: 2 !important;
+}
+
+.text-start {
+  text-align: left !important;
+}
+
+.text-end {
+  text-align: right !important;
+}
+
+.text-center {
+  text-align: center !important;
+}
+
+.text-decoration-none {
+  text-decoration: none !important;
+}
+
+.text-decoration-underline {
+  text-decoration: underline !important;
+}
+
+.text-decoration-line-through {
+  text-decoration: line-through !important;
+}
+
+.text-lowercase {
+  text-transform: lowercase !important;
+}
+
+.text-uppercase {
+  text-transform: uppercase !important;
+}
+
+.text-capitalize {
+  text-transform: capitalize !important;
+}
+
+.text-wrap {
+  white-space: normal !important;
+}
+
+.text-nowrap {
+  white-space: nowrap !important;
+}
+
+/* rtl:begin:remove */
+.text-break {
+  word-wrap: break-word !important;
+  word-break: break-word !important;
+}
+
+/* rtl:end:remove */
+.text-primary {
+  --bs-text-opacity: 1;
+  color: rgba(var(--bs-primary-rgb), var(--bs-text-opacity)) !important;
+}
+
+.text-secondary {
+  --bs-text-opacity: 1;
+  color: rgba(var(--bs-secondary-rgb), var(--bs-text-opacity)) !important;
+}
+
+.text-success {
+  --bs-text-opacity: 1;
+  color: rgba(var(--bs-success-rgb), var(--bs-text-opacity)) !important;
+}
+
+.text-info {
+  --bs-text-opacity: 1;
+  color: rgba(var(--bs-info-rgb), var(--bs-text-opacity)) !important;
+}
+
+.text-warning {
+  --bs-text-opacity: 1;
+  color: rgba(var(--bs-warning-rgb), var(--bs-text-opacity)) !important;
+}
+
+.text-danger {
+  --bs-text-opacity: 1;
+  color: rgba(var(--bs-danger-rgb), var(--bs-text-opacity)) !important;
+}
+
+.text-light {
+  --bs-text-opacity: 1;
+  color: rgba(var(--bs-light-rgb), var(--bs-text-opacity)) !important;
+}
+
+.text-dark {
+  --bs-text-opacity: 1;
+  color: rgba(var(--bs-dark-rgb), var(--bs-text-opacity)) !important;
+}
+
+.text-black {
+  --bs-text-opacity: 1;
+  color: rgba(var(--bs-black-rgb), var(--bs-text-opacity)) !important;
+}
+
+.text-white {
+  --bs-text-opacity: 1;
+  color: rgba(var(--bs-white-rgb), var(--bs-text-opacity)) !important;
+}
+
+.text-body {
+  --bs-text-opacity: 1;
+  color: rgba(var(--bs-body-color-rgb), var(--bs-text-opacity)) !important;
+}
+
+.text-muted {
+  --bs-text-opacity: 1;
+  color: var(--bs-secondary-color) !important;
+}
+
+.text-black-50 {
+  --bs-text-opacity: 1;
+  color: rgba(0, 0, 0, 0.5) !important;
+}
+
+.text-white-50 {
+  --bs-text-opacity: 1;
+  color: rgba(255, 255, 255, 0.5) !important;
+}
+
+.text-body-secondary {
+  --bs-text-opacity: 1;
+  color: var(--bs-secondary-color) !important;
+}
+
+.text-body-tertiary {
+  --bs-text-opacity: 1;
+  color: var(--bs-tertiary-color) !important;
+}
+
+.text-body-emphasis {
+  --bs-text-opacity: 1;
+  color: var(--bs-emphasis-color) !important;
+}
+
+.text-reset {
+  --bs-text-opacity: 1;
+  color: inherit !important;
+}
+
+.text-opacity-25 {
+  --bs-text-opacity: 0.25;
+}
+
+.text-opacity-50 {
+  --bs-text-opacity: 0.5;
+}
+
+.text-opacity-75 {
+  --bs-text-opacity: 0.75;
+}
+
+.text-opacity-100 {
+  --bs-text-opacity: 1;
+}
+
+.text-primary-emphasis {
+  color: var(--bs-primary-text-emphasis) !important;
+}
+
+.text-secondary-emphasis {
+  color: var(--bs-secondary-text-emphasis) !important;
+}
+
+.text-success-emphasis {
+  color: var(--bs-success-text-emphasis) !important;
+}
+
+.text-info-emphasis {
+  color: var(--bs-info-text-emphasis) !important;
+}
+
+.text-warning-emphasis {
+  color: var(--bs-warning-text-emphasis) !important;
+}
+
+.text-danger-emphasis {
+  color: var(--bs-danger-text-emphasis) !important;
+}
+
+.text-light-emphasis {
+  color: var(--bs-light-text-emphasis) !important;
+}
+
+.text-dark-emphasis {
+  color: var(--bs-dark-text-emphasis) !important;
+}
+
+.link-opacity-10 {
+  --bs-link-opacity: 0.1;
+}
+
+.link-opacity-10-hover:hover {
+  --bs-link-opacity: 0.1;
+}
+
+.link-opacity-25 {
+  --bs-link-opacity: 0.25;
+}
+
+.link-opacity-25-hover:hover {
+  --bs-link-opacity: 0.25;
+}
+
+.link-opacity-50 {
+  --bs-link-opacity: 0.5;
+}
+
+.link-opacity-50-hover:hover {
+  --bs-link-opacity: 0.5;
+}
+
+.link-opacity-75 {
+  --bs-link-opacity: 0.75;
+}
+
+.link-opacity-75-hover:hover {
+  --bs-link-opacity: 0.75;
+}
+
+.link-opacity-100 {
+  --bs-link-opacity: 1;
+}
+
+.link-opacity-100-hover:hover {
+  --bs-link-opacity: 1;
+}
+
+.link-offset-1 {
+  text-underline-offset: 0.125em !important;
+}
+
+.link-offset-1-hover:hover {
+  text-underline-offset: 0.125em !important;
+}
+
+.link-offset-2 {
+  text-underline-offset: 0.25em !important;
+}
+
+.link-offset-2-hover:hover {
+  text-underline-offset: 0.25em !important;
+}
+
+.link-offset-3 {
+  text-underline-offset: 0.375em !important;
+}
+
+.link-offset-3-hover:hover {
+  text-underline-offset: 0.375em !important;
+}
+
+.link-underline-primary {
+  --bs-link-underline-opacity: 1;
+  -webkit-text-decoration-color: rgba(var(--bs-primary-rgb), var(--bs-link-underline-opacity)) !important;
+  text-decoration-color: rgba(var(--bs-primary-rgb), var(--bs-link-underline-opacity)) !important;
+}
+
+.link-underline-secondary {
+  --bs-link-underline-opacity: 1;
+  -webkit-text-decoration-color: rgba(var(--bs-secondary-rgb), var(--bs-link-underline-opacity)) !important;
+  text-decoration-color: rgba(var(--bs-secondary-rgb), var(--bs-link-underline-opacity)) !important;
+}
+
+.link-underline-success {
+  --bs-link-underline-opacity: 1;
+  -webkit-text-decoration-color: rgba(var(--bs-success-rgb), var(--bs-link-underline-opacity)) !important;
+  text-decoration-color: rgba(var(--bs-success-rgb), var(--bs-link-underline-opacity)) !important;
+}
+
+.link-underline-info {
+  --bs-link-underline-opacity: 1;
+  -webkit-text-decoration-color: rgba(var(--bs-info-rgb), var(--bs-link-underline-opacity)) !important;
+  text-decoration-color: rgba(var(--bs-info-rgb), var(--bs-link-underline-opacity)) !important;
+}
+
+.link-underline-warning {
+  --bs-link-underline-opacity: 1;
+  -webkit-text-decoration-color: rgba(var(--bs-warning-rgb), var(--bs-link-underline-opacity)) !important;
+  text-decoration-color: rgba(var(--bs-warning-rgb), var(--bs-link-underline-opacity)) !important;
+}
+
+.link-underline-danger {
+  --bs-link-underline-opacity: 1;
+  -webkit-text-decoration-color: rgba(var(--bs-danger-rgb), var(--bs-link-underline-opacity)) !important;
+  text-decoration-color: rgba(var(--bs-danger-rgb), var(--bs-link-underline-opacity)) !important;
+}
+
+.link-underline-light {
+  --bs-link-underline-opacity: 1;
+  -webkit-text-decoration-color: rgba(var(--bs-light-rgb), var(--bs-link-underline-opacity)) !important;
+  text-decoration-color: rgba(var(--bs-light-rgb), var(--bs-link-underline-opacity)) !important;
+}
+
+.link-underline-dark {
+  --bs-link-underline-opacity: 1;
+  -webkit-text-decoration-color: rgba(var(--bs-dark-rgb), var(--bs-link-underline-opacity)) !important;
+  text-decoration-color: rgba(var(--bs-dark-rgb), var(--bs-link-underline-opacity)) !important;
+}
+
+.link-underline {
+  --bs-link-underline-opacity: 1;
+  -webkit-text-decoration-color: rgba(var(--bs-link-color-rgb), var(--bs-link-underline-opacity, 1)) !important;
+  text-decoration-color: rgba(var(--bs-link-color-rgb), var(--bs-link-underline-opacity, 1)) !important;
+}
+
+.link-underline-opacity-0 {
+  --bs-link-underline-opacity: 0;
+}
+
+.link-underline-opacity-0-hover:hover {
+  --bs-link-underline-opacity: 0;
+}
+
+.link-underline-opacity-10 {
+  --bs-link-underline-opacity: 0.1;
+}
+
+.link-underline-opacity-10-hover:hover {
+  --bs-link-underline-opacity: 0.1;
+}
+
+.link-underline-opacity-25 {
+  --bs-link-underline-opacity: 0.25;
+}
+
+.link-underline-opacity-25-hover:hover {
+  --bs-link-underline-opacity: 0.25;
+}
+
+.link-underline-opacity-50 {
+  --bs-link-underline-opacity: 0.5;
+}
+
+.link-underline-opacity-50-hover:hover {
+  --bs-link-underline-opacity: 0.5;
+}
+
+.link-underline-opacity-75 {
+  --bs-link-underline-opacity: 0.75;
+}
+
+.link-underline-opacity-75-hover:hover {
+  --bs-link-underline-opacity: 0.75;
+}
+
+.link-underline-opacity-100 {
+  --bs-link-underline-opacity: 1;
+}
+
+.link-underline-opacity-100-hover:hover {
+  --bs-link-underline-opacity: 1;
+}
+
+.bg-primary {
+  --bs-bg-opacity: 1;
+  background-color: rgba(var(--bs-primary-rgb), var(--bs-bg-opacity)) !important;
+}
+
+.bg-secondary {
+  --bs-bg-opacity: 1;
+  background-color: rgba(var(--bs-secondary-rgb), var(--bs-bg-opacity)) !important;
+}
+
+.bg-success {
+  --bs-bg-opacity: 1;
+  background-color: rgba(var(--bs-success-rgb), var(--bs-bg-opacity)) !important;
+}
+
+.bg-info {
+  --bs-bg-opacity: 1;
+  background-color: rgba(var(--bs-info-rgb), var(--bs-bg-opacity)) !important;
+}
+
+.bg-warning {
+  --bs-bg-opacity: 1;
+  background-color: rgba(var(--bs-warning-rgb), var(--bs-bg-opacity)) !important;
+}
+
+.bg-danger {
+  --bs-bg-opacity: 1;
+  background-color: rgba(var(--bs-danger-rgb), var(--bs-bg-opacity)) !important;
+}
+
+.bg-light {
+  --bs-bg-opacity: 1;
+  background-color: rgba(var(--bs-light-rgb), var(--bs-bg-opacity)) !important;
+}
+
+.bg-dark {
+  --bs-bg-opacity: 1;
+  background-color: rgba(var(--bs-dark-rgb), var(--bs-bg-opacity)) !important;
+}
+
+.bg-black {
+  --bs-bg-opacity: 1;
+  background-color: rgba(var(--bs-black-rgb), var(--bs-bg-opacity)) !important;
+}
+
+.bg-white {
+  --bs-bg-opacity: 1;
+  background-color: rgba(var(--bs-white-rgb), var(--bs-bg-opacity)) !important;
+}
+
+.bg-body {
+  --bs-bg-opacity: 1;
+  background-color: rgba(var(--bs-body-bg-rgb), var(--bs-bg-opacity)) !important;
+}
+
+.bg-transparent {
+  --bs-bg-opacity: 1;
+  background-color: transparent !important;
+}
+
+.bg-body-secondary {
+  --bs-bg-opacity: 1;
+  background-color: rgba(var(--bs-secondary-bg-rgb), var(--bs-bg-opacity)) !important;
+}
+
+.bg-body-tertiary {
+  --bs-bg-opacity: 1;
+  background-color: rgba(var(--bs-tertiary-bg-rgb), var(--bs-bg-opacity)) !important;
+}
+
+.bg-opacity-10 {
+  --bs-bg-opacity: 0.1;
+}
+
+.bg-opacity-25 {
+  --bs-bg-opacity: 0.25;
+}
+
+.bg-opacity-50 {
+  --bs-bg-opacity: 0.5;
+}
+
+.bg-opacity-75 {
+  --bs-bg-opacity: 0.75;
+}
+
+.bg-opacity-100 {
+  --bs-bg-opacity: 1;
+}
+
+.bg-primary-subtle {
+  background-color: var(--bs-primary-bg-subtle) !important;
+}
+
+.bg-secondary-subtle {
+  background-color: var(--bs-secondary-bg-subtle) !important;
+}
+
+.bg-success-subtle {
+  background-color: var(--bs-success-bg-subtle) !important;
+}
+
+.bg-info-subtle {
+  background-color: var(--bs-info-bg-subtle) !important;
+}
+
+.bg-warning-subtle {
+  background-color: var(--bs-warning-bg-subtle) !important;
+}
+
+.bg-danger-subtle {
+  background-color: var(--bs-danger-bg-subtle) !important;
+}
+
+.bg-light-subtle {
+  background-color: var(--bs-light-bg-subtle) !important;
+}
+
+.bg-dark-subtle {
+  background-color: var(--bs-dark-bg-subtle) !important;
+}
+
+.bg-gradient {
+  background-image: var(--bs-gradient) !important;
+}
+
+.user-select-all {
+  -webkit-user-select: all !important;
+  -moz-user-select: all !important;
+  user-select: all !important;
+}
+
+.user-select-auto {
+  -webkit-user-select: auto !important;
+  -moz-user-select: auto !important;
+  user-select: auto !important;
+}
+
+.user-select-none {
+  -webkit-user-select: none !important;
+  -moz-user-select: none !important;
+  user-select: none !important;
+}
+
+.pe-none {
+  pointer-events: none !important;
+}
+
+.pe-auto {
+  pointer-events: auto !important;
+}
+
+.rounded {
+  border-radius: var(--bs-border-radius) !important;
+}
+
+.rounded-0 {
+  border-radius: 0 !important;
+}
+
+.rounded-1 {
+  border-radius: var(--bs-border-radius-sm) !important;
+}
+
+.rounded-2 {
+  border-radius: var(--bs-border-radius) !important;
+}
+
+.rounded-3 {
+  border-radius: var(--bs-border-radius-lg) !important;
+}
+
+.rounded-4 {
+  border-radius: var(--bs-border-radius-xl) !important;
+}
+
+.rounded-5 {
+  border-radius: var(--bs-border-radius-xxl) !important;
+}
+
+.rounded-circle {
+  border-radius: 50% !important;
+}
+
+.rounded-pill {
+  border-radius: var(--bs-border-radius-pill) !important;
+}
+
+.rounded-top {
+  border-top-left-radius: var(--bs-border-radius) !important;
+  border-top-right-radius: var(--bs-border-radius) !important;
+}
+
+.rounded-top-0 {
+  border-top-left-radius: 0 !important;
+  border-top-right-radius: 0 !important;
+}
+
+.rounded-top-1 {
+  border-top-left-radius: var(--bs-border-radius-sm) !important;
+  border-top-right-radius: var(--bs-border-radius-sm) !important;
+}
+
+.rounded-top-2 {
+  border-top-left-radius: var(--bs-border-radius) !important;
+  border-top-right-radius: var(--bs-border-radius) !important;
+}
+
+.rounded-top-3 {
+  border-top-left-radius: var(--bs-border-radius-lg) !important;
+  border-top-right-radius: var(--bs-border-radius-lg) !important;
+}
+
+.rounded-top-4 {
+  border-top-left-radius: var(--bs-border-radius-xl) !important;
+  border-top-right-radius: var(--bs-border-radius-xl) !important;
+}
+
+.rounded-top-5 {
+  border-top-left-radius: var(--bs-border-radius-xxl) !important;
+  border-top-right-radius: var(--bs-border-radius-xxl) !important;
+}
+
+.rounded-top-circle {
+  border-top-left-radius: 50% !important;
+  border-top-right-radius: 50% !important;
+}
+
+.rounded-top-pill {
+  border-top-left-radius: var(--bs-border-radius-pill) !important;
+  border-top-right-radius: var(--bs-border-radius-pill) !important;
+}
+
+.rounded-end {
+  border-top-right-radius: var(--bs-border-radius) !important;
+  border-bottom-right-radius: var(--bs-border-radius) !important;
+}
+
+.rounded-end-0 {
+  border-top-right-radius: 0 !important;
+  border-bottom-right-radius: 0 !important;
+}
+
+.rounded-end-1 {
+  border-top-right-radius: var(--bs-border-radius-sm) !important;
+  border-bottom-right-radius: var(--bs-border-radius-sm) !important;
+}
+
+.rounded-end-2 {
+  border-top-right-radius: var(--bs-border-radius) !important;
+  border-bottom-right-radius: var(--bs-border-radius) !important;
+}
+
+.rounded-end-3 {
+  border-top-right-radius: var(--bs-border-radius-lg) !important;
+  border-bottom-right-radius: var(--bs-border-radius-lg) !important;
+}
+
+.rounded-end-4 {
+  border-top-right-radius: var(--bs-border-radius-xl) !important;
+  border-bottom-right-radius: var(--bs-border-radius-xl) !important;
+}
+
+.rounded-end-5 {
+  border-top-right-radius: var(--bs-border-radius-xxl) !important;
+  border-bottom-right-radius: var(--bs-border-radius-xxl) !important;
+}
+
+.rounded-end-circle {
+  border-top-right-radius: 50% !important;
+  border-bottom-right-radius: 50% !important;
+}
+
+.rounded-end-pill {
+  border-top-right-radius: var(--bs-border-radius-pill) !important;
+  border-bottom-right-radius: var(--bs-border-radius-pill) !important;
+}
+
+.rounded-bottom {
+  border-bottom-right-radius: var(--bs-border-radius) !important;
+  border-bottom-left-radius: var(--bs-border-radius) !important;
+}
+
+.rounded-bottom-0 {
+  border-bottom-right-radius: 0 !important;
+  border-bottom-left-radius: 0 !important;
+}
+
+.rounded-bottom-1 {
+  border-bottom-right-radius: var(--bs-border-radius-sm) !important;
+  border-bottom-left-radius: var(--bs-border-radius-sm) !important;
+}
+
+.rounded-bottom-2 {
+  border-bottom-right-radius: var(--bs-border-radius) !important;
+  border-bottom-left-radius: var(--bs-border-radius) !important;
+}
+
+.rounded-bottom-3 {
+  border-bottom-right-radius: var(--bs-border-radius-lg) !important;
+  border-bottom-left-radius: var(--bs-border-radius-lg) !important;
+}
+
+.rounded-bottom-4 {
+  border-bottom-right-radius: var(--bs-border-radius-xl) !important;
+  border-bottom-left-radius: var(--bs-border-radius-xl) !important;
+}
+
+.rounded-bottom-5 {
+  border-bottom-right-radius: var(--bs-border-radius-xxl) !important;
+  border-bottom-left-radius: var(--bs-border-radius-xxl) !important;
+}
+
+.rounded-bottom-circle {
+  border-bottom-right-radius: 50% !important;
+  border-bottom-left-radius: 50% !important;
+}
+
+.rounded-bottom-pill {
+  border-bottom-right-radius: var(--bs-border-radius-pill) !important;
+  border-bottom-left-radius: var(--bs-border-radius-pill) !important;
+}
+
+.rounded-start {
+  border-bottom-left-radius: var(--bs-border-radius) !important;
+  border-top-left-radius: var(--bs-border-radius) !important;
+}
+
+.rounded-start-0 {
+  border-bottom-left-radius: 0 !important;
+  border-top-left-radius: 0 !important;
+}
+
+.rounded-start-1 {
+  border-bottom-left-radius: var(--bs-border-radius-sm) !important;
+  border-top-left-radius: var(--bs-border-radius-sm) !important;
+}
+
+.rounded-start-2 {
+  border-bottom-left-radius: var(--bs-border-radius) !important;
+  border-top-left-radius: var(--bs-border-radius) !important;
+}
+
+.rounded-start-3 {
+  border-bottom-left-radius: var(--bs-border-radius-lg) !important;
+  border-top-left-radius: var(--bs-border-radius-lg) !important;
+}
+
+.rounded-start-4 {
+  border-bottom-left-radius: var(--bs-border-radius-xl) !important;
+  border-top-left-radius: var(--bs-border-radius-xl) !important;
+}
+
+.rounded-start-5 {
+  border-bottom-left-radius: var(--bs-border-radius-xxl) !important;
+  border-top-left-radius: var(--bs-border-radius-xxl) !important;
+}
+
+.rounded-start-circle {
+  border-bottom-left-radius: 50% !important;
+  border-top-left-radius: 50% !important;
+}
+
+.rounded-start-pill {
+  border-bottom-left-radius: var(--bs-border-radius-pill) !important;
+  border-top-left-radius: var(--bs-border-radius-pill) !important;
+}
+
+.visible {
+  visibility: visible !important;
+}
+
+.invisible {
+  visibility: hidden !important;
+}
+
+.z-n1 {
+  z-index: -1 !important;
+}
+
+.z-0 {
+  z-index: 0 !important;
+}
+
+.z-1 {
+  z-index: 1 !important;
+}
+
+.z-2 {
+  z-index: 2 !important;
+}
+
+.z-3 {
+  z-index: 3 !important;
+}
+
+@media (min-width: 576px) {
+  .float-sm-start {
+    float: left !important;
+  }
+  .float-sm-end {
+    float: right !important;
+  }
+  .float-sm-none {
+    float: none !important;
+  }
+  .object-fit-sm-contain {
+    -o-object-fit: contain !important;
+    object-fit: contain !important;
+  }
+  .object-fit-sm-cover {
+    -o-object-fit: cover !important;
+    object-fit: cover !important;
+  }
+  .object-fit-sm-fill {
+    -o-object-fit: fill !important;
+    object-fit: fill !important;
+  }
+  .object-fit-sm-scale {
+    -o-object-fit: scale-down !important;
+    object-fit: scale-down !important;
+  }
+  .object-fit-sm-none {
+    -o-object-fit: none !important;
+    object-fit: none !important;
+  }
+  .d-sm-inline {
+    display: inline !important;
+  }
+  .d-sm-inline-block {
+    display: inline-block !important;
+  }
+  .d-sm-block {
+    display: block !important;
+  }
+  .d-sm-grid {
+    display: grid !important;
+  }
+  .d-sm-inline-grid {
+    display: inline-grid !important;
+  }
+  .d-sm-table {
+    display: table !important;
+  }
+  .d-sm-table-row {
+    display: table-row !important;
+  }
+  .d-sm-table-cell {
+    display: table-cell !important;
+  }
+  .d-sm-flex {
+    display: flex !important;
+  }
+  .d-sm-inline-flex {
+    display: inline-flex !important;
+  }
+  .d-sm-none {
+    display: none !important;
+  }
+  .flex-sm-fill {
+    flex: 1 1 auto !important;
+  }
+  .flex-sm-row {
+    flex-direction: row !important;
+  }
+  .flex-sm-column {
+    flex-direction: column !important;
+  }
+  .flex-sm-row-reverse {
+    flex-direction: row-reverse !important;
+  }
+  .flex-sm-column-reverse {
+    flex-direction: column-reverse !important;
+  }
+  .flex-sm-grow-0 {
+    flex-grow: 0 !important;
+  }
+  .flex-sm-grow-1 {
+    flex-grow: 1 !important;
+  }
+  .flex-sm-shrink-0 {
+    flex-shrink: 0 !important;
+  }
+  .flex-sm-shrink-1 {
+    flex-shrink: 1 !important;
+  }
+  .flex-sm-wrap {
+    flex-wrap: wrap !important;
+  }
+  .flex-sm-nowrap {
+    flex-wrap: nowrap !important;
+  }
+  .flex-sm-wrap-reverse {
+    flex-wrap: wrap-reverse !important;
+  }
+  .justify-content-sm-start {
+    justify-content: flex-start !important;
+  }
+  .justify-content-sm-end {
+    justify-content: flex-end !important;
+  }
+  .justify-content-sm-center {
+    justify-content: center !important;
+  }
+  .justify-content-sm-between {
+    justify-content: space-between !important;
+  }
+  .justify-content-sm-around {
+    justify-content: space-around !important;
+  }
+  .justify-content-sm-evenly {
+    justify-content: space-evenly !important;
+  }
+  .align-items-sm-start {
+    align-items: flex-start !important;
+  }
+  .align-items-sm-end {
+    align-items: flex-end !important;
+  }
+  .align-items-sm-center {
+    align-items: center !important;
+  }
+  .align-items-sm-baseline {
+    align-items: baseline !important;
+  }
+  .align-items-sm-stretch {
+    align-items: stretch !important;
+  }
+  .align-content-sm-start {
+    align-content: flex-start !important;
+  }
+  .align-content-sm-end {
+    align-content: flex-end !important;
+  }
+  .align-content-sm-center {
+    align-content: center !important;
+  }
+  .align-content-sm-between {
+    align-content: space-between !important;
+  }
+  .align-content-sm-around {
+    align-content: space-around !important;
+  }
+  .align-content-sm-stretch {
+    align-content: stretch !important;
+  }
+  .align-self-sm-auto {
+    align-self: auto !important;
+  }
+  .align-self-sm-start {
+    align-self: flex-start !important;
+  }
+  .align-self-sm-end {
+    align-self: flex-end !important;
+  }
+  .align-self-sm-center {
+    align-self: center !important;
+  }
+  .align-self-sm-baseline {
+    align-self: baseline !important;
+  }
+  .align-self-sm-stretch {
+    align-self: stretch !important;
+  }
+  .order-sm-first {
+    order: -1 !important;
+  }
+  .order-sm-0 {
+    order: 0 !important;
+  }
+  .order-sm-1 {
+    order: 1 !important;
+  }
+  .order-sm-2 {
+    order: 2 !important;
+  }
+  .order-sm-3 {
+    order: 3 !important;
+  }
+  .order-sm-4 {
+    order: 4 !important;
+  }
+  .order-sm-5 {
+    order: 5 !important;
+  }
+  .order-sm-last {
+    order: 6 !important;
+  }
+  .m-sm-0 {
+    margin: 0 !important;
+  }
+  .m-sm-1 {
+    margin: 0.25rem !important;
+  }
+  .m-sm-2 {
+    margin: 0.5rem !important;
+  }
+  .m-sm-3 {
+    margin: 1rem !important;
+  }
+  .m-sm-4 {
+    margin: 1.5rem !important;
+  }
+  .m-sm-5 {
+    margin: 3rem !important;
+  }
+  .m-sm-auto {
+    margin: auto !important;
+  }
+  .mx-sm-0 {
+    margin-right: 0 !important;
+    margin-left: 0 !important;
+  }
+  .mx-sm-1 {
+    margin-right: 0.25rem !important;
+    margin-left: 0.25rem !important;
+  }
+  .mx-sm-2 {
+    margin-right: 0.5rem !important;
+    margin-left: 0.5rem !important;
+  }
+  .mx-sm-3 {
+    margin-right: 1rem !important;
+    margin-left: 1rem !important;
+  }
+  .mx-sm-4 {
+    margin-right: 1.5rem !important;
+    margin-left: 1.5rem !important;
+  }
+  .mx-sm-5 {
+    margin-right: 3rem !important;
+    margin-left: 3rem !important;
+  }
+  .mx-sm-auto {
+    margin-right: auto !important;
+    margin-left: auto !important;
+  }
+  .my-sm-0 {
+    margin-top: 0 !important;
+    margin-bottom: 0 !important;
+  }
+  .my-sm-1 {
+    margin-top: 0.25rem !important;
+    margin-bottom: 0.25rem !important;
+  }
+  .my-sm-2 {
+    margin-top: 0.5rem !important;
+    margin-bottom: 0.5rem !important;
+  }
+  .my-sm-3 {
+    margin-top: 1rem !important;
+    margin-bottom: 1rem !important;
+  }
+  .my-sm-4 {
+    margin-top: 1.5rem !important;
+    margin-bottom: 1.5rem !important;
+  }
+  .my-sm-5 {
+    margin-top: 3rem !important;
+    margin-bottom: 3rem !important;
+  }
+  .my-sm-auto {
+    margin-top: auto !important;
+    margin-bottom: auto !important;
+  }
+  .mt-sm-0 {
+    margin-top: 0 !important;
+  }
+  .mt-sm-1 {
+    margin-top: 0.25rem !important;
+  }
+  .mt-sm-2 {
+    margin-top: 0.5rem !important;
+  }
+  .mt-sm-3 {
+    margin-top: 1rem !important;
+  }
+  .mt-sm-4 {
+    margin-top: 1.5rem !important;
+  }
+  .mt-sm-5 {
+    margin-top: 3rem !important;
+  }
+  .mt-sm-auto {
+    margin-top: auto !important;
+  }
+  .me-sm-0 {
+    margin-right: 0 !important;
+  }
+  .me-sm-1 {
+    margin-right: 0.25rem !important;
+  }
+  .me-sm-2 {
+    margin-right: 0.5rem !important;
+  }
+  .me-sm-3 {
+    margin-right: 1rem !important;
+  }
+  .me-sm-4 {
+    margin-right: 1.5rem !important;
+  }
+  .me-sm-5 {
+    margin-right: 3rem !important;
+  }
+  .me-sm-auto {
+    margin-right: auto !important;
+  }
+  .mb-sm-0 {
+    margin-bottom: 0 !important;
+  }
+  .mb-sm-1 {
+    margin-bottom: 0.25rem !important;
+  }
+  .mb-sm-2 {
+    margin-bottom: 0.5rem !important;
+  }
+  .mb-sm-3 {
+    margin-bottom: 1rem !important;
+  }
+  .mb-sm-4 {
+    margin-bottom: 1.5rem !important;
+  }
+  .mb-sm-5 {
+    margin-bottom: 3rem !important;
+  }
+  .mb-sm-auto {
+    margin-bottom: auto !important;
+  }
+  .ms-sm-0 {
+    margin-left: 0 !important;
+  }
+  .ms-sm-1 {
+    margin-left: 0.25rem !important;
+  }
+  .ms-sm-2 {
+    margin-left: 0.5rem !important;
+  }
+  .ms-sm-3 {
+    margin-left: 1rem !important;
+  }
+  .ms-sm-4 {
+    margin-left: 1.5rem !important;
+  }
+  .ms-sm-5 {
+    margin-left: 3rem !important;
+  }
+  .ms-sm-auto {
+    margin-left: auto !important;
+  }
+  .p-sm-0 {
+    padding: 0 !important;
+  }
+  .p-sm-1 {
+    padding: 0.25rem !important;
+  }
+  .p-sm-2 {
+    padding: 0.5rem !important;
+  }
+  .p-sm-3 {
+    padding: 1rem !important;
+  }
+  .p-sm-4 {
+    padding: 1.5rem !important;
+  }
+  .p-sm-5 {
+    padding: 3rem !important;
+  }
+  .px-sm-0 {
+    padding-right: 0 !important;
+    padding-left: 0 !important;
+  }
+  .px-sm-1 {
+    padding-right: 0.25rem !important;
+    padding-left: 0.25rem !important;
+  }
+  .px-sm-2 {
+    padding-right: 0.5rem !important;
+    padding-left: 0.5rem !important;
+  }
+  .px-sm-3 {
+    padding-right: 1rem !important;
+    padding-left: 1rem !important;
+  }
+  .px-sm-4 {
+    padding-right: 1.5rem !important;
+    padding-left: 1.5rem !important;
+  }
+  .px-sm-5 {
+    padding-right: 3rem !important;
+    padding-left: 3rem !important;
+  }
+  .py-sm-0 {
+    padding-top: 0 !important;
+    padding-bottom: 0 !important;
+  }
+  .py-sm-1 {
+    padding-top: 0.25rem !important;
+    padding-bottom: 0.25rem !important;
+  }
+  .py-sm-2 {
+    padding-top: 0.5rem !important;
+    padding-bottom: 0.5rem !important;
+  }
+  .py-sm-3 {
+    padding-top: 1rem !important;
+    padding-bottom: 1rem !important;
+  }
+  .py-sm-4 {
+    padding-top: 1.5rem !important;
+    padding-bottom: 1.5rem !important;
+  }
+  .py-sm-5 {
+    padding-top: 3rem !important;
+    padding-bottom: 3rem !important;
+  }
+  .pt-sm-0 {
+    padding-top: 0 !important;
+  }
+  .pt-sm-1 {
+    padding-top: 0.25rem !important;
+  }
+  .pt-sm-2 {
+    padding-top: 0.5rem !important;
+  }
+  .pt-sm-3 {
+    padding-top: 1rem !important;
+  }
+  .pt-sm-4 {
+    padding-top: 1.5rem !important;
+  }
+  .pt-sm-5 {
+    padding-top: 3rem !important;
+  }
+  .pe-sm-0 {
+    padding-right: 0 !important;
+  }
+  .pe-sm-1 {
+    padding-right: 0.25rem !important;
+  }
+  .pe-sm-2 {
+    padding-right: 0.5rem !important;
+  }
+  .pe-sm-3 {
+    padding-right: 1rem !important;
+  }
+  .pe-sm-4 {
+    padding-right: 1.5rem !important;
+  }
+  .pe-sm-5 {
+    padding-right: 3rem !important;
+  }
+  .pb-sm-0 {
+    padding-bottom: 0 !important;
+  }
+  .pb-sm-1 {
+    padding-bottom: 0.25rem !important;
+  }
+  .pb-sm-2 {
+    padding-bottom: 0.5rem !important;
+  }
+  .pb-sm-3 {
+    padding-bottom: 1rem !important;
+  }
+  .pb-sm-4 {
+    padding-bottom: 1.5rem !important;
+  }
+  .pb-sm-5 {
+    padding-bottom: 3rem !important;
+  }
+  .ps-sm-0 {
+    padding-left: 0 !important;
+  }
+  .ps-sm-1 {
+    padding-left: 0.25rem !important;
+  }
+  .ps-sm-2 {
+    padding-left: 0.5rem !important;
+  }
+  .ps-sm-3 {
+    padding-left: 1rem !important;
+  }
+  .ps-sm-4 {
+    padding-left: 1.5rem !important;
+  }
+  .ps-sm-5 {
+    padding-left: 3rem !important;
+  }
+  .gap-sm-0 {
+    gap: 0 !important;
+  }
+  .gap-sm-1 {
+    gap: 0.25rem !important;
+  }
+  .gap-sm-2 {
+    gap: 0.5rem !important;
+  }
+  .gap-sm-3 {
+    gap: 1rem !important;
+  }
+  .gap-sm-4 {
+    gap: 1.5rem !important;
+  }
+  .gap-sm-5 {
+    gap: 3rem !important;
+  }
+  .row-gap-sm-0 {
+    row-gap: 0 !important;
+  }
+  .row-gap-sm-1 {
+    row-gap: 0.25rem !important;
+  }
+  .row-gap-sm-2 {
+    row-gap: 0.5rem !important;
+  }
+  .row-gap-sm-3 {
+    row-gap: 1rem !important;
+  }
+  .row-gap-sm-4 {
+    row-gap: 1.5rem !important;
+  }
+  .row-gap-sm-5 {
+    row-gap: 3rem !important;
+  }
+  .column-gap-sm-0 {
+    -moz-column-gap: 0 !important;
+    column-gap: 0 !important;
+  }
+  .column-gap-sm-1 {
+    -moz-column-gap: 0.25rem !important;
+    column-gap: 0.25rem !important;
+  }
+  .column-gap-sm-2 {
+    -moz-column-gap: 0.5rem !important;
+    column-gap: 0.5rem !important;
+  }
+  .column-gap-sm-3 {
+    -moz-column-gap: 1rem !important;
+    column-gap: 1rem !important;
+  }
+  .column-gap-sm-4 {
+    -moz-column-gap: 1.5rem !important;
+    column-gap: 1.5rem !important;
+  }
+  .column-gap-sm-5 {
+    -moz-column-gap: 3rem !important;
+    column-gap: 3rem !important;
+  }
+  .text-sm-start {
+    text-align: left !important;
+  }
+  .text-sm-end {
+    text-align: right !important;
+  }
+  .text-sm-center {
+    text-align: center !important;
+  }
+}
+@media (min-width: 768px) {
+  .float-md-start {
+    float: left !important;
+  }
+  .float-md-end {
+    float: right !important;
+  }
+  .float-md-none {
+    float: none !important;
+  }
+  .object-fit-md-contain {
+    -o-object-fit: contain !important;
+    object-fit: contain !important;
+  }
+  .object-fit-md-cover {
+    -o-object-fit: cover !important;
+    object-fit: cover !important;
+  }
+  .object-fit-md-fill {
+    -o-object-fit: fill !important;
+    object-fit: fill !important;
+  }
+  .object-fit-md-scale {
+    -o-object-fit: scale-down !important;
+    object-fit: scale-down !important;
+  }
+  .object-fit-md-none {
+    -o-object-fit: none !important;
+    object-fit: none !important;
+  }
+  .d-md-inline {
+    display: inline !important;
+  }
+  .d-md-inline-block {
+    display: inline-block !important;
+  }
+  .d-md-block {
+    display: block !important;
+  }
+  .d-md-grid {
+    display: grid !important;
+  }
+  .d-md-inline-grid {
+    display: inline-grid !important;
+  }
+  .d-md-table {
+    display: table !important;
+  }
+  .d-md-table-row {
+    display: table-row !important;
+  }
+  .d-md-table-cell {
+    display: table-cell !important;
+  }
+  .d-md-flex {
+    display: flex !important;
+  }
+  .d-md-inline-flex {
+    display: inline-flex !important;
+  }
+  .d-md-none {
+    display: none !important;
+  }
+  .flex-md-fill {
+    flex: 1 1 auto !important;
+  }
+  .flex-md-row {
+    flex-direction: row !important;
+  }
+  .flex-md-column {
+    flex-direction: column !important;
+  }
+  .flex-md-row-reverse {
+    flex-direction: row-reverse !important;
+  }
+  .flex-md-column-reverse {
+    flex-direction: column-reverse !important;
+  }
+  .flex-md-grow-0 {
+    flex-grow: 0 !important;
+  }
+  .flex-md-grow-1 {
+    flex-grow: 1 !important;
+  }
+  .flex-md-shrink-0 {
+    flex-shrink: 0 !important;
+  }
+  .flex-md-shrink-1 {
+    flex-shrink: 1 !important;
+  }
+  .flex-md-wrap {
+    flex-wrap: wrap !important;
+  }
+  .flex-md-nowrap {
+    flex-wrap: nowrap !important;
+  }
+  .flex-md-wrap-reverse {
+    flex-wrap: wrap-reverse !important;
+  }
+  .justify-content-md-start {
+    justify-content: flex-start !important;
+  }
+  .justify-content-md-end {
+    justify-content: flex-end !important;
+  }
+  .justify-content-md-center {
+    justify-content: center !important;
+  }
+  .justify-content-md-between {
+    justify-content: space-between !important;
+  }
+  .justify-content-md-around {
+    justify-content: space-around !important;
+  }
+  .justify-content-md-evenly {
+    justify-content: space-evenly !important;
+  }
+  .align-items-md-start {
+    align-items: flex-start !important;
+  }
+  .align-items-md-end {
+    align-items: flex-end !important;
+  }
+  .align-items-md-center {
+    align-items: center !important;
+  }
+  .align-items-md-baseline {
+    align-items: baseline !important;
+  }
+  .align-items-md-stretch {
+    align-items: stretch !important;
+  }
+  .align-content-md-start {
+    align-content: flex-start !important;
+  }
+  .align-content-md-end {
+    align-content: flex-end !important;
+  }
+  .align-content-md-center {
+    align-content: center !important;
+  }
+  .align-content-md-between {
+    align-content: space-between !important;
+  }
+  .align-content-md-around {
+    align-content: space-around !important;
+  }
+  .align-content-md-stretch {
+    align-content: stretch !important;
+  }
+  .align-self-md-auto {
+    align-self: auto !important;
+  }
+  .align-self-md-start {
+    align-self: flex-start !important;
+  }
+  .align-self-md-end {
+    align-self: flex-end !important;
+  }
+  .align-self-md-center {
+    align-self: center !important;
+  }
+  .align-self-md-baseline {
+    align-self: baseline !important;
+  }
+  .align-self-md-stretch {
+    align-self: stretch !important;
+  }
+  .order-md-first {
+    order: -1 !important;
+  }
+  .order-md-0 {
+    order: 0 !important;
+  }
+  .order-md-1 {
+    order: 1 !important;
+  }
+  .order-md-2 {
+    order: 2 !important;
+  }
+  .order-md-3 {
+    order: 3 !important;
+  }
+  .order-md-4 {
+    order: 4 !important;
+  }
+  .order-md-5 {
+    order: 5 !important;
+  }
+  .order-md-last {
+    order: 6 !important;
+  }
+  .m-md-0 {
+    margin: 0 !important;
+  }
+  .m-md-1 {
+    margin: 0.25rem !important;
+  }
+  .m-md-2 {
+    margin: 0.5rem !important;
+  }
+  .m-md-3 {
+    margin: 1rem !important;
+  }
+  .m-md-4 {
+    margin: 1.5rem !important;
+  }
+  .m-md-5 {
+    margin: 3rem !important;
+  }
+  .m-md-auto {
+    margin: auto !important;
+  }
+  .mx-md-0 {
+    margin-right: 0 !important;
+    margin-left: 0 !important;
+  }
+  .mx-md-1 {
+    margin-right: 0.25rem !important;
+    margin-left: 0.25rem !important;
+  }
+  .mx-md-2 {
+    margin-right: 0.5rem !important;
+    margin-left: 0.5rem !important;
+  }
+  .mx-md-3 {
+    margin-right: 1rem !important;
+    margin-left: 1rem !important;
+  }
+  .mx-md-4 {
+    margin-right: 1.5rem !important;
+    margin-left: 1.5rem !important;
+  }
+  .mx-md-5 {
+    margin-right: 3rem !important;
+    margin-left: 3rem !important;
+  }
+  .mx-md-auto {
+    margin-right: auto !important;
+    margin-left: auto !important;
+  }
+  .my-md-0 {
+    margin-top: 0 !important;
+    margin-bottom: 0 !important;
+  }
+  .my-md-1 {
+    margin-top: 0.25rem !important;
+    margin-bottom: 0.25rem !important;
+  }
+  .my-md-2 {
+    margin-top: 0.5rem !important;
+    margin-bottom: 0.5rem !important;
+  }
+  .my-md-3 {
+    margin-top: 1rem !important;
+    margin-bottom: 1rem !important;
+  }
+  .my-md-4 {
+    margin-top: 1.5rem !important;
+    margin-bottom: 1.5rem !important;
+  }
+  .my-md-5 {
+    margin-top: 3rem !important;
+    margin-bottom: 3rem !important;
+  }
+  .my-md-auto {
+    margin-top: auto !important;
+    margin-bottom: auto !important;
+  }
+  .mt-md-0 {
+    margin-top: 0 !important;
+  }
+  .mt-md-1 {
+    margin-top: 0.25rem !important;
+  }
+  .mt-md-2 {
+    margin-top: 0.5rem !important;
+  }
+  .mt-md-3 {
+    margin-top: 1rem !important;
+  }
+  .mt-md-4 {
+    margin-top: 1.5rem !important;
+  }
+  .mt-md-5 {
+    margin-top: 3rem !important;
+  }
+  .mt-md-auto {
+    margin-top: auto !important;
+  }
+  .me-md-0 {
+    margin-right: 0 !important;
+  }
+  .me-md-1 {
+    margin-right: 0.25rem !important;
+  }
+  .me-md-2 {
+    margin-right: 0.5rem !important;
+  }
+  .me-md-3 {
+    margin-right: 1rem !important;
+  }
+  .me-md-4 {
+    margin-right: 1.5rem !important;
+  }
+  .me-md-5 {
+    margin-right: 3rem !important;
+  }
+  .me-md-auto {
+    margin-right: auto !important;
+  }
+  .mb-md-0 {
+    margin-bottom: 0 !important;
+  }
+  .mb-md-1 {
+    margin-bottom: 0.25rem !important;
+  }
+  .mb-md-2 {
+    margin-bottom: 0.5rem !important;
+  }
+  .mb-md-3 {
+    margin-bottom: 1rem !important;
+  }
+  .mb-md-4 {
+    margin-bottom: 1.5rem !important;
+  }
+  .mb-md-5 {
+    margin-bottom: 3rem !important;
+  }
+  .mb-md-auto {
+    margin-bottom: auto !important;
+  }
+  .ms-md-0 {
+    margin-left: 0 !important;
+  }
+  .ms-md-1 {
+    margin-left: 0.25rem !important;
+  }
+  .ms-md-2 {
+    margin-left: 0.5rem !important;
+  }
+  .ms-md-3 {
+    margin-left: 1rem !important;
+  }
+  .ms-md-4 {
+    margin-left: 1.5rem !important;
+  }
+  .ms-md-5 {
+    margin-left: 3rem !important;
+  }
+  .ms-md-auto {
+    margin-left: auto !important;
+  }
+  .p-md-0 {
+    padding: 0 !important;
+  }
+  .p-md-1 {
+    padding: 0.25rem !important;
+  }
+  .p-md-2 {
+    padding: 0.5rem !important;
+  }
+  .p-md-3 {
+    padding: 1rem !important;
+  }
+  .p-md-4 {
+    padding: 1.5rem !important;
+  }
+  .p-md-5 {
+    padding: 3rem !important;
+  }
+  .px-md-0 {
+    padding-right: 0 !important;
+    padding-left: 0 !important;
+  }
+  .px-md-1 {
+    padding-right: 0.25rem !important;
+    padding-left: 0.25rem !important;
+  }
+  .px-md-2 {
+    padding-right: 0.5rem !important;
+    padding-left: 0.5rem !important;
+  }
+  .px-md-3 {
+    padding-right: 1rem !important;
+    padding-left: 1rem !important;
+  }
+  .px-md-4 {
+    padding-right: 1.5rem !important;
+    padding-left: 1.5rem !important;
+  }
+  .px-md-5 {
+    padding-right: 3rem !important;
+    padding-left: 3rem !important;
+  }
+  .py-md-0 {
+    padding-top: 0 !important;
+    padding-bottom: 0 !important;
+  }
+  .py-md-1 {
+    padding-top: 0.25rem !important;
+    padding-bottom: 0.25rem !important;
+  }
+  .py-md-2 {
+    padding-top: 0.5rem !important;
+    padding-bottom: 0.5rem !important;
+  }
+  .py-md-3 {
+    padding-top: 1rem !important;
+    padding-bottom: 1rem !important;
+  }
+  .py-md-4 {
+    padding-top: 1.5rem !important;
+    padding-bottom: 1.5rem !important;
+  }
+  .py-md-5 {
+    padding-top: 3rem !important;
+    padding-bottom: 3rem !important;
+  }
+  .pt-md-0 {
+    padding-top: 0 !important;
+  }
+  .pt-md-1 {
+    padding-top: 0.25rem !important;
+  }
+  .pt-md-2 {
+    padding-top: 0.5rem !important;
+  }
+  .pt-md-3 {
+    padding-top: 1rem !important;
+  }
+  .pt-md-4 {
+    padding-top: 1.5rem !important;
+  }
+  .pt-md-5 {
+    padding-top: 3rem !important;
+  }
+  .pe-md-0 {
+    padding-right: 0 !important;
+  }
+  .pe-md-1 {
+    padding-right: 0.25rem !important;
+  }
+  .pe-md-2 {
+    padding-right: 0.5rem !important;
+  }
+  .pe-md-3 {
+    padding-right: 1rem !important;
+  }
+  .pe-md-4 {
+    padding-right: 1.5rem !important;
+  }
+  .pe-md-5 {
+    padding-right: 3rem !important;
+  }
+  .pb-md-0 {
+    padding-bottom: 0 !important;
+  }
+  .pb-md-1 {
+    padding-bottom: 0.25rem !important;
+  }
+  .pb-md-2 {
+    padding-bottom: 0.5rem !important;
+  }
+  .pb-md-3 {
+    padding-bottom: 1rem !important;
+  }
+  .pb-md-4 {
+    padding-bottom: 1.5rem !important;
+  }
+  .pb-md-5 {
+    padding-bottom: 3rem !important;
+  }
+  .ps-md-0 {
+    padding-left: 0 !important;
+  }
+  .ps-md-1 {
+    padding-left: 0.25rem !important;
+  }
+  .ps-md-2 {
+    padding-left: 0.5rem !important;
+  }
+  .ps-md-3 {
+    padding-left: 1rem !important;
+  }
+  .ps-md-4 {
+    padding-left: 1.5rem !important;
+  }
+  .ps-md-5 {
+    padding-left: 3rem !important;
+  }
+  .gap-md-0 {
+    gap: 0 !important;
+  }
+  .gap-md-1 {
+    gap: 0.25rem !important;
+  }
+  .gap-md-2 {
+    gap: 0.5rem !important;
+  }
+  .gap-md-3 {
+    gap: 1rem !important;
+  }
+  .gap-md-4 {
+    gap: 1.5rem !important;
+  }
+  .gap-md-5 {
+    gap: 3rem !important;
+  }
+  .row-gap-md-0 {
+    row-gap: 0 !important;
+  }
+  .row-gap-md-1 {
+    row-gap: 0.25rem !important;
+  }
+  .row-gap-md-2 {
+    row-gap: 0.5rem !important;
+  }
+  .row-gap-md-3 {
+    row-gap: 1rem !important;
+  }
+  .row-gap-md-4 {
+    row-gap: 1.5rem !important;
+  }
+  .row-gap-md-5 {
+    row-gap: 3rem !important;
+  }
+  .column-gap-md-0 {
+    -moz-column-gap: 0 !important;
+    column-gap: 0 !important;
+  }
+  .column-gap-md-1 {
+    -moz-column-gap: 0.25rem !important;
+    column-gap: 0.25rem !important;
+  }
+  .column-gap-md-2 {
+    -moz-column-gap: 0.5rem !important;
+    column-gap: 0.5rem !important;
+  }
+  .column-gap-md-3 {
+    -moz-column-gap: 1rem !important;
+    column-gap: 1rem !important;
+  }
+  .column-gap-md-4 {
+    -moz-column-gap: 1.5rem !important;
+    column-gap: 1.5rem !important;
+  }
+  .column-gap-md-5 {
+    -moz-column-gap: 3rem !important;
+    column-gap: 3rem !important;
+  }
+  .text-md-start {
+    text-align: left !important;
+  }
+  .text-md-end {
+    text-align: right !important;
+  }
+  .text-md-center {
+    text-align: center !important;
+  }
+}
+@media (min-width: 992px) {
+  .float-lg-start {
+    float: left !important;
+  }
+  .float-lg-end {
+    float: right !important;
+  }
+  .float-lg-none {
+    float: none !important;
+  }
+  .object-fit-lg-contain {
+    -o-object-fit: contain !important;
+    object-fit: contain !important;
+  }
+  .object-fit-lg-cover {
+    -o-object-fit: cover !important;
+    object-fit: cover !important;
+  }
+  .object-fit-lg-fill {
+    -o-object-fit: fill !important;
+    object-fit: fill !important;
+  }
+  .object-fit-lg-scale {
+    -o-object-fit: scale-down !important;
+    object-fit: scale-down !important;
+  }
+  .object-fit-lg-none {
+    -o-object-fit: none !important;
+    object-fit: none !important;
+  }
+  .d-lg-inline {
+    display: inline !important;
+  }
+  .d-lg-inline-block {
+    display: inline-block !important;
+  }
+  .d-lg-block {
+    display: block !important;
+  }
+  .d-lg-grid {
+    display: grid !important;
+  }
+  .d-lg-inline-grid {
+    display: inline-grid !important;
+  }
+  .d-lg-table {
+    display: table !important;
+  }
+  .d-lg-table-row {
+    display: table-row !important;
+  }
+  .d-lg-table-cell {
+    display: table-cell !important;
+  }
+  .d-lg-flex {
+    display: flex !important;
+  }
+  .d-lg-inline-flex {
+    display: inline-flex !important;
+  }
+  .d-lg-none {
+    display: none !important;
+  }
+  .flex-lg-fill {
+    flex: 1 1 auto !important;
+  }
+  .flex-lg-row {
+    flex-direction: row !important;
+  }
+  .flex-lg-column {
+    flex-direction: column !important;
+  }
+  .flex-lg-row-reverse {
+    flex-direction: row-reverse !important;
+  }
+  .flex-lg-column-reverse {
+    flex-direction: column-reverse !important;
+  }
+  .flex-lg-grow-0 {
+    flex-grow: 0 !important;
+  }
+  .flex-lg-grow-1 {
+    flex-grow: 1 !important;
+  }
+  .flex-lg-shrink-0 {
+    flex-shrink: 0 !important;
+  }
+  .flex-lg-shrink-1 {
+    flex-shrink: 1 !important;
+  }
+  .flex-lg-wrap {
+    flex-wrap: wrap !important;
+  }
+  .flex-lg-nowrap {
+    flex-wrap: nowrap !important;
+  }
+  .flex-lg-wrap-reverse {
+    flex-wrap: wrap-reverse !important;
+  }
+  .justify-content-lg-start {
+    justify-content: flex-start !important;
+  }
+  .justify-content-lg-end {
+    justify-content: flex-end !important;
+  }
+  .justify-content-lg-center {
+    justify-content: center !important;
+  }
+  .justify-content-lg-between {
+    justify-content: space-between !important;
+  }
+  .justify-content-lg-around {
+    justify-content: space-around !important;
+  }
+  .justify-content-lg-evenly {
+    justify-content: space-evenly !important;
+  }
+  .align-items-lg-start {
+    align-items: flex-start !important;
+  }
+  .align-items-lg-end {
+    align-items: flex-end !important;
+  }
+  .align-items-lg-center {
+    align-items: center !important;
+  }
+  .align-items-lg-baseline {
+    align-items: baseline !important;
+  }
+  .align-items-lg-stretch {
+    align-items: stretch !important;
+  }
+  .align-content-lg-start {
+    align-content: flex-start !important;
+  }
+  .align-content-lg-end {
+    align-content: flex-end !important;
+  }
+  .align-content-lg-center {
+    align-content: center !important;
+  }
+  .align-content-lg-between {
+    align-content: space-between !important;
+  }
+  .align-content-lg-around {
+    align-content: space-around !important;
+  }
+  .align-content-lg-stretch {
+    align-content: stretch !important;
+  }
+  .align-self-lg-auto {
+    align-self: auto !important;
+  }
+  .align-self-lg-start {
+    align-self: flex-start !important;
+  }
+  .align-self-lg-end {
+    align-self: flex-end !important;
+  }
+  .align-self-lg-center {
+    align-self: center !important;
+  }
+  .align-self-lg-baseline {
+    align-self: baseline !important;
+  }
+  .align-self-lg-stretch {
+    align-self: stretch !important;
+  }
+  .order-lg-first {
+    order: -1 !important;
+  }
+  .order-lg-0 {
+    order: 0 !important;
+  }
+  .order-lg-1 {
+    order: 1 !important;
+  }
+  .order-lg-2 {
+    order: 2 !important;
+  }
+  .order-lg-3 {
+    order: 3 !important;
+  }
+  .order-lg-4 {
+    order: 4 !important;
+  }
+  .order-lg-5 {
+    order: 5 !important;
+  }
+  .order-lg-last {
+    order: 6 !important;
+  }
+  .m-lg-0 {
+    margin: 0 !important;
+  }
+  .m-lg-1 {
+    margin: 0.25rem !important;
+  }
+  .m-lg-2 {
+    margin: 0.5rem !important;
+  }
+  .m-lg-3 {
+    margin: 1rem !important;
+  }
+  .m-lg-4 {
+    margin: 1.5rem !important;
+  }
+  .m-lg-5 {
+    margin: 3rem !important;
+  }
+  .m-lg-auto {
+    margin: auto !important;
+  }
+  .mx-lg-0 {
+    margin-right: 0 !important;
+    margin-left: 0 !important;
+  }
+  .mx-lg-1 {
+    margin-right: 0.25rem !important;
+    margin-left: 0.25rem !important;
+  }
+  .mx-lg-2 {
+    margin-right: 0.5rem !important;
+    margin-left: 0.5rem !important;
+  }
+  .mx-lg-3 {
+    margin-right: 1rem !important;
+    margin-left: 1rem !important;
+  }
+  .mx-lg-4 {
+    margin-right: 1.5rem !important;
+    margin-left: 1.5rem !important;
+  }
+  .mx-lg-5 {
+    margin-right: 3rem !important;
+    margin-left: 3rem !important;
+  }
+  .mx-lg-auto {
+    margin-right: auto !important;
+    margin-left: auto !important;
+  }
+  .my-lg-0 {
+    margin-top: 0 !important;
+    margin-bottom: 0 !important;
+  }
+  .my-lg-1 {
+    margin-top: 0.25rem !important;
+    margin-bottom: 0.25rem !important;
+  }
+  .my-lg-2 {
+    margin-top: 0.5rem !important;
+    margin-bottom: 0.5rem !important;
+  }
+  .my-lg-3 {
+    margin-top: 1rem !important;
+    margin-bottom: 1rem !important;
+  }
+  .my-lg-4 {
+    margin-top: 1.5rem !important;
+    margin-bottom: 1.5rem !important;
+  }
+  .my-lg-5 {
+    margin-top: 3rem !important;
+    margin-bottom: 3rem !important;
+  }
+  .my-lg-auto {
+    margin-top: auto !important;
+    margin-bottom: auto !important;
+  }
+  .mt-lg-0 {
+    margin-top: 0 !important;
+  }
+  .mt-lg-1 {
+    margin-top: 0.25rem !important;
+  }
+  .mt-lg-2 {
+    margin-top: 0.5rem !important;
+  }
+  .mt-lg-3 {
+    margin-top: 1rem !important;
+  }
+  .mt-lg-4 {
+    margin-top: 1.5rem !important;
+  }
+  .mt-lg-5 {
+    margin-top: 3rem !important;
+  }
+  .mt-lg-auto {
+    margin-top: auto !important;
+  }
+  .me-lg-0 {
+    margin-right: 0 !important;
+  }
+  .me-lg-1 {
+    margin-right: 0.25rem !important;
+  }
+  .me-lg-2 {
+    margin-right: 0.5rem !important;
+  }
+  .me-lg-3 {
+    margin-right: 1rem !important;
+  }
+  .me-lg-4 {
+    margin-right: 1.5rem !important;
+  }
+  .me-lg-5 {
+    margin-right: 3rem !important;
+  }
+  .me-lg-auto {
+    margin-right: auto !important;
+  }
+  .mb-lg-0 {
+    margin-bottom: 0 !important;
+  }
+  .mb-lg-1 {
+    margin-bottom: 0.25rem !important;
+  }
+  .mb-lg-2 {
+    margin-bottom: 0.5rem !important;
+  }
+  .mb-lg-3 {
+    margin-bottom: 1rem !important;
+  }
+  .mb-lg-4 {
+    margin-bottom: 1.5rem !important;
+  }
+  .mb-lg-5 {
+    margin-bottom: 3rem !important;
+  }
+  .mb-lg-auto {
+    margin-bottom: auto !important;
+  }
+  .ms-lg-0 {
+    margin-left: 0 !important;
+  }
+  .ms-lg-1 {
+    margin-left: 0.25rem !important;
+  }
+  .ms-lg-2 {
+    margin-left: 0.5rem !important;
+  }
+  .ms-lg-3 {
+    margin-left: 1rem !important;
+  }
+  .ms-lg-4 {
+    margin-left: 1.5rem !important;
+  }
+  .ms-lg-5 {
+    margin-left: 3rem !important;
+  }
+  .ms-lg-auto {
+    margin-left: auto !important;
+  }
+  .p-lg-0 {
+    padding: 0 !important;
+  }
+  .p-lg-1 {
+    padding: 0.25rem !important;
+  }
+  .p-lg-2 {
+    padding: 0.5rem !important;
+  }
+  .p-lg-3 {
+    padding: 1rem !important;
+  }
+  .p-lg-4 {
+    padding: 1.5rem !important;
+  }
+  .p-lg-5 {
+    padding: 3rem !important;
+  }
+  .px-lg-0 {
+    padding-right: 0 !important;
+    padding-left: 0 !important;
+  }
+  .px-lg-1 {
+    padding-right: 0.25rem !important;
+    padding-left: 0.25rem !important;
+  }
+  .px-lg-2 {
+    padding-right: 0.5rem !important;
+    padding-left: 0.5rem !important;
+  }
+  .px-lg-3 {
+    padding-right: 1rem !important;
+    padding-left: 1rem !important;
+  }
+  .px-lg-4 {
+    padding-right: 1.5rem !important;
+    padding-left: 1.5rem !important;
+  }
+  .px-lg-5 {
+    padding-right: 3rem !important;
+    padding-left: 3rem !important;
+  }
+  .py-lg-0 {
+    padding-top: 0 !important;
+    padding-bottom: 0 !important;
+  }
+  .py-lg-1 {
+    padding-top: 0.25rem !important;
+    padding-bottom: 0.25rem !important;
+  }
+  .py-lg-2 {
+    padding-top: 0.5rem !important;
+    padding-bottom: 0.5rem !important;
+  }
+  .py-lg-3 {
+    padding-top: 1rem !important;
+    padding-bottom: 1rem !important;
+  }
+  .py-lg-4 {
+    padding-top: 1.5rem !important;
+    padding-bottom: 1.5rem !important;
+  }
+  .py-lg-5 {
+    padding-top: 3rem !important;
+    padding-bottom: 3rem !important;
+  }
+  .pt-lg-0 {
+    padding-top: 0 !important;
+  }
+  .pt-lg-1 {
+    padding-top: 0.25rem !important;
+  }
+  .pt-lg-2 {
+    padding-top: 0.5rem !important;
+  }
+  .pt-lg-3 {
+    padding-top: 1rem !important;
+  }
+  .pt-lg-4 {
+    padding-top: 1.5rem !important;
+  }
+  .pt-lg-5 {
+    padding-top: 3rem !important;
+  }
+  .pe-lg-0 {
+    padding-right: 0 !important;
+  }
+  .pe-lg-1 {
+    padding-right: 0.25rem !important;
+  }
+  .pe-lg-2 {
+    padding-right: 0.5rem !important;
+  }
+  .pe-lg-3 {
+    padding-right: 1rem !important;
+  }
+  .pe-lg-4 {
+    padding-right: 1.5rem !important;
+  }
+  .pe-lg-5 {
+    padding-right: 3rem !important;
+  }
+  .pb-lg-0 {
+    padding-bottom: 0 !important;
+  }
+  .pb-lg-1 {
+    padding-bottom: 0.25rem !important;
+  }
+  .pb-lg-2 {
+    padding-bottom: 0.5rem !important;
+  }
+  .pb-lg-3 {
+    padding-bottom: 1rem !important;
+  }
+  .pb-lg-4 {
+    padding-bottom: 1.5rem !important;
+  }
+  .pb-lg-5 {
+    padding-bottom: 3rem !important;
+  }
+  .ps-lg-0 {
+    padding-left: 0 !important;
+  }
+  .ps-lg-1 {
+    padding-left: 0.25rem !important;
+  }
+  .ps-lg-2 {
+    padding-left: 0.5rem !important;
+  }
+  .ps-lg-3 {
+    padding-left: 1rem !important;
+  }
+  .ps-lg-4 {
+    padding-left: 1.5rem !important;
+  }
+  .ps-lg-5 {
+    padding-left: 3rem !important;
+  }
+  .gap-lg-0 {
+    gap: 0 !important;
+  }
+  .gap-lg-1 {
+    gap: 0.25rem !important;
+  }
+  .gap-lg-2 {
+    gap: 0.5rem !important;
+  }
+  .gap-lg-3 {
+    gap: 1rem !important;
+  }
+  .gap-lg-4 {
+    gap: 1.5rem !important;
+  }
+  .gap-lg-5 {
+    gap: 3rem !important;
+  }
+  .row-gap-lg-0 {
+    row-gap: 0 !important;
+  }
+  .row-gap-lg-1 {
+    row-gap: 0.25rem !important;
+  }
+  .row-gap-lg-2 {
+    row-gap: 0.5rem !important;
+  }
+  .row-gap-lg-3 {
+    row-gap: 1rem !important;
+  }
+  .row-gap-lg-4 {
+    row-gap: 1.5rem !important;
+  }
+  .row-gap-lg-5 {
+    row-gap: 3rem !important;
+  }
+  .column-gap-lg-0 {
+    -moz-column-gap: 0 !important;
+    column-gap: 0 !important;
+  }
+  .column-gap-lg-1 {
+    -moz-column-gap: 0.25rem !important;
+    column-gap: 0.25rem !important;
+  }
+  .column-gap-lg-2 {
+    -moz-column-gap: 0.5rem !important;
+    column-gap: 0.5rem !important;
+  }
+  .column-gap-lg-3 {
+    -moz-column-gap: 1rem !important;
+    column-gap: 1rem !important;
+  }
+  .column-gap-lg-4 {
+    -moz-column-gap: 1.5rem !important;
+    column-gap: 1.5rem !important;
+  }
+  .column-gap-lg-5 {
+    -moz-column-gap: 3rem !important;
+    column-gap: 3rem !important;
+  }
+  .text-lg-start {
+    text-align: left !important;
+  }
+  .text-lg-end {
+    text-align: right !important;
+  }
+  .text-lg-center {
+    text-align: center !important;
+  }
+}
+@media (min-width: 1200px) {
+  .float-xl-start {
+    float: left !important;
+  }
+  .float-xl-end {
+    float: right !important;
+  }
+  .float-xl-none {
+    float: none !important;
+  }
+  .object-fit-xl-contain {
+    -o-object-fit: contain !important;
+    object-fit: contain !important;
+  }
+  .object-fit-xl-cover {
+    -o-object-fit: cover !important;
+    object-fit: cover !important;
+  }
+  .object-fit-xl-fill {
+    -o-object-fit: fill !important;
+    object-fit: fill !important;
+  }
+  .object-fit-xl-scale {
+    -o-object-fit: scale-down !important;
+    object-fit: scale-down !important;
+  }
+  .object-fit-xl-none {
+    -o-object-fit: none !important;
+    object-fit: none !important;
+  }
+  .d-xl-inline {
+    display: inline !important;
+  }
+  .d-xl-inline-block {
+    display: inline-block !important;
+  }
+  .d-xl-block {
+    display: block !important;
+  }
+  .d-xl-grid {
+    display: grid !important;
+  }
+  .d-xl-inline-grid {
+    display: inline-grid !important;
+  }
+  .d-xl-table {
+    display: table !important;
+  }
+  .d-xl-table-row {
+    display: table-row !important;
+  }
+  .d-xl-table-cell {
+    display: table-cell !important;
+  }
+  .d-xl-flex {
+    display: flex !important;
+  }
+  .d-xl-inline-flex {
+    display: inline-flex !important;
+  }
+  .d-xl-none {
+    display: none !important;
+  }
+  .flex-xl-fill {
+    flex: 1 1 auto !important;
+  }
+  .flex-xl-row {
+    flex-direction: row !important;
+  }
+  .flex-xl-column {
+    flex-direction: column !important;
+  }
+  .flex-xl-row-reverse {
+    flex-direction: row-reverse !important;
+  }
+  .flex-xl-column-reverse {
+    flex-direction: column-reverse !important;
+  }
+  .flex-xl-grow-0 {
+    flex-grow: 0 !important;
+  }
+  .flex-xl-grow-1 {
+    flex-grow: 1 !important;
+  }
+  .flex-xl-shrink-0 {
+    flex-shrink: 0 !important;
+  }
+  .flex-xl-shrink-1 {
+    flex-shrink: 1 !important;
+  }
+  .flex-xl-wrap {
+    flex-wrap: wrap !important;
+  }
+  .flex-xl-nowrap {
+    flex-wrap: nowrap !important;
+  }
+  .flex-xl-wrap-reverse {
+    flex-wrap: wrap-reverse !important;
+  }
+  .justify-content-xl-start {
+    justify-content: flex-start !important;
+  }
+  .justify-content-xl-end {
+    justify-content: flex-end !important;
+  }
+  .justify-content-xl-center {
+    justify-content: center !important;
+  }
+  .justify-content-xl-between {
+    justify-content: space-between !important;
+  }
+  .justify-content-xl-around {
+    justify-content: space-around !important;
+  }
+  .justify-content-xl-evenly {
+    justify-content: space-evenly !important;
+  }
+  .align-items-xl-start {
+    align-items: flex-start !important;
+  }
+  .align-items-xl-end {
+    align-items: flex-end !important;
+  }
+  .align-items-xl-center {
+    align-items: center !important;
+  }
+  .align-items-xl-baseline {
+    align-items: baseline !important;
+  }
+  .align-items-xl-stretch {
+    align-items: stretch !important;
+  }
+  .align-content-xl-start {
+    align-content: flex-start !important;
+  }
+  .align-content-xl-end {
+    align-content: flex-end !important;
+  }
+  .align-content-xl-center {
+    align-content: center !important;
+  }
+  .align-content-xl-between {
+    align-content: space-between !important;
+  }
+  .align-content-xl-around {
+    align-content: space-around !important;
+  }
+  .align-content-xl-stretch {
+    align-content: stretch !important;
+  }
+  .align-self-xl-auto {
+    align-self: auto !important;
+  }
+  .align-self-xl-start {
+    align-self: flex-start !important;
+  }
+  .align-self-xl-end {
+    align-self: flex-end !important;
+  }
+  .align-self-xl-center {
+    align-self: center !important;
+  }
+  .align-self-xl-baseline {
+    align-self: baseline !important;
+  }
+  .align-self-xl-stretch {
+    align-self: stretch !important;
+  }
+  .order-xl-first {
+    order: -1 !important;
+  }
+  .order-xl-0 {
+    order: 0 !important;
+  }
+  .order-xl-1 {
+    order: 1 !important;
+  }
+  .order-xl-2 {
+    order: 2 !important;
+  }
+  .order-xl-3 {
+    order: 3 !important;
+  }
+  .order-xl-4 {
+    order: 4 !important;
+  }
+  .order-xl-5 {
+    order: 5 !important;
+  }
+  .order-xl-last {
+    order: 6 !important;
+  }
+  .m-xl-0 {
+    margin: 0 !important;
+  }
+  .m-xl-1 {
+    margin: 0.25rem !important;
+  }
+  .m-xl-2 {
+    margin: 0.5rem !important;
+  }
+  .m-xl-3 {
+    margin: 1rem !important;
+  }
+  .m-xl-4 {
+    margin: 1.5rem !important;
+  }
+  .m-xl-5 {
+    margin: 3rem !important;
+  }
+  .m-xl-auto {
+    margin: auto !important;
+  }
+  .mx-xl-0 {
+    margin-right: 0 !important;
+    margin-left: 0 !important;
+  }
+  .mx-xl-1 {
+    margin-right: 0.25rem !important;
+    margin-left: 0.25rem !important;
+  }
+  .mx-xl-2 {
+    margin-right: 0.5rem !important;
+    margin-left: 0.5rem !important;
+  }
+  .mx-xl-3 {
+    margin-right: 1rem !important;
+    margin-left: 1rem !important;
+  }
+  .mx-xl-4 {
+    margin-right: 1.5rem !important;
+    margin-left: 1.5rem !important;
+  }
+  .mx-xl-5 {
+    margin-right: 3rem !important;
+    margin-left: 3rem !important;
+  }
+  .mx-xl-auto {
+    margin-right: auto !important;
+    margin-left: auto !important;
+  }
+  .my-xl-0 {
+    margin-top: 0 !important;
+    margin-bottom: 0 !important;
+  }
+  .my-xl-1 {
+    margin-top: 0.25rem !important;
+    margin-bottom: 0.25rem !important;
+  }
+  .my-xl-2 {
+    margin-top: 0.5rem !important;
+    margin-bottom: 0.5rem !important;
+  }
+  .my-xl-3 {
+    margin-top: 1rem !important;
+    margin-bottom: 1rem !important;
+  }
+  .my-xl-4 {
+    margin-top: 1.5rem !important;
+    margin-bottom: 1.5rem !important;
+  }
+  .my-xl-5 {
+    margin-top: 3rem !important;
+    margin-bottom: 3rem !important;
+  }
+  .my-xl-auto {
+    margin-top: auto !important;
+    margin-bottom: auto !important;
+  }
+  .mt-xl-0 {
+    margin-top: 0 !important;
+  }
+  .mt-xl-1 {
+    margin-top: 0.25rem !important;
+  }
+  .mt-xl-2 {
+    margin-top: 0.5rem !important;
+  }
+  .mt-xl-3 {
+    margin-top: 1rem !important;
+  }
+  .mt-xl-4 {
+    margin-top: 1.5rem !important;
+  }
+  .mt-xl-5 {
+    margin-top: 3rem !important;
+  }
+  .mt-xl-auto {
+    margin-top: auto !important;
+  }
+  .me-xl-0 {
+    margin-right: 0 !important;
+  }
+  .me-xl-1 {
+    margin-right: 0.25rem !important;
+  }
+  .me-xl-2 {
+    margin-right: 0.5rem !important;
+  }
+  .me-xl-3 {
+    margin-right: 1rem !important;
+  }
+  .me-xl-4 {
+    margin-right: 1.5rem !important;
+  }
+  .me-xl-5 {
+    margin-right: 3rem !important;
+  }
+  .me-xl-auto {
+    margin-right: auto !important;
+  }
+  .mb-xl-0 {
+    margin-bottom: 0 !important;
+  }
+  .mb-xl-1 {
+    margin-bottom: 0.25rem !important;
+  }
+  .mb-xl-2 {
+    margin-bottom: 0.5rem !important;
+  }
+  .mb-xl-3 {
+    margin-bottom: 1rem !important;
+  }
+  .mb-xl-4 {
+    margin-bottom: 1.5rem !important;
+  }
+  .mb-xl-5 {
+    margin-bottom: 3rem !important;
+  }
+  .mb-xl-auto {
+    margin-bottom: auto !important;
+  }
+  .ms-xl-0 {
+    margin-left: 0 !important;
+  }
+  .ms-xl-1 {
+    margin-left: 0.25rem !important;
+  }
+  .ms-xl-2 {
+    margin-left: 0.5rem !important;
+  }
+  .ms-xl-3 {
+    margin-left: 1rem !important;
+  }
+  .ms-xl-4 {
+    margin-left: 1.5rem !important;
+  }
+  .ms-xl-5 {
+    margin-left: 3rem !important;
+  }
+  .ms-xl-auto {
+    margin-left: auto !important;
+  }
+  .p-xl-0 {
+    padding: 0 !important;
+  }
+  .p-xl-1 {
+    padding: 0.25rem !important;
+  }
+  .p-xl-2 {
+    padding: 0.5rem !important;
+  }
+  .p-xl-3 {
+    padding: 1rem !important;
+  }
+  .p-xl-4 {
+    padding: 1.5rem !important;
+  }
+  .p-xl-5 {
+    padding: 3rem !important;
+  }
+  .px-xl-0 {
+    padding-right: 0 !important;
+    padding-left: 0 !important;
+  }
+  .px-xl-1 {
+    padding-right: 0.25rem !important;
+    padding-left: 0.25rem !important;
+  }
+  .px-xl-2 {
+    padding-right: 0.5rem !important;
+    padding-left: 0.5rem !important;
+  }
+  .px-xl-3 {
+    padding-right: 1rem !important;
+    padding-left: 1rem !important;
+  }
+  .px-xl-4 {
+    padding-right: 1.5rem !important;
+    padding-left: 1.5rem !important;
+  }
+  .px-xl-5 {
+    padding-right: 3rem !important;
+    padding-left: 3rem !important;
+  }
+  .py-xl-0 {
+    padding-top: 0 !important;
+    padding-bottom: 0 !important;
+  }
+  .py-xl-1 {
+    padding-top: 0.25rem !important;
+    padding-bottom: 0.25rem !important;
+  }
+  .py-xl-2 {
+    padding-top: 0.5rem !important;
+    padding-bottom: 0.5rem !important;
+  }
+  .py-xl-3 {
+    padding-top: 1rem !important;
+    padding-bottom: 1rem !important;
+  }
+  .py-xl-4 {
+    padding-top: 1.5rem !important;
+    padding-bottom: 1.5rem !important;
+  }
+  .py-xl-5 {
+    padding-top: 3rem !important;
+    padding-bottom: 3rem !important;
+  }
+  .pt-xl-0 {
+    padding-top: 0 !important;
+  }
+  .pt-xl-1 {
+    padding-top: 0.25rem !important;
+  }
+  .pt-xl-2 {
+    padding-top: 0.5rem !important;
+  }
+  .pt-xl-3 {
+    padding-top: 1rem !important;
+  }
+  .pt-xl-4 {
+    padding-top: 1.5rem !important;
+  }
+  .pt-xl-5 {
+    padding-top: 3rem !important;
+  }
+  .pe-xl-0 {
+    padding-right: 0 !important;
+  }
+  .pe-xl-1 {
+    padding-right: 0.25rem !important;
+  }
+  .pe-xl-2 {
+    padding-right: 0.5rem !important;
+  }
+  .pe-xl-3 {
+    padding-right: 1rem !important;
+  }
+  .pe-xl-4 {
+    padding-right: 1.5rem !important;
+  }
+  .pe-xl-5 {
+    padding-right: 3rem !important;
+  }
+  .pb-xl-0 {
+    padding-bottom: 0 !important;
+  }
+  .pb-xl-1 {
+    padding-bottom: 0.25rem !important;
+  }
+  .pb-xl-2 {
+    padding-bottom: 0.5rem !important;
+  }
+  .pb-xl-3 {
+    padding-bottom: 1rem !important;
+  }
+  .pb-xl-4 {
+    padding-bottom: 1.5rem !important;
+  }
+  .pb-xl-5 {
+    padding-bottom: 3rem !important;
+  }
+  .ps-xl-0 {
+    padding-left: 0 !important;
+  }
+  .ps-xl-1 {
+    padding-left: 0.25rem !important;
+  }
+  .ps-xl-2 {
+    padding-left: 0.5rem !important;
+  }
+  .ps-xl-3 {
+    padding-left: 1rem !important;
+  }
+  .ps-xl-4 {
+    padding-left: 1.5rem !important;
+  }
+  .ps-xl-5 {
+    padding-left: 3rem !important;
+  }
+  .gap-xl-0 {
+    gap: 0 !important;
+  }
+  .gap-xl-1 {
+    gap: 0.25rem !important;
+  }
+  .gap-xl-2 {
+    gap: 0.5rem !important;
+  }
+  .gap-xl-3 {
+    gap: 1rem !important;
+  }
+  .gap-xl-4 {
+    gap: 1.5rem !important;
+  }
+  .gap-xl-5 {
+    gap: 3rem !important;
+  }
+  .row-gap-xl-0 {
+    row-gap: 0 !important;
+  }
+  .row-gap-xl-1 {
+    row-gap: 0.25rem !important;
+  }
+  .row-gap-xl-2 {
+    row-gap: 0.5rem !important;
+  }
+  .row-gap-xl-3 {
+    row-gap: 1rem !important;
+  }
+  .row-gap-xl-4 {
+    row-gap: 1.5rem !important;
+  }
+  .row-gap-xl-5 {
+    row-gap: 3rem !important;
+  }
+  .column-gap-xl-0 {
+    -moz-column-gap: 0 !important;
+    column-gap: 0 !important;
+  }
+  .column-gap-xl-1 {
+    -moz-column-gap: 0.25rem !important;
+    column-gap: 0.25rem !important;
+  }
+  .column-gap-xl-2 {
+    -moz-column-gap: 0.5rem !important;
+    column-gap: 0.5rem !important;
+  }
+  .column-gap-xl-3 {
+    -moz-column-gap: 1rem !important;
+    column-gap: 1rem !important;
+  }
+  .column-gap-xl-4 {
+    -moz-column-gap: 1.5rem !important;
+    column-gap: 1.5rem !important;
+  }
+  .column-gap-xl-5 {
+    -moz-column-gap: 3rem !important;
+    column-gap: 3rem !important;
+  }
+  .text-xl-start {
+    text-align: left !important;
+  }
+  .text-xl-end {
+    text-align: right !important;
+  }
+  .text-xl-center {
+    text-align: center !important;
+  }
+}
+@media (min-width: 1400px) {
+  .float-xxl-start {
+    float: left !important;
+  }
+  .float-xxl-end {
+    float: right !important;
+  }
+  .float-xxl-none {
+    float: none !important;
+  }
+  .object-fit-xxl-contain {
+    -o-object-fit: contain !important;
+    object-fit: contain !important;
+  }
+  .object-fit-xxl-cover {
+    -o-object-fit: cover !important;
+    object-fit: cover !important;
+  }
+  .object-fit-xxl-fill {
+    -o-object-fit: fill !important;
+    object-fit: fill !important;
+  }
+  .object-fit-xxl-scale {
+    -o-object-fit: scale-down !important;
+    object-fit: scale-down !important;
+  }
+  .object-fit-xxl-none {
+    -o-object-fit: none !important;
+    object-fit: none !important;
+  }
+  .d-xxl-inline {
+    display: inline !important;
+  }
+  .d-xxl-inline-block {
+    display: inline-block !important;
+  }
+  .d-xxl-block {
+    display: block !important;
+  }
+  .d-xxl-grid {
+    display: grid !important;
+  }
+  .d-xxl-inline-grid {
+    display: inline-grid !important;
+  }
+  .d-xxl-table {
+    display: table !important;
+  }
+  .d-xxl-table-row {
+    display: table-row !important;
+  }
+  .d-xxl-table-cell {
+    display: table-cell !important;
+  }
+  .d-xxl-flex {
+    display: flex !important;
+  }
+  .d-xxl-inline-flex {
+    display: inline-flex !important;
+  }
+  .d-xxl-none {
+    display: none !important;
+  }
+  .flex-xxl-fill {
+    flex: 1 1 auto !important;
+  }
+  .flex-xxl-row {
+    flex-direction: row !important;
+  }
+  .flex-xxl-column {
+    flex-direction: column !important;
+  }
+  .flex-xxl-row-reverse {
+    flex-direction: row-reverse !important;
+  }
+  .flex-xxl-column-reverse {
+    flex-direction: column-reverse !important;
+  }
+  .flex-xxl-grow-0 {
+    flex-grow: 0 !important;
+  }
+  .flex-xxl-grow-1 {
+    flex-grow: 1 !important;
+  }
+  .flex-xxl-shrink-0 {
+    flex-shrink: 0 !important;
+  }
+  .flex-xxl-shrink-1 {
+    flex-shrink: 1 !important;
+  }
+  .flex-xxl-wrap {
+    flex-wrap: wrap !important;
+  }
+  .flex-xxl-nowrap {
+    flex-wrap: nowrap !important;
+  }
+  .flex-xxl-wrap-reverse {
+    flex-wrap: wrap-reverse !important;
+  }
+  .justify-content-xxl-start {
+    justify-content: flex-start !important;
+  }
+  .justify-content-xxl-end {
+    justify-content: flex-end !important;
+  }
+  .justify-content-xxl-center {
+    justify-content: center !important;
+  }
+  .justify-content-xxl-between {
+    justify-content: space-between !important;
+  }
+  .justify-content-xxl-around {
+    justify-content: space-around !important;
+  }
+  .justify-content-xxl-evenly {
+    justify-content: space-evenly !important;
+  }
+  .align-items-xxl-start {
+    align-items: flex-start !important;
+  }
+  .align-items-xxl-end {
+    align-items: flex-end !important;
+  }
+  .align-items-xxl-center {
+    align-items: center !important;
+  }
+  .align-items-xxl-baseline {
+    align-items: baseline !important;
+  }
+  .align-items-xxl-stretch {
+    align-items: stretch !important;
+  }
+  .align-content-xxl-start {
+    align-content: flex-start !important;
+  }
+  .align-content-xxl-end {
+    align-content: flex-end !important;
+  }
+  .align-content-xxl-center {
+    align-content: center !important;
+  }
+  .align-content-xxl-between {
+    align-content: space-between !important;
+  }
+  .align-content-xxl-around {
+    align-content: space-around !important;
+  }
+  .align-content-xxl-stretch {
+    align-content: stretch !important;
+  }
+  .align-self-xxl-auto {
+    align-self: auto !important;
+  }
+  .align-self-xxl-start {
+    align-self: flex-start !important;
+  }
+  .align-self-xxl-end {
+    align-self: flex-end !important;
+  }
+  .align-self-xxl-center {
+    align-self: center !important;
+  }
+  .align-self-xxl-baseline {
+    align-self: baseline !important;
+  }
+  .align-self-xxl-stretch {
+    align-self: stretch !important;
+  }
+  .order-xxl-first {
+    order: -1 !important;
+  }
+  .order-xxl-0 {
+    order: 0 !important;
+  }
+  .order-xxl-1 {
+    order: 1 !important;
+  }
+  .order-xxl-2 {
+    order: 2 !important;
+  }
+  .order-xxl-3 {
+    order: 3 !important;
+  }
+  .order-xxl-4 {
+    order: 4 !important;
+  }
+  .order-xxl-5 {
+    order: 5 !important;
+  }
+  .order-xxl-last {
+    order: 6 !important;
+  }
+  .m-xxl-0 {
+    margin: 0 !important;
+  }
+  .m-xxl-1 {
+    margin: 0.25rem !important;
+  }
+  .m-xxl-2 {
+    margin: 0.5rem !important;
+  }
+  .m-xxl-3 {
+    margin: 1rem !important;
+  }
+  .m-xxl-4 {
+    margin: 1.5rem !important;
+  }
+  .m-xxl-5 {
+    margin: 3rem !important;
+  }
+  .m-xxl-auto {
+    margin: auto !important;
+  }
+  .mx-xxl-0 {
+    margin-right: 0 !important;
+    margin-left: 0 !important;
+  }
+  .mx-xxl-1 {
+    margin-right: 0.25rem !important;
+    margin-left: 0.25rem !important;
+  }
+  .mx-xxl-2 {
+    margin-right: 0.5rem !important;
+    margin-left: 0.5rem !important;
+  }
+  .mx-xxl-3 {
+    margin-right: 1rem !important;
+    margin-left: 1rem !important;
+  }
+  .mx-xxl-4 {
+    margin-right: 1.5rem !important;
+    margin-left: 1.5rem !important;
+  }
+  .mx-xxl-5 {
+    margin-right: 3rem !important;
+    margin-left: 3rem !important;
+  }
+  .mx-xxl-auto {
+    margin-right: auto !important;
+    margin-left: auto !important;
+  }
+  .my-xxl-0 {
+    margin-top: 0 !important;
+    margin-bottom: 0 !important;
+  }
+  .my-xxl-1 {
+    margin-top: 0.25rem !important;
+    margin-bottom: 0.25rem !important;
+  }
+  .my-xxl-2 {
+    margin-top: 0.5rem !important;
+    margin-bottom: 0.5rem !important;
+  }
+  .my-xxl-3 {
+    margin-top: 1rem !important;
+    margin-bottom: 1rem !important;
+  }
+  .my-xxl-4 {
+    margin-top: 1.5rem !important;
+    margin-bottom: 1.5rem !important;
+  }
+  .my-xxl-5 {
+    margin-top: 3rem !important;
+    margin-bottom: 3rem !important;
+  }
+  .my-xxl-auto {
+    margin-top: auto !important;
+    margin-bottom: auto !important;
+  }
+  .mt-xxl-0 {
+    margin-top: 0 !important;
+  }
+  .mt-xxl-1 {
+    margin-top: 0.25rem !important;
+  }
+  .mt-xxl-2 {
+    margin-top: 0.5rem !important;
+  }
+  .mt-xxl-3 {
+    margin-top: 1rem !important;
+  }
+  .mt-xxl-4 {
+    margin-top: 1.5rem !important;
+  }
+  .mt-xxl-5 {
+    margin-top: 3rem !important;
+  }
+  .mt-xxl-auto {
+    margin-top: auto !important;
+  }
+  .me-xxl-0 {
+    margin-right: 0 !important;
+  }
+  .me-xxl-1 {
+    margin-right: 0.25rem !important;
+  }
+  .me-xxl-2 {
+    margin-right: 0.5rem !important;
+  }
+  .me-xxl-3 {
+    margin-right: 1rem !important;
+  }
+  .me-xxl-4 {
+    margin-right: 1.5rem !important;
+  }
+  .me-xxl-5 {
+    margin-right: 3rem !important;
+  }
+  .me-xxl-auto {
+    margin-right: auto !important;
+  }
+  .mb-xxl-0 {
+    margin-bottom: 0 !important;
+  }
+  .mb-xxl-1 {
+    margin-bottom: 0.25rem !important;
+  }
+  .mb-xxl-2 {
+    margin-bottom: 0.5rem !important;
+  }
+  .mb-xxl-3 {
+    margin-bottom: 1rem !important;
+  }
+  .mb-xxl-4 {
+    margin-bottom: 1.5rem !important;
+  }
+  .mb-xxl-5 {
+    margin-bottom: 3rem !important;
+  }
+  .mb-xxl-auto {
+    margin-bottom: auto !important;
+  }
+  .ms-xxl-0 {
+    margin-left: 0 !important;
+  }
+  .ms-xxl-1 {
+    margin-left: 0.25rem !important;
+  }
+  .ms-xxl-2 {
+    margin-left: 0.5rem !important;
+  }
+  .ms-xxl-3 {
+    margin-left: 1rem !important;
+  }
+  .ms-xxl-4 {
+    margin-left: 1.5rem !important;
+  }
+  .ms-xxl-5 {
+    margin-left: 3rem !important;
+  }
+  .ms-xxl-auto {
+    margin-left: auto !important;
+  }
+  .p-xxl-0 {
+    padding: 0 !important;
+  }
+  .p-xxl-1 {
+    padding: 0.25rem !important;
+  }
+  .p-xxl-2 {
+    padding: 0.5rem !important;
+  }
+  .p-xxl-3 {
+    padding: 1rem !important;
+  }
+  .p-xxl-4 {
+    padding: 1.5rem !important;
+  }
+  .p-xxl-5 {
+    padding: 3rem !important;
+  }
+  .px-xxl-0 {
+    padding-right: 0 !important;
+    padding-left: 0 !important;
+  }
+  .px-xxl-1 {
+    padding-right: 0.25rem !important;
+    padding-left: 0.25rem !important;
+  }
+  .px-xxl-2 {
+    padding-right: 0.5rem !important;
+    padding-left: 0.5rem !important;
+  }
+  .px-xxl-3 {
+    padding-right: 1rem !important;
+    padding-left: 1rem !important;
+  }
+  .px-xxl-4 {
+    padding-right: 1.5rem !important;
+    padding-left: 1.5rem !important;
+  }
+  .px-xxl-5 {
+    padding-right: 3rem !important;
+    padding-left: 3rem !important;
+  }
+  .py-xxl-0 {
+    padding-top: 0 !important;
+    padding-bottom: 0 !important;
+  }
+  .py-xxl-1 {
+    padding-top: 0.25rem !important;
+    padding-bottom: 0.25rem !important;
+  }
+  .py-xxl-2 {
+    padding-top: 0.5rem !important;
+    padding-bottom: 0.5rem !important;
+  }
+  .py-xxl-3 {
+    padding-top: 1rem !important;
+    padding-bottom: 1rem !important;
+  }
+  .py-xxl-4 {
+    padding-top: 1.5rem !important;
+    padding-bottom: 1.5rem !important;
+  }
+  .py-xxl-5 {
+    padding-top: 3rem !important;
+    padding-bottom: 3rem !important;
+  }
+  .pt-xxl-0 {
+    padding-top: 0 !important;
+  }
+  .pt-xxl-1 {
+    padding-top: 0.25rem !important;
+  }
+  .pt-xxl-2 {
+    padding-top: 0.5rem !important;
+  }
+  .pt-xxl-3 {
+    padding-top: 1rem !important;
+  }
+  .pt-xxl-4 {
+    padding-top: 1.5rem !important;
+  }
+  .pt-xxl-5 {
+    padding-top: 3rem !important;
+  }
+  .pe-xxl-0 {
+    padding-right: 0 !important;
+  }
+  .pe-xxl-1 {
+    padding-right: 0.25rem !important;
+  }
+  .pe-xxl-2 {
+    padding-right: 0.5rem !important;
+  }
+  .pe-xxl-3 {
+    padding-right: 1rem !important;
+  }
+  .pe-xxl-4 {
+    padding-right: 1.5rem !important;
+  }
+  .pe-xxl-5 {
+    padding-right: 3rem !important;
+  }
+  .pb-xxl-0 {
+    padding-bottom: 0 !important;
+  }
+  .pb-xxl-1 {
+    padding-bottom: 0.25rem !important;
+  }
+  .pb-xxl-2 {
+    padding-bottom: 0.5rem !important;
+  }
+  .pb-xxl-3 {
+    padding-bottom: 1rem !important;
+  }
+  .pb-xxl-4 {
+    padding-bottom: 1.5rem !important;
+  }
+  .pb-xxl-5 {
+    padding-bottom: 3rem !important;
+  }
+  .ps-xxl-0 {
+    padding-left: 0 !important;
+  }
+  .ps-xxl-1 {
+    padding-left: 0.25rem !important;
+  }
+  .ps-xxl-2 {
+    padding-left: 0.5rem !important;
+  }
+  .ps-xxl-3 {
+    padding-left: 1rem !important;
+  }
+  .ps-xxl-4 {
+    padding-left: 1.5rem !important;
+  }
+  .ps-xxl-5 {
+    padding-left: 3rem !important;
+  }
+  .gap-xxl-0 {
+    gap: 0 !important;
+  }
+  .gap-xxl-1 {
+    gap: 0.25rem !important;
+  }
+  .gap-xxl-2 {
+    gap: 0.5rem !important;
+  }
+  .gap-xxl-3 {
+    gap: 1rem !important;
+  }
+  .gap-xxl-4 {
+    gap: 1.5rem !important;
+  }
+  .gap-xxl-5 {
+    gap: 3rem !important;
+  }
+  .row-gap-xxl-0 {
+    row-gap: 0 !important;
+  }
+  .row-gap-xxl-1 {
+    row-gap: 0.25rem !important;
+  }
+  .row-gap-xxl-2 {
+    row-gap: 0.5rem !important;
+  }
+  .row-gap-xxl-3 {
+    row-gap: 1rem !important;
+  }
+  .row-gap-xxl-4 {
+    row-gap: 1.5rem !important;
+  }
+  .row-gap-xxl-5 {
+    row-gap: 3rem !important;
+  }
+  .column-gap-xxl-0 {
+    -moz-column-gap: 0 !important;
+    column-gap: 0 !important;
+  }
+  .column-gap-xxl-1 {
+    -moz-column-gap: 0.25rem !important;
+    column-gap: 0.25rem !important;
+  }
+  .column-gap-xxl-2 {
+    -moz-column-gap: 0.5rem !important;
+    column-gap: 0.5rem !important;
+  }
+  .column-gap-xxl-3 {
+    -moz-column-gap: 1rem !important;
+    column-gap: 1rem !important;
+  }
+  .column-gap-xxl-4 {
+    -moz-column-gap: 1.5rem !important;
+    column-gap: 1.5rem !important;
+  }
+  .column-gap-xxl-5 {
+    -moz-column-gap: 3rem !important;
+    column-gap: 3rem !important;
+  }
+  .text-xxl-start {
+    text-align: left !important;
+  }
+  .text-xxl-end {
+    text-align: right !important;
+  }
+  .text-xxl-center {
+    text-align: center !important;
+  }
+}
+@media (min-width: 1200px) {
+  .fs-1 {
+    font-size: 2.5rem !important;
+  }
+  .fs-2 {
+    font-size: 2rem !important;
+  }
+  .fs-3 {
+    font-size: 1.75rem !important;
+  }
+  .fs-4 {
+    font-size: 1.5rem !important;
+  }
+}
+@media print {
+  .d-print-inline {
+    display: inline !important;
+  }
+  .d-print-inline-block {
+    display: inline-block !important;
+  }
+  .d-print-block {
+    display: block !important;
+  }
+  .d-print-grid {
+    display: grid !important;
+  }
+  .d-print-inline-grid {
+    display: inline-grid !important;
+  }
+  .d-print-table {
+    display: table !important;
+  }
+  .d-print-table-row {
+    display: table-row !important;
+  }
+  .d-print-table-cell {
+    display: table-cell !important;
+  }
+  .d-print-flex {
+    display: flex !important;
+  }
+  .d-print-inline-flex {
+    display: inline-flex !important;
+  }
+  .d-print-none {
+    display: none !important;
+  }
+}
+
+/*# sourceMappingURL=bootstrap.css.map */
\ No newline at end of file
diff --git a/src/BCards.Web/wwwroot/lib/bootstrap/css/bootstrap.min.css b/src/BCards.Web/wwwroot/lib/bootstrap/css/bootstrap.min.css
new file mode 100644
index 0000000..f5910ac
--- /dev/null
+++ b/src/BCards.Web/wwwroot/lib/bootstrap/css/bootstrap.min.css
@@ -0,0 +1,6 @@
+@charset "UTF-8";/*!
+ * Bootstrap  v5.3.2 (https://getbootstrap.com/)
+ * Copyright 2011-2023 The Bootstrap Authors
+ * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)
+ */:root,[data-bs-theme=light]{--bs-blue:#0d6efd;--bs-indigo:#6610f2;--bs-purple:#6f42c1;--bs-pink:#d63384;--bs-red:#dc3545;--bs-orange:#fd7e14;--bs-yellow:#ffc107;--bs-green:#198754;--bs-teal:#20c997;--bs-cyan:#0dcaf0;--bs-black:#000;--bs-white:#fff;--bs-gray:#6c757d;--bs-gray-dark:#343a40;--bs-gray-100:#f8f9fa;--bs-gray-200:#e9ecef;--bs-gray-300:#dee2e6;--bs-gray-400:#ced4da;--bs-gray-500:#adb5bd;--bs-gray-600:#6c757d;--bs-gray-700:#495057;--bs-gray-800:#343a40;--bs-gray-900:#212529;--bs-primary:#0d6efd;--bs-secondary:#6c757d;--bs-success:#198754;--bs-info:#0dcaf0;--bs-warning:#ffc107;--bs-danger:#dc3545;--bs-light:#f8f9fa;--bs-dark:#212529;--bs-primary-rgb:13,110,253;--bs-secondary-rgb:108,117,125;--bs-success-rgb:25,135,84;--bs-info-rgb:13,202,240;--bs-warning-rgb:255,193,7;--bs-danger-rgb:220,53,69;--bs-light-rgb:248,249,250;--bs-dark-rgb:33,37,41;--bs-primary-text-emphasis:#052c65;--bs-secondary-text-emphasis:#2b2f32;--bs-success-text-emphasis:#0a3622;--bs-info-text-emphasis:#055160;--bs-warning-text-emphasis:#664d03;--bs-danger-text-emphasis:#58151c;--bs-light-text-emphasis:#495057;--bs-dark-text-emphasis:#495057;--bs-primary-bg-subtle:#cfe2ff;--bs-secondary-bg-subtle:#e2e3e5;--bs-success-bg-subtle:#d1e7dd;--bs-info-bg-subtle:#cff4fc;--bs-warning-bg-subtle:#fff3cd;--bs-danger-bg-subtle:#f8d7da;--bs-light-bg-subtle:#fcfcfd;--bs-dark-bg-subtle:#ced4da;--bs-primary-border-subtle:#9ec5fe;--bs-secondary-border-subtle:#c4c8cb;--bs-success-border-subtle:#a3cfbb;--bs-info-border-subtle:#9eeaf9;--bs-warning-border-subtle:#ffe69c;--bs-danger-border-subtle:#f1aeb5;--bs-light-border-subtle:#e9ecef;--bs-dark-border-subtle:#adb5bd;--bs-white-rgb:255,255,255;--bs-black-rgb:0,0,0;--bs-font-sans-serif:system-ui,-apple-system,"Segoe UI",Roboto,"Helvetica Neue","Noto Sans","Liberation Sans",Arial,sans-serif,"Apple Color Emoji","Segoe UI Emoji","Segoe UI Symbol","Noto Color Emoji";--bs-font-monospace:SFMono-Regular,Menlo,Monaco,Consolas,"Liberation Mono","Courier New",monospace;--bs-gradient:linear-gradient(180deg, rgba(255, 255, 255, 0.15), rgba(255, 255, 255, 0));--bs-body-font-family:var(--bs-font-sans-serif);--bs-body-font-size:1rem;--bs-body-font-weight:400;--bs-body-line-height:1.5;--bs-body-color:#212529;--bs-body-color-rgb:33,37,41;--bs-body-bg:#fff;--bs-body-bg-rgb:255,255,255;--bs-emphasis-color:#000;--bs-emphasis-color-rgb:0,0,0;--bs-secondary-color:rgba(33, 37, 41, 0.75);--bs-secondary-color-rgb:33,37,41;--bs-secondary-bg:#e9ecef;--bs-secondary-bg-rgb:233,236,239;--bs-tertiary-color:rgba(33, 37, 41, 0.5);--bs-tertiary-color-rgb:33,37,41;--bs-tertiary-bg:#f8f9fa;--bs-tertiary-bg-rgb:248,249,250;--bs-heading-color:inherit;--bs-link-color:#0d6efd;--bs-link-color-rgb:13,110,253;--bs-link-decoration:underline;--bs-link-hover-color:#0a58ca;--bs-link-hover-color-rgb:10,88,202;--bs-code-color:#d63384;--bs-highlight-color:#212529;--bs-highlight-bg:#fff3cd;--bs-border-width:1px;--bs-border-style:solid;--bs-border-color:#dee2e6;--bs-border-color-translucent:rgba(0, 0, 0, 0.175);--bs-border-radius:0.375rem;--bs-border-radius-sm:0.25rem;--bs-border-radius-lg:0.5rem;--bs-border-radius-xl:1rem;--bs-border-radius-xxl:2rem;--bs-border-radius-2xl:var(--bs-border-radius-xxl);--bs-border-radius-pill:50rem;--bs-box-shadow:0 0.5rem 1rem rgba(0, 0, 0, 0.15);--bs-box-shadow-sm:0 0.125rem 0.25rem rgba(0, 0, 0, 0.075);--bs-box-shadow-lg:0 1rem 3rem rgba(0, 0, 0, 0.175);--bs-box-shadow-inset:inset 0 1px 2px rgba(0, 0, 0, 0.075);--bs-focus-ring-width:0.25rem;--bs-focus-ring-opacity:0.25;--bs-focus-ring-color:rgba(13, 110, 253, 0.25);--bs-form-valid-color:#198754;--bs-form-valid-border-color:#198754;--bs-form-invalid-color:#dc3545;--bs-form-invalid-border-color:#dc3545}[data-bs-theme=dark]{color-scheme:dark;--bs-body-color:#dee2e6;--bs-body-color-rgb:222,226,230;--bs-body-bg:#212529;--bs-body-bg-rgb:33,37,41;--bs-emphasis-color:#fff;--bs-emphasis-color-rgb:255,255,255;--bs-secondary-color:rgba(222, 226, 230, 0.75);--bs-secondary-color-rgb:222,226,230;--bs-secondary-bg:#343a40;--bs-secondary-bg-rgb:52,58,64;--bs-tertiary-color:rgba(222, 226, 230, 0.5);--bs-tertiary-color-rgb:222,226,230;--bs-tertiary-bg:#2b3035;--bs-tertiary-bg-rgb:43,48,53;--bs-primary-text-emphasis:#6ea8fe;--bs-secondary-text-emphasis:#a7acb1;--bs-success-text-emphasis:#75b798;--bs-info-text-emphasis:#6edff6;--bs-warning-text-emphasis:#ffda6a;--bs-danger-text-emphasis:#ea868f;--bs-light-text-emphasis:#f8f9fa;--bs-dark-text-emphasis:#dee2e6;--bs-primary-bg-subtle:#031633;--bs-secondary-bg-subtle:#161719;--bs-success-bg-subtle:#051b11;--bs-info-bg-subtle:#032830;--bs-warning-bg-subtle:#332701;--bs-danger-bg-subtle:#2c0b0e;--bs-light-bg-subtle:#343a40;--bs-dark-bg-subtle:#1a1d20;--bs-primary-border-subtle:#084298;--bs-secondary-border-subtle:#41464b;--bs-success-border-subtle:#0f5132;--bs-info-border-subtle:#087990;--bs-warning-border-subtle:#997404;--bs-danger-border-subtle:#842029;--bs-light-border-subtle:#495057;--bs-dark-border-subtle:#343a40;--bs-heading-color:inherit;--bs-link-color:#6ea8fe;--bs-link-hover-color:#8bb9fe;--bs-link-color-rgb:110,168,254;--bs-link-hover-color-rgb:139,185,254;--bs-code-color:#e685b5;--bs-highlight-color:#dee2e6;--bs-highlight-bg:#664d03;--bs-border-color:#495057;--bs-border-color-translucent:rgba(255, 255, 255, 0.15);--bs-form-valid-color:#75b798;--bs-form-valid-border-color:#75b798;--bs-form-invalid-color:#ea868f;--bs-form-invalid-border-color:#ea868f}*,::after,::before{box-sizing:border-box}@media (prefers-reduced-motion:no-preference){:root{scroll-behavior:smooth}}body{margin:0;font-family:var(--bs-body-font-family);font-size:var(--bs-body-font-size);font-weight:var(--bs-body-font-weight);line-height:var(--bs-body-line-height);color:var(--bs-body-color);text-align:var(--bs-body-text-align);background-color:var(--bs-body-bg);-webkit-text-size-adjust:100%;-webkit-tap-highlight-color:transparent}hr{margin:1rem 0;color:inherit;border:0;border-top:var(--bs-border-width) solid;opacity:.25}.h1,.h2,.h3,.h4,.h5,.h6,h1,h2,h3,h4,h5,h6{margin-top:0;margin-bottom:.5rem;font-weight:500;line-height:1.2;color:var(--bs-heading-color)}.h1,h1{font-size:calc(1.375rem + 1.5vw)}@media (min-width:1200px){.h1,h1{font-size:2.5rem}}.h2,h2{font-size:calc(1.325rem + .9vw)}@media (min-width:1200px){.h2,h2{font-size:2rem}}.h3,h3{font-size:calc(1.3rem + .6vw)}@media (min-width:1200px){.h3,h3{font-size:1.75rem}}.h4,h4{font-size:calc(1.275rem + .3vw)}@media (min-width:1200px){.h4,h4{font-size:1.5rem}}.h5,h5{font-size:1.25rem}.h6,h6{font-size:1rem}p{margin-top:0;margin-bottom:1rem}abbr[title]{-webkit-text-decoration:underline dotted;text-decoration:underline dotted;cursor:help;-webkit-text-decoration-skip-ink:none;text-decoration-skip-ink:none}address{margin-bottom:1rem;font-style:normal;line-height:inherit}ol,ul{padding-left:2rem}dl,ol,ul{margin-top:0;margin-bottom:1rem}ol ol,ol ul,ul ol,ul ul{margin-bottom:0}dt{font-weight:700}dd{margin-bottom:.5rem;margin-left:0}blockquote{margin:0 0 1rem}b,strong{font-weight:bolder}.small,small{font-size:.875em}.mark,mark{padding:.1875em;color:var(--bs-highlight-color);background-color:var(--bs-highlight-bg)}sub,sup{position:relative;font-size:.75em;line-height:0;vertical-align:baseline}sub{bottom:-.25em}sup{top:-.5em}a{color:rgba(var(--bs-link-color-rgb),var(--bs-link-opacity,1));text-decoration:underline}a:hover{--bs-link-color-rgb:var(--bs-link-hover-color-rgb)}a:not([href]):not([class]),a:not([href]):not([class]):hover{color:inherit;text-decoration:none}code,kbd,pre,samp{font-family:var(--bs-font-monospace);font-size:1em}pre{display:block;margin-top:0;margin-bottom:1rem;overflow:auto;font-size:.875em}pre code{font-size:inherit;color:inherit;word-break:normal}code{font-size:.875em;color:var(--bs-code-color);word-wrap:break-word}a>code{color:inherit}kbd{padding:.1875rem .375rem;font-size:.875em;color:var(--bs-body-bg);background-color:var(--bs-body-color);border-radius:.25rem}kbd kbd{padding:0;font-size:1em}figure{margin:0 0 1rem}img,svg{vertical-align:middle}table{caption-side:bottom;border-collapse:collapse}caption{padding-top:.5rem;padding-bottom:.5rem;color:var(--bs-secondary-color);text-align:left}th{text-align:inherit;text-align:-webkit-match-parent}tbody,td,tfoot,th,thead,tr{border-color:inherit;border-style:solid;border-width:0}label{display:inline-block}button{border-radius:0}button:focus:not(:focus-visible){outline:0}button,input,optgroup,select,textarea{margin:0;font-family:inherit;font-size:inherit;line-height:inherit}button,select{text-transform:none}[role=button]{cursor:pointer}select{word-wrap:normal}select:disabled{opacity:1}[list]:not([type=date]):not([type=datetime-local]):not([type=month]):not([type=week]):not([type=time])::-webkit-calendar-picker-indicator{display:none!important}[type=button],[type=reset],[type=submit],button{-webkit-appearance:button}[type=button]:not(:disabled),[type=reset]:not(:disabled),[type=submit]:not(:disabled),button:not(:disabled){cursor:pointer}::-moz-focus-inner{padding:0;border-style:none}textarea{resize:vertical}fieldset{min-width:0;padding:0;margin:0;border:0}legend{float:left;width:100%;padding:0;margin-bottom:.5rem;font-size:calc(1.275rem + .3vw);line-height:inherit}@media (min-width:1200px){legend{font-size:1.5rem}}legend+*{clear:left}::-webkit-datetime-edit-day-field,::-webkit-datetime-edit-fields-wrapper,::-webkit-datetime-edit-hour-field,::-webkit-datetime-edit-minute,::-webkit-datetime-edit-month-field,::-webkit-datetime-edit-text,::-webkit-datetime-edit-year-field{padding:0}::-webkit-inner-spin-button{height:auto}[type=search]{-webkit-appearance:textfield;outline-offset:-2px}::-webkit-search-decoration{-webkit-appearance:none}::-webkit-color-swatch-wrapper{padding:0}::-webkit-file-upload-button{font:inherit;-webkit-appearance:button}::file-selector-button{font:inherit;-webkit-appearance:button}output{display:inline-block}iframe{border:0}summary{display:list-item;cursor:pointer}progress{vertical-align:baseline}[hidden]{display:none!important}.lead{font-size:1.25rem;font-weight:300}.display-1{font-size:calc(1.625rem + 4.5vw);font-weight:300;line-height:1.2}@media (min-width:1200px){.display-1{font-size:5rem}}.display-2{font-size:calc(1.575rem + 3.9vw);font-weight:300;line-height:1.2}@media (min-width:1200px){.display-2{font-size:4.5rem}}.display-3{font-size:calc(1.525rem + 3.3vw);font-weight:300;line-height:1.2}@media (min-width:1200px){.display-3{font-size:4rem}}.display-4{font-size:calc(1.475rem + 2.7vw);font-weight:300;line-height:1.2}@media (min-width:1200px){.display-4{font-size:3.5rem}}.display-5{font-size:calc(1.425rem + 2.1vw);font-weight:300;line-height:1.2}@media (min-width:1200px){.display-5{font-size:3rem}}.display-6{font-size:calc(1.375rem + 1.5vw);font-weight:300;line-height:1.2}@media (min-width:1200px){.display-6{font-size:2.5rem}}.list-unstyled{padding-left:0;list-style:none}.list-inline{padding-left:0;list-style:none}.list-inline-item{display:inline-block}.list-inline-item:not(:last-child){margin-right:.5rem}.initialism{font-size:.875em;text-transform:uppercase}.blockquote{margin-bottom:1rem;font-size:1.25rem}.blockquote>:last-child{margin-bottom:0}.blockquote-footer{margin-top:-1rem;margin-bottom:1rem;font-size:.875em;color:#6c757d}.blockquote-footer::before{content:"— "}.img-fluid{max-width:100%;height:auto}.img-thumbnail{padding:.25rem;background-color:var(--bs-body-bg);border:var(--bs-border-width) solid var(--bs-border-color);border-radius:var(--bs-border-radius);max-width:100%;height:auto}.figure{display:inline-block}.figure-img{margin-bottom:.5rem;line-height:1}.figure-caption{font-size:.875em;color:var(--bs-secondary-color)}.container,.container-fluid,.container-lg,.container-md,.container-sm,.container-xl,.container-xxl{--bs-gutter-x:1.5rem;--bs-gutter-y:0;width:100%;padding-right:calc(var(--bs-gutter-x) * .5);padding-left:calc(var(--bs-gutter-x) * .5);margin-right:auto;margin-left:auto}@media (min-width:576px){.container,.container-sm{max-width:540px}}@media (min-width:768px){.container,.container-md,.container-sm{max-width:720px}}@media (min-width:992px){.container,.container-lg,.container-md,.container-sm{max-width:960px}}@media (min-width:1200px){.container,.container-lg,.container-md,.container-sm,.container-xl{max-width:1140px}}@media (min-width:1400px){.container,.container-lg,.container-md,.container-sm,.container-xl,.container-xxl{max-width:1320px}}:root{--bs-breakpoint-xs:0;--bs-breakpoint-sm:576px;--bs-breakpoint-md:768px;--bs-breakpoint-lg:992px;--bs-breakpoint-xl:1200px;--bs-breakpoint-xxl:1400px}.row{--bs-gutter-x:1.5rem;--bs-gutter-y:0;display:flex;flex-wrap:wrap;margin-top:calc(-1 * var(--bs-gutter-y));margin-right:calc(-.5 * var(--bs-gutter-x));margin-left:calc(-.5 * var(--bs-gutter-x))}.row>*{flex-shrink:0;width:100%;max-width:100%;padding-right:calc(var(--bs-gutter-x) * .5);padding-left:calc(var(--bs-gutter-x) * .5);margin-top:var(--bs-gutter-y)}.col{flex:1 0 0%}.row-cols-auto>*{flex:0 0 auto;width:auto}.row-cols-1>*{flex:0 0 auto;width:100%}.row-cols-2>*{flex:0 0 auto;width:50%}.row-cols-3>*{flex:0 0 auto;width:33.33333333%}.row-cols-4>*{flex:0 0 auto;width:25%}.row-cols-5>*{flex:0 0 auto;width:20%}.row-cols-6>*{flex:0 0 auto;width:16.66666667%}.col-auto{flex:0 0 auto;width:auto}.col-1{flex:0 0 auto;width:8.33333333%}.col-2{flex:0 0 auto;width:16.66666667%}.col-3{flex:0 0 auto;width:25%}.col-4{flex:0 0 auto;width:33.33333333%}.col-5{flex:0 0 auto;width:41.66666667%}.col-6{flex:0 0 auto;width:50%}.col-7{flex:0 0 auto;width:58.33333333%}.col-8{flex:0 0 auto;width:66.66666667%}.col-9{flex:0 0 auto;width:75%}.col-10{flex:0 0 auto;width:83.33333333%}.col-11{flex:0 0 auto;width:91.66666667%}.col-12{flex:0 0 auto;width:100%}.offset-1{margin-left:8.33333333%}.offset-2{margin-left:16.66666667%}.offset-3{margin-left:25%}.offset-4{margin-left:33.33333333%}.offset-5{margin-left:41.66666667%}.offset-6{margin-left:50%}.offset-7{margin-left:58.33333333%}.offset-8{margin-left:66.66666667%}.offset-9{margin-left:75%}.offset-10{margin-left:83.33333333%}.offset-11{margin-left:91.66666667%}.g-0,.gx-0{--bs-gutter-x:0}.g-0,.gy-0{--bs-gutter-y:0}.g-1,.gx-1{--bs-gutter-x:0.25rem}.g-1,.gy-1{--bs-gutter-y:0.25rem}.g-2,.gx-2{--bs-gutter-x:0.5rem}.g-2,.gy-2{--bs-gutter-y:0.5rem}.g-3,.gx-3{--bs-gutter-x:1rem}.g-3,.gy-3{--bs-gutter-y:1rem}.g-4,.gx-4{--bs-gutter-x:1.5rem}.g-4,.gy-4{--bs-gutter-y:1.5rem}.g-5,.gx-5{--bs-gutter-x:3rem}.g-5,.gy-5{--bs-gutter-y:3rem}@media (min-width:576px){.col-sm{flex:1 0 0%}.row-cols-sm-auto>*{flex:0 0 auto;width:auto}.row-cols-sm-1>*{flex:0 0 auto;width:100%}.row-cols-sm-2>*{flex:0 0 auto;width:50%}.row-cols-sm-3>*{flex:0 0 auto;width:33.33333333%}.row-cols-sm-4>*{flex:0 0 auto;width:25%}.row-cols-sm-5>*{flex:0 0 auto;width:20%}.row-cols-sm-6>*{flex:0 0 auto;width:16.66666667%}.col-sm-auto{flex:0 0 auto;width:auto}.col-sm-1{flex:0 0 auto;width:8.33333333%}.col-sm-2{flex:0 0 auto;width:16.66666667%}.col-sm-3{flex:0 0 auto;width:25%}.col-sm-4{flex:0 0 auto;width:33.33333333%}.col-sm-5{flex:0 0 auto;width:41.66666667%}.col-sm-6{flex:0 0 auto;width:50%}.col-sm-7{flex:0 0 auto;width:58.33333333%}.col-sm-8{flex:0 0 auto;width:66.66666667%}.col-sm-9{flex:0 0 auto;width:75%}.col-sm-10{flex:0 0 auto;width:83.33333333%}.col-sm-11{flex:0 0 auto;width:91.66666667%}.col-sm-12{flex:0 0 auto;width:100%}.offset-sm-0{margin-left:0}.offset-sm-1{margin-left:8.33333333%}.offset-sm-2{margin-left:16.66666667%}.offset-sm-3{margin-left:25%}.offset-sm-4{margin-left:33.33333333%}.offset-sm-5{margin-left:41.66666667%}.offset-sm-6{margin-left:50%}.offset-sm-7{margin-left:58.33333333%}.offset-sm-8{margin-left:66.66666667%}.offset-sm-9{margin-left:75%}.offset-sm-10{margin-left:83.33333333%}.offset-sm-11{margin-left:91.66666667%}.g-sm-0,.gx-sm-0{--bs-gutter-x:0}.g-sm-0,.gy-sm-0{--bs-gutter-y:0}.g-sm-1,.gx-sm-1{--bs-gutter-x:0.25rem}.g-sm-1,.gy-sm-1{--bs-gutter-y:0.25rem}.g-sm-2,.gx-sm-2{--bs-gutter-x:0.5rem}.g-sm-2,.gy-sm-2{--bs-gutter-y:0.5rem}.g-sm-3,.gx-sm-3{--bs-gutter-x:1rem}.g-sm-3,.gy-sm-3{--bs-gutter-y:1rem}.g-sm-4,.gx-sm-4{--bs-gutter-x:1.5rem}.g-sm-4,.gy-sm-4{--bs-gutter-y:1.5rem}.g-sm-5,.gx-sm-5{--bs-gutter-x:3rem}.g-sm-5,.gy-sm-5{--bs-gutter-y:3rem}}@media (min-width:768px){.col-md{flex:1 0 0%}.row-cols-md-auto>*{flex:0 0 auto;width:auto}.row-cols-md-1>*{flex:0 0 auto;width:100%}.row-cols-md-2>*{flex:0 0 auto;width:50%}.row-cols-md-3>*{flex:0 0 auto;width:33.33333333%}.row-cols-md-4>*{flex:0 0 auto;width:25%}.row-cols-md-5>*{flex:0 0 auto;width:20%}.row-cols-md-6>*{flex:0 0 auto;width:16.66666667%}.col-md-auto{flex:0 0 auto;width:auto}.col-md-1{flex:0 0 auto;width:8.33333333%}.col-md-2{flex:0 0 auto;width:16.66666667%}.col-md-3{flex:0 0 auto;width:25%}.col-md-4{flex:0 0 auto;width:33.33333333%}.col-md-5{flex:0 0 auto;width:41.66666667%}.col-md-6{flex:0 0 auto;width:50%}.col-md-7{flex:0 0 auto;width:58.33333333%}.col-md-8{flex:0 0 auto;width:66.66666667%}.col-md-9{flex:0 0 auto;width:75%}.col-md-10{flex:0 0 auto;width:83.33333333%}.col-md-11{flex:0 0 auto;width:91.66666667%}.col-md-12{flex:0 0 auto;width:100%}.offset-md-0{margin-left:0}.offset-md-1{margin-left:8.33333333%}.offset-md-2{margin-left:16.66666667%}.offset-md-3{margin-left:25%}.offset-md-4{margin-left:33.33333333%}.offset-md-5{margin-left:41.66666667%}.offset-md-6{margin-left:50%}.offset-md-7{margin-left:58.33333333%}.offset-md-8{margin-left:66.66666667%}.offset-md-9{margin-left:75%}.offset-md-10{margin-left:83.33333333%}.offset-md-11{margin-left:91.66666667%}.g-md-0,.gx-md-0{--bs-gutter-x:0}.g-md-0,.gy-md-0{--bs-gutter-y:0}.g-md-1,.gx-md-1{--bs-gutter-x:0.25rem}.g-md-1,.gy-md-1{--bs-gutter-y:0.25rem}.g-md-2,.gx-md-2{--bs-gutter-x:0.5rem}.g-md-2,.gy-md-2{--bs-gutter-y:0.5rem}.g-md-3,.gx-md-3{--bs-gutter-x:1rem}.g-md-3,.gy-md-3{--bs-gutter-y:1rem}.g-md-4,.gx-md-4{--bs-gutter-x:1.5rem}.g-md-4,.gy-md-4{--bs-gutter-y:1.5rem}.g-md-5,.gx-md-5{--bs-gutter-x:3rem}.g-md-5,.gy-md-5{--bs-gutter-y:3rem}}@media (min-width:992px){.col-lg{flex:1 0 0%}.row-cols-lg-auto>*{flex:0 0 auto;width:auto}.row-cols-lg-1>*{flex:0 0 auto;width:100%}.row-cols-lg-2>*{flex:0 0 auto;width:50%}.row-cols-lg-3>*{flex:0 0 auto;width:33.33333333%}.row-cols-lg-4>*{flex:0 0 auto;width:25%}.row-cols-lg-5>*{flex:0 0 auto;width:20%}.row-cols-lg-6>*{flex:0 0 auto;width:16.66666667%}.col-lg-auto{flex:0 0 auto;width:auto}.col-lg-1{flex:0 0 auto;width:8.33333333%}.col-lg-2{flex:0 0 auto;width:16.66666667%}.col-lg-3{flex:0 0 auto;width:25%}.col-lg-4{flex:0 0 auto;width:33.33333333%}.col-lg-5{flex:0 0 auto;width:41.66666667%}.col-lg-6{flex:0 0 auto;width:50%}.col-lg-7{flex:0 0 auto;width:58.33333333%}.col-lg-8{flex:0 0 auto;width:66.66666667%}.col-lg-9{flex:0 0 auto;width:75%}.col-lg-10{flex:0 0 auto;width:83.33333333%}.col-lg-11{flex:0 0 auto;width:91.66666667%}.col-lg-12{flex:0 0 auto;width:100%}.offset-lg-0{margin-left:0}.offset-lg-1{margin-left:8.33333333%}.offset-lg-2{margin-left:16.66666667%}.offset-lg-3{margin-left:25%}.offset-lg-4{margin-left:33.33333333%}.offset-lg-5{margin-left:41.66666667%}.offset-lg-6{margin-left:50%}.offset-lg-7{margin-left:58.33333333%}.offset-lg-8{margin-left:66.66666667%}.offset-lg-9{margin-left:75%}.offset-lg-10{margin-left:83.33333333%}.offset-lg-11{margin-left:91.66666667%}.g-lg-0,.gx-lg-0{--bs-gutter-x:0}.g-lg-0,.gy-lg-0{--bs-gutter-y:0}.g-lg-1,.gx-lg-1{--bs-gutter-x:0.25rem}.g-lg-1,.gy-lg-1{--bs-gutter-y:0.25rem}.g-lg-2,.gx-lg-2{--bs-gutter-x:0.5rem}.g-lg-2,.gy-lg-2{--bs-gutter-y:0.5rem}.g-lg-3,.gx-lg-3{--bs-gutter-x:1rem}.g-lg-3,.gy-lg-3{--bs-gutter-y:1rem}.g-lg-4,.gx-lg-4{--bs-gutter-x:1.5rem}.g-lg-4,.gy-lg-4{--bs-gutter-y:1.5rem}.g-lg-5,.gx-lg-5{--bs-gutter-x:3rem}.g-lg-5,.gy-lg-5{--bs-gutter-y:3rem}}@media (min-width:1200px){.col-xl{flex:1 0 0%}.row-cols-xl-auto>*{flex:0 0 auto;width:auto}.row-cols-xl-1>*{flex:0 0 auto;width:100%}.row-cols-xl-2>*{flex:0 0 auto;width:50%}.row-cols-xl-3>*{flex:0 0 auto;width:33.33333333%}.row-cols-xl-4>*{flex:0 0 auto;width:25%}.row-cols-xl-5>*{flex:0 0 auto;width:20%}.row-cols-xl-6>*{flex:0 0 auto;width:16.66666667%}.col-xl-auto{flex:0 0 auto;width:auto}.col-xl-1{flex:0 0 auto;width:8.33333333%}.col-xl-2{flex:0 0 auto;width:16.66666667%}.col-xl-3{flex:0 0 auto;width:25%}.col-xl-4{flex:0 0 auto;width:33.33333333%}.col-xl-5{flex:0 0 auto;width:41.66666667%}.col-xl-6{flex:0 0 auto;width:50%}.col-xl-7{flex:0 0 auto;width:58.33333333%}.col-xl-8{flex:0 0 auto;width:66.66666667%}.col-xl-9{flex:0 0 auto;width:75%}.col-xl-10{flex:0 0 auto;width:83.33333333%}.col-xl-11{flex:0 0 auto;width:91.66666667%}.col-xl-12{flex:0 0 auto;width:100%}.offset-xl-0{margin-left:0}.offset-xl-1{margin-left:8.33333333%}.offset-xl-2{margin-left:16.66666667%}.offset-xl-3{margin-left:25%}.offset-xl-4{margin-left:33.33333333%}.offset-xl-5{margin-left:41.66666667%}.offset-xl-6{margin-left:50%}.offset-xl-7{margin-left:58.33333333%}.offset-xl-8{margin-left:66.66666667%}.offset-xl-9{margin-left:75%}.offset-xl-10{margin-left:83.33333333%}.offset-xl-11{margin-left:91.66666667%}.g-xl-0,.gx-xl-0{--bs-gutter-x:0}.g-xl-0,.gy-xl-0{--bs-gutter-y:0}.g-xl-1,.gx-xl-1{--bs-gutter-x:0.25rem}.g-xl-1,.gy-xl-1{--bs-gutter-y:0.25rem}.g-xl-2,.gx-xl-2{--bs-gutter-x:0.5rem}.g-xl-2,.gy-xl-2{--bs-gutter-y:0.5rem}.g-xl-3,.gx-xl-3{--bs-gutter-x:1rem}.g-xl-3,.gy-xl-3{--bs-gutter-y:1rem}.g-xl-4,.gx-xl-4{--bs-gutter-x:1.5rem}.g-xl-4,.gy-xl-4{--bs-gutter-y:1.5rem}.g-xl-5,.gx-xl-5{--bs-gutter-x:3rem}.g-xl-5,.gy-xl-5{--bs-gutter-y:3rem}}@media (min-width:1400px){.col-xxl{flex:1 0 0%}.row-cols-xxl-auto>*{flex:0 0 auto;width:auto}.row-cols-xxl-1>*{flex:0 0 auto;width:100%}.row-cols-xxl-2>*{flex:0 0 auto;width:50%}.row-cols-xxl-3>*{flex:0 0 auto;width:33.33333333%}.row-cols-xxl-4>*{flex:0 0 auto;width:25%}.row-cols-xxl-5>*{flex:0 0 auto;width:20%}.row-cols-xxl-6>*{flex:0 0 auto;width:16.66666667%}.col-xxl-auto{flex:0 0 auto;width:auto}.col-xxl-1{flex:0 0 auto;width:8.33333333%}.col-xxl-2{flex:0 0 auto;width:16.66666667%}.col-xxl-3{flex:0 0 auto;width:25%}.col-xxl-4{flex:0 0 auto;width:33.33333333%}.col-xxl-5{flex:0 0 auto;width:41.66666667%}.col-xxl-6{flex:0 0 auto;width:50%}.col-xxl-7{flex:0 0 auto;width:58.33333333%}.col-xxl-8{flex:0 0 auto;width:66.66666667%}.col-xxl-9{flex:0 0 auto;width:75%}.col-xxl-10{flex:0 0 auto;width:83.33333333%}.col-xxl-11{flex:0 0 auto;width:91.66666667%}.col-xxl-12{flex:0 0 auto;width:100%}.offset-xxl-0{margin-left:0}.offset-xxl-1{margin-left:8.33333333%}.offset-xxl-2{margin-left:16.66666667%}.offset-xxl-3{margin-left:25%}.offset-xxl-4{margin-left:33.33333333%}.offset-xxl-5{margin-left:41.66666667%}.offset-xxl-6{margin-left:50%}.offset-xxl-7{margin-left:58.33333333%}.offset-xxl-8{margin-left:66.66666667%}.offset-xxl-9{margin-left:75%}.offset-xxl-10{margin-left:83.33333333%}.offset-xxl-11{margin-left:91.66666667%}.g-xxl-0,.gx-xxl-0{--bs-gutter-x:0}.g-xxl-0,.gy-xxl-0{--bs-gutter-y:0}.g-xxl-1,.gx-xxl-1{--bs-gutter-x:0.25rem}.g-xxl-1,.gy-xxl-1{--bs-gutter-y:0.25rem}.g-xxl-2,.gx-xxl-2{--bs-gutter-x:0.5rem}.g-xxl-2,.gy-xxl-2{--bs-gutter-y:0.5rem}.g-xxl-3,.gx-xxl-3{--bs-gutter-x:1rem}.g-xxl-3,.gy-xxl-3{--bs-gutter-y:1rem}.g-xxl-4,.gx-xxl-4{--bs-gutter-x:1.5rem}.g-xxl-4,.gy-xxl-4{--bs-gutter-y:1.5rem}.g-xxl-5,.gx-xxl-5{--bs-gutter-x:3rem}.g-xxl-5,.gy-xxl-5{--bs-gutter-y:3rem}}.table{--bs-table-color-type:initial;--bs-table-bg-type:initial;--bs-table-color-state:initial;--bs-table-bg-state:initial;--bs-table-color:var(--bs-emphasis-color);--bs-table-bg:var(--bs-body-bg);--bs-table-border-color:var(--bs-border-color);--bs-table-accent-bg:transparent;--bs-table-striped-color:var(--bs-emphasis-color);--bs-table-striped-bg:rgba(var(--bs-emphasis-color-rgb), 0.05);--bs-table-active-color:var(--bs-emphasis-color);--bs-table-active-bg:rgba(var(--bs-emphasis-color-rgb), 0.1);--bs-table-hover-color:var(--bs-emphasis-color);--bs-table-hover-bg:rgba(var(--bs-emphasis-color-rgb), 0.075);width:100%;margin-bottom:1rem;vertical-align:top;border-color:var(--bs-table-border-color)}.table>:not(caption)>*>*{padding:.5rem .5rem;color:var(--bs-table-color-state,var(--bs-table-color-type,var(--bs-table-color)));background-color:var(--bs-table-bg);border-bottom-width:var(--bs-border-width);box-shadow:inset 0 0 0 9999px var(--bs-table-bg-state,var(--bs-table-bg-type,var(--bs-table-accent-bg)))}.table>tbody{vertical-align:inherit}.table>thead{vertical-align:bottom}.table-group-divider{border-top:calc(var(--bs-border-width) * 2) solid currentcolor}.caption-top{caption-side:top}.table-sm>:not(caption)>*>*{padding:.25rem .25rem}.table-bordered>:not(caption)>*{border-width:var(--bs-border-width) 0}.table-bordered>:not(caption)>*>*{border-width:0 var(--bs-border-width)}.table-borderless>:not(caption)>*>*{border-bottom-width:0}.table-borderless>:not(:first-child){border-top-width:0}.table-striped>tbody>tr:nth-of-type(odd)>*{--bs-table-color-type:var(--bs-table-striped-color);--bs-table-bg-type:var(--bs-table-striped-bg)}.table-striped-columns>:not(caption)>tr>:nth-child(2n){--bs-table-color-type:var(--bs-table-striped-color);--bs-table-bg-type:var(--bs-table-striped-bg)}.table-active{--bs-table-color-state:var(--bs-table-active-color);--bs-table-bg-state:var(--bs-table-active-bg)}.table-hover>tbody>tr:hover>*{--bs-table-color-state:var(--bs-table-hover-color);--bs-table-bg-state:var(--bs-table-hover-bg)}.table-primary{--bs-table-color:#000;--bs-table-bg:#cfe2ff;--bs-table-border-color:#a6b5cc;--bs-table-striped-bg:#c5d7f2;--bs-table-striped-color:#000;--bs-table-active-bg:#bacbe6;--bs-table-active-color:#000;--bs-table-hover-bg:#bfd1ec;--bs-table-hover-color:#000;color:var(--bs-table-color);border-color:var(--bs-table-border-color)}.table-secondary{--bs-table-color:#000;--bs-table-bg:#e2e3e5;--bs-table-border-color:#b5b6b7;--bs-table-striped-bg:#d7d8da;--bs-table-striped-color:#000;--bs-table-active-bg:#cbccce;--bs-table-active-color:#000;--bs-table-hover-bg:#d1d2d4;--bs-table-hover-color:#000;color:var(--bs-table-color);border-color:var(--bs-table-border-color)}.table-success{--bs-table-color:#000;--bs-table-bg:#d1e7dd;--bs-table-border-color:#a7b9b1;--bs-table-striped-bg:#c7dbd2;--bs-table-striped-color:#000;--bs-table-active-bg:#bcd0c7;--bs-table-active-color:#000;--bs-table-hover-bg:#c1d6cc;--bs-table-hover-color:#000;color:var(--bs-table-color);border-color:var(--bs-table-border-color)}.table-info{--bs-table-color:#000;--bs-table-bg:#cff4fc;--bs-table-border-color:#a6c3ca;--bs-table-striped-bg:#c5e8ef;--bs-table-striped-color:#000;--bs-table-active-bg:#badce3;--bs-table-active-color:#000;--bs-table-hover-bg:#bfe2e9;--bs-table-hover-color:#000;color:var(--bs-table-color);border-color:var(--bs-table-border-color)}.table-warning{--bs-table-color:#000;--bs-table-bg:#fff3cd;--bs-table-border-color:#ccc2a4;--bs-table-striped-bg:#f2e7c3;--bs-table-striped-color:#000;--bs-table-active-bg:#e6dbb9;--bs-table-active-color:#000;--bs-table-hover-bg:#ece1be;--bs-table-hover-color:#000;color:var(--bs-table-color);border-color:var(--bs-table-border-color)}.table-danger{--bs-table-color:#000;--bs-table-bg:#f8d7da;--bs-table-border-color:#c6acae;--bs-table-striped-bg:#eccccf;--bs-table-striped-color:#000;--bs-table-active-bg:#dfc2c4;--bs-table-active-color:#000;--bs-table-hover-bg:#e5c7ca;--bs-table-hover-color:#000;color:var(--bs-table-color);border-color:var(--bs-table-border-color)}.table-light{--bs-table-color:#000;--bs-table-bg:#f8f9fa;--bs-table-border-color:#c6c7c8;--bs-table-striped-bg:#ecedee;--bs-table-striped-color:#000;--bs-table-active-bg:#dfe0e1;--bs-table-active-color:#000;--bs-table-hover-bg:#e5e6e7;--bs-table-hover-color:#000;color:var(--bs-table-color);border-color:var(--bs-table-border-color)}.table-dark{--bs-table-color:#fff;--bs-table-bg:#212529;--bs-table-border-color:#4d5154;--bs-table-striped-bg:#2c3034;--bs-table-striped-color:#fff;--bs-table-active-bg:#373b3e;--bs-table-active-color:#fff;--bs-table-hover-bg:#323539;--bs-table-hover-color:#fff;color:var(--bs-table-color);border-color:var(--bs-table-border-color)}.table-responsive{overflow-x:auto;-webkit-overflow-scrolling:touch}@media (max-width:575.98px){.table-responsive-sm{overflow-x:auto;-webkit-overflow-scrolling:touch}}@media (max-width:767.98px){.table-responsive-md{overflow-x:auto;-webkit-overflow-scrolling:touch}}@media (max-width:991.98px){.table-responsive-lg{overflow-x:auto;-webkit-overflow-scrolling:touch}}@media (max-width:1199.98px){.table-responsive-xl{overflow-x:auto;-webkit-overflow-scrolling:touch}}@media (max-width:1399.98px){.table-responsive-xxl{overflow-x:auto;-webkit-overflow-scrolling:touch}}.form-label{margin-bottom:.5rem}.col-form-label{padding-top:calc(.375rem + var(--bs-border-width));padding-bottom:calc(.375rem + var(--bs-border-width));margin-bottom:0;font-size:inherit;line-height:1.5}.col-form-label-lg{padding-top:calc(.5rem + var(--bs-border-width));padding-bottom:calc(.5rem + var(--bs-border-width));font-size:1.25rem}.col-form-label-sm{padding-top:calc(.25rem + var(--bs-border-width));padding-bottom:calc(.25rem + var(--bs-border-width));font-size:.875rem}.form-text{margin-top:.25rem;font-size:.875em;color:var(--bs-secondary-color)}.form-control{display:block;width:100%;padding:.375rem .75rem;font-size:1rem;font-weight:400;line-height:1.5;color:var(--bs-body-color);-webkit-appearance:none;-moz-appearance:none;appearance:none;background-color:var(--bs-body-bg);background-clip:padding-box;border:var(--bs-border-width) solid var(--bs-border-color);border-radius:var(--bs-border-radius);transition:border-color .15s ease-in-out,box-shadow .15s ease-in-out}@media (prefers-reduced-motion:reduce){.form-control{transition:none}}.form-control[type=file]{overflow:hidden}.form-control[type=file]:not(:disabled):not([readonly]){cursor:pointer}.form-control:focus{color:var(--bs-body-color);background-color:var(--bs-body-bg);border-color:#86b7fe;outline:0;box-shadow:0 0 0 .25rem rgba(13,110,253,.25)}.form-control::-webkit-date-and-time-value{min-width:85px;height:1.5em;margin:0}.form-control::-webkit-datetime-edit{display:block;padding:0}.form-control::-moz-placeholder{color:var(--bs-secondary-color);opacity:1}.form-control::placeholder{color:var(--bs-secondary-color);opacity:1}.form-control:disabled{background-color:var(--bs-secondary-bg);opacity:1}.form-control::-webkit-file-upload-button{padding:.375rem .75rem;margin:-.375rem -.75rem;-webkit-margin-end:.75rem;margin-inline-end:.75rem;color:var(--bs-body-color);background-color:var(--bs-tertiary-bg);pointer-events:none;border-color:inherit;border-style:solid;border-width:0;border-inline-end-width:var(--bs-border-width);border-radius:0;-webkit-transition:color .15s ease-in-out,background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out;transition:color .15s ease-in-out,background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out}.form-control::file-selector-button{padding:.375rem .75rem;margin:-.375rem -.75rem;-webkit-margin-end:.75rem;margin-inline-end:.75rem;color:var(--bs-body-color);background-color:var(--bs-tertiary-bg);pointer-events:none;border-color:inherit;border-style:solid;border-width:0;border-inline-end-width:var(--bs-border-width);border-radius:0;transition:color .15s ease-in-out,background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out}@media (prefers-reduced-motion:reduce){.form-control::-webkit-file-upload-button{-webkit-transition:none;transition:none}.form-control::file-selector-button{transition:none}}.form-control:hover:not(:disabled):not([readonly])::-webkit-file-upload-button{background-color:var(--bs-secondary-bg)}.form-control:hover:not(:disabled):not([readonly])::file-selector-button{background-color:var(--bs-secondary-bg)}.form-control-plaintext{display:block;width:100%;padding:.375rem 0;margin-bottom:0;line-height:1.5;color:var(--bs-body-color);background-color:transparent;border:solid transparent;border-width:var(--bs-border-width) 0}.form-control-plaintext:focus{outline:0}.form-control-plaintext.form-control-lg,.form-control-plaintext.form-control-sm{padding-right:0;padding-left:0}.form-control-sm{min-height:calc(1.5em + .5rem + calc(var(--bs-border-width) * 2));padding:.25rem .5rem;font-size:.875rem;border-radius:var(--bs-border-radius-sm)}.form-control-sm::-webkit-file-upload-button{padding:.25rem .5rem;margin:-.25rem -.5rem;-webkit-margin-end:.5rem;margin-inline-end:.5rem}.form-control-sm::file-selector-button{padding:.25rem .5rem;margin:-.25rem -.5rem;-webkit-margin-end:.5rem;margin-inline-end:.5rem}.form-control-lg{min-height:calc(1.5em + 1rem + calc(var(--bs-border-width) * 2));padding:.5rem 1rem;font-size:1.25rem;border-radius:var(--bs-border-radius-lg)}.form-control-lg::-webkit-file-upload-button{padding:.5rem 1rem;margin:-.5rem -1rem;-webkit-margin-end:1rem;margin-inline-end:1rem}.form-control-lg::file-selector-button{padding:.5rem 1rem;margin:-.5rem -1rem;-webkit-margin-end:1rem;margin-inline-end:1rem}textarea.form-control{min-height:calc(1.5em + .75rem + calc(var(--bs-border-width) * 2))}textarea.form-control-sm{min-height:calc(1.5em + .5rem + calc(var(--bs-border-width) * 2))}textarea.form-control-lg{min-height:calc(1.5em + 1rem + calc(var(--bs-border-width) * 2))}.form-control-color{width:3rem;height:calc(1.5em + .75rem + calc(var(--bs-border-width) * 2));padding:.375rem}.form-control-color:not(:disabled):not([readonly]){cursor:pointer}.form-control-color::-moz-color-swatch{border:0!important;border-radius:var(--bs-border-radius)}.form-control-color::-webkit-color-swatch{border:0!important;border-radius:var(--bs-border-radius)}.form-control-color.form-control-sm{height:calc(1.5em + .5rem + calc(var(--bs-border-width) * 2))}.form-control-color.form-control-lg{height:calc(1.5em + 1rem + calc(var(--bs-border-width) * 2))}.form-select{--bs-form-select-bg-img:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16'%3e%3cpath fill='none' stroke='%23343a40' stroke-linecap='round' stroke-linejoin='round' stroke-width='2' d='m2 5 6 6 6-6'/%3e%3c/svg%3e");display:block;width:100%;padding:.375rem 2.25rem .375rem .75rem;font-size:1rem;font-weight:400;line-height:1.5;color:var(--bs-body-color);-webkit-appearance:none;-moz-appearance:none;appearance:none;background-color:var(--bs-body-bg);background-image:var(--bs-form-select-bg-img),var(--bs-form-select-bg-icon,none);background-repeat:no-repeat;background-position:right .75rem center;background-size:16px 12px;border:var(--bs-border-width) solid var(--bs-border-color);border-radius:var(--bs-border-radius);transition:border-color .15s ease-in-out,box-shadow .15s ease-in-out}@media (prefers-reduced-motion:reduce){.form-select{transition:none}}.form-select:focus{border-color:#86b7fe;outline:0;box-shadow:0 0 0 .25rem rgba(13,110,253,.25)}.form-select[multiple],.form-select[size]:not([size="1"]){padding-right:.75rem;background-image:none}.form-select:disabled{background-color:var(--bs-secondary-bg)}.form-select:-moz-focusring{color:transparent;text-shadow:0 0 0 var(--bs-body-color)}.form-select-sm{padding-top:.25rem;padding-bottom:.25rem;padding-left:.5rem;font-size:.875rem;border-radius:var(--bs-border-radius-sm)}.form-select-lg{padding-top:.5rem;padding-bottom:.5rem;padding-left:1rem;font-size:1.25rem;border-radius:var(--bs-border-radius-lg)}[data-bs-theme=dark] .form-select{--bs-form-select-bg-img:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16'%3e%3cpath fill='none' stroke='%23dee2e6' stroke-linecap='round' stroke-linejoin='round' stroke-width='2' d='m2 5 6 6 6-6'/%3e%3c/svg%3e")}.form-check{display:block;min-height:1.5rem;padding-left:1.5em;margin-bottom:.125rem}.form-check .form-check-input{float:left;margin-left:-1.5em}.form-check-reverse{padding-right:1.5em;padding-left:0;text-align:right}.form-check-reverse .form-check-input{float:right;margin-right:-1.5em;margin-left:0}.form-check-input{--bs-form-check-bg:var(--bs-body-bg);flex-shrink:0;width:1em;height:1em;margin-top:.25em;vertical-align:top;-webkit-appearance:none;-moz-appearance:none;appearance:none;background-color:var(--bs-form-check-bg);background-image:var(--bs-form-check-bg-image);background-repeat:no-repeat;background-position:center;background-size:contain;border:var(--bs-border-width) solid var(--bs-border-color);-webkit-print-color-adjust:exact;color-adjust:exact;print-color-adjust:exact}.form-check-input[type=checkbox]{border-radius:.25em}.form-check-input[type=radio]{border-radius:50%}.form-check-input:active{filter:brightness(90%)}.form-check-input:focus{border-color:#86b7fe;outline:0;box-shadow:0 0 0 .25rem rgba(13,110,253,.25)}.form-check-input:checked{background-color:#0d6efd;border-color:#0d6efd}.form-check-input:checked[type=checkbox]{--bs-form-check-bg-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 20 20'%3e%3cpath fill='none' stroke='%23fff' stroke-linecap='round' stroke-linejoin='round' stroke-width='3' d='m6 10 3 3 6-6'/%3e%3c/svg%3e")}.form-check-input:checked[type=radio]{--bs-form-check-bg-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='-4 -4 8 8'%3e%3ccircle r='2' fill='%23fff'/%3e%3c/svg%3e")}.form-check-input[type=checkbox]:indeterminate{background-color:#0d6efd;border-color:#0d6efd;--bs-form-check-bg-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 20 20'%3e%3cpath fill='none' stroke='%23fff' stroke-linecap='round' stroke-linejoin='round' stroke-width='3' d='M6 10h8'/%3e%3c/svg%3e")}.form-check-input:disabled{pointer-events:none;filter:none;opacity:.5}.form-check-input:disabled~.form-check-label,.form-check-input[disabled]~.form-check-label{cursor:default;opacity:.5}.form-switch{padding-left:2.5em}.form-switch .form-check-input{--bs-form-switch-bg:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='-4 -4 8 8'%3e%3ccircle r='3' fill='rgba%280, 0, 0, 0.25%29'/%3e%3c/svg%3e");width:2em;margin-left:-2.5em;background-image:var(--bs-form-switch-bg);background-position:left center;border-radius:2em;transition:background-position .15s ease-in-out}@media (prefers-reduced-motion:reduce){.form-switch .form-check-input{transition:none}}.form-switch .form-check-input:focus{--bs-form-switch-bg:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='-4 -4 8 8'%3e%3ccircle r='3' fill='%2386b7fe'/%3e%3c/svg%3e")}.form-switch .form-check-input:checked{background-position:right center;--bs-form-switch-bg:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='-4 -4 8 8'%3e%3ccircle r='3' fill='%23fff'/%3e%3c/svg%3e")}.form-switch.form-check-reverse{padding-right:2.5em;padding-left:0}.form-switch.form-check-reverse .form-check-input{margin-right:-2.5em;margin-left:0}.form-check-inline{display:inline-block;margin-right:1rem}.btn-check{position:absolute;clip:rect(0,0,0,0);pointer-events:none}.btn-check:disabled+.btn,.btn-check[disabled]+.btn{pointer-events:none;filter:none;opacity:.65}[data-bs-theme=dark] .form-switch .form-check-input:not(:checked):not(:focus){--bs-form-switch-bg:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='-4 -4 8 8'%3e%3ccircle r='3' fill='rgba%28255, 255, 255, 0.25%29'/%3e%3c/svg%3e")}.form-range{width:100%;height:1.5rem;padding:0;-webkit-appearance:none;-moz-appearance:none;appearance:none;background-color:transparent}.form-range:focus{outline:0}.form-range:focus::-webkit-slider-thumb{box-shadow:0 0 0 1px #fff,0 0 0 .25rem rgba(13,110,253,.25)}.form-range:focus::-moz-range-thumb{box-shadow:0 0 0 1px #fff,0 0 0 .25rem rgba(13,110,253,.25)}.form-range::-moz-focus-outer{border:0}.form-range::-webkit-slider-thumb{width:1rem;height:1rem;margin-top:-.25rem;-webkit-appearance:none;appearance:none;background-color:#0d6efd;border:0;border-radius:1rem;-webkit-transition:background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out;transition:background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out}@media (prefers-reduced-motion:reduce){.form-range::-webkit-slider-thumb{-webkit-transition:none;transition:none}}.form-range::-webkit-slider-thumb:active{background-color:#b6d4fe}.form-range::-webkit-slider-runnable-track{width:100%;height:.5rem;color:transparent;cursor:pointer;background-color:var(--bs-secondary-bg);border-color:transparent;border-radius:1rem}.form-range::-moz-range-thumb{width:1rem;height:1rem;-moz-appearance:none;appearance:none;background-color:#0d6efd;border:0;border-radius:1rem;-moz-transition:background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out;transition:background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out}@media (prefers-reduced-motion:reduce){.form-range::-moz-range-thumb{-moz-transition:none;transition:none}}.form-range::-moz-range-thumb:active{background-color:#b6d4fe}.form-range::-moz-range-track{width:100%;height:.5rem;color:transparent;cursor:pointer;background-color:var(--bs-secondary-bg);border-color:transparent;border-radius:1rem}.form-range:disabled{pointer-events:none}.form-range:disabled::-webkit-slider-thumb{background-color:var(--bs-secondary-color)}.form-range:disabled::-moz-range-thumb{background-color:var(--bs-secondary-color)}.form-floating{position:relative}.form-floating>.form-control,.form-floating>.form-control-plaintext,.form-floating>.form-select{height:calc(3.5rem + calc(var(--bs-border-width) * 2));min-height:calc(3.5rem + calc(var(--bs-border-width) * 2));line-height:1.25}.form-floating>label{position:absolute;top:0;left:0;z-index:2;height:100%;padding:1rem .75rem;overflow:hidden;text-align:start;text-overflow:ellipsis;white-space:nowrap;pointer-events:none;border:var(--bs-border-width) solid transparent;transform-origin:0 0;transition:opacity .1s ease-in-out,transform .1s ease-in-out}@media (prefers-reduced-motion:reduce){.form-floating>label{transition:none}}.form-floating>.form-control,.form-floating>.form-control-plaintext{padding:1rem .75rem}.form-floating>.form-control-plaintext::-moz-placeholder,.form-floating>.form-control::-moz-placeholder{color:transparent}.form-floating>.form-control-plaintext::placeholder,.form-floating>.form-control::placeholder{color:transparent}.form-floating>.form-control-plaintext:not(:-moz-placeholder-shown),.form-floating>.form-control:not(:-moz-placeholder-shown){padding-top:1.625rem;padding-bottom:.625rem}.form-floating>.form-control-plaintext:focus,.form-floating>.form-control-plaintext:not(:placeholder-shown),.form-floating>.form-control:focus,.form-floating>.form-control:not(:placeholder-shown){padding-top:1.625rem;padding-bottom:.625rem}.form-floating>.form-control-plaintext:-webkit-autofill,.form-floating>.form-control:-webkit-autofill{padding-top:1.625rem;padding-bottom:.625rem}.form-floating>.form-select{padding-top:1.625rem;padding-bottom:.625rem}.form-floating>.form-control:not(:-moz-placeholder-shown)~label{color:rgba(var(--bs-body-color-rgb),.65);transform:scale(.85) translateY(-.5rem) translateX(.15rem)}.form-floating>.form-control-plaintext~label,.form-floating>.form-control:focus~label,.form-floating>.form-control:not(:placeholder-shown)~label,.form-floating>.form-select~label{color:rgba(var(--bs-body-color-rgb),.65);transform:scale(.85) translateY(-.5rem) translateX(.15rem)}.form-floating>.form-control:not(:-moz-placeholder-shown)~label::after{position:absolute;inset:1rem 0.375rem;z-index:-1;height:1.5em;content:"";background-color:var(--bs-body-bg);border-radius:var(--bs-border-radius)}.form-floating>.form-control-plaintext~label::after,.form-floating>.form-control:focus~label::after,.form-floating>.form-control:not(:placeholder-shown)~label::after,.form-floating>.form-select~label::after{position:absolute;inset:1rem 0.375rem;z-index:-1;height:1.5em;content:"";background-color:var(--bs-body-bg);border-radius:var(--bs-border-radius)}.form-floating>.form-control:-webkit-autofill~label{color:rgba(var(--bs-body-color-rgb),.65);transform:scale(.85) translateY(-.5rem) translateX(.15rem)}.form-floating>.form-control-plaintext~label{border-width:var(--bs-border-width) 0}.form-floating>.form-control:disabled~label,.form-floating>:disabled~label{color:#6c757d}.form-floating>.form-control:disabled~label::after,.form-floating>:disabled~label::after{background-color:var(--bs-secondary-bg)}.input-group{position:relative;display:flex;flex-wrap:wrap;align-items:stretch;width:100%}.input-group>.form-control,.input-group>.form-floating,.input-group>.form-select{position:relative;flex:1 1 auto;width:1%;min-width:0}.input-group>.form-control:focus,.input-group>.form-floating:focus-within,.input-group>.form-select:focus{z-index:5}.input-group .btn{position:relative;z-index:2}.input-group .btn:focus{z-index:5}.input-group-text{display:flex;align-items:center;padding:.375rem .75rem;font-size:1rem;font-weight:400;line-height:1.5;color:var(--bs-body-color);text-align:center;white-space:nowrap;background-color:var(--bs-tertiary-bg);border:var(--bs-border-width) solid var(--bs-border-color);border-radius:var(--bs-border-radius)}.input-group-lg>.btn,.input-group-lg>.form-control,.input-group-lg>.form-select,.input-group-lg>.input-group-text{padding:.5rem 1rem;font-size:1.25rem;border-radius:var(--bs-border-radius-lg)}.input-group-sm>.btn,.input-group-sm>.form-control,.input-group-sm>.form-select,.input-group-sm>.input-group-text{padding:.25rem .5rem;font-size:.875rem;border-radius:var(--bs-border-radius-sm)}.input-group-lg>.form-select,.input-group-sm>.form-select{padding-right:3rem}.input-group:not(.has-validation)>.dropdown-toggle:nth-last-child(n+3),.input-group:not(.has-validation)>.form-floating:not(:last-child)>.form-control,.input-group:not(.has-validation)>.form-floating:not(:last-child)>.form-select,.input-group:not(.has-validation)>:not(:last-child):not(.dropdown-toggle):not(.dropdown-menu):not(.form-floating){border-top-right-radius:0;border-bottom-right-radius:0}.input-group.has-validation>.dropdown-toggle:nth-last-child(n+4),.input-group.has-validation>.form-floating:nth-last-child(n+3)>.form-control,.input-group.has-validation>.form-floating:nth-last-child(n+3)>.form-select,.input-group.has-validation>:nth-last-child(n+3):not(.dropdown-toggle):not(.dropdown-menu):not(.form-floating){border-top-right-radius:0;border-bottom-right-radius:0}.input-group>:not(:first-child):not(.dropdown-menu):not(.valid-tooltip):not(.valid-feedback):not(.invalid-tooltip):not(.invalid-feedback){margin-left:calc(var(--bs-border-width) * -1);border-top-left-radius:0;border-bottom-left-radius:0}.input-group>.form-floating:not(:first-child)>.form-control,.input-group>.form-floating:not(:first-child)>.form-select{border-top-left-radius:0;border-bottom-left-radius:0}.valid-feedback{display:none;width:100%;margin-top:.25rem;font-size:.875em;color:var(--bs-form-valid-color)}.valid-tooltip{position:absolute;top:100%;z-index:5;display:none;max-width:100%;padding:.25rem .5rem;margin-top:.1rem;font-size:.875rem;color:#fff;background-color:var(--bs-success);border-radius:var(--bs-border-radius)}.is-valid~.valid-feedback,.is-valid~.valid-tooltip,.was-validated :valid~.valid-feedback,.was-validated :valid~.valid-tooltip{display:block}.form-control.is-valid,.was-validated .form-control:valid{border-color:var(--bs-form-valid-border-color);padding-right:calc(1.5em + .75rem);background-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 8 8'%3e%3cpath fill='%23198754' d='M2.3 6.73.6 4.53c-.4-1.04.46-1.4 1.1-.8l1.1 1.4 3.4-3.8c.6-.63 1.6-.27 1.2.7l-4 4.6c-.43.5-.8.4-1.1.1z'/%3e%3c/svg%3e");background-repeat:no-repeat;background-position:right calc(.375em + .1875rem) center;background-size:calc(.75em + .375rem) calc(.75em + .375rem)}.form-control.is-valid:focus,.was-validated .form-control:valid:focus{border-color:var(--bs-form-valid-border-color);box-shadow:0 0 0 .25rem rgba(var(--bs-success-rgb),.25)}.was-validated textarea.form-control:valid,textarea.form-control.is-valid{padding-right:calc(1.5em + .75rem);background-position:top calc(.375em + .1875rem) right calc(.375em + .1875rem)}.form-select.is-valid,.was-validated .form-select:valid{border-color:var(--bs-form-valid-border-color)}.form-select.is-valid:not([multiple]):not([size]),.form-select.is-valid:not([multiple])[size="1"],.was-validated .form-select:valid:not([multiple]):not([size]),.was-validated .form-select:valid:not([multiple])[size="1"]{--bs-form-select-bg-icon:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 8 8'%3e%3cpath fill='%23198754' d='M2.3 6.73.6 4.53c-.4-1.04.46-1.4 1.1-.8l1.1 1.4 3.4-3.8c.6-.63 1.6-.27 1.2.7l-4 4.6c-.43.5-.8.4-1.1.1z'/%3e%3c/svg%3e");padding-right:4.125rem;background-position:right .75rem center,center right 2.25rem;background-size:16px 12px,calc(.75em + .375rem) calc(.75em + .375rem)}.form-select.is-valid:focus,.was-validated .form-select:valid:focus{border-color:var(--bs-form-valid-border-color);box-shadow:0 0 0 .25rem rgba(var(--bs-success-rgb),.25)}.form-control-color.is-valid,.was-validated .form-control-color:valid{width:calc(3rem + calc(1.5em + .75rem))}.form-check-input.is-valid,.was-validated .form-check-input:valid{border-color:var(--bs-form-valid-border-color)}.form-check-input.is-valid:checked,.was-validated .form-check-input:valid:checked{background-color:var(--bs-form-valid-color)}.form-check-input.is-valid:focus,.was-validated .form-check-input:valid:focus{box-shadow:0 0 0 .25rem rgba(var(--bs-success-rgb),.25)}.form-check-input.is-valid~.form-check-label,.was-validated .form-check-input:valid~.form-check-label{color:var(--bs-form-valid-color)}.form-check-inline .form-check-input~.valid-feedback{margin-left:.5em}.input-group>.form-control:not(:focus).is-valid,.input-group>.form-floating:not(:focus-within).is-valid,.input-group>.form-select:not(:focus).is-valid,.was-validated .input-group>.form-control:not(:focus):valid,.was-validated .input-group>.form-floating:not(:focus-within):valid,.was-validated .input-group>.form-select:not(:focus):valid{z-index:3}.invalid-feedback{display:none;width:100%;margin-top:.25rem;font-size:.875em;color:var(--bs-form-invalid-color)}.invalid-tooltip{position:absolute;top:100%;z-index:5;display:none;max-width:100%;padding:.25rem .5rem;margin-top:.1rem;font-size:.875rem;color:#fff;background-color:var(--bs-danger);border-radius:var(--bs-border-radius)}.is-invalid~.invalid-feedback,.is-invalid~.invalid-tooltip,.was-validated :invalid~.invalid-feedback,.was-validated :invalid~.invalid-tooltip{display:block}.form-control.is-invalid,.was-validated .form-control:invalid{border-color:var(--bs-form-invalid-border-color);padding-right:calc(1.5em + .75rem);background-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 12 12' width='12' height='12' fill='none' stroke='%23dc3545'%3e%3ccircle cx='6' cy='6' r='4.5'/%3e%3cpath stroke-linejoin='round' d='M5.8 3.6h.4L6 6.5z'/%3e%3ccircle cx='6' cy='8.2' r='.6' fill='%23dc3545' stroke='none'/%3e%3c/svg%3e");background-repeat:no-repeat;background-position:right calc(.375em + .1875rem) center;background-size:calc(.75em + .375rem) calc(.75em + .375rem)}.form-control.is-invalid:focus,.was-validated .form-control:invalid:focus{border-color:var(--bs-form-invalid-border-color);box-shadow:0 0 0 .25rem rgba(var(--bs-danger-rgb),.25)}.was-validated textarea.form-control:invalid,textarea.form-control.is-invalid{padding-right:calc(1.5em + .75rem);background-position:top calc(.375em + .1875rem) right calc(.375em + .1875rem)}.form-select.is-invalid,.was-validated .form-select:invalid{border-color:var(--bs-form-invalid-border-color)}.form-select.is-invalid:not([multiple]):not([size]),.form-select.is-invalid:not([multiple])[size="1"],.was-validated .form-select:invalid:not([multiple]):not([size]),.was-validated .form-select:invalid:not([multiple])[size="1"]{--bs-form-select-bg-icon:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 12 12' width='12' height='12' fill='none' stroke='%23dc3545'%3e%3ccircle cx='6' cy='6' r='4.5'/%3e%3cpath stroke-linejoin='round' d='M5.8 3.6h.4L6 6.5z'/%3e%3ccircle cx='6' cy='8.2' r='.6' fill='%23dc3545' stroke='none'/%3e%3c/svg%3e");padding-right:4.125rem;background-position:right .75rem center,center right 2.25rem;background-size:16px 12px,calc(.75em + .375rem) calc(.75em + .375rem)}.form-select.is-invalid:focus,.was-validated .form-select:invalid:focus{border-color:var(--bs-form-invalid-border-color);box-shadow:0 0 0 .25rem rgba(var(--bs-danger-rgb),.25)}.form-control-color.is-invalid,.was-validated .form-control-color:invalid{width:calc(3rem + calc(1.5em + .75rem))}.form-check-input.is-invalid,.was-validated .form-check-input:invalid{border-color:var(--bs-form-invalid-border-color)}.form-check-input.is-invalid:checked,.was-validated .form-check-input:invalid:checked{background-color:var(--bs-form-invalid-color)}.form-check-input.is-invalid:focus,.was-validated .form-check-input:invalid:focus{box-shadow:0 0 0 .25rem rgba(var(--bs-danger-rgb),.25)}.form-check-input.is-invalid~.form-check-label,.was-validated .form-check-input:invalid~.form-check-label{color:var(--bs-form-invalid-color)}.form-check-inline .form-check-input~.invalid-feedback{margin-left:.5em}.input-group>.form-control:not(:focus).is-invalid,.input-group>.form-floating:not(:focus-within).is-invalid,.input-group>.form-select:not(:focus).is-invalid,.was-validated .input-group>.form-control:not(:focus):invalid,.was-validated .input-group>.form-floating:not(:focus-within):invalid,.was-validated .input-group>.form-select:not(:focus):invalid{z-index:4}.btn{--bs-btn-padding-x:0.75rem;--bs-btn-padding-y:0.375rem;--bs-btn-font-family: ;--bs-btn-font-size:1rem;--bs-btn-font-weight:400;--bs-btn-line-height:1.5;--bs-btn-color:var(--bs-body-color);--bs-btn-bg:transparent;--bs-btn-border-width:var(--bs-border-width);--bs-btn-border-color:transparent;--bs-btn-border-radius:var(--bs-border-radius);--bs-btn-hover-border-color:transparent;--bs-btn-box-shadow:inset 0 1px 0 rgba(255, 255, 255, 0.15),0 1px 1px rgba(0, 0, 0, 0.075);--bs-btn-disabled-opacity:0.65;--bs-btn-focus-box-shadow:0 0 0 0.25rem rgba(var(--bs-btn-focus-shadow-rgb), .5);display:inline-block;padding:var(--bs-btn-padding-y) var(--bs-btn-padding-x);font-family:var(--bs-btn-font-family);font-size:var(--bs-btn-font-size);font-weight:var(--bs-btn-font-weight);line-height:var(--bs-btn-line-height);color:var(--bs-btn-color);text-align:center;text-decoration:none;vertical-align:middle;cursor:pointer;-webkit-user-select:none;-moz-user-select:none;user-select:none;border:var(--bs-btn-border-width) solid var(--bs-btn-border-color);border-radius:var(--bs-btn-border-radius);background-color:var(--bs-btn-bg);transition:color .15s ease-in-out,background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out}@media (prefers-reduced-motion:reduce){.btn{transition:none}}.btn:hover{color:var(--bs-btn-hover-color);background-color:var(--bs-btn-hover-bg);border-color:var(--bs-btn-hover-border-color)}.btn-check+.btn:hover{color:var(--bs-btn-color);background-color:var(--bs-btn-bg);border-color:var(--bs-btn-border-color)}.btn:focus-visible{color:var(--bs-btn-hover-color);background-color:var(--bs-btn-hover-bg);border-color:var(--bs-btn-hover-border-color);outline:0;box-shadow:var(--bs-btn-focus-box-shadow)}.btn-check:focus-visible+.btn{border-color:var(--bs-btn-hover-border-color);outline:0;box-shadow:var(--bs-btn-focus-box-shadow)}.btn-check:checked+.btn,.btn.active,.btn.show,.btn:first-child:active,:not(.btn-check)+.btn:active{color:var(--bs-btn-active-color);background-color:var(--bs-btn-active-bg);border-color:var(--bs-btn-active-border-color)}.btn-check:checked+.btn:focus-visible,.btn.active:focus-visible,.btn.show:focus-visible,.btn:first-child:active:focus-visible,:not(.btn-check)+.btn:active:focus-visible{box-shadow:var(--bs-btn-focus-box-shadow)}.btn.disabled,.btn:disabled,fieldset:disabled .btn{color:var(--bs-btn-disabled-color);pointer-events:none;background-color:var(--bs-btn-disabled-bg);border-color:var(--bs-btn-disabled-border-color);opacity:var(--bs-btn-disabled-opacity)}.btn-primary{--bs-btn-color:#fff;--bs-btn-bg:#0d6efd;--bs-btn-border-color:#0d6efd;--bs-btn-hover-color:#fff;--bs-btn-hover-bg:#0b5ed7;--bs-btn-hover-border-color:#0a58ca;--bs-btn-focus-shadow-rgb:49,132,253;--bs-btn-active-color:#fff;--bs-btn-active-bg:#0a58ca;--bs-btn-active-border-color:#0a53be;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#fff;--bs-btn-disabled-bg:#0d6efd;--bs-btn-disabled-border-color:#0d6efd}.btn-secondary{--bs-btn-color:#fff;--bs-btn-bg:#6c757d;--bs-btn-border-color:#6c757d;--bs-btn-hover-color:#fff;--bs-btn-hover-bg:#5c636a;--bs-btn-hover-border-color:#565e64;--bs-btn-focus-shadow-rgb:130,138,145;--bs-btn-active-color:#fff;--bs-btn-active-bg:#565e64;--bs-btn-active-border-color:#51585e;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#fff;--bs-btn-disabled-bg:#6c757d;--bs-btn-disabled-border-color:#6c757d}.btn-success{--bs-btn-color:#fff;--bs-btn-bg:#198754;--bs-btn-border-color:#198754;--bs-btn-hover-color:#fff;--bs-btn-hover-bg:#157347;--bs-btn-hover-border-color:#146c43;--bs-btn-focus-shadow-rgb:60,153,110;--bs-btn-active-color:#fff;--bs-btn-active-bg:#146c43;--bs-btn-active-border-color:#13653f;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#fff;--bs-btn-disabled-bg:#198754;--bs-btn-disabled-border-color:#198754}.btn-info{--bs-btn-color:#000;--bs-btn-bg:#0dcaf0;--bs-btn-border-color:#0dcaf0;--bs-btn-hover-color:#000;--bs-btn-hover-bg:#31d2f2;--bs-btn-hover-border-color:#25cff2;--bs-btn-focus-shadow-rgb:11,172,204;--bs-btn-active-color:#000;--bs-btn-active-bg:#3dd5f3;--bs-btn-active-border-color:#25cff2;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#000;--bs-btn-disabled-bg:#0dcaf0;--bs-btn-disabled-border-color:#0dcaf0}.btn-warning{--bs-btn-color:#000;--bs-btn-bg:#ffc107;--bs-btn-border-color:#ffc107;--bs-btn-hover-color:#000;--bs-btn-hover-bg:#ffca2c;--bs-btn-hover-border-color:#ffc720;--bs-btn-focus-shadow-rgb:217,164,6;--bs-btn-active-color:#000;--bs-btn-active-bg:#ffcd39;--bs-btn-active-border-color:#ffc720;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#000;--bs-btn-disabled-bg:#ffc107;--bs-btn-disabled-border-color:#ffc107}.btn-danger{--bs-btn-color:#fff;--bs-btn-bg:#dc3545;--bs-btn-border-color:#dc3545;--bs-btn-hover-color:#fff;--bs-btn-hover-bg:#bb2d3b;--bs-btn-hover-border-color:#b02a37;--bs-btn-focus-shadow-rgb:225,83,97;--bs-btn-active-color:#fff;--bs-btn-active-bg:#b02a37;--bs-btn-active-border-color:#a52834;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#fff;--bs-btn-disabled-bg:#dc3545;--bs-btn-disabled-border-color:#dc3545}.btn-light{--bs-btn-color:#000;--bs-btn-bg:#f8f9fa;--bs-btn-border-color:#f8f9fa;--bs-btn-hover-color:#000;--bs-btn-hover-bg:#d3d4d5;--bs-btn-hover-border-color:#c6c7c8;--bs-btn-focus-shadow-rgb:211,212,213;--bs-btn-active-color:#000;--bs-btn-active-bg:#c6c7c8;--bs-btn-active-border-color:#babbbc;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#000;--bs-btn-disabled-bg:#f8f9fa;--bs-btn-disabled-border-color:#f8f9fa}.btn-dark{--bs-btn-color:#fff;--bs-btn-bg:#212529;--bs-btn-border-color:#212529;--bs-btn-hover-color:#fff;--bs-btn-hover-bg:#424649;--bs-btn-hover-border-color:#373b3e;--bs-btn-focus-shadow-rgb:66,70,73;--bs-btn-active-color:#fff;--bs-btn-active-bg:#4d5154;--bs-btn-active-border-color:#373b3e;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#fff;--bs-btn-disabled-bg:#212529;--bs-btn-disabled-border-color:#212529}.btn-outline-primary{--bs-btn-color:#0d6efd;--bs-btn-border-color:#0d6efd;--bs-btn-hover-color:#fff;--bs-btn-hover-bg:#0d6efd;--bs-btn-hover-border-color:#0d6efd;--bs-btn-focus-shadow-rgb:13,110,253;--bs-btn-active-color:#fff;--bs-btn-active-bg:#0d6efd;--bs-btn-active-border-color:#0d6efd;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#0d6efd;--bs-btn-disabled-bg:transparent;--bs-btn-disabled-border-color:#0d6efd;--bs-gradient:none}.btn-outline-secondary{--bs-btn-color:#6c757d;--bs-btn-border-color:#6c757d;--bs-btn-hover-color:#fff;--bs-btn-hover-bg:#6c757d;--bs-btn-hover-border-color:#6c757d;--bs-btn-focus-shadow-rgb:108,117,125;--bs-btn-active-color:#fff;--bs-btn-active-bg:#6c757d;--bs-btn-active-border-color:#6c757d;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#6c757d;--bs-btn-disabled-bg:transparent;--bs-btn-disabled-border-color:#6c757d;--bs-gradient:none}.btn-outline-success{--bs-btn-color:#198754;--bs-btn-border-color:#198754;--bs-btn-hover-color:#fff;--bs-btn-hover-bg:#198754;--bs-btn-hover-border-color:#198754;--bs-btn-focus-shadow-rgb:25,135,84;--bs-btn-active-color:#fff;--bs-btn-active-bg:#198754;--bs-btn-active-border-color:#198754;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#198754;--bs-btn-disabled-bg:transparent;--bs-btn-disabled-border-color:#198754;--bs-gradient:none}.btn-outline-info{--bs-btn-color:#0dcaf0;--bs-btn-border-color:#0dcaf0;--bs-btn-hover-color:#000;--bs-btn-hover-bg:#0dcaf0;--bs-btn-hover-border-color:#0dcaf0;--bs-btn-focus-shadow-rgb:13,202,240;--bs-btn-active-color:#000;--bs-btn-active-bg:#0dcaf0;--bs-btn-active-border-color:#0dcaf0;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#0dcaf0;--bs-btn-disabled-bg:transparent;--bs-btn-disabled-border-color:#0dcaf0;--bs-gradient:none}.btn-outline-warning{--bs-btn-color:#ffc107;--bs-btn-border-color:#ffc107;--bs-btn-hover-color:#000;--bs-btn-hover-bg:#ffc107;--bs-btn-hover-border-color:#ffc107;--bs-btn-focus-shadow-rgb:255,193,7;--bs-btn-active-color:#000;--bs-btn-active-bg:#ffc107;--bs-btn-active-border-color:#ffc107;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#ffc107;--bs-btn-disabled-bg:transparent;--bs-btn-disabled-border-color:#ffc107;--bs-gradient:none}.btn-outline-danger{--bs-btn-color:#dc3545;--bs-btn-border-color:#dc3545;--bs-btn-hover-color:#fff;--bs-btn-hover-bg:#dc3545;--bs-btn-hover-border-color:#dc3545;--bs-btn-focus-shadow-rgb:220,53,69;--bs-btn-active-color:#fff;--bs-btn-active-bg:#dc3545;--bs-btn-active-border-color:#dc3545;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#dc3545;--bs-btn-disabled-bg:transparent;--bs-btn-disabled-border-color:#dc3545;--bs-gradient:none}.btn-outline-light{--bs-btn-color:#f8f9fa;--bs-btn-border-color:#f8f9fa;--bs-btn-hover-color:#000;--bs-btn-hover-bg:#f8f9fa;--bs-btn-hover-border-color:#f8f9fa;--bs-btn-focus-shadow-rgb:248,249,250;--bs-btn-active-color:#000;--bs-btn-active-bg:#f8f9fa;--bs-btn-active-border-color:#f8f9fa;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#f8f9fa;--bs-btn-disabled-bg:transparent;--bs-btn-disabled-border-color:#f8f9fa;--bs-gradient:none}.btn-outline-dark{--bs-btn-color:#212529;--bs-btn-border-color:#212529;--bs-btn-hover-color:#fff;--bs-btn-hover-bg:#212529;--bs-btn-hover-border-color:#212529;--bs-btn-focus-shadow-rgb:33,37,41;--bs-btn-active-color:#fff;--bs-btn-active-bg:#212529;--bs-btn-active-border-color:#212529;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#212529;--bs-btn-disabled-bg:transparent;--bs-btn-disabled-border-color:#212529;--bs-gradient:none}.btn-link{--bs-btn-font-weight:400;--bs-btn-color:var(--bs-link-color);--bs-btn-bg:transparent;--bs-btn-border-color:transparent;--bs-btn-hover-color:var(--bs-link-hover-color);--bs-btn-hover-border-color:transparent;--bs-btn-active-color:var(--bs-link-hover-color);--bs-btn-active-border-color:transparent;--bs-btn-disabled-color:#6c757d;--bs-btn-disabled-border-color:transparent;--bs-btn-box-shadow:0 0 0 #000;--bs-btn-focus-shadow-rgb:49,132,253;text-decoration:underline}.btn-link:focus-visible{color:var(--bs-btn-color)}.btn-link:hover{color:var(--bs-btn-hover-color)}.btn-group-lg>.btn,.btn-lg{--bs-btn-padding-y:0.5rem;--bs-btn-padding-x:1rem;--bs-btn-font-size:1.25rem;--bs-btn-border-radius:var(--bs-border-radius-lg)}.btn-group-sm>.btn,.btn-sm{--bs-btn-padding-y:0.25rem;--bs-btn-padding-x:0.5rem;--bs-btn-font-size:0.875rem;--bs-btn-border-radius:var(--bs-border-radius-sm)}.fade{transition:opacity .15s linear}@media (prefers-reduced-motion:reduce){.fade{transition:none}}.fade:not(.show){opacity:0}.collapse:not(.show){display:none}.collapsing{height:0;overflow:hidden;transition:height .35s ease}@media (prefers-reduced-motion:reduce){.collapsing{transition:none}}.collapsing.collapse-horizontal{width:0;height:auto;transition:width .35s ease}@media (prefers-reduced-motion:reduce){.collapsing.collapse-horizontal{transition:none}}.dropdown,.dropdown-center,.dropend,.dropstart,.dropup,.dropup-center{position:relative}.dropdown-toggle{white-space:nowrap}.dropdown-toggle::after{display:inline-block;margin-left:.255em;vertical-align:.255em;content:"";border-top:.3em solid;border-right:.3em solid transparent;border-bottom:0;border-left:.3em solid transparent}.dropdown-toggle:empty::after{margin-left:0}.dropdown-menu{--bs-dropdown-zindex:1000;--bs-dropdown-min-width:10rem;--bs-dropdown-padding-x:0;--bs-dropdown-padding-y:0.5rem;--bs-dropdown-spacer:0.125rem;--bs-dropdown-font-size:1rem;--bs-dropdown-color:var(--bs-body-color);--bs-dropdown-bg:var(--bs-body-bg);--bs-dropdown-border-color:var(--bs-border-color-translucent);--bs-dropdown-border-radius:var(--bs-border-radius);--bs-dropdown-border-width:var(--bs-border-width);--bs-dropdown-inner-border-radius:calc(var(--bs-border-radius) - var(--bs-border-width));--bs-dropdown-divider-bg:var(--bs-border-color-translucent);--bs-dropdown-divider-margin-y:0.5rem;--bs-dropdown-box-shadow:var(--bs-box-shadow);--bs-dropdown-link-color:var(--bs-body-color);--bs-dropdown-link-hover-color:var(--bs-body-color);--bs-dropdown-link-hover-bg:var(--bs-tertiary-bg);--bs-dropdown-link-active-color:#fff;--bs-dropdown-link-active-bg:#0d6efd;--bs-dropdown-link-disabled-color:var(--bs-tertiary-color);--bs-dropdown-item-padding-x:1rem;--bs-dropdown-item-padding-y:0.25rem;--bs-dropdown-header-color:#6c757d;--bs-dropdown-header-padding-x:1rem;--bs-dropdown-header-padding-y:0.5rem;position:absolute;z-index:var(--bs-dropdown-zindex);display:none;min-width:var(--bs-dropdown-min-width);padding:var(--bs-dropdown-padding-y) var(--bs-dropdown-padding-x);margin:0;font-size:var(--bs-dropdown-font-size);color:var(--bs-dropdown-color);text-align:left;list-style:none;background-color:var(--bs-dropdown-bg);background-clip:padding-box;border:var(--bs-dropdown-border-width) solid var(--bs-dropdown-border-color);border-radius:var(--bs-dropdown-border-radius)}.dropdown-menu[data-bs-popper]{top:100%;left:0;margin-top:var(--bs-dropdown-spacer)}.dropdown-menu-start{--bs-position:start}.dropdown-menu-start[data-bs-popper]{right:auto;left:0}.dropdown-menu-end{--bs-position:end}.dropdown-menu-end[data-bs-popper]{right:0;left:auto}@media (min-width:576px){.dropdown-menu-sm-start{--bs-position:start}.dropdown-menu-sm-start[data-bs-popper]{right:auto;left:0}.dropdown-menu-sm-end{--bs-position:end}.dropdown-menu-sm-end[data-bs-popper]{right:0;left:auto}}@media (min-width:768px){.dropdown-menu-md-start{--bs-position:start}.dropdown-menu-md-start[data-bs-popper]{right:auto;left:0}.dropdown-menu-md-end{--bs-position:end}.dropdown-menu-md-end[data-bs-popper]{right:0;left:auto}}@media (min-width:992px){.dropdown-menu-lg-start{--bs-position:start}.dropdown-menu-lg-start[data-bs-popper]{right:auto;left:0}.dropdown-menu-lg-end{--bs-position:end}.dropdown-menu-lg-end[data-bs-popper]{right:0;left:auto}}@media (min-width:1200px){.dropdown-menu-xl-start{--bs-position:start}.dropdown-menu-xl-start[data-bs-popper]{right:auto;left:0}.dropdown-menu-xl-end{--bs-position:end}.dropdown-menu-xl-end[data-bs-popper]{right:0;left:auto}}@media (min-width:1400px){.dropdown-menu-xxl-start{--bs-position:start}.dropdown-menu-xxl-start[data-bs-popper]{right:auto;left:0}.dropdown-menu-xxl-end{--bs-position:end}.dropdown-menu-xxl-end[data-bs-popper]{right:0;left:auto}}.dropup .dropdown-menu[data-bs-popper]{top:auto;bottom:100%;margin-top:0;margin-bottom:var(--bs-dropdown-spacer)}.dropup .dropdown-toggle::after{display:inline-block;margin-left:.255em;vertical-align:.255em;content:"";border-top:0;border-right:.3em solid transparent;border-bottom:.3em solid;border-left:.3em solid transparent}.dropup .dropdown-toggle:empty::after{margin-left:0}.dropend .dropdown-menu[data-bs-popper]{top:0;right:auto;left:100%;margin-top:0;margin-left:var(--bs-dropdown-spacer)}.dropend .dropdown-toggle::after{display:inline-block;margin-left:.255em;vertical-align:.255em;content:"";border-top:.3em solid transparent;border-right:0;border-bottom:.3em solid transparent;border-left:.3em solid}.dropend .dropdown-toggle:empty::after{margin-left:0}.dropend .dropdown-toggle::after{vertical-align:0}.dropstart .dropdown-menu[data-bs-popper]{top:0;right:100%;left:auto;margin-top:0;margin-right:var(--bs-dropdown-spacer)}.dropstart .dropdown-toggle::after{display:inline-block;margin-left:.255em;vertical-align:.255em;content:""}.dropstart .dropdown-toggle::after{display:none}.dropstart .dropdown-toggle::before{display:inline-block;margin-right:.255em;vertical-align:.255em;content:"";border-top:.3em solid transparent;border-right:.3em solid;border-bottom:.3em solid transparent}.dropstart .dropdown-toggle:empty::after{margin-left:0}.dropstart .dropdown-toggle::before{vertical-align:0}.dropdown-divider{height:0;margin:var(--bs-dropdown-divider-margin-y) 0;overflow:hidden;border-top:1px solid var(--bs-dropdown-divider-bg);opacity:1}.dropdown-item{display:block;width:100%;padding:var(--bs-dropdown-item-padding-y) var(--bs-dropdown-item-padding-x);clear:both;font-weight:400;color:var(--bs-dropdown-link-color);text-align:inherit;text-decoration:none;white-space:nowrap;background-color:transparent;border:0;border-radius:var(--bs-dropdown-item-border-radius,0)}.dropdown-item:focus,.dropdown-item:hover{color:var(--bs-dropdown-link-hover-color);background-color:var(--bs-dropdown-link-hover-bg)}.dropdown-item.active,.dropdown-item:active{color:var(--bs-dropdown-link-active-color);text-decoration:none;background-color:var(--bs-dropdown-link-active-bg)}.dropdown-item.disabled,.dropdown-item:disabled{color:var(--bs-dropdown-link-disabled-color);pointer-events:none;background-color:transparent}.dropdown-menu.show{display:block}.dropdown-header{display:block;padding:var(--bs-dropdown-header-padding-y) var(--bs-dropdown-header-padding-x);margin-bottom:0;font-size:.875rem;color:var(--bs-dropdown-header-color);white-space:nowrap}.dropdown-item-text{display:block;padding:var(--bs-dropdown-item-padding-y) var(--bs-dropdown-item-padding-x);color:var(--bs-dropdown-link-color)}.dropdown-menu-dark{--bs-dropdown-color:#dee2e6;--bs-dropdown-bg:#343a40;--bs-dropdown-border-color:var(--bs-border-color-translucent);--bs-dropdown-box-shadow: ;--bs-dropdown-link-color:#dee2e6;--bs-dropdown-link-hover-color:#fff;--bs-dropdown-divider-bg:var(--bs-border-color-translucent);--bs-dropdown-link-hover-bg:rgba(255, 255, 255, 0.15);--bs-dropdown-link-active-color:#fff;--bs-dropdown-link-active-bg:#0d6efd;--bs-dropdown-link-disabled-color:#adb5bd;--bs-dropdown-header-color:#adb5bd}.btn-group,.btn-group-vertical{position:relative;display:inline-flex;vertical-align:middle}.btn-group-vertical>.btn,.btn-group>.btn{position:relative;flex:1 1 auto}.btn-group-vertical>.btn-check:checked+.btn,.btn-group-vertical>.btn-check:focus+.btn,.btn-group-vertical>.btn.active,.btn-group-vertical>.btn:active,.btn-group-vertical>.btn:focus,.btn-group-vertical>.btn:hover,.btn-group>.btn-check:checked+.btn,.btn-group>.btn-check:focus+.btn,.btn-group>.btn.active,.btn-group>.btn:active,.btn-group>.btn:focus,.btn-group>.btn:hover{z-index:1}.btn-toolbar{display:flex;flex-wrap:wrap;justify-content:flex-start}.btn-toolbar .input-group{width:auto}.btn-group{border-radius:var(--bs-border-radius)}.btn-group>.btn-group:not(:first-child),.btn-group>:not(.btn-check:first-child)+.btn{margin-left:calc(var(--bs-border-width) * -1)}.btn-group>.btn-group:not(:last-child)>.btn,.btn-group>.btn.dropdown-toggle-split:first-child,.btn-group>.btn:not(:last-child):not(.dropdown-toggle){border-top-right-radius:0;border-bottom-right-radius:0}.btn-group>.btn-group:not(:first-child)>.btn,.btn-group>.btn:nth-child(n+3),.btn-group>:not(.btn-check)+.btn{border-top-left-radius:0;border-bottom-left-radius:0}.dropdown-toggle-split{padding-right:.5625rem;padding-left:.5625rem}.dropdown-toggle-split::after,.dropend .dropdown-toggle-split::after,.dropup .dropdown-toggle-split::after{margin-left:0}.dropstart .dropdown-toggle-split::before{margin-right:0}.btn-group-sm>.btn+.dropdown-toggle-split,.btn-sm+.dropdown-toggle-split{padding-right:.375rem;padding-left:.375rem}.btn-group-lg>.btn+.dropdown-toggle-split,.btn-lg+.dropdown-toggle-split{padding-right:.75rem;padding-left:.75rem}.btn-group-vertical{flex-direction:column;align-items:flex-start;justify-content:center}.btn-group-vertical>.btn,.btn-group-vertical>.btn-group{width:100%}.btn-group-vertical>.btn-group:not(:first-child),.btn-group-vertical>.btn:not(:first-child){margin-top:calc(var(--bs-border-width) * -1)}.btn-group-vertical>.btn-group:not(:last-child)>.btn,.btn-group-vertical>.btn:not(:last-child):not(.dropdown-toggle){border-bottom-right-radius:0;border-bottom-left-radius:0}.btn-group-vertical>.btn-group:not(:first-child)>.btn,.btn-group-vertical>.btn~.btn{border-top-left-radius:0;border-top-right-radius:0}.nav{--bs-nav-link-padding-x:1rem;--bs-nav-link-padding-y:0.5rem;--bs-nav-link-font-weight: ;--bs-nav-link-color:var(--bs-link-color);--bs-nav-link-hover-color:var(--bs-link-hover-color);--bs-nav-link-disabled-color:var(--bs-secondary-color);display:flex;flex-wrap:wrap;padding-left:0;margin-bottom:0;list-style:none}.nav-link{display:block;padding:var(--bs-nav-link-padding-y) var(--bs-nav-link-padding-x);font-size:var(--bs-nav-link-font-size);font-weight:var(--bs-nav-link-font-weight);color:var(--bs-nav-link-color);text-decoration:none;background:0 0;border:0;transition:color .15s ease-in-out,background-color .15s ease-in-out,border-color .15s ease-in-out}@media (prefers-reduced-motion:reduce){.nav-link{transition:none}}.nav-link:focus,.nav-link:hover{color:var(--bs-nav-link-hover-color)}.nav-link:focus-visible{outline:0;box-shadow:0 0 0 .25rem rgba(13,110,253,.25)}.nav-link.disabled,.nav-link:disabled{color:var(--bs-nav-link-disabled-color);pointer-events:none;cursor:default}.nav-tabs{--bs-nav-tabs-border-width:var(--bs-border-width);--bs-nav-tabs-border-color:var(--bs-border-color);--bs-nav-tabs-border-radius:var(--bs-border-radius);--bs-nav-tabs-link-hover-border-color:var(--bs-secondary-bg) var(--bs-secondary-bg) var(--bs-border-color);--bs-nav-tabs-link-active-color:var(--bs-emphasis-color);--bs-nav-tabs-link-active-bg:var(--bs-body-bg);--bs-nav-tabs-link-active-border-color:var(--bs-border-color) var(--bs-border-color) var(--bs-body-bg);border-bottom:var(--bs-nav-tabs-border-width) solid var(--bs-nav-tabs-border-color)}.nav-tabs .nav-link{margin-bottom:calc(-1 * var(--bs-nav-tabs-border-width));border:var(--bs-nav-tabs-border-width) solid transparent;border-top-left-radius:var(--bs-nav-tabs-border-radius);border-top-right-radius:var(--bs-nav-tabs-border-radius)}.nav-tabs .nav-link:focus,.nav-tabs .nav-link:hover{isolation:isolate;border-color:var(--bs-nav-tabs-link-hover-border-color)}.nav-tabs .nav-item.show .nav-link,.nav-tabs .nav-link.active{color:var(--bs-nav-tabs-link-active-color);background-color:var(--bs-nav-tabs-link-active-bg);border-color:var(--bs-nav-tabs-link-active-border-color)}.nav-tabs .dropdown-menu{margin-top:calc(-1 * var(--bs-nav-tabs-border-width));border-top-left-radius:0;border-top-right-radius:0}.nav-pills{--bs-nav-pills-border-radius:var(--bs-border-radius);--bs-nav-pills-link-active-color:#fff;--bs-nav-pills-link-active-bg:#0d6efd}.nav-pills .nav-link{border-radius:var(--bs-nav-pills-border-radius)}.nav-pills .nav-link.active,.nav-pills .show>.nav-link{color:var(--bs-nav-pills-link-active-color);background-color:var(--bs-nav-pills-link-active-bg)}.nav-underline{--bs-nav-underline-gap:1rem;--bs-nav-underline-border-width:0.125rem;--bs-nav-underline-link-active-color:var(--bs-emphasis-color);gap:var(--bs-nav-underline-gap)}.nav-underline .nav-link{padding-right:0;padding-left:0;border-bottom:var(--bs-nav-underline-border-width) solid transparent}.nav-underline .nav-link:focus,.nav-underline .nav-link:hover{border-bottom-color:currentcolor}.nav-underline .nav-link.active,.nav-underline .show>.nav-link{font-weight:700;color:var(--bs-nav-underline-link-active-color);border-bottom-color:currentcolor}.nav-fill .nav-item,.nav-fill>.nav-link{flex:1 1 auto;text-align:center}.nav-justified .nav-item,.nav-justified>.nav-link{flex-basis:0;flex-grow:1;text-align:center}.nav-fill .nav-item .nav-link,.nav-justified .nav-item .nav-link{width:100%}.tab-content>.tab-pane{display:none}.tab-content>.active{display:block}.navbar{--bs-navbar-padding-x:0;--bs-navbar-padding-y:0.5rem;--bs-navbar-color:rgba(var(--bs-emphasis-color-rgb), 0.65);--bs-navbar-hover-color:rgba(var(--bs-emphasis-color-rgb), 0.8);--bs-navbar-disabled-color:rgba(var(--bs-emphasis-color-rgb), 0.3);--bs-navbar-active-color:rgba(var(--bs-emphasis-color-rgb), 1);--bs-navbar-brand-padding-y:0.3125rem;--bs-navbar-brand-margin-end:1rem;--bs-navbar-brand-font-size:1.25rem;--bs-navbar-brand-color:rgba(var(--bs-emphasis-color-rgb), 1);--bs-navbar-brand-hover-color:rgba(var(--bs-emphasis-color-rgb), 1);--bs-navbar-nav-link-padding-x:0.5rem;--bs-navbar-toggler-padding-y:0.25rem;--bs-navbar-toggler-padding-x:0.75rem;--bs-navbar-toggler-font-size:1.25rem;--bs-navbar-toggler-icon-bg:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 30 30'%3e%3cpath stroke='rgba%2833, 37, 41, 0.75%29' stroke-linecap='round' stroke-miterlimit='10' stroke-width='2' d='M4 7h22M4 15h22M4 23h22'/%3e%3c/svg%3e");--bs-navbar-toggler-border-color:rgba(var(--bs-emphasis-color-rgb), 0.15);--bs-navbar-toggler-border-radius:var(--bs-border-radius);--bs-navbar-toggler-focus-width:0.25rem;--bs-navbar-toggler-transition:box-shadow 0.15s ease-in-out;position:relative;display:flex;flex-wrap:wrap;align-items:center;justify-content:space-between;padding:var(--bs-navbar-padding-y) var(--bs-navbar-padding-x)}.navbar>.container,.navbar>.container-fluid,.navbar>.container-lg,.navbar>.container-md,.navbar>.container-sm,.navbar>.container-xl,.navbar>.container-xxl{display:flex;flex-wrap:inherit;align-items:center;justify-content:space-between}.navbar-brand{padding-top:var(--bs-navbar-brand-padding-y);padding-bottom:var(--bs-navbar-brand-padding-y);margin-right:var(--bs-navbar-brand-margin-end);font-size:var(--bs-navbar-brand-font-size);color:var(--bs-navbar-brand-color);text-decoration:none;white-space:nowrap}.navbar-brand:focus,.navbar-brand:hover{color:var(--bs-navbar-brand-hover-color)}.navbar-nav{--bs-nav-link-padding-x:0;--bs-nav-link-padding-y:0.5rem;--bs-nav-link-font-weight: ;--bs-nav-link-color:var(--bs-navbar-color);--bs-nav-link-hover-color:var(--bs-navbar-hover-color);--bs-nav-link-disabled-color:var(--bs-navbar-disabled-color);display:flex;flex-direction:column;padding-left:0;margin-bottom:0;list-style:none}.navbar-nav .nav-link.active,.navbar-nav .nav-link.show{color:var(--bs-navbar-active-color)}.navbar-nav .dropdown-menu{position:static}.navbar-text{padding-top:.5rem;padding-bottom:.5rem;color:var(--bs-navbar-color)}.navbar-text a,.navbar-text a:focus,.navbar-text a:hover{color:var(--bs-navbar-active-color)}.navbar-collapse{flex-basis:100%;flex-grow:1;align-items:center}.navbar-toggler{padding:var(--bs-navbar-toggler-padding-y) var(--bs-navbar-toggler-padding-x);font-size:var(--bs-navbar-toggler-font-size);line-height:1;color:var(--bs-navbar-color);background-color:transparent;border:var(--bs-border-width) solid var(--bs-navbar-toggler-border-color);border-radius:var(--bs-navbar-toggler-border-radius);transition:var(--bs-navbar-toggler-transition)}@media (prefers-reduced-motion:reduce){.navbar-toggler{transition:none}}.navbar-toggler:hover{text-decoration:none}.navbar-toggler:focus{text-decoration:none;outline:0;box-shadow:0 0 0 var(--bs-navbar-toggler-focus-width)}.navbar-toggler-icon{display:inline-block;width:1.5em;height:1.5em;vertical-align:middle;background-image:var(--bs-navbar-toggler-icon-bg);background-repeat:no-repeat;background-position:center;background-size:100%}.navbar-nav-scroll{max-height:var(--bs-scroll-height,75vh);overflow-y:auto}@media (min-width:576px){.navbar-expand-sm{flex-wrap:nowrap;justify-content:flex-start}.navbar-expand-sm .navbar-nav{flex-direction:row}.navbar-expand-sm .navbar-nav .dropdown-menu{position:absolute}.navbar-expand-sm .navbar-nav .nav-link{padding-right:var(--bs-navbar-nav-link-padding-x);padding-left:var(--bs-navbar-nav-link-padding-x)}.navbar-expand-sm .navbar-nav-scroll{overflow:visible}.navbar-expand-sm .navbar-collapse{display:flex!important;flex-basis:auto}.navbar-expand-sm .navbar-toggler{display:none}.navbar-expand-sm .offcanvas{position:static;z-index:auto;flex-grow:1;width:auto!important;height:auto!important;visibility:visible!important;background-color:transparent!important;border:0!important;transform:none!important;transition:none}.navbar-expand-sm .offcanvas .offcanvas-header{display:none}.navbar-expand-sm .offcanvas .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible}}@media (min-width:768px){.navbar-expand-md{flex-wrap:nowrap;justify-content:flex-start}.navbar-expand-md .navbar-nav{flex-direction:row}.navbar-expand-md .navbar-nav .dropdown-menu{position:absolute}.navbar-expand-md .navbar-nav .nav-link{padding-right:var(--bs-navbar-nav-link-padding-x);padding-left:var(--bs-navbar-nav-link-padding-x)}.navbar-expand-md .navbar-nav-scroll{overflow:visible}.navbar-expand-md .navbar-collapse{display:flex!important;flex-basis:auto}.navbar-expand-md .navbar-toggler{display:none}.navbar-expand-md .offcanvas{position:static;z-index:auto;flex-grow:1;width:auto!important;height:auto!important;visibility:visible!important;background-color:transparent!important;border:0!important;transform:none!important;transition:none}.navbar-expand-md .offcanvas .offcanvas-header{display:none}.navbar-expand-md .offcanvas .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible}}@media (min-width:992px){.navbar-expand-lg{flex-wrap:nowrap;justify-content:flex-start}.navbar-expand-lg .navbar-nav{flex-direction:row}.navbar-expand-lg .navbar-nav .dropdown-menu{position:absolute}.navbar-expand-lg .navbar-nav .nav-link{padding-right:var(--bs-navbar-nav-link-padding-x);padding-left:var(--bs-navbar-nav-link-padding-x)}.navbar-expand-lg .navbar-nav-scroll{overflow:visible}.navbar-expand-lg .navbar-collapse{display:flex!important;flex-basis:auto}.navbar-expand-lg .navbar-toggler{display:none}.navbar-expand-lg .offcanvas{position:static;z-index:auto;flex-grow:1;width:auto!important;height:auto!important;visibility:visible!important;background-color:transparent!important;border:0!important;transform:none!important;transition:none}.navbar-expand-lg .offcanvas .offcanvas-header{display:none}.navbar-expand-lg .offcanvas .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible}}@media (min-width:1200px){.navbar-expand-xl{flex-wrap:nowrap;justify-content:flex-start}.navbar-expand-xl .navbar-nav{flex-direction:row}.navbar-expand-xl .navbar-nav .dropdown-menu{position:absolute}.navbar-expand-xl .navbar-nav .nav-link{padding-right:var(--bs-navbar-nav-link-padding-x);padding-left:var(--bs-navbar-nav-link-padding-x)}.navbar-expand-xl .navbar-nav-scroll{overflow:visible}.navbar-expand-xl .navbar-collapse{display:flex!important;flex-basis:auto}.navbar-expand-xl .navbar-toggler{display:none}.navbar-expand-xl .offcanvas{position:static;z-index:auto;flex-grow:1;width:auto!important;height:auto!important;visibility:visible!important;background-color:transparent!important;border:0!important;transform:none!important;transition:none}.navbar-expand-xl .offcanvas .offcanvas-header{display:none}.navbar-expand-xl .offcanvas .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible}}@media (min-width:1400px){.navbar-expand-xxl{flex-wrap:nowrap;justify-content:flex-start}.navbar-expand-xxl .navbar-nav{flex-direction:row}.navbar-expand-xxl .navbar-nav .dropdown-menu{position:absolute}.navbar-expand-xxl .navbar-nav .nav-link{padding-right:var(--bs-navbar-nav-link-padding-x);padding-left:var(--bs-navbar-nav-link-padding-x)}.navbar-expand-xxl .navbar-nav-scroll{overflow:visible}.navbar-expand-xxl .navbar-collapse{display:flex!important;flex-basis:auto}.navbar-expand-xxl .navbar-toggler{display:none}.navbar-expand-xxl .offcanvas{position:static;z-index:auto;flex-grow:1;width:auto!important;height:auto!important;visibility:visible!important;background-color:transparent!important;border:0!important;transform:none!important;transition:none}.navbar-expand-xxl .offcanvas .offcanvas-header{display:none}.navbar-expand-xxl .offcanvas .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible}}.navbar-expand{flex-wrap:nowrap;justify-content:flex-start}.navbar-expand .navbar-nav{flex-direction:row}.navbar-expand .navbar-nav .dropdown-menu{position:absolute}.navbar-expand .navbar-nav .nav-link{padding-right:var(--bs-navbar-nav-link-padding-x);padding-left:var(--bs-navbar-nav-link-padding-x)}.navbar-expand .navbar-nav-scroll{overflow:visible}.navbar-expand .navbar-collapse{display:flex!important;flex-basis:auto}.navbar-expand .navbar-toggler{display:none}.navbar-expand .offcanvas{position:static;z-index:auto;flex-grow:1;width:auto!important;height:auto!important;visibility:visible!important;background-color:transparent!important;border:0!important;transform:none!important;transition:none}.navbar-expand .offcanvas .offcanvas-header{display:none}.navbar-expand .offcanvas .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible}.navbar-dark,.navbar[data-bs-theme=dark]{--bs-navbar-color:rgba(255, 255, 255, 0.55);--bs-navbar-hover-color:rgba(255, 255, 255, 0.75);--bs-navbar-disabled-color:rgba(255, 255, 255, 0.25);--bs-navbar-active-color:#fff;--bs-navbar-brand-color:#fff;--bs-navbar-brand-hover-color:#fff;--bs-navbar-toggler-border-color:rgba(255, 255, 255, 0.1);--bs-navbar-toggler-icon-bg:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 30 30'%3e%3cpath stroke='rgba%28255, 255, 255, 0.55%29' stroke-linecap='round' stroke-miterlimit='10' stroke-width='2' d='M4 7h22M4 15h22M4 23h22'/%3e%3c/svg%3e")}[data-bs-theme=dark] .navbar-toggler-icon{--bs-navbar-toggler-icon-bg:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 30 30'%3e%3cpath stroke='rgba%28255, 255, 255, 0.55%29' stroke-linecap='round' stroke-miterlimit='10' stroke-width='2' d='M4 7h22M4 15h22M4 23h22'/%3e%3c/svg%3e")}.card{--bs-card-spacer-y:1rem;--bs-card-spacer-x:1rem;--bs-card-title-spacer-y:0.5rem;--bs-card-title-color: ;--bs-card-subtitle-color: ;--bs-card-border-width:var(--bs-border-width);--bs-card-border-color:var(--bs-border-color-translucent);--bs-card-border-radius:var(--bs-border-radius);--bs-card-box-shadow: ;--bs-card-inner-border-radius:calc(var(--bs-border-radius) - (var(--bs-border-width)));--bs-card-cap-padding-y:0.5rem;--bs-card-cap-padding-x:1rem;--bs-card-cap-bg:rgba(var(--bs-body-color-rgb), 0.03);--bs-card-cap-color: ;--bs-card-height: ;--bs-card-color: ;--bs-card-bg:var(--bs-body-bg);--bs-card-img-overlay-padding:1rem;--bs-card-group-margin:0.75rem;position:relative;display:flex;flex-direction:column;min-width:0;height:var(--bs-card-height);color:var(--bs-body-color);word-wrap:break-word;background-color:var(--bs-card-bg);background-clip:border-box;border:var(--bs-card-border-width) solid var(--bs-card-border-color);border-radius:var(--bs-card-border-radius)}.card>hr{margin-right:0;margin-left:0}.card>.list-group{border-top:inherit;border-bottom:inherit}.card>.list-group:first-child{border-top-width:0;border-top-left-radius:var(--bs-card-inner-border-radius);border-top-right-radius:var(--bs-card-inner-border-radius)}.card>.list-group:last-child{border-bottom-width:0;border-bottom-right-radius:var(--bs-card-inner-border-radius);border-bottom-left-radius:var(--bs-card-inner-border-radius)}.card>.card-header+.list-group,.card>.list-group+.card-footer{border-top:0}.card-body{flex:1 1 auto;padding:var(--bs-card-spacer-y) var(--bs-card-spacer-x);color:var(--bs-card-color)}.card-title{margin-bottom:var(--bs-card-title-spacer-y);color:var(--bs-card-title-color)}.card-subtitle{margin-top:calc(-.5 * var(--bs-card-title-spacer-y));margin-bottom:0;color:var(--bs-card-subtitle-color)}.card-text:last-child{margin-bottom:0}.card-link+.card-link{margin-left:var(--bs-card-spacer-x)}.card-header{padding:var(--bs-card-cap-padding-y) var(--bs-card-cap-padding-x);margin-bottom:0;color:var(--bs-card-cap-color);background-color:var(--bs-card-cap-bg);border-bottom:var(--bs-card-border-width) solid var(--bs-card-border-color)}.card-header:first-child{border-radius:var(--bs-card-inner-border-radius) var(--bs-card-inner-border-radius) 0 0}.card-footer{padding:var(--bs-card-cap-padding-y) var(--bs-card-cap-padding-x);color:var(--bs-card-cap-color);background-color:var(--bs-card-cap-bg);border-top:var(--bs-card-border-width) solid var(--bs-card-border-color)}.card-footer:last-child{border-radius:0 0 var(--bs-card-inner-border-radius) var(--bs-card-inner-border-radius)}.card-header-tabs{margin-right:calc(-.5 * var(--bs-card-cap-padding-x));margin-bottom:calc(-1 * var(--bs-card-cap-padding-y));margin-left:calc(-.5 * var(--bs-card-cap-padding-x));border-bottom:0}.card-header-tabs .nav-link.active{background-color:var(--bs-card-bg);border-bottom-color:var(--bs-card-bg)}.card-header-pills{margin-right:calc(-.5 * var(--bs-card-cap-padding-x));margin-left:calc(-.5 * var(--bs-card-cap-padding-x))}.card-img-overlay{position:absolute;top:0;right:0;bottom:0;left:0;padding:var(--bs-card-img-overlay-padding);border-radius:var(--bs-card-inner-border-radius)}.card-img,.card-img-bottom,.card-img-top{width:100%}.card-img,.card-img-top{border-top-left-radius:var(--bs-card-inner-border-radius);border-top-right-radius:var(--bs-card-inner-border-radius)}.card-img,.card-img-bottom{border-bottom-right-radius:var(--bs-card-inner-border-radius);border-bottom-left-radius:var(--bs-card-inner-border-radius)}.card-group>.card{margin-bottom:var(--bs-card-group-margin)}@media (min-width:576px){.card-group{display:flex;flex-flow:row wrap}.card-group>.card{flex:1 0 0%;margin-bottom:0}.card-group>.card+.card{margin-left:0;border-left:0}.card-group>.card:not(:last-child){border-top-right-radius:0;border-bottom-right-radius:0}.card-group>.card:not(:last-child) .card-header,.card-group>.card:not(:last-child) .card-img-top{border-top-right-radius:0}.card-group>.card:not(:last-child) .card-footer,.card-group>.card:not(:last-child) .card-img-bottom{border-bottom-right-radius:0}.card-group>.card:not(:first-child){border-top-left-radius:0;border-bottom-left-radius:0}.card-group>.card:not(:first-child) .card-header,.card-group>.card:not(:first-child) .card-img-top{border-top-left-radius:0}.card-group>.card:not(:first-child) .card-footer,.card-group>.card:not(:first-child) .card-img-bottom{border-bottom-left-radius:0}}.accordion{--bs-accordion-color:var(--bs-body-color);--bs-accordion-bg:var(--bs-body-bg);--bs-accordion-transition:color 0.15s ease-in-out,background-color 0.15s ease-in-out,border-color 0.15s ease-in-out,box-shadow 0.15s ease-in-out,border-radius 0.15s ease;--bs-accordion-border-color:var(--bs-border-color);--bs-accordion-border-width:var(--bs-border-width);--bs-accordion-border-radius:var(--bs-border-radius);--bs-accordion-inner-border-radius:calc(var(--bs-border-radius) - (var(--bs-border-width)));--bs-accordion-btn-padding-x:1.25rem;--bs-accordion-btn-padding-y:1rem;--bs-accordion-btn-color:var(--bs-body-color);--bs-accordion-btn-bg:var(--bs-accordion-bg);--bs-accordion-btn-icon:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16' fill='%23212529'%3e%3cpath fill-rule='evenodd' d='M1.646 4.646a.5.5 0 0 1 .708 0L8 10.293l5.646-5.647a.5.5 0 0 1 .708.708l-6 6a.5.5 0 0 1-.708 0l-6-6a.5.5 0 0 1 0-.708z'/%3e%3c/svg%3e");--bs-accordion-btn-icon-width:1.25rem;--bs-accordion-btn-icon-transform:rotate(-180deg);--bs-accordion-btn-icon-transition:transform 0.2s ease-in-out;--bs-accordion-btn-active-icon:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16' fill='%23052c65'%3e%3cpath fill-rule='evenodd' d='M1.646 4.646a.5.5 0 0 1 .708 0L8 10.293l5.646-5.647a.5.5 0 0 1 .708.708l-6 6a.5.5 0 0 1-.708 0l-6-6a.5.5 0 0 1 0-.708z'/%3e%3c/svg%3e");--bs-accordion-btn-focus-border-color:#86b7fe;--bs-accordion-btn-focus-box-shadow:0 0 0 0.25rem rgba(13, 110, 253, 0.25);--bs-accordion-body-padding-x:1.25rem;--bs-accordion-body-padding-y:1rem;--bs-accordion-active-color:var(--bs-primary-text-emphasis);--bs-accordion-active-bg:var(--bs-primary-bg-subtle)}.accordion-button{position:relative;display:flex;align-items:center;width:100%;padding:var(--bs-accordion-btn-padding-y) var(--bs-accordion-btn-padding-x);font-size:1rem;color:var(--bs-accordion-btn-color);text-align:left;background-color:var(--bs-accordion-btn-bg);border:0;border-radius:0;overflow-anchor:none;transition:var(--bs-accordion-transition)}@media (prefers-reduced-motion:reduce){.accordion-button{transition:none}}.accordion-button:not(.collapsed){color:var(--bs-accordion-active-color);background-color:var(--bs-accordion-active-bg);box-shadow:inset 0 calc(-1 * var(--bs-accordion-border-width)) 0 var(--bs-accordion-border-color)}.accordion-button:not(.collapsed)::after{background-image:var(--bs-accordion-btn-active-icon);transform:var(--bs-accordion-btn-icon-transform)}.accordion-button::after{flex-shrink:0;width:var(--bs-accordion-btn-icon-width);height:var(--bs-accordion-btn-icon-width);margin-left:auto;content:"";background-image:var(--bs-accordion-btn-icon);background-repeat:no-repeat;background-size:var(--bs-accordion-btn-icon-width);transition:var(--bs-accordion-btn-icon-transition)}@media (prefers-reduced-motion:reduce){.accordion-button::after{transition:none}}.accordion-button:hover{z-index:2}.accordion-button:focus{z-index:3;border-color:var(--bs-accordion-btn-focus-border-color);outline:0;box-shadow:var(--bs-accordion-btn-focus-box-shadow)}.accordion-header{margin-bottom:0}.accordion-item{color:var(--bs-accordion-color);background-color:var(--bs-accordion-bg);border:var(--bs-accordion-border-width) solid var(--bs-accordion-border-color)}.accordion-item:first-of-type{border-top-left-radius:var(--bs-accordion-border-radius);border-top-right-radius:var(--bs-accordion-border-radius)}.accordion-item:first-of-type .accordion-button{border-top-left-radius:var(--bs-accordion-inner-border-radius);border-top-right-radius:var(--bs-accordion-inner-border-radius)}.accordion-item:not(:first-of-type){border-top:0}.accordion-item:last-of-type{border-bottom-right-radius:var(--bs-accordion-border-radius);border-bottom-left-radius:var(--bs-accordion-border-radius)}.accordion-item:last-of-type .accordion-button.collapsed{border-bottom-right-radius:var(--bs-accordion-inner-border-radius);border-bottom-left-radius:var(--bs-accordion-inner-border-radius)}.accordion-item:last-of-type .accordion-collapse{border-bottom-right-radius:var(--bs-accordion-border-radius);border-bottom-left-radius:var(--bs-accordion-border-radius)}.accordion-body{padding:var(--bs-accordion-body-padding-y) var(--bs-accordion-body-padding-x)}.accordion-flush .accordion-collapse{border-width:0}.accordion-flush .accordion-item{border-right:0;border-left:0;border-radius:0}.accordion-flush .accordion-item:first-child{border-top:0}.accordion-flush .accordion-item:last-child{border-bottom:0}.accordion-flush .accordion-item .accordion-button,.accordion-flush .accordion-item .accordion-button.collapsed{border-radius:0}[data-bs-theme=dark] .accordion-button::after{--bs-accordion-btn-icon:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16' fill='%236ea8fe'%3e%3cpath fill-rule='evenodd' d='M1.646 4.646a.5.5 0 0 1 .708 0L8 10.293l5.646-5.647a.5.5 0 0 1 .708.708l-6 6a.5.5 0 0 1-.708 0l-6-6a.5.5 0 0 1 0-.708z'/%3e%3c/svg%3e");--bs-accordion-btn-active-icon:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16' fill='%236ea8fe'%3e%3cpath fill-rule='evenodd' d='M1.646 4.646a.5.5 0 0 1 .708 0L8 10.293l5.646-5.647a.5.5 0 0 1 .708.708l-6 6a.5.5 0 0 1-.708 0l-6-6a.5.5 0 0 1 0-.708z'/%3e%3c/svg%3e")}.breadcrumb{--bs-breadcrumb-padding-x:0;--bs-breadcrumb-padding-y:0;--bs-breadcrumb-margin-bottom:1rem;--bs-breadcrumb-bg: ;--bs-breadcrumb-border-radius: ;--bs-breadcrumb-divider-color:var(--bs-secondary-color);--bs-breadcrumb-item-padding-x:0.5rem;--bs-breadcrumb-item-active-color:var(--bs-secondary-color);display:flex;flex-wrap:wrap;padding:var(--bs-breadcrumb-padding-y) var(--bs-breadcrumb-padding-x);margin-bottom:var(--bs-breadcrumb-margin-bottom);font-size:var(--bs-breadcrumb-font-size);list-style:none;background-color:var(--bs-breadcrumb-bg);border-radius:var(--bs-breadcrumb-border-radius)}.breadcrumb-item+.breadcrumb-item{padding-left:var(--bs-breadcrumb-item-padding-x)}.breadcrumb-item+.breadcrumb-item::before{float:left;padding-right:var(--bs-breadcrumb-item-padding-x);color:var(--bs-breadcrumb-divider-color);content:var(--bs-breadcrumb-divider, "/")}.breadcrumb-item.active{color:var(--bs-breadcrumb-item-active-color)}.pagination{--bs-pagination-padding-x:0.75rem;--bs-pagination-padding-y:0.375rem;--bs-pagination-font-size:1rem;--bs-pagination-color:var(--bs-link-color);--bs-pagination-bg:var(--bs-body-bg);--bs-pagination-border-width:var(--bs-border-width);--bs-pagination-border-color:var(--bs-border-color);--bs-pagination-border-radius:var(--bs-border-radius);--bs-pagination-hover-color:var(--bs-link-hover-color);--bs-pagination-hover-bg:var(--bs-tertiary-bg);--bs-pagination-hover-border-color:var(--bs-border-color);--bs-pagination-focus-color:var(--bs-link-hover-color);--bs-pagination-focus-bg:var(--bs-secondary-bg);--bs-pagination-focus-box-shadow:0 0 0 0.25rem rgba(13, 110, 253, 0.25);--bs-pagination-active-color:#fff;--bs-pagination-active-bg:#0d6efd;--bs-pagination-active-border-color:#0d6efd;--bs-pagination-disabled-color:var(--bs-secondary-color);--bs-pagination-disabled-bg:var(--bs-secondary-bg);--bs-pagination-disabled-border-color:var(--bs-border-color);display:flex;padding-left:0;list-style:none}.page-link{position:relative;display:block;padding:var(--bs-pagination-padding-y) var(--bs-pagination-padding-x);font-size:var(--bs-pagination-font-size);color:var(--bs-pagination-color);text-decoration:none;background-color:var(--bs-pagination-bg);border:var(--bs-pagination-border-width) solid var(--bs-pagination-border-color);transition:color .15s ease-in-out,background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out}@media (prefers-reduced-motion:reduce){.page-link{transition:none}}.page-link:hover{z-index:2;color:var(--bs-pagination-hover-color);background-color:var(--bs-pagination-hover-bg);border-color:var(--bs-pagination-hover-border-color)}.page-link:focus{z-index:3;color:var(--bs-pagination-focus-color);background-color:var(--bs-pagination-focus-bg);outline:0;box-shadow:var(--bs-pagination-focus-box-shadow)}.active>.page-link,.page-link.active{z-index:3;color:var(--bs-pagination-active-color);background-color:var(--bs-pagination-active-bg);border-color:var(--bs-pagination-active-border-color)}.disabled>.page-link,.page-link.disabled{color:var(--bs-pagination-disabled-color);pointer-events:none;background-color:var(--bs-pagination-disabled-bg);border-color:var(--bs-pagination-disabled-border-color)}.page-item:not(:first-child) .page-link{margin-left:calc(var(--bs-border-width) * -1)}.page-item:first-child .page-link{border-top-left-radius:var(--bs-pagination-border-radius);border-bottom-left-radius:var(--bs-pagination-border-radius)}.page-item:last-child .page-link{border-top-right-radius:var(--bs-pagination-border-radius);border-bottom-right-radius:var(--bs-pagination-border-radius)}.pagination-lg{--bs-pagination-padding-x:1.5rem;--bs-pagination-padding-y:0.75rem;--bs-pagination-font-size:1.25rem;--bs-pagination-border-radius:var(--bs-border-radius-lg)}.pagination-sm{--bs-pagination-padding-x:0.5rem;--bs-pagination-padding-y:0.25rem;--bs-pagination-font-size:0.875rem;--bs-pagination-border-radius:var(--bs-border-radius-sm)}.badge{--bs-badge-padding-x:0.65em;--bs-badge-padding-y:0.35em;--bs-badge-font-size:0.75em;--bs-badge-font-weight:700;--bs-badge-color:#fff;--bs-badge-border-radius:var(--bs-border-radius);display:inline-block;padding:var(--bs-badge-padding-y) var(--bs-badge-padding-x);font-size:var(--bs-badge-font-size);font-weight:var(--bs-badge-font-weight);line-height:1;color:var(--bs-badge-color);text-align:center;white-space:nowrap;vertical-align:baseline;border-radius:var(--bs-badge-border-radius)}.badge:empty{display:none}.btn .badge{position:relative;top:-1px}.alert{--bs-alert-bg:transparent;--bs-alert-padding-x:1rem;--bs-alert-padding-y:1rem;--bs-alert-margin-bottom:1rem;--bs-alert-color:inherit;--bs-alert-border-color:transparent;--bs-alert-border:var(--bs-border-width) solid var(--bs-alert-border-color);--bs-alert-border-radius:var(--bs-border-radius);--bs-alert-link-color:inherit;position:relative;padding:var(--bs-alert-padding-y) var(--bs-alert-padding-x);margin-bottom:var(--bs-alert-margin-bottom);color:var(--bs-alert-color);background-color:var(--bs-alert-bg);border:var(--bs-alert-border);border-radius:var(--bs-alert-border-radius)}.alert-heading{color:inherit}.alert-link{font-weight:700;color:var(--bs-alert-link-color)}.alert-dismissible{padding-right:3rem}.alert-dismissible .btn-close{position:absolute;top:0;right:0;z-index:2;padding:1.25rem 1rem}.alert-primary{--bs-alert-color:var(--bs-primary-text-emphasis);--bs-alert-bg:var(--bs-primary-bg-subtle);--bs-alert-border-color:var(--bs-primary-border-subtle);--bs-alert-link-color:var(--bs-primary-text-emphasis)}.alert-secondary{--bs-alert-color:var(--bs-secondary-text-emphasis);--bs-alert-bg:var(--bs-secondary-bg-subtle);--bs-alert-border-color:var(--bs-secondary-border-subtle);--bs-alert-link-color:var(--bs-secondary-text-emphasis)}.alert-success{--bs-alert-color:var(--bs-success-text-emphasis);--bs-alert-bg:var(--bs-success-bg-subtle);--bs-alert-border-color:var(--bs-success-border-subtle);--bs-alert-link-color:var(--bs-success-text-emphasis)}.alert-info{--bs-alert-color:var(--bs-info-text-emphasis);--bs-alert-bg:var(--bs-info-bg-subtle);--bs-alert-border-color:var(--bs-info-border-subtle);--bs-alert-link-color:var(--bs-info-text-emphasis)}.alert-warning{--bs-alert-color:var(--bs-warning-text-emphasis);--bs-alert-bg:var(--bs-warning-bg-subtle);--bs-alert-border-color:var(--bs-warning-border-subtle);--bs-alert-link-color:var(--bs-warning-text-emphasis)}.alert-danger{--bs-alert-color:var(--bs-danger-text-emphasis);--bs-alert-bg:var(--bs-danger-bg-subtle);--bs-alert-border-color:var(--bs-danger-border-subtle);--bs-alert-link-color:var(--bs-danger-text-emphasis)}.alert-light{--bs-alert-color:var(--bs-light-text-emphasis);--bs-alert-bg:var(--bs-light-bg-subtle);--bs-alert-border-color:var(--bs-light-border-subtle);--bs-alert-link-color:var(--bs-light-text-emphasis)}.alert-dark{--bs-alert-color:var(--bs-dark-text-emphasis);--bs-alert-bg:var(--bs-dark-bg-subtle);--bs-alert-border-color:var(--bs-dark-border-subtle);--bs-alert-link-color:var(--bs-dark-text-emphasis)}@keyframes progress-bar-stripes{0%{background-position-x:1rem}}.progress,.progress-stacked{--bs-progress-height:1rem;--bs-progress-font-size:0.75rem;--bs-progress-bg:var(--bs-secondary-bg);--bs-progress-border-radius:var(--bs-border-radius);--bs-progress-box-shadow:var(--bs-box-shadow-inset);--bs-progress-bar-color:#fff;--bs-progress-bar-bg:#0d6efd;--bs-progress-bar-transition:width 0.6s ease;display:flex;height:var(--bs-progress-height);overflow:hidden;font-size:var(--bs-progress-font-size);background-color:var(--bs-progress-bg);border-radius:var(--bs-progress-border-radius)}.progress-bar{display:flex;flex-direction:column;justify-content:center;overflow:hidden;color:var(--bs-progress-bar-color);text-align:center;white-space:nowrap;background-color:var(--bs-progress-bar-bg);transition:var(--bs-progress-bar-transition)}@media (prefers-reduced-motion:reduce){.progress-bar{transition:none}}.progress-bar-striped{background-image:linear-gradient(45deg,rgba(255,255,255,.15) 25%,transparent 25%,transparent 50%,rgba(255,255,255,.15) 50%,rgba(255,255,255,.15) 75%,transparent 75%,transparent);background-size:var(--bs-progress-height) var(--bs-progress-height)}.progress-stacked>.progress{overflow:visible}.progress-stacked>.progress>.progress-bar{width:100%}.progress-bar-animated{animation:1s linear infinite progress-bar-stripes}@media (prefers-reduced-motion:reduce){.progress-bar-animated{animation:none}}.list-group{--bs-list-group-color:var(--bs-body-color);--bs-list-group-bg:var(--bs-body-bg);--bs-list-group-border-color:var(--bs-border-color);--bs-list-group-border-width:var(--bs-border-width);--bs-list-group-border-radius:var(--bs-border-radius);--bs-list-group-item-padding-x:1rem;--bs-list-group-item-padding-y:0.5rem;--bs-list-group-action-color:var(--bs-secondary-color);--bs-list-group-action-hover-color:var(--bs-emphasis-color);--bs-list-group-action-hover-bg:var(--bs-tertiary-bg);--bs-list-group-action-active-color:var(--bs-body-color);--bs-list-group-action-active-bg:var(--bs-secondary-bg);--bs-list-group-disabled-color:var(--bs-secondary-color);--bs-list-group-disabled-bg:var(--bs-body-bg);--bs-list-group-active-color:#fff;--bs-list-group-active-bg:#0d6efd;--bs-list-group-active-border-color:#0d6efd;display:flex;flex-direction:column;padding-left:0;margin-bottom:0;border-radius:var(--bs-list-group-border-radius)}.list-group-numbered{list-style-type:none;counter-reset:section}.list-group-numbered>.list-group-item::before{content:counters(section, ".") ". ";counter-increment:section}.list-group-item-action{width:100%;color:var(--bs-list-group-action-color);text-align:inherit}.list-group-item-action:focus,.list-group-item-action:hover{z-index:1;color:var(--bs-list-group-action-hover-color);text-decoration:none;background-color:var(--bs-list-group-action-hover-bg)}.list-group-item-action:active{color:var(--bs-list-group-action-active-color);background-color:var(--bs-list-group-action-active-bg)}.list-group-item{position:relative;display:block;padding:var(--bs-list-group-item-padding-y) var(--bs-list-group-item-padding-x);color:var(--bs-list-group-color);text-decoration:none;background-color:var(--bs-list-group-bg);border:var(--bs-list-group-border-width) solid var(--bs-list-group-border-color)}.list-group-item:first-child{border-top-left-radius:inherit;border-top-right-radius:inherit}.list-group-item:last-child{border-bottom-right-radius:inherit;border-bottom-left-radius:inherit}.list-group-item.disabled,.list-group-item:disabled{color:var(--bs-list-group-disabled-color);pointer-events:none;background-color:var(--bs-list-group-disabled-bg)}.list-group-item.active{z-index:2;color:var(--bs-list-group-active-color);background-color:var(--bs-list-group-active-bg);border-color:var(--bs-list-group-active-border-color)}.list-group-item+.list-group-item{border-top-width:0}.list-group-item+.list-group-item.active{margin-top:calc(-1 * var(--bs-list-group-border-width));border-top-width:var(--bs-list-group-border-width)}.list-group-horizontal{flex-direction:row}.list-group-horizontal>.list-group-item:first-child:not(:last-child){border-bottom-left-radius:var(--bs-list-group-border-radius);border-top-right-radius:0}.list-group-horizontal>.list-group-item:last-child:not(:first-child){border-top-right-radius:var(--bs-list-group-border-radius);border-bottom-left-radius:0}.list-group-horizontal>.list-group-item.active{margin-top:0}.list-group-horizontal>.list-group-item+.list-group-item{border-top-width:var(--bs-list-group-border-width);border-left-width:0}.list-group-horizontal>.list-group-item+.list-group-item.active{margin-left:calc(-1 * var(--bs-list-group-border-width));border-left-width:var(--bs-list-group-border-width)}@media (min-width:576px){.list-group-horizontal-sm{flex-direction:row}.list-group-horizontal-sm>.list-group-item:first-child:not(:last-child){border-bottom-left-radius:var(--bs-list-group-border-radius);border-top-right-radius:0}.list-group-horizontal-sm>.list-group-item:last-child:not(:first-child){border-top-right-radius:var(--bs-list-group-border-radius);border-bottom-left-radius:0}.list-group-horizontal-sm>.list-group-item.active{margin-top:0}.list-group-horizontal-sm>.list-group-item+.list-group-item{border-top-width:var(--bs-list-group-border-width);border-left-width:0}.list-group-horizontal-sm>.list-group-item+.list-group-item.active{margin-left:calc(-1 * var(--bs-list-group-border-width));border-left-width:var(--bs-list-group-border-width)}}@media (min-width:768px){.list-group-horizontal-md{flex-direction:row}.list-group-horizontal-md>.list-group-item:first-child:not(:last-child){border-bottom-left-radius:var(--bs-list-group-border-radius);border-top-right-radius:0}.list-group-horizontal-md>.list-group-item:last-child:not(:first-child){border-top-right-radius:var(--bs-list-group-border-radius);border-bottom-left-radius:0}.list-group-horizontal-md>.list-group-item.active{margin-top:0}.list-group-horizontal-md>.list-group-item+.list-group-item{border-top-width:var(--bs-list-group-border-width);border-left-width:0}.list-group-horizontal-md>.list-group-item+.list-group-item.active{margin-left:calc(-1 * var(--bs-list-group-border-width));border-left-width:var(--bs-list-group-border-width)}}@media (min-width:992px){.list-group-horizontal-lg{flex-direction:row}.list-group-horizontal-lg>.list-group-item:first-child:not(:last-child){border-bottom-left-radius:var(--bs-list-group-border-radius);border-top-right-radius:0}.list-group-horizontal-lg>.list-group-item:last-child:not(:first-child){border-top-right-radius:var(--bs-list-group-border-radius);border-bottom-left-radius:0}.list-group-horizontal-lg>.list-group-item.active{margin-top:0}.list-group-horizontal-lg>.list-group-item+.list-group-item{border-top-width:var(--bs-list-group-border-width);border-left-width:0}.list-group-horizontal-lg>.list-group-item+.list-group-item.active{margin-left:calc(-1 * var(--bs-list-group-border-width));border-left-width:var(--bs-list-group-border-width)}}@media (min-width:1200px){.list-group-horizontal-xl{flex-direction:row}.list-group-horizontal-xl>.list-group-item:first-child:not(:last-child){border-bottom-left-radius:var(--bs-list-group-border-radius);border-top-right-radius:0}.list-group-horizontal-xl>.list-group-item:last-child:not(:first-child){border-top-right-radius:var(--bs-list-group-border-radius);border-bottom-left-radius:0}.list-group-horizontal-xl>.list-group-item.active{margin-top:0}.list-group-horizontal-xl>.list-group-item+.list-group-item{border-top-width:var(--bs-list-group-border-width);border-left-width:0}.list-group-horizontal-xl>.list-group-item+.list-group-item.active{margin-left:calc(-1 * var(--bs-list-group-border-width));border-left-width:var(--bs-list-group-border-width)}}@media (min-width:1400px){.list-group-horizontal-xxl{flex-direction:row}.list-group-horizontal-xxl>.list-group-item:first-child:not(:last-child){border-bottom-left-radius:var(--bs-list-group-border-radius);border-top-right-radius:0}.list-group-horizontal-xxl>.list-group-item:last-child:not(:first-child){border-top-right-radius:var(--bs-list-group-border-radius);border-bottom-left-radius:0}.list-group-horizontal-xxl>.list-group-item.active{margin-top:0}.list-group-horizontal-xxl>.list-group-item+.list-group-item{border-top-width:var(--bs-list-group-border-width);border-left-width:0}.list-group-horizontal-xxl>.list-group-item+.list-group-item.active{margin-left:calc(-1 * var(--bs-list-group-border-width));border-left-width:var(--bs-list-group-border-width)}}.list-group-flush{border-radius:0}.list-group-flush>.list-group-item{border-width:0 0 var(--bs-list-group-border-width)}.list-group-flush>.list-group-item:last-child{border-bottom-width:0}.list-group-item-primary{--bs-list-group-color:var(--bs-primary-text-emphasis);--bs-list-group-bg:var(--bs-primary-bg-subtle);--bs-list-group-border-color:var(--bs-primary-border-subtle);--bs-list-group-action-hover-color:var(--bs-emphasis-color);--bs-list-group-action-hover-bg:var(--bs-primary-border-subtle);--bs-list-group-action-active-color:var(--bs-emphasis-color);--bs-list-group-action-active-bg:var(--bs-primary-border-subtle);--bs-list-group-active-color:var(--bs-primary-bg-subtle);--bs-list-group-active-bg:var(--bs-primary-text-emphasis);--bs-list-group-active-border-color:var(--bs-primary-text-emphasis)}.list-group-item-secondary{--bs-list-group-color:var(--bs-secondary-text-emphasis);--bs-list-group-bg:var(--bs-secondary-bg-subtle);--bs-list-group-border-color:var(--bs-secondary-border-subtle);--bs-list-group-action-hover-color:var(--bs-emphasis-color);--bs-list-group-action-hover-bg:var(--bs-secondary-border-subtle);--bs-list-group-action-active-color:var(--bs-emphasis-color);--bs-list-group-action-active-bg:var(--bs-secondary-border-subtle);--bs-list-group-active-color:var(--bs-secondary-bg-subtle);--bs-list-group-active-bg:var(--bs-secondary-text-emphasis);--bs-list-group-active-border-color:var(--bs-secondary-text-emphasis)}.list-group-item-success{--bs-list-group-color:var(--bs-success-text-emphasis);--bs-list-group-bg:var(--bs-success-bg-subtle);--bs-list-group-border-color:var(--bs-success-border-subtle);--bs-list-group-action-hover-color:var(--bs-emphasis-color);--bs-list-group-action-hover-bg:var(--bs-success-border-subtle);--bs-list-group-action-active-color:var(--bs-emphasis-color);--bs-list-group-action-active-bg:var(--bs-success-border-subtle);--bs-list-group-active-color:var(--bs-success-bg-subtle);--bs-list-group-active-bg:var(--bs-success-text-emphasis);--bs-list-group-active-border-color:var(--bs-success-text-emphasis)}.list-group-item-info{--bs-list-group-color:var(--bs-info-text-emphasis);--bs-list-group-bg:var(--bs-info-bg-subtle);--bs-list-group-border-color:var(--bs-info-border-subtle);--bs-list-group-action-hover-color:var(--bs-emphasis-color);--bs-list-group-action-hover-bg:var(--bs-info-border-subtle);--bs-list-group-action-active-color:var(--bs-emphasis-color);--bs-list-group-action-active-bg:var(--bs-info-border-subtle);--bs-list-group-active-color:var(--bs-info-bg-subtle);--bs-list-group-active-bg:var(--bs-info-text-emphasis);--bs-list-group-active-border-color:var(--bs-info-text-emphasis)}.list-group-item-warning{--bs-list-group-color:var(--bs-warning-text-emphasis);--bs-list-group-bg:var(--bs-warning-bg-subtle);--bs-list-group-border-color:var(--bs-warning-border-subtle);--bs-list-group-action-hover-color:var(--bs-emphasis-color);--bs-list-group-action-hover-bg:var(--bs-warning-border-subtle);--bs-list-group-action-active-color:var(--bs-emphasis-color);--bs-list-group-action-active-bg:var(--bs-warning-border-subtle);--bs-list-group-active-color:var(--bs-warning-bg-subtle);--bs-list-group-active-bg:var(--bs-warning-text-emphasis);--bs-list-group-active-border-color:var(--bs-warning-text-emphasis)}.list-group-item-danger{--bs-list-group-color:var(--bs-danger-text-emphasis);--bs-list-group-bg:var(--bs-danger-bg-subtle);--bs-list-group-border-color:var(--bs-danger-border-subtle);--bs-list-group-action-hover-color:var(--bs-emphasis-color);--bs-list-group-action-hover-bg:var(--bs-danger-border-subtle);--bs-list-group-action-active-color:var(--bs-emphasis-color);--bs-list-group-action-active-bg:var(--bs-danger-border-subtle);--bs-list-group-active-color:var(--bs-danger-bg-subtle);--bs-list-group-active-bg:var(--bs-danger-text-emphasis);--bs-list-group-active-border-color:var(--bs-danger-text-emphasis)}.list-group-item-light{--bs-list-group-color:var(--bs-light-text-emphasis);--bs-list-group-bg:var(--bs-light-bg-subtle);--bs-list-group-border-color:var(--bs-light-border-subtle);--bs-list-group-action-hover-color:var(--bs-emphasis-color);--bs-list-group-action-hover-bg:var(--bs-light-border-subtle);--bs-list-group-action-active-color:var(--bs-emphasis-color);--bs-list-group-action-active-bg:var(--bs-light-border-subtle);--bs-list-group-active-color:var(--bs-light-bg-subtle);--bs-list-group-active-bg:var(--bs-light-text-emphasis);--bs-list-group-active-border-color:var(--bs-light-text-emphasis)}.list-group-item-dark{--bs-list-group-color:var(--bs-dark-text-emphasis);--bs-list-group-bg:var(--bs-dark-bg-subtle);--bs-list-group-border-color:var(--bs-dark-border-subtle);--bs-list-group-action-hover-color:var(--bs-emphasis-color);--bs-list-group-action-hover-bg:var(--bs-dark-border-subtle);--bs-list-group-action-active-color:var(--bs-emphasis-color);--bs-list-group-action-active-bg:var(--bs-dark-border-subtle);--bs-list-group-active-color:var(--bs-dark-bg-subtle);--bs-list-group-active-bg:var(--bs-dark-text-emphasis);--bs-list-group-active-border-color:var(--bs-dark-text-emphasis)}.btn-close{--bs-btn-close-color:#000;--bs-btn-close-bg:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16' fill='%23000'%3e%3cpath d='M.293.293a1 1 0 0 1 1.414 0L8 6.586 14.293.293a1 1 0 1 1 1.414 1.414L9.414 8l6.293 6.293a1 1 0 0 1-1.414 1.414L8 9.414l-6.293 6.293a1 1 0 0 1-1.414-1.414L6.586 8 .293 1.707a1 1 0 0 1 0-1.414z'/%3e%3c/svg%3e");--bs-btn-close-opacity:0.5;--bs-btn-close-hover-opacity:0.75;--bs-btn-close-focus-shadow:0 0 0 0.25rem rgba(13, 110, 253, 0.25);--bs-btn-close-focus-opacity:1;--bs-btn-close-disabled-opacity:0.25;--bs-btn-close-white-filter:invert(1) grayscale(100%) brightness(200%);box-sizing:content-box;width:1em;height:1em;padding:.25em .25em;color:var(--bs-btn-close-color);background:transparent var(--bs-btn-close-bg) center/1em auto no-repeat;border:0;border-radius:.375rem;opacity:var(--bs-btn-close-opacity)}.btn-close:hover{color:var(--bs-btn-close-color);text-decoration:none;opacity:var(--bs-btn-close-hover-opacity)}.btn-close:focus{outline:0;box-shadow:var(--bs-btn-close-focus-shadow);opacity:var(--bs-btn-close-focus-opacity)}.btn-close.disabled,.btn-close:disabled{pointer-events:none;-webkit-user-select:none;-moz-user-select:none;user-select:none;opacity:var(--bs-btn-close-disabled-opacity)}.btn-close-white{filter:var(--bs-btn-close-white-filter)}[data-bs-theme=dark] .btn-close{filter:var(--bs-btn-close-white-filter)}.toast{--bs-toast-zindex:1090;--bs-toast-padding-x:0.75rem;--bs-toast-padding-y:0.5rem;--bs-toast-spacing:1.5rem;--bs-toast-max-width:350px;--bs-toast-font-size:0.875rem;--bs-toast-color: ;--bs-toast-bg:rgba(var(--bs-body-bg-rgb), 0.85);--bs-toast-border-width:var(--bs-border-width);--bs-toast-border-color:var(--bs-border-color-translucent);--bs-toast-border-radius:var(--bs-border-radius);--bs-toast-box-shadow:var(--bs-box-shadow);--bs-toast-header-color:var(--bs-secondary-color);--bs-toast-header-bg:rgba(var(--bs-body-bg-rgb), 0.85);--bs-toast-header-border-color:var(--bs-border-color-translucent);width:var(--bs-toast-max-width);max-width:100%;font-size:var(--bs-toast-font-size);color:var(--bs-toast-color);pointer-events:auto;background-color:var(--bs-toast-bg);background-clip:padding-box;border:var(--bs-toast-border-width) solid var(--bs-toast-border-color);box-shadow:var(--bs-toast-box-shadow);border-radius:var(--bs-toast-border-radius)}.toast.showing{opacity:0}.toast:not(.show){display:none}.toast-container{--bs-toast-zindex:1090;position:absolute;z-index:var(--bs-toast-zindex);width:-webkit-max-content;width:-moz-max-content;width:max-content;max-width:100%;pointer-events:none}.toast-container>:not(:last-child){margin-bottom:var(--bs-toast-spacing)}.toast-header{display:flex;align-items:center;padding:var(--bs-toast-padding-y) var(--bs-toast-padding-x);color:var(--bs-toast-header-color);background-color:var(--bs-toast-header-bg);background-clip:padding-box;border-bottom:var(--bs-toast-border-width) solid var(--bs-toast-header-border-color);border-top-left-radius:calc(var(--bs-toast-border-radius) - var(--bs-toast-border-width));border-top-right-radius:calc(var(--bs-toast-border-radius) - var(--bs-toast-border-width))}.toast-header .btn-close{margin-right:calc(-.5 * var(--bs-toast-padding-x));margin-left:var(--bs-toast-padding-x)}.toast-body{padding:var(--bs-toast-padding-x);word-wrap:break-word}.modal{--bs-modal-zindex:1055;--bs-modal-width:500px;--bs-modal-padding:1rem;--bs-modal-margin:0.5rem;--bs-modal-color: ;--bs-modal-bg:var(--bs-body-bg);--bs-modal-border-color:var(--bs-border-color-translucent);--bs-modal-border-width:var(--bs-border-width);--bs-modal-border-radius:var(--bs-border-radius-lg);--bs-modal-box-shadow:var(--bs-box-shadow-sm);--bs-modal-inner-border-radius:calc(var(--bs-border-radius-lg) - (var(--bs-border-width)));--bs-modal-header-padding-x:1rem;--bs-modal-header-padding-y:1rem;--bs-modal-header-padding:1rem 1rem;--bs-modal-header-border-color:var(--bs-border-color);--bs-modal-header-border-width:var(--bs-border-width);--bs-modal-title-line-height:1.5;--bs-modal-footer-gap:0.5rem;--bs-modal-footer-bg: ;--bs-modal-footer-border-color:var(--bs-border-color);--bs-modal-footer-border-width:var(--bs-border-width);position:fixed;top:0;left:0;z-index:var(--bs-modal-zindex);display:none;width:100%;height:100%;overflow-x:hidden;overflow-y:auto;outline:0}.modal-dialog{position:relative;width:auto;margin:var(--bs-modal-margin);pointer-events:none}.modal.fade .modal-dialog{transition:transform .3s ease-out;transform:translate(0,-50px)}@media (prefers-reduced-motion:reduce){.modal.fade .modal-dialog{transition:none}}.modal.show .modal-dialog{transform:none}.modal.modal-static .modal-dialog{transform:scale(1.02)}.modal-dialog-scrollable{height:calc(100% - var(--bs-modal-margin) * 2)}.modal-dialog-scrollable .modal-content{max-height:100%;overflow:hidden}.modal-dialog-scrollable .modal-body{overflow-y:auto}.modal-dialog-centered{display:flex;align-items:center;min-height:calc(100% - var(--bs-modal-margin) * 2)}.modal-content{position:relative;display:flex;flex-direction:column;width:100%;color:var(--bs-modal-color);pointer-events:auto;background-color:var(--bs-modal-bg);background-clip:padding-box;border:var(--bs-modal-border-width) solid var(--bs-modal-border-color);border-radius:var(--bs-modal-border-radius);outline:0}.modal-backdrop{--bs-backdrop-zindex:1050;--bs-backdrop-bg:#000;--bs-backdrop-opacity:0.5;position:fixed;top:0;left:0;z-index:var(--bs-backdrop-zindex);width:100vw;height:100vh;background-color:var(--bs-backdrop-bg)}.modal-backdrop.fade{opacity:0}.modal-backdrop.show{opacity:var(--bs-backdrop-opacity)}.modal-header{display:flex;flex-shrink:0;align-items:center;justify-content:space-between;padding:var(--bs-modal-header-padding);border-bottom:var(--bs-modal-header-border-width) solid var(--bs-modal-header-border-color);border-top-left-radius:var(--bs-modal-inner-border-radius);border-top-right-radius:var(--bs-modal-inner-border-radius)}.modal-header .btn-close{padding:calc(var(--bs-modal-header-padding-y) * .5) calc(var(--bs-modal-header-padding-x) * .5);margin:calc(-.5 * var(--bs-modal-header-padding-y)) calc(-.5 * var(--bs-modal-header-padding-x)) calc(-.5 * var(--bs-modal-header-padding-y)) auto}.modal-title{margin-bottom:0;line-height:var(--bs-modal-title-line-height)}.modal-body{position:relative;flex:1 1 auto;padding:var(--bs-modal-padding)}.modal-footer{display:flex;flex-shrink:0;flex-wrap:wrap;align-items:center;justify-content:flex-end;padding:calc(var(--bs-modal-padding) - var(--bs-modal-footer-gap) * .5);background-color:var(--bs-modal-footer-bg);border-top:var(--bs-modal-footer-border-width) solid var(--bs-modal-footer-border-color);border-bottom-right-radius:var(--bs-modal-inner-border-radius);border-bottom-left-radius:var(--bs-modal-inner-border-radius)}.modal-footer>*{margin:calc(var(--bs-modal-footer-gap) * .5)}@media (min-width:576px){.modal{--bs-modal-margin:1.75rem;--bs-modal-box-shadow:var(--bs-box-shadow)}.modal-dialog{max-width:var(--bs-modal-width);margin-right:auto;margin-left:auto}.modal-sm{--bs-modal-width:300px}}@media (min-width:992px){.modal-lg,.modal-xl{--bs-modal-width:800px}}@media (min-width:1200px){.modal-xl{--bs-modal-width:1140px}}.modal-fullscreen{width:100vw;max-width:none;height:100%;margin:0}.modal-fullscreen .modal-content{height:100%;border:0;border-radius:0}.modal-fullscreen .modal-footer,.modal-fullscreen .modal-header{border-radius:0}.modal-fullscreen .modal-body{overflow-y:auto}@media (max-width:575.98px){.modal-fullscreen-sm-down{width:100vw;max-width:none;height:100%;margin:0}.modal-fullscreen-sm-down .modal-content{height:100%;border:0;border-radius:0}.modal-fullscreen-sm-down .modal-footer,.modal-fullscreen-sm-down .modal-header{border-radius:0}.modal-fullscreen-sm-down .modal-body{overflow-y:auto}}@media (max-width:767.98px){.modal-fullscreen-md-down{width:100vw;max-width:none;height:100%;margin:0}.modal-fullscreen-md-down .modal-content{height:100%;border:0;border-radius:0}.modal-fullscreen-md-down .modal-footer,.modal-fullscreen-md-down .modal-header{border-radius:0}.modal-fullscreen-md-down .modal-body{overflow-y:auto}}@media (max-width:991.98px){.modal-fullscreen-lg-down{width:100vw;max-width:none;height:100%;margin:0}.modal-fullscreen-lg-down .modal-content{height:100%;border:0;border-radius:0}.modal-fullscreen-lg-down .modal-footer,.modal-fullscreen-lg-down .modal-header{border-radius:0}.modal-fullscreen-lg-down .modal-body{overflow-y:auto}}@media (max-width:1199.98px){.modal-fullscreen-xl-down{width:100vw;max-width:none;height:100%;margin:0}.modal-fullscreen-xl-down .modal-content{height:100%;border:0;border-radius:0}.modal-fullscreen-xl-down .modal-footer,.modal-fullscreen-xl-down .modal-header{border-radius:0}.modal-fullscreen-xl-down .modal-body{overflow-y:auto}}@media (max-width:1399.98px){.modal-fullscreen-xxl-down{width:100vw;max-width:none;height:100%;margin:0}.modal-fullscreen-xxl-down .modal-content{height:100%;border:0;border-radius:0}.modal-fullscreen-xxl-down .modal-footer,.modal-fullscreen-xxl-down .modal-header{border-radius:0}.modal-fullscreen-xxl-down .modal-body{overflow-y:auto}}.tooltip{--bs-tooltip-zindex:1080;--bs-tooltip-max-width:200px;--bs-tooltip-padding-x:0.5rem;--bs-tooltip-padding-y:0.25rem;--bs-tooltip-margin: ;--bs-tooltip-font-size:0.875rem;--bs-tooltip-color:var(--bs-body-bg);--bs-tooltip-bg:var(--bs-emphasis-color);--bs-tooltip-border-radius:var(--bs-border-radius);--bs-tooltip-opacity:0.9;--bs-tooltip-arrow-width:0.8rem;--bs-tooltip-arrow-height:0.4rem;z-index:var(--bs-tooltip-zindex);display:block;margin:var(--bs-tooltip-margin);font-family:var(--bs-font-sans-serif);font-style:normal;font-weight:400;line-height:1.5;text-align:left;text-align:start;text-decoration:none;text-shadow:none;text-transform:none;letter-spacing:normal;word-break:normal;white-space:normal;word-spacing:normal;line-break:auto;font-size:var(--bs-tooltip-font-size);word-wrap:break-word;opacity:0}.tooltip.show{opacity:var(--bs-tooltip-opacity)}.tooltip .tooltip-arrow{display:block;width:var(--bs-tooltip-arrow-width);height:var(--bs-tooltip-arrow-height)}.tooltip .tooltip-arrow::before{position:absolute;content:"";border-color:transparent;border-style:solid}.bs-tooltip-auto[data-popper-placement^=top] .tooltip-arrow,.bs-tooltip-top .tooltip-arrow{bottom:calc(-1 * var(--bs-tooltip-arrow-height))}.bs-tooltip-auto[data-popper-placement^=top] .tooltip-arrow::before,.bs-tooltip-top .tooltip-arrow::before{top:-1px;border-width:var(--bs-tooltip-arrow-height) calc(var(--bs-tooltip-arrow-width) * .5) 0;border-top-color:var(--bs-tooltip-bg)}.bs-tooltip-auto[data-popper-placement^=right] .tooltip-arrow,.bs-tooltip-end .tooltip-arrow{left:calc(-1 * var(--bs-tooltip-arrow-height));width:var(--bs-tooltip-arrow-height);height:var(--bs-tooltip-arrow-width)}.bs-tooltip-auto[data-popper-placement^=right] .tooltip-arrow::before,.bs-tooltip-end .tooltip-arrow::before{right:-1px;border-width:calc(var(--bs-tooltip-arrow-width) * .5) var(--bs-tooltip-arrow-height) calc(var(--bs-tooltip-arrow-width) * .5) 0;border-right-color:var(--bs-tooltip-bg)}.bs-tooltip-auto[data-popper-placement^=bottom] .tooltip-arrow,.bs-tooltip-bottom .tooltip-arrow{top:calc(-1 * var(--bs-tooltip-arrow-height))}.bs-tooltip-auto[data-popper-placement^=bottom] .tooltip-arrow::before,.bs-tooltip-bottom .tooltip-arrow::before{bottom:-1px;border-width:0 calc(var(--bs-tooltip-arrow-width) * .5) var(--bs-tooltip-arrow-height);border-bottom-color:var(--bs-tooltip-bg)}.bs-tooltip-auto[data-popper-placement^=left] .tooltip-arrow,.bs-tooltip-start .tooltip-arrow{right:calc(-1 * var(--bs-tooltip-arrow-height));width:var(--bs-tooltip-arrow-height);height:var(--bs-tooltip-arrow-width)}.bs-tooltip-auto[data-popper-placement^=left] .tooltip-arrow::before,.bs-tooltip-start .tooltip-arrow::before{left:-1px;border-width:calc(var(--bs-tooltip-arrow-width) * .5) 0 calc(var(--bs-tooltip-arrow-width) * .5) var(--bs-tooltip-arrow-height);border-left-color:var(--bs-tooltip-bg)}.tooltip-inner{max-width:var(--bs-tooltip-max-width);padding:var(--bs-tooltip-padding-y) var(--bs-tooltip-padding-x);color:var(--bs-tooltip-color);text-align:center;background-color:var(--bs-tooltip-bg);border-radius:var(--bs-tooltip-border-radius)}.popover{--bs-popover-zindex:1070;--bs-popover-max-width:276px;--bs-popover-font-size:0.875rem;--bs-popover-bg:var(--bs-body-bg);--bs-popover-border-width:var(--bs-border-width);--bs-popover-border-color:var(--bs-border-color-translucent);--bs-popover-border-radius:var(--bs-border-radius-lg);--bs-popover-inner-border-radius:calc(var(--bs-border-radius-lg) - var(--bs-border-width));--bs-popover-box-shadow:var(--bs-box-shadow);--bs-popover-header-padding-x:1rem;--bs-popover-header-padding-y:0.5rem;--bs-popover-header-font-size:1rem;--bs-popover-header-color:inherit;--bs-popover-header-bg:var(--bs-secondary-bg);--bs-popover-body-padding-x:1rem;--bs-popover-body-padding-y:1rem;--bs-popover-body-color:var(--bs-body-color);--bs-popover-arrow-width:1rem;--bs-popover-arrow-height:0.5rem;--bs-popover-arrow-border:var(--bs-popover-border-color);z-index:var(--bs-popover-zindex);display:block;max-width:var(--bs-popover-max-width);font-family:var(--bs-font-sans-serif);font-style:normal;font-weight:400;line-height:1.5;text-align:left;text-align:start;text-decoration:none;text-shadow:none;text-transform:none;letter-spacing:normal;word-break:normal;white-space:normal;word-spacing:normal;line-break:auto;font-size:var(--bs-popover-font-size);word-wrap:break-word;background-color:var(--bs-popover-bg);background-clip:padding-box;border:var(--bs-popover-border-width) solid var(--bs-popover-border-color);border-radius:var(--bs-popover-border-radius)}.popover .popover-arrow{display:block;width:var(--bs-popover-arrow-width);height:var(--bs-popover-arrow-height)}.popover .popover-arrow::after,.popover .popover-arrow::before{position:absolute;display:block;content:"";border-color:transparent;border-style:solid;border-width:0}.bs-popover-auto[data-popper-placement^=top]>.popover-arrow,.bs-popover-top>.popover-arrow{bottom:calc(-1 * (var(--bs-popover-arrow-height)) - var(--bs-popover-border-width))}.bs-popover-auto[data-popper-placement^=top]>.popover-arrow::after,.bs-popover-auto[data-popper-placement^=top]>.popover-arrow::before,.bs-popover-top>.popover-arrow::after,.bs-popover-top>.popover-arrow::before{border-width:var(--bs-popover-arrow-height) calc(var(--bs-popover-arrow-width) * .5) 0}.bs-popover-auto[data-popper-placement^=top]>.popover-arrow::before,.bs-popover-top>.popover-arrow::before{bottom:0;border-top-color:var(--bs-popover-arrow-border)}.bs-popover-auto[data-popper-placement^=top]>.popover-arrow::after,.bs-popover-top>.popover-arrow::after{bottom:var(--bs-popover-border-width);border-top-color:var(--bs-popover-bg)}.bs-popover-auto[data-popper-placement^=right]>.popover-arrow,.bs-popover-end>.popover-arrow{left:calc(-1 * (var(--bs-popover-arrow-height)) - var(--bs-popover-border-width));width:var(--bs-popover-arrow-height);height:var(--bs-popover-arrow-width)}.bs-popover-auto[data-popper-placement^=right]>.popover-arrow::after,.bs-popover-auto[data-popper-placement^=right]>.popover-arrow::before,.bs-popover-end>.popover-arrow::after,.bs-popover-end>.popover-arrow::before{border-width:calc(var(--bs-popover-arrow-width) * .5) var(--bs-popover-arrow-height) calc(var(--bs-popover-arrow-width) * .5) 0}.bs-popover-auto[data-popper-placement^=right]>.popover-arrow::before,.bs-popover-end>.popover-arrow::before{left:0;border-right-color:var(--bs-popover-arrow-border)}.bs-popover-auto[data-popper-placement^=right]>.popover-arrow::after,.bs-popover-end>.popover-arrow::after{left:var(--bs-popover-border-width);border-right-color:var(--bs-popover-bg)}.bs-popover-auto[data-popper-placement^=bottom]>.popover-arrow,.bs-popover-bottom>.popover-arrow{top:calc(-1 * (var(--bs-popover-arrow-height)) - var(--bs-popover-border-width))}.bs-popover-auto[data-popper-placement^=bottom]>.popover-arrow::after,.bs-popover-auto[data-popper-placement^=bottom]>.popover-arrow::before,.bs-popover-bottom>.popover-arrow::after,.bs-popover-bottom>.popover-arrow::before{border-width:0 calc(var(--bs-popover-arrow-width) * .5) var(--bs-popover-arrow-height)}.bs-popover-auto[data-popper-placement^=bottom]>.popover-arrow::before,.bs-popover-bottom>.popover-arrow::before{top:0;border-bottom-color:var(--bs-popover-arrow-border)}.bs-popover-auto[data-popper-placement^=bottom]>.popover-arrow::after,.bs-popover-bottom>.popover-arrow::after{top:var(--bs-popover-border-width);border-bottom-color:var(--bs-popover-bg)}.bs-popover-auto[data-popper-placement^=bottom] .popover-header::before,.bs-popover-bottom .popover-header::before{position:absolute;top:0;left:50%;display:block;width:var(--bs-popover-arrow-width);margin-left:calc(-.5 * var(--bs-popover-arrow-width));content:"";border-bottom:var(--bs-popover-border-width) solid var(--bs-popover-header-bg)}.bs-popover-auto[data-popper-placement^=left]>.popover-arrow,.bs-popover-start>.popover-arrow{right:calc(-1 * (var(--bs-popover-arrow-height)) - var(--bs-popover-border-width));width:var(--bs-popover-arrow-height);height:var(--bs-popover-arrow-width)}.bs-popover-auto[data-popper-placement^=left]>.popover-arrow::after,.bs-popover-auto[data-popper-placement^=left]>.popover-arrow::before,.bs-popover-start>.popover-arrow::after,.bs-popover-start>.popover-arrow::before{border-width:calc(var(--bs-popover-arrow-width) * .5) 0 calc(var(--bs-popover-arrow-width) * .5) var(--bs-popover-arrow-height)}.bs-popover-auto[data-popper-placement^=left]>.popover-arrow::before,.bs-popover-start>.popover-arrow::before{right:0;border-left-color:var(--bs-popover-arrow-border)}.bs-popover-auto[data-popper-placement^=left]>.popover-arrow::after,.bs-popover-start>.popover-arrow::after{right:var(--bs-popover-border-width);border-left-color:var(--bs-popover-bg)}.popover-header{padding:var(--bs-popover-header-padding-y) var(--bs-popover-header-padding-x);margin-bottom:0;font-size:var(--bs-popover-header-font-size);color:var(--bs-popover-header-color);background-color:var(--bs-popover-header-bg);border-bottom:var(--bs-popover-border-width) solid var(--bs-popover-border-color);border-top-left-radius:var(--bs-popover-inner-border-radius);border-top-right-radius:var(--bs-popover-inner-border-radius)}.popover-header:empty{display:none}.popover-body{padding:var(--bs-popover-body-padding-y) var(--bs-popover-body-padding-x);color:var(--bs-popover-body-color)}.carousel{position:relative}.carousel.pointer-event{touch-action:pan-y}.carousel-inner{position:relative;width:100%;overflow:hidden}.carousel-inner::after{display:block;clear:both;content:""}.carousel-item{position:relative;display:none;float:left;width:100%;margin-right:-100%;-webkit-backface-visibility:hidden;backface-visibility:hidden;transition:transform .6s ease-in-out}@media (prefers-reduced-motion:reduce){.carousel-item{transition:none}}.carousel-item-next,.carousel-item-prev,.carousel-item.active{display:block}.active.carousel-item-end,.carousel-item-next:not(.carousel-item-start){transform:translateX(100%)}.active.carousel-item-start,.carousel-item-prev:not(.carousel-item-end){transform:translateX(-100%)}.carousel-fade .carousel-item{opacity:0;transition-property:opacity;transform:none}.carousel-fade .carousel-item-next.carousel-item-start,.carousel-fade .carousel-item-prev.carousel-item-end,.carousel-fade .carousel-item.active{z-index:1;opacity:1}.carousel-fade .active.carousel-item-end,.carousel-fade .active.carousel-item-start{z-index:0;opacity:0;transition:opacity 0s .6s}@media (prefers-reduced-motion:reduce){.carousel-fade .active.carousel-item-end,.carousel-fade .active.carousel-item-start{transition:none}}.carousel-control-next,.carousel-control-prev{position:absolute;top:0;bottom:0;z-index:1;display:flex;align-items:center;justify-content:center;width:15%;padding:0;color:#fff;text-align:center;background:0 0;border:0;opacity:.5;transition:opacity .15s ease}@media (prefers-reduced-motion:reduce){.carousel-control-next,.carousel-control-prev{transition:none}}.carousel-control-next:focus,.carousel-control-next:hover,.carousel-control-prev:focus,.carousel-control-prev:hover{color:#fff;text-decoration:none;outline:0;opacity:.9}.carousel-control-prev{left:0}.carousel-control-next{right:0}.carousel-control-next-icon,.carousel-control-prev-icon{display:inline-block;width:2rem;height:2rem;background-repeat:no-repeat;background-position:50%;background-size:100% 100%}.carousel-control-prev-icon{background-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16' fill='%23fff'%3e%3cpath d='M11.354 1.646a.5.5 0 0 1 0 .708L5.707 8l5.647 5.646a.5.5 0 0 1-.708.708l-6-6a.5.5 0 0 1 0-.708l6-6a.5.5 0 0 1 .708 0z'/%3e%3c/svg%3e")}.carousel-control-next-icon{background-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16' fill='%23fff'%3e%3cpath d='M4.646 1.646a.5.5 0 0 1 .708 0l6 6a.5.5 0 0 1 0 .708l-6 6a.5.5 0 0 1-.708-.708L10.293 8 4.646 2.354a.5.5 0 0 1 0-.708z'/%3e%3c/svg%3e")}.carousel-indicators{position:absolute;right:0;bottom:0;left:0;z-index:2;display:flex;justify-content:center;padding:0;margin-right:15%;margin-bottom:1rem;margin-left:15%}.carousel-indicators [data-bs-target]{box-sizing:content-box;flex:0 1 auto;width:30px;height:3px;padding:0;margin-right:3px;margin-left:3px;text-indent:-999px;cursor:pointer;background-color:#fff;background-clip:padding-box;border:0;border-top:10px solid transparent;border-bottom:10px solid transparent;opacity:.5;transition:opacity .6s ease}@media (prefers-reduced-motion:reduce){.carousel-indicators [data-bs-target]{transition:none}}.carousel-indicators .active{opacity:1}.carousel-caption{position:absolute;right:15%;bottom:1.25rem;left:15%;padding-top:1.25rem;padding-bottom:1.25rem;color:#fff;text-align:center}.carousel-dark .carousel-control-next-icon,.carousel-dark .carousel-control-prev-icon{filter:invert(1) grayscale(100)}.carousel-dark .carousel-indicators [data-bs-target]{background-color:#000}.carousel-dark .carousel-caption{color:#000}[data-bs-theme=dark] .carousel .carousel-control-next-icon,[data-bs-theme=dark] .carousel .carousel-control-prev-icon,[data-bs-theme=dark].carousel .carousel-control-next-icon,[data-bs-theme=dark].carousel .carousel-control-prev-icon{filter:invert(1) grayscale(100)}[data-bs-theme=dark] .carousel .carousel-indicators [data-bs-target],[data-bs-theme=dark].carousel .carousel-indicators [data-bs-target]{background-color:#000}[data-bs-theme=dark] .carousel .carousel-caption,[data-bs-theme=dark].carousel .carousel-caption{color:#000}.spinner-border,.spinner-grow{display:inline-block;width:var(--bs-spinner-width);height:var(--bs-spinner-height);vertical-align:var(--bs-spinner-vertical-align);border-radius:50%;animation:var(--bs-spinner-animation-speed) linear infinite var(--bs-spinner-animation-name)}@keyframes spinner-border{to{transform:rotate(360deg)}}.spinner-border{--bs-spinner-width:2rem;--bs-spinner-height:2rem;--bs-spinner-vertical-align:-0.125em;--bs-spinner-border-width:0.25em;--bs-spinner-animation-speed:0.75s;--bs-spinner-animation-name:spinner-border;border:var(--bs-spinner-border-width) solid currentcolor;border-right-color:transparent}.spinner-border-sm{--bs-spinner-width:1rem;--bs-spinner-height:1rem;--bs-spinner-border-width:0.2em}@keyframes spinner-grow{0%{transform:scale(0)}50%{opacity:1;transform:none}}.spinner-grow{--bs-spinner-width:2rem;--bs-spinner-height:2rem;--bs-spinner-vertical-align:-0.125em;--bs-spinner-animation-speed:0.75s;--bs-spinner-animation-name:spinner-grow;background-color:currentcolor;opacity:0}.spinner-grow-sm{--bs-spinner-width:1rem;--bs-spinner-height:1rem}@media (prefers-reduced-motion:reduce){.spinner-border,.spinner-grow{--bs-spinner-animation-speed:1.5s}}.offcanvas,.offcanvas-lg,.offcanvas-md,.offcanvas-sm,.offcanvas-xl,.offcanvas-xxl{--bs-offcanvas-zindex:1045;--bs-offcanvas-width:400px;--bs-offcanvas-height:30vh;--bs-offcanvas-padding-x:1rem;--bs-offcanvas-padding-y:1rem;--bs-offcanvas-color:var(--bs-body-color);--bs-offcanvas-bg:var(--bs-body-bg);--bs-offcanvas-border-width:var(--bs-border-width);--bs-offcanvas-border-color:var(--bs-border-color-translucent);--bs-offcanvas-box-shadow:var(--bs-box-shadow-sm);--bs-offcanvas-transition:transform 0.3s ease-in-out;--bs-offcanvas-title-line-height:1.5}@media (max-width:575.98px){.offcanvas-sm{position:fixed;bottom:0;z-index:var(--bs-offcanvas-zindex);display:flex;flex-direction:column;max-width:100%;color:var(--bs-offcanvas-color);visibility:hidden;background-color:var(--bs-offcanvas-bg);background-clip:padding-box;outline:0;transition:var(--bs-offcanvas-transition)}}@media (max-width:575.98px) and (prefers-reduced-motion:reduce){.offcanvas-sm{transition:none}}@media (max-width:575.98px){.offcanvas-sm.offcanvas-start{top:0;left:0;width:var(--bs-offcanvas-width);border-right:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(-100%)}.offcanvas-sm.offcanvas-end{top:0;right:0;width:var(--bs-offcanvas-width);border-left:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(100%)}.offcanvas-sm.offcanvas-top{top:0;right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-bottom:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(-100%)}.offcanvas-sm.offcanvas-bottom{right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-top:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(100%)}.offcanvas-sm.show:not(.hiding),.offcanvas-sm.showing{transform:none}.offcanvas-sm.hiding,.offcanvas-sm.show,.offcanvas-sm.showing{visibility:visible}}@media (min-width:576px){.offcanvas-sm{--bs-offcanvas-height:auto;--bs-offcanvas-border-width:0;background-color:transparent!important}.offcanvas-sm .offcanvas-header{display:none}.offcanvas-sm .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible;background-color:transparent!important}}@media (max-width:767.98px){.offcanvas-md{position:fixed;bottom:0;z-index:var(--bs-offcanvas-zindex);display:flex;flex-direction:column;max-width:100%;color:var(--bs-offcanvas-color);visibility:hidden;background-color:var(--bs-offcanvas-bg);background-clip:padding-box;outline:0;transition:var(--bs-offcanvas-transition)}}@media (max-width:767.98px) and (prefers-reduced-motion:reduce){.offcanvas-md{transition:none}}@media (max-width:767.98px){.offcanvas-md.offcanvas-start{top:0;left:0;width:var(--bs-offcanvas-width);border-right:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(-100%)}.offcanvas-md.offcanvas-end{top:0;right:0;width:var(--bs-offcanvas-width);border-left:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(100%)}.offcanvas-md.offcanvas-top{top:0;right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-bottom:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(-100%)}.offcanvas-md.offcanvas-bottom{right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-top:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(100%)}.offcanvas-md.show:not(.hiding),.offcanvas-md.showing{transform:none}.offcanvas-md.hiding,.offcanvas-md.show,.offcanvas-md.showing{visibility:visible}}@media (min-width:768px){.offcanvas-md{--bs-offcanvas-height:auto;--bs-offcanvas-border-width:0;background-color:transparent!important}.offcanvas-md .offcanvas-header{display:none}.offcanvas-md .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible;background-color:transparent!important}}@media (max-width:991.98px){.offcanvas-lg{position:fixed;bottom:0;z-index:var(--bs-offcanvas-zindex);display:flex;flex-direction:column;max-width:100%;color:var(--bs-offcanvas-color);visibility:hidden;background-color:var(--bs-offcanvas-bg);background-clip:padding-box;outline:0;transition:var(--bs-offcanvas-transition)}}@media (max-width:991.98px) and (prefers-reduced-motion:reduce){.offcanvas-lg{transition:none}}@media (max-width:991.98px){.offcanvas-lg.offcanvas-start{top:0;left:0;width:var(--bs-offcanvas-width);border-right:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(-100%)}.offcanvas-lg.offcanvas-end{top:0;right:0;width:var(--bs-offcanvas-width);border-left:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(100%)}.offcanvas-lg.offcanvas-top{top:0;right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-bottom:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(-100%)}.offcanvas-lg.offcanvas-bottom{right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-top:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(100%)}.offcanvas-lg.show:not(.hiding),.offcanvas-lg.showing{transform:none}.offcanvas-lg.hiding,.offcanvas-lg.show,.offcanvas-lg.showing{visibility:visible}}@media (min-width:992px){.offcanvas-lg{--bs-offcanvas-height:auto;--bs-offcanvas-border-width:0;background-color:transparent!important}.offcanvas-lg .offcanvas-header{display:none}.offcanvas-lg .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible;background-color:transparent!important}}@media (max-width:1199.98px){.offcanvas-xl{position:fixed;bottom:0;z-index:var(--bs-offcanvas-zindex);display:flex;flex-direction:column;max-width:100%;color:var(--bs-offcanvas-color);visibility:hidden;background-color:var(--bs-offcanvas-bg);background-clip:padding-box;outline:0;transition:var(--bs-offcanvas-transition)}}@media (max-width:1199.98px) and (prefers-reduced-motion:reduce){.offcanvas-xl{transition:none}}@media (max-width:1199.98px){.offcanvas-xl.offcanvas-start{top:0;left:0;width:var(--bs-offcanvas-width);border-right:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(-100%)}.offcanvas-xl.offcanvas-end{top:0;right:0;width:var(--bs-offcanvas-width);border-left:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(100%)}.offcanvas-xl.offcanvas-top{top:0;right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-bottom:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(-100%)}.offcanvas-xl.offcanvas-bottom{right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-top:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(100%)}.offcanvas-xl.show:not(.hiding),.offcanvas-xl.showing{transform:none}.offcanvas-xl.hiding,.offcanvas-xl.show,.offcanvas-xl.showing{visibility:visible}}@media (min-width:1200px){.offcanvas-xl{--bs-offcanvas-height:auto;--bs-offcanvas-border-width:0;background-color:transparent!important}.offcanvas-xl .offcanvas-header{display:none}.offcanvas-xl .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible;background-color:transparent!important}}@media (max-width:1399.98px){.offcanvas-xxl{position:fixed;bottom:0;z-index:var(--bs-offcanvas-zindex);display:flex;flex-direction:column;max-width:100%;color:var(--bs-offcanvas-color);visibility:hidden;background-color:var(--bs-offcanvas-bg);background-clip:padding-box;outline:0;transition:var(--bs-offcanvas-transition)}}@media (max-width:1399.98px) and (prefers-reduced-motion:reduce){.offcanvas-xxl{transition:none}}@media (max-width:1399.98px){.offcanvas-xxl.offcanvas-start{top:0;left:0;width:var(--bs-offcanvas-width);border-right:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(-100%)}.offcanvas-xxl.offcanvas-end{top:0;right:0;width:var(--bs-offcanvas-width);border-left:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(100%)}.offcanvas-xxl.offcanvas-top{top:0;right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-bottom:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(-100%)}.offcanvas-xxl.offcanvas-bottom{right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-top:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(100%)}.offcanvas-xxl.show:not(.hiding),.offcanvas-xxl.showing{transform:none}.offcanvas-xxl.hiding,.offcanvas-xxl.show,.offcanvas-xxl.showing{visibility:visible}}@media (min-width:1400px){.offcanvas-xxl{--bs-offcanvas-height:auto;--bs-offcanvas-border-width:0;background-color:transparent!important}.offcanvas-xxl .offcanvas-header{display:none}.offcanvas-xxl .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible;background-color:transparent!important}}.offcanvas{position:fixed;bottom:0;z-index:var(--bs-offcanvas-zindex);display:flex;flex-direction:column;max-width:100%;color:var(--bs-offcanvas-color);visibility:hidden;background-color:var(--bs-offcanvas-bg);background-clip:padding-box;outline:0;transition:var(--bs-offcanvas-transition)}@media (prefers-reduced-motion:reduce){.offcanvas{transition:none}}.offcanvas.offcanvas-start{top:0;left:0;width:var(--bs-offcanvas-width);border-right:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(-100%)}.offcanvas.offcanvas-end{top:0;right:0;width:var(--bs-offcanvas-width);border-left:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(100%)}.offcanvas.offcanvas-top{top:0;right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-bottom:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(-100%)}.offcanvas.offcanvas-bottom{right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-top:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(100%)}.offcanvas.show:not(.hiding),.offcanvas.showing{transform:none}.offcanvas.hiding,.offcanvas.show,.offcanvas.showing{visibility:visible}.offcanvas-backdrop{position:fixed;top:0;left:0;z-index:1040;width:100vw;height:100vh;background-color:#000}.offcanvas-backdrop.fade{opacity:0}.offcanvas-backdrop.show{opacity:.5}.offcanvas-header{display:flex;align-items:center;justify-content:space-between;padding:var(--bs-offcanvas-padding-y) var(--bs-offcanvas-padding-x)}.offcanvas-header .btn-close{padding:calc(var(--bs-offcanvas-padding-y) * .5) calc(var(--bs-offcanvas-padding-x) * .5);margin-top:calc(-.5 * var(--bs-offcanvas-padding-y));margin-right:calc(-.5 * var(--bs-offcanvas-padding-x));margin-bottom:calc(-.5 * var(--bs-offcanvas-padding-y))}.offcanvas-title{margin-bottom:0;line-height:var(--bs-offcanvas-title-line-height)}.offcanvas-body{flex-grow:1;padding:var(--bs-offcanvas-padding-y) var(--bs-offcanvas-padding-x);overflow-y:auto}.placeholder{display:inline-block;min-height:1em;vertical-align:middle;cursor:wait;background-color:currentcolor;opacity:.5}.placeholder.btn::before{display:inline-block;content:""}.placeholder-xs{min-height:.6em}.placeholder-sm{min-height:.8em}.placeholder-lg{min-height:1.2em}.placeholder-glow .placeholder{animation:placeholder-glow 2s ease-in-out infinite}@keyframes placeholder-glow{50%{opacity:.2}}.placeholder-wave{-webkit-mask-image:linear-gradient(130deg,#000 55%,rgba(0,0,0,0.8) 75%,#000 95%);mask-image:linear-gradient(130deg,#000 55%,rgba(0,0,0,0.8) 75%,#000 95%);-webkit-mask-size:200% 100%;mask-size:200% 100%;animation:placeholder-wave 2s linear infinite}@keyframes placeholder-wave{100%{-webkit-mask-position:-200% 0%;mask-position:-200% 0%}}.clearfix::after{display:block;clear:both;content:""}.text-bg-primary{color:#fff!important;background-color:RGBA(var(--bs-primary-rgb),var(--bs-bg-opacity,1))!important}.text-bg-secondary{color:#fff!important;background-color:RGBA(var(--bs-secondary-rgb),var(--bs-bg-opacity,1))!important}.text-bg-success{color:#fff!important;background-color:RGBA(var(--bs-success-rgb),var(--bs-bg-opacity,1))!important}.text-bg-info{color:#000!important;background-color:RGBA(var(--bs-info-rgb),var(--bs-bg-opacity,1))!important}.text-bg-warning{color:#000!important;background-color:RGBA(var(--bs-warning-rgb),var(--bs-bg-opacity,1))!important}.text-bg-danger{color:#fff!important;background-color:RGBA(var(--bs-danger-rgb),var(--bs-bg-opacity,1))!important}.text-bg-light{color:#000!important;background-color:RGBA(var(--bs-light-rgb),var(--bs-bg-opacity,1))!important}.text-bg-dark{color:#fff!important;background-color:RGBA(var(--bs-dark-rgb),var(--bs-bg-opacity,1))!important}.link-primary{color:RGBA(var(--bs-primary-rgb),var(--bs-link-opacity,1))!important;-webkit-text-decoration-color:RGBA(var(--bs-primary-rgb),var(--bs-link-underline-opacity,1))!important;text-decoration-color:RGBA(var(--bs-primary-rgb),var(--bs-link-underline-opacity,1))!important}.link-primary:focus,.link-primary:hover{color:RGBA(10,88,202,var(--bs-link-opacity,1))!important;-webkit-text-decoration-color:RGBA(10,88,202,var(--bs-link-underline-opacity,1))!important;text-decoration-color:RGBA(10,88,202,var(--bs-link-underline-opacity,1))!important}.link-secondary{color:RGBA(var(--bs-secondary-rgb),var(--bs-link-opacity,1))!important;-webkit-text-decoration-color:RGBA(var(--bs-secondary-rgb),var(--bs-link-underline-opacity,1))!important;text-decoration-color:RGBA(var(--bs-secondary-rgb),var(--bs-link-underline-opacity,1))!important}.link-secondary:focus,.link-secondary:hover{color:RGBA(86,94,100,var(--bs-link-opacity,1))!important;-webkit-text-decoration-color:RGBA(86,94,100,var(--bs-link-underline-opacity,1))!important;text-decoration-color:RGBA(86,94,100,var(--bs-link-underline-opacity,1))!important}.link-success{color:RGBA(var(--bs-success-rgb),var(--bs-link-opacity,1))!important;-webkit-text-decoration-color:RGBA(var(--bs-success-rgb),var(--bs-link-underline-opacity,1))!important;text-decoration-color:RGBA(var(--bs-success-rgb),var(--bs-link-underline-opacity,1))!important}.link-success:focus,.link-success:hover{color:RGBA(20,108,67,var(--bs-link-opacity,1))!important;-webkit-text-decoration-color:RGBA(20,108,67,var(--bs-link-underline-opacity,1))!important;text-decoration-color:RGBA(20,108,67,var(--bs-link-underline-opacity,1))!important}.link-info{color:RGBA(var(--bs-info-rgb),var(--bs-link-opacity,1))!important;-webkit-text-decoration-color:RGBA(var(--bs-info-rgb),var(--bs-link-underline-opacity,1))!important;text-decoration-color:RGBA(var(--bs-info-rgb),var(--bs-link-underline-opacity,1))!important}.link-info:focus,.link-info:hover{color:RGBA(61,213,243,var(--bs-link-opacity,1))!important;-webkit-text-decoration-color:RGBA(61,213,243,var(--bs-link-underline-opacity,1))!important;text-decoration-color:RGBA(61,213,243,var(--bs-link-underline-opacity,1))!important}.link-warning{color:RGBA(var(--bs-warning-rgb),var(--bs-link-opacity,1))!important;-webkit-text-decoration-color:RGBA(var(--bs-warning-rgb),var(--bs-link-underline-opacity,1))!important;text-decoration-color:RGBA(var(--bs-warning-rgb),var(--bs-link-underline-opacity,1))!important}.link-warning:focus,.link-warning:hover{color:RGBA(255,205,57,var(--bs-link-opacity,1))!important;-webkit-text-decoration-color:RGBA(255,205,57,var(--bs-link-underline-opacity,1))!important;text-decoration-color:RGBA(255,205,57,var(--bs-link-underline-opacity,1))!important}.link-danger{color:RGBA(var(--bs-danger-rgb),var(--bs-link-opacity,1))!important;-webkit-text-decoration-color:RGBA(var(--bs-danger-rgb),var(--bs-link-underline-opacity,1))!important;text-decoration-color:RGBA(var(--bs-danger-rgb),var(--bs-link-underline-opacity,1))!important}.link-danger:focus,.link-danger:hover{color:RGBA(176,42,55,var(--bs-link-opacity,1))!important;-webkit-text-decoration-color:RGBA(176,42,55,var(--bs-link-underline-opacity,1))!important;text-decoration-color:RGBA(176,42,55,var(--bs-link-underline-opacity,1))!important}.link-light{color:RGBA(var(--bs-light-rgb),var(--bs-link-opacity,1))!important;-webkit-text-decoration-color:RGBA(var(--bs-light-rgb),var(--bs-link-underline-opacity,1))!important;text-decoration-color:RGBA(var(--bs-light-rgb),var(--bs-link-underline-opacity,1))!important}.link-light:focus,.link-light:hover{color:RGBA(249,250,251,var(--bs-link-opacity,1))!important;-webkit-text-decoration-color:RGBA(249,250,251,var(--bs-link-underline-opacity,1))!important;text-decoration-color:RGBA(249,250,251,var(--bs-link-underline-opacity,1))!important}.link-dark{color:RGBA(var(--bs-dark-rgb),var(--bs-link-opacity,1))!important;-webkit-text-decoration-color:RGBA(var(--bs-dark-rgb),var(--bs-link-underline-opacity,1))!important;text-decoration-color:RGBA(var(--bs-dark-rgb),var(--bs-link-underline-opacity,1))!important}.link-dark:focus,.link-dark:hover{color:RGBA(26,30,33,var(--bs-link-opacity,1))!important;-webkit-text-decoration-color:RGBA(26,30,33,var(--bs-link-underline-opacity,1))!important;text-decoration-color:RGBA(26,30,33,var(--bs-link-underline-opacity,1))!important}.link-body-emphasis{color:RGBA(var(--bs-emphasis-color-rgb),var(--bs-link-opacity,1))!important;-webkit-text-decoration-color:RGBA(var(--bs-emphasis-color-rgb),var(--bs-link-underline-opacity,1))!important;text-decoration-color:RGBA(var(--bs-emphasis-color-rgb),var(--bs-link-underline-opacity,1))!important}.link-body-emphasis:focus,.link-body-emphasis:hover{color:RGBA(var(--bs-emphasis-color-rgb),var(--bs-link-opacity,.75))!important;-webkit-text-decoration-color:RGBA(var(--bs-emphasis-color-rgb),var(--bs-link-underline-opacity,0.75))!important;text-decoration-color:RGBA(var(--bs-emphasis-color-rgb),var(--bs-link-underline-opacity,0.75))!important}.focus-ring:focus{outline:0;box-shadow:var(--bs-focus-ring-x,0) var(--bs-focus-ring-y,0) var(--bs-focus-ring-blur,0) var(--bs-focus-ring-width) var(--bs-focus-ring-color)}.icon-link{display:inline-flex;gap:.375rem;align-items:center;-webkit-text-decoration-color:rgba(var(--bs-link-color-rgb),var(--bs-link-opacity,0.5));text-decoration-color:rgba(var(--bs-link-color-rgb),var(--bs-link-opacity,0.5));text-underline-offset:0.25em;-webkit-backface-visibility:hidden;backface-visibility:hidden}.icon-link>.bi{flex-shrink:0;width:1em;height:1em;fill:currentcolor;transition:.2s ease-in-out transform}@media (prefers-reduced-motion:reduce){.icon-link>.bi{transition:none}}.icon-link-hover:focus-visible>.bi,.icon-link-hover:hover>.bi{transform:var(--bs-icon-link-transform,translate3d(.25em,0,0))}.ratio{position:relative;width:100%}.ratio::before{display:block;padding-top:var(--bs-aspect-ratio);content:""}.ratio>*{position:absolute;top:0;left:0;width:100%;height:100%}.ratio-1x1{--bs-aspect-ratio:100%}.ratio-4x3{--bs-aspect-ratio:75%}.ratio-16x9{--bs-aspect-ratio:56.25%}.ratio-21x9{--bs-aspect-ratio:42.8571428571%}.fixed-top{position:fixed;top:0;right:0;left:0;z-index:1030}.fixed-bottom{position:fixed;right:0;bottom:0;left:0;z-index:1030}.sticky-top{position:-webkit-sticky;position:sticky;top:0;z-index:1020}.sticky-bottom{position:-webkit-sticky;position:sticky;bottom:0;z-index:1020}@media (min-width:576px){.sticky-sm-top{position:-webkit-sticky;position:sticky;top:0;z-index:1020}.sticky-sm-bottom{position:-webkit-sticky;position:sticky;bottom:0;z-index:1020}}@media (min-width:768px){.sticky-md-top{position:-webkit-sticky;position:sticky;top:0;z-index:1020}.sticky-md-bottom{position:-webkit-sticky;position:sticky;bottom:0;z-index:1020}}@media (min-width:992px){.sticky-lg-top{position:-webkit-sticky;position:sticky;top:0;z-index:1020}.sticky-lg-bottom{position:-webkit-sticky;position:sticky;bottom:0;z-index:1020}}@media (min-width:1200px){.sticky-xl-top{position:-webkit-sticky;position:sticky;top:0;z-index:1020}.sticky-xl-bottom{position:-webkit-sticky;position:sticky;bottom:0;z-index:1020}}@media (min-width:1400px){.sticky-xxl-top{position:-webkit-sticky;position:sticky;top:0;z-index:1020}.sticky-xxl-bottom{position:-webkit-sticky;position:sticky;bottom:0;z-index:1020}}.hstack{display:flex;flex-direction:row;align-items:center;align-self:stretch}.vstack{display:flex;flex:1 1 auto;flex-direction:column;align-self:stretch}.visually-hidden,.visually-hidden-focusable:not(:focus):not(:focus-within){width:1px!important;height:1px!important;padding:0!important;margin:-1px!important;overflow:hidden!important;clip:rect(0,0,0,0)!important;white-space:nowrap!important;border:0!important}.visually-hidden-focusable:not(:focus):not(:focus-within):not(caption),.visually-hidden:not(caption){position:absolute!important}.stretched-link::after{position:absolute;top:0;right:0;bottom:0;left:0;z-index:1;content:""}.text-truncate{overflow:hidden;text-overflow:ellipsis;white-space:nowrap}.vr{display:inline-block;align-self:stretch;width:var(--bs-border-width);min-height:1em;background-color:currentcolor;opacity:.25}.align-baseline{vertical-align:baseline!important}.align-top{vertical-align:top!important}.align-middle{vertical-align:middle!important}.align-bottom{vertical-align:bottom!important}.align-text-bottom{vertical-align:text-bottom!important}.align-text-top{vertical-align:text-top!important}.float-start{float:left!important}.float-end{float:right!important}.float-none{float:none!important}.object-fit-contain{-o-object-fit:contain!important;object-fit:contain!important}.object-fit-cover{-o-object-fit:cover!important;object-fit:cover!important}.object-fit-fill{-o-object-fit:fill!important;object-fit:fill!important}.object-fit-scale{-o-object-fit:scale-down!important;object-fit:scale-down!important}.object-fit-none{-o-object-fit:none!important;object-fit:none!important}.opacity-0{opacity:0!important}.opacity-25{opacity:.25!important}.opacity-50{opacity:.5!important}.opacity-75{opacity:.75!important}.opacity-100{opacity:1!important}.overflow-auto{overflow:auto!important}.overflow-hidden{overflow:hidden!important}.overflow-visible{overflow:visible!important}.overflow-scroll{overflow:scroll!important}.overflow-x-auto{overflow-x:auto!important}.overflow-x-hidden{overflow-x:hidden!important}.overflow-x-visible{overflow-x:visible!important}.overflow-x-scroll{overflow-x:scroll!important}.overflow-y-auto{overflow-y:auto!important}.overflow-y-hidden{overflow-y:hidden!important}.overflow-y-visible{overflow-y:visible!important}.overflow-y-scroll{overflow-y:scroll!important}.d-inline{display:inline!important}.d-inline-block{display:inline-block!important}.d-block{display:block!important}.d-grid{display:grid!important}.d-inline-grid{display:inline-grid!important}.d-table{display:table!important}.d-table-row{display:table-row!important}.d-table-cell{display:table-cell!important}.d-flex{display:flex!important}.d-inline-flex{display:inline-flex!important}.d-none{display:none!important}.shadow{box-shadow:var(--bs-box-shadow)!important}.shadow-sm{box-shadow:var(--bs-box-shadow-sm)!important}.shadow-lg{box-shadow:var(--bs-box-shadow-lg)!important}.shadow-none{box-shadow:none!important}.focus-ring-primary{--bs-focus-ring-color:rgba(var(--bs-primary-rgb), var(--bs-focus-ring-opacity))}.focus-ring-secondary{--bs-focus-ring-color:rgba(var(--bs-secondary-rgb), var(--bs-focus-ring-opacity))}.focus-ring-success{--bs-focus-ring-color:rgba(var(--bs-success-rgb), var(--bs-focus-ring-opacity))}.focus-ring-info{--bs-focus-ring-color:rgba(var(--bs-info-rgb), var(--bs-focus-ring-opacity))}.focus-ring-warning{--bs-focus-ring-color:rgba(var(--bs-warning-rgb), var(--bs-focus-ring-opacity))}.focus-ring-danger{--bs-focus-ring-color:rgba(var(--bs-danger-rgb), var(--bs-focus-ring-opacity))}.focus-ring-light{--bs-focus-ring-color:rgba(var(--bs-light-rgb), var(--bs-focus-ring-opacity))}.focus-ring-dark{--bs-focus-ring-color:rgba(var(--bs-dark-rgb), var(--bs-focus-ring-opacity))}.position-static{position:static!important}.position-relative{position:relative!important}.position-absolute{position:absolute!important}.position-fixed{position:fixed!important}.position-sticky{position:-webkit-sticky!important;position:sticky!important}.top-0{top:0!important}.top-50{top:50%!important}.top-100{top:100%!important}.bottom-0{bottom:0!important}.bottom-50{bottom:50%!important}.bottom-100{bottom:100%!important}.start-0{left:0!important}.start-50{left:50%!important}.start-100{left:100%!important}.end-0{right:0!important}.end-50{right:50%!important}.end-100{right:100%!important}.translate-middle{transform:translate(-50%,-50%)!important}.translate-middle-x{transform:translateX(-50%)!important}.translate-middle-y{transform:translateY(-50%)!important}.border{border:var(--bs-border-width) var(--bs-border-style) var(--bs-border-color)!important}.border-0{border:0!important}.border-top{border-top:var(--bs-border-width) var(--bs-border-style) var(--bs-border-color)!important}.border-top-0{border-top:0!important}.border-end{border-right:var(--bs-border-width) var(--bs-border-style) var(--bs-border-color)!important}.border-end-0{border-right:0!important}.border-bottom{border-bottom:var(--bs-border-width) var(--bs-border-style) var(--bs-border-color)!important}.border-bottom-0{border-bottom:0!important}.border-start{border-left:var(--bs-border-width) var(--bs-border-style) var(--bs-border-color)!important}.border-start-0{border-left:0!important}.border-primary{--bs-border-opacity:1;border-color:rgba(var(--bs-primary-rgb),var(--bs-border-opacity))!important}.border-secondary{--bs-border-opacity:1;border-color:rgba(var(--bs-secondary-rgb),var(--bs-border-opacity))!important}.border-success{--bs-border-opacity:1;border-color:rgba(var(--bs-success-rgb),var(--bs-border-opacity))!important}.border-info{--bs-border-opacity:1;border-color:rgba(var(--bs-info-rgb),var(--bs-border-opacity))!important}.border-warning{--bs-border-opacity:1;border-color:rgba(var(--bs-warning-rgb),var(--bs-border-opacity))!important}.border-danger{--bs-border-opacity:1;border-color:rgba(var(--bs-danger-rgb),var(--bs-border-opacity))!important}.border-light{--bs-border-opacity:1;border-color:rgba(var(--bs-light-rgb),var(--bs-border-opacity))!important}.border-dark{--bs-border-opacity:1;border-color:rgba(var(--bs-dark-rgb),var(--bs-border-opacity))!important}.border-black{--bs-border-opacity:1;border-color:rgba(var(--bs-black-rgb),var(--bs-border-opacity))!important}.border-white{--bs-border-opacity:1;border-color:rgba(var(--bs-white-rgb),var(--bs-border-opacity))!important}.border-primary-subtle{border-color:var(--bs-primary-border-subtle)!important}.border-secondary-subtle{border-color:var(--bs-secondary-border-subtle)!important}.border-success-subtle{border-color:var(--bs-success-border-subtle)!important}.border-info-subtle{border-color:var(--bs-info-border-subtle)!important}.border-warning-subtle{border-color:var(--bs-warning-border-subtle)!important}.border-danger-subtle{border-color:var(--bs-danger-border-subtle)!important}.border-light-subtle{border-color:var(--bs-light-border-subtle)!important}.border-dark-subtle{border-color:var(--bs-dark-border-subtle)!important}.border-1{border-width:1px!important}.border-2{border-width:2px!important}.border-3{border-width:3px!important}.border-4{border-width:4px!important}.border-5{border-width:5px!important}.border-opacity-10{--bs-border-opacity:0.1}.border-opacity-25{--bs-border-opacity:0.25}.border-opacity-50{--bs-border-opacity:0.5}.border-opacity-75{--bs-border-opacity:0.75}.border-opacity-100{--bs-border-opacity:1}.w-25{width:25%!important}.w-50{width:50%!important}.w-75{width:75%!important}.w-100{width:100%!important}.w-auto{width:auto!important}.mw-100{max-width:100%!important}.vw-100{width:100vw!important}.min-vw-100{min-width:100vw!important}.h-25{height:25%!important}.h-50{height:50%!important}.h-75{height:75%!important}.h-100{height:100%!important}.h-auto{height:auto!important}.mh-100{max-height:100%!important}.vh-100{height:100vh!important}.min-vh-100{min-height:100vh!important}.flex-fill{flex:1 1 auto!important}.flex-row{flex-direction:row!important}.flex-column{flex-direction:column!important}.flex-row-reverse{flex-direction:row-reverse!important}.flex-column-reverse{flex-direction:column-reverse!important}.flex-grow-0{flex-grow:0!important}.flex-grow-1{flex-grow:1!important}.flex-shrink-0{flex-shrink:0!important}.flex-shrink-1{flex-shrink:1!important}.flex-wrap{flex-wrap:wrap!important}.flex-nowrap{flex-wrap:nowrap!important}.flex-wrap-reverse{flex-wrap:wrap-reverse!important}.justify-content-start{justify-content:flex-start!important}.justify-content-end{justify-content:flex-end!important}.justify-content-center{justify-content:center!important}.justify-content-between{justify-content:space-between!important}.justify-content-around{justify-content:space-around!important}.justify-content-evenly{justify-content:space-evenly!important}.align-items-start{align-items:flex-start!important}.align-items-end{align-items:flex-end!important}.align-items-center{align-items:center!important}.align-items-baseline{align-items:baseline!important}.align-items-stretch{align-items:stretch!important}.align-content-start{align-content:flex-start!important}.align-content-end{align-content:flex-end!important}.align-content-center{align-content:center!important}.align-content-between{align-content:space-between!important}.align-content-around{align-content:space-around!important}.align-content-stretch{align-content:stretch!important}.align-self-auto{align-self:auto!important}.align-self-start{align-self:flex-start!important}.align-self-end{align-self:flex-end!important}.align-self-center{align-self:center!important}.align-self-baseline{align-self:baseline!important}.align-self-stretch{align-self:stretch!important}.order-first{order:-1!important}.order-0{order:0!important}.order-1{order:1!important}.order-2{order:2!important}.order-3{order:3!important}.order-4{order:4!important}.order-5{order:5!important}.order-last{order:6!important}.m-0{margin:0!important}.m-1{margin:.25rem!important}.m-2{margin:.5rem!important}.m-3{margin:1rem!important}.m-4{margin:1.5rem!important}.m-5{margin:3rem!important}.m-auto{margin:auto!important}.mx-0{margin-right:0!important;margin-left:0!important}.mx-1{margin-right:.25rem!important;margin-left:.25rem!important}.mx-2{margin-right:.5rem!important;margin-left:.5rem!important}.mx-3{margin-right:1rem!important;margin-left:1rem!important}.mx-4{margin-right:1.5rem!important;margin-left:1.5rem!important}.mx-5{margin-right:3rem!important;margin-left:3rem!important}.mx-auto{margin-right:auto!important;margin-left:auto!important}.my-0{margin-top:0!important;margin-bottom:0!important}.my-1{margin-top:.25rem!important;margin-bottom:.25rem!important}.my-2{margin-top:.5rem!important;margin-bottom:.5rem!important}.my-3{margin-top:1rem!important;margin-bottom:1rem!important}.my-4{margin-top:1.5rem!important;margin-bottom:1.5rem!important}.my-5{margin-top:3rem!important;margin-bottom:3rem!important}.my-auto{margin-top:auto!important;margin-bottom:auto!important}.mt-0{margin-top:0!important}.mt-1{margin-top:.25rem!important}.mt-2{margin-top:.5rem!important}.mt-3{margin-top:1rem!important}.mt-4{margin-top:1.5rem!important}.mt-5{margin-top:3rem!important}.mt-auto{margin-top:auto!important}.me-0{margin-right:0!important}.me-1{margin-right:.25rem!important}.me-2{margin-right:.5rem!important}.me-3{margin-right:1rem!important}.me-4{margin-right:1.5rem!important}.me-5{margin-right:3rem!important}.me-auto{margin-right:auto!important}.mb-0{margin-bottom:0!important}.mb-1{margin-bottom:.25rem!important}.mb-2{margin-bottom:.5rem!important}.mb-3{margin-bottom:1rem!important}.mb-4{margin-bottom:1.5rem!important}.mb-5{margin-bottom:3rem!important}.mb-auto{margin-bottom:auto!important}.ms-0{margin-left:0!important}.ms-1{margin-left:.25rem!important}.ms-2{margin-left:.5rem!important}.ms-3{margin-left:1rem!important}.ms-4{margin-left:1.5rem!important}.ms-5{margin-left:3rem!important}.ms-auto{margin-left:auto!important}.p-0{padding:0!important}.p-1{padding:.25rem!important}.p-2{padding:.5rem!important}.p-3{padding:1rem!important}.p-4{padding:1.5rem!important}.p-5{padding:3rem!important}.px-0{padding-right:0!important;padding-left:0!important}.px-1{padding-right:.25rem!important;padding-left:.25rem!important}.px-2{padding-right:.5rem!important;padding-left:.5rem!important}.px-3{padding-right:1rem!important;padding-left:1rem!important}.px-4{padding-right:1.5rem!important;padding-left:1.5rem!important}.px-5{padding-right:3rem!important;padding-left:3rem!important}.py-0{padding-top:0!important;padding-bottom:0!important}.py-1{padding-top:.25rem!important;padding-bottom:.25rem!important}.py-2{padding-top:.5rem!important;padding-bottom:.5rem!important}.py-3{padding-top:1rem!important;padding-bottom:1rem!important}.py-4{padding-top:1.5rem!important;padding-bottom:1.5rem!important}.py-5{padding-top:3rem!important;padding-bottom:3rem!important}.pt-0{padding-top:0!important}.pt-1{padding-top:.25rem!important}.pt-2{padding-top:.5rem!important}.pt-3{padding-top:1rem!important}.pt-4{padding-top:1.5rem!important}.pt-5{padding-top:3rem!important}.pe-0{padding-right:0!important}.pe-1{padding-right:.25rem!important}.pe-2{padding-right:.5rem!important}.pe-3{padding-right:1rem!important}.pe-4{padding-right:1.5rem!important}.pe-5{padding-right:3rem!important}.pb-0{padding-bottom:0!important}.pb-1{padding-bottom:.25rem!important}.pb-2{padding-bottom:.5rem!important}.pb-3{padding-bottom:1rem!important}.pb-4{padding-bottom:1.5rem!important}.pb-5{padding-bottom:3rem!important}.ps-0{padding-left:0!important}.ps-1{padding-left:.25rem!important}.ps-2{padding-left:.5rem!important}.ps-3{padding-left:1rem!important}.ps-4{padding-left:1.5rem!important}.ps-5{padding-left:3rem!important}.gap-0{gap:0!important}.gap-1{gap:.25rem!important}.gap-2{gap:.5rem!important}.gap-3{gap:1rem!important}.gap-4{gap:1.5rem!important}.gap-5{gap:3rem!important}.row-gap-0{row-gap:0!important}.row-gap-1{row-gap:.25rem!important}.row-gap-2{row-gap:.5rem!important}.row-gap-3{row-gap:1rem!important}.row-gap-4{row-gap:1.5rem!important}.row-gap-5{row-gap:3rem!important}.column-gap-0{-moz-column-gap:0!important;column-gap:0!important}.column-gap-1{-moz-column-gap:0.25rem!important;column-gap:.25rem!important}.column-gap-2{-moz-column-gap:0.5rem!important;column-gap:.5rem!important}.column-gap-3{-moz-column-gap:1rem!important;column-gap:1rem!important}.column-gap-4{-moz-column-gap:1.5rem!important;column-gap:1.5rem!important}.column-gap-5{-moz-column-gap:3rem!important;column-gap:3rem!important}.font-monospace{font-family:var(--bs-font-monospace)!important}.fs-1{font-size:calc(1.375rem + 1.5vw)!important}.fs-2{font-size:calc(1.325rem + .9vw)!important}.fs-3{font-size:calc(1.3rem + .6vw)!important}.fs-4{font-size:calc(1.275rem + .3vw)!important}.fs-5{font-size:1.25rem!important}.fs-6{font-size:1rem!important}.fst-italic{font-style:italic!important}.fst-normal{font-style:normal!important}.fw-lighter{font-weight:lighter!important}.fw-light{font-weight:300!important}.fw-normal{font-weight:400!important}.fw-medium{font-weight:500!important}.fw-semibold{font-weight:600!important}.fw-bold{font-weight:700!important}.fw-bolder{font-weight:bolder!important}.lh-1{line-height:1!important}.lh-sm{line-height:1.25!important}.lh-base{line-height:1.5!important}.lh-lg{line-height:2!important}.text-start{text-align:left!important}.text-end{text-align:right!important}.text-center{text-align:center!important}.text-decoration-none{text-decoration:none!important}.text-decoration-underline{text-decoration:underline!important}.text-decoration-line-through{text-decoration:line-through!important}.text-lowercase{text-transform:lowercase!important}.text-uppercase{text-transform:uppercase!important}.text-capitalize{text-transform:capitalize!important}.text-wrap{white-space:normal!important}.text-nowrap{white-space:nowrap!important}.text-break{word-wrap:break-word!important;word-break:break-word!important}.text-primary{--bs-text-opacity:1;color:rgba(var(--bs-primary-rgb),var(--bs-text-opacity))!important}.text-secondary{--bs-text-opacity:1;color:rgba(var(--bs-secondary-rgb),var(--bs-text-opacity))!important}.text-success{--bs-text-opacity:1;color:rgba(var(--bs-success-rgb),var(--bs-text-opacity))!important}.text-info{--bs-text-opacity:1;color:rgba(var(--bs-info-rgb),var(--bs-text-opacity))!important}.text-warning{--bs-text-opacity:1;color:rgba(var(--bs-warning-rgb),var(--bs-text-opacity))!important}.text-danger{--bs-text-opacity:1;color:rgba(var(--bs-danger-rgb),var(--bs-text-opacity))!important}.text-light{--bs-text-opacity:1;color:rgba(var(--bs-light-rgb),var(--bs-text-opacity))!important}.text-dark{--bs-text-opacity:1;color:rgba(var(--bs-dark-rgb),var(--bs-text-opacity))!important}.text-black{--bs-text-opacity:1;color:rgba(var(--bs-black-rgb),var(--bs-text-opacity))!important}.text-white{--bs-text-opacity:1;color:rgba(var(--bs-white-rgb),var(--bs-text-opacity))!important}.text-body{--bs-text-opacity:1;color:rgba(var(--bs-body-color-rgb),var(--bs-text-opacity))!important}.text-muted{--bs-text-opacity:1;color:var(--bs-secondary-color)!important}.text-black-50{--bs-text-opacity:1;color:rgba(0,0,0,.5)!important}.text-white-50{--bs-text-opacity:1;color:rgba(255,255,255,.5)!important}.text-body-secondary{--bs-text-opacity:1;color:var(--bs-secondary-color)!important}.text-body-tertiary{--bs-text-opacity:1;color:var(--bs-tertiary-color)!important}.text-body-emphasis{--bs-text-opacity:1;color:var(--bs-emphasis-color)!important}.text-reset{--bs-text-opacity:1;color:inherit!important}.text-opacity-25{--bs-text-opacity:0.25}.text-opacity-50{--bs-text-opacity:0.5}.text-opacity-75{--bs-text-opacity:0.75}.text-opacity-100{--bs-text-opacity:1}.text-primary-emphasis{color:var(--bs-primary-text-emphasis)!important}.text-secondary-emphasis{color:var(--bs-secondary-text-emphasis)!important}.text-success-emphasis{color:var(--bs-success-text-emphasis)!important}.text-info-emphasis{color:var(--bs-info-text-emphasis)!important}.text-warning-emphasis{color:var(--bs-warning-text-emphasis)!important}.text-danger-emphasis{color:var(--bs-danger-text-emphasis)!important}.text-light-emphasis{color:var(--bs-light-text-emphasis)!important}.text-dark-emphasis{color:var(--bs-dark-text-emphasis)!important}.link-opacity-10{--bs-link-opacity:0.1}.link-opacity-10-hover:hover{--bs-link-opacity:0.1}.link-opacity-25{--bs-link-opacity:0.25}.link-opacity-25-hover:hover{--bs-link-opacity:0.25}.link-opacity-50{--bs-link-opacity:0.5}.link-opacity-50-hover:hover{--bs-link-opacity:0.5}.link-opacity-75{--bs-link-opacity:0.75}.link-opacity-75-hover:hover{--bs-link-opacity:0.75}.link-opacity-100{--bs-link-opacity:1}.link-opacity-100-hover:hover{--bs-link-opacity:1}.link-offset-1{text-underline-offset:0.125em!important}.link-offset-1-hover:hover{text-underline-offset:0.125em!important}.link-offset-2{text-underline-offset:0.25em!important}.link-offset-2-hover:hover{text-underline-offset:0.25em!important}.link-offset-3{text-underline-offset:0.375em!important}.link-offset-3-hover:hover{text-underline-offset:0.375em!important}.link-underline-primary{--bs-link-underline-opacity:1;-webkit-text-decoration-color:rgba(var(--bs-primary-rgb),var(--bs-link-underline-opacity))!important;text-decoration-color:rgba(var(--bs-primary-rgb),var(--bs-link-underline-opacity))!important}.link-underline-secondary{--bs-link-underline-opacity:1;-webkit-text-decoration-color:rgba(var(--bs-secondary-rgb),var(--bs-link-underline-opacity))!important;text-decoration-color:rgba(var(--bs-secondary-rgb),var(--bs-link-underline-opacity))!important}.link-underline-success{--bs-link-underline-opacity:1;-webkit-text-decoration-color:rgba(var(--bs-success-rgb),var(--bs-link-underline-opacity))!important;text-decoration-color:rgba(var(--bs-success-rgb),var(--bs-link-underline-opacity))!important}.link-underline-info{--bs-link-underline-opacity:1;-webkit-text-decoration-color:rgba(var(--bs-info-rgb),var(--bs-link-underline-opacity))!important;text-decoration-color:rgba(var(--bs-info-rgb),var(--bs-link-underline-opacity))!important}.link-underline-warning{--bs-link-underline-opacity:1;-webkit-text-decoration-color:rgba(var(--bs-warning-rgb),var(--bs-link-underline-opacity))!important;text-decoration-color:rgba(var(--bs-warning-rgb),var(--bs-link-underline-opacity))!important}.link-underline-danger{--bs-link-underline-opacity:1;-webkit-text-decoration-color:rgba(var(--bs-danger-rgb),var(--bs-link-underline-opacity))!important;text-decoration-color:rgba(var(--bs-danger-rgb),var(--bs-link-underline-opacity))!important}.link-underline-light{--bs-link-underline-opacity:1;-webkit-text-decoration-color:rgba(var(--bs-light-rgb),var(--bs-link-underline-opacity))!important;text-decoration-color:rgba(var(--bs-light-rgb),var(--bs-link-underline-opacity))!important}.link-underline-dark{--bs-link-underline-opacity:1;-webkit-text-decoration-color:rgba(var(--bs-dark-rgb),var(--bs-link-underline-opacity))!important;text-decoration-color:rgba(var(--bs-dark-rgb),var(--bs-link-underline-opacity))!important}.link-underline{--bs-link-underline-opacity:1;-webkit-text-decoration-color:rgba(var(--bs-link-color-rgb),var(--bs-link-underline-opacity,1))!important;text-decoration-color:rgba(var(--bs-link-color-rgb),var(--bs-link-underline-opacity,1))!important}.link-underline-opacity-0{--bs-link-underline-opacity:0}.link-underline-opacity-0-hover:hover{--bs-link-underline-opacity:0}.link-underline-opacity-10{--bs-link-underline-opacity:0.1}.link-underline-opacity-10-hover:hover{--bs-link-underline-opacity:0.1}.link-underline-opacity-25{--bs-link-underline-opacity:0.25}.link-underline-opacity-25-hover:hover{--bs-link-underline-opacity:0.25}.link-underline-opacity-50{--bs-link-underline-opacity:0.5}.link-underline-opacity-50-hover:hover{--bs-link-underline-opacity:0.5}.link-underline-opacity-75{--bs-link-underline-opacity:0.75}.link-underline-opacity-75-hover:hover{--bs-link-underline-opacity:0.75}.link-underline-opacity-100{--bs-link-underline-opacity:1}.link-underline-opacity-100-hover:hover{--bs-link-underline-opacity:1}.bg-primary{--bs-bg-opacity:1;background-color:rgba(var(--bs-primary-rgb),var(--bs-bg-opacity))!important}.bg-secondary{--bs-bg-opacity:1;background-color:rgba(var(--bs-secondary-rgb),var(--bs-bg-opacity))!important}.bg-success{--bs-bg-opacity:1;background-color:rgba(var(--bs-success-rgb),var(--bs-bg-opacity))!important}.bg-info{--bs-bg-opacity:1;background-color:rgba(var(--bs-info-rgb),var(--bs-bg-opacity))!important}.bg-warning{--bs-bg-opacity:1;background-color:rgba(var(--bs-warning-rgb),var(--bs-bg-opacity))!important}.bg-danger{--bs-bg-opacity:1;background-color:rgba(var(--bs-danger-rgb),var(--bs-bg-opacity))!important}.bg-light{--bs-bg-opacity:1;background-color:rgba(var(--bs-light-rgb),var(--bs-bg-opacity))!important}.bg-dark{--bs-bg-opacity:1;background-color:rgba(var(--bs-dark-rgb),var(--bs-bg-opacity))!important}.bg-black{--bs-bg-opacity:1;background-color:rgba(var(--bs-black-rgb),var(--bs-bg-opacity))!important}.bg-white{--bs-bg-opacity:1;background-color:rgba(var(--bs-white-rgb),var(--bs-bg-opacity))!important}.bg-body{--bs-bg-opacity:1;background-color:rgba(var(--bs-body-bg-rgb),var(--bs-bg-opacity))!important}.bg-transparent{--bs-bg-opacity:1;background-color:transparent!important}.bg-body-secondary{--bs-bg-opacity:1;background-color:rgba(var(--bs-secondary-bg-rgb),var(--bs-bg-opacity))!important}.bg-body-tertiary{--bs-bg-opacity:1;background-color:rgba(var(--bs-tertiary-bg-rgb),var(--bs-bg-opacity))!important}.bg-opacity-10{--bs-bg-opacity:0.1}.bg-opacity-25{--bs-bg-opacity:0.25}.bg-opacity-50{--bs-bg-opacity:0.5}.bg-opacity-75{--bs-bg-opacity:0.75}.bg-opacity-100{--bs-bg-opacity:1}.bg-primary-subtle{background-color:var(--bs-primary-bg-subtle)!important}.bg-secondary-subtle{background-color:var(--bs-secondary-bg-subtle)!important}.bg-success-subtle{background-color:var(--bs-success-bg-subtle)!important}.bg-info-subtle{background-color:var(--bs-info-bg-subtle)!important}.bg-warning-subtle{background-color:var(--bs-warning-bg-subtle)!important}.bg-danger-subtle{background-color:var(--bs-danger-bg-subtle)!important}.bg-light-subtle{background-color:var(--bs-light-bg-subtle)!important}.bg-dark-subtle{background-color:var(--bs-dark-bg-subtle)!important}.bg-gradient{background-image:var(--bs-gradient)!important}.user-select-all{-webkit-user-select:all!important;-moz-user-select:all!important;user-select:all!important}.user-select-auto{-webkit-user-select:auto!important;-moz-user-select:auto!important;user-select:auto!important}.user-select-none{-webkit-user-select:none!important;-moz-user-select:none!important;user-select:none!important}.pe-none{pointer-events:none!important}.pe-auto{pointer-events:auto!important}.rounded{border-radius:var(--bs-border-radius)!important}.rounded-0{border-radius:0!important}.rounded-1{border-radius:var(--bs-border-radius-sm)!important}.rounded-2{border-radius:var(--bs-border-radius)!important}.rounded-3{border-radius:var(--bs-border-radius-lg)!important}.rounded-4{border-radius:var(--bs-border-radius-xl)!important}.rounded-5{border-radius:var(--bs-border-radius-xxl)!important}.rounded-circle{border-radius:50%!important}.rounded-pill{border-radius:var(--bs-border-radius-pill)!important}.rounded-top{border-top-left-radius:var(--bs-border-radius)!important;border-top-right-radius:var(--bs-border-radius)!important}.rounded-top-0{border-top-left-radius:0!important;border-top-right-radius:0!important}.rounded-top-1{border-top-left-radius:var(--bs-border-radius-sm)!important;border-top-right-radius:var(--bs-border-radius-sm)!important}.rounded-top-2{border-top-left-radius:var(--bs-border-radius)!important;border-top-right-radius:var(--bs-border-radius)!important}.rounded-top-3{border-top-left-radius:var(--bs-border-radius-lg)!important;border-top-right-radius:var(--bs-border-radius-lg)!important}.rounded-top-4{border-top-left-radius:var(--bs-border-radius-xl)!important;border-top-right-radius:var(--bs-border-radius-xl)!important}.rounded-top-5{border-top-left-radius:var(--bs-border-radius-xxl)!important;border-top-right-radius:var(--bs-border-radius-xxl)!important}.rounded-top-circle{border-top-left-radius:50%!important;border-top-right-radius:50%!important}.rounded-top-pill{border-top-left-radius:var(--bs-border-radius-pill)!important;border-top-right-radius:var(--bs-border-radius-pill)!important}.rounded-end{border-top-right-radius:var(--bs-border-radius)!important;border-bottom-right-radius:var(--bs-border-radius)!important}.rounded-end-0{border-top-right-radius:0!important;border-bottom-right-radius:0!important}.rounded-end-1{border-top-right-radius:var(--bs-border-radius-sm)!important;border-bottom-right-radius:var(--bs-border-radius-sm)!important}.rounded-end-2{border-top-right-radius:var(--bs-border-radius)!important;border-bottom-right-radius:var(--bs-border-radius)!important}.rounded-end-3{border-top-right-radius:var(--bs-border-radius-lg)!important;border-bottom-right-radius:var(--bs-border-radius-lg)!important}.rounded-end-4{border-top-right-radius:var(--bs-border-radius-xl)!important;border-bottom-right-radius:var(--bs-border-radius-xl)!important}.rounded-end-5{border-top-right-radius:var(--bs-border-radius-xxl)!important;border-bottom-right-radius:var(--bs-border-radius-xxl)!important}.rounded-end-circle{border-top-right-radius:50%!important;border-bottom-right-radius:50%!important}.rounded-end-pill{border-top-right-radius:var(--bs-border-radius-pill)!important;border-bottom-right-radius:var(--bs-border-radius-pill)!important}.rounded-bottom{border-bottom-right-radius:var(--bs-border-radius)!important;border-bottom-left-radius:var(--bs-border-radius)!important}.rounded-bottom-0{border-bottom-right-radius:0!important;border-bottom-left-radius:0!important}.rounded-bottom-1{border-bottom-right-radius:var(--bs-border-radius-sm)!important;border-bottom-left-radius:var(--bs-border-radius-sm)!important}.rounded-bottom-2{border-bottom-right-radius:var(--bs-border-radius)!important;border-bottom-left-radius:var(--bs-border-radius)!important}.rounded-bottom-3{border-bottom-right-radius:var(--bs-border-radius-lg)!important;border-bottom-left-radius:var(--bs-border-radius-lg)!important}.rounded-bottom-4{border-bottom-right-radius:var(--bs-border-radius-xl)!important;border-bottom-left-radius:var(--bs-border-radius-xl)!important}.rounded-bottom-5{border-bottom-right-radius:var(--bs-border-radius-xxl)!important;border-bottom-left-radius:var(--bs-border-radius-xxl)!important}.rounded-bottom-circle{border-bottom-right-radius:50%!important;border-bottom-left-radius:50%!important}.rounded-bottom-pill{border-bottom-right-radius:var(--bs-border-radius-pill)!important;border-bottom-left-radius:var(--bs-border-radius-pill)!important}.rounded-start{border-bottom-left-radius:var(--bs-border-radius)!important;border-top-left-radius:var(--bs-border-radius)!important}.rounded-start-0{border-bottom-left-radius:0!important;border-top-left-radius:0!important}.rounded-start-1{border-bottom-left-radius:var(--bs-border-radius-sm)!important;border-top-left-radius:var(--bs-border-radius-sm)!important}.rounded-start-2{border-bottom-left-radius:var(--bs-border-radius)!important;border-top-left-radius:var(--bs-border-radius)!important}.rounded-start-3{border-bottom-left-radius:var(--bs-border-radius-lg)!important;border-top-left-radius:var(--bs-border-radius-lg)!important}.rounded-start-4{border-bottom-left-radius:var(--bs-border-radius-xl)!important;border-top-left-radius:var(--bs-border-radius-xl)!important}.rounded-start-5{border-bottom-left-radius:var(--bs-border-radius-xxl)!important;border-top-left-radius:var(--bs-border-radius-xxl)!important}.rounded-start-circle{border-bottom-left-radius:50%!important;border-top-left-radius:50%!important}.rounded-start-pill{border-bottom-left-radius:var(--bs-border-radius-pill)!important;border-top-left-radius:var(--bs-border-radius-pill)!important}.visible{visibility:visible!important}.invisible{visibility:hidden!important}.z-n1{z-index:-1!important}.z-0{z-index:0!important}.z-1{z-index:1!important}.z-2{z-index:2!important}.z-3{z-index:3!important}@media (min-width:576px){.float-sm-start{float:left!important}.float-sm-end{float:right!important}.float-sm-none{float:none!important}.object-fit-sm-contain{-o-object-fit:contain!important;object-fit:contain!important}.object-fit-sm-cover{-o-object-fit:cover!important;object-fit:cover!important}.object-fit-sm-fill{-o-object-fit:fill!important;object-fit:fill!important}.object-fit-sm-scale{-o-object-fit:scale-down!important;object-fit:scale-down!important}.object-fit-sm-none{-o-object-fit:none!important;object-fit:none!important}.d-sm-inline{display:inline!important}.d-sm-inline-block{display:inline-block!important}.d-sm-block{display:block!important}.d-sm-grid{display:grid!important}.d-sm-inline-grid{display:inline-grid!important}.d-sm-table{display:table!important}.d-sm-table-row{display:table-row!important}.d-sm-table-cell{display:table-cell!important}.d-sm-flex{display:flex!important}.d-sm-inline-flex{display:inline-flex!important}.d-sm-none{display:none!important}.flex-sm-fill{flex:1 1 auto!important}.flex-sm-row{flex-direction:row!important}.flex-sm-column{flex-direction:column!important}.flex-sm-row-reverse{flex-direction:row-reverse!important}.flex-sm-column-reverse{flex-direction:column-reverse!important}.flex-sm-grow-0{flex-grow:0!important}.flex-sm-grow-1{flex-grow:1!important}.flex-sm-shrink-0{flex-shrink:0!important}.flex-sm-shrink-1{flex-shrink:1!important}.flex-sm-wrap{flex-wrap:wrap!important}.flex-sm-nowrap{flex-wrap:nowrap!important}.flex-sm-wrap-reverse{flex-wrap:wrap-reverse!important}.justify-content-sm-start{justify-content:flex-start!important}.justify-content-sm-end{justify-content:flex-end!important}.justify-content-sm-center{justify-content:center!important}.justify-content-sm-between{justify-content:space-between!important}.justify-content-sm-around{justify-content:space-around!important}.justify-content-sm-evenly{justify-content:space-evenly!important}.align-items-sm-start{align-items:flex-start!important}.align-items-sm-end{align-items:flex-end!important}.align-items-sm-center{align-items:center!important}.align-items-sm-baseline{align-items:baseline!important}.align-items-sm-stretch{align-items:stretch!important}.align-content-sm-start{align-content:flex-start!important}.align-content-sm-end{align-content:flex-end!important}.align-content-sm-center{align-content:center!important}.align-content-sm-between{align-content:space-between!important}.align-content-sm-around{align-content:space-around!important}.align-content-sm-stretch{align-content:stretch!important}.align-self-sm-auto{align-self:auto!important}.align-self-sm-start{align-self:flex-start!important}.align-self-sm-end{align-self:flex-end!important}.align-self-sm-center{align-self:center!important}.align-self-sm-baseline{align-self:baseline!important}.align-self-sm-stretch{align-self:stretch!important}.order-sm-first{order:-1!important}.order-sm-0{order:0!important}.order-sm-1{order:1!important}.order-sm-2{order:2!important}.order-sm-3{order:3!important}.order-sm-4{order:4!important}.order-sm-5{order:5!important}.order-sm-last{order:6!important}.m-sm-0{margin:0!important}.m-sm-1{margin:.25rem!important}.m-sm-2{margin:.5rem!important}.m-sm-3{margin:1rem!important}.m-sm-4{margin:1.5rem!important}.m-sm-5{margin:3rem!important}.m-sm-auto{margin:auto!important}.mx-sm-0{margin-right:0!important;margin-left:0!important}.mx-sm-1{margin-right:.25rem!important;margin-left:.25rem!important}.mx-sm-2{margin-right:.5rem!important;margin-left:.5rem!important}.mx-sm-3{margin-right:1rem!important;margin-left:1rem!important}.mx-sm-4{margin-right:1.5rem!important;margin-left:1.5rem!important}.mx-sm-5{margin-right:3rem!important;margin-left:3rem!important}.mx-sm-auto{margin-right:auto!important;margin-left:auto!important}.my-sm-0{margin-top:0!important;margin-bottom:0!important}.my-sm-1{margin-top:.25rem!important;margin-bottom:.25rem!important}.my-sm-2{margin-top:.5rem!important;margin-bottom:.5rem!important}.my-sm-3{margin-top:1rem!important;margin-bottom:1rem!important}.my-sm-4{margin-top:1.5rem!important;margin-bottom:1.5rem!important}.my-sm-5{margin-top:3rem!important;margin-bottom:3rem!important}.my-sm-auto{margin-top:auto!important;margin-bottom:auto!important}.mt-sm-0{margin-top:0!important}.mt-sm-1{margin-top:.25rem!important}.mt-sm-2{margin-top:.5rem!important}.mt-sm-3{margin-top:1rem!important}.mt-sm-4{margin-top:1.5rem!important}.mt-sm-5{margin-top:3rem!important}.mt-sm-auto{margin-top:auto!important}.me-sm-0{margin-right:0!important}.me-sm-1{margin-right:.25rem!important}.me-sm-2{margin-right:.5rem!important}.me-sm-3{margin-right:1rem!important}.me-sm-4{margin-right:1.5rem!important}.me-sm-5{margin-right:3rem!important}.me-sm-auto{margin-right:auto!important}.mb-sm-0{margin-bottom:0!important}.mb-sm-1{margin-bottom:.25rem!important}.mb-sm-2{margin-bottom:.5rem!important}.mb-sm-3{margin-bottom:1rem!important}.mb-sm-4{margin-bottom:1.5rem!important}.mb-sm-5{margin-bottom:3rem!important}.mb-sm-auto{margin-bottom:auto!important}.ms-sm-0{margin-left:0!important}.ms-sm-1{margin-left:.25rem!important}.ms-sm-2{margin-left:.5rem!important}.ms-sm-3{margin-left:1rem!important}.ms-sm-4{margin-left:1.5rem!important}.ms-sm-5{margin-left:3rem!important}.ms-sm-auto{margin-left:auto!important}.p-sm-0{padding:0!important}.p-sm-1{padding:.25rem!important}.p-sm-2{padding:.5rem!important}.p-sm-3{padding:1rem!important}.p-sm-4{padding:1.5rem!important}.p-sm-5{padding:3rem!important}.px-sm-0{padding-right:0!important;padding-left:0!important}.px-sm-1{padding-right:.25rem!important;padding-left:.25rem!important}.px-sm-2{padding-right:.5rem!important;padding-left:.5rem!important}.px-sm-3{padding-right:1rem!important;padding-left:1rem!important}.px-sm-4{padding-right:1.5rem!important;padding-left:1.5rem!important}.px-sm-5{padding-right:3rem!important;padding-left:3rem!important}.py-sm-0{padding-top:0!important;padding-bottom:0!important}.py-sm-1{padding-top:.25rem!important;padding-bottom:.25rem!important}.py-sm-2{padding-top:.5rem!important;padding-bottom:.5rem!important}.py-sm-3{padding-top:1rem!important;padding-bottom:1rem!important}.py-sm-4{padding-top:1.5rem!important;padding-bottom:1.5rem!important}.py-sm-5{padding-top:3rem!important;padding-bottom:3rem!important}.pt-sm-0{padding-top:0!important}.pt-sm-1{padding-top:.25rem!important}.pt-sm-2{padding-top:.5rem!important}.pt-sm-3{padding-top:1rem!important}.pt-sm-4{padding-top:1.5rem!important}.pt-sm-5{padding-top:3rem!important}.pe-sm-0{padding-right:0!important}.pe-sm-1{padding-right:.25rem!important}.pe-sm-2{padding-right:.5rem!important}.pe-sm-3{padding-right:1rem!important}.pe-sm-4{padding-right:1.5rem!important}.pe-sm-5{padding-right:3rem!important}.pb-sm-0{padding-bottom:0!important}.pb-sm-1{padding-bottom:.25rem!important}.pb-sm-2{padding-bottom:.5rem!important}.pb-sm-3{padding-bottom:1rem!important}.pb-sm-4{padding-bottom:1.5rem!important}.pb-sm-5{padding-bottom:3rem!important}.ps-sm-0{padding-left:0!important}.ps-sm-1{padding-left:.25rem!important}.ps-sm-2{padding-left:.5rem!important}.ps-sm-3{padding-left:1rem!important}.ps-sm-4{padding-left:1.5rem!important}.ps-sm-5{padding-left:3rem!important}.gap-sm-0{gap:0!important}.gap-sm-1{gap:.25rem!important}.gap-sm-2{gap:.5rem!important}.gap-sm-3{gap:1rem!important}.gap-sm-4{gap:1.5rem!important}.gap-sm-5{gap:3rem!important}.row-gap-sm-0{row-gap:0!important}.row-gap-sm-1{row-gap:.25rem!important}.row-gap-sm-2{row-gap:.5rem!important}.row-gap-sm-3{row-gap:1rem!important}.row-gap-sm-4{row-gap:1.5rem!important}.row-gap-sm-5{row-gap:3rem!important}.column-gap-sm-0{-moz-column-gap:0!important;column-gap:0!important}.column-gap-sm-1{-moz-column-gap:0.25rem!important;column-gap:.25rem!important}.column-gap-sm-2{-moz-column-gap:0.5rem!important;column-gap:.5rem!important}.column-gap-sm-3{-moz-column-gap:1rem!important;column-gap:1rem!important}.column-gap-sm-4{-moz-column-gap:1.5rem!important;column-gap:1.5rem!important}.column-gap-sm-5{-moz-column-gap:3rem!important;column-gap:3rem!important}.text-sm-start{text-align:left!important}.text-sm-end{text-align:right!important}.text-sm-center{text-align:center!important}}@media (min-width:768px){.float-md-start{float:left!important}.float-md-end{float:right!important}.float-md-none{float:none!important}.object-fit-md-contain{-o-object-fit:contain!important;object-fit:contain!important}.object-fit-md-cover{-o-object-fit:cover!important;object-fit:cover!important}.object-fit-md-fill{-o-object-fit:fill!important;object-fit:fill!important}.object-fit-md-scale{-o-object-fit:scale-down!important;object-fit:scale-down!important}.object-fit-md-none{-o-object-fit:none!important;object-fit:none!important}.d-md-inline{display:inline!important}.d-md-inline-block{display:inline-block!important}.d-md-block{display:block!important}.d-md-grid{display:grid!important}.d-md-inline-grid{display:inline-grid!important}.d-md-table{display:table!important}.d-md-table-row{display:table-row!important}.d-md-table-cell{display:table-cell!important}.d-md-flex{display:flex!important}.d-md-inline-flex{display:inline-flex!important}.d-md-none{display:none!important}.flex-md-fill{flex:1 1 auto!important}.flex-md-row{flex-direction:row!important}.flex-md-column{flex-direction:column!important}.flex-md-row-reverse{flex-direction:row-reverse!important}.flex-md-column-reverse{flex-direction:column-reverse!important}.flex-md-grow-0{flex-grow:0!important}.flex-md-grow-1{flex-grow:1!important}.flex-md-shrink-0{flex-shrink:0!important}.flex-md-shrink-1{flex-shrink:1!important}.flex-md-wrap{flex-wrap:wrap!important}.flex-md-nowrap{flex-wrap:nowrap!important}.flex-md-wrap-reverse{flex-wrap:wrap-reverse!important}.justify-content-md-start{justify-content:flex-start!important}.justify-content-md-end{justify-content:flex-end!important}.justify-content-md-center{justify-content:center!important}.justify-content-md-between{justify-content:space-between!important}.justify-content-md-around{justify-content:space-around!important}.justify-content-md-evenly{justify-content:space-evenly!important}.align-items-md-start{align-items:flex-start!important}.align-items-md-end{align-items:flex-end!important}.align-items-md-center{align-items:center!important}.align-items-md-baseline{align-items:baseline!important}.align-items-md-stretch{align-items:stretch!important}.align-content-md-start{align-content:flex-start!important}.align-content-md-end{align-content:flex-end!important}.align-content-md-center{align-content:center!important}.align-content-md-between{align-content:space-between!important}.align-content-md-around{align-content:space-around!important}.align-content-md-stretch{align-content:stretch!important}.align-self-md-auto{align-self:auto!important}.align-self-md-start{align-self:flex-start!important}.align-self-md-end{align-self:flex-end!important}.align-self-md-center{align-self:center!important}.align-self-md-baseline{align-self:baseline!important}.align-self-md-stretch{align-self:stretch!important}.order-md-first{order:-1!important}.order-md-0{order:0!important}.order-md-1{order:1!important}.order-md-2{order:2!important}.order-md-3{order:3!important}.order-md-4{order:4!important}.order-md-5{order:5!important}.order-md-last{order:6!important}.m-md-0{margin:0!important}.m-md-1{margin:.25rem!important}.m-md-2{margin:.5rem!important}.m-md-3{margin:1rem!important}.m-md-4{margin:1.5rem!important}.m-md-5{margin:3rem!important}.m-md-auto{margin:auto!important}.mx-md-0{margin-right:0!important;margin-left:0!important}.mx-md-1{margin-right:.25rem!important;margin-left:.25rem!important}.mx-md-2{margin-right:.5rem!important;margin-left:.5rem!important}.mx-md-3{margin-right:1rem!important;margin-left:1rem!important}.mx-md-4{margin-right:1.5rem!important;margin-left:1.5rem!important}.mx-md-5{margin-right:3rem!important;margin-left:3rem!important}.mx-md-auto{margin-right:auto!important;margin-left:auto!important}.my-md-0{margin-top:0!important;margin-bottom:0!important}.my-md-1{margin-top:.25rem!important;margin-bottom:.25rem!important}.my-md-2{margin-top:.5rem!important;margin-bottom:.5rem!important}.my-md-3{margin-top:1rem!important;margin-bottom:1rem!important}.my-md-4{margin-top:1.5rem!important;margin-bottom:1.5rem!important}.my-md-5{margin-top:3rem!important;margin-bottom:3rem!important}.my-md-auto{margin-top:auto!important;margin-bottom:auto!important}.mt-md-0{margin-top:0!important}.mt-md-1{margin-top:.25rem!important}.mt-md-2{margin-top:.5rem!important}.mt-md-3{margin-top:1rem!important}.mt-md-4{margin-top:1.5rem!important}.mt-md-5{margin-top:3rem!important}.mt-md-auto{margin-top:auto!important}.me-md-0{margin-right:0!important}.me-md-1{margin-right:.25rem!important}.me-md-2{margin-right:.5rem!important}.me-md-3{margin-right:1rem!important}.me-md-4{margin-right:1.5rem!important}.me-md-5{margin-right:3rem!important}.me-md-auto{margin-right:auto!important}.mb-md-0{margin-bottom:0!important}.mb-md-1{margin-bottom:.25rem!important}.mb-md-2{margin-bottom:.5rem!important}.mb-md-3{margin-bottom:1rem!important}.mb-md-4{margin-bottom:1.5rem!important}.mb-md-5{margin-bottom:3rem!important}.mb-md-auto{margin-bottom:auto!important}.ms-md-0{margin-left:0!important}.ms-md-1{margin-left:.25rem!important}.ms-md-2{margin-left:.5rem!important}.ms-md-3{margin-left:1rem!important}.ms-md-4{margin-left:1.5rem!important}.ms-md-5{margin-left:3rem!important}.ms-md-auto{margin-left:auto!important}.p-md-0{padding:0!important}.p-md-1{padding:.25rem!important}.p-md-2{padding:.5rem!important}.p-md-3{padding:1rem!important}.p-md-4{padding:1.5rem!important}.p-md-5{padding:3rem!important}.px-md-0{padding-right:0!important;padding-left:0!important}.px-md-1{padding-right:.25rem!important;padding-left:.25rem!important}.px-md-2{padding-right:.5rem!important;padding-left:.5rem!important}.px-md-3{padding-right:1rem!important;padding-left:1rem!important}.px-md-4{padding-right:1.5rem!important;padding-left:1.5rem!important}.px-md-5{padding-right:3rem!important;padding-left:3rem!important}.py-md-0{padding-top:0!important;padding-bottom:0!important}.py-md-1{padding-top:.25rem!important;padding-bottom:.25rem!important}.py-md-2{padding-top:.5rem!important;padding-bottom:.5rem!important}.py-md-3{padding-top:1rem!important;padding-bottom:1rem!important}.py-md-4{padding-top:1.5rem!important;padding-bottom:1.5rem!important}.py-md-5{padding-top:3rem!important;padding-bottom:3rem!important}.pt-md-0{padding-top:0!important}.pt-md-1{padding-top:.25rem!important}.pt-md-2{padding-top:.5rem!important}.pt-md-3{padding-top:1rem!important}.pt-md-4{padding-top:1.5rem!important}.pt-md-5{padding-top:3rem!important}.pe-md-0{padding-right:0!important}.pe-md-1{padding-right:.25rem!important}.pe-md-2{padding-right:.5rem!important}.pe-md-3{padding-right:1rem!important}.pe-md-4{padding-right:1.5rem!important}.pe-md-5{padding-right:3rem!important}.pb-md-0{padding-bottom:0!important}.pb-md-1{padding-bottom:.25rem!important}.pb-md-2{padding-bottom:.5rem!important}.pb-md-3{padding-bottom:1rem!important}.pb-md-4{padding-bottom:1.5rem!important}.pb-md-5{padding-bottom:3rem!important}.ps-md-0{padding-left:0!important}.ps-md-1{padding-left:.25rem!important}.ps-md-2{padding-left:.5rem!important}.ps-md-3{padding-left:1rem!important}.ps-md-4{padding-left:1.5rem!important}.ps-md-5{padding-left:3rem!important}.gap-md-0{gap:0!important}.gap-md-1{gap:.25rem!important}.gap-md-2{gap:.5rem!important}.gap-md-3{gap:1rem!important}.gap-md-4{gap:1.5rem!important}.gap-md-5{gap:3rem!important}.row-gap-md-0{row-gap:0!important}.row-gap-md-1{row-gap:.25rem!important}.row-gap-md-2{row-gap:.5rem!important}.row-gap-md-3{row-gap:1rem!important}.row-gap-md-4{row-gap:1.5rem!important}.row-gap-md-5{row-gap:3rem!important}.column-gap-md-0{-moz-column-gap:0!important;column-gap:0!important}.column-gap-md-1{-moz-column-gap:0.25rem!important;column-gap:.25rem!important}.column-gap-md-2{-moz-column-gap:0.5rem!important;column-gap:.5rem!important}.column-gap-md-3{-moz-column-gap:1rem!important;column-gap:1rem!important}.column-gap-md-4{-moz-column-gap:1.5rem!important;column-gap:1.5rem!important}.column-gap-md-5{-moz-column-gap:3rem!important;column-gap:3rem!important}.text-md-start{text-align:left!important}.text-md-end{text-align:right!important}.text-md-center{text-align:center!important}}@media (min-width:992px){.float-lg-start{float:left!important}.float-lg-end{float:right!important}.float-lg-none{float:none!important}.object-fit-lg-contain{-o-object-fit:contain!important;object-fit:contain!important}.object-fit-lg-cover{-o-object-fit:cover!important;object-fit:cover!important}.object-fit-lg-fill{-o-object-fit:fill!important;object-fit:fill!important}.object-fit-lg-scale{-o-object-fit:scale-down!important;object-fit:scale-down!important}.object-fit-lg-none{-o-object-fit:none!important;object-fit:none!important}.d-lg-inline{display:inline!important}.d-lg-inline-block{display:inline-block!important}.d-lg-block{display:block!important}.d-lg-grid{display:grid!important}.d-lg-inline-grid{display:inline-grid!important}.d-lg-table{display:table!important}.d-lg-table-row{display:table-row!important}.d-lg-table-cell{display:table-cell!important}.d-lg-flex{display:flex!important}.d-lg-inline-flex{display:inline-flex!important}.d-lg-none{display:none!important}.flex-lg-fill{flex:1 1 auto!important}.flex-lg-row{flex-direction:row!important}.flex-lg-column{flex-direction:column!important}.flex-lg-row-reverse{flex-direction:row-reverse!important}.flex-lg-column-reverse{flex-direction:column-reverse!important}.flex-lg-grow-0{flex-grow:0!important}.flex-lg-grow-1{flex-grow:1!important}.flex-lg-shrink-0{flex-shrink:0!important}.flex-lg-shrink-1{flex-shrink:1!important}.flex-lg-wrap{flex-wrap:wrap!important}.flex-lg-nowrap{flex-wrap:nowrap!important}.flex-lg-wrap-reverse{flex-wrap:wrap-reverse!important}.justify-content-lg-start{justify-content:flex-start!important}.justify-content-lg-end{justify-content:flex-end!important}.justify-content-lg-center{justify-content:center!important}.justify-content-lg-between{justify-content:space-between!important}.justify-content-lg-around{justify-content:space-around!important}.justify-content-lg-evenly{justify-content:space-evenly!important}.align-items-lg-start{align-items:flex-start!important}.align-items-lg-end{align-items:flex-end!important}.align-items-lg-center{align-items:center!important}.align-items-lg-baseline{align-items:baseline!important}.align-items-lg-stretch{align-items:stretch!important}.align-content-lg-start{align-content:flex-start!important}.align-content-lg-end{align-content:flex-end!important}.align-content-lg-center{align-content:center!important}.align-content-lg-between{align-content:space-between!important}.align-content-lg-around{align-content:space-around!important}.align-content-lg-stretch{align-content:stretch!important}.align-self-lg-auto{align-self:auto!important}.align-self-lg-start{align-self:flex-start!important}.align-self-lg-end{align-self:flex-end!important}.align-self-lg-center{align-self:center!important}.align-self-lg-baseline{align-self:baseline!important}.align-self-lg-stretch{align-self:stretch!important}.order-lg-first{order:-1!important}.order-lg-0{order:0!important}.order-lg-1{order:1!important}.order-lg-2{order:2!important}.order-lg-3{order:3!important}.order-lg-4{order:4!important}.order-lg-5{order:5!important}.order-lg-last{order:6!important}.m-lg-0{margin:0!important}.m-lg-1{margin:.25rem!important}.m-lg-2{margin:.5rem!important}.m-lg-3{margin:1rem!important}.m-lg-4{margin:1.5rem!important}.m-lg-5{margin:3rem!important}.m-lg-auto{margin:auto!important}.mx-lg-0{margin-right:0!important;margin-left:0!important}.mx-lg-1{margin-right:.25rem!important;margin-left:.25rem!important}.mx-lg-2{margin-right:.5rem!important;margin-left:.5rem!important}.mx-lg-3{margin-right:1rem!important;margin-left:1rem!important}.mx-lg-4{margin-right:1.5rem!important;margin-left:1.5rem!important}.mx-lg-5{margin-right:3rem!important;margin-left:3rem!important}.mx-lg-auto{margin-right:auto!important;margin-left:auto!important}.my-lg-0{margin-top:0!important;margin-bottom:0!important}.my-lg-1{margin-top:.25rem!important;margin-bottom:.25rem!important}.my-lg-2{margin-top:.5rem!important;margin-bottom:.5rem!important}.my-lg-3{margin-top:1rem!important;margin-bottom:1rem!important}.my-lg-4{margin-top:1.5rem!important;margin-bottom:1.5rem!important}.my-lg-5{margin-top:3rem!important;margin-bottom:3rem!important}.my-lg-auto{margin-top:auto!important;margin-bottom:auto!important}.mt-lg-0{margin-top:0!important}.mt-lg-1{margin-top:.25rem!important}.mt-lg-2{margin-top:.5rem!important}.mt-lg-3{margin-top:1rem!important}.mt-lg-4{margin-top:1.5rem!important}.mt-lg-5{margin-top:3rem!important}.mt-lg-auto{margin-top:auto!important}.me-lg-0{margin-right:0!important}.me-lg-1{margin-right:.25rem!important}.me-lg-2{margin-right:.5rem!important}.me-lg-3{margin-right:1rem!important}.me-lg-4{margin-right:1.5rem!important}.me-lg-5{margin-right:3rem!important}.me-lg-auto{margin-right:auto!important}.mb-lg-0{margin-bottom:0!important}.mb-lg-1{margin-bottom:.25rem!important}.mb-lg-2{margin-bottom:.5rem!important}.mb-lg-3{margin-bottom:1rem!important}.mb-lg-4{margin-bottom:1.5rem!important}.mb-lg-5{margin-bottom:3rem!important}.mb-lg-auto{margin-bottom:auto!important}.ms-lg-0{margin-left:0!important}.ms-lg-1{margin-left:.25rem!important}.ms-lg-2{margin-left:.5rem!important}.ms-lg-3{margin-left:1rem!important}.ms-lg-4{margin-left:1.5rem!important}.ms-lg-5{margin-left:3rem!important}.ms-lg-auto{margin-left:auto!important}.p-lg-0{padding:0!important}.p-lg-1{padding:.25rem!important}.p-lg-2{padding:.5rem!important}.p-lg-3{padding:1rem!important}.p-lg-4{padding:1.5rem!important}.p-lg-5{padding:3rem!important}.px-lg-0{padding-right:0!important;padding-left:0!important}.px-lg-1{padding-right:.25rem!important;padding-left:.25rem!important}.px-lg-2{padding-right:.5rem!important;padding-left:.5rem!important}.px-lg-3{padding-right:1rem!important;padding-left:1rem!important}.px-lg-4{padding-right:1.5rem!important;padding-left:1.5rem!important}.px-lg-5{padding-right:3rem!important;padding-left:3rem!important}.py-lg-0{padding-top:0!important;padding-bottom:0!important}.py-lg-1{padding-top:.25rem!important;padding-bottom:.25rem!important}.py-lg-2{padding-top:.5rem!important;padding-bottom:.5rem!important}.py-lg-3{padding-top:1rem!important;padding-bottom:1rem!important}.py-lg-4{padding-top:1.5rem!important;padding-bottom:1.5rem!important}.py-lg-5{padding-top:3rem!important;padding-bottom:3rem!important}.pt-lg-0{padding-top:0!important}.pt-lg-1{padding-top:.25rem!important}.pt-lg-2{padding-top:.5rem!important}.pt-lg-3{padding-top:1rem!important}.pt-lg-4{padding-top:1.5rem!important}.pt-lg-5{padding-top:3rem!important}.pe-lg-0{padding-right:0!important}.pe-lg-1{padding-right:.25rem!important}.pe-lg-2{padding-right:.5rem!important}.pe-lg-3{padding-right:1rem!important}.pe-lg-4{padding-right:1.5rem!important}.pe-lg-5{padding-right:3rem!important}.pb-lg-0{padding-bottom:0!important}.pb-lg-1{padding-bottom:.25rem!important}.pb-lg-2{padding-bottom:.5rem!important}.pb-lg-3{padding-bottom:1rem!important}.pb-lg-4{padding-bottom:1.5rem!important}.pb-lg-5{padding-bottom:3rem!important}.ps-lg-0{padding-left:0!important}.ps-lg-1{padding-left:.25rem!important}.ps-lg-2{padding-left:.5rem!important}.ps-lg-3{padding-left:1rem!important}.ps-lg-4{padding-left:1.5rem!important}.ps-lg-5{padding-left:3rem!important}.gap-lg-0{gap:0!important}.gap-lg-1{gap:.25rem!important}.gap-lg-2{gap:.5rem!important}.gap-lg-3{gap:1rem!important}.gap-lg-4{gap:1.5rem!important}.gap-lg-5{gap:3rem!important}.row-gap-lg-0{row-gap:0!important}.row-gap-lg-1{row-gap:.25rem!important}.row-gap-lg-2{row-gap:.5rem!important}.row-gap-lg-3{row-gap:1rem!important}.row-gap-lg-4{row-gap:1.5rem!important}.row-gap-lg-5{row-gap:3rem!important}.column-gap-lg-0{-moz-column-gap:0!important;column-gap:0!important}.column-gap-lg-1{-moz-column-gap:0.25rem!important;column-gap:.25rem!important}.column-gap-lg-2{-moz-column-gap:0.5rem!important;column-gap:.5rem!important}.column-gap-lg-3{-moz-column-gap:1rem!important;column-gap:1rem!important}.column-gap-lg-4{-moz-column-gap:1.5rem!important;column-gap:1.5rem!important}.column-gap-lg-5{-moz-column-gap:3rem!important;column-gap:3rem!important}.text-lg-start{text-align:left!important}.text-lg-end{text-align:right!important}.text-lg-center{text-align:center!important}}@media (min-width:1200px){.float-xl-start{float:left!important}.float-xl-end{float:right!important}.float-xl-none{float:none!important}.object-fit-xl-contain{-o-object-fit:contain!important;object-fit:contain!important}.object-fit-xl-cover{-o-object-fit:cover!important;object-fit:cover!important}.object-fit-xl-fill{-o-object-fit:fill!important;object-fit:fill!important}.object-fit-xl-scale{-o-object-fit:scale-down!important;object-fit:scale-down!important}.object-fit-xl-none{-o-object-fit:none!important;object-fit:none!important}.d-xl-inline{display:inline!important}.d-xl-inline-block{display:inline-block!important}.d-xl-block{display:block!important}.d-xl-grid{display:grid!important}.d-xl-inline-grid{display:inline-grid!important}.d-xl-table{display:table!important}.d-xl-table-row{display:table-row!important}.d-xl-table-cell{display:table-cell!important}.d-xl-flex{display:flex!important}.d-xl-inline-flex{display:inline-flex!important}.d-xl-none{display:none!important}.flex-xl-fill{flex:1 1 auto!important}.flex-xl-row{flex-direction:row!important}.flex-xl-column{flex-direction:column!important}.flex-xl-row-reverse{flex-direction:row-reverse!important}.flex-xl-column-reverse{flex-direction:column-reverse!important}.flex-xl-grow-0{flex-grow:0!important}.flex-xl-grow-1{flex-grow:1!important}.flex-xl-shrink-0{flex-shrink:0!important}.flex-xl-shrink-1{flex-shrink:1!important}.flex-xl-wrap{flex-wrap:wrap!important}.flex-xl-nowrap{flex-wrap:nowrap!important}.flex-xl-wrap-reverse{flex-wrap:wrap-reverse!important}.justify-content-xl-start{justify-content:flex-start!important}.justify-content-xl-end{justify-content:flex-end!important}.justify-content-xl-center{justify-content:center!important}.justify-content-xl-between{justify-content:space-between!important}.justify-content-xl-around{justify-content:space-around!important}.justify-content-xl-evenly{justify-content:space-evenly!important}.align-items-xl-start{align-items:flex-start!important}.align-items-xl-end{align-items:flex-end!important}.align-items-xl-center{align-items:center!important}.align-items-xl-baseline{align-items:baseline!important}.align-items-xl-stretch{align-items:stretch!important}.align-content-xl-start{align-content:flex-start!important}.align-content-xl-end{align-content:flex-end!important}.align-content-xl-center{align-content:center!important}.align-content-xl-between{align-content:space-between!important}.align-content-xl-around{align-content:space-around!important}.align-content-xl-stretch{align-content:stretch!important}.align-self-xl-auto{align-self:auto!important}.align-self-xl-start{align-self:flex-start!important}.align-self-xl-end{align-self:flex-end!important}.align-self-xl-center{align-self:center!important}.align-self-xl-baseline{align-self:baseline!important}.align-self-xl-stretch{align-self:stretch!important}.order-xl-first{order:-1!important}.order-xl-0{order:0!important}.order-xl-1{order:1!important}.order-xl-2{order:2!important}.order-xl-3{order:3!important}.order-xl-4{order:4!important}.order-xl-5{order:5!important}.order-xl-last{order:6!important}.m-xl-0{margin:0!important}.m-xl-1{margin:.25rem!important}.m-xl-2{margin:.5rem!important}.m-xl-3{margin:1rem!important}.m-xl-4{margin:1.5rem!important}.m-xl-5{margin:3rem!important}.m-xl-auto{margin:auto!important}.mx-xl-0{margin-right:0!important;margin-left:0!important}.mx-xl-1{margin-right:.25rem!important;margin-left:.25rem!important}.mx-xl-2{margin-right:.5rem!important;margin-left:.5rem!important}.mx-xl-3{margin-right:1rem!important;margin-left:1rem!important}.mx-xl-4{margin-right:1.5rem!important;margin-left:1.5rem!important}.mx-xl-5{margin-right:3rem!important;margin-left:3rem!important}.mx-xl-auto{margin-right:auto!important;margin-left:auto!important}.my-xl-0{margin-top:0!important;margin-bottom:0!important}.my-xl-1{margin-top:.25rem!important;margin-bottom:.25rem!important}.my-xl-2{margin-top:.5rem!important;margin-bottom:.5rem!important}.my-xl-3{margin-top:1rem!important;margin-bottom:1rem!important}.my-xl-4{margin-top:1.5rem!important;margin-bottom:1.5rem!important}.my-xl-5{margin-top:3rem!important;margin-bottom:3rem!important}.my-xl-auto{margin-top:auto!important;margin-bottom:auto!important}.mt-xl-0{margin-top:0!important}.mt-xl-1{margin-top:.25rem!important}.mt-xl-2{margin-top:.5rem!important}.mt-xl-3{margin-top:1rem!important}.mt-xl-4{margin-top:1.5rem!important}.mt-xl-5{margin-top:3rem!important}.mt-xl-auto{margin-top:auto!important}.me-xl-0{margin-right:0!important}.me-xl-1{margin-right:.25rem!important}.me-xl-2{margin-right:.5rem!important}.me-xl-3{margin-right:1rem!important}.me-xl-4{margin-right:1.5rem!important}.me-xl-5{margin-right:3rem!important}.me-xl-auto{margin-right:auto!important}.mb-xl-0{margin-bottom:0!important}.mb-xl-1{margin-bottom:.25rem!important}.mb-xl-2{margin-bottom:.5rem!important}.mb-xl-3{margin-bottom:1rem!important}.mb-xl-4{margin-bottom:1.5rem!important}.mb-xl-5{margin-bottom:3rem!important}.mb-xl-auto{margin-bottom:auto!important}.ms-xl-0{margin-left:0!important}.ms-xl-1{margin-left:.25rem!important}.ms-xl-2{margin-left:.5rem!important}.ms-xl-3{margin-left:1rem!important}.ms-xl-4{margin-left:1.5rem!important}.ms-xl-5{margin-left:3rem!important}.ms-xl-auto{margin-left:auto!important}.p-xl-0{padding:0!important}.p-xl-1{padding:.25rem!important}.p-xl-2{padding:.5rem!important}.p-xl-3{padding:1rem!important}.p-xl-4{padding:1.5rem!important}.p-xl-5{padding:3rem!important}.px-xl-0{padding-right:0!important;padding-left:0!important}.px-xl-1{padding-right:.25rem!important;padding-left:.25rem!important}.px-xl-2{padding-right:.5rem!important;padding-left:.5rem!important}.px-xl-3{padding-right:1rem!important;padding-left:1rem!important}.px-xl-4{padding-right:1.5rem!important;padding-left:1.5rem!important}.px-xl-5{padding-right:3rem!important;padding-left:3rem!important}.py-xl-0{padding-top:0!important;padding-bottom:0!important}.py-xl-1{padding-top:.25rem!important;padding-bottom:.25rem!important}.py-xl-2{padding-top:.5rem!important;padding-bottom:.5rem!important}.py-xl-3{padding-top:1rem!important;padding-bottom:1rem!important}.py-xl-4{padding-top:1.5rem!important;padding-bottom:1.5rem!important}.py-xl-5{padding-top:3rem!important;padding-bottom:3rem!important}.pt-xl-0{padding-top:0!important}.pt-xl-1{padding-top:.25rem!important}.pt-xl-2{padding-top:.5rem!important}.pt-xl-3{padding-top:1rem!important}.pt-xl-4{padding-top:1.5rem!important}.pt-xl-5{padding-top:3rem!important}.pe-xl-0{padding-right:0!important}.pe-xl-1{padding-right:.25rem!important}.pe-xl-2{padding-right:.5rem!important}.pe-xl-3{padding-right:1rem!important}.pe-xl-4{padding-right:1.5rem!important}.pe-xl-5{padding-right:3rem!important}.pb-xl-0{padding-bottom:0!important}.pb-xl-1{padding-bottom:.25rem!important}.pb-xl-2{padding-bottom:.5rem!important}.pb-xl-3{padding-bottom:1rem!important}.pb-xl-4{padding-bottom:1.5rem!important}.pb-xl-5{padding-bottom:3rem!important}.ps-xl-0{padding-left:0!important}.ps-xl-1{padding-left:.25rem!important}.ps-xl-2{padding-left:.5rem!important}.ps-xl-3{padding-left:1rem!important}.ps-xl-4{padding-left:1.5rem!important}.ps-xl-5{padding-left:3rem!important}.gap-xl-0{gap:0!important}.gap-xl-1{gap:.25rem!important}.gap-xl-2{gap:.5rem!important}.gap-xl-3{gap:1rem!important}.gap-xl-4{gap:1.5rem!important}.gap-xl-5{gap:3rem!important}.row-gap-xl-0{row-gap:0!important}.row-gap-xl-1{row-gap:.25rem!important}.row-gap-xl-2{row-gap:.5rem!important}.row-gap-xl-3{row-gap:1rem!important}.row-gap-xl-4{row-gap:1.5rem!important}.row-gap-xl-5{row-gap:3rem!important}.column-gap-xl-0{-moz-column-gap:0!important;column-gap:0!important}.column-gap-xl-1{-moz-column-gap:0.25rem!important;column-gap:.25rem!important}.column-gap-xl-2{-moz-column-gap:0.5rem!important;column-gap:.5rem!important}.column-gap-xl-3{-moz-column-gap:1rem!important;column-gap:1rem!important}.column-gap-xl-4{-moz-column-gap:1.5rem!important;column-gap:1.5rem!important}.column-gap-xl-5{-moz-column-gap:3rem!important;column-gap:3rem!important}.text-xl-start{text-align:left!important}.text-xl-end{text-align:right!important}.text-xl-center{text-align:center!important}}@media (min-width:1400px){.float-xxl-start{float:left!important}.float-xxl-end{float:right!important}.float-xxl-none{float:none!important}.object-fit-xxl-contain{-o-object-fit:contain!important;object-fit:contain!important}.object-fit-xxl-cover{-o-object-fit:cover!important;object-fit:cover!important}.object-fit-xxl-fill{-o-object-fit:fill!important;object-fit:fill!important}.object-fit-xxl-scale{-o-object-fit:scale-down!important;object-fit:scale-down!important}.object-fit-xxl-none{-o-object-fit:none!important;object-fit:none!important}.d-xxl-inline{display:inline!important}.d-xxl-inline-block{display:inline-block!important}.d-xxl-block{display:block!important}.d-xxl-grid{display:grid!important}.d-xxl-inline-grid{display:inline-grid!important}.d-xxl-table{display:table!important}.d-xxl-table-row{display:table-row!important}.d-xxl-table-cell{display:table-cell!important}.d-xxl-flex{display:flex!important}.d-xxl-inline-flex{display:inline-flex!important}.d-xxl-none{display:none!important}.flex-xxl-fill{flex:1 1 auto!important}.flex-xxl-row{flex-direction:row!important}.flex-xxl-column{flex-direction:column!important}.flex-xxl-row-reverse{flex-direction:row-reverse!important}.flex-xxl-column-reverse{flex-direction:column-reverse!important}.flex-xxl-grow-0{flex-grow:0!important}.flex-xxl-grow-1{flex-grow:1!important}.flex-xxl-shrink-0{flex-shrink:0!important}.flex-xxl-shrink-1{flex-shrink:1!important}.flex-xxl-wrap{flex-wrap:wrap!important}.flex-xxl-nowrap{flex-wrap:nowrap!important}.flex-xxl-wrap-reverse{flex-wrap:wrap-reverse!important}.justify-content-xxl-start{justify-content:flex-start!important}.justify-content-xxl-end{justify-content:flex-end!important}.justify-content-xxl-center{justify-content:center!important}.justify-content-xxl-between{justify-content:space-between!important}.justify-content-xxl-around{justify-content:space-around!important}.justify-content-xxl-evenly{justify-content:space-evenly!important}.align-items-xxl-start{align-items:flex-start!important}.align-items-xxl-end{align-items:flex-end!important}.align-items-xxl-center{align-items:center!important}.align-items-xxl-baseline{align-items:baseline!important}.align-items-xxl-stretch{align-items:stretch!important}.align-content-xxl-start{align-content:flex-start!important}.align-content-xxl-end{align-content:flex-end!important}.align-content-xxl-center{align-content:center!important}.align-content-xxl-between{align-content:space-between!important}.align-content-xxl-around{align-content:space-around!important}.align-content-xxl-stretch{align-content:stretch!important}.align-self-xxl-auto{align-self:auto!important}.align-self-xxl-start{align-self:flex-start!important}.align-self-xxl-end{align-self:flex-end!important}.align-self-xxl-center{align-self:center!important}.align-self-xxl-baseline{align-self:baseline!important}.align-self-xxl-stretch{align-self:stretch!important}.order-xxl-first{order:-1!important}.order-xxl-0{order:0!important}.order-xxl-1{order:1!important}.order-xxl-2{order:2!important}.order-xxl-3{order:3!important}.order-xxl-4{order:4!important}.order-xxl-5{order:5!important}.order-xxl-last{order:6!important}.m-xxl-0{margin:0!important}.m-xxl-1{margin:.25rem!important}.m-xxl-2{margin:.5rem!important}.m-xxl-3{margin:1rem!important}.m-xxl-4{margin:1.5rem!important}.m-xxl-5{margin:3rem!important}.m-xxl-auto{margin:auto!important}.mx-xxl-0{margin-right:0!important;margin-left:0!important}.mx-xxl-1{margin-right:.25rem!important;margin-left:.25rem!important}.mx-xxl-2{margin-right:.5rem!important;margin-left:.5rem!important}.mx-xxl-3{margin-right:1rem!important;margin-left:1rem!important}.mx-xxl-4{margin-right:1.5rem!important;margin-left:1.5rem!important}.mx-xxl-5{margin-right:3rem!important;margin-left:3rem!important}.mx-xxl-auto{margin-right:auto!important;margin-left:auto!important}.my-xxl-0{margin-top:0!important;margin-bottom:0!important}.my-xxl-1{margin-top:.25rem!important;margin-bottom:.25rem!important}.my-xxl-2{margin-top:.5rem!important;margin-bottom:.5rem!important}.my-xxl-3{margin-top:1rem!important;margin-bottom:1rem!important}.my-xxl-4{margin-top:1.5rem!important;margin-bottom:1.5rem!important}.my-xxl-5{margin-top:3rem!important;margin-bottom:3rem!important}.my-xxl-auto{margin-top:auto!important;margin-bottom:auto!important}.mt-xxl-0{margin-top:0!important}.mt-xxl-1{margin-top:.25rem!important}.mt-xxl-2{margin-top:.5rem!important}.mt-xxl-3{margin-top:1rem!important}.mt-xxl-4{margin-top:1.5rem!important}.mt-xxl-5{margin-top:3rem!important}.mt-xxl-auto{margin-top:auto!important}.me-xxl-0{margin-right:0!important}.me-xxl-1{margin-right:.25rem!important}.me-xxl-2{margin-right:.5rem!important}.me-xxl-3{margin-right:1rem!important}.me-xxl-4{margin-right:1.5rem!important}.me-xxl-5{margin-right:3rem!important}.me-xxl-auto{margin-right:auto!important}.mb-xxl-0{margin-bottom:0!important}.mb-xxl-1{margin-bottom:.25rem!important}.mb-xxl-2{margin-bottom:.5rem!important}.mb-xxl-3{margin-bottom:1rem!important}.mb-xxl-4{margin-bottom:1.5rem!important}.mb-xxl-5{margin-bottom:3rem!important}.mb-xxl-auto{margin-bottom:auto!important}.ms-xxl-0{margin-left:0!important}.ms-xxl-1{margin-left:.25rem!important}.ms-xxl-2{margin-left:.5rem!important}.ms-xxl-3{margin-left:1rem!important}.ms-xxl-4{margin-left:1.5rem!important}.ms-xxl-5{margin-left:3rem!important}.ms-xxl-auto{margin-left:auto!important}.p-xxl-0{padding:0!important}.p-xxl-1{padding:.25rem!important}.p-xxl-2{padding:.5rem!important}.p-xxl-3{padding:1rem!important}.p-xxl-4{padding:1.5rem!important}.p-xxl-5{padding:3rem!important}.px-xxl-0{padding-right:0!important;padding-left:0!important}.px-xxl-1{padding-right:.25rem!important;padding-left:.25rem!important}.px-xxl-2{padding-right:.5rem!important;padding-left:.5rem!important}.px-xxl-3{padding-right:1rem!important;padding-left:1rem!important}.px-xxl-4{padding-right:1.5rem!important;padding-left:1.5rem!important}.px-xxl-5{padding-right:3rem!important;padding-left:3rem!important}.py-xxl-0{padding-top:0!important;padding-bottom:0!important}.py-xxl-1{padding-top:.25rem!important;padding-bottom:.25rem!important}.py-xxl-2{padding-top:.5rem!important;padding-bottom:.5rem!important}.py-xxl-3{padding-top:1rem!important;padding-bottom:1rem!important}.py-xxl-4{padding-top:1.5rem!important;padding-bottom:1.5rem!important}.py-xxl-5{padding-top:3rem!important;padding-bottom:3rem!important}.pt-xxl-0{padding-top:0!important}.pt-xxl-1{padding-top:.25rem!important}.pt-xxl-2{padding-top:.5rem!important}.pt-xxl-3{padding-top:1rem!important}.pt-xxl-4{padding-top:1.5rem!important}.pt-xxl-5{padding-top:3rem!important}.pe-xxl-0{padding-right:0!important}.pe-xxl-1{padding-right:.25rem!important}.pe-xxl-2{padding-right:.5rem!important}.pe-xxl-3{padding-right:1rem!important}.pe-xxl-4{padding-right:1.5rem!important}.pe-xxl-5{padding-right:3rem!important}.pb-xxl-0{padding-bottom:0!important}.pb-xxl-1{padding-bottom:.25rem!important}.pb-xxl-2{padding-bottom:.5rem!important}.pb-xxl-3{padding-bottom:1rem!important}.pb-xxl-4{padding-bottom:1.5rem!important}.pb-xxl-5{padding-bottom:3rem!important}.ps-xxl-0{padding-left:0!important}.ps-xxl-1{padding-left:.25rem!important}.ps-xxl-2{padding-left:.5rem!important}.ps-xxl-3{padding-left:1rem!important}.ps-xxl-4{padding-left:1.5rem!important}.ps-xxl-5{padding-left:3rem!important}.gap-xxl-0{gap:0!important}.gap-xxl-1{gap:.25rem!important}.gap-xxl-2{gap:.5rem!important}.gap-xxl-3{gap:1rem!important}.gap-xxl-4{gap:1.5rem!important}.gap-xxl-5{gap:3rem!important}.row-gap-xxl-0{row-gap:0!important}.row-gap-xxl-1{row-gap:.25rem!important}.row-gap-xxl-2{row-gap:.5rem!important}.row-gap-xxl-3{row-gap:1rem!important}.row-gap-xxl-4{row-gap:1.5rem!important}.row-gap-xxl-5{row-gap:3rem!important}.column-gap-xxl-0{-moz-column-gap:0!important;column-gap:0!important}.column-gap-xxl-1{-moz-column-gap:0.25rem!important;column-gap:.25rem!important}.column-gap-xxl-2{-moz-column-gap:0.5rem!important;column-gap:.5rem!important}.column-gap-xxl-3{-moz-column-gap:1rem!important;column-gap:1rem!important}.column-gap-xxl-4{-moz-column-gap:1.5rem!important;column-gap:1.5rem!important}.column-gap-xxl-5{-moz-column-gap:3rem!important;column-gap:3rem!important}.text-xxl-start{text-align:left!important}.text-xxl-end{text-align:right!important}.text-xxl-center{text-align:center!important}}@media (min-width:1200px){.fs-1{font-size:2.5rem!important}.fs-2{font-size:2rem!important}.fs-3{font-size:1.75rem!important}.fs-4{font-size:1.5rem!important}}@media print{.d-print-inline{display:inline!important}.d-print-inline-block{display:inline-block!important}.d-print-block{display:block!important}.d-print-grid{display:grid!important}.d-print-inline-grid{display:inline-grid!important}.d-print-table{display:table!important}.d-print-table-row{display:table-row!important}.d-print-table-cell{display:table-cell!important}.d-print-flex{display:flex!important}.d-print-inline-flex{display:inline-flex!important}.d-print-none{display:none!important}}
+/*# sourceMappingURL=bootstrap.min.css.map */
\ No newline at end of file
diff --git a/src/BCards.Web/wwwroot/lib/bootstrap/js/bootstrap.bundle.js b/src/BCards.Web/wwwroot/lib/bootstrap/js/bootstrap.bundle.js
new file mode 100644
index 0000000..37e6f95
--- /dev/null
+++ b/src/BCards.Web/wwwroot/lib/bootstrap/js/bootstrap.bundle.js
@@ -0,0 +1,6314 @@
+/*!
+  * Bootstrap v5.3.2 (https://getbootstrap.com/)
+  * Copyright 2011-2023 The Bootstrap Authors (https://github.com/twbs/bootstrap/graphs/contributors)
+  * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)
+  */
+(function (global, factory) {
+  typeof exports === 'object' && typeof module !== 'undefined' ? module.exports = factory() :
+  typeof define === 'function' && define.amd ? define(factory) :
+  (global = typeof globalThis !== 'undefined' ? globalThis : global || self, global.bootstrap = factory());
+})(this, (function () { 'use strict';
+
+  /**
+   * --------------------------------------------------------------------------
+   * Bootstrap dom/data.js
+   * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)
+   * --------------------------------------------------------------------------
+   */
+
+  /**
+   * Constants
+   */
+
+  const elementMap = new Map();
+  const Data = {
+    set(element, key, instance) {
+      if (!elementMap.has(element)) {
+        elementMap.set(element, new Map());
+      }
+      const instanceMap = elementMap.get(element);
+
+      // make it clear we only want one instance per element
+      // can be removed later when multiple key/instances are fine to be used
+      if (!instanceMap.has(key) && instanceMap.size !== 0) {
+        // eslint-disable-next-line no-console
+        console.error(`Bootstrap doesn't allow more than one instance per element. Bound instance: ${Array.from(instanceMap.keys())[0]}.`);
+        return;
+      }
+      instanceMap.set(key, instance);
+    },
+    get(element, key) {
+      if (elementMap.has(element)) {
+        return elementMap.get(element).get(key) || null;
+      }
+      return null;
+    },
+    remove(element, key) {
+      if (!elementMap.has(element)) {
+        return;
+      }
+      const instanceMap = elementMap.get(element);
+      instanceMap.delete(key);
+
+      // free up element references if there are no instances left for an element
+      if (instanceMap.size === 0) {
+        elementMap.delete(element);
+      }
+    }
+  };
+
+  /**
+   * --------------------------------------------------------------------------
+   * Bootstrap util/index.js
+   * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)
+   * --------------------------------------------------------------------------
+   */
+
+  const MAX_UID = 1000000;
+  const MILLISECONDS_MULTIPLIER = 1000;
+  const TRANSITION_END = 'transitionend';
+
+  /**
+   * Properly escape IDs selectors to handle weird IDs
+   * @param {string} selector
+   * @returns {string}
+   */
+  const parseSelector = selector => {
+    if (selector && window.CSS && window.CSS.escape) {
+      // document.querySelector needs escaping to handle IDs (html5+) containing for instance /
+      selector = selector.replace(/#([^\s"#']+)/g, (match, id) => `#${CSS.escape(id)}`);
+    }
+    return selector;
+  };
+
+  // Shout-out Angus Croll (https://goo.gl/pxwQGp)
+  const toType = object => {
+    if (object === null || object === undefined) {
+      return `${object}`;
+    }
+    return Object.prototype.toString.call(object).match(/\s([a-z]+)/i)[1].toLowerCase();
+  };
+
+  /**
+   * Public Util API
+   */
+
+  const getUID = prefix => {
+    do {
+      prefix += Math.floor(Math.random() * MAX_UID);
+    } while (document.getElementById(prefix));
+    return prefix;
+  };
+  const getTransitionDurationFromElement = element => {
+    if (!element) {
+      return 0;
+    }
+
+    // Get transition-duration of the element
+    let {
+      transitionDuration,
+      transitionDelay
+    } = window.getComputedStyle(element);
+    const floatTransitionDuration = Number.parseFloat(transitionDuration);
+    const floatTransitionDelay = Number.parseFloat(transitionDelay);
+
+    // Return 0 if element or transition duration is not found
+    if (!floatTransitionDuration && !floatTransitionDelay) {
+      return 0;
+    }
+
+    // If multiple durations are defined, take the first
+    transitionDuration = transitionDuration.split(',')[0];
+    transitionDelay = transitionDelay.split(',')[0];
+    return (Number.parseFloat(transitionDuration) + Number.parseFloat(transitionDelay)) * MILLISECONDS_MULTIPLIER;
+  };
+  const triggerTransitionEnd = element => {
+    element.dispatchEvent(new Event(TRANSITION_END));
+  };
+  const isElement$1 = object => {
+    if (!object || typeof object !== 'object') {
+      return false;
+    }
+    if (typeof object.jquery !== 'undefined') {
+      object = object[0];
+    }
+    return typeof object.nodeType !== 'undefined';
+  };
+  const getElement = object => {
+    // it's a jQuery object or a node element
+    if (isElement$1(object)) {
+      return object.jquery ? object[0] : object;
+    }
+    if (typeof object === 'string' && object.length > 0) {
+      return document.querySelector(parseSelector(object));
+    }
+    return null;
+  };
+  const isVisible = element => {
+    if (!isElement$1(element) || element.getClientRects().length === 0) {
+      return false;
+    }
+    const elementIsVisible = getComputedStyle(element).getPropertyValue('visibility') === 'visible';
+    // Handle `details` element as its content may falsie appear visible when it is closed
+    const closedDetails = element.closest('details:not([open])');
+    if (!closedDetails) {
+      return elementIsVisible;
+    }
+    if (closedDetails !== element) {
+      const summary = element.closest('summary');
+      if (summary && summary.parentNode !== closedDetails) {
+        return false;
+      }
+      if (summary === null) {
+        return false;
+      }
+    }
+    return elementIsVisible;
+  };
+  const isDisabled = element => {
+    if (!element || element.nodeType !== Node.ELEMENT_NODE) {
+      return true;
+    }
+    if (element.classList.contains('disabled')) {
+      return true;
+    }
+    if (typeof element.disabled !== 'undefined') {
+      return element.disabled;
+    }
+    return element.hasAttribute('disabled') && element.getAttribute('disabled') !== 'false';
+  };
+  const findShadowRoot = element => {
+    if (!document.documentElement.attachShadow) {
+      return null;
+    }
+
+    // Can find the shadow root otherwise it'll return the document
+    if (typeof element.getRootNode === 'function') {
+      const root = element.getRootNode();
+      return root instanceof ShadowRoot ? root : null;
+    }
+    if (element instanceof ShadowRoot) {
+      return element;
+    }
+
+    // when we don't find a shadow root
+    if (!element.parentNode) {
+      return null;
+    }
+    return findShadowRoot(element.parentNode);
+  };
+  const noop = () => {};
+
+  /**
+   * Trick to restart an element's animation
+   *
+   * @param {HTMLElement} element
+   * @return void
+   *
+   * @see https://www.charistheo.io/blog/2021/02/restart-a-css-animation-with-javascript/#restarting-a-css-animation
+   */
+  const reflow = element => {
+    element.offsetHeight; // eslint-disable-line no-unused-expressions
+  };
+
+  const getjQuery = () => {
+    if (window.jQuery && !document.body.hasAttribute('data-bs-no-jquery')) {
+      return window.jQuery;
+    }
+    return null;
+  };
+  const DOMContentLoadedCallbacks = [];
+  const onDOMContentLoaded = callback => {
+    if (document.readyState === 'loading') {
+      // add listener on the first call when the document is in loading state
+      if (!DOMContentLoadedCallbacks.length) {
+        document.addEventListener('DOMContentLoaded', () => {
+          for (const callback of DOMContentLoadedCallbacks) {
+            callback();
+          }
+        });
+      }
+      DOMContentLoadedCallbacks.push(callback);
+    } else {
+      callback();
+    }
+  };
+  const isRTL = () => document.documentElement.dir === 'rtl';
+  const defineJQueryPlugin = plugin => {
+    onDOMContentLoaded(() => {
+      const $ = getjQuery();
+      /* istanbul ignore if */
+      if ($) {
+        const name = plugin.NAME;
+        const JQUERY_NO_CONFLICT = $.fn[name];
+        $.fn[name] = plugin.jQueryInterface;
+        $.fn[name].Constructor = plugin;
+        $.fn[name].noConflict = () => {
+          $.fn[name] = JQUERY_NO_CONFLICT;
+          return plugin.jQueryInterface;
+        };
+      }
+    });
+  };
+  const execute = (possibleCallback, args = [], defaultValue = possibleCallback) => {
+    return typeof possibleCallback === 'function' ? possibleCallback(...args) : defaultValue;
+  };
+  const executeAfterTransition = (callback, transitionElement, waitForTransition = true) => {
+    if (!waitForTransition) {
+      execute(callback);
+      return;
+    }
+    const durationPadding = 5;
+    const emulatedDuration = getTransitionDurationFromElement(transitionElement) + durationPadding;
+    let called = false;
+    const handler = ({
+      target
+    }) => {
+      if (target !== transitionElement) {
+        return;
+      }
+      called = true;
+      transitionElement.removeEventListener(TRANSITION_END, handler);
+      execute(callback);
+    };
+    transitionElement.addEventListener(TRANSITION_END, handler);
+    setTimeout(() => {
+      if (!called) {
+        triggerTransitionEnd(transitionElement);
+      }
+    }, emulatedDuration);
+  };
+
+  /**
+   * Return the previous/next element of a list.
+   *
+   * @param {array} list    The list of elements
+   * @param activeElement   The active element
+   * @param shouldGetNext   Choose to get next or previous element
+   * @param isCycleAllowed
+   * @return {Element|elem} The proper element
+   */
+  const getNextActiveElement = (list, activeElement, shouldGetNext, isCycleAllowed) => {
+    const listLength = list.length;
+    let index = list.indexOf(activeElement);
+
+    // if the element does not exist in the list return an element
+    // depending on the direction and if cycle is allowed
+    if (index === -1) {
+      return !shouldGetNext && isCycleAllowed ? list[listLength - 1] : list[0];
+    }
+    index += shouldGetNext ? 1 : -1;
+    if (isCycleAllowed) {
+      index = (index + listLength) % listLength;
+    }
+    return list[Math.max(0, Math.min(index, listLength - 1))];
+  };
+
+  /**
+   * --------------------------------------------------------------------------
+   * Bootstrap dom/event-handler.js
+   * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)
+   * --------------------------------------------------------------------------
+   */
+
+
+  /**
+   * Constants
+   */
+
+  const namespaceRegex = /[^.]*(?=\..*)\.|.*/;
+  const stripNameRegex = /\..*/;
+  const stripUidRegex = /::\d+$/;
+  const eventRegistry = {}; // Events storage
+  let uidEvent = 1;
+  const customEvents = {
+    mouseenter: 'mouseover',
+    mouseleave: 'mouseout'
+  };
+  const nativeEvents = new Set(['click', 'dblclick', 'mouseup', 'mousedown', 'contextmenu', 'mousewheel', 'DOMMouseScroll', 'mouseover', 'mouseout', 'mousemove', 'selectstart', 'selectend', 'keydown', 'keypress', 'keyup', 'orientationchange', 'touchstart', 'touchmove', 'touchend', 'touchcancel', 'pointerdown', 'pointermove', 'pointerup', 'pointerleave', 'pointercancel', 'gesturestart', 'gesturechange', 'gestureend', 'focus', 'blur', 'change', 'reset', 'select', 'submit', 'focusin', 'focusout', 'load', 'unload', 'beforeunload', 'resize', 'move', 'DOMContentLoaded', 'readystatechange', 'error', 'abort', 'scroll']);
+
+  /**
+   * Private methods
+   */
+
+  function makeEventUid(element, uid) {
+    return uid && `${uid}::${uidEvent++}` || element.uidEvent || uidEvent++;
+  }
+  function getElementEvents(element) {
+    const uid = makeEventUid(element);
+    element.uidEvent = uid;
+    eventRegistry[uid] = eventRegistry[uid] || {};
+    return eventRegistry[uid];
+  }
+  function bootstrapHandler(element, fn) {
+    return function handler(event) {
+      hydrateObj(event, {
+        delegateTarget: element
+      });
+      if (handler.oneOff) {
+        EventHandler.off(element, event.type, fn);
+      }
+      return fn.apply(element, [event]);
+    };
+  }
+  function bootstrapDelegationHandler(element, selector, fn) {
+    return function handler(event) {
+      const domElements = element.querySelectorAll(selector);
+      for (let {
+        target
+      } = event; target && target !== this; target = target.parentNode) {
+        for (const domElement of domElements) {
+          if (domElement !== target) {
+            continue;
+          }
+          hydrateObj(event, {
+            delegateTarget: target
+          });
+          if (handler.oneOff) {
+            EventHandler.off(element, event.type, selector, fn);
+          }
+          return fn.apply(target, [event]);
+        }
+      }
+    };
+  }
+  function findHandler(events, callable, delegationSelector = null) {
+    return Object.values(events).find(event => event.callable === callable && event.delegationSelector === delegationSelector);
+  }
+  function normalizeParameters(originalTypeEvent, handler, delegationFunction) {
+    const isDelegated = typeof handler === 'string';
+    // TODO: tooltip passes `false` instead of selector, so we need to check
+    const callable = isDelegated ? delegationFunction : handler || delegationFunction;
+    let typeEvent = getTypeEvent(originalTypeEvent);
+    if (!nativeEvents.has(typeEvent)) {
+      typeEvent = originalTypeEvent;
+    }
+    return [isDelegated, callable, typeEvent];
+  }
+  function addHandler(element, originalTypeEvent, handler, delegationFunction, oneOff) {
+    if (typeof originalTypeEvent !== 'string' || !element) {
+      return;
+    }
+    let [isDelegated, callable, typeEvent] = normalizeParameters(originalTypeEvent, handler, delegationFunction);
+
+    // in case of mouseenter or mouseleave wrap the handler within a function that checks for its DOM position
+    // this prevents the handler from being dispatched the same way as mouseover or mouseout does
+    if (originalTypeEvent in customEvents) {
+      const wrapFunction = fn => {
+        return function (event) {
+          if (!event.relatedTarget || event.relatedTarget !== event.delegateTarget && !event.delegateTarget.contains(event.relatedTarget)) {
+            return fn.call(this, event);
+          }
+        };
+      };
+      callable = wrapFunction(callable);
+    }
+    const events = getElementEvents(element);
+    const handlers = events[typeEvent] || (events[typeEvent] = {});
+    const previousFunction = findHandler(handlers, callable, isDelegated ? handler : null);
+    if (previousFunction) {
+      previousFunction.oneOff = previousFunction.oneOff && oneOff;
+      return;
+    }
+    const uid = makeEventUid(callable, originalTypeEvent.replace(namespaceRegex, ''));
+    const fn = isDelegated ? bootstrapDelegationHandler(element, handler, callable) : bootstrapHandler(element, callable);
+    fn.delegationSelector = isDelegated ? handler : null;
+    fn.callable = callable;
+    fn.oneOff = oneOff;
+    fn.uidEvent = uid;
+    handlers[uid] = fn;
+    element.addEventListener(typeEvent, fn, isDelegated);
+  }
+  function removeHandler(element, events, typeEvent, handler, delegationSelector) {
+    const fn = findHandler(events[typeEvent], handler, delegationSelector);
+    if (!fn) {
+      return;
+    }
+    element.removeEventListener(typeEvent, fn, Boolean(delegationSelector));
+    delete events[typeEvent][fn.uidEvent];
+  }
+  function removeNamespacedHandlers(element, events, typeEvent, namespace) {
+    const storeElementEvent = events[typeEvent] || {};
+    for (const [handlerKey, event] of Object.entries(storeElementEvent)) {
+      if (handlerKey.includes(namespace)) {
+        removeHandler(element, events, typeEvent, event.callable, event.delegationSelector);
+      }
+    }
+  }
+  function getTypeEvent(event) {
+    // allow to get the native events from namespaced events ('click.bs.button' --> 'click')
+    event = event.replace(stripNameRegex, '');
+    return customEvents[event] || event;
+  }
+  const EventHandler = {
+    on(element, event, handler, delegationFunction) {
+      addHandler(element, event, handler, delegationFunction, false);
+    },
+    one(element, event, handler, delegationFunction) {
+      addHandler(element, event, handler, delegationFunction, true);
+    },
+    off(element, originalTypeEvent, handler, delegationFunction) {
+      if (typeof originalTypeEvent !== 'string' || !element) {
+        return;
+      }
+      const [isDelegated, callable, typeEvent] = normalizeParameters(originalTypeEvent, handler, delegationFunction);
+      const inNamespace = typeEvent !== originalTypeEvent;
+      const events = getElementEvents(element);
+      const storeElementEvent = events[typeEvent] || {};
+      const isNamespace = originalTypeEvent.startsWith('.');
+      if (typeof callable !== 'undefined') {
+        // Simplest case: handler is passed, remove that listener ONLY.
+        if (!Object.keys(storeElementEvent).length) {
+          return;
+        }
+        removeHandler(element, events, typeEvent, callable, isDelegated ? handler : null);
+        return;
+      }
+      if (isNamespace) {
+        for (const elementEvent of Object.keys(events)) {
+          removeNamespacedHandlers(element, events, elementEvent, originalTypeEvent.slice(1));
+        }
+      }
+      for (const [keyHandlers, event] of Object.entries(storeElementEvent)) {
+        const handlerKey = keyHandlers.replace(stripUidRegex, '');
+        if (!inNamespace || originalTypeEvent.includes(handlerKey)) {
+          removeHandler(element, events, typeEvent, event.callable, event.delegationSelector);
+        }
+      }
+    },
+    trigger(element, event, args) {
+      if (typeof event !== 'string' || !element) {
+        return null;
+      }
+      const $ = getjQuery();
+      const typeEvent = getTypeEvent(event);
+      const inNamespace = event !== typeEvent;
+      let jQueryEvent = null;
+      let bubbles = true;
+      let nativeDispatch = true;
+      let defaultPrevented = false;
+      if (inNamespace && $) {
+        jQueryEvent = $.Event(event, args);
+        $(element).trigger(jQueryEvent);
+        bubbles = !jQueryEvent.isPropagationStopped();
+        nativeDispatch = !jQueryEvent.isImmediatePropagationStopped();
+        defaultPrevented = jQueryEvent.isDefaultPrevented();
+      }
+      const evt = hydrateObj(new Event(event, {
+        bubbles,
+        cancelable: true
+      }), args);
+      if (defaultPrevented) {
+        evt.preventDefault();
+      }
+      if (nativeDispatch) {
+        element.dispatchEvent(evt);
+      }
+      if (evt.defaultPrevented && jQueryEvent) {
+        jQueryEvent.preventDefault();
+      }
+      return evt;
+    }
+  };
+  function hydrateObj(obj, meta = {}) {
+    for (const [key, value] of Object.entries(meta)) {
+      try {
+        obj[key] = value;
+      } catch (_unused) {
+        Object.defineProperty(obj, key, {
+          configurable: true,
+          get() {
+            return value;
+          }
+        });
+      }
+    }
+    return obj;
+  }
+
+  /**
+   * --------------------------------------------------------------------------
+   * Bootstrap dom/manipulator.js
+   * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)
+   * --------------------------------------------------------------------------
+   */
+
+  function normalizeData(value) {
+    if (value === 'true') {
+      return true;
+    }
+    if (value === 'false') {
+      return false;
+    }
+    if (value === Number(value).toString()) {
+      return Number(value);
+    }
+    if (value === '' || value === 'null') {
+      return null;
+    }
+    if (typeof value !== 'string') {
+      return value;
+    }
+    try {
+      return JSON.parse(decodeURIComponent(value));
+    } catch (_unused) {
+      return value;
+    }
+  }
+  function normalizeDataKey(key) {
+    return key.replace(/[A-Z]/g, chr => `-${chr.toLowerCase()}`);
+  }
+  const Manipulator = {
+    setDataAttribute(element, key, value) {
+      element.setAttribute(`data-bs-${normalizeDataKey(key)}`, value);
+    },
+    removeDataAttribute(element, key) {
+      element.removeAttribute(`data-bs-${normalizeDataKey(key)}`);
+    },
+    getDataAttributes(element) {
+      if (!element) {
+        return {};
+      }
+      const attributes = {};
+      const bsKeys = Object.keys(element.dataset).filter(key => key.startsWith('bs') && !key.startsWith('bsConfig'));
+      for (const key of bsKeys) {
+        let pureKey = key.replace(/^bs/, '');
+        pureKey = pureKey.charAt(0).toLowerCase() + pureKey.slice(1, pureKey.length);
+        attributes[pureKey] = normalizeData(element.dataset[key]);
+      }
+      return attributes;
+    },
+    getDataAttribute(element, key) {
+      return normalizeData(element.getAttribute(`data-bs-${normalizeDataKey(key)}`));
+    }
+  };
+
+  /**
+   * --------------------------------------------------------------------------
+   * Bootstrap util/config.js
+   * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)
+   * --------------------------------------------------------------------------
+   */
+
+
+  /**
+   * Class definition
+   */
+
+  class Config {
+    // Getters
+    static get Default() {
+      return {};
+    }
+    static get DefaultType() {
+      return {};
+    }
+    static get NAME() {
+      throw new Error('You have to implement the static method "NAME", for each component!');
+    }
+    _getConfig(config) {
+      config = this._mergeConfigObj(config);
+      config = this._configAfterMerge(config);
+      this._typeCheckConfig(config);
+      return config;
+    }
+    _configAfterMerge(config) {
+      return config;
+    }
+    _mergeConfigObj(config, element) {
+      const jsonConfig = isElement$1(element) ? Manipulator.getDataAttribute(element, 'config') : {}; // try to parse
+
+      return {
+        ...this.constructor.Default,
+        ...(typeof jsonConfig === 'object' ? jsonConfig : {}),
+        ...(isElement$1(element) ? Manipulator.getDataAttributes(element) : {}),
+        ...(typeof config === 'object' ? config : {})
+      };
+    }
+    _typeCheckConfig(config, configTypes = this.constructor.DefaultType) {
+      for (const [property, expectedTypes] of Object.entries(configTypes)) {
+        const value = config[property];
+        const valueType = isElement$1(value) ? 'element' : toType(value);
+        if (!new RegExp(expectedTypes).test(valueType)) {
+          throw new TypeError(`${this.constructor.NAME.toUpperCase()}: Option "${property}" provided type "${valueType}" but expected type "${expectedTypes}".`);
+        }
+      }
+    }
+  }
+
+  /**
+   * --------------------------------------------------------------------------
+   * Bootstrap base-component.js
+   * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)
+   * --------------------------------------------------------------------------
+   */
+
+
+  /**
+   * Constants
+   */
+
+  const VERSION = '5.3.2';
+
+  /**
+   * Class definition
+   */
+
+  class BaseComponent extends Config {
+    constructor(element, config) {
+      super();
+      element = getElement(element);
+      if (!element) {
+        return;
+      }
+      this._element = element;
+      this._config = this._getConfig(config);
+      Data.set(this._element, this.constructor.DATA_KEY, this);
+    }
+
+    // Public
+    dispose() {
+      Data.remove(this._element, this.constructor.DATA_KEY);
+      EventHandler.off(this._element, this.constructor.EVENT_KEY);
+      for (const propertyName of Object.getOwnPropertyNames(this)) {
+        this[propertyName] = null;
+      }
+    }
+    _queueCallback(callback, element, isAnimated = true) {
+      executeAfterTransition(callback, element, isAnimated);
+    }
+    _getConfig(config) {
+      config = this._mergeConfigObj(config, this._element);
+      config = this._configAfterMerge(config);
+      this._typeCheckConfig(config);
+      return config;
+    }
+
+    // Static
+    static getInstance(element) {
+      return Data.get(getElement(element), this.DATA_KEY);
+    }
+    static getOrCreateInstance(element, config = {}) {
+      return this.getInstance(element) || new this(element, typeof config === 'object' ? config : null);
+    }
+    static get VERSION() {
+      return VERSION;
+    }
+    static get DATA_KEY() {
+      return `bs.${this.NAME}`;
+    }
+    static get EVENT_KEY() {
+      return `.${this.DATA_KEY}`;
+    }
+    static eventName(name) {
+      return `${name}${this.EVENT_KEY}`;
+    }
+  }
+
+  /**
+   * --------------------------------------------------------------------------
+   * Bootstrap dom/selector-engine.js
+   * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)
+   * --------------------------------------------------------------------------
+   */
+
+  const getSelector = element => {
+    let selector = element.getAttribute('data-bs-target');
+    if (!selector || selector === '#') {
+      let hrefAttribute = element.getAttribute('href');
+
+      // The only valid content that could double as a selector are IDs or classes,
+      // so everything starting with `#` or `.`. If a "real" URL is used as the selector,
+      // `document.querySelector` will rightfully complain it is invalid.
+      // See https://github.com/twbs/bootstrap/issues/32273
+      if (!hrefAttribute || !hrefAttribute.includes('#') && !hrefAttribute.startsWith('.')) {
+        return null;
+      }
+
+      // Just in case some CMS puts out a full URL with the anchor appended
+      if (hrefAttribute.includes('#') && !hrefAttribute.startsWith('#')) {
+        hrefAttribute = `#${hrefAttribute.split('#')[1]}`;
+      }
+      selector = hrefAttribute && hrefAttribute !== '#' ? parseSelector(hrefAttribute.trim()) : null;
+    }
+    return selector;
+  };
+  const SelectorEngine = {
+    find(selector, element = document.documentElement) {
+      return [].concat(...Element.prototype.querySelectorAll.call(element, selector));
+    },
+    findOne(selector, element = document.documentElement) {
+      return Element.prototype.querySelector.call(element, selector);
+    },
+    children(element, selector) {
+      return [].concat(...element.children).filter(child => child.matches(selector));
+    },
+    parents(element, selector) {
+      const parents = [];
+      let ancestor = element.parentNode.closest(selector);
+      while (ancestor) {
+        parents.push(ancestor);
+        ancestor = ancestor.parentNode.closest(selector);
+      }
+      return parents;
+    },
+    prev(element, selector) {
+      let previous = element.previousElementSibling;
+      while (previous) {
+        if (previous.matches(selector)) {
+          return [previous];
+        }
+        previous = previous.previousElementSibling;
+      }
+      return [];
+    },
+    // TODO: this is now unused; remove later along with prev()
+    next(element, selector) {
+      let next = element.nextElementSibling;
+      while (next) {
+        if (next.matches(selector)) {
+          return [next];
+        }
+        next = next.nextElementSibling;
+      }
+      return [];
+    },
+    focusableChildren(element) {
+      const focusables = ['a', 'button', 'input', 'textarea', 'select', 'details', '[tabindex]', '[contenteditable="true"]'].map(selector => `${selector}:not([tabindex^="-"])`).join(',');
+      return this.find(focusables, element).filter(el => !isDisabled(el) && isVisible(el));
+    },
+    getSelectorFromElement(element) {
+      const selector = getSelector(element);
+      if (selector) {
+        return SelectorEngine.findOne(selector) ? selector : null;
+      }
+      return null;
+    },
+    getElementFromSelector(element) {
+      const selector = getSelector(element);
+      return selector ? SelectorEngine.findOne(selector) : null;
+    },
+    getMultipleElementsFromSelector(element) {
+      const selector = getSelector(element);
+      return selector ? SelectorEngine.find(selector) : [];
+    }
+  };
+
+  /**
+   * --------------------------------------------------------------------------
+   * Bootstrap util/component-functions.js
+   * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)
+   * --------------------------------------------------------------------------
+   */
+
+  const enableDismissTrigger = (component, method = 'hide') => {
+    const clickEvent = `click.dismiss${component.EVENT_KEY}`;
+    const name = component.NAME;
+    EventHandler.on(document, clickEvent, `[data-bs-dismiss="${name}"]`, function (event) {
+      if (['A', 'AREA'].includes(this.tagName)) {
+        event.preventDefault();
+      }
+      if (isDisabled(this)) {
+        return;
+      }
+      const target = SelectorEngine.getElementFromSelector(this) || this.closest(`.${name}`);
+      const instance = component.getOrCreateInstance(target);
+
+      // Method argument is left, for Alert and only, as it doesn't implement the 'hide' method
+      instance[method]();
+    });
+  };
+
+  /**
+   * --------------------------------------------------------------------------
+   * Bootstrap alert.js
+   * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)
+   * --------------------------------------------------------------------------
+   */
+
+
+  /**
+   * Constants
+   */
+
+  const NAME$f = 'alert';
+  const DATA_KEY$a = 'bs.alert';
+  const EVENT_KEY$b = `.${DATA_KEY$a}`;
+  const EVENT_CLOSE = `close${EVENT_KEY$b}`;
+  const EVENT_CLOSED = `closed${EVENT_KEY$b}`;
+  const CLASS_NAME_FADE$5 = 'fade';
+  const CLASS_NAME_SHOW$8 = 'show';
+
+  /**
+   * Class definition
+   */
+
+  class Alert extends BaseComponent {
+    // Getters
+    static get NAME() {
+      return NAME$f;
+    }
+
+    // Public
+    close() {
+      const closeEvent = EventHandler.trigger(this._element, EVENT_CLOSE);
+      if (closeEvent.defaultPrevented) {
+        return;
+      }
+      this._element.classList.remove(CLASS_NAME_SHOW$8);
+      const isAnimated = this._element.classList.contains(CLASS_NAME_FADE$5);
+      this._queueCallback(() => this._destroyElement(), this._element, isAnimated);
+    }
+
+    // Private
+    _destroyElement() {
+      this._element.remove();
+      EventHandler.trigger(this._element, EVENT_CLOSED);
+      this.dispose();
+    }
+
+    // Static
+    static jQueryInterface(config) {
+      return this.each(function () {
+        const data = Alert.getOrCreateInstance(this);
+        if (typeof config !== 'string') {
+          return;
+        }
+        if (data[config] === undefined || config.startsWith('_') || config === 'constructor') {
+          throw new TypeError(`No method named "${config}"`);
+        }
+        data[config](this);
+      });
+    }
+  }
+
+  /**
+   * Data API implementation
+   */
+
+  enableDismissTrigger(Alert, 'close');
+
+  /**
+   * jQuery
+   */
+
+  defineJQueryPlugin(Alert);
+
+  /**
+   * --------------------------------------------------------------------------
+   * Bootstrap button.js
+   * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)
+   * --------------------------------------------------------------------------
+   */
+
+
+  /**
+   * Constants
+   */
+
+  const NAME$e = 'button';
+  const DATA_KEY$9 = 'bs.button';
+  const EVENT_KEY$a = `.${DATA_KEY$9}`;
+  const DATA_API_KEY$6 = '.data-api';
+  const CLASS_NAME_ACTIVE$3 = 'active';
+  const SELECTOR_DATA_TOGGLE$5 = '[data-bs-toggle="button"]';
+  const EVENT_CLICK_DATA_API$6 = `click${EVENT_KEY$a}${DATA_API_KEY$6}`;
+
+  /**
+   * Class definition
+   */
+
+  class Button extends BaseComponent {
+    // Getters
+    static get NAME() {
+      return NAME$e;
+    }
+
+    // Public
+    toggle() {
+      // Toggle class and sync the `aria-pressed` attribute with the return value of the `.toggle()` method
+      this._element.setAttribute('aria-pressed', this._element.classList.toggle(CLASS_NAME_ACTIVE$3));
+    }
+
+    // Static
+    static jQueryInterface(config) {
+      return this.each(function () {
+        const data = Button.getOrCreateInstance(this);
+        if (config === 'toggle') {
+          data[config]();
+        }
+      });
+    }
+  }
+
+  /**
+   * Data API implementation
+   */
+
+  EventHandler.on(document, EVENT_CLICK_DATA_API$6, SELECTOR_DATA_TOGGLE$5, event => {
+    event.preventDefault();
+    const button = event.target.closest(SELECTOR_DATA_TOGGLE$5);
+    const data = Button.getOrCreateInstance(button);
+    data.toggle();
+  });
+
+  /**
+   * jQuery
+   */
+
+  defineJQueryPlugin(Button);
+
+  /**
+   * --------------------------------------------------------------------------
+   * Bootstrap util/swipe.js
+   * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)
+   * --------------------------------------------------------------------------
+   */
+
+
+  /**
+   * Constants
+   */
+
+  const NAME$d = 'swipe';
+  const EVENT_KEY$9 = '.bs.swipe';
+  const EVENT_TOUCHSTART = `touchstart${EVENT_KEY$9}`;
+  const EVENT_TOUCHMOVE = `touchmove${EVENT_KEY$9}`;
+  const EVENT_TOUCHEND = `touchend${EVENT_KEY$9}`;
+  const EVENT_POINTERDOWN = `pointerdown${EVENT_KEY$9}`;
+  const EVENT_POINTERUP = `pointerup${EVENT_KEY$9}`;
+  const POINTER_TYPE_TOUCH = 'touch';
+  const POINTER_TYPE_PEN = 'pen';
+  const CLASS_NAME_POINTER_EVENT = 'pointer-event';
+  const SWIPE_THRESHOLD = 40;
+  const Default$c = {
+    endCallback: null,
+    leftCallback: null,
+    rightCallback: null
+  };
+  const DefaultType$c = {
+    endCallback: '(function|null)',
+    leftCallback: '(function|null)',
+    rightCallback: '(function|null)'
+  };
+
+  /**
+   * Class definition
+   */
+
+  class Swipe extends Config {
+    constructor(element, config) {
+      super();
+      this._element = element;
+      if (!element || !Swipe.isSupported()) {
+        return;
+      }
+      this._config = this._getConfig(config);
+      this._deltaX = 0;
+      this._supportPointerEvents = Boolean(window.PointerEvent);
+      this._initEvents();
+    }
+
+    // Getters
+    static get Default() {
+      return Default$c;
+    }
+    static get DefaultType() {
+      return DefaultType$c;
+    }
+    static get NAME() {
+      return NAME$d;
+    }
+
+    // Public
+    dispose() {
+      EventHandler.off(this._element, EVENT_KEY$9);
+    }
+
+    // Private
+    _start(event) {
+      if (!this._supportPointerEvents) {
+        this._deltaX = event.touches[0].clientX;
+        return;
+      }
+      if (this._eventIsPointerPenTouch(event)) {
+        this._deltaX = event.clientX;
+      }
+    }
+    _end(event) {
+      if (this._eventIsPointerPenTouch(event)) {
+        this._deltaX = event.clientX - this._deltaX;
+      }
+      this._handleSwipe();
+      execute(this._config.endCallback);
+    }
+    _move(event) {
+      this._deltaX = event.touches && event.touches.length > 1 ? 0 : event.touches[0].clientX - this._deltaX;
+    }
+    _handleSwipe() {
+      const absDeltaX = Math.abs(this._deltaX);
+      if (absDeltaX <= SWIPE_THRESHOLD) {
+        return;
+      }
+      const direction = absDeltaX / this._deltaX;
+      this._deltaX = 0;
+      if (!direction) {
+        return;
+      }
+      execute(direction > 0 ? this._config.rightCallback : this._config.leftCallback);
+    }
+    _initEvents() {
+      if (this._supportPointerEvents) {
+        EventHandler.on(this._element, EVENT_POINTERDOWN, event => this._start(event));
+        EventHandler.on(this._element, EVENT_POINTERUP, event => this._end(event));
+        this._element.classList.add(CLASS_NAME_POINTER_EVENT);
+      } else {
+        EventHandler.on(this._element, EVENT_TOUCHSTART, event => this._start(event));
+        EventHandler.on(this._element, EVENT_TOUCHMOVE, event => this._move(event));
+        EventHandler.on(this._element, EVENT_TOUCHEND, event => this._end(event));
+      }
+    }
+    _eventIsPointerPenTouch(event) {
+      return this._supportPointerEvents && (event.pointerType === POINTER_TYPE_PEN || event.pointerType === POINTER_TYPE_TOUCH);
+    }
+
+    // Static
+    static isSupported() {
+      return 'ontouchstart' in document.documentElement || navigator.maxTouchPoints > 0;
+    }
+  }
+
+  /**
+   * --------------------------------------------------------------------------
+   * Bootstrap carousel.js
+   * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)
+   * --------------------------------------------------------------------------
+   */
+
+
+  /**
+   * Constants
+   */
+
+  const NAME$c = 'carousel';
+  const DATA_KEY$8 = 'bs.carousel';
+  const EVENT_KEY$8 = `.${DATA_KEY$8}`;
+  const DATA_API_KEY$5 = '.data-api';
+  const ARROW_LEFT_KEY$1 = 'ArrowLeft';
+  const ARROW_RIGHT_KEY$1 = 'ArrowRight';
+  const TOUCHEVENT_COMPAT_WAIT = 500; // Time for mouse compat events to fire after touch
+
+  const ORDER_NEXT = 'next';
+  const ORDER_PREV = 'prev';
+  const DIRECTION_LEFT = 'left';
+  const DIRECTION_RIGHT = 'right';
+  const EVENT_SLIDE = `slide${EVENT_KEY$8}`;
+  const EVENT_SLID = `slid${EVENT_KEY$8}`;
+  const EVENT_KEYDOWN$1 = `keydown${EVENT_KEY$8}`;
+  const EVENT_MOUSEENTER$1 = `mouseenter${EVENT_KEY$8}`;
+  const EVENT_MOUSELEAVE$1 = `mouseleave${EVENT_KEY$8}`;
+  const EVENT_DRAG_START = `dragstart${EVENT_KEY$8}`;
+  const EVENT_LOAD_DATA_API$3 = `load${EVENT_KEY$8}${DATA_API_KEY$5}`;
+  const EVENT_CLICK_DATA_API$5 = `click${EVENT_KEY$8}${DATA_API_KEY$5}`;
+  const CLASS_NAME_CAROUSEL = 'carousel';
+  const CLASS_NAME_ACTIVE$2 = 'active';
+  const CLASS_NAME_SLIDE = 'slide';
+  const CLASS_NAME_END = 'carousel-item-end';
+  const CLASS_NAME_START = 'carousel-item-start';
+  const CLASS_NAME_NEXT = 'carousel-item-next';
+  const CLASS_NAME_PREV = 'carousel-item-prev';
+  const SELECTOR_ACTIVE = '.active';
+  const SELECTOR_ITEM = '.carousel-item';
+  const SELECTOR_ACTIVE_ITEM = SELECTOR_ACTIVE + SELECTOR_ITEM;
+  const SELECTOR_ITEM_IMG = '.carousel-item img';
+  const SELECTOR_INDICATORS = '.carousel-indicators';
+  const SELECTOR_DATA_SLIDE = '[data-bs-slide], [data-bs-slide-to]';
+  const SELECTOR_DATA_RIDE = '[data-bs-ride="carousel"]';
+  const KEY_TO_DIRECTION = {
+    [ARROW_LEFT_KEY$1]: DIRECTION_RIGHT,
+    [ARROW_RIGHT_KEY$1]: DIRECTION_LEFT
+  };
+  const Default$b = {
+    interval: 5000,
+    keyboard: true,
+    pause: 'hover',
+    ride: false,
+    touch: true,
+    wrap: true
+  };
+  const DefaultType$b = {
+    interval: '(number|boolean)',
+    // TODO:v6 remove boolean support
+    keyboard: 'boolean',
+    pause: '(string|boolean)',
+    ride: '(boolean|string)',
+    touch: 'boolean',
+    wrap: 'boolean'
+  };
+
+  /**
+   * Class definition
+   */
+
+  class Carousel extends BaseComponent {
+    constructor(element, config) {
+      super(element, config);
+      this._interval = null;
+      this._activeElement = null;
+      this._isSliding = false;
+      this.touchTimeout = null;
+      this._swipeHelper = null;
+      this._indicatorsElement = SelectorEngine.findOne(SELECTOR_INDICATORS, this._element);
+      this._addEventListeners();
+      if (this._config.ride === CLASS_NAME_CAROUSEL) {
+        this.cycle();
+      }
+    }
+
+    // Getters
+    static get Default() {
+      return Default$b;
+    }
+    static get DefaultType() {
+      return DefaultType$b;
+    }
+    static get NAME() {
+      return NAME$c;
+    }
+
+    // Public
+    next() {
+      this._slide(ORDER_NEXT);
+    }
+    nextWhenVisible() {
+      // FIXME TODO use `document.visibilityState`
+      // Don't call next when the page isn't visible
+      // or the carousel or its parent isn't visible
+      if (!document.hidden && isVisible(this._element)) {
+        this.next();
+      }
+    }
+    prev() {
+      this._slide(ORDER_PREV);
+    }
+    pause() {
+      if (this._isSliding) {
+        triggerTransitionEnd(this._element);
+      }
+      this._clearInterval();
+    }
+    cycle() {
+      this._clearInterval();
+      this._updateInterval();
+      this._interval = setInterval(() => this.nextWhenVisible(), this._config.interval);
+    }
+    _maybeEnableCycle() {
+      if (!this._config.ride) {
+        return;
+      }
+      if (this._isSliding) {
+        EventHandler.one(this._element, EVENT_SLID, () => this.cycle());
+        return;
+      }
+      this.cycle();
+    }
+    to(index) {
+      const items = this._getItems();
+      if (index > items.length - 1 || index < 0) {
+        return;
+      }
+      if (this._isSliding) {
+        EventHandler.one(this._element, EVENT_SLID, () => this.to(index));
+        return;
+      }
+      const activeIndex = this._getItemIndex(this._getActive());
+      if (activeIndex === index) {
+        return;
+      }
+      const order = index > activeIndex ? ORDER_NEXT : ORDER_PREV;
+      this._slide(order, items[index]);
+    }
+    dispose() {
+      if (this._swipeHelper) {
+        this._swipeHelper.dispose();
+      }
+      super.dispose();
+    }
+
+    // Private
+    _configAfterMerge(config) {
+      config.defaultInterval = config.interval;
+      return config;
+    }
+    _addEventListeners() {
+      if (this._config.keyboard) {
+        EventHandler.on(this._element, EVENT_KEYDOWN$1, event => this._keydown(event));
+      }
+      if (this._config.pause === 'hover') {
+        EventHandler.on(this._element, EVENT_MOUSEENTER$1, () => this.pause());
+        EventHandler.on(this._element, EVENT_MOUSELEAVE$1, () => this._maybeEnableCycle());
+      }
+      if (this._config.touch && Swipe.isSupported()) {
+        this._addTouchEventListeners();
+      }
+    }
+    _addTouchEventListeners() {
+      for (const img of SelectorEngine.find(SELECTOR_ITEM_IMG, this._element)) {
+        EventHandler.on(img, EVENT_DRAG_START, event => event.preventDefault());
+      }
+      const endCallBack = () => {
+        if (this._config.pause !== 'hover') {
+          return;
+        }
+
+        // If it's a touch-enabled device, mouseenter/leave are fired as
+        // part of the mouse compatibility events on first tap - the carousel
+        // would stop cycling until user tapped out of it;
+        // here, we listen for touchend, explicitly pause the carousel
+        // (as if it's the second time we tap on it, mouseenter compat event
+        // is NOT fired) and after a timeout (to allow for mouse compatibility
+        // events to fire) we explicitly restart cycling
+
+        this.pause();
+        if (this.touchTimeout) {
+          clearTimeout(this.touchTimeout);
+        }
+        this.touchTimeout = setTimeout(() => this._maybeEnableCycle(), TOUCHEVENT_COMPAT_WAIT + this._config.interval);
+      };
+      const swipeConfig = {
+        leftCallback: () => this._slide(this._directionToOrder(DIRECTION_LEFT)),
+        rightCallback: () => this._slide(this._directionToOrder(DIRECTION_RIGHT)),
+        endCallback: endCallBack
+      };
+      this._swipeHelper = new Swipe(this._element, swipeConfig);
+    }
+    _keydown(event) {
+      if (/input|textarea/i.test(event.target.tagName)) {
+        return;
+      }
+      const direction = KEY_TO_DIRECTION[event.key];
+      if (direction) {
+        event.preventDefault();
+        this._slide(this._directionToOrder(direction));
+      }
+    }
+    _getItemIndex(element) {
+      return this._getItems().indexOf(element);
+    }
+    _setActiveIndicatorElement(index) {
+      if (!this._indicatorsElement) {
+        return;
+      }
+      const activeIndicator = SelectorEngine.findOne(SELECTOR_ACTIVE, this._indicatorsElement);
+      activeIndicator.classList.remove(CLASS_NAME_ACTIVE$2);
+      activeIndicator.removeAttribute('aria-current');
+      const newActiveIndicator = SelectorEngine.findOne(`[data-bs-slide-to="${index}"]`, this._indicatorsElement);
+      if (newActiveIndicator) {
+        newActiveIndicator.classList.add(CLASS_NAME_ACTIVE$2);
+        newActiveIndicator.setAttribute('aria-current', 'true');
+      }
+    }
+    _updateInterval() {
+      const element = this._activeElement || this._getActive();
+      if (!element) {
+        return;
+      }
+      const elementInterval = Number.parseInt(element.getAttribute('data-bs-interval'), 10);
+      this._config.interval = elementInterval || this._config.defaultInterval;
+    }
+    _slide(order, element = null) {
+      if (this._isSliding) {
+        return;
+      }
+      const activeElement = this._getActive();
+      const isNext = order === ORDER_NEXT;
+      const nextElement = element || getNextActiveElement(this._getItems(), activeElement, isNext, this._config.wrap);
+      if (nextElement === activeElement) {
+        return;
+      }
+      const nextElementIndex = this._getItemIndex(nextElement);
+      const triggerEvent = eventName => {
+        return EventHandler.trigger(this._element, eventName, {
+          relatedTarget: nextElement,
+          direction: this._orderToDirection(order),
+          from: this._getItemIndex(activeElement),
+          to: nextElementIndex
+        });
+      };
+      const slideEvent = triggerEvent(EVENT_SLIDE);
+      if (slideEvent.defaultPrevented) {
+        return;
+      }
+      if (!activeElement || !nextElement) {
+        // Some weirdness is happening, so we bail
+        // TODO: change tests that use empty divs to avoid this check
+        return;
+      }
+      const isCycling = Boolean(this._interval);
+      this.pause();
+      this._isSliding = true;
+      this._setActiveIndicatorElement(nextElementIndex);
+      this._activeElement = nextElement;
+      const directionalClassName = isNext ? CLASS_NAME_START : CLASS_NAME_END;
+      const orderClassName = isNext ? CLASS_NAME_NEXT : CLASS_NAME_PREV;
+      nextElement.classList.add(orderClassName);
+      reflow(nextElement);
+      activeElement.classList.add(directionalClassName);
+      nextElement.classList.add(directionalClassName);
+      const completeCallBack = () => {
+        nextElement.classList.remove(directionalClassName, orderClassName);
+        nextElement.classList.add(CLASS_NAME_ACTIVE$2);
+        activeElement.classList.remove(CLASS_NAME_ACTIVE$2, orderClassName, directionalClassName);
+        this._isSliding = false;
+        triggerEvent(EVENT_SLID);
+      };
+      this._queueCallback(completeCallBack, activeElement, this._isAnimated());
+      if (isCycling) {
+        this.cycle();
+      }
+    }
+    _isAnimated() {
+      return this._element.classList.contains(CLASS_NAME_SLIDE);
+    }
+    _getActive() {
+      return SelectorEngine.findOne(SELECTOR_ACTIVE_ITEM, this._element);
+    }
+    _getItems() {
+      return SelectorEngine.find(SELECTOR_ITEM, this._element);
+    }
+    _clearInterval() {
+      if (this._interval) {
+        clearInterval(this._interval);
+        this._interval = null;
+      }
+    }
+    _directionToOrder(direction) {
+      if (isRTL()) {
+        return direction === DIRECTION_LEFT ? ORDER_PREV : ORDER_NEXT;
+      }
+      return direction === DIRECTION_LEFT ? ORDER_NEXT : ORDER_PREV;
+    }
+    _orderToDirection(order) {
+      if (isRTL()) {
+        return order === ORDER_PREV ? DIRECTION_LEFT : DIRECTION_RIGHT;
+      }
+      return order === ORDER_PREV ? DIRECTION_RIGHT : DIRECTION_LEFT;
+    }
+
+    // Static
+    static jQueryInterface(config) {
+      return this.each(function () {
+        const data = Carousel.getOrCreateInstance(this, config);
+        if (typeof config === 'number') {
+          data.to(config);
+          return;
+        }
+        if (typeof config === 'string') {
+          if (data[config] === undefined || config.startsWith('_') || config === 'constructor') {
+            throw new TypeError(`No method named "${config}"`);
+          }
+          data[config]();
+        }
+      });
+    }
+  }
+
+  /**
+   * Data API implementation
+   */
+
+  EventHandler.on(document, EVENT_CLICK_DATA_API$5, SELECTOR_DATA_SLIDE, function (event) {
+    const target = SelectorEngine.getElementFromSelector(this);
+    if (!target || !target.classList.contains(CLASS_NAME_CAROUSEL)) {
+      return;
+    }
+    event.preventDefault();
+    const carousel = Carousel.getOrCreateInstance(target);
+    const slideIndex = this.getAttribute('data-bs-slide-to');
+    if (slideIndex) {
+      carousel.to(slideIndex);
+      carousel._maybeEnableCycle();
+      return;
+    }
+    if (Manipulator.getDataAttribute(this, 'slide') === 'next') {
+      carousel.next();
+      carousel._maybeEnableCycle();
+      return;
+    }
+    carousel.prev();
+    carousel._maybeEnableCycle();
+  });
+  EventHandler.on(window, EVENT_LOAD_DATA_API$3, () => {
+    const carousels = SelectorEngine.find(SELECTOR_DATA_RIDE);
+    for (const carousel of carousels) {
+      Carousel.getOrCreateInstance(carousel);
+    }
+  });
+
+  /**
+   * jQuery
+   */
+
+  defineJQueryPlugin(Carousel);
+
+  /**
+   * --------------------------------------------------------------------------
+   * Bootstrap collapse.js
+   * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)
+   * --------------------------------------------------------------------------
+   */
+
+
+  /**
+   * Constants
+   */
+
+  const NAME$b = 'collapse';
+  const DATA_KEY$7 = 'bs.collapse';
+  const EVENT_KEY$7 = `.${DATA_KEY$7}`;
+  const DATA_API_KEY$4 = '.data-api';
+  const EVENT_SHOW$6 = `show${EVENT_KEY$7}`;
+  const EVENT_SHOWN$6 = `shown${EVENT_KEY$7}`;
+  const EVENT_HIDE$6 = `hide${EVENT_KEY$7}`;
+  const EVENT_HIDDEN$6 = `hidden${EVENT_KEY$7}`;
+  const EVENT_CLICK_DATA_API$4 = `click${EVENT_KEY$7}${DATA_API_KEY$4}`;
+  const CLASS_NAME_SHOW$7 = 'show';
+  const CLASS_NAME_COLLAPSE = 'collapse';
+  const CLASS_NAME_COLLAPSING = 'collapsing';
+  const CLASS_NAME_COLLAPSED = 'collapsed';
+  const CLASS_NAME_DEEPER_CHILDREN = `:scope .${CLASS_NAME_COLLAPSE} .${CLASS_NAME_COLLAPSE}`;
+  const CLASS_NAME_HORIZONTAL = 'collapse-horizontal';
+  const WIDTH = 'width';
+  const HEIGHT = 'height';
+  const SELECTOR_ACTIVES = '.collapse.show, .collapse.collapsing';
+  const SELECTOR_DATA_TOGGLE$4 = '[data-bs-toggle="collapse"]';
+  const Default$a = {
+    parent: null,
+    toggle: true
+  };
+  const DefaultType$a = {
+    parent: '(null|element)',
+    toggle: 'boolean'
+  };
+
+  /**
+   * Class definition
+   */
+
+  class Collapse extends BaseComponent {
+    constructor(element, config) {
+      super(element, config);
+      this._isTransitioning = false;
+      this._triggerArray = [];
+      const toggleList = SelectorEngine.find(SELECTOR_DATA_TOGGLE$4);
+      for (const elem of toggleList) {
+        const selector = SelectorEngine.getSelectorFromElement(elem);
+        const filterElement = SelectorEngine.find(selector).filter(foundElement => foundElement === this._element);
+        if (selector !== null && filterElement.length) {
+          this._triggerArray.push(elem);
+        }
+      }
+      this._initializeChildren();
+      if (!this._config.parent) {
+        this._addAriaAndCollapsedClass(this._triggerArray, this._isShown());
+      }
+      if (this._config.toggle) {
+        this.toggle();
+      }
+    }
+
+    // Getters
+    static get Default() {
+      return Default$a;
+    }
+    static get DefaultType() {
+      return DefaultType$a;
+    }
+    static get NAME() {
+      return NAME$b;
+    }
+
+    // Public
+    toggle() {
+      if (this._isShown()) {
+        this.hide();
+      } else {
+        this.show();
+      }
+    }
+    show() {
+      if (this._isTransitioning || this._isShown()) {
+        return;
+      }
+      let activeChildren = [];
+
+      // find active children
+      if (this._config.parent) {
+        activeChildren = this._getFirstLevelChildren(SELECTOR_ACTIVES).filter(element => element !== this._element).map(element => Collapse.getOrCreateInstance(element, {
+          toggle: false
+        }));
+      }
+      if (activeChildren.length && activeChildren[0]._isTransitioning) {
+        return;
+      }
+      const startEvent = EventHandler.trigger(this._element, EVENT_SHOW$6);
+      if (startEvent.defaultPrevented) {
+        return;
+      }
+      for (const activeInstance of activeChildren) {
+        activeInstance.hide();
+      }
+      const dimension = this._getDimension();
+      this._element.classList.remove(CLASS_NAME_COLLAPSE);
+      this._element.classList.add(CLASS_NAME_COLLAPSING);
+      this._element.style[dimension] = 0;
+      this._addAriaAndCollapsedClass(this._triggerArray, true);
+      this._isTransitioning = true;
+      const complete = () => {
+        this._isTransitioning = false;
+        this._element.classList.remove(CLASS_NAME_COLLAPSING);
+        this._element.classList.add(CLASS_NAME_COLLAPSE, CLASS_NAME_SHOW$7);
+        this._element.style[dimension] = '';
+        EventHandler.trigger(this._element, EVENT_SHOWN$6);
+      };
+      const capitalizedDimension = dimension[0].toUpperCase() + dimension.slice(1);
+      const scrollSize = `scroll${capitalizedDimension}`;
+      this._queueCallback(complete, this._element, true);
+      this._element.style[dimension] = `${this._element[scrollSize]}px`;
+    }
+    hide() {
+      if (this._isTransitioning || !this._isShown()) {
+        return;
+      }
+      const startEvent = EventHandler.trigger(this._element, EVENT_HIDE$6);
+      if (startEvent.defaultPrevented) {
+        return;
+      }
+      const dimension = this._getDimension();
+      this._element.style[dimension] = `${this._element.getBoundingClientRect()[dimension]}px`;
+      reflow(this._element);
+      this._element.classList.add(CLASS_NAME_COLLAPSING);
+      this._element.classList.remove(CLASS_NAME_COLLAPSE, CLASS_NAME_SHOW$7);
+      for (const trigger of this._triggerArray) {
+        const element = SelectorEngine.getElementFromSelector(trigger);
+        if (element && !this._isShown(element)) {
+          this._addAriaAndCollapsedClass([trigger], false);
+        }
+      }
+      this._isTransitioning = true;
+      const complete = () => {
+        this._isTransitioning = false;
+        this._element.classList.remove(CLASS_NAME_COLLAPSING);
+        this._element.classList.add(CLASS_NAME_COLLAPSE);
+        EventHandler.trigger(this._element, EVENT_HIDDEN$6);
+      };
+      this._element.style[dimension] = '';
+      this._queueCallback(complete, this._element, true);
+    }
+    _isShown(element = this._element) {
+      return element.classList.contains(CLASS_NAME_SHOW$7);
+    }
+
+    // Private
+    _configAfterMerge(config) {
+      config.toggle = Boolean(config.toggle); // Coerce string values
+      config.parent = getElement(config.parent);
+      return config;
+    }
+    _getDimension() {
+      return this._element.classList.contains(CLASS_NAME_HORIZONTAL) ? WIDTH : HEIGHT;
+    }
+    _initializeChildren() {
+      if (!this._config.parent) {
+        return;
+      }
+      const children = this._getFirstLevelChildren(SELECTOR_DATA_TOGGLE$4);
+      for (const element of children) {
+        const selected = SelectorEngine.getElementFromSelector(element);
+        if (selected) {
+          this._addAriaAndCollapsedClass([element], this._isShown(selected));
+        }
+      }
+    }
+    _getFirstLevelChildren(selector) {
+      const children = SelectorEngine.find(CLASS_NAME_DEEPER_CHILDREN, this._config.parent);
+      // remove children if greater depth
+      return SelectorEngine.find(selector, this._config.parent).filter(element => !children.includes(element));
+    }
+    _addAriaAndCollapsedClass(triggerArray, isOpen) {
+      if (!triggerArray.length) {
+        return;
+      }
+      for (const element of triggerArray) {
+        element.classList.toggle(CLASS_NAME_COLLAPSED, !isOpen);
+        element.setAttribute('aria-expanded', isOpen);
+      }
+    }
+
+    // Static
+    static jQueryInterface(config) {
+      const _config = {};
+      if (typeof config === 'string' && /show|hide/.test(config)) {
+        _config.toggle = false;
+      }
+      return this.each(function () {
+        const data = Collapse.getOrCreateInstance(this, _config);
+        if (typeof config === 'string') {
+          if (typeof data[config] === 'undefined') {
+            throw new TypeError(`No method named "${config}"`);
+          }
+          data[config]();
+        }
+      });
+    }
+  }
+
+  /**
+   * Data API implementation
+   */
+
+  EventHandler.on(document, EVENT_CLICK_DATA_API$4, SELECTOR_DATA_TOGGLE$4, function (event) {
+    // preventDefault only for <a> elements (which change the URL) not inside the collapsible element
+    if (event.target.tagName === 'A' || event.delegateTarget && event.delegateTarget.tagName === 'A') {
+      event.preventDefault();
+    }
+    for (const element of SelectorEngine.getMultipleElementsFromSelector(this)) {
+      Collapse.getOrCreateInstance(element, {
+        toggle: false
+      }).toggle();
+    }
+  });
+
+  /**
+   * jQuery
+   */
+
+  defineJQueryPlugin(Collapse);
+
+  var top = 'top';
+  var bottom = 'bottom';
+  var right = 'right';
+  var left = 'left';
+  var auto = 'auto';
+  var basePlacements = [top, bottom, right, left];
+  var start = 'start';
+  var end = 'end';
+  var clippingParents = 'clippingParents';
+  var viewport = 'viewport';
+  var popper = 'popper';
+  var reference = 'reference';
+  var variationPlacements = /*#__PURE__*/basePlacements.reduce(function (acc, placement) {
+    return acc.concat([placement + "-" + start, placement + "-" + end]);
+  }, []);
+  var placements = /*#__PURE__*/[].concat(basePlacements, [auto]).reduce(function (acc, placement) {
+    return acc.concat([placement, placement + "-" + start, placement + "-" + end]);
+  }, []); // modifiers that need to read the DOM
+
+  var beforeRead = 'beforeRead';
+  var read = 'read';
+  var afterRead = 'afterRead'; // pure-logic modifiers
+
+  var beforeMain = 'beforeMain';
+  var main = 'main';
+  var afterMain = 'afterMain'; // modifier with the purpose to write to the DOM (or write into a framework state)
+
+  var beforeWrite = 'beforeWrite';
+  var write = 'write';
+  var afterWrite = 'afterWrite';
+  var modifierPhases = [beforeRead, read, afterRead, beforeMain, main, afterMain, beforeWrite, write, afterWrite];
+
+  function getNodeName(element) {
+    return element ? (element.nodeName || '').toLowerCase() : null;
+  }
+
+  function getWindow(node) {
+    if (node == null) {
+      return window;
+    }
+
+    if (node.toString() !== '[object Window]') {
+      var ownerDocument = node.ownerDocument;
+      return ownerDocument ? ownerDocument.defaultView || window : window;
+    }
+
+    return node;
+  }
+
+  function isElement(node) {
+    var OwnElement = getWindow(node).Element;
+    return node instanceof OwnElement || node instanceof Element;
+  }
+
+  function isHTMLElement(node) {
+    var OwnElement = getWindow(node).HTMLElement;
+    return node instanceof OwnElement || node instanceof HTMLElement;
+  }
+
+  function isShadowRoot(node) {
+    // IE 11 has no ShadowRoot
+    if (typeof ShadowRoot === 'undefined') {
+      return false;
+    }
+
+    var OwnElement = getWindow(node).ShadowRoot;
+    return node instanceof OwnElement || node instanceof ShadowRoot;
+  }
+
+  // and applies them to the HTMLElements such as popper and arrow
+
+  function applyStyles(_ref) {
+    var state = _ref.state;
+    Object.keys(state.elements).forEach(function (name) {
+      var style = state.styles[name] || {};
+      var attributes = state.attributes[name] || {};
+      var element = state.elements[name]; // arrow is optional + virtual elements
+
+      if (!isHTMLElement(element) || !getNodeName(element)) {
+        return;
+      } // Flow doesn't support to extend this property, but it's the most
+      // effective way to apply styles to an HTMLElement
+      // $FlowFixMe[cannot-write]
+
+
+      Object.assign(element.style, style);
+      Object.keys(attributes).forEach(function (name) {
+        var value = attributes[name];
+
+        if (value === false) {
+          element.removeAttribute(name);
+        } else {
+          element.setAttribute(name, value === true ? '' : value);
+        }
+      });
+    });
+  }
+
+  function effect$2(_ref2) {
+    var state = _ref2.state;
+    var initialStyles = {
+      popper: {
+        position: state.options.strategy,
+        left: '0',
+        top: '0',
+        margin: '0'
+      },
+      arrow: {
+        position: 'absolute'
+      },
+      reference: {}
+    };
+    Object.assign(state.elements.popper.style, initialStyles.popper);
+    state.styles = initialStyles;
+
+    if (state.elements.arrow) {
+      Object.assign(state.elements.arrow.style, initialStyles.arrow);
+    }
+
+    return function () {
+      Object.keys(state.elements).forEach(function (name) {
+        var element = state.elements[name];
+        var attributes = state.attributes[name] || {};
+        var styleProperties = Object.keys(state.styles.hasOwnProperty(name) ? state.styles[name] : initialStyles[name]); // Set all values to an empty string to unset them
+
+        var style = styleProperties.reduce(function (style, property) {
+          style[property] = '';
+          return style;
+        }, {}); // arrow is optional + virtual elements
+
+        if (!isHTMLElement(element) || !getNodeName(element)) {
+          return;
+        }
+
+        Object.assign(element.style, style);
+        Object.keys(attributes).forEach(function (attribute) {
+          element.removeAttribute(attribute);
+        });
+      });
+    };
+  } // eslint-disable-next-line import/no-unused-modules
+
+
+  const applyStyles$1 = {
+    name: 'applyStyles',
+    enabled: true,
+    phase: 'write',
+    fn: applyStyles,
+    effect: effect$2,
+    requires: ['computeStyles']
+  };
+
+  function getBasePlacement(placement) {
+    return placement.split('-')[0];
+  }
+
+  var max = Math.max;
+  var min = Math.min;
+  var round = Math.round;
+
+  function getUAString() {
+    var uaData = navigator.userAgentData;
+
+    if (uaData != null && uaData.brands && Array.isArray(uaData.brands)) {
+      return uaData.brands.map(function (item) {
+        return item.brand + "/" + item.version;
+      }).join(' ');
+    }
+
+    return navigator.userAgent;
+  }
+
+  function isLayoutViewport() {
+    return !/^((?!chrome|android).)*safari/i.test(getUAString());
+  }
+
+  function getBoundingClientRect(element, includeScale, isFixedStrategy) {
+    if (includeScale === void 0) {
+      includeScale = false;
+    }
+
+    if (isFixedStrategy === void 0) {
+      isFixedStrategy = false;
+    }
+
+    var clientRect = element.getBoundingClientRect();
+    var scaleX = 1;
+    var scaleY = 1;
+
+    if (includeScale && isHTMLElement(element)) {
+      scaleX = element.offsetWidth > 0 ? round(clientRect.width) / element.offsetWidth || 1 : 1;
+      scaleY = element.offsetHeight > 0 ? round(clientRect.height) / element.offsetHeight || 1 : 1;
+    }
+
+    var _ref = isElement(element) ? getWindow(element) : window,
+        visualViewport = _ref.visualViewport;
+
+    var addVisualOffsets = !isLayoutViewport() && isFixedStrategy;
+    var x = (clientRect.left + (addVisualOffsets && visualViewport ? visualViewport.offsetLeft : 0)) / scaleX;
+    var y = (clientRect.top + (addVisualOffsets && visualViewport ? visualViewport.offsetTop : 0)) / scaleY;
+    var width = clientRect.width / scaleX;
+    var height = clientRect.height / scaleY;
+    return {
+      width: width,
+      height: height,
+      top: y,
+      right: x + width,
+      bottom: y + height,
+      left: x,
+      x: x,
+      y: y
+    };
+  }
+
+  // means it doesn't take into account transforms.
+
+  function getLayoutRect(element) {
+    var clientRect = getBoundingClientRect(element); // Use the clientRect sizes if it's not been transformed.
+    // Fixes https://github.com/popperjs/popper-core/issues/1223
+
+    var width = element.offsetWidth;
+    var height = element.offsetHeight;
+
+    if (Math.abs(clientRect.width - width) <= 1) {
+      width = clientRect.width;
+    }
+
+    if (Math.abs(clientRect.height - height) <= 1) {
+      height = clientRect.height;
+    }
+
+    return {
+      x: element.offsetLeft,
+      y: element.offsetTop,
+      width: width,
+      height: height
+    };
+  }
+
+  function contains(parent, child) {
+    var rootNode = child.getRootNode && child.getRootNode(); // First, attempt with faster native method
+
+    if (parent.contains(child)) {
+      return true;
+    } // then fallback to custom implementation with Shadow DOM support
+    else if (rootNode && isShadowRoot(rootNode)) {
+        var next = child;
+
+        do {
+          if (next && parent.isSameNode(next)) {
+            return true;
+          } // $FlowFixMe[prop-missing]: need a better way to handle this...
+
+
+          next = next.parentNode || next.host;
+        } while (next);
+      } // Give up, the result is false
+
+
+    return false;
+  }
+
+  function getComputedStyle$1(element) {
+    return getWindow(element).getComputedStyle(element);
+  }
+
+  function isTableElement(element) {
+    return ['table', 'td', 'th'].indexOf(getNodeName(element)) >= 0;
+  }
+
+  function getDocumentElement(element) {
+    // $FlowFixMe[incompatible-return]: assume body is always available
+    return ((isElement(element) ? element.ownerDocument : // $FlowFixMe[prop-missing]
+    element.document) || window.document).documentElement;
+  }
+
+  function getParentNode(element) {
+    if (getNodeName(element) === 'html') {
+      return element;
+    }
+
+    return (// this is a quicker (but less type safe) way to save quite some bytes from the bundle
+      // $FlowFixMe[incompatible-return]
+      // $FlowFixMe[prop-missing]
+      element.assignedSlot || // step into the shadow DOM of the parent of a slotted node
+      element.parentNode || ( // DOM Element detected
+      isShadowRoot(element) ? element.host : null) || // ShadowRoot detected
+      // $FlowFixMe[incompatible-call]: HTMLElement is a Node
+      getDocumentElement(element) // fallback
+
+    );
+  }
+
+  function getTrueOffsetParent(element) {
+    if (!isHTMLElement(element) || // https://github.com/popperjs/popper-core/issues/837
+    getComputedStyle$1(element).position === 'fixed') {
+      return null;
+    }
+
+    return element.offsetParent;
+  } // `.offsetParent` reports `null` for fixed elements, while absolute elements
+  // return the containing block
+
+
+  function getContainingBlock(element) {
+    var isFirefox = /firefox/i.test(getUAString());
+    var isIE = /Trident/i.test(getUAString());
+
+    if (isIE && isHTMLElement(element)) {
+      // In IE 9, 10 and 11 fixed elements containing block is always established by the viewport
+      var elementCss = getComputedStyle$1(element);
+
+      if (elementCss.position === 'fixed') {
+        return null;
+      }
+    }
+
+    var currentNode = getParentNode(element);
+
+    if (isShadowRoot(currentNode)) {
+      currentNode = currentNode.host;
+    }
+
+    while (isHTMLElement(currentNode) && ['html', 'body'].indexOf(getNodeName(currentNode)) < 0) {
+      var css = getComputedStyle$1(currentNode); // This is non-exhaustive but covers the most common CSS properties that
+      // create a containing block.
+      // https://developer.mozilla.org/en-US/docs/Web/CSS/Containing_block#identifying_the_containing_block
+
+      if (css.transform !== 'none' || css.perspective !== 'none' || css.contain === 'paint' || ['transform', 'perspective'].indexOf(css.willChange) !== -1 || isFirefox && css.willChange === 'filter' || isFirefox && css.filter && css.filter !== 'none') {
+        return currentNode;
+      } else {
+        currentNode = currentNode.parentNode;
+      }
+    }
+
+    return null;
+  } // Gets the closest ancestor positioned element. Handles some edge cases,
+  // such as table ancestors and cross browser bugs.
+
+
+  function getOffsetParent(element) {
+    var window = getWindow(element);
+    var offsetParent = getTrueOffsetParent(element);
+
+    while (offsetParent && isTableElement(offsetParent) && getComputedStyle$1(offsetParent).position === 'static') {
+      offsetParent = getTrueOffsetParent(offsetParent);
+    }
+
+    if (offsetParent && (getNodeName(offsetParent) === 'html' || getNodeName(offsetParent) === 'body' && getComputedStyle$1(offsetParent).position === 'static')) {
+      return window;
+    }
+
+    return offsetParent || getContainingBlock(element) || window;
+  }
+
+  function getMainAxisFromPlacement(placement) {
+    return ['top', 'bottom'].indexOf(placement) >= 0 ? 'x' : 'y';
+  }
+
+  function within(min$1, value, max$1) {
+    return max(min$1, min(value, max$1));
+  }
+  function withinMaxClamp(min, value, max) {
+    var v = within(min, value, max);
+    return v > max ? max : v;
+  }
+
+  function getFreshSideObject() {
+    return {
+      top: 0,
+      right: 0,
+      bottom: 0,
+      left: 0
+    };
+  }
+
+  function mergePaddingObject(paddingObject) {
+    return Object.assign({}, getFreshSideObject(), paddingObject);
+  }
+
+  function expandToHashMap(value, keys) {
+    return keys.reduce(function (hashMap, key) {
+      hashMap[key] = value;
+      return hashMap;
+    }, {});
+  }
+
+  var toPaddingObject = function toPaddingObject(padding, state) {
+    padding = typeof padding === 'function' ? padding(Object.assign({}, state.rects, {
+      placement: state.placement
+    })) : padding;
+    return mergePaddingObject(typeof padding !== 'number' ? padding : expandToHashMap(padding, basePlacements));
+  };
+
+  function arrow(_ref) {
+    var _state$modifiersData$;
+
+    var state = _ref.state,
+        name = _ref.name,
+        options = _ref.options;
+    var arrowElement = state.elements.arrow;
+    var popperOffsets = state.modifiersData.popperOffsets;
+    var basePlacement = getBasePlacement(state.placement);
+    var axis = getMainAxisFromPlacement(basePlacement);
+    var isVertical = [left, right].indexOf(basePlacement) >= 0;
+    var len = isVertical ? 'height' : 'width';
+
+    if (!arrowElement || !popperOffsets) {
+      return;
+    }
+
+    var paddingObject = toPaddingObject(options.padding, state);
+    var arrowRect = getLayoutRect(arrowElement);
+    var minProp = axis === 'y' ? top : left;
+    var maxProp = axis === 'y' ? bottom : right;
+    var endDiff = state.rects.reference[len] + state.rects.reference[axis] - popperOffsets[axis] - state.rects.popper[len];
+    var startDiff = popperOffsets[axis] - state.rects.reference[axis];
+    var arrowOffsetParent = getOffsetParent(arrowElement);
+    var clientSize = arrowOffsetParent ? axis === 'y' ? arrowOffsetParent.clientHeight || 0 : arrowOffsetParent.clientWidth || 0 : 0;
+    var centerToReference = endDiff / 2 - startDiff / 2; // Make sure the arrow doesn't overflow the popper if the center point is
+    // outside of the popper bounds
+
+    var min = paddingObject[minProp];
+    var max = clientSize - arrowRect[len] - paddingObject[maxProp];
+    var center = clientSize / 2 - arrowRect[len] / 2 + centerToReference;
+    var offset = within(min, center, max); // Prevents breaking syntax highlighting...
+
+    var axisProp = axis;
+    state.modifiersData[name] = (_state$modifiersData$ = {}, _state$modifiersData$[axisProp] = offset, _state$modifiersData$.centerOffset = offset - center, _state$modifiersData$);
+  }
+
+  function effect$1(_ref2) {
+    var state = _ref2.state,
+        options = _ref2.options;
+    var _options$element = options.element,
+        arrowElement = _options$element === void 0 ? '[data-popper-arrow]' : _options$element;
+
+    if (arrowElement == null) {
+      return;
+    } // CSS selector
+
+
+    if (typeof arrowElement === 'string') {
+      arrowElement = state.elements.popper.querySelector(arrowElement);
+
+      if (!arrowElement) {
+        return;
+      }
+    }
+
+    if (!contains(state.elements.popper, arrowElement)) {
+      return;
+    }
+
+    state.elements.arrow = arrowElement;
+  } // eslint-disable-next-line import/no-unused-modules
+
+
+  const arrow$1 = {
+    name: 'arrow',
+    enabled: true,
+    phase: 'main',
+    fn: arrow,
+    effect: effect$1,
+    requires: ['popperOffsets'],
+    requiresIfExists: ['preventOverflow']
+  };
+
+  function getVariation(placement) {
+    return placement.split('-')[1];
+  }
+
+  var unsetSides = {
+    top: 'auto',
+    right: 'auto',
+    bottom: 'auto',
+    left: 'auto'
+  }; // Round the offsets to the nearest suitable subpixel based on the DPR.
+  // Zooming can change the DPR, but it seems to report a value that will
+  // cleanly divide the values into the appropriate subpixels.
+
+  function roundOffsetsByDPR(_ref, win) {
+    var x = _ref.x,
+        y = _ref.y;
+    var dpr = win.devicePixelRatio || 1;
+    return {
+      x: round(x * dpr) / dpr || 0,
+      y: round(y * dpr) / dpr || 0
+    };
+  }
+
+  function mapToStyles(_ref2) {
+    var _Object$assign2;
+
+    var popper = _ref2.popper,
+        popperRect = _ref2.popperRect,
+        placement = _ref2.placement,
+        variation = _ref2.variation,
+        offsets = _ref2.offsets,
+        position = _ref2.position,
+        gpuAcceleration = _ref2.gpuAcceleration,
+        adaptive = _ref2.adaptive,
+        roundOffsets = _ref2.roundOffsets,
+        isFixed = _ref2.isFixed;
+    var _offsets$x = offsets.x,
+        x = _offsets$x === void 0 ? 0 : _offsets$x,
+        _offsets$y = offsets.y,
+        y = _offsets$y === void 0 ? 0 : _offsets$y;
+
+    var _ref3 = typeof roundOffsets === 'function' ? roundOffsets({
+      x: x,
+      y: y
+    }) : {
+      x: x,
+      y: y
+    };
+
+    x = _ref3.x;
+    y = _ref3.y;
+    var hasX = offsets.hasOwnProperty('x');
+    var hasY = offsets.hasOwnProperty('y');
+    var sideX = left;
+    var sideY = top;
+    var win = window;
+
+    if (adaptive) {
+      var offsetParent = getOffsetParent(popper);
+      var heightProp = 'clientHeight';
+      var widthProp = 'clientWidth';
+
+      if (offsetParent === getWindow(popper)) {
+        offsetParent = getDocumentElement(popper);
+
+        if (getComputedStyle$1(offsetParent).position !== 'static' && position === 'absolute') {
+          heightProp = 'scrollHeight';
+          widthProp = 'scrollWidth';
+        }
+      } // $FlowFixMe[incompatible-cast]: force type refinement, we compare offsetParent with window above, but Flow doesn't detect it
+
+
+      offsetParent = offsetParent;
+
+      if (placement === top || (placement === left || placement === right) && variation === end) {
+        sideY = bottom;
+        var offsetY = isFixed && offsetParent === win && win.visualViewport ? win.visualViewport.height : // $FlowFixMe[prop-missing]
+        offsetParent[heightProp];
+        y -= offsetY - popperRect.height;
+        y *= gpuAcceleration ? 1 : -1;
+      }
+
+      if (placement === left || (placement === top || placement === bottom) && variation === end) {
+        sideX = right;
+        var offsetX = isFixed && offsetParent === win && win.visualViewport ? win.visualViewport.width : // $FlowFixMe[prop-missing]
+        offsetParent[widthProp];
+        x -= offsetX - popperRect.width;
+        x *= gpuAcceleration ? 1 : -1;
+      }
+    }
+
+    var commonStyles = Object.assign({
+      position: position
+    }, adaptive && unsetSides);
+
+    var _ref4 = roundOffsets === true ? roundOffsetsByDPR({
+      x: x,
+      y: y
+    }, getWindow(popper)) : {
+      x: x,
+      y: y
+    };
+
+    x = _ref4.x;
+    y = _ref4.y;
+
+    if (gpuAcceleration) {
+      var _Object$assign;
+
+      return Object.assign({}, commonStyles, (_Object$assign = {}, _Object$assign[sideY] = hasY ? '0' : '', _Object$assign[sideX] = hasX ? '0' : '', _Object$assign.transform = (win.devicePixelRatio || 1) <= 1 ? "translate(" + x + "px, " + y + "px)" : "translate3d(" + x + "px, " + y + "px, 0)", _Object$assign));
+    }
+
+    return Object.assign({}, commonStyles, (_Object$assign2 = {}, _Object$assign2[sideY] = hasY ? y + "px" : '', _Object$assign2[sideX] = hasX ? x + "px" : '', _Object$assign2.transform = '', _Object$assign2));
+  }
+
+  function computeStyles(_ref5) {
+    var state = _ref5.state,
+        options = _ref5.options;
+    var _options$gpuAccelerat = options.gpuAcceleration,
+        gpuAcceleration = _options$gpuAccelerat === void 0 ? true : _options$gpuAccelerat,
+        _options$adaptive = options.adaptive,
+        adaptive = _options$adaptive === void 0 ? true : _options$adaptive,
+        _options$roundOffsets = options.roundOffsets,
+        roundOffsets = _options$roundOffsets === void 0 ? true : _options$roundOffsets;
+    var commonStyles = {
+      placement: getBasePlacement(state.placement),
+      variation: getVariation(state.placement),
+      popper: state.elements.popper,
+      popperRect: state.rects.popper,
+      gpuAcceleration: gpuAcceleration,
+      isFixed: state.options.strategy === 'fixed'
+    };
+
+    if (state.modifiersData.popperOffsets != null) {
+      state.styles.popper = Object.assign({}, state.styles.popper, mapToStyles(Object.assign({}, commonStyles, {
+        offsets: state.modifiersData.popperOffsets,
+        position: state.options.strategy,
+        adaptive: adaptive,
+        roundOffsets: roundOffsets
+      })));
+    }
+
+    if (state.modifiersData.arrow != null) {
+      state.styles.arrow = Object.assign({}, state.styles.arrow, mapToStyles(Object.assign({}, commonStyles, {
+        offsets: state.modifiersData.arrow,
+        position: 'absolute',
+        adaptive: false,
+        roundOffsets: roundOffsets
+      })));
+    }
+
+    state.attributes.popper = Object.assign({}, state.attributes.popper, {
+      'data-popper-placement': state.placement
+    });
+  } // eslint-disable-next-line import/no-unused-modules
+
+
+  const computeStyles$1 = {
+    name: 'computeStyles',
+    enabled: true,
+    phase: 'beforeWrite',
+    fn: computeStyles,
+    data: {}
+  };
+
+  var passive = {
+    passive: true
+  };
+
+  function effect(_ref) {
+    var state = _ref.state,
+        instance = _ref.instance,
+        options = _ref.options;
+    var _options$scroll = options.scroll,
+        scroll = _options$scroll === void 0 ? true : _options$scroll,
+        _options$resize = options.resize,
+        resize = _options$resize === void 0 ? true : _options$resize;
+    var window = getWindow(state.elements.popper);
+    var scrollParents = [].concat(state.scrollParents.reference, state.scrollParents.popper);
+
+    if (scroll) {
+      scrollParents.forEach(function (scrollParent) {
+        scrollParent.addEventListener('scroll', instance.update, passive);
+      });
+    }
+
+    if (resize) {
+      window.addEventListener('resize', instance.update, passive);
+    }
+
+    return function () {
+      if (scroll) {
+        scrollParents.forEach(function (scrollParent) {
+          scrollParent.removeEventListener('scroll', instance.update, passive);
+        });
+      }
+
+      if (resize) {
+        window.removeEventListener('resize', instance.update, passive);
+      }
+    };
+  } // eslint-disable-next-line import/no-unused-modules
+
+
+  const eventListeners = {
+    name: 'eventListeners',
+    enabled: true,
+    phase: 'write',
+    fn: function fn() {},
+    effect: effect,
+    data: {}
+  };
+
+  var hash$1 = {
+    left: 'right',
+    right: 'left',
+    bottom: 'top',
+    top: 'bottom'
+  };
+  function getOppositePlacement(placement) {
+    return placement.replace(/left|right|bottom|top/g, function (matched) {
+      return hash$1[matched];
+    });
+  }
+
+  var hash = {
+    start: 'end',
+    end: 'start'
+  };
+  function getOppositeVariationPlacement(placement) {
+    return placement.replace(/start|end/g, function (matched) {
+      return hash[matched];
+    });
+  }
+
+  function getWindowScroll(node) {
+    var win = getWindow(node);
+    var scrollLeft = win.pageXOffset;
+    var scrollTop = win.pageYOffset;
+    return {
+      scrollLeft: scrollLeft,
+      scrollTop: scrollTop
+    };
+  }
+
+  function getWindowScrollBarX(element) {
+    // If <html> has a CSS width greater than the viewport, then this will be
+    // incorrect for RTL.
+    // Popper 1 is broken in this case and never had a bug report so let's assume
+    // it's not an issue. I don't think anyone ever specifies width on <html>
+    // anyway.
+    // Browsers where the left scrollbar doesn't cause an issue report `0` for
+    // this (e.g. Edge 2019, IE11, Safari)
+    return getBoundingClientRect(getDocumentElement(element)).left + getWindowScroll(element).scrollLeft;
+  }
+
+  function getViewportRect(element, strategy) {
+    var win = getWindow(element);
+    var html = getDocumentElement(element);
+    var visualViewport = win.visualViewport;
+    var width = html.clientWidth;
+    var height = html.clientHeight;
+    var x = 0;
+    var y = 0;
+
+    if (visualViewport) {
+      width = visualViewport.width;
+      height = visualViewport.height;
+      var layoutViewport = isLayoutViewport();
+
+      if (layoutViewport || !layoutViewport && strategy === 'fixed') {
+        x = visualViewport.offsetLeft;
+        y = visualViewport.offsetTop;
+      }
+    }
+
+    return {
+      width: width,
+      height: height,
+      x: x + getWindowScrollBarX(element),
+      y: y
+    };
+  }
+
+  // of the `<html>` and `<body>` rect bounds if horizontally scrollable
+
+  function getDocumentRect(element) {
+    var _element$ownerDocumen;
+
+    var html = getDocumentElement(element);
+    var winScroll = getWindowScroll(element);
+    var body = (_element$ownerDocumen = element.ownerDocument) == null ? void 0 : _element$ownerDocumen.body;
+    var width = max(html.scrollWidth, html.clientWidth, body ? body.scrollWidth : 0, body ? body.clientWidth : 0);
+    var height = max(html.scrollHeight, html.clientHeight, body ? body.scrollHeight : 0, body ? body.clientHeight : 0);
+    var x = -winScroll.scrollLeft + getWindowScrollBarX(element);
+    var y = -winScroll.scrollTop;
+
+    if (getComputedStyle$1(body || html).direction === 'rtl') {
+      x += max(html.clientWidth, body ? body.clientWidth : 0) - width;
+    }
+
+    return {
+      width: width,
+      height: height,
+      x: x,
+      y: y
+    };
+  }
+
+  function isScrollParent(element) {
+    // Firefox wants us to check `-x` and `-y` variations as well
+    var _getComputedStyle = getComputedStyle$1(element),
+        overflow = _getComputedStyle.overflow,
+        overflowX = _getComputedStyle.overflowX,
+        overflowY = _getComputedStyle.overflowY;
+
+    return /auto|scroll|overlay|hidden/.test(overflow + overflowY + overflowX);
+  }
+
+  function getScrollParent(node) {
+    if (['html', 'body', '#document'].indexOf(getNodeName(node)) >= 0) {
+      // $FlowFixMe[incompatible-return]: assume body is always available
+      return node.ownerDocument.body;
+    }
+
+    if (isHTMLElement(node) && isScrollParent(node)) {
+      return node;
+    }
+
+    return getScrollParent(getParentNode(node));
+  }
+
+  /*
+  given a DOM element, return the list of all scroll parents, up the list of ancesors
+  until we get to the top window object. This list is what we attach scroll listeners
+  to, because if any of these parent elements scroll, we'll need to re-calculate the
+  reference element's position.
+  */
+
+  function listScrollParents(element, list) {
+    var _element$ownerDocumen;
+
+    if (list === void 0) {
+      list = [];
+    }
+
+    var scrollParent = getScrollParent(element);
+    var isBody = scrollParent === ((_element$ownerDocumen = element.ownerDocument) == null ? void 0 : _element$ownerDocumen.body);
+    var win = getWindow(scrollParent);
+    var target = isBody ? [win].concat(win.visualViewport || [], isScrollParent(scrollParent) ? scrollParent : []) : scrollParent;
+    var updatedList = list.concat(target);
+    return isBody ? updatedList : // $FlowFixMe[incompatible-call]: isBody tells us target will be an HTMLElement here
+    updatedList.concat(listScrollParents(getParentNode(target)));
+  }
+
+  function rectToClientRect(rect) {
+    return Object.assign({}, rect, {
+      left: rect.x,
+      top: rect.y,
+      right: rect.x + rect.width,
+      bottom: rect.y + rect.height
+    });
+  }
+
+  function getInnerBoundingClientRect(element, strategy) {
+    var rect = getBoundingClientRect(element, false, strategy === 'fixed');
+    rect.top = rect.top + element.clientTop;
+    rect.left = rect.left + element.clientLeft;
+    rect.bottom = rect.top + element.clientHeight;
+    rect.right = rect.left + element.clientWidth;
+    rect.width = element.clientWidth;
+    rect.height = element.clientHeight;
+    rect.x = rect.left;
+    rect.y = rect.top;
+    return rect;
+  }
+
+  function getClientRectFromMixedType(element, clippingParent, strategy) {
+    return clippingParent === viewport ? rectToClientRect(getViewportRect(element, strategy)) : isElement(clippingParent) ? getInnerBoundingClientRect(clippingParent, strategy) : rectToClientRect(getDocumentRect(getDocumentElement(element)));
+  } // A "clipping parent" is an overflowable container with the characteristic of
+  // clipping (or hiding) overflowing elements with a position different from
+  // `initial`
+
+
+  function getClippingParents(element) {
+    var clippingParents = listScrollParents(getParentNode(element));
+    var canEscapeClipping = ['absolute', 'fixed'].indexOf(getComputedStyle$1(element).position) >= 0;
+    var clipperElement = canEscapeClipping && isHTMLElement(element) ? getOffsetParent(element) : element;
+
+    if (!isElement(clipperElement)) {
+      return [];
+    } // $FlowFixMe[incompatible-return]: https://github.com/facebook/flow/issues/1414
+
+
+    return clippingParents.filter(function (clippingParent) {
+      return isElement(clippingParent) && contains(clippingParent, clipperElement) && getNodeName(clippingParent) !== 'body';
+    });
+  } // Gets the maximum area that the element is visible in due to any number of
+  // clipping parents
+
+
+  function getClippingRect(element, boundary, rootBoundary, strategy) {
+    var mainClippingParents = boundary === 'clippingParents' ? getClippingParents(element) : [].concat(boundary);
+    var clippingParents = [].concat(mainClippingParents, [rootBoundary]);
+    var firstClippingParent = clippingParents[0];
+    var clippingRect = clippingParents.reduce(function (accRect, clippingParent) {
+      var rect = getClientRectFromMixedType(element, clippingParent, strategy);
+      accRect.top = max(rect.top, accRect.top);
+      accRect.right = min(rect.right, accRect.right);
+      accRect.bottom = min(rect.bottom, accRect.bottom);
+      accRect.left = max(rect.left, accRect.left);
+      return accRect;
+    }, getClientRectFromMixedType(element, firstClippingParent, strategy));
+    clippingRect.width = clippingRect.right - clippingRect.left;
+    clippingRect.height = clippingRect.bottom - clippingRect.top;
+    clippingRect.x = clippingRect.left;
+    clippingRect.y = clippingRect.top;
+    return clippingRect;
+  }
+
+  function computeOffsets(_ref) {
+    var reference = _ref.reference,
+        element = _ref.element,
+        placement = _ref.placement;
+    var basePlacement = placement ? getBasePlacement(placement) : null;
+    var variation = placement ? getVariation(placement) : null;
+    var commonX = reference.x + reference.width / 2 - element.width / 2;
+    var commonY = reference.y + reference.height / 2 - element.height / 2;
+    var offsets;
+
+    switch (basePlacement) {
+      case top:
+        offsets = {
+          x: commonX,
+          y: reference.y - element.height
+        };
+        break;
+
+      case bottom:
+        offsets = {
+          x: commonX,
+          y: reference.y + reference.height
+        };
+        break;
+
+      case right:
+        offsets = {
+          x: reference.x + reference.width,
+          y: commonY
+        };
+        break;
+
+      case left:
+        offsets = {
+          x: reference.x - element.width,
+          y: commonY
+        };
+        break;
+
+      default:
+        offsets = {
+          x: reference.x,
+          y: reference.y
+        };
+    }
+
+    var mainAxis = basePlacement ? getMainAxisFromPlacement(basePlacement) : null;
+
+    if (mainAxis != null) {
+      var len = mainAxis === 'y' ? 'height' : 'width';
+
+      switch (variation) {
+        case start:
+          offsets[mainAxis] = offsets[mainAxis] - (reference[len] / 2 - element[len] / 2);
+          break;
+
+        case end:
+          offsets[mainAxis] = offsets[mainAxis] + (reference[len] / 2 - element[len] / 2);
+          break;
+      }
+    }
+
+    return offsets;
+  }
+
+  function detectOverflow(state, options) {
+    if (options === void 0) {
+      options = {};
+    }
+
+    var _options = options,
+        _options$placement = _options.placement,
+        placement = _options$placement === void 0 ? state.placement : _options$placement,
+        _options$strategy = _options.strategy,
+        strategy = _options$strategy === void 0 ? state.strategy : _options$strategy,
+        _options$boundary = _options.boundary,
+        boundary = _options$boundary === void 0 ? clippingParents : _options$boundary,
+        _options$rootBoundary = _options.rootBoundary,
+        rootBoundary = _options$rootBoundary === void 0 ? viewport : _options$rootBoundary,
+        _options$elementConte = _options.elementContext,
+        elementContext = _options$elementConte === void 0 ? popper : _options$elementConte,
+        _options$altBoundary = _options.altBoundary,
+        altBoundary = _options$altBoundary === void 0 ? false : _options$altBoundary,
+        _options$padding = _options.padding,
+        padding = _options$padding === void 0 ? 0 : _options$padding;
+    var paddingObject = mergePaddingObject(typeof padding !== 'number' ? padding : expandToHashMap(padding, basePlacements));
+    var altContext = elementContext === popper ? reference : popper;
+    var popperRect = state.rects.popper;
+    var element = state.elements[altBoundary ? altContext : elementContext];
+    var clippingClientRect = getClippingRect(isElement(element) ? element : element.contextElement || getDocumentElement(state.elements.popper), boundary, rootBoundary, strategy);
+    var referenceClientRect = getBoundingClientRect(state.elements.reference);
+    var popperOffsets = computeOffsets({
+      reference: referenceClientRect,
+      element: popperRect,
+      strategy: 'absolute',
+      placement: placement
+    });
+    var popperClientRect = rectToClientRect(Object.assign({}, popperRect, popperOffsets));
+    var elementClientRect = elementContext === popper ? popperClientRect : referenceClientRect; // positive = overflowing the clipping rect
+    // 0 or negative = within the clipping rect
+
+    var overflowOffsets = {
+      top: clippingClientRect.top - elementClientRect.top + paddingObject.top,
+      bottom: elementClientRect.bottom - clippingClientRect.bottom + paddingObject.bottom,
+      left: clippingClientRect.left - elementClientRect.left + paddingObject.left,
+      right: elementClientRect.right - clippingClientRect.right + paddingObject.right
+    };
+    var offsetData = state.modifiersData.offset; // Offsets can be applied only to the popper element
+
+    if (elementContext === popper && offsetData) {
+      var offset = offsetData[placement];
+      Object.keys(overflowOffsets).forEach(function (key) {
+        var multiply = [right, bottom].indexOf(key) >= 0 ? 1 : -1;
+        var axis = [top, bottom].indexOf(key) >= 0 ? 'y' : 'x';
+        overflowOffsets[key] += offset[axis] * multiply;
+      });
+    }
+
+    return overflowOffsets;
+  }
+
+  function computeAutoPlacement(state, options) {
+    if (options === void 0) {
+      options = {};
+    }
+
+    var _options = options,
+        placement = _options.placement,
+        boundary = _options.boundary,
+        rootBoundary = _options.rootBoundary,
+        padding = _options.padding,
+        flipVariations = _options.flipVariations,
+        _options$allowedAutoP = _options.allowedAutoPlacements,
+        allowedAutoPlacements = _options$allowedAutoP === void 0 ? placements : _options$allowedAutoP;
+    var variation = getVariation(placement);
+    var placements$1 = variation ? flipVariations ? variationPlacements : variationPlacements.filter(function (placement) {
+      return getVariation(placement) === variation;
+    }) : basePlacements;
+    var allowedPlacements = placements$1.filter(function (placement) {
+      return allowedAutoPlacements.indexOf(placement) >= 0;
+    });
+
+    if (allowedPlacements.length === 0) {
+      allowedPlacements = placements$1;
+    } // $FlowFixMe[incompatible-type]: Flow seems to have problems with two array unions...
+
+
+    var overflows = allowedPlacements.reduce(function (acc, placement) {
+      acc[placement] = detectOverflow(state, {
+        placement: placement,
+        boundary: boundary,
+        rootBoundary: rootBoundary,
+        padding: padding
+      })[getBasePlacement(placement)];
+      return acc;
+    }, {});
+    return Object.keys(overflows).sort(function (a, b) {
+      return overflows[a] - overflows[b];
+    });
+  }
+
+  function getExpandedFallbackPlacements(placement) {
+    if (getBasePlacement(placement) === auto) {
+      return [];
+    }
+
+    var oppositePlacement = getOppositePlacement(placement);
+    return [getOppositeVariationPlacement(placement), oppositePlacement, getOppositeVariationPlacement(oppositePlacement)];
+  }
+
+  function flip(_ref) {
+    var state = _ref.state,
+        options = _ref.options,
+        name = _ref.name;
+
+    if (state.modifiersData[name]._skip) {
+      return;
+    }
+
+    var _options$mainAxis = options.mainAxis,
+        checkMainAxis = _options$mainAxis === void 0 ? true : _options$mainAxis,
+        _options$altAxis = options.altAxis,
+        checkAltAxis = _options$altAxis === void 0 ? true : _options$altAxis,
+        specifiedFallbackPlacements = options.fallbackPlacements,
+        padding = options.padding,
+        boundary = options.boundary,
+        rootBoundary = options.rootBoundary,
+        altBoundary = options.altBoundary,
+        _options$flipVariatio = options.flipVariations,
+        flipVariations = _options$flipVariatio === void 0 ? true : _options$flipVariatio,
+        allowedAutoPlacements = options.allowedAutoPlacements;
+    var preferredPlacement = state.options.placement;
+    var basePlacement = getBasePlacement(preferredPlacement);
+    var isBasePlacement = basePlacement === preferredPlacement;
+    var fallbackPlacements = specifiedFallbackPlacements || (isBasePlacement || !flipVariations ? [getOppositePlacement(preferredPlacement)] : getExpandedFallbackPlacements(preferredPlacement));
+    var placements = [preferredPlacement].concat(fallbackPlacements).reduce(function (acc, placement) {
+      return acc.concat(getBasePlacement(placement) === auto ? computeAutoPlacement(state, {
+        placement: placement,
+        boundary: boundary,
+        rootBoundary: rootBoundary,
+        padding: padding,
+        flipVariations: flipVariations,
+        allowedAutoPlacements: allowedAutoPlacements
+      }) : placement);
+    }, []);
+    var referenceRect = state.rects.reference;
+    var popperRect = state.rects.popper;
+    var checksMap = new Map();
+    var makeFallbackChecks = true;
+    var firstFittingPlacement = placements[0];
+
+    for (var i = 0; i < placements.length; i++) {
+      var placement = placements[i];
+
+      var _basePlacement = getBasePlacement(placement);
+
+      var isStartVariation = getVariation(placement) === start;
+      var isVertical = [top, bottom].indexOf(_basePlacement) >= 0;
+      var len = isVertical ? 'width' : 'height';
+      var overflow = detectOverflow(state, {
+        placement: placement,
+        boundary: boundary,
+        rootBoundary: rootBoundary,
+        altBoundary: altBoundary,
+        padding: padding
+      });
+      var mainVariationSide = isVertical ? isStartVariation ? right : left : isStartVariation ? bottom : top;
+
+      if (referenceRect[len] > popperRect[len]) {
+        mainVariationSide = getOppositePlacement(mainVariationSide);
+      }
+
+      var altVariationSide = getOppositePlacement(mainVariationSide);
+      var checks = [];
+
+      if (checkMainAxis) {
+        checks.push(overflow[_basePlacement] <= 0);
+      }
+
+      if (checkAltAxis) {
+        checks.push(overflow[mainVariationSide] <= 0, overflow[altVariationSide] <= 0);
+      }
+
+      if (checks.every(function (check) {
+        return check;
+      })) {
+        firstFittingPlacement = placement;
+        makeFallbackChecks = false;
+        break;
+      }
+
+      checksMap.set(placement, checks);
+    }
+
+    if (makeFallbackChecks) {
+      // `2` may be desired in some cases – research later
+      var numberOfChecks = flipVariations ? 3 : 1;
+
+      var _loop = function _loop(_i) {
+        var fittingPlacement = placements.find(function (placement) {
+          var checks = checksMap.get(placement);
+
+          if (checks) {
+            return checks.slice(0, _i).every(function (check) {
+              return check;
+            });
+          }
+        });
+
+        if (fittingPlacement) {
+          firstFittingPlacement = fittingPlacement;
+          return "break";
+        }
+      };
+
+      for (var _i = numberOfChecks; _i > 0; _i--) {
+        var _ret = _loop(_i);
+
+        if (_ret === "break") break;
+      }
+    }
+
+    if (state.placement !== firstFittingPlacement) {
+      state.modifiersData[name]._skip = true;
+      state.placement = firstFittingPlacement;
+      state.reset = true;
+    }
+  } // eslint-disable-next-line import/no-unused-modules
+
+
+  const flip$1 = {
+    name: 'flip',
+    enabled: true,
+    phase: 'main',
+    fn: flip,
+    requiresIfExists: ['offset'],
+    data: {
+      _skip: false
+    }
+  };
+
+  function getSideOffsets(overflow, rect, preventedOffsets) {
+    if (preventedOffsets === void 0) {
+      preventedOffsets = {
+        x: 0,
+        y: 0
+      };
+    }
+
+    return {
+      top: overflow.top - rect.height - preventedOffsets.y,
+      right: overflow.right - rect.width + preventedOffsets.x,
+      bottom: overflow.bottom - rect.height + preventedOffsets.y,
+      left: overflow.left - rect.width - preventedOffsets.x
+    };
+  }
+
+  function isAnySideFullyClipped(overflow) {
+    return [top, right, bottom, left].some(function (side) {
+      return overflow[side] >= 0;
+    });
+  }
+
+  function hide(_ref) {
+    var state = _ref.state,
+        name = _ref.name;
+    var referenceRect = state.rects.reference;
+    var popperRect = state.rects.popper;
+    var preventedOffsets = state.modifiersData.preventOverflow;
+    var referenceOverflow = detectOverflow(state, {
+      elementContext: 'reference'
+    });
+    var popperAltOverflow = detectOverflow(state, {
+      altBoundary: true
+    });
+    var referenceClippingOffsets = getSideOffsets(referenceOverflow, referenceRect);
+    var popperEscapeOffsets = getSideOffsets(popperAltOverflow, popperRect, preventedOffsets);
+    var isReferenceHidden = isAnySideFullyClipped(referenceClippingOffsets);
+    var hasPopperEscaped = isAnySideFullyClipped(popperEscapeOffsets);
+    state.modifiersData[name] = {
+      referenceClippingOffsets: referenceClippingOffsets,
+      popperEscapeOffsets: popperEscapeOffsets,
+      isReferenceHidden: isReferenceHidden,
+      hasPopperEscaped: hasPopperEscaped
+    };
+    state.attributes.popper = Object.assign({}, state.attributes.popper, {
+      'data-popper-reference-hidden': isReferenceHidden,
+      'data-popper-escaped': hasPopperEscaped
+    });
+  } // eslint-disable-next-line import/no-unused-modules
+
+
+  const hide$1 = {
+    name: 'hide',
+    enabled: true,
+    phase: 'main',
+    requiresIfExists: ['preventOverflow'],
+    fn: hide
+  };
+
+  function distanceAndSkiddingToXY(placement, rects, offset) {
+    var basePlacement = getBasePlacement(placement);
+    var invertDistance = [left, top].indexOf(basePlacement) >= 0 ? -1 : 1;
+
+    var _ref = typeof offset === 'function' ? offset(Object.assign({}, rects, {
+      placement: placement
+    })) : offset,
+        skidding = _ref[0],
+        distance = _ref[1];
+
+    skidding = skidding || 0;
+    distance = (distance || 0) * invertDistance;
+    return [left, right].indexOf(basePlacement) >= 0 ? {
+      x: distance,
+      y: skidding
+    } : {
+      x: skidding,
+      y: distance
+    };
+  }
+
+  function offset(_ref2) {
+    var state = _ref2.state,
+        options = _ref2.options,
+        name = _ref2.name;
+    var _options$offset = options.offset,
+        offset = _options$offset === void 0 ? [0, 0] : _options$offset;
+    var data = placements.reduce(function (acc, placement) {
+      acc[placement] = distanceAndSkiddingToXY(placement, state.rects, offset);
+      return acc;
+    }, {});
+    var _data$state$placement = data[state.placement],
+        x = _data$state$placement.x,
+        y = _data$state$placement.y;
+
+    if (state.modifiersData.popperOffsets != null) {
+      state.modifiersData.popperOffsets.x += x;
+      state.modifiersData.popperOffsets.y += y;
+    }
+
+    state.modifiersData[name] = data;
+  } // eslint-disable-next-line import/no-unused-modules
+
+
+  const offset$1 = {
+    name: 'offset',
+    enabled: true,
+    phase: 'main',
+    requires: ['popperOffsets'],
+    fn: offset
+  };
+
+  function popperOffsets(_ref) {
+    var state = _ref.state,
+        name = _ref.name;
+    // Offsets are the actual position the popper needs to have to be
+    // properly positioned near its reference element
+    // This is the most basic placement, and will be adjusted by
+    // the modifiers in the next step
+    state.modifiersData[name] = computeOffsets({
+      reference: state.rects.reference,
+      element: state.rects.popper,
+      strategy: 'absolute',
+      placement: state.placement
+    });
+  } // eslint-disable-next-line import/no-unused-modules
+
+
+  const popperOffsets$1 = {
+    name: 'popperOffsets',
+    enabled: true,
+    phase: 'read',
+    fn: popperOffsets,
+    data: {}
+  };
+
+  function getAltAxis(axis) {
+    return axis === 'x' ? 'y' : 'x';
+  }
+
+  function preventOverflow(_ref) {
+    var state = _ref.state,
+        options = _ref.options,
+        name = _ref.name;
+    var _options$mainAxis = options.mainAxis,
+        checkMainAxis = _options$mainAxis === void 0 ? true : _options$mainAxis,
+        _options$altAxis = options.altAxis,
+        checkAltAxis = _options$altAxis === void 0 ? false : _options$altAxis,
+        boundary = options.boundary,
+        rootBoundary = options.rootBoundary,
+        altBoundary = options.altBoundary,
+        padding = options.padding,
+        _options$tether = options.tether,
+        tether = _options$tether === void 0 ? true : _options$tether,
+        _options$tetherOffset = options.tetherOffset,
+        tetherOffset = _options$tetherOffset === void 0 ? 0 : _options$tetherOffset;
+    var overflow = detectOverflow(state, {
+      boundary: boundary,
+      rootBoundary: rootBoundary,
+      padding: padding,
+      altBoundary: altBoundary
+    });
+    var basePlacement = getBasePlacement(state.placement);
+    var variation = getVariation(state.placement);
+    var isBasePlacement = !variation;
+    var mainAxis = getMainAxisFromPlacement(basePlacement);
+    var altAxis = getAltAxis(mainAxis);
+    var popperOffsets = state.modifiersData.popperOffsets;
+    var referenceRect = state.rects.reference;
+    var popperRect = state.rects.popper;
+    var tetherOffsetValue = typeof tetherOffset === 'function' ? tetherOffset(Object.assign({}, state.rects, {
+      placement: state.placement
+    })) : tetherOffset;
+    var normalizedTetherOffsetValue = typeof tetherOffsetValue === 'number' ? {
+      mainAxis: tetherOffsetValue,
+      altAxis: tetherOffsetValue
+    } : Object.assign({
+      mainAxis: 0,
+      altAxis: 0
+    }, tetherOffsetValue);
+    var offsetModifierState = state.modifiersData.offset ? state.modifiersData.offset[state.placement] : null;
+    var data = {
+      x: 0,
+      y: 0
+    };
+
+    if (!popperOffsets) {
+      return;
+    }
+
+    if (checkMainAxis) {
+      var _offsetModifierState$;
+
+      var mainSide = mainAxis === 'y' ? top : left;
+      var altSide = mainAxis === 'y' ? bottom : right;
+      var len = mainAxis === 'y' ? 'height' : 'width';
+      var offset = popperOffsets[mainAxis];
+      var min$1 = offset + overflow[mainSide];
+      var max$1 = offset - overflow[altSide];
+      var additive = tether ? -popperRect[len] / 2 : 0;
+      var minLen = variation === start ? referenceRect[len] : popperRect[len];
+      var maxLen = variation === start ? -popperRect[len] : -referenceRect[len]; // We need to include the arrow in the calculation so the arrow doesn't go
+      // outside the reference bounds
+
+      var arrowElement = state.elements.arrow;
+      var arrowRect = tether && arrowElement ? getLayoutRect(arrowElement) : {
+        width: 0,
+        height: 0
+      };
+      var arrowPaddingObject = state.modifiersData['arrow#persistent'] ? state.modifiersData['arrow#persistent'].padding : getFreshSideObject();
+      var arrowPaddingMin = arrowPaddingObject[mainSide];
+      var arrowPaddingMax = arrowPaddingObject[altSide]; // If the reference length is smaller than the arrow length, we don't want
+      // to include its full size in the calculation. If the reference is small
+      // and near the edge of a boundary, the popper can overflow even if the
+      // reference is not overflowing as well (e.g. virtual elements with no
+      // width or height)
+
+      var arrowLen = within(0, referenceRect[len], arrowRect[len]);
+      var minOffset = isBasePlacement ? referenceRect[len] / 2 - additive - arrowLen - arrowPaddingMin - normalizedTetherOffsetValue.mainAxis : minLen - arrowLen - arrowPaddingMin - normalizedTetherOffsetValue.mainAxis;
+      var maxOffset = isBasePlacement ? -referenceRect[len] / 2 + additive + arrowLen + arrowPaddingMax + normalizedTetherOffsetValue.mainAxis : maxLen + arrowLen + arrowPaddingMax + normalizedTetherOffsetValue.mainAxis;
+      var arrowOffsetParent = state.elements.arrow && getOffsetParent(state.elements.arrow);
+      var clientOffset = arrowOffsetParent ? mainAxis === 'y' ? arrowOffsetParent.clientTop || 0 : arrowOffsetParent.clientLeft || 0 : 0;
+      var offsetModifierValue = (_offsetModifierState$ = offsetModifierState == null ? void 0 : offsetModifierState[mainAxis]) != null ? _offsetModifierState$ : 0;
+      var tetherMin = offset + minOffset - offsetModifierValue - clientOffset;
+      var tetherMax = offset + maxOffset - offsetModifierValue;
+      var preventedOffset = within(tether ? min(min$1, tetherMin) : min$1, offset, tether ? max(max$1, tetherMax) : max$1);
+      popperOffsets[mainAxis] = preventedOffset;
+      data[mainAxis] = preventedOffset - offset;
+    }
+
+    if (checkAltAxis) {
+      var _offsetModifierState$2;
+
+      var _mainSide = mainAxis === 'x' ? top : left;
+
+      var _altSide = mainAxis === 'x' ? bottom : right;
+
+      var _offset = popperOffsets[altAxis];
+
+      var _len = altAxis === 'y' ? 'height' : 'width';
+
+      var _min = _offset + overflow[_mainSide];
+
+      var _max = _offset - overflow[_altSide];
+
+      var isOriginSide = [top, left].indexOf(basePlacement) !== -1;
+
+      var _offsetModifierValue = (_offsetModifierState$2 = offsetModifierState == null ? void 0 : offsetModifierState[altAxis]) != null ? _offsetModifierState$2 : 0;
+
+      var _tetherMin = isOriginSide ? _min : _offset - referenceRect[_len] - popperRect[_len] - _offsetModifierValue + normalizedTetherOffsetValue.altAxis;
+
+      var _tetherMax = isOriginSide ? _offset + referenceRect[_len] + popperRect[_len] - _offsetModifierValue - normalizedTetherOffsetValue.altAxis : _max;
+
+      var _preventedOffset = tether && isOriginSide ? withinMaxClamp(_tetherMin, _offset, _tetherMax) : within(tether ? _tetherMin : _min, _offset, tether ? _tetherMax : _max);
+
+      popperOffsets[altAxis] = _preventedOffset;
+      data[altAxis] = _preventedOffset - _offset;
+    }
+
+    state.modifiersData[name] = data;
+  } // eslint-disable-next-line import/no-unused-modules
+
+
+  const preventOverflow$1 = {
+    name: 'preventOverflow',
+    enabled: true,
+    phase: 'main',
+    fn: preventOverflow,
+    requiresIfExists: ['offset']
+  };
+
+  function getHTMLElementScroll(element) {
+    return {
+      scrollLeft: element.scrollLeft,
+      scrollTop: element.scrollTop
+    };
+  }
+
+  function getNodeScroll(node) {
+    if (node === getWindow(node) || !isHTMLElement(node)) {
+      return getWindowScroll(node);
+    } else {
+      return getHTMLElementScroll(node);
+    }
+  }
+
+  function isElementScaled(element) {
+    var rect = element.getBoundingClientRect();
+    var scaleX = round(rect.width) / element.offsetWidth || 1;
+    var scaleY = round(rect.height) / element.offsetHeight || 1;
+    return scaleX !== 1 || scaleY !== 1;
+  } // Returns the composite rect of an element relative to its offsetParent.
+  // Composite means it takes into account transforms as well as layout.
+
+
+  function getCompositeRect(elementOrVirtualElement, offsetParent, isFixed) {
+    if (isFixed === void 0) {
+      isFixed = false;
+    }
+
+    var isOffsetParentAnElement = isHTMLElement(offsetParent);
+    var offsetParentIsScaled = isHTMLElement(offsetParent) && isElementScaled(offsetParent);
+    var documentElement = getDocumentElement(offsetParent);
+    var rect = getBoundingClientRect(elementOrVirtualElement, offsetParentIsScaled, isFixed);
+    var scroll = {
+      scrollLeft: 0,
+      scrollTop: 0
+    };
+    var offsets = {
+      x: 0,
+      y: 0
+    };
+
+    if (isOffsetParentAnElement || !isOffsetParentAnElement && !isFixed) {
+      if (getNodeName(offsetParent) !== 'body' || // https://github.com/popperjs/popper-core/issues/1078
+      isScrollParent(documentElement)) {
+        scroll = getNodeScroll(offsetParent);
+      }
+
+      if (isHTMLElement(offsetParent)) {
+        offsets = getBoundingClientRect(offsetParent, true);
+        offsets.x += offsetParent.clientLeft;
+        offsets.y += offsetParent.clientTop;
+      } else if (documentElement) {
+        offsets.x = getWindowScrollBarX(documentElement);
+      }
+    }
+
+    return {
+      x: rect.left + scroll.scrollLeft - offsets.x,
+      y: rect.top + scroll.scrollTop - offsets.y,
+      width: rect.width,
+      height: rect.height
+    };
+  }
+
+  function order(modifiers) {
+    var map = new Map();
+    var visited = new Set();
+    var result = [];
+    modifiers.forEach(function (modifier) {
+      map.set(modifier.name, modifier);
+    }); // On visiting object, check for its dependencies and visit them recursively
+
+    function sort(modifier) {
+      visited.add(modifier.name);
+      var requires = [].concat(modifier.requires || [], modifier.requiresIfExists || []);
+      requires.forEach(function (dep) {
+        if (!visited.has(dep)) {
+          var depModifier = map.get(dep);
+
+          if (depModifier) {
+            sort(depModifier);
+          }
+        }
+      });
+      result.push(modifier);
+    }
+
+    modifiers.forEach(function (modifier) {
+      if (!visited.has(modifier.name)) {
+        // check for visited object
+        sort(modifier);
+      }
+    });
+    return result;
+  }
+
+  function orderModifiers(modifiers) {
+    // order based on dependencies
+    var orderedModifiers = order(modifiers); // order based on phase
+
+    return modifierPhases.reduce(function (acc, phase) {
+      return acc.concat(orderedModifiers.filter(function (modifier) {
+        return modifier.phase === phase;
+      }));
+    }, []);
+  }
+
+  function debounce(fn) {
+    var pending;
+    return function () {
+      if (!pending) {
+        pending = new Promise(function (resolve) {
+          Promise.resolve().then(function () {
+            pending = undefined;
+            resolve(fn());
+          });
+        });
+      }
+
+      return pending;
+    };
+  }
+
+  function mergeByName(modifiers) {
+    var merged = modifiers.reduce(function (merged, current) {
+      var existing = merged[current.name];
+      merged[current.name] = existing ? Object.assign({}, existing, current, {
+        options: Object.assign({}, existing.options, current.options),
+        data: Object.assign({}, existing.data, current.data)
+      }) : current;
+      return merged;
+    }, {}); // IE11 does not support Object.values
+
+    return Object.keys(merged).map(function (key) {
+      return merged[key];
+    });
+  }
+
+  var DEFAULT_OPTIONS = {
+    placement: 'bottom',
+    modifiers: [],
+    strategy: 'absolute'
+  };
+
+  function areValidElements() {
+    for (var _len = arguments.length, args = new Array(_len), _key = 0; _key < _len; _key++) {
+      args[_key] = arguments[_key];
+    }
+
+    return !args.some(function (element) {
+      return !(element && typeof element.getBoundingClientRect === 'function');
+    });
+  }
+
+  function popperGenerator(generatorOptions) {
+    if (generatorOptions === void 0) {
+      generatorOptions = {};
+    }
+
+    var _generatorOptions = generatorOptions,
+        _generatorOptions$def = _generatorOptions.defaultModifiers,
+        defaultModifiers = _generatorOptions$def === void 0 ? [] : _generatorOptions$def,
+        _generatorOptions$def2 = _generatorOptions.defaultOptions,
+        defaultOptions = _generatorOptions$def2 === void 0 ? DEFAULT_OPTIONS : _generatorOptions$def2;
+    return function createPopper(reference, popper, options) {
+      if (options === void 0) {
+        options = defaultOptions;
+      }
+
+      var state = {
+        placement: 'bottom',
+        orderedModifiers: [],
+        options: Object.assign({}, DEFAULT_OPTIONS, defaultOptions),
+        modifiersData: {},
+        elements: {
+          reference: reference,
+          popper: popper
+        },
+        attributes: {},
+        styles: {}
+      };
+      var effectCleanupFns = [];
+      var isDestroyed = false;
+      var instance = {
+        state: state,
+        setOptions: function setOptions(setOptionsAction) {
+          var options = typeof setOptionsAction === 'function' ? setOptionsAction(state.options) : setOptionsAction;
+          cleanupModifierEffects();
+          state.options = Object.assign({}, defaultOptions, state.options, options);
+          state.scrollParents = {
+            reference: isElement(reference) ? listScrollParents(reference) : reference.contextElement ? listScrollParents(reference.contextElement) : [],
+            popper: listScrollParents(popper)
+          }; // Orders the modifiers based on their dependencies and `phase`
+          // properties
+
+          var orderedModifiers = orderModifiers(mergeByName([].concat(defaultModifiers, state.options.modifiers))); // Strip out disabled modifiers
+
+          state.orderedModifiers = orderedModifiers.filter(function (m) {
+            return m.enabled;
+          });
+          runModifierEffects();
+          return instance.update();
+        },
+        // Sync update – it will always be executed, even if not necessary. This
+        // is useful for low frequency updates where sync behavior simplifies the
+        // logic.
+        // For high frequency updates (e.g. `resize` and `scroll` events), always
+        // prefer the async Popper#update method
+        forceUpdate: function forceUpdate() {
+          if (isDestroyed) {
+            return;
+          }
+
+          var _state$elements = state.elements,
+              reference = _state$elements.reference,
+              popper = _state$elements.popper; // Don't proceed if `reference` or `popper` are not valid elements
+          // anymore
+
+          if (!areValidElements(reference, popper)) {
+            return;
+          } // Store the reference and popper rects to be read by modifiers
+
+
+          state.rects = {
+            reference: getCompositeRect(reference, getOffsetParent(popper), state.options.strategy === 'fixed'),
+            popper: getLayoutRect(popper)
+          }; // Modifiers have the ability to reset the current update cycle. The
+          // most common use case for this is the `flip` modifier changing the
+          // placement, which then needs to re-run all the modifiers, because the
+          // logic was previously ran for the previous placement and is therefore
+          // stale/incorrect
+
+          state.reset = false;
+          state.placement = state.options.placement; // On each update cycle, the `modifiersData` property for each modifier
+          // is filled with the initial data specified by the modifier. This means
+          // it doesn't persist and is fresh on each update.
+          // To ensure persistent data, use `${name}#persistent`
+
+          state.orderedModifiers.forEach(function (modifier) {
+            return state.modifiersData[modifier.name] = Object.assign({}, modifier.data);
+          });
+
+          for (var index = 0; index < state.orderedModifiers.length; index++) {
+            if (state.reset === true) {
+              state.reset = false;
+              index = -1;
+              continue;
+            }
+
+            var _state$orderedModifie = state.orderedModifiers[index],
+                fn = _state$orderedModifie.fn,
+                _state$orderedModifie2 = _state$orderedModifie.options,
+                _options = _state$orderedModifie2 === void 0 ? {} : _state$orderedModifie2,
+                name = _state$orderedModifie.name;
+
+            if (typeof fn === 'function') {
+              state = fn({
+                state: state,
+                options: _options,
+                name: name,
+                instance: instance
+              }) || state;
+            }
+          }
+        },
+        // Async and optimistically optimized update – it will not be executed if
+        // not necessary (debounced to run at most once-per-tick)
+        update: debounce(function () {
+          return new Promise(function (resolve) {
+            instance.forceUpdate();
+            resolve(state);
+          });
+        }),
+        destroy: function destroy() {
+          cleanupModifierEffects();
+          isDestroyed = true;
+        }
+      };
+
+      if (!areValidElements(reference, popper)) {
+        return instance;
+      }
+
+      instance.setOptions(options).then(function (state) {
+        if (!isDestroyed && options.onFirstUpdate) {
+          options.onFirstUpdate(state);
+        }
+      }); // Modifiers have the ability to execute arbitrary code before the first
+      // update cycle runs. They will be executed in the same order as the update
+      // cycle. This is useful when a modifier adds some persistent data that
+      // other modifiers need to use, but the modifier is run after the dependent
+      // one.
+
+      function runModifierEffects() {
+        state.orderedModifiers.forEach(function (_ref) {
+          var name = _ref.name,
+              _ref$options = _ref.options,
+              options = _ref$options === void 0 ? {} : _ref$options,
+              effect = _ref.effect;
+
+          if (typeof effect === 'function') {
+            var cleanupFn = effect({
+              state: state,
+              name: name,
+              instance: instance,
+              options: options
+            });
+
+            var noopFn = function noopFn() {};
+
+            effectCleanupFns.push(cleanupFn || noopFn);
+          }
+        });
+      }
+
+      function cleanupModifierEffects() {
+        effectCleanupFns.forEach(function (fn) {
+          return fn();
+        });
+        effectCleanupFns = [];
+      }
+
+      return instance;
+    };
+  }
+  var createPopper$2 = /*#__PURE__*/popperGenerator(); // eslint-disable-next-line import/no-unused-modules
+
+  var defaultModifiers$1 = [eventListeners, popperOffsets$1, computeStyles$1, applyStyles$1];
+  var createPopper$1 = /*#__PURE__*/popperGenerator({
+    defaultModifiers: defaultModifiers$1
+  }); // eslint-disable-next-line import/no-unused-modules
+
+  var defaultModifiers = [eventListeners, popperOffsets$1, computeStyles$1, applyStyles$1, offset$1, flip$1, preventOverflow$1, arrow$1, hide$1];
+  var createPopper = /*#__PURE__*/popperGenerator({
+    defaultModifiers: defaultModifiers
+  }); // eslint-disable-next-line import/no-unused-modules
+
+  const Popper = /*#__PURE__*/Object.freeze(/*#__PURE__*/Object.defineProperty({
+    __proto__: null,
+    afterMain,
+    afterRead,
+    afterWrite,
+    applyStyles: applyStyles$1,
+    arrow: arrow$1,
+    auto,
+    basePlacements,
+    beforeMain,
+    beforeRead,
+    beforeWrite,
+    bottom,
+    clippingParents,
+    computeStyles: computeStyles$1,
+    createPopper,
+    createPopperBase: createPopper$2,
+    createPopperLite: createPopper$1,
+    detectOverflow,
+    end,
+    eventListeners,
+    flip: flip$1,
+    hide: hide$1,
+    left,
+    main,
+    modifierPhases,
+    offset: offset$1,
+    placements,
+    popper,
+    popperGenerator,
+    popperOffsets: popperOffsets$1,
+    preventOverflow: preventOverflow$1,
+    read,
+    reference,
+    right,
+    start,
+    top,
+    variationPlacements,
+    viewport,
+    write
+  }, Symbol.toStringTag, { value: 'Module' }));
+
+  /**
+   * --------------------------------------------------------------------------
+   * Bootstrap dropdown.js
+   * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)
+   * --------------------------------------------------------------------------
+   */
+
+
+  /**
+   * Constants
+   */
+
+  const NAME$a = 'dropdown';
+  const DATA_KEY$6 = 'bs.dropdown';
+  const EVENT_KEY$6 = `.${DATA_KEY$6}`;
+  const DATA_API_KEY$3 = '.data-api';
+  const ESCAPE_KEY$2 = 'Escape';
+  const TAB_KEY$1 = 'Tab';
+  const ARROW_UP_KEY$1 = 'ArrowUp';
+  const ARROW_DOWN_KEY$1 = 'ArrowDown';
+  const RIGHT_MOUSE_BUTTON = 2; // MouseEvent.button value for the secondary button, usually the right button
+
+  const EVENT_HIDE$5 = `hide${EVENT_KEY$6}`;
+  const EVENT_HIDDEN$5 = `hidden${EVENT_KEY$6}`;
+  const EVENT_SHOW$5 = `show${EVENT_KEY$6}`;
+  const EVENT_SHOWN$5 = `shown${EVENT_KEY$6}`;
+  const EVENT_CLICK_DATA_API$3 = `click${EVENT_KEY$6}${DATA_API_KEY$3}`;
+  const EVENT_KEYDOWN_DATA_API = `keydown${EVENT_KEY$6}${DATA_API_KEY$3}`;
+  const EVENT_KEYUP_DATA_API = `keyup${EVENT_KEY$6}${DATA_API_KEY$3}`;
+  const CLASS_NAME_SHOW$6 = 'show';
+  const CLASS_NAME_DROPUP = 'dropup';
+  const CLASS_NAME_DROPEND = 'dropend';
+  const CLASS_NAME_DROPSTART = 'dropstart';
+  const CLASS_NAME_DROPUP_CENTER = 'dropup-center';
+  const CLASS_NAME_DROPDOWN_CENTER = 'dropdown-center';
+  const SELECTOR_DATA_TOGGLE$3 = '[data-bs-toggle="dropdown"]:not(.disabled):not(:disabled)';
+  const SELECTOR_DATA_TOGGLE_SHOWN = `${SELECTOR_DATA_TOGGLE$3}.${CLASS_NAME_SHOW$6}`;
+  const SELECTOR_MENU = '.dropdown-menu';
+  const SELECTOR_NAVBAR = '.navbar';
+  const SELECTOR_NAVBAR_NAV = '.navbar-nav';
+  const SELECTOR_VISIBLE_ITEMS = '.dropdown-menu .dropdown-item:not(.disabled):not(:disabled)';
+  const PLACEMENT_TOP = isRTL() ? 'top-end' : 'top-start';
+  const PLACEMENT_TOPEND = isRTL() ? 'top-start' : 'top-end';
+  const PLACEMENT_BOTTOM = isRTL() ? 'bottom-end' : 'bottom-start';
+  const PLACEMENT_BOTTOMEND = isRTL() ? 'bottom-start' : 'bottom-end';
+  const PLACEMENT_RIGHT = isRTL() ? 'left-start' : 'right-start';
+  const PLACEMENT_LEFT = isRTL() ? 'right-start' : 'left-start';
+  const PLACEMENT_TOPCENTER = 'top';
+  const PLACEMENT_BOTTOMCENTER = 'bottom';
+  const Default$9 = {
+    autoClose: true,
+    boundary: 'clippingParents',
+    display: 'dynamic',
+    offset: [0, 2],
+    popperConfig: null,
+    reference: 'toggle'
+  };
+  const DefaultType$9 = {
+    autoClose: '(boolean|string)',
+    boundary: '(string|element)',
+    display: 'string',
+    offset: '(array|string|function)',
+    popperConfig: '(null|object|function)',
+    reference: '(string|element|object)'
+  };
+
+  /**
+   * Class definition
+   */
+
+  class Dropdown extends BaseComponent {
+    constructor(element, config) {
+      super(element, config);
+      this._popper = null;
+      this._parent = this._element.parentNode; // dropdown wrapper
+      // TODO: v6 revert #37011 & change markup https://getbootstrap.com/docs/5.3/forms/input-group/
+      this._menu = SelectorEngine.next(this._element, SELECTOR_MENU)[0] || SelectorEngine.prev(this._element, SELECTOR_MENU)[0] || SelectorEngine.findOne(SELECTOR_MENU, this._parent);
+      this._inNavbar = this._detectNavbar();
+    }
+
+    // Getters
+    static get Default() {
+      return Default$9;
+    }
+    static get DefaultType() {
+      return DefaultType$9;
+    }
+    static get NAME() {
+      return NAME$a;
+    }
+
+    // Public
+    toggle() {
+      return this._isShown() ? this.hide() : this.show();
+    }
+    show() {
+      if (isDisabled(this._element) || this._isShown()) {
+        return;
+      }
+      const relatedTarget = {
+        relatedTarget: this._element
+      };
+      const showEvent = EventHandler.trigger(this._element, EVENT_SHOW$5, relatedTarget);
+      if (showEvent.defaultPrevented) {
+        return;
+      }
+      this._createPopper();
+
+      // If this is a touch-enabled device we add extra
+      // empty mouseover listeners to the body's immediate children;
+      // only needed because of broken event delegation on iOS
+      // https://www.quirksmode.org/blog/archives/2014/02/mouse_event_bub.html
+      if ('ontouchstart' in document.documentElement && !this._parent.closest(SELECTOR_NAVBAR_NAV)) {
+        for (const element of [].concat(...document.body.children)) {
+          EventHandler.on(element, 'mouseover', noop);
+        }
+      }
+      this._element.focus();
+      this._element.setAttribute('aria-expanded', true);
+      this._menu.classList.add(CLASS_NAME_SHOW$6);
+      this._element.classList.add(CLASS_NAME_SHOW$6);
+      EventHandler.trigger(this._element, EVENT_SHOWN$5, relatedTarget);
+    }
+    hide() {
+      if (isDisabled(this._element) || !this._isShown()) {
+        return;
+      }
+      const relatedTarget = {
+        relatedTarget: this._element
+      };
+      this._completeHide(relatedTarget);
+    }
+    dispose() {
+      if (this._popper) {
+        this._popper.destroy();
+      }
+      super.dispose();
+    }
+    update() {
+      this._inNavbar = this._detectNavbar();
+      if (this._popper) {
+        this._popper.update();
+      }
+    }
+
+    // Private
+    _completeHide(relatedTarget) {
+      const hideEvent = EventHandler.trigger(this._element, EVENT_HIDE$5, relatedTarget);
+      if (hideEvent.defaultPrevented) {
+        return;
+      }
+
+      // If this is a touch-enabled device we remove the extra
+      // empty mouseover listeners we added for iOS support
+      if ('ontouchstart' in document.documentElement) {
+        for (const element of [].concat(...document.body.children)) {
+          EventHandler.off(element, 'mouseover', noop);
+        }
+      }
+      if (this._popper) {
+        this._popper.destroy();
+      }
+      this._menu.classList.remove(CLASS_NAME_SHOW$6);
+      this._element.classList.remove(CLASS_NAME_SHOW$6);
+      this._element.setAttribute('aria-expanded', 'false');
+      Manipulator.removeDataAttribute(this._menu, 'popper');
+      EventHandler.trigger(this._element, EVENT_HIDDEN$5, relatedTarget);
+    }
+    _getConfig(config) {
+      config = super._getConfig(config);
+      if (typeof config.reference === 'object' && !isElement$1(config.reference) && typeof config.reference.getBoundingClientRect !== 'function') {
+        // Popper virtual elements require a getBoundingClientRect method
+        throw new TypeError(`${NAME$a.toUpperCase()}: Option "reference" provided type "object" without a required "getBoundingClientRect" method.`);
+      }
+      return config;
+    }
+    _createPopper() {
+      if (typeof Popper === 'undefined') {
+        throw new TypeError('Bootstrap\'s dropdowns require Popper (https://popper.js.org)');
+      }
+      let referenceElement = this._element;
+      if (this._config.reference === 'parent') {
+        referenceElement = this._parent;
+      } else if (isElement$1(this._config.reference)) {
+        referenceElement = getElement(this._config.reference);
+      } else if (typeof this._config.reference === 'object') {
+        referenceElement = this._config.reference;
+      }
+      const popperConfig = this._getPopperConfig();
+      this._popper = createPopper(referenceElement, this._menu, popperConfig);
+    }
+    _isShown() {
+      return this._menu.classList.contains(CLASS_NAME_SHOW$6);
+    }
+    _getPlacement() {
+      const parentDropdown = this._parent;
+      if (parentDropdown.classList.contains(CLASS_NAME_DROPEND)) {
+        return PLACEMENT_RIGHT;
+      }
+      if (parentDropdown.classList.contains(CLASS_NAME_DROPSTART)) {
+        return PLACEMENT_LEFT;
+      }
+      if (parentDropdown.classList.contains(CLASS_NAME_DROPUP_CENTER)) {
+        return PLACEMENT_TOPCENTER;
+      }
+      if (parentDropdown.classList.contains(CLASS_NAME_DROPDOWN_CENTER)) {
+        return PLACEMENT_BOTTOMCENTER;
+      }
+
+      // We need to trim the value because custom properties can also include spaces
+      const isEnd = getComputedStyle(this._menu).getPropertyValue('--bs-position').trim() === 'end';
+      if (parentDropdown.classList.contains(CLASS_NAME_DROPUP)) {
+        return isEnd ? PLACEMENT_TOPEND : PLACEMENT_TOP;
+      }
+      return isEnd ? PLACEMENT_BOTTOMEND : PLACEMENT_BOTTOM;
+    }
+    _detectNavbar() {
+      return this._element.closest(SELECTOR_NAVBAR) !== null;
+    }
+    _getOffset() {
+      const {
+        offset
+      } = this._config;
+      if (typeof offset === 'string') {
+        return offset.split(',').map(value => Number.parseInt(value, 10));
+      }
+      if (typeof offset === 'function') {
+        return popperData => offset(popperData, this._element);
+      }
+      return offset;
+    }
+    _getPopperConfig() {
+      const defaultBsPopperConfig = {
+        placement: this._getPlacement(),
+        modifiers: [{
+          name: 'preventOverflow',
+          options: {
+            boundary: this._config.boundary
+          }
+        }, {
+          name: 'offset',
+          options: {
+            offset: this._getOffset()
+          }
+        }]
+      };
+
+      // Disable Popper if we have a static display or Dropdown is in Navbar
+      if (this._inNavbar || this._config.display === 'static') {
+        Manipulator.setDataAttribute(this._menu, 'popper', 'static'); // TODO: v6 remove
+        defaultBsPopperConfig.modifiers = [{
+          name: 'applyStyles',
+          enabled: false
+        }];
+      }
+      return {
+        ...defaultBsPopperConfig,
+        ...execute(this._config.popperConfig, [defaultBsPopperConfig])
+      };
+    }
+    _selectMenuItem({
+      key,
+      target
+    }) {
+      const items = SelectorEngine.find(SELECTOR_VISIBLE_ITEMS, this._menu).filter(element => isVisible(element));
+      if (!items.length) {
+        return;
+      }
+
+      // if target isn't included in items (e.g. when expanding the dropdown)
+      // allow cycling to get the last item in case key equals ARROW_UP_KEY
+      getNextActiveElement(items, target, key === ARROW_DOWN_KEY$1, !items.includes(target)).focus();
+    }
+
+    // Static
+    static jQueryInterface(config) {
+      return this.each(function () {
+        const data = Dropdown.getOrCreateInstance(this, config);
+        if (typeof config !== 'string') {
+          return;
+        }
+        if (typeof data[config] === 'undefined') {
+          throw new TypeError(`No method named "${config}"`);
+        }
+        data[config]();
+      });
+    }
+    static clearMenus(event) {
+      if (event.button === RIGHT_MOUSE_BUTTON || event.type === 'keyup' && event.key !== TAB_KEY$1) {
+        return;
+      }
+      const openToggles = SelectorEngine.find(SELECTOR_DATA_TOGGLE_SHOWN);
+      for (const toggle of openToggles) {
+        const context = Dropdown.getInstance(toggle);
+        if (!context || context._config.autoClose === false) {
+          continue;
+        }
+        const composedPath = event.composedPath();
+        const isMenuTarget = composedPath.includes(context._menu);
+        if (composedPath.includes(context._element) || context._config.autoClose === 'inside' && !isMenuTarget || context._config.autoClose === 'outside' && isMenuTarget) {
+          continue;
+        }
+
+        // Tab navigation through the dropdown menu or events from contained inputs shouldn't close the menu
+        if (context._menu.contains(event.target) && (event.type === 'keyup' && event.key === TAB_KEY$1 || /input|select|option|textarea|form/i.test(event.target.tagName))) {
+          continue;
+        }
+        const relatedTarget = {
+          relatedTarget: context._element
+        };
+        if (event.type === 'click') {
+          relatedTarget.clickEvent = event;
+        }
+        context._completeHide(relatedTarget);
+      }
+    }
+    static dataApiKeydownHandler(event) {
+      // If not an UP | DOWN | ESCAPE key => not a dropdown command
+      // If input/textarea && if key is other than ESCAPE => not a dropdown command
+
+      const isInput = /input|textarea/i.test(event.target.tagName);
+      const isEscapeEvent = event.key === ESCAPE_KEY$2;
+      const isUpOrDownEvent = [ARROW_UP_KEY$1, ARROW_DOWN_KEY$1].includes(event.key);
+      if (!isUpOrDownEvent && !isEscapeEvent) {
+        return;
+      }
+      if (isInput && !isEscapeEvent) {
+        return;
+      }
+      event.preventDefault();
+
+      // TODO: v6 revert #37011 & change markup https://getbootstrap.com/docs/5.3/forms/input-group/
+      const getToggleButton = this.matches(SELECTOR_DATA_TOGGLE$3) ? this : SelectorEngine.prev(this, SELECTOR_DATA_TOGGLE$3)[0] || SelectorEngine.next(this, SELECTOR_DATA_TOGGLE$3)[0] || SelectorEngine.findOne(SELECTOR_DATA_TOGGLE$3, event.delegateTarget.parentNode);
+      const instance = Dropdown.getOrCreateInstance(getToggleButton);
+      if (isUpOrDownEvent) {
+        event.stopPropagation();
+        instance.show();
+        instance._selectMenuItem(event);
+        return;
+      }
+      if (instance._isShown()) {
+        // else is escape and we check if it is shown
+        event.stopPropagation();
+        instance.hide();
+        getToggleButton.focus();
+      }
+    }
+  }
+
+  /**
+   * Data API implementation
+   */
+
+  EventHandler.on(document, EVENT_KEYDOWN_DATA_API, SELECTOR_DATA_TOGGLE$3, Dropdown.dataApiKeydownHandler);
+  EventHandler.on(document, EVENT_KEYDOWN_DATA_API, SELECTOR_MENU, Dropdown.dataApiKeydownHandler);
+  EventHandler.on(document, EVENT_CLICK_DATA_API$3, Dropdown.clearMenus);
+  EventHandler.on(document, EVENT_KEYUP_DATA_API, Dropdown.clearMenus);
+  EventHandler.on(document, EVENT_CLICK_DATA_API$3, SELECTOR_DATA_TOGGLE$3, function (event) {
+    event.preventDefault();
+    Dropdown.getOrCreateInstance(this).toggle();
+  });
+
+  /**
+   * jQuery
+   */
+
+  defineJQueryPlugin(Dropdown);
+
+  /**
+   * --------------------------------------------------------------------------
+   * Bootstrap util/backdrop.js
+   * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)
+   * --------------------------------------------------------------------------
+   */
+
+
+  /**
+   * Constants
+   */
+
+  const NAME$9 = 'backdrop';
+  const CLASS_NAME_FADE$4 = 'fade';
+  const CLASS_NAME_SHOW$5 = 'show';
+  const EVENT_MOUSEDOWN = `mousedown.bs.${NAME$9}`;
+  const Default$8 = {
+    className: 'modal-backdrop',
+    clickCallback: null,
+    isAnimated: false,
+    isVisible: true,
+    // if false, we use the backdrop helper without adding any element to the dom
+    rootElement: 'body' // give the choice to place backdrop under different elements
+  };
+
+  const DefaultType$8 = {
+    className: 'string',
+    clickCallback: '(function|null)',
+    isAnimated: 'boolean',
+    isVisible: 'boolean',
+    rootElement: '(element|string)'
+  };
+
+  /**
+   * Class definition
+   */
+
+  class Backdrop extends Config {
+    constructor(config) {
+      super();
+      this._config = this._getConfig(config);
+      this._isAppended = false;
+      this._element = null;
+    }
+
+    // Getters
+    static get Default() {
+      return Default$8;
+    }
+    static get DefaultType() {
+      return DefaultType$8;
+    }
+    static get NAME() {
+      return NAME$9;
+    }
+
+    // Public
+    show(callback) {
+      if (!this._config.isVisible) {
+        execute(callback);
+        return;
+      }
+      this._append();
+      const element = this._getElement();
+      if (this._config.isAnimated) {
+        reflow(element);
+      }
+      element.classList.add(CLASS_NAME_SHOW$5);
+      this._emulateAnimation(() => {
+        execute(callback);
+      });
+    }
+    hide(callback) {
+      if (!this._config.isVisible) {
+        execute(callback);
+        return;
+      }
+      this._getElement().classList.remove(CLASS_NAME_SHOW$5);
+      this._emulateAnimation(() => {
+        this.dispose();
+        execute(callback);
+      });
+    }
+    dispose() {
+      if (!this._isAppended) {
+        return;
+      }
+      EventHandler.off(this._element, EVENT_MOUSEDOWN);
+      this._element.remove();
+      this._isAppended = false;
+    }
+
+    // Private
+    _getElement() {
+      if (!this._element) {
+        const backdrop = document.createElement('div');
+        backdrop.className = this._config.className;
+        if (this._config.isAnimated) {
+          backdrop.classList.add(CLASS_NAME_FADE$4);
+        }
+        this._element = backdrop;
+      }
+      return this._element;
+    }
+    _configAfterMerge(config) {
+      // use getElement() with the default "body" to get a fresh Element on each instantiation
+      config.rootElement = getElement(config.rootElement);
+      return config;
+    }
+    _append() {
+      if (this._isAppended) {
+        return;
+      }
+      const element = this._getElement();
+      this._config.rootElement.append(element);
+      EventHandler.on(element, EVENT_MOUSEDOWN, () => {
+        execute(this._config.clickCallback);
+      });
+      this._isAppended = true;
+    }
+    _emulateAnimation(callback) {
+      executeAfterTransition(callback, this._getElement(), this._config.isAnimated);
+    }
+  }
+
+  /**
+   * --------------------------------------------------------------------------
+   * Bootstrap util/focustrap.js
+   * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)
+   * --------------------------------------------------------------------------
+   */
+
+
+  /**
+   * Constants
+   */
+
+  const NAME$8 = 'focustrap';
+  const DATA_KEY$5 = 'bs.focustrap';
+  const EVENT_KEY$5 = `.${DATA_KEY$5}`;
+  const EVENT_FOCUSIN$2 = `focusin${EVENT_KEY$5}`;
+  const EVENT_KEYDOWN_TAB = `keydown.tab${EVENT_KEY$5}`;
+  const TAB_KEY = 'Tab';
+  const TAB_NAV_FORWARD = 'forward';
+  const TAB_NAV_BACKWARD = 'backward';
+  const Default$7 = {
+    autofocus: true,
+    trapElement: null // The element to trap focus inside of
+  };
+
+  const DefaultType$7 = {
+    autofocus: 'boolean',
+    trapElement: 'element'
+  };
+
+  /**
+   * Class definition
+   */
+
+  class FocusTrap extends Config {
+    constructor(config) {
+      super();
+      this._config = this._getConfig(config);
+      this._isActive = false;
+      this._lastTabNavDirection = null;
+    }
+
+    // Getters
+    static get Default() {
+      return Default$7;
+    }
+    static get DefaultType() {
+      return DefaultType$7;
+    }
+    static get NAME() {
+      return NAME$8;
+    }
+
+    // Public
+    activate() {
+      if (this._isActive) {
+        return;
+      }
+      if (this._config.autofocus) {
+        this._config.trapElement.focus();
+      }
+      EventHandler.off(document, EVENT_KEY$5); // guard against infinite focus loop
+      EventHandler.on(document, EVENT_FOCUSIN$2, event => this._handleFocusin(event));
+      EventHandler.on(document, EVENT_KEYDOWN_TAB, event => this._handleKeydown(event));
+      this._isActive = true;
+    }
+    deactivate() {
+      if (!this._isActive) {
+        return;
+      }
+      this._isActive = false;
+      EventHandler.off(document, EVENT_KEY$5);
+    }
+
+    // Private
+    _handleFocusin(event) {
+      const {
+        trapElement
+      } = this._config;
+      if (event.target === document || event.target === trapElement || trapElement.contains(event.target)) {
+        return;
+      }
+      const elements = SelectorEngine.focusableChildren(trapElement);
+      if (elements.length === 0) {
+        trapElement.focus();
+      } else if (this._lastTabNavDirection === TAB_NAV_BACKWARD) {
+        elements[elements.length - 1].focus();
+      } else {
+        elements[0].focus();
+      }
+    }
+    _handleKeydown(event) {
+      if (event.key !== TAB_KEY) {
+        return;
+      }
+      this._lastTabNavDirection = event.shiftKey ? TAB_NAV_BACKWARD : TAB_NAV_FORWARD;
+    }
+  }
+
+  /**
+   * --------------------------------------------------------------------------
+   * Bootstrap util/scrollBar.js
+   * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)
+   * --------------------------------------------------------------------------
+   */
+
+
+  /**
+   * Constants
+   */
+
+  const SELECTOR_FIXED_CONTENT = '.fixed-top, .fixed-bottom, .is-fixed, .sticky-top';
+  const SELECTOR_STICKY_CONTENT = '.sticky-top';
+  const PROPERTY_PADDING = 'padding-right';
+  const PROPERTY_MARGIN = 'margin-right';
+
+  /**
+   * Class definition
+   */
+
+  class ScrollBarHelper {
+    constructor() {
+      this._element = document.body;
+    }
+
+    // Public
+    getWidth() {
+      // https://developer.mozilla.org/en-US/docs/Web/API/Window/innerWidth#usage_notes
+      const documentWidth = document.documentElement.clientWidth;
+      return Math.abs(window.innerWidth - documentWidth);
+    }
+    hide() {
+      const width = this.getWidth();
+      this._disableOverFlow();
+      // give padding to element to balance the hidden scrollbar width
+      this._setElementAttributes(this._element, PROPERTY_PADDING, calculatedValue => calculatedValue + width);
+      // trick: We adjust positive paddingRight and negative marginRight to sticky-top elements to keep showing fullwidth
+      this._setElementAttributes(SELECTOR_FIXED_CONTENT, PROPERTY_PADDING, calculatedValue => calculatedValue + width);
+      this._setElementAttributes(SELECTOR_STICKY_CONTENT, PROPERTY_MARGIN, calculatedValue => calculatedValue - width);
+    }
+    reset() {
+      this._resetElementAttributes(this._element, 'overflow');
+      this._resetElementAttributes(this._element, PROPERTY_PADDING);
+      this._resetElementAttributes(SELECTOR_FIXED_CONTENT, PROPERTY_PADDING);
+      this._resetElementAttributes(SELECTOR_STICKY_CONTENT, PROPERTY_MARGIN);
+    }
+    isOverflowing() {
+      return this.getWidth() > 0;
+    }
+
+    // Private
+    _disableOverFlow() {
+      this._saveInitialAttribute(this._element, 'overflow');
+      this._element.style.overflow = 'hidden';
+    }
+    _setElementAttributes(selector, styleProperty, callback) {
+      const scrollbarWidth = this.getWidth();
+      const manipulationCallBack = element => {
+        if (element !== this._element && window.innerWidth > element.clientWidth + scrollbarWidth) {
+          return;
+        }
+        this._saveInitialAttribute(element, styleProperty);
+        const calculatedValue = window.getComputedStyle(element).getPropertyValue(styleProperty);
+        element.style.setProperty(styleProperty, `${callback(Number.parseFloat(calculatedValue))}px`);
+      };
+      this._applyManipulationCallback(selector, manipulationCallBack);
+    }
+    _saveInitialAttribute(element, styleProperty) {
+      const actualValue = element.style.getPropertyValue(styleProperty);
+      if (actualValue) {
+        Manipulator.setDataAttribute(element, styleProperty, actualValue);
+      }
+    }
+    _resetElementAttributes(selector, styleProperty) {
+      const manipulationCallBack = element => {
+        const value = Manipulator.getDataAttribute(element, styleProperty);
+        // We only want to remove the property if the value is `null`; the value can also be zero
+        if (value === null) {
+          element.style.removeProperty(styleProperty);
+          return;
+        }
+        Manipulator.removeDataAttribute(element, styleProperty);
+        element.style.setProperty(styleProperty, value);
+      };
+      this._applyManipulationCallback(selector, manipulationCallBack);
+    }
+    _applyManipulationCallback(selector, callBack) {
+      if (isElement$1(selector)) {
+        callBack(selector);
+        return;
+      }
+      for (const sel of SelectorEngine.find(selector, this._element)) {
+        callBack(sel);
+      }
+    }
+  }
+
+  /**
+   * --------------------------------------------------------------------------
+   * Bootstrap modal.js
+   * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)
+   * --------------------------------------------------------------------------
+   */
+
+
+  /**
+   * Constants
+   */
+
+  const NAME$7 = 'modal';
+  const DATA_KEY$4 = 'bs.modal';
+  const EVENT_KEY$4 = `.${DATA_KEY$4}`;
+  const DATA_API_KEY$2 = '.data-api';
+  const ESCAPE_KEY$1 = 'Escape';
+  const EVENT_HIDE$4 = `hide${EVENT_KEY$4}`;
+  const EVENT_HIDE_PREVENTED$1 = `hidePrevented${EVENT_KEY$4}`;
+  const EVENT_HIDDEN$4 = `hidden${EVENT_KEY$4}`;
+  const EVENT_SHOW$4 = `show${EVENT_KEY$4}`;
+  const EVENT_SHOWN$4 = `shown${EVENT_KEY$4}`;
+  const EVENT_RESIZE$1 = `resize${EVENT_KEY$4}`;
+  const EVENT_CLICK_DISMISS = `click.dismiss${EVENT_KEY$4}`;
+  const EVENT_MOUSEDOWN_DISMISS = `mousedown.dismiss${EVENT_KEY$4}`;
+  const EVENT_KEYDOWN_DISMISS$1 = `keydown.dismiss${EVENT_KEY$4}`;
+  const EVENT_CLICK_DATA_API$2 = `click${EVENT_KEY$4}${DATA_API_KEY$2}`;
+  const CLASS_NAME_OPEN = 'modal-open';
+  const CLASS_NAME_FADE$3 = 'fade';
+  const CLASS_NAME_SHOW$4 = 'show';
+  const CLASS_NAME_STATIC = 'modal-static';
+  const OPEN_SELECTOR$1 = '.modal.show';
+  const SELECTOR_DIALOG = '.modal-dialog';
+  const SELECTOR_MODAL_BODY = '.modal-body';
+  const SELECTOR_DATA_TOGGLE$2 = '[data-bs-toggle="modal"]';
+  const Default$6 = {
+    backdrop: true,
+    focus: true,
+    keyboard: true
+  };
+  const DefaultType$6 = {
+    backdrop: '(boolean|string)',
+    focus: 'boolean',
+    keyboard: 'boolean'
+  };
+
+  /**
+   * Class definition
+   */
+
+  class Modal extends BaseComponent {
+    constructor(element, config) {
+      super(element, config);
+      this._dialog = SelectorEngine.findOne(SELECTOR_DIALOG, this._element);
+      this._backdrop = this._initializeBackDrop();
+      this._focustrap = this._initializeFocusTrap();
+      this._isShown = false;
+      this._isTransitioning = false;
+      this._scrollBar = new ScrollBarHelper();
+      this._addEventListeners();
+    }
+
+    // Getters
+    static get Default() {
+      return Default$6;
+    }
+    static get DefaultType() {
+      return DefaultType$6;
+    }
+    static get NAME() {
+      return NAME$7;
+    }
+
+    // Public
+    toggle(relatedTarget) {
+      return this._isShown ? this.hide() : this.show(relatedTarget);
+    }
+    show(relatedTarget) {
+      if (this._isShown || this._isTransitioning) {
+        return;
+      }
+      const showEvent = EventHandler.trigger(this._element, EVENT_SHOW$4, {
+        relatedTarget
+      });
+      if (showEvent.defaultPrevented) {
+        return;
+      }
+      this._isShown = true;
+      this._isTransitioning = true;
+      this._scrollBar.hide();
+      document.body.classList.add(CLASS_NAME_OPEN);
+      this._adjustDialog();
+      this._backdrop.show(() => this._showElement(relatedTarget));
+    }
+    hide() {
+      if (!this._isShown || this._isTransitioning) {
+        return;
+      }
+      const hideEvent = EventHandler.trigger(this._element, EVENT_HIDE$4);
+      if (hideEvent.defaultPrevented) {
+        return;
+      }
+      this._isShown = false;
+      this._isTransitioning = true;
+      this._focustrap.deactivate();
+      this._element.classList.remove(CLASS_NAME_SHOW$4);
+      this._queueCallback(() => this._hideModal(), this._element, this._isAnimated());
+    }
+    dispose() {
+      EventHandler.off(window, EVENT_KEY$4);
+      EventHandler.off(this._dialog, EVENT_KEY$4);
+      this._backdrop.dispose();
+      this._focustrap.deactivate();
+      super.dispose();
+    }
+    handleUpdate() {
+      this._adjustDialog();
+    }
+
+    // Private
+    _initializeBackDrop() {
+      return new Backdrop({
+        isVisible: Boolean(this._config.backdrop),
+        // 'static' option will be translated to true, and booleans will keep their value,
+        isAnimated: this._isAnimated()
+      });
+    }
+    _initializeFocusTrap() {
+      return new FocusTrap({
+        trapElement: this._element
+      });
+    }
+    _showElement(relatedTarget) {
+      // try to append dynamic modal
+      if (!document.body.contains(this._element)) {
+        document.body.append(this._element);
+      }
+      this._element.style.display = 'block';
+      this._element.removeAttribute('aria-hidden');
+      this._element.setAttribute('aria-modal', true);
+      this._element.setAttribute('role', 'dialog');
+      this._element.scrollTop = 0;
+      const modalBody = SelectorEngine.findOne(SELECTOR_MODAL_BODY, this._dialog);
+      if (modalBody) {
+        modalBody.scrollTop = 0;
+      }
+      reflow(this._element);
+      this._element.classList.add(CLASS_NAME_SHOW$4);
+      const transitionComplete = () => {
+        if (this._config.focus) {
+          this._focustrap.activate();
+        }
+        this._isTransitioning = false;
+        EventHandler.trigger(this._element, EVENT_SHOWN$4, {
+          relatedTarget
+        });
+      };
+      this._queueCallback(transitionComplete, this._dialog, this._isAnimated());
+    }
+    _addEventListeners() {
+      EventHandler.on(this._element, EVENT_KEYDOWN_DISMISS$1, event => {
+        if (event.key !== ESCAPE_KEY$1) {
+          return;
+        }
+        if (this._config.keyboard) {
+          this.hide();
+          return;
+        }
+        this._triggerBackdropTransition();
+      });
+      EventHandler.on(window, EVENT_RESIZE$1, () => {
+        if (this._isShown && !this._isTransitioning) {
+          this._adjustDialog();
+        }
+      });
+      EventHandler.on(this._element, EVENT_MOUSEDOWN_DISMISS, event => {
+        // a bad trick to segregate clicks that may start inside dialog but end outside, and avoid listen to scrollbar clicks
+        EventHandler.one(this._element, EVENT_CLICK_DISMISS, event2 => {
+          if (this._element !== event.target || this._element !== event2.target) {
+            return;
+          }
+          if (this._config.backdrop === 'static') {
+            this._triggerBackdropTransition();
+            return;
+          }
+          if (this._config.backdrop) {
+            this.hide();
+          }
+        });
+      });
+    }
+    _hideModal() {
+      this._element.style.display = 'none';
+      this._element.setAttribute('aria-hidden', true);
+      this._element.removeAttribute('aria-modal');
+      this._element.removeAttribute('role');
+      this._isTransitioning = false;
+      this._backdrop.hide(() => {
+        document.body.classList.remove(CLASS_NAME_OPEN);
+        this._resetAdjustments();
+        this._scrollBar.reset();
+        EventHandler.trigger(this._element, EVENT_HIDDEN$4);
+      });
+    }
+    _isAnimated() {
+      return this._element.classList.contains(CLASS_NAME_FADE$3);
+    }
+    _triggerBackdropTransition() {
+      const hideEvent = EventHandler.trigger(this._element, EVENT_HIDE_PREVENTED$1);
+      if (hideEvent.defaultPrevented) {
+        return;
+      }
+      const isModalOverflowing = this._element.scrollHeight > document.documentElement.clientHeight;
+      const initialOverflowY = this._element.style.overflowY;
+      // return if the following background transition hasn't yet completed
+      if (initialOverflowY === 'hidden' || this._element.classList.contains(CLASS_NAME_STATIC)) {
+        return;
+      }
+      if (!isModalOverflowing) {
+        this._element.style.overflowY = 'hidden';
+      }
+      this._element.classList.add(CLASS_NAME_STATIC);
+      this._queueCallback(() => {
+        this._element.classList.remove(CLASS_NAME_STATIC);
+        this._queueCallback(() => {
+          this._element.style.overflowY = initialOverflowY;
+        }, this._dialog);
+      }, this._dialog);
+      this._element.focus();
+    }
+
+    /**
+     * The following methods are used to handle overflowing modals
+     */
+
+    _adjustDialog() {
+      const isModalOverflowing = this._element.scrollHeight > document.documentElement.clientHeight;
+      const scrollbarWidth = this._scrollBar.getWidth();
+      const isBodyOverflowing = scrollbarWidth > 0;
+      if (isBodyOverflowing && !isModalOverflowing) {
+        const property = isRTL() ? 'paddingLeft' : 'paddingRight';
+        this._element.style[property] = `${scrollbarWidth}px`;
+      }
+      if (!isBodyOverflowing && isModalOverflowing) {
+        const property = isRTL() ? 'paddingRight' : 'paddingLeft';
+        this._element.style[property] = `${scrollbarWidth}px`;
+      }
+    }
+    _resetAdjustments() {
+      this._element.style.paddingLeft = '';
+      this._element.style.paddingRight = '';
+    }
+
+    // Static
+    static jQueryInterface(config, relatedTarget) {
+      return this.each(function () {
+        const data = Modal.getOrCreateInstance(this, config);
+        if (typeof config !== 'string') {
+          return;
+        }
+        if (typeof data[config] === 'undefined') {
+          throw new TypeError(`No method named "${config}"`);
+        }
+        data[config](relatedTarget);
+      });
+    }
+  }
+
+  /**
+   * Data API implementation
+   */
+
+  EventHandler.on(document, EVENT_CLICK_DATA_API$2, SELECTOR_DATA_TOGGLE$2, function (event) {
+    const target = SelectorEngine.getElementFromSelector(this);
+    if (['A', 'AREA'].includes(this.tagName)) {
+      event.preventDefault();
+    }
+    EventHandler.one(target, EVENT_SHOW$4, showEvent => {
+      if (showEvent.defaultPrevented) {
+        // only register focus restorer if modal will actually get shown
+        return;
+      }
+      EventHandler.one(target, EVENT_HIDDEN$4, () => {
+        if (isVisible(this)) {
+          this.focus();
+        }
+      });
+    });
+
+    // avoid conflict when clicking modal toggler while another one is open
+    const alreadyOpen = SelectorEngine.findOne(OPEN_SELECTOR$1);
+    if (alreadyOpen) {
+      Modal.getInstance(alreadyOpen).hide();
+    }
+    const data = Modal.getOrCreateInstance(target);
+    data.toggle(this);
+  });
+  enableDismissTrigger(Modal);
+
+  /**
+   * jQuery
+   */
+
+  defineJQueryPlugin(Modal);
+
+  /**
+   * --------------------------------------------------------------------------
+   * Bootstrap offcanvas.js
+   * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)
+   * --------------------------------------------------------------------------
+   */
+
+
+  /**
+   * Constants
+   */
+
+  const NAME$6 = 'offcanvas';
+  const DATA_KEY$3 = 'bs.offcanvas';
+  const EVENT_KEY$3 = `.${DATA_KEY$3}`;
+  const DATA_API_KEY$1 = '.data-api';
+  const EVENT_LOAD_DATA_API$2 = `load${EVENT_KEY$3}${DATA_API_KEY$1}`;
+  const ESCAPE_KEY = 'Escape';
+  const CLASS_NAME_SHOW$3 = 'show';
+  const CLASS_NAME_SHOWING$1 = 'showing';
+  const CLASS_NAME_HIDING = 'hiding';
+  const CLASS_NAME_BACKDROP = 'offcanvas-backdrop';
+  const OPEN_SELECTOR = '.offcanvas.show';
+  const EVENT_SHOW$3 = `show${EVENT_KEY$3}`;
+  const EVENT_SHOWN$3 = `shown${EVENT_KEY$3}`;
+  const EVENT_HIDE$3 = `hide${EVENT_KEY$3}`;
+  const EVENT_HIDE_PREVENTED = `hidePrevented${EVENT_KEY$3}`;
+  const EVENT_HIDDEN$3 = `hidden${EVENT_KEY$3}`;
+  const EVENT_RESIZE = `resize${EVENT_KEY$3}`;
+  const EVENT_CLICK_DATA_API$1 = `click${EVENT_KEY$3}${DATA_API_KEY$1}`;
+  const EVENT_KEYDOWN_DISMISS = `keydown.dismiss${EVENT_KEY$3}`;
+  const SELECTOR_DATA_TOGGLE$1 = '[data-bs-toggle="offcanvas"]';
+  const Default$5 = {
+    backdrop: true,
+    keyboard: true,
+    scroll: false
+  };
+  const DefaultType$5 = {
+    backdrop: '(boolean|string)',
+    keyboard: 'boolean',
+    scroll: 'boolean'
+  };
+
+  /**
+   * Class definition
+   */
+
+  class Offcanvas extends BaseComponent {
+    constructor(element, config) {
+      super(element, config);
+      this._isShown = false;
+      this._backdrop = this._initializeBackDrop();
+      this._focustrap = this._initializeFocusTrap();
+      this._addEventListeners();
+    }
+
+    // Getters
+    static get Default() {
+      return Default$5;
+    }
+    static get DefaultType() {
+      return DefaultType$5;
+    }
+    static get NAME() {
+      return NAME$6;
+    }
+
+    // Public
+    toggle(relatedTarget) {
+      return this._isShown ? this.hide() : this.show(relatedTarget);
+    }
+    show(relatedTarget) {
+      if (this._isShown) {
+        return;
+      }
+      const showEvent = EventHandler.trigger(this._element, EVENT_SHOW$3, {
+        relatedTarget
+      });
+      if (showEvent.defaultPrevented) {
+        return;
+      }
+      this._isShown = true;
+      this._backdrop.show();
+      if (!this._config.scroll) {
+        new ScrollBarHelper().hide();
+      }
+      this._element.setAttribute('aria-modal', true);
+      this._element.setAttribute('role', 'dialog');
+      this._element.classList.add(CLASS_NAME_SHOWING$1);
+      const completeCallBack = () => {
+        if (!this._config.scroll || this._config.backdrop) {
+          this._focustrap.activate();
+        }
+        this._element.classList.add(CLASS_NAME_SHOW$3);
+        this._element.classList.remove(CLASS_NAME_SHOWING$1);
+        EventHandler.trigger(this._element, EVENT_SHOWN$3, {
+          relatedTarget
+        });
+      };
+      this._queueCallback(completeCallBack, this._element, true);
+    }
+    hide() {
+      if (!this._isShown) {
+        return;
+      }
+      const hideEvent = EventHandler.trigger(this._element, EVENT_HIDE$3);
+      if (hideEvent.defaultPrevented) {
+        return;
+      }
+      this._focustrap.deactivate();
+      this._element.blur();
+      this._isShown = false;
+      this._element.classList.add(CLASS_NAME_HIDING);
+      this._backdrop.hide();
+      const completeCallback = () => {
+        this._element.classList.remove(CLASS_NAME_SHOW$3, CLASS_NAME_HIDING);
+        this._element.removeAttribute('aria-modal');
+        this._element.removeAttribute('role');
+        if (!this._config.scroll) {
+          new ScrollBarHelper().reset();
+        }
+        EventHandler.trigger(this._element, EVENT_HIDDEN$3);
+      };
+      this._queueCallback(completeCallback, this._element, true);
+    }
+    dispose() {
+      this._backdrop.dispose();
+      this._focustrap.deactivate();
+      super.dispose();
+    }
+
+    // Private
+    _initializeBackDrop() {
+      const clickCallback = () => {
+        if (this._config.backdrop === 'static') {
+          EventHandler.trigger(this._element, EVENT_HIDE_PREVENTED);
+          return;
+        }
+        this.hide();
+      };
+
+      // 'static' option will be translated to true, and booleans will keep their value
+      const isVisible = Boolean(this._config.backdrop);
+      return new Backdrop({
+        className: CLASS_NAME_BACKDROP,
+        isVisible,
+        isAnimated: true,
+        rootElement: this._element.parentNode,
+        clickCallback: isVisible ? clickCallback : null
+      });
+    }
+    _initializeFocusTrap() {
+      return new FocusTrap({
+        trapElement: this._element
+      });
+    }
+    _addEventListeners() {
+      EventHandler.on(this._element, EVENT_KEYDOWN_DISMISS, event => {
+        if (event.key !== ESCAPE_KEY) {
+          return;
+        }
+        if (this._config.keyboard) {
+          this.hide();
+          return;
+        }
+        EventHandler.trigger(this._element, EVENT_HIDE_PREVENTED);
+      });
+    }
+
+    // Static
+    static jQueryInterface(config) {
+      return this.each(function () {
+        const data = Offcanvas.getOrCreateInstance(this, config);
+        if (typeof config !== 'string') {
+          return;
+        }
+        if (data[config] === undefined || config.startsWith('_') || config === 'constructor') {
+          throw new TypeError(`No method named "${config}"`);
+        }
+        data[config](this);
+      });
+    }
+  }
+
+  /**
+   * Data API implementation
+   */
+
+  EventHandler.on(document, EVENT_CLICK_DATA_API$1, SELECTOR_DATA_TOGGLE$1, function (event) {
+    const target = SelectorEngine.getElementFromSelector(this);
+    if (['A', 'AREA'].includes(this.tagName)) {
+      event.preventDefault();
+    }
+    if (isDisabled(this)) {
+      return;
+    }
+    EventHandler.one(target, EVENT_HIDDEN$3, () => {
+      // focus on trigger when it is closed
+      if (isVisible(this)) {
+        this.focus();
+      }
+    });
+
+    // avoid conflict when clicking a toggler of an offcanvas, while another is open
+    const alreadyOpen = SelectorEngine.findOne(OPEN_SELECTOR);
+    if (alreadyOpen && alreadyOpen !== target) {
+      Offcanvas.getInstance(alreadyOpen).hide();
+    }
+    const data = Offcanvas.getOrCreateInstance(target);
+    data.toggle(this);
+  });
+  EventHandler.on(window, EVENT_LOAD_DATA_API$2, () => {
+    for (const selector of SelectorEngine.find(OPEN_SELECTOR)) {
+      Offcanvas.getOrCreateInstance(selector).show();
+    }
+  });
+  EventHandler.on(window, EVENT_RESIZE, () => {
+    for (const element of SelectorEngine.find('[aria-modal][class*=show][class*=offcanvas-]')) {
+      if (getComputedStyle(element).position !== 'fixed') {
+        Offcanvas.getOrCreateInstance(element).hide();
+      }
+    }
+  });
+  enableDismissTrigger(Offcanvas);
+
+  /**
+   * jQuery
+   */
+
+  defineJQueryPlugin(Offcanvas);
+
+  /**
+   * --------------------------------------------------------------------------
+   * Bootstrap util/sanitizer.js
+   * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)
+   * --------------------------------------------------------------------------
+   */
+
+  // js-docs-start allow-list
+  const ARIA_ATTRIBUTE_PATTERN = /^aria-[\w-]*$/i;
+  const DefaultAllowlist = {
+    // Global attributes allowed on any supplied element below.
+    '*': ['class', 'dir', 'id', 'lang', 'role', ARIA_ATTRIBUTE_PATTERN],
+    a: ['target', 'href', 'title', 'rel'],
+    area: [],
+    b: [],
+    br: [],
+    col: [],
+    code: [],
+    div: [],
+    em: [],
+    hr: [],
+    h1: [],
+    h2: [],
+    h3: [],
+    h4: [],
+    h5: [],
+    h6: [],
+    i: [],
+    img: ['src', 'srcset', 'alt', 'title', 'width', 'height'],
+    li: [],
+    ol: [],
+    p: [],
+    pre: [],
+    s: [],
+    small: [],
+    span: [],
+    sub: [],
+    sup: [],
+    strong: [],
+    u: [],
+    ul: []
+  };
+  // js-docs-end allow-list
+
+  const uriAttributes = new Set(['background', 'cite', 'href', 'itemtype', 'longdesc', 'poster', 'src', 'xlink:href']);
+
+  /**
+   * A pattern that recognizes URLs that are safe wrt. XSS in URL navigation
+   * contexts.
+   *
+   * Shout-out to Angular https://github.com/angular/angular/blob/15.2.8/packages/core/src/sanitization/url_sanitizer.ts#L38
+   */
+  // eslint-disable-next-line unicorn/better-regex
+  const SAFE_URL_PATTERN = /^(?!javascript:)(?:[a-z0-9+.-]+:|[^&:/?#]*(?:[/?#]|$))/i;
+  const allowedAttribute = (attribute, allowedAttributeList) => {
+    const attributeName = attribute.nodeName.toLowerCase();
+    if (allowedAttributeList.includes(attributeName)) {
+      if (uriAttributes.has(attributeName)) {
+        return Boolean(SAFE_URL_PATTERN.test(attribute.nodeValue));
+      }
+      return true;
+    }
+
+    // Check if a regular expression validates the attribute.
+    return allowedAttributeList.filter(attributeRegex => attributeRegex instanceof RegExp).some(regex => regex.test(attributeName));
+  };
+  function sanitizeHtml(unsafeHtml, allowList, sanitizeFunction) {
+    if (!unsafeHtml.length) {
+      return unsafeHtml;
+    }
+    if (sanitizeFunction && typeof sanitizeFunction === 'function') {
+      return sanitizeFunction(unsafeHtml);
+    }
+    const domParser = new window.DOMParser();
+    const createdDocument = domParser.parseFromString(unsafeHtml, 'text/html');
+    const elements = [].concat(...createdDocument.body.querySelectorAll('*'));
+    for (const element of elements) {
+      const elementName = element.nodeName.toLowerCase();
+      if (!Object.keys(allowList).includes(elementName)) {
+        element.remove();
+        continue;
+      }
+      const attributeList = [].concat(...element.attributes);
+      const allowedAttributes = [].concat(allowList['*'] || [], allowList[elementName] || []);
+      for (const attribute of attributeList) {
+        if (!allowedAttribute(attribute, allowedAttributes)) {
+          element.removeAttribute(attribute.nodeName);
+        }
+      }
+    }
+    return createdDocument.body.innerHTML;
+  }
+
+  /**
+   * --------------------------------------------------------------------------
+   * Bootstrap util/template-factory.js
+   * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)
+   * --------------------------------------------------------------------------
+   */
+
+
+  /**
+   * Constants
+   */
+
+  const NAME$5 = 'TemplateFactory';
+  const Default$4 = {
+    allowList: DefaultAllowlist,
+    content: {},
+    // { selector : text ,  selector2 : text2 , }
+    extraClass: '',
+    html: false,
+    sanitize: true,
+    sanitizeFn: null,
+    template: '<div></div>'
+  };
+  const DefaultType$4 = {
+    allowList: 'object',
+    content: 'object',
+    extraClass: '(string|function)',
+    html: 'boolean',
+    sanitize: 'boolean',
+    sanitizeFn: '(null|function)',
+    template: 'string'
+  };
+  const DefaultContentType = {
+    entry: '(string|element|function|null)',
+    selector: '(string|element)'
+  };
+
+  /**
+   * Class definition
+   */
+
+  class TemplateFactory extends Config {
+    constructor(config) {
+      super();
+      this._config = this._getConfig(config);
+    }
+
+    // Getters
+    static get Default() {
+      return Default$4;
+    }
+    static get DefaultType() {
+      return DefaultType$4;
+    }
+    static get NAME() {
+      return NAME$5;
+    }
+
+    // Public
+    getContent() {
+      return Object.values(this._config.content).map(config => this._resolvePossibleFunction(config)).filter(Boolean);
+    }
+    hasContent() {
+      return this.getContent().length > 0;
+    }
+    changeContent(content) {
+      this._checkContent(content);
+      this._config.content = {
+        ...this._config.content,
+        ...content
+      };
+      return this;
+    }
+    toHtml() {
+      const templateWrapper = document.createElement('div');
+      templateWrapper.innerHTML = this._maybeSanitize(this._config.template);
+      for (const [selector, text] of Object.entries(this._config.content)) {
+        this._setContent(templateWrapper, text, selector);
+      }
+      const template = templateWrapper.children[0];
+      const extraClass = this._resolvePossibleFunction(this._config.extraClass);
+      if (extraClass) {
+        template.classList.add(...extraClass.split(' '));
+      }
+      return template;
+    }
+
+    // Private
+    _typeCheckConfig(config) {
+      super._typeCheckConfig(config);
+      this._checkContent(config.content);
+    }
+    _checkContent(arg) {
+      for (const [selector, content] of Object.entries(arg)) {
+        super._typeCheckConfig({
+          selector,
+          entry: content
+        }, DefaultContentType);
+      }
+    }
+    _setContent(template, content, selector) {
+      const templateElement = SelectorEngine.findOne(selector, template);
+      if (!templateElement) {
+        return;
+      }
+      content = this._resolvePossibleFunction(content);
+      if (!content) {
+        templateElement.remove();
+        return;
+      }
+      if (isElement$1(content)) {
+        this._putElementInTemplate(getElement(content), templateElement);
+        return;
+      }
+      if (this._config.html) {
+        templateElement.innerHTML = this._maybeSanitize(content);
+        return;
+      }
+      templateElement.textContent = content;
+    }
+    _maybeSanitize(arg) {
+      return this._config.sanitize ? sanitizeHtml(arg, this._config.allowList, this._config.sanitizeFn) : arg;
+    }
+    _resolvePossibleFunction(arg) {
+      return execute(arg, [this]);
+    }
+    _putElementInTemplate(element, templateElement) {
+      if (this._config.html) {
+        templateElement.innerHTML = '';
+        templateElement.append(element);
+        return;
+      }
+      templateElement.textContent = element.textContent;
+    }
+  }
+
+  /**
+   * --------------------------------------------------------------------------
+   * Bootstrap tooltip.js
+   * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)
+   * --------------------------------------------------------------------------
+   */
+
+
+  /**
+   * Constants
+   */
+
+  const NAME$4 = 'tooltip';
+  const DISALLOWED_ATTRIBUTES = new Set(['sanitize', 'allowList', 'sanitizeFn']);
+  const CLASS_NAME_FADE$2 = 'fade';
+  const CLASS_NAME_MODAL = 'modal';
+  const CLASS_NAME_SHOW$2 = 'show';
+  const SELECTOR_TOOLTIP_INNER = '.tooltip-inner';
+  const SELECTOR_MODAL = `.${CLASS_NAME_MODAL}`;
+  const EVENT_MODAL_HIDE = 'hide.bs.modal';
+  const TRIGGER_HOVER = 'hover';
+  const TRIGGER_FOCUS = 'focus';
+  const TRIGGER_CLICK = 'click';
+  const TRIGGER_MANUAL = 'manual';
+  const EVENT_HIDE$2 = 'hide';
+  const EVENT_HIDDEN$2 = 'hidden';
+  const EVENT_SHOW$2 = 'show';
+  const EVENT_SHOWN$2 = 'shown';
+  const EVENT_INSERTED = 'inserted';
+  const EVENT_CLICK$1 = 'click';
+  const EVENT_FOCUSIN$1 = 'focusin';
+  const EVENT_FOCUSOUT$1 = 'focusout';
+  const EVENT_MOUSEENTER = 'mouseenter';
+  const EVENT_MOUSELEAVE = 'mouseleave';
+  const AttachmentMap = {
+    AUTO: 'auto',
+    TOP: 'top',
+    RIGHT: isRTL() ? 'left' : 'right',
+    BOTTOM: 'bottom',
+    LEFT: isRTL() ? 'right' : 'left'
+  };
+  const Default$3 = {
+    allowList: DefaultAllowlist,
+    animation: true,
+    boundary: 'clippingParents',
+    container: false,
+    customClass: '',
+    delay: 0,
+    fallbackPlacements: ['top', 'right', 'bottom', 'left'],
+    html: false,
+    offset: [0, 6],
+    placement: 'top',
+    popperConfig: null,
+    sanitize: true,
+    sanitizeFn: null,
+    selector: false,
+    template: '<div class="tooltip" role="tooltip">' + '<div class="tooltip-arrow"></div>' + '<div class="tooltip-inner"></div>' + '</div>',
+    title: '',
+    trigger: 'hover focus'
+  };
+  const DefaultType$3 = {
+    allowList: 'object',
+    animation: 'boolean',
+    boundary: '(string|element)',
+    container: '(string|element|boolean)',
+    customClass: '(string|function)',
+    delay: '(number|object)',
+    fallbackPlacements: 'array',
+    html: 'boolean',
+    offset: '(array|string|function)',
+    placement: '(string|function)',
+    popperConfig: '(null|object|function)',
+    sanitize: 'boolean',
+    sanitizeFn: '(null|function)',
+    selector: '(string|boolean)',
+    template: 'string',
+    title: '(string|element|function)',
+    trigger: 'string'
+  };
+
+  /**
+   * Class definition
+   */
+
+  class Tooltip extends BaseComponent {
+    constructor(element, config) {
+      if (typeof Popper === 'undefined') {
+        throw new TypeError('Bootstrap\'s tooltips require Popper (https://popper.js.org)');
+      }
+      super(element, config);
+
+      // Private
+      this._isEnabled = true;
+      this._timeout = 0;
+      this._isHovered = null;
+      this._activeTrigger = {};
+      this._popper = null;
+      this._templateFactory = null;
+      this._newContent = null;
+
+      // Protected
+      this.tip = null;
+      this._setListeners();
+      if (!this._config.selector) {
+        this._fixTitle();
+      }
+    }
+
+    // Getters
+    static get Default() {
+      return Default$3;
+    }
+    static get DefaultType() {
+      return DefaultType$3;
+    }
+    static get NAME() {
+      return NAME$4;
+    }
+
+    // Public
+    enable() {
+      this._isEnabled = true;
+    }
+    disable() {
+      this._isEnabled = false;
+    }
+    toggleEnabled() {
+      this._isEnabled = !this._isEnabled;
+    }
+    toggle() {
+      if (!this._isEnabled) {
+        return;
+      }
+      this._activeTrigger.click = !this._activeTrigger.click;
+      if (this._isShown()) {
+        this._leave();
+        return;
+      }
+      this._enter();
+    }
+    dispose() {
+      clearTimeout(this._timeout);
+      EventHandler.off(this._element.closest(SELECTOR_MODAL), EVENT_MODAL_HIDE, this._hideModalHandler);
+      if (this._element.getAttribute('data-bs-original-title')) {
+        this._element.setAttribute('title', this._element.getAttribute('data-bs-original-title'));
+      }
+      this._disposePopper();
+      super.dispose();
+    }
+    show() {
+      if (this._element.style.display === 'none') {
+        throw new Error('Please use show on visible elements');
+      }
+      if (!(this._isWithContent() && this._isEnabled)) {
+        return;
+      }
+      const showEvent = EventHandler.trigger(this._element, this.constructor.eventName(EVENT_SHOW$2));
+      const shadowRoot = findShadowRoot(this._element);
+      const isInTheDom = (shadowRoot || this._element.ownerDocument.documentElement).contains(this._element);
+      if (showEvent.defaultPrevented || !isInTheDom) {
+        return;
+      }
+
+      // TODO: v6 remove this or make it optional
+      this._disposePopper();
+      const tip = this._getTipElement();
+      this._element.setAttribute('aria-describedby', tip.getAttribute('id'));
+      const {
+        container
+      } = this._config;
+      if (!this._element.ownerDocument.documentElement.contains(this.tip)) {
+        container.append(tip);
+        EventHandler.trigger(this._element, this.constructor.eventName(EVENT_INSERTED));
+      }
+      this._popper = this._createPopper(tip);
+      tip.classList.add(CLASS_NAME_SHOW$2);
+
+      // If this is a touch-enabled device we add extra
+      // empty mouseover listeners to the body's immediate children;
+      // only needed because of broken event delegation on iOS
+      // https://www.quirksmode.org/blog/archives/2014/02/mouse_event_bub.html
+      if ('ontouchstart' in document.documentElement) {
+        for (const element of [].concat(...document.body.children)) {
+          EventHandler.on(element, 'mouseover', noop);
+        }
+      }
+      const complete = () => {
+        EventHandler.trigger(this._element, this.constructor.eventName(EVENT_SHOWN$2));
+        if (this._isHovered === false) {
+          this._leave();
+        }
+        this._isHovered = false;
+      };
+      this._queueCallback(complete, this.tip, this._isAnimated());
+    }
+    hide() {
+      if (!this._isShown()) {
+        return;
+      }
+      const hideEvent = EventHandler.trigger(this._element, this.constructor.eventName(EVENT_HIDE$2));
+      if (hideEvent.defaultPrevented) {
+        return;
+      }
+      const tip = this._getTipElement();
+      tip.classList.remove(CLASS_NAME_SHOW$2);
+
+      // If this is a touch-enabled device we remove the extra
+      // empty mouseover listeners we added for iOS support
+      if ('ontouchstart' in document.documentElement) {
+        for (const element of [].concat(...document.body.children)) {
+          EventHandler.off(element, 'mouseover', noop);
+        }
+      }
+      this._activeTrigger[TRIGGER_CLICK] = false;
+      this._activeTrigger[TRIGGER_FOCUS] = false;
+      this._activeTrigger[TRIGGER_HOVER] = false;
+      this._isHovered = null; // it is a trick to support manual triggering
+
+      const complete = () => {
+        if (this._isWithActiveTrigger()) {
+          return;
+        }
+        if (!this._isHovered) {
+          this._disposePopper();
+        }
+        this._element.removeAttribute('aria-describedby');
+        EventHandler.trigger(this._element, this.constructor.eventName(EVENT_HIDDEN$2));
+      };
+      this._queueCallback(complete, this.tip, this._isAnimated());
+    }
+    update() {
+      if (this._popper) {
+        this._popper.update();
+      }
+    }
+
+    // Protected
+    _isWithContent() {
+      return Boolean(this._getTitle());
+    }
+    _getTipElement() {
+      if (!this.tip) {
+        this.tip = this._createTipElement(this._newContent || this._getContentForTemplate());
+      }
+      return this.tip;
+    }
+    _createTipElement(content) {
+      const tip = this._getTemplateFactory(content).toHtml();
+
+      // TODO: remove this check in v6
+      if (!tip) {
+        return null;
+      }
+      tip.classList.remove(CLASS_NAME_FADE$2, CLASS_NAME_SHOW$2);
+      // TODO: v6 the following can be achieved with CSS only
+      tip.classList.add(`bs-${this.constructor.NAME}-auto`);
+      const tipId = getUID(this.constructor.NAME).toString();
+      tip.setAttribute('id', tipId);
+      if (this._isAnimated()) {
+        tip.classList.add(CLASS_NAME_FADE$2);
+      }
+      return tip;
+    }
+    setContent(content) {
+      this._newContent = content;
+      if (this._isShown()) {
+        this._disposePopper();
+        this.show();
+      }
+    }
+    _getTemplateFactory(content) {
+      if (this._templateFactory) {
+        this._templateFactory.changeContent(content);
+      } else {
+        this._templateFactory = new TemplateFactory({
+          ...this._config,
+          // the `content` var has to be after `this._config`
+          // to override config.content in case of popover
+          content,
+          extraClass: this._resolvePossibleFunction(this._config.customClass)
+        });
+      }
+      return this._templateFactory;
+    }
+    _getContentForTemplate() {
+      return {
+        [SELECTOR_TOOLTIP_INNER]: this._getTitle()
+      };
+    }
+    _getTitle() {
+      return this._resolvePossibleFunction(this._config.title) || this._element.getAttribute('data-bs-original-title');
+    }
+
+    // Private
+    _initializeOnDelegatedTarget(event) {
+      return this.constructor.getOrCreateInstance(event.delegateTarget, this._getDelegateConfig());
+    }
+    _isAnimated() {
+      return this._config.animation || this.tip && this.tip.classList.contains(CLASS_NAME_FADE$2);
+    }
+    _isShown() {
+      return this.tip && this.tip.classList.contains(CLASS_NAME_SHOW$2);
+    }
+    _createPopper(tip) {
+      const placement = execute(this._config.placement, [this, tip, this._element]);
+      const attachment = AttachmentMap[placement.toUpperCase()];
+      return createPopper(this._element, tip, this._getPopperConfig(attachment));
+    }
+    _getOffset() {
+      const {
+        offset
+      } = this._config;
+      if (typeof offset === 'string') {
+        return offset.split(',').map(value => Number.parseInt(value, 10));
+      }
+      if (typeof offset === 'function') {
+        return popperData => offset(popperData, this._element);
+      }
+      return offset;
+    }
+    _resolvePossibleFunction(arg) {
+      return execute(arg, [this._element]);
+    }
+    _getPopperConfig(attachment) {
+      const defaultBsPopperConfig = {
+        placement: attachment,
+        modifiers: [{
+          name: 'flip',
+          options: {
+            fallbackPlacements: this._config.fallbackPlacements
+          }
+        }, {
+          name: 'offset',
+          options: {
+            offset: this._getOffset()
+          }
+        }, {
+          name: 'preventOverflow',
+          options: {
+            boundary: this._config.boundary
+          }
+        }, {
+          name: 'arrow',
+          options: {
+            element: `.${this.constructor.NAME}-arrow`
+          }
+        }, {
+          name: 'preSetPlacement',
+          enabled: true,
+          phase: 'beforeMain',
+          fn: data => {
+            // Pre-set Popper's placement attribute in order to read the arrow sizes properly.
+            // Otherwise, Popper mixes up the width and height dimensions since the initial arrow style is for top placement
+            this._getTipElement().setAttribute('data-popper-placement', data.state.placement);
+          }
+        }]
+      };
+      return {
+        ...defaultBsPopperConfig,
+        ...execute(this._config.popperConfig, [defaultBsPopperConfig])
+      };
+    }
+    _setListeners() {
+      const triggers = this._config.trigger.split(' ');
+      for (const trigger of triggers) {
+        if (trigger === 'click') {
+          EventHandler.on(this._element, this.constructor.eventName(EVENT_CLICK$1), this._config.selector, event => {
+            const context = this._initializeOnDelegatedTarget(event);
+            context.toggle();
+          });
+        } else if (trigger !== TRIGGER_MANUAL) {
+          const eventIn = trigger === TRIGGER_HOVER ? this.constructor.eventName(EVENT_MOUSEENTER) : this.constructor.eventName(EVENT_FOCUSIN$1);
+          const eventOut = trigger === TRIGGER_HOVER ? this.constructor.eventName(EVENT_MOUSELEAVE) : this.constructor.eventName(EVENT_FOCUSOUT$1);
+          EventHandler.on(this._element, eventIn, this._config.selector, event => {
+            const context = this._initializeOnDelegatedTarget(event);
+            context._activeTrigger[event.type === 'focusin' ? TRIGGER_FOCUS : TRIGGER_HOVER] = true;
+            context._enter();
+          });
+          EventHandler.on(this._element, eventOut, this._config.selector, event => {
+            const context = this._initializeOnDelegatedTarget(event);
+            context._activeTrigger[event.type === 'focusout' ? TRIGGER_FOCUS : TRIGGER_HOVER] = context._element.contains(event.relatedTarget);
+            context._leave();
+          });
+        }
+      }
+      this._hideModalHandler = () => {
+        if (this._element) {
+          this.hide();
+        }
+      };
+      EventHandler.on(this._element.closest(SELECTOR_MODAL), EVENT_MODAL_HIDE, this._hideModalHandler);
+    }
+    _fixTitle() {
+      const title = this._element.getAttribute('title');
+      if (!title) {
+        return;
+      }
+      if (!this._element.getAttribute('aria-label') && !this._element.textContent.trim()) {
+        this._element.setAttribute('aria-label', title);
+      }
+      this._element.setAttribute('data-bs-original-title', title); // DO NOT USE IT. Is only for backwards compatibility
+      this._element.removeAttribute('title');
+    }
+    _enter() {
+      if (this._isShown() || this._isHovered) {
+        this._isHovered = true;
+        return;
+      }
+      this._isHovered = true;
+      this._setTimeout(() => {
+        if (this._isHovered) {
+          this.show();
+        }
+      }, this._config.delay.show);
+    }
+    _leave() {
+      if (this._isWithActiveTrigger()) {
+        return;
+      }
+      this._isHovered = false;
+      this._setTimeout(() => {
+        if (!this._isHovered) {
+          this.hide();
+        }
+      }, this._config.delay.hide);
+    }
+    _setTimeout(handler, timeout) {
+      clearTimeout(this._timeout);
+      this._timeout = setTimeout(handler, timeout);
+    }
+    _isWithActiveTrigger() {
+      return Object.values(this._activeTrigger).includes(true);
+    }
+    _getConfig(config) {
+      const dataAttributes = Manipulator.getDataAttributes(this._element);
+      for (const dataAttribute of Object.keys(dataAttributes)) {
+        if (DISALLOWED_ATTRIBUTES.has(dataAttribute)) {
+          delete dataAttributes[dataAttribute];
+        }
+      }
+      config = {
+        ...dataAttributes,
+        ...(typeof config === 'object' && config ? config : {})
+      };
+      config = this._mergeConfigObj(config);
+      config = this._configAfterMerge(config);
+      this._typeCheckConfig(config);
+      return config;
+    }
+    _configAfterMerge(config) {
+      config.container = config.container === false ? document.body : getElement(config.container);
+      if (typeof config.delay === 'number') {
+        config.delay = {
+          show: config.delay,
+          hide: config.delay
+        };
+      }
+      if (typeof config.title === 'number') {
+        config.title = config.title.toString();
+      }
+      if (typeof config.content === 'number') {
+        config.content = config.content.toString();
+      }
+      return config;
+    }
+    _getDelegateConfig() {
+      const config = {};
+      for (const [key, value] of Object.entries(this._config)) {
+        if (this.constructor.Default[key] !== value) {
+          config[key] = value;
+        }
+      }
+      config.selector = false;
+      config.trigger = 'manual';
+
+      // In the future can be replaced with:
+      // const keysWithDifferentValues = Object.entries(this._config).filter(entry => this.constructor.Default[entry[0]] !== this._config[entry[0]])
+      // `Object.fromEntries(keysWithDifferentValues)`
+      return config;
+    }
+    _disposePopper() {
+      if (this._popper) {
+        this._popper.destroy();
+        this._popper = null;
+      }
+      if (this.tip) {
+        this.tip.remove();
+        this.tip = null;
+      }
+    }
+
+    // Static
+    static jQueryInterface(config) {
+      return this.each(function () {
+        const data = Tooltip.getOrCreateInstance(this, config);
+        if (typeof config !== 'string') {
+          return;
+        }
+        if (typeof data[config] === 'undefined') {
+          throw new TypeError(`No method named "${config}"`);
+        }
+        data[config]();
+      });
+    }
+  }
+
+  /**
+   * jQuery
+   */
+
+  defineJQueryPlugin(Tooltip);
+
+  /**
+   * --------------------------------------------------------------------------
+   * Bootstrap popover.js
+   * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)
+   * --------------------------------------------------------------------------
+   */
+
+
+  /**
+   * Constants
+   */
+
+  const NAME$3 = 'popover';
+  const SELECTOR_TITLE = '.popover-header';
+  const SELECTOR_CONTENT = '.popover-body';
+  const Default$2 = {
+    ...Tooltip.Default,
+    content: '',
+    offset: [0, 8],
+    placement: 'right',
+    template: '<div class="popover" role="tooltip">' + '<div class="popover-arrow"></div>' + '<h3 class="popover-header"></h3>' + '<div class="popover-body"></div>' + '</div>',
+    trigger: 'click'
+  };
+  const DefaultType$2 = {
+    ...Tooltip.DefaultType,
+    content: '(null|string|element|function)'
+  };
+
+  /**
+   * Class definition
+   */
+
+  class Popover extends Tooltip {
+    // Getters
+    static get Default() {
+      return Default$2;
+    }
+    static get DefaultType() {
+      return DefaultType$2;
+    }
+    static get NAME() {
+      return NAME$3;
+    }
+
+    // Overrides
+    _isWithContent() {
+      return this._getTitle() || this._getContent();
+    }
+
+    // Private
+    _getContentForTemplate() {
+      return {
+        [SELECTOR_TITLE]: this._getTitle(),
+        [SELECTOR_CONTENT]: this._getContent()
+      };
+    }
+    _getContent() {
+      return this._resolvePossibleFunction(this._config.content);
+    }
+
+    // Static
+    static jQueryInterface(config) {
+      return this.each(function () {
+        const data = Popover.getOrCreateInstance(this, config);
+        if (typeof config !== 'string') {
+          return;
+        }
+        if (typeof data[config] === 'undefined') {
+          throw new TypeError(`No method named "${config}"`);
+        }
+        data[config]();
+      });
+    }
+  }
+
+  /**
+   * jQuery
+   */
+
+  defineJQueryPlugin(Popover);
+
+  /**
+   * --------------------------------------------------------------------------
+   * Bootstrap scrollspy.js
+   * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)
+   * --------------------------------------------------------------------------
+   */
+
+
+  /**
+   * Constants
+   */
+
+  const NAME$2 = 'scrollspy';
+  const DATA_KEY$2 = 'bs.scrollspy';
+  const EVENT_KEY$2 = `.${DATA_KEY$2}`;
+  const DATA_API_KEY = '.data-api';
+  const EVENT_ACTIVATE = `activate${EVENT_KEY$2}`;
+  const EVENT_CLICK = `click${EVENT_KEY$2}`;
+  const EVENT_LOAD_DATA_API$1 = `load${EVENT_KEY$2}${DATA_API_KEY}`;
+  const CLASS_NAME_DROPDOWN_ITEM = 'dropdown-item';
+  const CLASS_NAME_ACTIVE$1 = 'active';
+  const SELECTOR_DATA_SPY = '[data-bs-spy="scroll"]';
+  const SELECTOR_TARGET_LINKS = '[href]';
+  const SELECTOR_NAV_LIST_GROUP = '.nav, .list-group';
+  const SELECTOR_NAV_LINKS = '.nav-link';
+  const SELECTOR_NAV_ITEMS = '.nav-item';
+  const SELECTOR_LIST_ITEMS = '.list-group-item';
+  const SELECTOR_LINK_ITEMS = `${SELECTOR_NAV_LINKS}, ${SELECTOR_NAV_ITEMS} > ${SELECTOR_NAV_LINKS}, ${SELECTOR_LIST_ITEMS}`;
+  const SELECTOR_DROPDOWN = '.dropdown';
+  const SELECTOR_DROPDOWN_TOGGLE$1 = '.dropdown-toggle';
+  const Default$1 = {
+    offset: null,
+    // TODO: v6 @deprecated, keep it for backwards compatibility reasons
+    rootMargin: '0px 0px -25%',
+    smoothScroll: false,
+    target: null,
+    threshold: [0.1, 0.5, 1]
+  };
+  const DefaultType$1 = {
+    offset: '(number|null)',
+    // TODO v6 @deprecated, keep it for backwards compatibility reasons
+    rootMargin: 'string',
+    smoothScroll: 'boolean',
+    target: 'element',
+    threshold: 'array'
+  };
+
+  /**
+   * Class definition
+   */
+
+  class ScrollSpy extends BaseComponent {
+    constructor(element, config) {
+      super(element, config);
+
+      // this._element is the observablesContainer and config.target the menu links wrapper
+      this._targetLinks = new Map();
+      this._observableSections = new Map();
+      this._rootElement = getComputedStyle(this._element).overflowY === 'visible' ? null : this._element;
+      this._activeTarget = null;
+      this._observer = null;
+      this._previousScrollData = {
+        visibleEntryTop: 0,
+        parentScrollTop: 0
+      };
+      this.refresh(); // initialize
+    }
+
+    // Getters
+    static get Default() {
+      return Default$1;
+    }
+    static get DefaultType() {
+      return DefaultType$1;
+    }
+    static get NAME() {
+      return NAME$2;
+    }
+
+    // Public
+    refresh() {
+      this._initializeTargetsAndObservables();
+      this._maybeEnableSmoothScroll();
+      if (this._observer) {
+        this._observer.disconnect();
+      } else {
+        this._observer = this._getNewObserver();
+      }
+      for (const section of this._observableSections.values()) {
+        this._observer.observe(section);
+      }
+    }
+    dispose() {
+      this._observer.disconnect();
+      super.dispose();
+    }
+
+    // Private
+    _configAfterMerge(config) {
+      // TODO: on v6 target should be given explicitly & remove the {target: 'ss-target'} case
+      config.target = getElement(config.target) || document.body;
+
+      // TODO: v6 Only for backwards compatibility reasons. Use rootMargin only
+      config.rootMargin = config.offset ? `${config.offset}px 0px -30%` : config.rootMargin;
+      if (typeof config.threshold === 'string') {
+        config.threshold = config.threshold.split(',').map(value => Number.parseFloat(value));
+      }
+      return config;
+    }
+    _maybeEnableSmoothScroll() {
+      if (!this._config.smoothScroll) {
+        return;
+      }
+
+      // unregister any previous listeners
+      EventHandler.off(this._config.target, EVENT_CLICK);
+      EventHandler.on(this._config.target, EVENT_CLICK, SELECTOR_TARGET_LINKS, event => {
+        const observableSection = this._observableSections.get(event.target.hash);
+        if (observableSection) {
+          event.preventDefault();
+          const root = this._rootElement || window;
+          const height = observableSection.offsetTop - this._element.offsetTop;
+          if (root.scrollTo) {
+            root.scrollTo({
+              top: height,
+              behavior: 'smooth'
+            });
+            return;
+          }
+
+          // Chrome 60 doesn't support `scrollTo`
+          root.scrollTop = height;
+        }
+      });
+    }
+    _getNewObserver() {
+      const options = {
+        root: this._rootElement,
+        threshold: this._config.threshold,
+        rootMargin: this._config.rootMargin
+      };
+      return new IntersectionObserver(entries => this._observerCallback(entries), options);
+    }
+
+    // The logic of selection
+    _observerCallback(entries) {
+      const targetElement = entry => this._targetLinks.get(`#${entry.target.id}`);
+      const activate = entry => {
+        this._previousScrollData.visibleEntryTop = entry.target.offsetTop;
+        this._process(targetElement(entry));
+      };
+      const parentScrollTop = (this._rootElement || document.documentElement).scrollTop;
+      const userScrollsDown = parentScrollTop >= this._previousScrollData.parentScrollTop;
+      this._previousScrollData.parentScrollTop = parentScrollTop;
+      for (const entry of entries) {
+        if (!entry.isIntersecting) {
+          this._activeTarget = null;
+          this._clearActiveClass(targetElement(entry));
+          continue;
+        }
+        const entryIsLowerThanPrevious = entry.target.offsetTop >= this._previousScrollData.visibleEntryTop;
+        // if we are scrolling down, pick the bigger offsetTop
+        if (userScrollsDown && entryIsLowerThanPrevious) {
+          activate(entry);
+          // if parent isn't scrolled, let's keep the first visible item, breaking the iteration
+          if (!parentScrollTop) {
+            return;
+          }
+          continue;
+        }
+
+        // if we are scrolling up, pick the smallest offsetTop
+        if (!userScrollsDown && !entryIsLowerThanPrevious) {
+          activate(entry);
+        }
+      }
+    }
+    _initializeTargetsAndObservables() {
+      this._targetLinks = new Map();
+      this._observableSections = new Map();
+      const targetLinks = SelectorEngine.find(SELECTOR_TARGET_LINKS, this._config.target);
+      for (const anchor of targetLinks) {
+        // ensure that the anchor has an id and is not disabled
+        if (!anchor.hash || isDisabled(anchor)) {
+          continue;
+        }
+        const observableSection = SelectorEngine.findOne(decodeURI(anchor.hash), this._element);
+
+        // ensure that the observableSection exists & is visible
+        if (isVisible(observableSection)) {
+          this._targetLinks.set(decodeURI(anchor.hash), anchor);
+          this._observableSections.set(anchor.hash, observableSection);
+        }
+      }
+    }
+    _process(target) {
+      if (this._activeTarget === target) {
+        return;
+      }
+      this._clearActiveClass(this._config.target);
+      this._activeTarget = target;
+      target.classList.add(CLASS_NAME_ACTIVE$1);
+      this._activateParents(target);
+      EventHandler.trigger(this._element, EVENT_ACTIVATE, {
+        relatedTarget: target
+      });
+    }
+    _activateParents(target) {
+      // Activate dropdown parents
+      if (target.classList.contains(CLASS_NAME_DROPDOWN_ITEM)) {
+        SelectorEngine.findOne(SELECTOR_DROPDOWN_TOGGLE$1, target.closest(SELECTOR_DROPDOWN)).classList.add(CLASS_NAME_ACTIVE$1);
+        return;
+      }
+      for (const listGroup of SelectorEngine.parents(target, SELECTOR_NAV_LIST_GROUP)) {
+        // Set triggered links parents as active
+        // With both <ul> and <nav> markup a parent is the previous sibling of any nav ancestor
+        for (const item of SelectorEngine.prev(listGroup, SELECTOR_LINK_ITEMS)) {
+          item.classList.add(CLASS_NAME_ACTIVE$1);
+        }
+      }
+    }
+    _clearActiveClass(parent) {
+      parent.classList.remove(CLASS_NAME_ACTIVE$1);
+      const activeNodes = SelectorEngine.find(`${SELECTOR_TARGET_LINKS}.${CLASS_NAME_ACTIVE$1}`, parent);
+      for (const node of activeNodes) {
+        node.classList.remove(CLASS_NAME_ACTIVE$1);
+      }
+    }
+
+    // Static
+    static jQueryInterface(config) {
+      return this.each(function () {
+        const data = ScrollSpy.getOrCreateInstance(this, config);
+        if (typeof config !== 'string') {
+          return;
+        }
+        if (data[config] === undefined || config.startsWith('_') || config === 'constructor') {
+          throw new TypeError(`No method named "${config}"`);
+        }
+        data[config]();
+      });
+    }
+  }
+
+  /**
+   * Data API implementation
+   */
+
+  EventHandler.on(window, EVENT_LOAD_DATA_API$1, () => {
+    for (const spy of SelectorEngine.find(SELECTOR_DATA_SPY)) {
+      ScrollSpy.getOrCreateInstance(spy);
+    }
+  });
+
+  /**
+   * jQuery
+   */
+
+  defineJQueryPlugin(ScrollSpy);
+
+  /**
+   * --------------------------------------------------------------------------
+   * Bootstrap tab.js
+   * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)
+   * --------------------------------------------------------------------------
+   */
+
+
+  /**
+   * Constants
+   */
+
+  const NAME$1 = 'tab';
+  const DATA_KEY$1 = 'bs.tab';
+  const EVENT_KEY$1 = `.${DATA_KEY$1}`;
+  const EVENT_HIDE$1 = `hide${EVENT_KEY$1}`;
+  const EVENT_HIDDEN$1 = `hidden${EVENT_KEY$1}`;
+  const EVENT_SHOW$1 = `show${EVENT_KEY$1}`;
+  const EVENT_SHOWN$1 = `shown${EVENT_KEY$1}`;
+  const EVENT_CLICK_DATA_API = `click${EVENT_KEY$1}`;
+  const EVENT_KEYDOWN = `keydown${EVENT_KEY$1}`;
+  const EVENT_LOAD_DATA_API = `load${EVENT_KEY$1}`;
+  const ARROW_LEFT_KEY = 'ArrowLeft';
+  const ARROW_RIGHT_KEY = 'ArrowRight';
+  const ARROW_UP_KEY = 'ArrowUp';
+  const ARROW_DOWN_KEY = 'ArrowDown';
+  const HOME_KEY = 'Home';
+  const END_KEY = 'End';
+  const CLASS_NAME_ACTIVE = 'active';
+  const CLASS_NAME_FADE$1 = 'fade';
+  const CLASS_NAME_SHOW$1 = 'show';
+  const CLASS_DROPDOWN = 'dropdown';
+  const SELECTOR_DROPDOWN_TOGGLE = '.dropdown-toggle';
+  const SELECTOR_DROPDOWN_MENU = '.dropdown-menu';
+  const NOT_SELECTOR_DROPDOWN_TOGGLE = `:not(${SELECTOR_DROPDOWN_TOGGLE})`;
+  const SELECTOR_TAB_PANEL = '.list-group, .nav, [role="tablist"]';
+  const SELECTOR_OUTER = '.nav-item, .list-group-item';
+  const SELECTOR_INNER = `.nav-link${NOT_SELECTOR_DROPDOWN_TOGGLE}, .list-group-item${NOT_SELECTOR_DROPDOWN_TOGGLE}, [role="tab"]${NOT_SELECTOR_DROPDOWN_TOGGLE}`;
+  const SELECTOR_DATA_TOGGLE = '[data-bs-toggle="tab"], [data-bs-toggle="pill"], [data-bs-toggle="list"]'; // TODO: could only be `tab` in v6
+  const SELECTOR_INNER_ELEM = `${SELECTOR_INNER}, ${SELECTOR_DATA_TOGGLE}`;
+  const SELECTOR_DATA_TOGGLE_ACTIVE = `.${CLASS_NAME_ACTIVE}[data-bs-toggle="tab"], .${CLASS_NAME_ACTIVE}[data-bs-toggle="pill"], .${CLASS_NAME_ACTIVE}[data-bs-toggle="list"]`;
+
+  /**
+   * Class definition
+   */
+
+  class Tab extends BaseComponent {
+    constructor(element) {
+      super(element);
+      this._parent = this._element.closest(SELECTOR_TAB_PANEL);
+      if (!this._parent) {
+        return;
+        // TODO: should throw exception in v6
+        // throw new TypeError(`${element.outerHTML} has not a valid parent ${SELECTOR_INNER_ELEM}`)
+      }
+
+      // Set up initial aria attributes
+      this._setInitialAttributes(this._parent, this._getChildren());
+      EventHandler.on(this._element, EVENT_KEYDOWN, event => this._keydown(event));
+    }
+
+    // Getters
+    static get NAME() {
+      return NAME$1;
+    }
+
+    // Public
+    show() {
+      // Shows this elem and deactivate the active sibling if exists
+      const innerElem = this._element;
+      if (this._elemIsActive(innerElem)) {
+        return;
+      }
+
+      // Search for active tab on same parent to deactivate it
+      const active = this._getActiveElem();
+      const hideEvent = active ? EventHandler.trigger(active, EVENT_HIDE$1, {
+        relatedTarget: innerElem
+      }) : null;
+      const showEvent = EventHandler.trigger(innerElem, EVENT_SHOW$1, {
+        relatedTarget: active
+      });
+      if (showEvent.defaultPrevented || hideEvent && hideEvent.defaultPrevented) {
+        return;
+      }
+      this._deactivate(active, innerElem);
+      this._activate(innerElem, active);
+    }
+
+    // Private
+    _activate(element, relatedElem) {
+      if (!element) {
+        return;
+      }
+      element.classList.add(CLASS_NAME_ACTIVE);
+      this._activate(SelectorEngine.getElementFromSelector(element)); // Search and activate/show the proper section
+
+      const complete = () => {
+        if (element.getAttribute('role') !== 'tab') {
+          element.classList.add(CLASS_NAME_SHOW$1);
+          return;
+        }
+        element.removeAttribute('tabindex');
+        element.setAttribute('aria-selected', true);
+        this._toggleDropDown(element, true);
+        EventHandler.trigger(element, EVENT_SHOWN$1, {
+          relatedTarget: relatedElem
+        });
+      };
+      this._queueCallback(complete, element, element.classList.contains(CLASS_NAME_FADE$1));
+    }
+    _deactivate(element, relatedElem) {
+      if (!element) {
+        return;
+      }
+      element.classList.remove(CLASS_NAME_ACTIVE);
+      element.blur();
+      this._deactivate(SelectorEngine.getElementFromSelector(element)); // Search and deactivate the shown section too
+
+      const complete = () => {
+        if (element.getAttribute('role') !== 'tab') {
+          element.classList.remove(CLASS_NAME_SHOW$1);
+          return;
+        }
+        element.setAttribute('aria-selected', false);
+        element.setAttribute('tabindex', '-1');
+        this._toggleDropDown(element, false);
+        EventHandler.trigger(element, EVENT_HIDDEN$1, {
+          relatedTarget: relatedElem
+        });
+      };
+      this._queueCallback(complete, element, element.classList.contains(CLASS_NAME_FADE$1));
+    }
+    _keydown(event) {
+      if (![ARROW_LEFT_KEY, ARROW_RIGHT_KEY, ARROW_UP_KEY, ARROW_DOWN_KEY, HOME_KEY, END_KEY].includes(event.key)) {
+        return;
+      }
+      event.stopPropagation(); // stopPropagation/preventDefault both added to support up/down keys without scrolling the page
+      event.preventDefault();
+      const children = this._getChildren().filter(element => !isDisabled(element));
+      let nextActiveElement;
+      if ([HOME_KEY, END_KEY].includes(event.key)) {
+        nextActiveElement = children[event.key === HOME_KEY ? 0 : children.length - 1];
+      } else {
+        const isNext = [ARROW_RIGHT_KEY, ARROW_DOWN_KEY].includes(event.key);
+        nextActiveElement = getNextActiveElement(children, event.target, isNext, true);
+      }
+      if (nextActiveElement) {
+        nextActiveElement.focus({
+          preventScroll: true
+        });
+        Tab.getOrCreateInstance(nextActiveElement).show();
+      }
+    }
+    _getChildren() {
+      // collection of inner elements
+      return SelectorEngine.find(SELECTOR_INNER_ELEM, this._parent);
+    }
+    _getActiveElem() {
+      return this._getChildren().find(child => this._elemIsActive(child)) || null;
+    }
+    _setInitialAttributes(parent, children) {
+      this._setAttributeIfNotExists(parent, 'role', 'tablist');
+      for (const child of children) {
+        this._setInitialAttributesOnChild(child);
+      }
+    }
+    _setInitialAttributesOnChild(child) {
+      child = this._getInnerElement(child);
+      const isActive = this._elemIsActive(child);
+      const outerElem = this._getOuterElement(child);
+      child.setAttribute('aria-selected', isActive);
+      if (outerElem !== child) {
+        this._setAttributeIfNotExists(outerElem, 'role', 'presentation');
+      }
+      if (!isActive) {
+        child.setAttribute('tabindex', '-1');
+      }
+      this._setAttributeIfNotExists(child, 'role', 'tab');
+
+      // set attributes to the related panel too
+      this._setInitialAttributesOnTargetPanel(child);
+    }
+    _setInitialAttributesOnTargetPanel(child) {
+      const target = SelectorEngine.getElementFromSelector(child);
+      if (!target) {
+        return;
+      }
+      this._setAttributeIfNotExists(target, 'role', 'tabpanel');
+      if (child.id) {
+        this._setAttributeIfNotExists(target, 'aria-labelledby', `${child.id}`);
+      }
+    }
+    _toggleDropDown(element, open) {
+      const outerElem = this._getOuterElement(element);
+      if (!outerElem.classList.contains(CLASS_DROPDOWN)) {
+        return;
+      }
+      const toggle = (selector, className) => {
+        const element = SelectorEngine.findOne(selector, outerElem);
+        if (element) {
+          element.classList.toggle(className, open);
+        }
+      };
+      toggle(SELECTOR_DROPDOWN_TOGGLE, CLASS_NAME_ACTIVE);
+      toggle(SELECTOR_DROPDOWN_MENU, CLASS_NAME_SHOW$1);
+      outerElem.setAttribute('aria-expanded', open);
+    }
+    _setAttributeIfNotExists(element, attribute, value) {
+      if (!element.hasAttribute(attribute)) {
+        element.setAttribute(attribute, value);
+      }
+    }
+    _elemIsActive(elem) {
+      return elem.classList.contains(CLASS_NAME_ACTIVE);
+    }
+
+    // Try to get the inner element (usually the .nav-link)
+    _getInnerElement(elem) {
+      return elem.matches(SELECTOR_INNER_ELEM) ? elem : SelectorEngine.findOne(SELECTOR_INNER_ELEM, elem);
+    }
+
+    // Try to get the outer element (usually the .nav-item)
+    _getOuterElement(elem) {
+      return elem.closest(SELECTOR_OUTER) || elem;
+    }
+
+    // Static
+    static jQueryInterface(config) {
+      return this.each(function () {
+        const data = Tab.getOrCreateInstance(this);
+        if (typeof config !== 'string') {
+          return;
+        }
+        if (data[config] === undefined || config.startsWith('_') || config === 'constructor') {
+          throw new TypeError(`No method named "${config}"`);
+        }
+        data[config]();
+      });
+    }
+  }
+
+  /**
+   * Data API implementation
+   */
+
+  EventHandler.on(document, EVENT_CLICK_DATA_API, SELECTOR_DATA_TOGGLE, function (event) {
+    if (['A', 'AREA'].includes(this.tagName)) {
+      event.preventDefault();
+    }
+    if (isDisabled(this)) {
+      return;
+    }
+    Tab.getOrCreateInstance(this).show();
+  });
+
+  /**
+   * Initialize on focus
+   */
+  EventHandler.on(window, EVENT_LOAD_DATA_API, () => {
+    for (const element of SelectorEngine.find(SELECTOR_DATA_TOGGLE_ACTIVE)) {
+      Tab.getOrCreateInstance(element);
+    }
+  });
+  /**
+   * jQuery
+   */
+
+  defineJQueryPlugin(Tab);
+
+  /**
+   * --------------------------------------------------------------------------
+   * Bootstrap toast.js
+   * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)
+   * --------------------------------------------------------------------------
+   */
+
+
+  /**
+   * Constants
+   */
+
+  const NAME = 'toast';
+  const DATA_KEY = 'bs.toast';
+  const EVENT_KEY = `.${DATA_KEY}`;
+  const EVENT_MOUSEOVER = `mouseover${EVENT_KEY}`;
+  const EVENT_MOUSEOUT = `mouseout${EVENT_KEY}`;
+  const EVENT_FOCUSIN = `focusin${EVENT_KEY}`;
+  const EVENT_FOCUSOUT = `focusout${EVENT_KEY}`;
+  const EVENT_HIDE = `hide${EVENT_KEY}`;
+  const EVENT_HIDDEN = `hidden${EVENT_KEY}`;
+  const EVENT_SHOW = `show${EVENT_KEY}`;
+  const EVENT_SHOWN = `shown${EVENT_KEY}`;
+  const CLASS_NAME_FADE = 'fade';
+  const CLASS_NAME_HIDE = 'hide'; // @deprecated - kept here only for backwards compatibility
+  const CLASS_NAME_SHOW = 'show';
+  const CLASS_NAME_SHOWING = 'showing';
+  const DefaultType = {
+    animation: 'boolean',
+    autohide: 'boolean',
+    delay: 'number'
+  };
+  const Default = {
+    animation: true,
+    autohide: true,
+    delay: 5000
+  };
+
+  /**
+   * Class definition
+   */
+
+  class Toast extends BaseComponent {
+    constructor(element, config) {
+      super(element, config);
+      this._timeout = null;
+      this._hasMouseInteraction = false;
+      this._hasKeyboardInteraction = false;
+      this._setListeners();
+    }
+
+    // Getters
+    static get Default() {
+      return Default;
+    }
+    static get DefaultType() {
+      return DefaultType;
+    }
+    static get NAME() {
+      return NAME;
+    }
+
+    // Public
+    show() {
+      const showEvent = EventHandler.trigger(this._element, EVENT_SHOW);
+      if (showEvent.defaultPrevented) {
+        return;
+      }
+      this._clearTimeout();
+      if (this._config.animation) {
+        this._element.classList.add(CLASS_NAME_FADE);
+      }
+      const complete = () => {
+        this._element.classList.remove(CLASS_NAME_SHOWING);
+        EventHandler.trigger(this._element, EVENT_SHOWN);
+        this._maybeScheduleHide();
+      };
+      this._element.classList.remove(CLASS_NAME_HIDE); // @deprecated
+      reflow(this._element);
+      this._element.classList.add(CLASS_NAME_SHOW, CLASS_NAME_SHOWING);
+      this._queueCallback(complete, this._element, this._config.animation);
+    }
+    hide() {
+      if (!this.isShown()) {
+        return;
+      }
+      const hideEvent = EventHandler.trigger(this._element, EVENT_HIDE);
+      if (hideEvent.defaultPrevented) {
+        return;
+      }
+      const complete = () => {
+        this._element.classList.add(CLASS_NAME_HIDE); // @deprecated
+        this._element.classList.remove(CLASS_NAME_SHOWING, CLASS_NAME_SHOW);
+        EventHandler.trigger(this._element, EVENT_HIDDEN);
+      };
+      this._element.classList.add(CLASS_NAME_SHOWING);
+      this._queueCallback(complete, this._element, this._config.animation);
+    }
+    dispose() {
+      this._clearTimeout();
+      if (this.isShown()) {
+        this._element.classList.remove(CLASS_NAME_SHOW);
+      }
+      super.dispose();
+    }
+    isShown() {
+      return this._element.classList.contains(CLASS_NAME_SHOW);
+    }
+
+    // Private
+
+    _maybeScheduleHide() {
+      if (!this._config.autohide) {
+        return;
+      }
+      if (this._hasMouseInteraction || this._hasKeyboardInteraction) {
+        return;
+      }
+      this._timeout = setTimeout(() => {
+        this.hide();
+      }, this._config.delay);
+    }
+    _onInteraction(event, isInteracting) {
+      switch (event.type) {
+        case 'mouseover':
+        case 'mouseout':
+          {
+            this._hasMouseInteraction = isInteracting;
+            break;
+          }
+        case 'focusin':
+        case 'focusout':
+          {
+            this._hasKeyboardInteraction = isInteracting;
+            break;
+          }
+      }
+      if (isInteracting) {
+        this._clearTimeout();
+        return;
+      }
+      const nextElement = event.relatedTarget;
+      if (this._element === nextElement || this._element.contains(nextElement)) {
+        return;
+      }
+      this._maybeScheduleHide();
+    }
+    _setListeners() {
+      EventHandler.on(this._element, EVENT_MOUSEOVER, event => this._onInteraction(event, true));
+      EventHandler.on(this._element, EVENT_MOUSEOUT, event => this._onInteraction(event, false));
+      EventHandler.on(this._element, EVENT_FOCUSIN, event => this._onInteraction(event, true));
+      EventHandler.on(this._element, EVENT_FOCUSOUT, event => this._onInteraction(event, false));
+    }
+    _clearTimeout() {
+      clearTimeout(this._timeout);
+      this._timeout = null;
+    }
+
+    // Static
+    static jQueryInterface(config) {
+      return this.each(function () {
+        const data = Toast.getOrCreateInstance(this, config);
+        if (typeof config === 'string') {
+          if (typeof data[config] === 'undefined') {
+            throw new TypeError(`No method named "${config}"`);
+          }
+          data[config](this);
+        }
+      });
+    }
+  }
+
+  /**
+   * Data API implementation
+   */
+
+  enableDismissTrigger(Toast);
+
+  /**
+   * jQuery
+   */
+
+  defineJQueryPlugin(Toast);
+
+  /**
+   * --------------------------------------------------------------------------
+   * Bootstrap index.umd.js
+   * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)
+   * --------------------------------------------------------------------------
+   */
+
+  const index_umd = {
+    Alert,
+    Button,
+    Carousel,
+    Collapse,
+    Dropdown,
+    Modal,
+    Offcanvas,
+    Popover,
+    ScrollSpy,
+    Tab,
+    Toast,
+    Tooltip
+  };
+
+  return index_umd;
+
+}));
+//# sourceMappingURL=bootstrap.bundle.js.map
diff --git a/src/BCards.Web/wwwroot/lib/bootstrap/js/bootstrap.bundle.min.js b/src/BCards.Web/wwwroot/lib/bootstrap/js/bootstrap.bundle.min.js
new file mode 100644
index 0000000..b1999d9
--- /dev/null
+++ b/src/BCards.Web/wwwroot/lib/bootstrap/js/bootstrap.bundle.min.js
@@ -0,0 +1,7 @@
+/*!
+  * Bootstrap v5.3.2 (https://getbootstrap.com/)
+  * Copyright 2011-2023 The Bootstrap Authors (https://github.com/twbs/bootstrap/graphs/contributors)
+  * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)
+  */
+!function(t,e){"object"==typeof exports&&"undefined"!=typeof module?module.exports=e():"function"==typeof define&&define.amd?define(e):(t="undefined"!=typeof globalThis?globalThis:t||self).bootstrap=e()}(this,(function(){"use strict";const t=new Map,e={set(e,i,n){t.has(e)||t.set(e,new Map);const s=t.get(e);s.has(i)||0===s.size?s.set(i,n):console.error(`Bootstrap doesn't allow more than one instance per element. Bound instance: ${Array.from(s.keys())[0]}.`)},get:(e,i)=>t.has(e)&&t.get(e).get(i)||null,remove(e,i){if(!t.has(e))return;const n=t.get(e);n.delete(i),0===n.size&&t.delete(e)}},i="transitionend",n=t=>(t&&window.CSS&&window.CSS.escape&&(t=t.replace(/#([^\s"#']+)/g,((t,e)=>`#${CSS.escape(e)}`))),t),s=t=>{t.dispatchEvent(new Event(i))},o=t=>!(!t||"object"!=typeof t)&&(void 0!==t.jquery&&(t=t[0]),void 0!==t.nodeType),r=t=>o(t)?t.jquery?t[0]:t:"string"==typeof t&&t.length>0?document.querySelector(n(t)):null,a=t=>{if(!o(t)||0===t.getClientRects().length)return!1;const e="visible"===getComputedStyle(t).getPropertyValue("visibility"),i=t.closest("details:not([open])");if(!i)return e;if(i!==t){const e=t.closest("summary");if(e&&e.parentNode!==i)return!1;if(null===e)return!1}return e},l=t=>!t||t.nodeType!==Node.ELEMENT_NODE||!!t.classList.contains("disabled")||(void 0!==t.disabled?t.disabled:t.hasAttribute("disabled")&&"false"!==t.getAttribute("disabled")),c=t=>{if(!document.documentElement.attachShadow)return null;if("function"==typeof t.getRootNode){const e=t.getRootNode();return e instanceof ShadowRoot?e:null}return t instanceof ShadowRoot?t:t.parentNode?c(t.parentNode):null},h=()=>{},d=t=>{t.offsetHeight},u=()=>window.jQuery&&!document.body.hasAttribute("data-bs-no-jquery")?window.jQuery:null,f=[],p=()=>"rtl"===document.documentElement.dir,m=t=>{var e;e=()=>{const e=u();if(e){const i=t.NAME,n=e.fn[i];e.fn[i]=t.jQueryInterface,e.fn[i].Constructor=t,e.fn[i].noConflict=()=>(e.fn[i]=n,t.jQueryInterface)}},"loading"===document.readyState?(f.length||document.addEventListener("DOMContentLoaded",(()=>{for(const t of f)t()})),f.push(e)):e()},g=(t,e=[],i=t)=>"function"==typeof t?t(...e):i,_=(t,e,n=!0)=>{if(!n)return void g(t);const o=(t=>{if(!t)return 0;let{transitionDuration:e,transitionDelay:i}=window.getComputedStyle(t);const n=Number.parseFloat(e),s=Number.parseFloat(i);return n||s?(e=e.split(",")[0],i=i.split(",")[0],1e3*(Number.parseFloat(e)+Number.parseFloat(i))):0})(e)+5;let r=!1;const a=({target:n})=>{n===e&&(r=!0,e.removeEventListener(i,a),g(t))};e.addEventListener(i,a),setTimeout((()=>{r||s(e)}),o)},b=(t,e,i,n)=>{const s=t.length;let o=t.indexOf(e);return-1===o?!i&&n?t[s-1]:t[0]:(o+=i?1:-1,n&&(o=(o+s)%s),t[Math.max(0,Math.min(o,s-1))])},v=/[^.]*(?=\..*)\.|.*/,y=/\..*/,w=/::\d+$/,A={};let E=1;const T={mouseenter:"mouseover",mouseleave:"mouseout"},C=new Set(["click","dblclick","mouseup","mousedown","contextmenu","mousewheel","DOMMouseScroll","mouseover","mouseout","mousemove","selectstart","selectend","keydown","keypress","keyup","orientationchange","touchstart","touchmove","touchend","touchcancel","pointerdown","pointermove","pointerup","pointerleave","pointercancel","gesturestart","gesturechange","gestureend","focus","blur","change","reset","select","submit","focusin","focusout","load","unload","beforeunload","resize","move","DOMContentLoaded","readystatechange","error","abort","scroll"]);function O(t,e){return e&&`${e}::${E++}`||t.uidEvent||E++}function x(t){const e=O(t);return t.uidEvent=e,A[e]=A[e]||{},A[e]}function k(t,e,i=null){return Object.values(t).find((t=>t.callable===e&&t.delegationSelector===i))}function L(t,e,i){const n="string"==typeof e,s=n?i:e||i;let o=I(t);return C.has(o)||(o=t),[n,s,o]}function S(t,e,i,n,s){if("string"!=typeof e||!t)return;let[o,r,a]=L(e,i,n);if(e in T){const t=t=>function(e){if(!e.relatedTarget||e.relatedTarget!==e.delegateTarget&&!e.delegateTarget.contains(e.relatedTarget))return t.call(this,e)};r=t(r)}const l=x(t),c=l[a]||(l[a]={}),h=k(c,r,o?i:null);if(h)return void(h.oneOff=h.oneOff&&s);const d=O(r,e.replace(v,"")),u=o?function(t,e,i){return function n(s){const o=t.querySelectorAll(e);for(let{target:r}=s;r&&r!==this;r=r.parentNode)for(const a of o)if(a===r)return P(s,{delegateTarget:r}),n.oneOff&&N.off(t,s.type,e,i),i.apply(r,[s])}}(t,i,r):function(t,e){return function i(n){return P(n,{delegateTarget:t}),i.oneOff&&N.off(t,n.type,e),e.apply(t,[n])}}(t,r);u.delegationSelector=o?i:null,u.callable=r,u.oneOff=s,u.uidEvent=d,c[d]=u,t.addEventListener(a,u,o)}function D(t,e,i,n,s){const o=k(e[i],n,s);o&&(t.removeEventListener(i,o,Boolean(s)),delete e[i][o.uidEvent])}function $(t,e,i,n){const s=e[i]||{};for(const[o,r]of Object.entries(s))o.includes(n)&&D(t,e,i,r.callable,r.delegationSelector)}function I(t){return t=t.replace(y,""),T[t]||t}const N={on(t,e,i,n){S(t,e,i,n,!1)},one(t,e,i,n){S(t,e,i,n,!0)},off(t,e,i,n){if("string"!=typeof e||!t)return;const[s,o,r]=L(e,i,n),a=r!==e,l=x(t),c=l[r]||{},h=e.startsWith(".");if(void 0===o){if(h)for(const i of Object.keys(l))$(t,l,i,e.slice(1));for(const[i,n]of Object.entries(c)){const s=i.replace(w,"");a&&!e.includes(s)||D(t,l,r,n.callable,n.delegationSelector)}}else{if(!Object.keys(c).length)return;D(t,l,r,o,s?i:null)}},trigger(t,e,i){if("string"!=typeof e||!t)return null;const n=u();let s=null,o=!0,r=!0,a=!1;e!==I(e)&&n&&(s=n.Event(e,i),n(t).trigger(s),o=!s.isPropagationStopped(),r=!s.isImmediatePropagationStopped(),a=s.isDefaultPrevented());const l=P(new Event(e,{bubbles:o,cancelable:!0}),i);return a&&l.preventDefault(),r&&t.dispatchEvent(l),l.defaultPrevented&&s&&s.preventDefault(),l}};function P(t,e={}){for(const[i,n]of Object.entries(e))try{t[i]=n}catch(e){Object.defineProperty(t,i,{configurable:!0,get:()=>n})}return t}function M(t){if("true"===t)return!0;if("false"===t)return!1;if(t===Number(t).toString())return Number(t);if(""===t||"null"===t)return null;if("string"!=typeof t)return t;try{return JSON.parse(decodeURIComponent(t))}catch(e){return t}}function j(t){return t.replace(/[A-Z]/g,(t=>`-${t.toLowerCase()}`))}const F={setDataAttribute(t,e,i){t.setAttribute(`data-bs-${j(e)}`,i)},removeDataAttribute(t,e){t.removeAttribute(`data-bs-${j(e)}`)},getDataAttributes(t){if(!t)return{};const e={},i=Object.keys(t.dataset).filter((t=>t.startsWith("bs")&&!t.startsWith("bsConfig")));for(const n of i){let i=n.replace(/^bs/,"");i=i.charAt(0).toLowerCase()+i.slice(1,i.length),e[i]=M(t.dataset[n])}return e},getDataAttribute:(t,e)=>M(t.getAttribute(`data-bs-${j(e)}`))};class H{static get Default(){return{}}static get DefaultType(){return{}}static get NAME(){throw new Error('You have to implement the static method "NAME", for each component!')}_getConfig(t){return t=this._mergeConfigObj(t),t=this._configAfterMerge(t),this._typeCheckConfig(t),t}_configAfterMerge(t){return t}_mergeConfigObj(t,e){const i=o(e)?F.getDataAttribute(e,"config"):{};return{...this.constructor.Default,..."object"==typeof i?i:{},...o(e)?F.getDataAttributes(e):{},..."object"==typeof t?t:{}}}_typeCheckConfig(t,e=this.constructor.DefaultType){for(const[n,s]of Object.entries(e)){const e=t[n],r=o(e)?"element":null==(i=e)?`${i}`:Object.prototype.toString.call(i).match(/\s([a-z]+)/i)[1].toLowerCase();if(!new RegExp(s).test(r))throw new TypeError(`${this.constructor.NAME.toUpperCase()}: Option "${n}" provided type "${r}" but expected type "${s}".`)}var i}}class W extends H{constructor(t,i){super(),(t=r(t))&&(this._element=t,this._config=this._getConfig(i),e.set(this._element,this.constructor.DATA_KEY,this))}dispose(){e.remove(this._element,this.constructor.DATA_KEY),N.off(this._element,this.constructor.EVENT_KEY);for(const t of Object.getOwnPropertyNames(this))this[t]=null}_queueCallback(t,e,i=!0){_(t,e,i)}_getConfig(t){return t=this._mergeConfigObj(t,this._element),t=this._configAfterMerge(t),this._typeCheckConfig(t),t}static getInstance(t){return e.get(r(t),this.DATA_KEY)}static getOrCreateInstance(t,e={}){return this.getInstance(t)||new this(t,"object"==typeof e?e:null)}static get VERSION(){return"5.3.2"}static get DATA_KEY(){return`bs.${this.NAME}`}static get EVENT_KEY(){return`.${this.DATA_KEY}`}static eventName(t){return`${t}${this.EVENT_KEY}`}}const B=t=>{let e=t.getAttribute("data-bs-target");if(!e||"#"===e){let i=t.getAttribute("href");if(!i||!i.includes("#")&&!i.startsWith("."))return null;i.includes("#")&&!i.startsWith("#")&&(i=`#${i.split("#")[1]}`),e=i&&"#"!==i?n(i.trim()):null}return e},z={find:(t,e=document.documentElement)=>[].concat(...Element.prototype.querySelectorAll.call(e,t)),findOne:(t,e=document.documentElement)=>Element.prototype.querySelector.call(e,t),children:(t,e)=>[].concat(...t.children).filter((t=>t.matches(e))),parents(t,e){const i=[];let n=t.parentNode.closest(e);for(;n;)i.push(n),n=n.parentNode.closest(e);return i},prev(t,e){let i=t.previousElementSibling;for(;i;){if(i.matches(e))return[i];i=i.previousElementSibling}return[]},next(t,e){let i=t.nextElementSibling;for(;i;){if(i.matches(e))return[i];i=i.nextElementSibling}return[]},focusableChildren(t){const e=["a","button","input","textarea","select","details","[tabindex]",'[contenteditable="true"]'].map((t=>`${t}:not([tabindex^="-"])`)).join(",");return this.find(e,t).filter((t=>!l(t)&&a(t)))},getSelectorFromElement(t){const e=B(t);return e&&z.findOne(e)?e:null},getElementFromSelector(t){const e=B(t);return e?z.findOne(e):null},getMultipleElementsFromSelector(t){const e=B(t);return e?z.find(e):[]}},R=(t,e="hide")=>{const i=`click.dismiss${t.EVENT_KEY}`,n=t.NAME;N.on(document,i,`[data-bs-dismiss="${n}"]`,(function(i){if(["A","AREA"].includes(this.tagName)&&i.preventDefault(),l(this))return;const s=z.getElementFromSelector(this)||this.closest(`.${n}`);t.getOrCreateInstance(s)[e]()}))},q=".bs.alert",V=`close${q}`,K=`closed${q}`;class Q extends W{static get NAME(){return"alert"}close(){if(N.trigger(this._element,V).defaultPrevented)return;this._element.classList.remove("show");const t=this._element.classList.contains("fade");this._queueCallback((()=>this._destroyElement()),this._element,t)}_destroyElement(){this._element.remove(),N.trigger(this._element,K),this.dispose()}static jQueryInterface(t){return this.each((function(){const e=Q.getOrCreateInstance(this);if("string"==typeof t){if(void 0===e[t]||t.startsWith("_")||"constructor"===t)throw new TypeError(`No method named "${t}"`);e[t](this)}}))}}R(Q,"close"),m(Q);const X='[data-bs-toggle="button"]';class Y extends W{static get NAME(){return"button"}toggle(){this._element.setAttribute("aria-pressed",this._element.classList.toggle("active"))}static jQueryInterface(t){return this.each((function(){const e=Y.getOrCreateInstance(this);"toggle"===t&&e[t]()}))}}N.on(document,"click.bs.button.data-api",X,(t=>{t.preventDefault();const e=t.target.closest(X);Y.getOrCreateInstance(e).toggle()})),m(Y);const U=".bs.swipe",G=`touchstart${U}`,J=`touchmove${U}`,Z=`touchend${U}`,tt=`pointerdown${U}`,et=`pointerup${U}`,it={endCallback:null,leftCallback:null,rightCallback:null},nt={endCallback:"(function|null)",leftCallback:"(function|null)",rightCallback:"(function|null)"};class st extends H{constructor(t,e){super(),this._element=t,t&&st.isSupported()&&(this._config=this._getConfig(e),this._deltaX=0,this._supportPointerEvents=Boolean(window.PointerEvent),this._initEvents())}static get Default(){return it}static get DefaultType(){return nt}static get NAME(){return"swipe"}dispose(){N.off(this._element,U)}_start(t){this._supportPointerEvents?this._eventIsPointerPenTouch(t)&&(this._deltaX=t.clientX):this._deltaX=t.touches[0].clientX}_end(t){this._eventIsPointerPenTouch(t)&&(this._deltaX=t.clientX-this._deltaX),this._handleSwipe(),g(this._config.endCallback)}_move(t){this._deltaX=t.touches&&t.touches.length>1?0:t.touches[0].clientX-this._deltaX}_handleSwipe(){const t=Math.abs(this._deltaX);if(t<=40)return;const e=t/this._deltaX;this._deltaX=0,e&&g(e>0?this._config.rightCallback:this._config.leftCallback)}_initEvents(){this._supportPointerEvents?(N.on(this._element,tt,(t=>this._start(t))),N.on(this._element,et,(t=>this._end(t))),this._element.classList.add("pointer-event")):(N.on(this._element,G,(t=>this._start(t))),N.on(this._element,J,(t=>this._move(t))),N.on(this._element,Z,(t=>this._end(t))))}_eventIsPointerPenTouch(t){return this._supportPointerEvents&&("pen"===t.pointerType||"touch"===t.pointerType)}static isSupported(){return"ontouchstart"in document.documentElement||navigator.maxTouchPoints>0}}const ot=".bs.carousel",rt=".data-api",at="next",lt="prev",ct="left",ht="right",dt=`slide${ot}`,ut=`slid${ot}`,ft=`keydown${ot}`,pt=`mouseenter${ot}`,mt=`mouseleave${ot}`,gt=`dragstart${ot}`,_t=`load${ot}${rt}`,bt=`click${ot}${rt}`,vt="carousel",yt="active",wt=".active",At=".carousel-item",Et=wt+At,Tt={ArrowLeft:ht,ArrowRight:ct},Ct={interval:5e3,keyboard:!0,pause:"hover",ride:!1,touch:!0,wrap:!0},Ot={interval:"(number|boolean)",keyboard:"boolean",pause:"(string|boolean)",ride:"(boolean|string)",touch:"boolean",wrap:"boolean"};class xt extends W{constructor(t,e){super(t,e),this._interval=null,this._activeElement=null,this._isSliding=!1,this.touchTimeout=null,this._swipeHelper=null,this._indicatorsElement=z.findOne(".carousel-indicators",this._element),this._addEventListeners(),this._config.ride===vt&&this.cycle()}static get Default(){return Ct}static get DefaultType(){return Ot}static get NAME(){return"carousel"}next(){this._slide(at)}nextWhenVisible(){!document.hidden&&a(this._element)&&this.next()}prev(){this._slide(lt)}pause(){this._isSliding&&s(this._element),this._clearInterval()}cycle(){this._clearInterval(),this._updateInterval(),this._interval=setInterval((()=>this.nextWhenVisible()),this._config.interval)}_maybeEnableCycle(){this._config.ride&&(this._isSliding?N.one(this._element,ut,(()=>this.cycle())):this.cycle())}to(t){const e=this._getItems();if(t>e.length-1||t<0)return;if(this._isSliding)return void N.one(this._element,ut,(()=>this.to(t)));const i=this._getItemIndex(this._getActive());if(i===t)return;const n=t>i?at:lt;this._slide(n,e[t])}dispose(){this._swipeHelper&&this._swipeHelper.dispose(),super.dispose()}_configAfterMerge(t){return t.defaultInterval=t.interval,t}_addEventListeners(){this._config.keyboard&&N.on(this._element,ft,(t=>this._keydown(t))),"hover"===this._config.pause&&(N.on(this._element,pt,(()=>this.pause())),N.on(this._element,mt,(()=>this._maybeEnableCycle()))),this._config.touch&&st.isSupported()&&this._addTouchEventListeners()}_addTouchEventListeners(){for(const t of z.find(".carousel-item img",this._element))N.on(t,gt,(t=>t.preventDefault()));const t={leftCallback:()=>this._slide(this._directionToOrder(ct)),rightCallback:()=>this._slide(this._directionToOrder(ht)),endCallback:()=>{"hover"===this._config.pause&&(this.pause(),this.touchTimeout&&clearTimeout(this.touchTimeout),this.touchTimeout=setTimeout((()=>this._maybeEnableCycle()),500+this._config.interval))}};this._swipeHelper=new st(this._element,t)}_keydown(t){if(/input|textarea/i.test(t.target.tagName))return;const e=Tt[t.key];e&&(t.preventDefault(),this._slide(this._directionToOrder(e)))}_getItemIndex(t){return this._getItems().indexOf(t)}_setActiveIndicatorElement(t){if(!this._indicatorsElement)return;const e=z.findOne(wt,this._indicatorsElement);e.classList.remove(yt),e.removeAttribute("aria-current");const i=z.findOne(`[data-bs-slide-to="${t}"]`,this._indicatorsElement);i&&(i.classList.add(yt),i.setAttribute("aria-current","true"))}_updateInterval(){const t=this._activeElement||this._getActive();if(!t)return;const e=Number.parseInt(t.getAttribute("data-bs-interval"),10);this._config.interval=e||this._config.defaultInterval}_slide(t,e=null){if(this._isSliding)return;const i=this._getActive(),n=t===at,s=e||b(this._getItems(),i,n,this._config.wrap);if(s===i)return;const o=this._getItemIndex(s),r=e=>N.trigger(this._element,e,{relatedTarget:s,direction:this._orderToDirection(t),from:this._getItemIndex(i),to:o});if(r(dt).defaultPrevented)return;if(!i||!s)return;const a=Boolean(this._interval);this.pause(),this._isSliding=!0,this._setActiveIndicatorElement(o),this._activeElement=s;const l=n?"carousel-item-start":"carousel-item-end",c=n?"carousel-item-next":"carousel-item-prev";s.classList.add(c),d(s),i.classList.add(l),s.classList.add(l),this._queueCallback((()=>{s.classList.remove(l,c),s.classList.add(yt),i.classList.remove(yt,c,l),this._isSliding=!1,r(ut)}),i,this._isAnimated()),a&&this.cycle()}_isAnimated(){return this._element.classList.contains("slide")}_getActive(){return z.findOne(Et,this._element)}_getItems(){return z.find(At,this._element)}_clearInterval(){this._interval&&(clearInterval(this._interval),this._interval=null)}_directionToOrder(t){return p()?t===ct?lt:at:t===ct?at:lt}_orderToDirection(t){return p()?t===lt?ct:ht:t===lt?ht:ct}static jQueryInterface(t){return this.each((function(){const e=xt.getOrCreateInstance(this,t);if("number"!=typeof t){if("string"==typeof t){if(void 0===e[t]||t.startsWith("_")||"constructor"===t)throw new TypeError(`No method named "${t}"`);e[t]()}}else e.to(t)}))}}N.on(document,bt,"[data-bs-slide], [data-bs-slide-to]",(function(t){const e=z.getElementFromSelector(this);if(!e||!e.classList.contains(vt))return;t.preventDefault();const i=xt.getOrCreateInstance(e),n=this.getAttribute("data-bs-slide-to");return n?(i.to(n),void i._maybeEnableCycle()):"next"===F.getDataAttribute(this,"slide")?(i.next(),void i._maybeEnableCycle()):(i.prev(),void i._maybeEnableCycle())})),N.on(window,_t,(()=>{const t=z.find('[data-bs-ride="carousel"]');for(const e of t)xt.getOrCreateInstance(e)})),m(xt);const kt=".bs.collapse",Lt=`show${kt}`,St=`shown${kt}`,Dt=`hide${kt}`,$t=`hidden${kt}`,It=`click${kt}.data-api`,Nt="show",Pt="collapse",Mt="collapsing",jt=`:scope .${Pt} .${Pt}`,Ft='[data-bs-toggle="collapse"]',Ht={parent:null,toggle:!0},Wt={parent:"(null|element)",toggle:"boolean"};class Bt extends W{constructor(t,e){super(t,e),this._isTransitioning=!1,this._triggerArray=[];const i=z.find(Ft);for(const t of i){const e=z.getSelectorFromElement(t),i=z.find(e).filter((t=>t===this._element));null!==e&&i.length&&this._triggerArray.push(t)}this._initializeChildren(),this._config.parent||this._addAriaAndCollapsedClass(this._triggerArray,this._isShown()),this._config.toggle&&this.toggle()}static get Default(){return Ht}static get DefaultType(){return Wt}static get NAME(){return"collapse"}toggle(){this._isShown()?this.hide():this.show()}show(){if(this._isTransitioning||this._isShown())return;let t=[];if(this._config.parent&&(t=this._getFirstLevelChildren(".collapse.show, .collapse.collapsing").filter((t=>t!==this._element)).map((t=>Bt.getOrCreateInstance(t,{toggle:!1})))),t.length&&t[0]._isTransitioning)return;if(N.trigger(this._element,Lt).defaultPrevented)return;for(const e of t)e.hide();const e=this._getDimension();this._element.classList.remove(Pt),this._element.classList.add(Mt),this._element.style[e]=0,this._addAriaAndCollapsedClass(this._triggerArray,!0),this._isTransitioning=!0;const i=`scroll${e[0].toUpperCase()+e.slice(1)}`;this._queueCallback((()=>{this._isTransitioning=!1,this._element.classList.remove(Mt),this._element.classList.add(Pt,Nt),this._element.style[e]="",N.trigger(this._element,St)}),this._element,!0),this._element.style[e]=`${this._element[i]}px`}hide(){if(this._isTransitioning||!this._isShown())return;if(N.trigger(this._element,Dt).defaultPrevented)return;const t=this._getDimension();this._element.style[t]=`${this._element.getBoundingClientRect()[t]}px`,d(this._element),this._element.classList.add(Mt),this._element.classList.remove(Pt,Nt);for(const t of this._triggerArray){const e=z.getElementFromSelector(t);e&&!this._isShown(e)&&this._addAriaAndCollapsedClass([t],!1)}this._isTransitioning=!0,this._element.style[t]="",this._queueCallback((()=>{this._isTransitioning=!1,this._element.classList.remove(Mt),this._element.classList.add(Pt),N.trigger(this._element,$t)}),this._element,!0)}_isShown(t=this._element){return t.classList.contains(Nt)}_configAfterMerge(t){return t.toggle=Boolean(t.toggle),t.parent=r(t.parent),t}_getDimension(){return this._element.classList.contains("collapse-horizontal")?"width":"height"}_initializeChildren(){if(!this._config.parent)return;const t=this._getFirstLevelChildren(Ft);for(const e of t){const t=z.getElementFromSelector(e);t&&this._addAriaAndCollapsedClass([e],this._isShown(t))}}_getFirstLevelChildren(t){const e=z.find(jt,this._config.parent);return z.find(t,this._config.parent).filter((t=>!e.includes(t)))}_addAriaAndCollapsedClass(t,e){if(t.length)for(const i of t)i.classList.toggle("collapsed",!e),i.setAttribute("aria-expanded",e)}static jQueryInterface(t){const e={};return"string"==typeof t&&/show|hide/.test(t)&&(e.toggle=!1),this.each((function(){const i=Bt.getOrCreateInstance(this,e);if("string"==typeof t){if(void 0===i[t])throw new TypeError(`No method named "${t}"`);i[t]()}}))}}N.on(document,It,Ft,(function(t){("A"===t.target.tagName||t.delegateTarget&&"A"===t.delegateTarget.tagName)&&t.preventDefault();for(const t of z.getMultipleElementsFromSelector(this))Bt.getOrCreateInstance(t,{toggle:!1}).toggle()})),m(Bt);var zt="top",Rt="bottom",qt="right",Vt="left",Kt="auto",Qt=[zt,Rt,qt,Vt],Xt="start",Yt="end",Ut="clippingParents",Gt="viewport",Jt="popper",Zt="reference",te=Qt.reduce((function(t,e){return t.concat([e+"-"+Xt,e+"-"+Yt])}),[]),ee=[].concat(Qt,[Kt]).reduce((function(t,e){return t.concat([e,e+"-"+Xt,e+"-"+Yt])}),[]),ie="beforeRead",ne="read",se="afterRead",oe="beforeMain",re="main",ae="afterMain",le="beforeWrite",ce="write",he="afterWrite",de=[ie,ne,se,oe,re,ae,le,ce,he];function ue(t){return t?(t.nodeName||"").toLowerCase():null}function fe(t){if(null==t)return window;if("[object Window]"!==t.toString()){var e=t.ownerDocument;return e&&e.defaultView||window}return t}function pe(t){return t instanceof fe(t).Element||t instanceof Element}function me(t){return t instanceof fe(t).HTMLElement||t instanceof HTMLElement}function ge(t){return"undefined"!=typeof ShadowRoot&&(t instanceof fe(t).ShadowRoot||t instanceof ShadowRoot)}const _e={name:"applyStyles",enabled:!0,phase:"write",fn:function(t){var e=t.state;Object.keys(e.elements).forEach((function(t){var i=e.styles[t]||{},n=e.attributes[t]||{},s=e.elements[t];me(s)&&ue(s)&&(Object.assign(s.style,i),Object.keys(n).forEach((function(t){var e=n[t];!1===e?s.removeAttribute(t):s.setAttribute(t,!0===e?"":e)})))}))},effect:function(t){var e=t.state,i={popper:{position:e.options.strategy,left:"0",top:"0",margin:"0"},arrow:{position:"absolute"},reference:{}};return Object.assign(e.elements.popper.style,i.popper),e.styles=i,e.elements.arrow&&Object.assign(e.elements.arrow.style,i.arrow),function(){Object.keys(e.elements).forEach((function(t){var n=e.elements[t],s=e.attributes[t]||{},o=Object.keys(e.styles.hasOwnProperty(t)?e.styles[t]:i[t]).reduce((function(t,e){return t[e]="",t}),{});me(n)&&ue(n)&&(Object.assign(n.style,o),Object.keys(s).forEach((function(t){n.removeAttribute(t)})))}))}},requires:["computeStyles"]};function be(t){return t.split("-")[0]}var ve=Math.max,ye=Math.min,we=Math.round;function Ae(){var t=navigator.userAgentData;return null!=t&&t.brands&&Array.isArray(t.brands)?t.brands.map((function(t){return t.brand+"/"+t.version})).join(" "):navigator.userAgent}function Ee(){return!/^((?!chrome|android).)*safari/i.test(Ae())}function Te(t,e,i){void 0===e&&(e=!1),void 0===i&&(i=!1);var n=t.getBoundingClientRect(),s=1,o=1;e&&me(t)&&(s=t.offsetWidth>0&&we(n.width)/t.offsetWidth||1,o=t.offsetHeight>0&&we(n.height)/t.offsetHeight||1);var r=(pe(t)?fe(t):window).visualViewport,a=!Ee()&&i,l=(n.left+(a&&r?r.offsetLeft:0))/s,c=(n.top+(a&&r?r.offsetTop:0))/o,h=n.width/s,d=n.height/o;return{width:h,height:d,top:c,right:l+h,bottom:c+d,left:l,x:l,y:c}}function Ce(t){var e=Te(t),i=t.offsetWidth,n=t.offsetHeight;return Math.abs(e.width-i)<=1&&(i=e.width),Math.abs(e.height-n)<=1&&(n=e.height),{x:t.offsetLeft,y:t.offsetTop,width:i,height:n}}function Oe(t,e){var i=e.getRootNode&&e.getRootNode();if(t.contains(e))return!0;if(i&&ge(i)){var n=e;do{if(n&&t.isSameNode(n))return!0;n=n.parentNode||n.host}while(n)}return!1}function xe(t){return fe(t).getComputedStyle(t)}function ke(t){return["table","td","th"].indexOf(ue(t))>=0}function Le(t){return((pe(t)?t.ownerDocument:t.document)||window.document).documentElement}function Se(t){return"html"===ue(t)?t:t.assignedSlot||t.parentNode||(ge(t)?t.host:null)||Le(t)}function De(t){return me(t)&&"fixed"!==xe(t).position?t.offsetParent:null}function $e(t){for(var e=fe(t),i=De(t);i&&ke(i)&&"static"===xe(i).position;)i=De(i);return i&&("html"===ue(i)||"body"===ue(i)&&"static"===xe(i).position)?e:i||function(t){var e=/firefox/i.test(Ae());if(/Trident/i.test(Ae())&&me(t)&&"fixed"===xe(t).position)return null;var i=Se(t);for(ge(i)&&(i=i.host);me(i)&&["html","body"].indexOf(ue(i))<0;){var n=xe(i);if("none"!==n.transform||"none"!==n.perspective||"paint"===n.contain||-1!==["transform","perspective"].indexOf(n.willChange)||e&&"filter"===n.willChange||e&&n.filter&&"none"!==n.filter)return i;i=i.parentNode}return null}(t)||e}function Ie(t){return["top","bottom"].indexOf(t)>=0?"x":"y"}function Ne(t,e,i){return ve(t,ye(e,i))}function Pe(t){return Object.assign({},{top:0,right:0,bottom:0,left:0},t)}function Me(t,e){return e.reduce((function(e,i){return e[i]=t,e}),{})}const je={name:"arrow",enabled:!0,phase:"main",fn:function(t){var e,i=t.state,n=t.name,s=t.options,o=i.elements.arrow,r=i.modifiersData.popperOffsets,a=be(i.placement),l=Ie(a),c=[Vt,qt].indexOf(a)>=0?"height":"width";if(o&&r){var h=function(t,e){return Pe("number"!=typeof(t="function"==typeof t?t(Object.assign({},e.rects,{placement:e.placement})):t)?t:Me(t,Qt))}(s.padding,i),d=Ce(o),u="y"===l?zt:Vt,f="y"===l?Rt:qt,p=i.rects.reference[c]+i.rects.reference[l]-r[l]-i.rects.popper[c],m=r[l]-i.rects.reference[l],g=$e(o),_=g?"y"===l?g.clientHeight||0:g.clientWidth||0:0,b=p/2-m/2,v=h[u],y=_-d[c]-h[f],w=_/2-d[c]/2+b,A=Ne(v,w,y),E=l;i.modifiersData[n]=((e={})[E]=A,e.centerOffset=A-w,e)}},effect:function(t){var e=t.state,i=t.options.element,n=void 0===i?"[data-popper-arrow]":i;null!=n&&("string"!=typeof n||(n=e.elements.popper.querySelector(n)))&&Oe(e.elements.popper,n)&&(e.elements.arrow=n)},requires:["popperOffsets"],requiresIfExists:["preventOverflow"]};function Fe(t){return t.split("-")[1]}var He={top:"auto",right:"auto",bottom:"auto",left:"auto"};function We(t){var e,i=t.popper,n=t.popperRect,s=t.placement,o=t.variation,r=t.offsets,a=t.position,l=t.gpuAcceleration,c=t.adaptive,h=t.roundOffsets,d=t.isFixed,u=r.x,f=void 0===u?0:u,p=r.y,m=void 0===p?0:p,g="function"==typeof h?h({x:f,y:m}):{x:f,y:m};f=g.x,m=g.y;var _=r.hasOwnProperty("x"),b=r.hasOwnProperty("y"),v=Vt,y=zt,w=window;if(c){var A=$e(i),E="clientHeight",T="clientWidth";A===fe(i)&&"static"!==xe(A=Le(i)).position&&"absolute"===a&&(E="scrollHeight",T="scrollWidth"),(s===zt||(s===Vt||s===qt)&&o===Yt)&&(y=Rt,m-=(d&&A===w&&w.visualViewport?w.visualViewport.height:A[E])-n.height,m*=l?1:-1),s!==Vt&&(s!==zt&&s!==Rt||o!==Yt)||(v=qt,f-=(d&&A===w&&w.visualViewport?w.visualViewport.width:A[T])-n.width,f*=l?1:-1)}var C,O=Object.assign({position:a},c&&He),x=!0===h?function(t,e){var i=t.x,n=t.y,s=e.devicePixelRatio||1;return{x:we(i*s)/s||0,y:we(n*s)/s||0}}({x:f,y:m},fe(i)):{x:f,y:m};return f=x.x,m=x.y,l?Object.assign({},O,((C={})[y]=b?"0":"",C[v]=_?"0":"",C.transform=(w.devicePixelRatio||1)<=1?"translate("+f+"px, "+m+"px)":"translate3d("+f+"px, "+m+"px, 0)",C)):Object.assign({},O,((e={})[y]=b?m+"px":"",e[v]=_?f+"px":"",e.transform="",e))}const Be={name:"computeStyles",enabled:!0,phase:"beforeWrite",fn:function(t){var e=t.state,i=t.options,n=i.gpuAcceleration,s=void 0===n||n,o=i.adaptive,r=void 0===o||o,a=i.roundOffsets,l=void 0===a||a,c={placement:be(e.placement),variation:Fe(e.placement),popper:e.elements.popper,popperRect:e.rects.popper,gpuAcceleration:s,isFixed:"fixed"===e.options.strategy};null!=e.modifiersData.popperOffsets&&(e.styles.popper=Object.assign({},e.styles.popper,We(Object.assign({},c,{offsets:e.modifiersData.popperOffsets,position:e.options.strategy,adaptive:r,roundOffsets:l})))),null!=e.modifiersData.arrow&&(e.styles.arrow=Object.assign({},e.styles.arrow,We(Object.assign({},c,{offsets:e.modifiersData.arrow,position:"absolute",adaptive:!1,roundOffsets:l})))),e.attributes.popper=Object.assign({},e.attributes.popper,{"data-popper-placement":e.placement})},data:{}};var ze={passive:!0};const Re={name:"eventListeners",enabled:!0,phase:"write",fn:function(){},effect:function(t){var e=t.state,i=t.instance,n=t.options,s=n.scroll,o=void 0===s||s,r=n.resize,a=void 0===r||r,l=fe(e.elements.popper),c=[].concat(e.scrollParents.reference,e.scrollParents.popper);return o&&c.forEach((function(t){t.addEventListener("scroll",i.update,ze)})),a&&l.addEventListener("resize",i.update,ze),function(){o&&c.forEach((function(t){t.removeEventListener("scroll",i.update,ze)})),a&&l.removeEventListener("resize",i.update,ze)}},data:{}};var qe={left:"right",right:"left",bottom:"top",top:"bottom"};function Ve(t){return t.replace(/left|right|bottom|top/g,(function(t){return qe[t]}))}var Ke={start:"end",end:"start"};function Qe(t){return t.replace(/start|end/g,(function(t){return Ke[t]}))}function Xe(t){var e=fe(t);return{scrollLeft:e.pageXOffset,scrollTop:e.pageYOffset}}function Ye(t){return Te(Le(t)).left+Xe(t).scrollLeft}function Ue(t){var e=xe(t),i=e.overflow,n=e.overflowX,s=e.overflowY;return/auto|scroll|overlay|hidden/.test(i+s+n)}function Ge(t){return["html","body","#document"].indexOf(ue(t))>=0?t.ownerDocument.body:me(t)&&Ue(t)?t:Ge(Se(t))}function Je(t,e){var i;void 0===e&&(e=[]);var n=Ge(t),s=n===(null==(i=t.ownerDocument)?void 0:i.body),o=fe(n),r=s?[o].concat(o.visualViewport||[],Ue(n)?n:[]):n,a=e.concat(r);return s?a:a.concat(Je(Se(r)))}function Ze(t){return Object.assign({},t,{left:t.x,top:t.y,right:t.x+t.width,bottom:t.y+t.height})}function ti(t,e,i){return e===Gt?Ze(function(t,e){var i=fe(t),n=Le(t),s=i.visualViewport,o=n.clientWidth,r=n.clientHeight,a=0,l=0;if(s){o=s.width,r=s.height;var c=Ee();(c||!c&&"fixed"===e)&&(a=s.offsetLeft,l=s.offsetTop)}return{width:o,height:r,x:a+Ye(t),y:l}}(t,i)):pe(e)?function(t,e){var i=Te(t,!1,"fixed"===e);return i.top=i.top+t.clientTop,i.left=i.left+t.clientLeft,i.bottom=i.top+t.clientHeight,i.right=i.left+t.clientWidth,i.width=t.clientWidth,i.height=t.clientHeight,i.x=i.left,i.y=i.top,i}(e,i):Ze(function(t){var e,i=Le(t),n=Xe(t),s=null==(e=t.ownerDocument)?void 0:e.body,o=ve(i.scrollWidth,i.clientWidth,s?s.scrollWidth:0,s?s.clientWidth:0),r=ve(i.scrollHeight,i.clientHeight,s?s.scrollHeight:0,s?s.clientHeight:0),a=-n.scrollLeft+Ye(t),l=-n.scrollTop;return"rtl"===xe(s||i).direction&&(a+=ve(i.clientWidth,s?s.clientWidth:0)-o),{width:o,height:r,x:a,y:l}}(Le(t)))}function ei(t){var e,i=t.reference,n=t.element,s=t.placement,o=s?be(s):null,r=s?Fe(s):null,a=i.x+i.width/2-n.width/2,l=i.y+i.height/2-n.height/2;switch(o){case zt:e={x:a,y:i.y-n.height};break;case Rt:e={x:a,y:i.y+i.height};break;case qt:e={x:i.x+i.width,y:l};break;case Vt:e={x:i.x-n.width,y:l};break;default:e={x:i.x,y:i.y}}var c=o?Ie(o):null;if(null!=c){var h="y"===c?"height":"width";switch(r){case Xt:e[c]=e[c]-(i[h]/2-n[h]/2);break;case Yt:e[c]=e[c]+(i[h]/2-n[h]/2)}}return e}function ii(t,e){void 0===e&&(e={});var i=e,n=i.placement,s=void 0===n?t.placement:n,o=i.strategy,r=void 0===o?t.strategy:o,a=i.boundary,l=void 0===a?Ut:a,c=i.rootBoundary,h=void 0===c?Gt:c,d=i.elementContext,u=void 0===d?Jt:d,f=i.altBoundary,p=void 0!==f&&f,m=i.padding,g=void 0===m?0:m,_=Pe("number"!=typeof g?g:Me(g,Qt)),b=u===Jt?Zt:Jt,v=t.rects.popper,y=t.elements[p?b:u],w=function(t,e,i,n){var s="clippingParents"===e?function(t){var e=Je(Se(t)),i=["absolute","fixed"].indexOf(xe(t).position)>=0&&me(t)?$e(t):t;return pe(i)?e.filter((function(t){return pe(t)&&Oe(t,i)&&"body"!==ue(t)})):[]}(t):[].concat(e),o=[].concat(s,[i]),r=o[0],a=o.reduce((function(e,i){var s=ti(t,i,n);return e.top=ve(s.top,e.top),e.right=ye(s.right,e.right),e.bottom=ye(s.bottom,e.bottom),e.left=ve(s.left,e.left),e}),ti(t,r,n));return a.width=a.right-a.left,a.height=a.bottom-a.top,a.x=a.left,a.y=a.top,a}(pe(y)?y:y.contextElement||Le(t.elements.popper),l,h,r),A=Te(t.elements.reference),E=ei({reference:A,element:v,strategy:"absolute",placement:s}),T=Ze(Object.assign({},v,E)),C=u===Jt?T:A,O={top:w.top-C.top+_.top,bottom:C.bottom-w.bottom+_.bottom,left:w.left-C.left+_.left,right:C.right-w.right+_.right},x=t.modifiersData.offset;if(u===Jt&&x){var k=x[s];Object.keys(O).forEach((function(t){var e=[qt,Rt].indexOf(t)>=0?1:-1,i=[zt,Rt].indexOf(t)>=0?"y":"x";O[t]+=k[i]*e}))}return O}function ni(t,e){void 0===e&&(e={});var i=e,n=i.placement,s=i.boundary,o=i.rootBoundary,r=i.padding,a=i.flipVariations,l=i.allowedAutoPlacements,c=void 0===l?ee:l,h=Fe(n),d=h?a?te:te.filter((function(t){return Fe(t)===h})):Qt,u=d.filter((function(t){return c.indexOf(t)>=0}));0===u.length&&(u=d);var f=u.reduce((function(e,i){return e[i]=ii(t,{placement:i,boundary:s,rootBoundary:o,padding:r})[be(i)],e}),{});return Object.keys(f).sort((function(t,e){return f[t]-f[e]}))}const si={name:"flip",enabled:!0,phase:"main",fn:function(t){var e=t.state,i=t.options,n=t.name;if(!e.modifiersData[n]._skip){for(var s=i.mainAxis,o=void 0===s||s,r=i.altAxis,a=void 0===r||r,l=i.fallbackPlacements,c=i.padding,h=i.boundary,d=i.rootBoundary,u=i.altBoundary,f=i.flipVariations,p=void 0===f||f,m=i.allowedAutoPlacements,g=e.options.placement,_=be(g),b=l||(_!==g&&p?function(t){if(be(t)===Kt)return[];var e=Ve(t);return[Qe(t),e,Qe(e)]}(g):[Ve(g)]),v=[g].concat(b).reduce((function(t,i){return t.concat(be(i)===Kt?ni(e,{placement:i,boundary:h,rootBoundary:d,padding:c,flipVariations:p,allowedAutoPlacements:m}):i)}),[]),y=e.rects.reference,w=e.rects.popper,A=new Map,E=!0,T=v[0],C=0;C<v.length;C++){var O=v[C],x=be(O),k=Fe(O)===Xt,L=[zt,Rt].indexOf(x)>=0,S=L?"width":"height",D=ii(e,{placement:O,boundary:h,rootBoundary:d,altBoundary:u,padding:c}),$=L?k?qt:Vt:k?Rt:zt;y[S]>w[S]&&($=Ve($));var I=Ve($),N=[];if(o&&N.push(D[x]<=0),a&&N.push(D[$]<=0,D[I]<=0),N.every((function(t){return t}))){T=O,E=!1;break}A.set(O,N)}if(E)for(var P=function(t){var e=v.find((function(e){var i=A.get(e);if(i)return i.slice(0,t).every((function(t){return t}))}));if(e)return T=e,"break"},M=p?3:1;M>0&&"break"!==P(M);M--);e.placement!==T&&(e.modifiersData[n]._skip=!0,e.placement=T,e.reset=!0)}},requiresIfExists:["offset"],data:{_skip:!1}};function oi(t,e,i){return void 0===i&&(i={x:0,y:0}),{top:t.top-e.height-i.y,right:t.right-e.width+i.x,bottom:t.bottom-e.height+i.y,left:t.left-e.width-i.x}}function ri(t){return[zt,qt,Rt,Vt].some((function(e){return t[e]>=0}))}const ai={name:"hide",enabled:!0,phase:"main",requiresIfExists:["preventOverflow"],fn:function(t){var e=t.state,i=t.name,n=e.rects.reference,s=e.rects.popper,o=e.modifiersData.preventOverflow,r=ii(e,{elementContext:"reference"}),a=ii(e,{altBoundary:!0}),l=oi(r,n),c=oi(a,s,o),h=ri(l),d=ri(c);e.modifiersData[i]={referenceClippingOffsets:l,popperEscapeOffsets:c,isReferenceHidden:h,hasPopperEscaped:d},e.attributes.popper=Object.assign({},e.attributes.popper,{"data-popper-reference-hidden":h,"data-popper-escaped":d})}},li={name:"offset",enabled:!0,phase:"main",requires:["popperOffsets"],fn:function(t){var e=t.state,i=t.options,n=t.name,s=i.offset,o=void 0===s?[0,0]:s,r=ee.reduce((function(t,i){return t[i]=function(t,e,i){var n=be(t),s=[Vt,zt].indexOf(n)>=0?-1:1,o="function"==typeof i?i(Object.assign({},e,{placement:t})):i,r=o[0],a=o[1];return r=r||0,a=(a||0)*s,[Vt,qt].indexOf(n)>=0?{x:a,y:r}:{x:r,y:a}}(i,e.rects,o),t}),{}),a=r[e.placement],l=a.x,c=a.y;null!=e.modifiersData.popperOffsets&&(e.modifiersData.popperOffsets.x+=l,e.modifiersData.popperOffsets.y+=c),e.modifiersData[n]=r}},ci={name:"popperOffsets",enabled:!0,phase:"read",fn:function(t){var e=t.state,i=t.name;e.modifiersData[i]=ei({reference:e.rects.reference,element:e.rects.popper,strategy:"absolute",placement:e.placement})},data:{}},hi={name:"preventOverflow",enabled:!0,phase:"main",fn:function(t){var e=t.state,i=t.options,n=t.name,s=i.mainAxis,o=void 0===s||s,r=i.altAxis,a=void 0!==r&&r,l=i.boundary,c=i.rootBoundary,h=i.altBoundary,d=i.padding,u=i.tether,f=void 0===u||u,p=i.tetherOffset,m=void 0===p?0:p,g=ii(e,{boundary:l,rootBoundary:c,padding:d,altBoundary:h}),_=be(e.placement),b=Fe(e.placement),v=!b,y=Ie(_),w="x"===y?"y":"x",A=e.modifiersData.popperOffsets,E=e.rects.reference,T=e.rects.popper,C="function"==typeof m?m(Object.assign({},e.rects,{placement:e.placement})):m,O="number"==typeof C?{mainAxis:C,altAxis:C}:Object.assign({mainAxis:0,altAxis:0},C),x=e.modifiersData.offset?e.modifiersData.offset[e.placement]:null,k={x:0,y:0};if(A){if(o){var L,S="y"===y?zt:Vt,D="y"===y?Rt:qt,$="y"===y?"height":"width",I=A[y],N=I+g[S],P=I-g[D],M=f?-T[$]/2:0,j=b===Xt?E[$]:T[$],F=b===Xt?-T[$]:-E[$],H=e.elements.arrow,W=f&&H?Ce(H):{width:0,height:0},B=e.modifiersData["arrow#persistent"]?e.modifiersData["arrow#persistent"].padding:{top:0,right:0,bottom:0,left:0},z=B[S],R=B[D],q=Ne(0,E[$],W[$]),V=v?E[$]/2-M-q-z-O.mainAxis:j-q-z-O.mainAxis,K=v?-E[$]/2+M+q+R+O.mainAxis:F+q+R+O.mainAxis,Q=e.elements.arrow&&$e(e.elements.arrow),X=Q?"y"===y?Q.clientTop||0:Q.clientLeft||0:0,Y=null!=(L=null==x?void 0:x[y])?L:0,U=I+K-Y,G=Ne(f?ye(N,I+V-Y-X):N,I,f?ve(P,U):P);A[y]=G,k[y]=G-I}if(a){var J,Z="x"===y?zt:Vt,tt="x"===y?Rt:qt,et=A[w],it="y"===w?"height":"width",nt=et+g[Z],st=et-g[tt],ot=-1!==[zt,Vt].indexOf(_),rt=null!=(J=null==x?void 0:x[w])?J:0,at=ot?nt:et-E[it]-T[it]-rt+O.altAxis,lt=ot?et+E[it]+T[it]-rt-O.altAxis:st,ct=f&&ot?function(t,e,i){var n=Ne(t,e,i);return n>i?i:n}(at,et,lt):Ne(f?at:nt,et,f?lt:st);A[w]=ct,k[w]=ct-et}e.modifiersData[n]=k}},requiresIfExists:["offset"]};function di(t,e,i){void 0===i&&(i=!1);var n,s,o=me(e),r=me(e)&&function(t){var e=t.getBoundingClientRect(),i=we(e.width)/t.offsetWidth||1,n=we(e.height)/t.offsetHeight||1;return 1!==i||1!==n}(e),a=Le(e),l=Te(t,r,i),c={scrollLeft:0,scrollTop:0},h={x:0,y:0};return(o||!o&&!i)&&(("body"!==ue(e)||Ue(a))&&(c=(n=e)!==fe(n)&&me(n)?{scrollLeft:(s=n).scrollLeft,scrollTop:s.scrollTop}:Xe(n)),me(e)?((h=Te(e,!0)).x+=e.clientLeft,h.y+=e.clientTop):a&&(h.x=Ye(a))),{x:l.left+c.scrollLeft-h.x,y:l.top+c.scrollTop-h.y,width:l.width,height:l.height}}function ui(t){var e=new Map,i=new Set,n=[];function s(t){i.add(t.name),[].concat(t.requires||[],t.requiresIfExists||[]).forEach((function(t){if(!i.has(t)){var n=e.get(t);n&&s(n)}})),n.push(t)}return t.forEach((function(t){e.set(t.name,t)})),t.forEach((function(t){i.has(t.name)||s(t)})),n}var fi={placement:"bottom",modifiers:[],strategy:"absolute"};function pi(){for(var t=arguments.length,e=new Array(t),i=0;i<t;i++)e[i]=arguments[i];return!e.some((function(t){return!(t&&"function"==typeof t.getBoundingClientRect)}))}function mi(t){void 0===t&&(t={});var e=t,i=e.defaultModifiers,n=void 0===i?[]:i,s=e.defaultOptions,o=void 0===s?fi:s;return function(t,e,i){void 0===i&&(i=o);var s,r,a={placement:"bottom",orderedModifiers:[],options:Object.assign({},fi,o),modifiersData:{},elements:{reference:t,popper:e},attributes:{},styles:{}},l=[],c=!1,h={state:a,setOptions:function(i){var s="function"==typeof i?i(a.options):i;d(),a.options=Object.assign({},o,a.options,s),a.scrollParents={reference:pe(t)?Je(t):t.contextElement?Je(t.contextElement):[],popper:Je(e)};var r,c,u=function(t){var e=ui(t);return de.reduce((function(t,i){return t.concat(e.filter((function(t){return t.phase===i})))}),[])}((r=[].concat(n,a.options.modifiers),c=r.reduce((function(t,e){var i=t[e.name];return t[e.name]=i?Object.assign({},i,e,{options:Object.assign({},i.options,e.options),data:Object.assign({},i.data,e.data)}):e,t}),{}),Object.keys(c).map((function(t){return c[t]}))));return a.orderedModifiers=u.filter((function(t){return t.enabled})),a.orderedModifiers.forEach((function(t){var e=t.name,i=t.options,n=void 0===i?{}:i,s=t.effect;if("function"==typeof s){var o=s({state:a,name:e,instance:h,options:n});l.push(o||function(){})}})),h.update()},forceUpdate:function(){if(!c){var t=a.elements,e=t.reference,i=t.popper;if(pi(e,i)){a.rects={reference:di(e,$e(i),"fixed"===a.options.strategy),popper:Ce(i)},a.reset=!1,a.placement=a.options.placement,a.orderedModifiers.forEach((function(t){return a.modifiersData[t.name]=Object.assign({},t.data)}));for(var n=0;n<a.orderedModifiers.length;n++)if(!0!==a.reset){var s=a.orderedModifiers[n],o=s.fn,r=s.options,l=void 0===r?{}:r,d=s.name;"function"==typeof o&&(a=o({state:a,options:l,name:d,instance:h})||a)}else a.reset=!1,n=-1}}},update:(s=function(){return new Promise((function(t){h.forceUpdate(),t(a)}))},function(){return r||(r=new Promise((function(t){Promise.resolve().then((function(){r=void 0,t(s())}))}))),r}),destroy:function(){d(),c=!0}};if(!pi(t,e))return h;function d(){l.forEach((function(t){return t()})),l=[]}return h.setOptions(i).then((function(t){!c&&i.onFirstUpdate&&i.onFirstUpdate(t)})),h}}var gi=mi(),_i=mi({defaultModifiers:[Re,ci,Be,_e]}),bi=mi({defaultModifiers:[Re,ci,Be,_e,li,si,hi,je,ai]});const vi=Object.freeze(Object.defineProperty({__proto__:null,afterMain:ae,afterRead:se,afterWrite:he,applyStyles:_e,arrow:je,auto:Kt,basePlacements:Qt,beforeMain:oe,beforeRead:ie,beforeWrite:le,bottom:Rt,clippingParents:Ut,computeStyles:Be,createPopper:bi,createPopperBase:gi,createPopperLite:_i,detectOverflow:ii,end:Yt,eventListeners:Re,flip:si,hide:ai,left:Vt,main:re,modifierPhases:de,offset:li,placements:ee,popper:Jt,popperGenerator:mi,popperOffsets:ci,preventOverflow:hi,read:ne,reference:Zt,right:qt,start:Xt,top:zt,variationPlacements:te,viewport:Gt,write:ce},Symbol.toStringTag,{value:"Module"})),yi="dropdown",wi=".bs.dropdown",Ai=".data-api",Ei="ArrowUp",Ti="ArrowDown",Ci=`hide${wi}`,Oi=`hidden${wi}`,xi=`show${wi}`,ki=`shown${wi}`,Li=`click${wi}${Ai}`,Si=`keydown${wi}${Ai}`,Di=`keyup${wi}${Ai}`,$i="show",Ii='[data-bs-toggle="dropdown"]:not(.disabled):not(:disabled)',Ni=`${Ii}.${$i}`,Pi=".dropdown-menu",Mi=p()?"top-end":"top-start",ji=p()?"top-start":"top-end",Fi=p()?"bottom-end":"bottom-start",Hi=p()?"bottom-start":"bottom-end",Wi=p()?"left-start":"right-start",Bi=p()?"right-start":"left-start",zi={autoClose:!0,boundary:"clippingParents",display:"dynamic",offset:[0,2],popperConfig:null,reference:"toggle"},Ri={autoClose:"(boolean|string)",boundary:"(string|element)",display:"string",offset:"(array|string|function)",popperConfig:"(null|object|function)",reference:"(string|element|object)"};class qi extends W{constructor(t,e){super(t,e),this._popper=null,this._parent=this._element.parentNode,this._menu=z.next(this._element,Pi)[0]||z.prev(this._element,Pi)[0]||z.findOne(Pi,this._parent),this._inNavbar=this._detectNavbar()}static get Default(){return zi}static get DefaultType(){return Ri}static get NAME(){return yi}toggle(){return this._isShown()?this.hide():this.show()}show(){if(l(this._element)||this._isShown())return;const t={relatedTarget:this._element};if(!N.trigger(this._element,xi,t).defaultPrevented){if(this._createPopper(),"ontouchstart"in document.documentElement&&!this._parent.closest(".navbar-nav"))for(const t of[].concat(...document.body.children))N.on(t,"mouseover",h);this._element.focus(),this._element.setAttribute("aria-expanded",!0),this._menu.classList.add($i),this._element.classList.add($i),N.trigger(this._element,ki,t)}}hide(){if(l(this._element)||!this._isShown())return;const t={relatedTarget:this._element};this._completeHide(t)}dispose(){this._popper&&this._popper.destroy(),super.dispose()}update(){this._inNavbar=this._detectNavbar(),this._popper&&this._popper.update()}_completeHide(t){if(!N.trigger(this._element,Ci,t).defaultPrevented){if("ontouchstart"in document.documentElement)for(const t of[].concat(...document.body.children))N.off(t,"mouseover",h);this._popper&&this._popper.destroy(),this._menu.classList.remove($i),this._element.classList.remove($i),this._element.setAttribute("aria-expanded","false"),F.removeDataAttribute(this._menu,"popper"),N.trigger(this._element,Oi,t)}}_getConfig(t){if("object"==typeof(t=super._getConfig(t)).reference&&!o(t.reference)&&"function"!=typeof t.reference.getBoundingClientRect)throw new TypeError(`${yi.toUpperCase()}: Option "reference" provided type "object" without a required "getBoundingClientRect" method.`);return t}_createPopper(){if(void 0===vi)throw new TypeError("Bootstrap's dropdowns require Popper (https://popper.js.org)");let t=this._element;"parent"===this._config.reference?t=this._parent:o(this._config.reference)?t=r(this._config.reference):"object"==typeof this._config.reference&&(t=this._config.reference);const e=this._getPopperConfig();this._popper=bi(t,this._menu,e)}_isShown(){return this._menu.classList.contains($i)}_getPlacement(){const t=this._parent;if(t.classList.contains("dropend"))return Wi;if(t.classList.contains("dropstart"))return Bi;if(t.classList.contains("dropup-center"))return"top";if(t.classList.contains("dropdown-center"))return"bottom";const e="end"===getComputedStyle(this._menu).getPropertyValue("--bs-position").trim();return t.classList.contains("dropup")?e?ji:Mi:e?Hi:Fi}_detectNavbar(){return null!==this._element.closest(".navbar")}_getOffset(){const{offset:t}=this._config;return"string"==typeof t?t.split(",").map((t=>Number.parseInt(t,10))):"function"==typeof t?e=>t(e,this._element):t}_getPopperConfig(){const t={placement:this._getPlacement(),modifiers:[{name:"preventOverflow",options:{boundary:this._config.boundary}},{name:"offset",options:{offset:this._getOffset()}}]};return(this._inNavbar||"static"===this._config.display)&&(F.setDataAttribute(this._menu,"popper","static"),t.modifiers=[{name:"applyStyles",enabled:!1}]),{...t,...g(this._config.popperConfig,[t])}}_selectMenuItem({key:t,target:e}){const i=z.find(".dropdown-menu .dropdown-item:not(.disabled):not(:disabled)",this._menu).filter((t=>a(t)));i.length&&b(i,e,t===Ti,!i.includes(e)).focus()}static jQueryInterface(t){return this.each((function(){const e=qi.getOrCreateInstance(this,t);if("string"==typeof t){if(void 0===e[t])throw new TypeError(`No method named "${t}"`);e[t]()}}))}static clearMenus(t){if(2===t.button||"keyup"===t.type&&"Tab"!==t.key)return;const e=z.find(Ni);for(const i of e){const e=qi.getInstance(i);if(!e||!1===e._config.autoClose)continue;const n=t.composedPath(),s=n.includes(e._menu);if(n.includes(e._element)||"inside"===e._config.autoClose&&!s||"outside"===e._config.autoClose&&s)continue;if(e._menu.contains(t.target)&&("keyup"===t.type&&"Tab"===t.key||/input|select|option|textarea|form/i.test(t.target.tagName)))continue;const o={relatedTarget:e._element};"click"===t.type&&(o.clickEvent=t),e._completeHide(o)}}static dataApiKeydownHandler(t){const e=/input|textarea/i.test(t.target.tagName),i="Escape"===t.key,n=[Ei,Ti].includes(t.key);if(!n&&!i)return;if(e&&!i)return;t.preventDefault();const s=this.matches(Ii)?this:z.prev(this,Ii)[0]||z.next(this,Ii)[0]||z.findOne(Ii,t.delegateTarget.parentNode),o=qi.getOrCreateInstance(s);if(n)return t.stopPropagation(),o.show(),void o._selectMenuItem(t);o._isShown()&&(t.stopPropagation(),o.hide(),s.focus())}}N.on(document,Si,Ii,qi.dataApiKeydownHandler),N.on(document,Si,Pi,qi.dataApiKeydownHandler),N.on(document,Li,qi.clearMenus),N.on(document,Di,qi.clearMenus),N.on(document,Li,Ii,(function(t){t.preventDefault(),qi.getOrCreateInstance(this).toggle()})),m(qi);const Vi="backdrop",Ki="show",Qi=`mousedown.bs.${Vi}`,Xi={className:"modal-backdrop",clickCallback:null,isAnimated:!1,isVisible:!0,rootElement:"body"},Yi={className:"string",clickCallback:"(function|null)",isAnimated:"boolean",isVisible:"boolean",rootElement:"(element|string)"};class Ui extends H{constructor(t){super(),this._config=this._getConfig(t),this._isAppended=!1,this._element=null}static get Default(){return Xi}static get DefaultType(){return Yi}static get NAME(){return Vi}show(t){if(!this._config.isVisible)return void g(t);this._append();const e=this._getElement();this._config.isAnimated&&d(e),e.classList.add(Ki),this._emulateAnimation((()=>{g(t)}))}hide(t){this._config.isVisible?(this._getElement().classList.remove(Ki),this._emulateAnimation((()=>{this.dispose(),g(t)}))):g(t)}dispose(){this._isAppended&&(N.off(this._element,Qi),this._element.remove(),this._isAppended=!1)}_getElement(){if(!this._element){const t=document.createElement("div");t.className=this._config.className,this._config.isAnimated&&t.classList.add("fade"),this._element=t}return this._element}_configAfterMerge(t){return t.rootElement=r(t.rootElement),t}_append(){if(this._isAppended)return;const t=this._getElement();this._config.rootElement.append(t),N.on(t,Qi,(()=>{g(this._config.clickCallback)})),this._isAppended=!0}_emulateAnimation(t){_(t,this._getElement(),this._config.isAnimated)}}const Gi=".bs.focustrap",Ji=`focusin${Gi}`,Zi=`keydown.tab${Gi}`,tn="backward",en={autofocus:!0,trapElement:null},nn={autofocus:"boolean",trapElement:"element"};class sn extends H{constructor(t){super(),this._config=this._getConfig(t),this._isActive=!1,this._lastTabNavDirection=null}static get Default(){return en}static get DefaultType(){return nn}static get NAME(){return"focustrap"}activate(){this._isActive||(this._config.autofocus&&this._config.trapElement.focus(),N.off(document,Gi),N.on(document,Ji,(t=>this._handleFocusin(t))),N.on(document,Zi,(t=>this._handleKeydown(t))),this._isActive=!0)}deactivate(){this._isActive&&(this._isActive=!1,N.off(document,Gi))}_handleFocusin(t){const{trapElement:e}=this._config;if(t.target===document||t.target===e||e.contains(t.target))return;const i=z.focusableChildren(e);0===i.length?e.focus():this._lastTabNavDirection===tn?i[i.length-1].focus():i[0].focus()}_handleKeydown(t){"Tab"===t.key&&(this._lastTabNavDirection=t.shiftKey?tn:"forward")}}const on=".fixed-top, .fixed-bottom, .is-fixed, .sticky-top",rn=".sticky-top",an="padding-right",ln="margin-right";class cn{constructor(){this._element=document.body}getWidth(){const t=document.documentElement.clientWidth;return Math.abs(window.innerWidth-t)}hide(){const t=this.getWidth();this._disableOverFlow(),this._setElementAttributes(this._element,an,(e=>e+t)),this._setElementAttributes(on,an,(e=>e+t)),this._setElementAttributes(rn,ln,(e=>e-t))}reset(){this._resetElementAttributes(this._element,"overflow"),this._resetElementAttributes(this._element,an),this._resetElementAttributes(on,an),this._resetElementAttributes(rn,ln)}isOverflowing(){return this.getWidth()>0}_disableOverFlow(){this._saveInitialAttribute(this._element,"overflow"),this._element.style.overflow="hidden"}_setElementAttributes(t,e,i){const n=this.getWidth();this._applyManipulationCallback(t,(t=>{if(t!==this._element&&window.innerWidth>t.clientWidth+n)return;this._saveInitialAttribute(t,e);const s=window.getComputedStyle(t).getPropertyValue(e);t.style.setProperty(e,`${i(Number.parseFloat(s))}px`)}))}_saveInitialAttribute(t,e){const i=t.style.getPropertyValue(e);i&&F.setDataAttribute(t,e,i)}_resetElementAttributes(t,e){this._applyManipulationCallback(t,(t=>{const i=F.getDataAttribute(t,e);null!==i?(F.removeDataAttribute(t,e),t.style.setProperty(e,i)):t.style.removeProperty(e)}))}_applyManipulationCallback(t,e){if(o(t))e(t);else for(const i of z.find(t,this._element))e(i)}}const hn=".bs.modal",dn=`hide${hn}`,un=`hidePrevented${hn}`,fn=`hidden${hn}`,pn=`show${hn}`,mn=`shown${hn}`,gn=`resize${hn}`,_n=`click.dismiss${hn}`,bn=`mousedown.dismiss${hn}`,vn=`keydown.dismiss${hn}`,yn=`click${hn}.data-api`,wn="modal-open",An="show",En="modal-static",Tn={backdrop:!0,focus:!0,keyboard:!0},Cn={backdrop:"(boolean|string)",focus:"boolean",keyboard:"boolean"};class On extends W{constructor(t,e){super(t,e),this._dialog=z.findOne(".modal-dialog",this._element),this._backdrop=this._initializeBackDrop(),this._focustrap=this._initializeFocusTrap(),this._isShown=!1,this._isTransitioning=!1,this._scrollBar=new cn,this._addEventListeners()}static get Default(){return Tn}static get DefaultType(){return Cn}static get NAME(){return"modal"}toggle(t){return this._isShown?this.hide():this.show(t)}show(t){this._isShown||this._isTransitioning||N.trigger(this._element,pn,{relatedTarget:t}).defaultPrevented||(this._isShown=!0,this._isTransitioning=!0,this._scrollBar.hide(),document.body.classList.add(wn),this._adjustDialog(),this._backdrop.show((()=>this._showElement(t))))}hide(){this._isShown&&!this._isTransitioning&&(N.trigger(this._element,dn).defaultPrevented||(this._isShown=!1,this._isTransitioning=!0,this._focustrap.deactivate(),this._element.classList.remove(An),this._queueCallback((()=>this._hideModal()),this._element,this._isAnimated())))}dispose(){N.off(window,hn),N.off(this._dialog,hn),this._backdrop.dispose(),this._focustrap.deactivate(),super.dispose()}handleUpdate(){this._adjustDialog()}_initializeBackDrop(){return new Ui({isVisible:Boolean(this._config.backdrop),isAnimated:this._isAnimated()})}_initializeFocusTrap(){return new sn({trapElement:this._element})}_showElement(t){document.body.contains(this._element)||document.body.append(this._element),this._element.style.display="block",this._element.removeAttribute("aria-hidden"),this._element.setAttribute("aria-modal",!0),this._element.setAttribute("role","dialog"),this._element.scrollTop=0;const e=z.findOne(".modal-body",this._dialog);e&&(e.scrollTop=0),d(this._element),this._element.classList.add(An),this._queueCallback((()=>{this._config.focus&&this._focustrap.activate(),this._isTransitioning=!1,N.trigger(this._element,mn,{relatedTarget:t})}),this._dialog,this._isAnimated())}_addEventListeners(){N.on(this._element,vn,(t=>{"Escape"===t.key&&(this._config.keyboard?this.hide():this._triggerBackdropTransition())})),N.on(window,gn,(()=>{this._isShown&&!this._isTransitioning&&this._adjustDialog()})),N.on(this._element,bn,(t=>{N.one(this._element,_n,(e=>{this._element===t.target&&this._element===e.target&&("static"!==this._config.backdrop?this._config.backdrop&&this.hide():this._triggerBackdropTransition())}))}))}_hideModal(){this._element.style.display="none",this._element.setAttribute("aria-hidden",!0),this._element.removeAttribute("aria-modal"),this._element.removeAttribute("role"),this._isTransitioning=!1,this._backdrop.hide((()=>{document.body.classList.remove(wn),this._resetAdjustments(),this._scrollBar.reset(),N.trigger(this._element,fn)}))}_isAnimated(){return this._element.classList.contains("fade")}_triggerBackdropTransition(){if(N.trigger(this._element,un).defaultPrevented)return;const t=this._element.scrollHeight>document.documentElement.clientHeight,e=this._element.style.overflowY;"hidden"===e||this._element.classList.contains(En)||(t||(this._element.style.overflowY="hidden"),this._element.classList.add(En),this._queueCallback((()=>{this._element.classList.remove(En),this._queueCallback((()=>{this._element.style.overflowY=e}),this._dialog)}),this._dialog),this._element.focus())}_adjustDialog(){const t=this._element.scrollHeight>document.documentElement.clientHeight,e=this._scrollBar.getWidth(),i=e>0;if(i&&!t){const t=p()?"paddingLeft":"paddingRight";this._element.style[t]=`${e}px`}if(!i&&t){const t=p()?"paddingRight":"paddingLeft";this._element.style[t]=`${e}px`}}_resetAdjustments(){this._element.style.paddingLeft="",this._element.style.paddingRight=""}static jQueryInterface(t,e){return this.each((function(){const i=On.getOrCreateInstance(this,t);if("string"==typeof t){if(void 0===i[t])throw new TypeError(`No method named "${t}"`);i[t](e)}}))}}N.on(document,yn,'[data-bs-toggle="modal"]',(function(t){const e=z.getElementFromSelector(this);["A","AREA"].includes(this.tagName)&&t.preventDefault(),N.one(e,pn,(t=>{t.defaultPrevented||N.one(e,fn,(()=>{a(this)&&this.focus()}))}));const i=z.findOne(".modal.show");i&&On.getInstance(i).hide(),On.getOrCreateInstance(e).toggle(this)})),R(On),m(On);const xn=".bs.offcanvas",kn=".data-api",Ln=`load${xn}${kn}`,Sn="show",Dn="showing",$n="hiding",In=".offcanvas.show",Nn=`show${xn}`,Pn=`shown${xn}`,Mn=`hide${xn}`,jn=`hidePrevented${xn}`,Fn=`hidden${xn}`,Hn=`resize${xn}`,Wn=`click${xn}${kn}`,Bn=`keydown.dismiss${xn}`,zn={backdrop:!0,keyboard:!0,scroll:!1},Rn={backdrop:"(boolean|string)",keyboard:"boolean",scroll:"boolean"};class qn extends W{constructor(t,e){super(t,e),this._isShown=!1,this._backdrop=this._initializeBackDrop(),this._focustrap=this._initializeFocusTrap(),this._addEventListeners()}static get Default(){return zn}static get DefaultType(){return Rn}static get NAME(){return"offcanvas"}toggle(t){return this._isShown?this.hide():this.show(t)}show(t){this._isShown||N.trigger(this._element,Nn,{relatedTarget:t}).defaultPrevented||(this._isShown=!0,this._backdrop.show(),this._config.scroll||(new cn).hide(),this._element.setAttribute("aria-modal",!0),this._element.setAttribute("role","dialog"),this._element.classList.add(Dn),this._queueCallback((()=>{this._config.scroll&&!this._config.backdrop||this._focustrap.activate(),this._element.classList.add(Sn),this._element.classList.remove(Dn),N.trigger(this._element,Pn,{relatedTarget:t})}),this._element,!0))}hide(){this._isShown&&(N.trigger(this._element,Mn).defaultPrevented||(this._focustrap.deactivate(),this._element.blur(),this._isShown=!1,this._element.classList.add($n),this._backdrop.hide(),this._queueCallback((()=>{this._element.classList.remove(Sn,$n),this._element.removeAttribute("aria-modal"),this._element.removeAttribute("role"),this._config.scroll||(new cn).reset(),N.trigger(this._element,Fn)}),this._element,!0)))}dispose(){this._backdrop.dispose(),this._focustrap.deactivate(),super.dispose()}_initializeBackDrop(){const t=Boolean(this._config.backdrop);return new Ui({className:"offcanvas-backdrop",isVisible:t,isAnimated:!0,rootElement:this._element.parentNode,clickCallback:t?()=>{"static"!==this._config.backdrop?this.hide():N.trigger(this._element,jn)}:null})}_initializeFocusTrap(){return new sn({trapElement:this._element})}_addEventListeners(){N.on(this._element,Bn,(t=>{"Escape"===t.key&&(this._config.keyboard?this.hide():N.trigger(this._element,jn))}))}static jQueryInterface(t){return this.each((function(){const e=qn.getOrCreateInstance(this,t);if("string"==typeof t){if(void 0===e[t]||t.startsWith("_")||"constructor"===t)throw new TypeError(`No method named "${t}"`);e[t](this)}}))}}N.on(document,Wn,'[data-bs-toggle="offcanvas"]',(function(t){const e=z.getElementFromSelector(this);if(["A","AREA"].includes(this.tagName)&&t.preventDefault(),l(this))return;N.one(e,Fn,(()=>{a(this)&&this.focus()}));const i=z.findOne(In);i&&i!==e&&qn.getInstance(i).hide(),qn.getOrCreateInstance(e).toggle(this)})),N.on(window,Ln,(()=>{for(const t of z.find(In))qn.getOrCreateInstance(t).show()})),N.on(window,Hn,(()=>{for(const t of z.find("[aria-modal][class*=show][class*=offcanvas-]"))"fixed"!==getComputedStyle(t).position&&qn.getOrCreateInstance(t).hide()})),R(qn),m(qn);const Vn={"*":["class","dir","id","lang","role",/^aria-[\w-]*$/i],a:["target","href","title","rel"],area:[],b:[],br:[],col:[],code:[],div:[],em:[],hr:[],h1:[],h2:[],h3:[],h4:[],h5:[],h6:[],i:[],img:["src","srcset","alt","title","width","height"],li:[],ol:[],p:[],pre:[],s:[],small:[],span:[],sub:[],sup:[],strong:[],u:[],ul:[]},Kn=new Set(["background","cite","href","itemtype","longdesc","poster","src","xlink:href"]),Qn=/^(?!javascript:)(?:[a-z0-9+.-]+:|[^&:/?#]*(?:[/?#]|$))/i,Xn=(t,e)=>{const i=t.nodeName.toLowerCase();return e.includes(i)?!Kn.has(i)||Boolean(Qn.test(t.nodeValue)):e.filter((t=>t instanceof RegExp)).some((t=>t.test(i)))},Yn={allowList:Vn,content:{},extraClass:"",html:!1,sanitize:!0,sanitizeFn:null,template:"<div></div>"},Un={allowList:"object",content:"object",extraClass:"(string|function)",html:"boolean",sanitize:"boolean",sanitizeFn:"(null|function)",template:"string"},Gn={entry:"(string|element|function|null)",selector:"(string|element)"};class Jn extends H{constructor(t){super(),this._config=this._getConfig(t)}static get Default(){return Yn}static get DefaultType(){return Un}static get NAME(){return"TemplateFactory"}getContent(){return Object.values(this._config.content).map((t=>this._resolvePossibleFunction(t))).filter(Boolean)}hasContent(){return this.getContent().length>0}changeContent(t){return this._checkContent(t),this._config.content={...this._config.content,...t},this}toHtml(){const t=document.createElement("div");t.innerHTML=this._maybeSanitize(this._config.template);for(const[e,i]of Object.entries(this._config.content))this._setContent(t,i,e);const e=t.children[0],i=this._resolvePossibleFunction(this._config.extraClass);return i&&e.classList.add(...i.split(" ")),e}_typeCheckConfig(t){super._typeCheckConfig(t),this._checkContent(t.content)}_checkContent(t){for(const[e,i]of Object.entries(t))super._typeCheckConfig({selector:e,entry:i},Gn)}_setContent(t,e,i){const n=z.findOne(i,t);n&&((e=this._resolvePossibleFunction(e))?o(e)?this._putElementInTemplate(r(e),n):this._config.html?n.innerHTML=this._maybeSanitize(e):n.textContent=e:n.remove())}_maybeSanitize(t){return this._config.sanitize?function(t,e,i){if(!t.length)return t;if(i&&"function"==typeof i)return i(t);const n=(new window.DOMParser).parseFromString(t,"text/html"),s=[].concat(...n.body.querySelectorAll("*"));for(const t of s){const i=t.nodeName.toLowerCase();if(!Object.keys(e).includes(i)){t.remove();continue}const n=[].concat(...t.attributes),s=[].concat(e["*"]||[],e[i]||[]);for(const e of n)Xn(e,s)||t.removeAttribute(e.nodeName)}return n.body.innerHTML}(t,this._config.allowList,this._config.sanitizeFn):t}_resolvePossibleFunction(t){return g(t,[this])}_putElementInTemplate(t,e){if(this._config.html)return e.innerHTML="",void e.append(t);e.textContent=t.textContent}}const Zn=new Set(["sanitize","allowList","sanitizeFn"]),ts="fade",es="show",is=".modal",ns="hide.bs.modal",ss="hover",os="focus",rs={AUTO:"auto",TOP:"top",RIGHT:p()?"left":"right",BOTTOM:"bottom",LEFT:p()?"right":"left"},as={allowList:Vn,animation:!0,boundary:"clippingParents",container:!1,customClass:"",delay:0,fallbackPlacements:["top","right","bottom","left"],html:!1,offset:[0,6],placement:"top",popperConfig:null,sanitize:!0,sanitizeFn:null,selector:!1,template:'<div class="tooltip" role="tooltip"><div class="tooltip-arrow"></div><div class="tooltip-inner"></div></div>',title:"",trigger:"hover focus"},ls={allowList:"object",animation:"boolean",boundary:"(string|element)",container:"(string|element|boolean)",customClass:"(string|function)",delay:"(number|object)",fallbackPlacements:"array",html:"boolean",offset:"(array|string|function)",placement:"(string|function)",popperConfig:"(null|object|function)",sanitize:"boolean",sanitizeFn:"(null|function)",selector:"(string|boolean)",template:"string",title:"(string|element|function)",trigger:"string"};class cs extends W{constructor(t,e){if(void 0===vi)throw new TypeError("Bootstrap's tooltips require Popper (https://popper.js.org)");super(t,e),this._isEnabled=!0,this._timeout=0,this._isHovered=null,this._activeTrigger={},this._popper=null,this._templateFactory=null,this._newContent=null,this.tip=null,this._setListeners(),this._config.selector||this._fixTitle()}static get Default(){return as}static get DefaultType(){return ls}static get NAME(){return"tooltip"}enable(){this._isEnabled=!0}disable(){this._isEnabled=!1}toggleEnabled(){this._isEnabled=!this._isEnabled}toggle(){this._isEnabled&&(this._activeTrigger.click=!this._activeTrigger.click,this._isShown()?this._leave():this._enter())}dispose(){clearTimeout(this._timeout),N.off(this._element.closest(is),ns,this._hideModalHandler),this._element.getAttribute("data-bs-original-title")&&this._element.setAttribute("title",this._element.getAttribute("data-bs-original-title")),this._disposePopper(),super.dispose()}show(){if("none"===this._element.style.display)throw new Error("Please use show on visible elements");if(!this._isWithContent()||!this._isEnabled)return;const t=N.trigger(this._element,this.constructor.eventName("show")),e=(c(this._element)||this._element.ownerDocument.documentElement).contains(this._element);if(t.defaultPrevented||!e)return;this._disposePopper();const i=this._getTipElement();this._element.setAttribute("aria-describedby",i.getAttribute("id"));const{container:n}=this._config;if(this._element.ownerDocument.documentElement.contains(this.tip)||(n.append(i),N.trigger(this._element,this.constructor.eventName("inserted"))),this._popper=this._createPopper(i),i.classList.add(es),"ontouchstart"in document.documentElement)for(const t of[].concat(...document.body.children))N.on(t,"mouseover",h);this._queueCallback((()=>{N.trigger(this._element,this.constructor.eventName("shown")),!1===this._isHovered&&this._leave(),this._isHovered=!1}),this.tip,this._isAnimated())}hide(){if(this._isShown()&&!N.trigger(this._element,this.constructor.eventName("hide")).defaultPrevented){if(this._getTipElement().classList.remove(es),"ontouchstart"in document.documentElement)for(const t of[].concat(...document.body.children))N.off(t,"mouseover",h);this._activeTrigger.click=!1,this._activeTrigger[os]=!1,this._activeTrigger[ss]=!1,this._isHovered=null,this._queueCallback((()=>{this._isWithActiveTrigger()||(this._isHovered||this._disposePopper(),this._element.removeAttribute("aria-describedby"),N.trigger(this._element,this.constructor.eventName("hidden")))}),this.tip,this._isAnimated())}}update(){this._popper&&this._popper.update()}_isWithContent(){return Boolean(this._getTitle())}_getTipElement(){return this.tip||(this.tip=this._createTipElement(this._newContent||this._getContentForTemplate())),this.tip}_createTipElement(t){const e=this._getTemplateFactory(t).toHtml();if(!e)return null;e.classList.remove(ts,es),e.classList.add(`bs-${this.constructor.NAME}-auto`);const i=(t=>{do{t+=Math.floor(1e6*Math.random())}while(document.getElementById(t));return t})(this.constructor.NAME).toString();return e.setAttribute("id",i),this._isAnimated()&&e.classList.add(ts),e}setContent(t){this._newContent=t,this._isShown()&&(this._disposePopper(),this.show())}_getTemplateFactory(t){return this._templateFactory?this._templateFactory.changeContent(t):this._templateFactory=new Jn({...this._config,content:t,extraClass:this._resolvePossibleFunction(this._config.customClass)}),this._templateFactory}_getContentForTemplate(){return{".tooltip-inner":this._getTitle()}}_getTitle(){return this._resolvePossibleFunction(this._config.title)||this._element.getAttribute("data-bs-original-title")}_initializeOnDelegatedTarget(t){return this.constructor.getOrCreateInstance(t.delegateTarget,this._getDelegateConfig())}_isAnimated(){return this._config.animation||this.tip&&this.tip.classList.contains(ts)}_isShown(){return this.tip&&this.tip.classList.contains(es)}_createPopper(t){const e=g(this._config.placement,[this,t,this._element]),i=rs[e.toUpperCase()];return bi(this._element,t,this._getPopperConfig(i))}_getOffset(){const{offset:t}=this._config;return"string"==typeof t?t.split(",").map((t=>Number.parseInt(t,10))):"function"==typeof t?e=>t(e,this._element):t}_resolvePossibleFunction(t){return g(t,[this._element])}_getPopperConfig(t){const e={placement:t,modifiers:[{name:"flip",options:{fallbackPlacements:this._config.fallbackPlacements}},{name:"offset",options:{offset:this._getOffset()}},{name:"preventOverflow",options:{boundary:this._config.boundary}},{name:"arrow",options:{element:`.${this.constructor.NAME}-arrow`}},{name:"preSetPlacement",enabled:!0,phase:"beforeMain",fn:t=>{this._getTipElement().setAttribute("data-popper-placement",t.state.placement)}}]};return{...e,...g(this._config.popperConfig,[e])}}_setListeners(){const t=this._config.trigger.split(" ");for(const e of t)if("click"===e)N.on(this._element,this.constructor.eventName("click"),this._config.selector,(t=>{this._initializeOnDelegatedTarget(t).toggle()}));else if("manual"!==e){const t=e===ss?this.constructor.eventName("mouseenter"):this.constructor.eventName("focusin"),i=e===ss?this.constructor.eventName("mouseleave"):this.constructor.eventName("focusout");N.on(this._element,t,this._config.selector,(t=>{const e=this._initializeOnDelegatedTarget(t);e._activeTrigger["focusin"===t.type?os:ss]=!0,e._enter()})),N.on(this._element,i,this._config.selector,(t=>{const e=this._initializeOnDelegatedTarget(t);e._activeTrigger["focusout"===t.type?os:ss]=e._element.contains(t.relatedTarget),e._leave()}))}this._hideModalHandler=()=>{this._element&&this.hide()},N.on(this._element.closest(is),ns,this._hideModalHandler)}_fixTitle(){const t=this._element.getAttribute("title");t&&(this._element.getAttribute("aria-label")||this._element.textContent.trim()||this._element.setAttribute("aria-label",t),this._element.setAttribute("data-bs-original-title",t),this._element.removeAttribute("title"))}_enter(){this._isShown()||this._isHovered?this._isHovered=!0:(this._isHovered=!0,this._setTimeout((()=>{this._isHovered&&this.show()}),this._config.delay.show))}_leave(){this._isWithActiveTrigger()||(this._isHovered=!1,this._setTimeout((()=>{this._isHovered||this.hide()}),this._config.delay.hide))}_setTimeout(t,e){clearTimeout(this._timeout),this._timeout=setTimeout(t,e)}_isWithActiveTrigger(){return Object.values(this._activeTrigger).includes(!0)}_getConfig(t){const e=F.getDataAttributes(this._element);for(const t of Object.keys(e))Zn.has(t)&&delete e[t];return t={...e,..."object"==typeof t&&t?t:{}},t=this._mergeConfigObj(t),t=this._configAfterMerge(t),this._typeCheckConfig(t),t}_configAfterMerge(t){return t.container=!1===t.container?document.body:r(t.container),"number"==typeof t.delay&&(t.delay={show:t.delay,hide:t.delay}),"number"==typeof t.title&&(t.title=t.title.toString()),"number"==typeof t.content&&(t.content=t.content.toString()),t}_getDelegateConfig(){const t={};for(const[e,i]of Object.entries(this._config))this.constructor.Default[e]!==i&&(t[e]=i);return t.selector=!1,t.trigger="manual",t}_disposePopper(){this._popper&&(this._popper.destroy(),this._popper=null),this.tip&&(this.tip.remove(),this.tip=null)}static jQueryInterface(t){return this.each((function(){const e=cs.getOrCreateInstance(this,t);if("string"==typeof t){if(void 0===e[t])throw new TypeError(`No method named "${t}"`);e[t]()}}))}}m(cs);const hs={...cs.Default,content:"",offset:[0,8],placement:"right",template:'<div class="popover" role="tooltip"><div class="popover-arrow"></div><h3 class="popover-header"></h3><div class="popover-body"></div></div>',trigger:"click"},ds={...cs.DefaultType,content:"(null|string|element|function)"};class us extends cs{static get Default(){return hs}static get DefaultType(){return ds}static get NAME(){return"popover"}_isWithContent(){return this._getTitle()||this._getContent()}_getContentForTemplate(){return{".popover-header":this._getTitle(),".popover-body":this._getContent()}}_getContent(){return this._resolvePossibleFunction(this._config.content)}static jQueryInterface(t){return this.each((function(){const e=us.getOrCreateInstance(this,t);if("string"==typeof t){if(void 0===e[t])throw new TypeError(`No method named "${t}"`);e[t]()}}))}}m(us);const fs=".bs.scrollspy",ps=`activate${fs}`,ms=`click${fs}`,gs=`load${fs}.data-api`,_s="active",bs="[href]",vs=".nav-link",ys=`${vs}, .nav-item > ${vs}, .list-group-item`,ws={offset:null,rootMargin:"0px 0px -25%",smoothScroll:!1,target:null,threshold:[.1,.5,1]},As={offset:"(number|null)",rootMargin:"string",smoothScroll:"boolean",target:"element",threshold:"array"};class Es extends W{constructor(t,e){super(t,e),this._targetLinks=new Map,this._observableSections=new Map,this._rootElement="visible"===getComputedStyle(this._element).overflowY?null:this._element,this._activeTarget=null,this._observer=null,this._previousScrollData={visibleEntryTop:0,parentScrollTop:0},this.refresh()}static get Default(){return ws}static get DefaultType(){return As}static get NAME(){return"scrollspy"}refresh(){this._initializeTargetsAndObservables(),this._maybeEnableSmoothScroll(),this._observer?this._observer.disconnect():this._observer=this._getNewObserver();for(const t of this._observableSections.values())this._observer.observe(t)}dispose(){this._observer.disconnect(),super.dispose()}_configAfterMerge(t){return t.target=r(t.target)||document.body,t.rootMargin=t.offset?`${t.offset}px 0px -30%`:t.rootMargin,"string"==typeof t.threshold&&(t.threshold=t.threshold.split(",").map((t=>Number.parseFloat(t)))),t}_maybeEnableSmoothScroll(){this._config.smoothScroll&&(N.off(this._config.target,ms),N.on(this._config.target,ms,bs,(t=>{const e=this._observableSections.get(t.target.hash);if(e){t.preventDefault();const i=this._rootElement||window,n=e.offsetTop-this._element.offsetTop;if(i.scrollTo)return void i.scrollTo({top:n,behavior:"smooth"});i.scrollTop=n}})))}_getNewObserver(){const t={root:this._rootElement,threshold:this._config.threshold,rootMargin:this._config.rootMargin};return new IntersectionObserver((t=>this._observerCallback(t)),t)}_observerCallback(t){const e=t=>this._targetLinks.get(`#${t.target.id}`),i=t=>{this._previousScrollData.visibleEntryTop=t.target.offsetTop,this._process(e(t))},n=(this._rootElement||document.documentElement).scrollTop,s=n>=this._previousScrollData.parentScrollTop;this._previousScrollData.parentScrollTop=n;for(const o of t){if(!o.isIntersecting){this._activeTarget=null,this._clearActiveClass(e(o));continue}const t=o.target.offsetTop>=this._previousScrollData.visibleEntryTop;if(s&&t){if(i(o),!n)return}else s||t||i(o)}}_initializeTargetsAndObservables(){this._targetLinks=new Map,this._observableSections=new Map;const t=z.find(bs,this._config.target);for(const e of t){if(!e.hash||l(e))continue;const t=z.findOne(decodeURI(e.hash),this._element);a(t)&&(this._targetLinks.set(decodeURI(e.hash),e),this._observableSections.set(e.hash,t))}}_process(t){this._activeTarget!==t&&(this._clearActiveClass(this._config.target),this._activeTarget=t,t.classList.add(_s),this._activateParents(t),N.trigger(this._element,ps,{relatedTarget:t}))}_activateParents(t){if(t.classList.contains("dropdown-item"))z.findOne(".dropdown-toggle",t.closest(".dropdown")).classList.add(_s);else for(const e of z.parents(t,".nav, .list-group"))for(const t of z.prev(e,ys))t.classList.add(_s)}_clearActiveClass(t){t.classList.remove(_s);const e=z.find(`${bs}.${_s}`,t);for(const t of e)t.classList.remove(_s)}static jQueryInterface(t){return this.each((function(){const e=Es.getOrCreateInstance(this,t);if("string"==typeof t){if(void 0===e[t]||t.startsWith("_")||"constructor"===t)throw new TypeError(`No method named "${t}"`);e[t]()}}))}}N.on(window,gs,(()=>{for(const t of z.find('[data-bs-spy="scroll"]'))Es.getOrCreateInstance(t)})),m(Es);const Ts=".bs.tab",Cs=`hide${Ts}`,Os=`hidden${Ts}`,xs=`show${Ts}`,ks=`shown${Ts}`,Ls=`click${Ts}`,Ss=`keydown${Ts}`,Ds=`load${Ts}`,$s="ArrowLeft",Is="ArrowRight",Ns="ArrowUp",Ps="ArrowDown",Ms="Home",js="End",Fs="active",Hs="fade",Ws="show",Bs=".dropdown-toggle",zs=`:not(${Bs})`,Rs='[data-bs-toggle="tab"], [data-bs-toggle="pill"], [data-bs-toggle="list"]',qs=`.nav-link${zs}, .list-group-item${zs}, [role="tab"]${zs}, ${Rs}`,Vs=`.${Fs}[data-bs-toggle="tab"], .${Fs}[data-bs-toggle="pill"], .${Fs}[data-bs-toggle="list"]`;class Ks extends W{constructor(t){super(t),this._parent=this._element.closest('.list-group, .nav, [role="tablist"]'),this._parent&&(this._setInitialAttributes(this._parent,this._getChildren()),N.on(this._element,Ss,(t=>this._keydown(t))))}static get NAME(){return"tab"}show(){const t=this._element;if(this._elemIsActive(t))return;const e=this._getActiveElem(),i=e?N.trigger(e,Cs,{relatedTarget:t}):null;N.trigger(t,xs,{relatedTarget:e}).defaultPrevented||i&&i.defaultPrevented||(this._deactivate(e,t),this._activate(t,e))}_activate(t,e){t&&(t.classList.add(Fs),this._activate(z.getElementFromSelector(t)),this._queueCallback((()=>{"tab"===t.getAttribute("role")?(t.removeAttribute("tabindex"),t.setAttribute("aria-selected",!0),this._toggleDropDown(t,!0),N.trigger(t,ks,{relatedTarget:e})):t.classList.add(Ws)}),t,t.classList.contains(Hs)))}_deactivate(t,e){t&&(t.classList.remove(Fs),t.blur(),this._deactivate(z.getElementFromSelector(t)),this._queueCallback((()=>{"tab"===t.getAttribute("role")?(t.setAttribute("aria-selected",!1),t.setAttribute("tabindex","-1"),this._toggleDropDown(t,!1),N.trigger(t,Os,{relatedTarget:e})):t.classList.remove(Ws)}),t,t.classList.contains(Hs)))}_keydown(t){if(![$s,Is,Ns,Ps,Ms,js].includes(t.key))return;t.stopPropagation(),t.preventDefault();const e=this._getChildren().filter((t=>!l(t)));let i;if([Ms,js].includes(t.key))i=e[t.key===Ms?0:e.length-1];else{const n=[Is,Ps].includes(t.key);i=b(e,t.target,n,!0)}i&&(i.focus({preventScroll:!0}),Ks.getOrCreateInstance(i).show())}_getChildren(){return z.find(qs,this._parent)}_getActiveElem(){return this._getChildren().find((t=>this._elemIsActive(t)))||null}_setInitialAttributes(t,e){this._setAttributeIfNotExists(t,"role","tablist");for(const t of e)this._setInitialAttributesOnChild(t)}_setInitialAttributesOnChild(t){t=this._getInnerElement(t);const e=this._elemIsActive(t),i=this._getOuterElement(t);t.setAttribute("aria-selected",e),i!==t&&this._setAttributeIfNotExists(i,"role","presentation"),e||t.setAttribute("tabindex","-1"),this._setAttributeIfNotExists(t,"role","tab"),this._setInitialAttributesOnTargetPanel(t)}_setInitialAttributesOnTargetPanel(t){const e=z.getElementFromSelector(t);e&&(this._setAttributeIfNotExists(e,"role","tabpanel"),t.id&&this._setAttributeIfNotExists(e,"aria-labelledby",`${t.id}`))}_toggleDropDown(t,e){const i=this._getOuterElement(t);if(!i.classList.contains("dropdown"))return;const n=(t,n)=>{const s=z.findOne(t,i);s&&s.classList.toggle(n,e)};n(Bs,Fs),n(".dropdown-menu",Ws),i.setAttribute("aria-expanded",e)}_setAttributeIfNotExists(t,e,i){t.hasAttribute(e)||t.setAttribute(e,i)}_elemIsActive(t){return t.classList.contains(Fs)}_getInnerElement(t){return t.matches(qs)?t:z.findOne(qs,t)}_getOuterElement(t){return t.closest(".nav-item, .list-group-item")||t}static jQueryInterface(t){return this.each((function(){const e=Ks.getOrCreateInstance(this);if("string"==typeof t){if(void 0===e[t]||t.startsWith("_")||"constructor"===t)throw new TypeError(`No method named "${t}"`);e[t]()}}))}}N.on(document,Ls,Rs,(function(t){["A","AREA"].includes(this.tagName)&&t.preventDefault(),l(this)||Ks.getOrCreateInstance(this).show()})),N.on(window,Ds,(()=>{for(const t of z.find(Vs))Ks.getOrCreateInstance(t)})),m(Ks);const Qs=".bs.toast",Xs=`mouseover${Qs}`,Ys=`mouseout${Qs}`,Us=`focusin${Qs}`,Gs=`focusout${Qs}`,Js=`hide${Qs}`,Zs=`hidden${Qs}`,to=`show${Qs}`,eo=`shown${Qs}`,io="hide",no="show",so="showing",oo={animation:"boolean",autohide:"boolean",delay:"number"},ro={animation:!0,autohide:!0,delay:5e3};class ao extends W{constructor(t,e){super(t,e),this._timeout=null,this._hasMouseInteraction=!1,this._hasKeyboardInteraction=!1,this._setListeners()}static get Default(){return ro}static get DefaultType(){return oo}static get NAME(){return"toast"}show(){N.trigger(this._element,to).defaultPrevented||(this._clearTimeout(),this._config.animation&&this._element.classList.add("fade"),this._element.classList.remove(io),d(this._element),this._element.classList.add(no,so),this._queueCallback((()=>{this._element.classList.remove(so),N.trigger(this._element,eo),this._maybeScheduleHide()}),this._element,this._config.animation))}hide(){this.isShown()&&(N.trigger(this._element,Js).defaultPrevented||(this._element.classList.add(so),this._queueCallback((()=>{this._element.classList.add(io),this._element.classList.remove(so,no),N.trigger(this._element,Zs)}),this._element,this._config.animation)))}dispose(){this._clearTimeout(),this.isShown()&&this._element.classList.remove(no),super.dispose()}isShown(){return this._element.classList.contains(no)}_maybeScheduleHide(){this._config.autohide&&(this._hasMouseInteraction||this._hasKeyboardInteraction||(this._timeout=setTimeout((()=>{this.hide()}),this._config.delay)))}_onInteraction(t,e){switch(t.type){case"mouseover":case"mouseout":this._hasMouseInteraction=e;break;case"focusin":case"focusout":this._hasKeyboardInteraction=e}if(e)return void this._clearTimeout();const i=t.relatedTarget;this._element===i||this._element.contains(i)||this._maybeScheduleHide()}_setListeners(){N.on(this._element,Xs,(t=>this._onInteraction(t,!0))),N.on(this._element,Ys,(t=>this._onInteraction(t,!1))),N.on(this._element,Us,(t=>this._onInteraction(t,!0))),N.on(this._element,Gs,(t=>this._onInteraction(t,!1)))}_clearTimeout(){clearTimeout(this._timeout),this._timeout=null}static jQueryInterface(t){return this.each((function(){const e=ao.getOrCreateInstance(this,t);if("string"==typeof t){if(void 0===e[t])throw new TypeError(`No method named "${t}"`);e[t](this)}}))}}return R(ao),m(ao),{Alert:Q,Button:Y,Carousel:xt,Collapse:Bt,Dropdown:qi,Modal:On,Offcanvas:qn,Popover:us,ScrollSpy:Es,Tab:Ks,Toast:ao,Tooltip:cs}}));
+//# sourceMappingURL=bootstrap.bundle.min.js.map
\ No newline at end of file
diff --git a/src/BCards.Web/wwwroot/lib/jquery/jquery.js b/src/BCards.Web/wwwroot/lib/jquery/jquery.js
new file mode 100644
index 0000000..1a86433
--- /dev/null
+++ b/src/BCards.Web/wwwroot/lib/jquery/jquery.js
@@ -0,0 +1,10716 @@
+/*!
+ * jQuery JavaScript Library v3.7.1
+ * https://jquery.com/
+ *
+ * Copyright OpenJS Foundation and other contributors
+ * Released under the MIT license
+ * https://jquery.org/license
+ *
+ * Date: 2023-08-28T13:37Z
+ */
+( function( global, factory ) {
+
+	"use strict";
+
+	if ( typeof module === "object" && typeof module.exports === "object" ) {
+
+		// For CommonJS and CommonJS-like environments where a proper `window`
+		// is present, execute the factory and get jQuery.
+		// For environments that do not have a `window` with a `document`
+		// (such as Node.js), expose a factory as module.exports.
+		// This accentuates the need for the creation of a real `window`.
+		// e.g. var jQuery = require("jquery")(window);
+		// See ticket trac-14549 for more info.
+		module.exports = global.document ?
+			factory( global, true ) :
+			function( w ) {
+				if ( !w.document ) {
+					throw new Error( "jQuery requires a window with a document" );
+				}
+				return factory( w );
+			};
+	} else {
+		factory( global );
+	}
+
+// Pass this if window is not defined yet
+} )( typeof window !== "undefined" ? window : this, function( window, noGlobal ) {
+
+// Edge <= 12 - 13+, Firefox <=18 - 45+, IE 10 - 11, Safari 5.1 - 9+, iOS 6 - 9.1
+// throw exceptions when non-strict code (e.g., ASP.NET 4.5) accesses strict mode
+// arguments.callee.caller (trac-13335). But as of jQuery 3.0 (2016), strict mode should be common
+// enough that all such attempts are guarded in a try block.
+"use strict";
+
+var arr = [];
+
+var getProto = Object.getPrototypeOf;
+
+var slice = arr.slice;
+
+var flat = arr.flat ? function( array ) {
+	return arr.flat.call( array );
+} : function( array ) {
+	return arr.concat.apply( [], array );
+};
+
+
+var push = arr.push;
+
+var indexOf = arr.indexOf;
+
+var class2type = {};
+
+var toString = class2type.toString;
+
+var hasOwn = class2type.hasOwnProperty;
+
+var fnToString = hasOwn.toString;
+
+var ObjectFunctionString = fnToString.call( Object );
+
+var support = {};
+
+var isFunction = function isFunction( obj ) {
+
+		// Support: Chrome <=57, Firefox <=52
+		// In some browsers, typeof returns "function" for HTML <object> elements
+		// (i.e., `typeof document.createElement( "object" ) === "function"`).
+		// We don't want to classify *any* DOM node as a function.
+		// Support: QtWeb <=3.8.5, WebKit <=534.34, wkhtmltopdf tool <=0.12.5
+		// Plus for old WebKit, typeof returns "function" for HTML collections
+		// (e.g., `typeof document.getElementsByTagName("div") === "function"`). (gh-4756)
+		return typeof obj === "function" && typeof obj.nodeType !== "number" &&
+			typeof obj.item !== "function";
+	};
+
+
+var isWindow = function isWindow( obj ) {
+		return obj != null && obj === obj.window;
+	};
+
+
+var document = window.document;
+
+
+
+	var preservedScriptAttributes = {
+		type: true,
+		src: true,
+		nonce: true,
+		noModule: true
+	};
+
+	function DOMEval( code, node, doc ) {
+		doc = doc || document;
+
+		var i, val,
+			script = doc.createElement( "script" );
+
+		script.text = code;
+		if ( node ) {
+			for ( i in preservedScriptAttributes ) {
+
+				// Support: Firefox 64+, Edge 18+
+				// Some browsers don't support the "nonce" property on scripts.
+				// On the other hand, just using `getAttribute` is not enough as
+				// the `nonce` attribute is reset to an empty string whenever it
+				// becomes browsing-context connected.
+				// See https://github.com/whatwg/html/issues/2369
+				// See https://html.spec.whatwg.org/#nonce-attributes
+				// The `node.getAttribute` check was added for the sake of
+				// `jQuery.globalEval` so that it can fake a nonce-containing node
+				// via an object.
+				val = node[ i ] || node.getAttribute && node.getAttribute( i );
+				if ( val ) {
+					script.setAttribute( i, val );
+				}
+			}
+		}
+		doc.head.appendChild( script ).parentNode.removeChild( script );
+	}
+
+
+function toType( obj ) {
+	if ( obj == null ) {
+		return obj + "";
+	}
+
+	// Support: Android <=2.3 only (functionish RegExp)
+	return typeof obj === "object" || typeof obj === "function" ?
+		class2type[ toString.call( obj ) ] || "object" :
+		typeof obj;
+}
+/* global Symbol */
+// Defining this global in .eslintrc.json would create a danger of using the global
+// unguarded in another place, it seems safer to define global only for this module
+
+
+
+var version = "3.7.1",
+
+	rhtmlSuffix = /HTML$/i,
+
+	// Define a local copy of jQuery
+	jQuery = function( selector, context ) {
+
+		// The jQuery object is actually just the init constructor 'enhanced'
+		// Need init if jQuery is called (just allow error to be thrown if not included)
+		return new jQuery.fn.init( selector, context );
+	};
+
+jQuery.fn = jQuery.prototype = {
+
+	// The current version of jQuery being used
+	jquery: version,
+
+	constructor: jQuery,
+
+	// The default length of a jQuery object is 0
+	length: 0,
+
+	toArray: function() {
+		return slice.call( this );
+	},
+
+	// Get the Nth element in the matched element set OR
+	// Get the whole matched element set as a clean array
+	get: function( num ) {
+
+		// Return all the elements in a clean array
+		if ( num == null ) {
+			return slice.call( this );
+		}
+
+		// Return just the one element from the set
+		return num < 0 ? this[ num + this.length ] : this[ num ];
+	},
+
+	// Take an array of elements and push it onto the stack
+	// (returning the new matched element set)
+	pushStack: function( elems ) {
+
+		// Build a new jQuery matched element set
+		var ret = jQuery.merge( this.constructor(), elems );
+
+		// Add the old object onto the stack (as a reference)
+		ret.prevObject = this;
+
+		// Return the newly-formed element set
+		return ret;
+	},
+
+	// Execute a callback for every element in the matched set.
+	each: function( callback ) {
+		return jQuery.each( this, callback );
+	},
+
+	map: function( callback ) {
+		return this.pushStack( jQuery.map( this, function( elem, i ) {
+			return callback.call( elem, i, elem );
+		} ) );
+	},
+
+	slice: function() {
+		return this.pushStack( slice.apply( this, arguments ) );
+	},
+
+	first: function() {
+		return this.eq( 0 );
+	},
+
+	last: function() {
+		return this.eq( -1 );
+	},
+
+	even: function() {
+		return this.pushStack( jQuery.grep( this, function( _elem, i ) {
+			return ( i + 1 ) % 2;
+		} ) );
+	},
+
+	odd: function() {
+		return this.pushStack( jQuery.grep( this, function( _elem, i ) {
+			return i % 2;
+		} ) );
+	},
+
+	eq: function( i ) {
+		var len = this.length,
+			j = +i + ( i < 0 ? len : 0 );
+		return this.pushStack( j >= 0 && j < len ? [ this[ j ] ] : [] );
+	},
+
+	end: function() {
+		return this.prevObject || this.constructor();
+	},
+
+	// For internal use only.
+	// Behaves like an Array's method, not like a jQuery method.
+	push: push,
+	sort: arr.sort,
+	splice: arr.splice
+};
+
+jQuery.extend = jQuery.fn.extend = function() {
+	var options, name, src, copy, copyIsArray, clone,
+		target = arguments[ 0 ] || {},
+		i = 1,
+		length = arguments.length,
+		deep = false;
+
+	// Handle a deep copy situation
+	if ( typeof target === "boolean" ) {
+		deep = target;
+
+		// Skip the boolean and the target
+		target = arguments[ i ] || {};
+		i++;
+	}
+
+	// Handle case when target is a string or something (possible in deep copy)
+	if ( typeof target !== "object" && !isFunction( target ) ) {
+		target = {};
+	}
+
+	// Extend jQuery itself if only one argument is passed
+	if ( i === length ) {
+		target = this;
+		i--;
+	}
+
+	for ( ; i < length; i++ ) {
+
+		// Only deal with non-null/undefined values
+		if ( ( options = arguments[ i ] ) != null ) {
+
+			// Extend the base object
+			for ( name in options ) {
+				copy = options[ name ];
+
+				// Prevent Object.prototype pollution
+				// Prevent never-ending loop
+				if ( name === "__proto__" || target === copy ) {
+					continue;
+				}
+
+				// Recurse if we're merging plain objects or arrays
+				if ( deep && copy && ( jQuery.isPlainObject( copy ) ||
+					( copyIsArray = Array.isArray( copy ) ) ) ) {
+					src = target[ name ];
+
+					// Ensure proper type for the source value
+					if ( copyIsArray && !Array.isArray( src ) ) {
+						clone = [];
+					} else if ( !copyIsArray && !jQuery.isPlainObject( src ) ) {
+						clone = {};
+					} else {
+						clone = src;
+					}
+					copyIsArray = false;
+
+					// Never move original objects, clone them
+					target[ name ] = jQuery.extend( deep, clone, copy );
+
+				// Don't bring in undefined values
+				} else if ( copy !== undefined ) {
+					target[ name ] = copy;
+				}
+			}
+		}
+	}
+
+	// Return the modified object
+	return target;
+};
+
+jQuery.extend( {
+
+	// Unique for each copy of jQuery on the page
+	expando: "jQuery" + ( version + Math.random() ).replace( /\D/g, "" ),
+
+	// Assume jQuery is ready without the ready module
+	isReady: true,
+
+	error: function( msg ) {
+		throw new Error( msg );
+	},
+
+	noop: function() {},
+
+	isPlainObject: function( obj ) {
+		var proto, Ctor;
+
+		// Detect obvious negatives
+		// Use toString instead of jQuery.type to catch host objects
+		if ( !obj || toString.call( obj ) !== "[object Object]" ) {
+			return false;
+		}
+
+		proto = getProto( obj );
+
+		// Objects with no prototype (e.g., `Object.create( null )`) are plain
+		if ( !proto ) {
+			return true;
+		}
+
+		// Objects with prototype are plain iff they were constructed by a global Object function
+		Ctor = hasOwn.call( proto, "constructor" ) && proto.constructor;
+		return typeof Ctor === "function" && fnToString.call( Ctor ) === ObjectFunctionString;
+	},
+
+	isEmptyObject: function( obj ) {
+		var name;
+
+		for ( name in obj ) {
+			return false;
+		}
+		return true;
+	},
+
+	// Evaluates a script in a provided context; falls back to the global one
+	// if not specified.
+	globalEval: function( code, options, doc ) {
+		DOMEval( code, { nonce: options && options.nonce }, doc );
+	},
+
+	each: function( obj, callback ) {
+		var length, i = 0;
+
+		if ( isArrayLike( obj ) ) {
+			length = obj.length;
+			for ( ; i < length; i++ ) {
+				if ( callback.call( obj[ i ], i, obj[ i ] ) === false ) {
+					break;
+				}
+			}
+		} else {
+			for ( i in obj ) {
+				if ( callback.call( obj[ i ], i, obj[ i ] ) === false ) {
+					break;
+				}
+			}
+		}
+
+		return obj;
+	},
+
+
+	// Retrieve the text value of an array of DOM nodes
+	text: function( elem ) {
+		var node,
+			ret = "",
+			i = 0,
+			nodeType = elem.nodeType;
+
+		if ( !nodeType ) {
+
+			// If no nodeType, this is expected to be an array
+			while ( ( node = elem[ i++ ] ) ) {
+
+				// Do not traverse comment nodes
+				ret += jQuery.text( node );
+			}
+		}
+		if ( nodeType === 1 || nodeType === 11 ) {
+			return elem.textContent;
+		}
+		if ( nodeType === 9 ) {
+			return elem.documentElement.textContent;
+		}
+		if ( nodeType === 3 || nodeType === 4 ) {
+			return elem.nodeValue;
+		}
+
+		// Do not include comment or processing instruction nodes
+
+		return ret;
+	},
+
+	// results is for internal usage only
+	makeArray: function( arr, results ) {
+		var ret = results || [];
+
+		if ( arr != null ) {
+			if ( isArrayLike( Object( arr ) ) ) {
+				jQuery.merge( ret,
+					typeof arr === "string" ?
+						[ arr ] : arr
+				);
+			} else {
+				push.call( ret, arr );
+			}
+		}
+
+		return ret;
+	},
+
+	inArray: function( elem, arr, i ) {
+		return arr == null ? -1 : indexOf.call( arr, elem, i );
+	},
+
+	isXMLDoc: function( elem ) {
+		var namespace = elem && elem.namespaceURI,
+			docElem = elem && ( elem.ownerDocument || elem ).documentElement;
+
+		// Assume HTML when documentElement doesn't yet exist, such as inside
+		// document fragments.
+		return !rhtmlSuffix.test( namespace || docElem && docElem.nodeName || "HTML" );
+	},
+
+	// Support: Android <=4.0 only, PhantomJS 1 only
+	// push.apply(_, arraylike) throws on ancient WebKit
+	merge: function( first, second ) {
+		var len = +second.length,
+			j = 0,
+			i = first.length;
+
+		for ( ; j < len; j++ ) {
+			first[ i++ ] = second[ j ];
+		}
+
+		first.length = i;
+
+		return first;
+	},
+
+	grep: function( elems, callback, invert ) {
+		var callbackInverse,
+			matches = [],
+			i = 0,
+			length = elems.length,
+			callbackExpect = !invert;
+
+		// Go through the array, only saving the items
+		// that pass the validator function
+		for ( ; i < length; i++ ) {
+			callbackInverse = !callback( elems[ i ], i );
+			if ( callbackInverse !== callbackExpect ) {
+				matches.push( elems[ i ] );
+			}
+		}
+
+		return matches;
+	},
+
+	// arg is for internal usage only
+	map: function( elems, callback, arg ) {
+		var length, value,
+			i = 0,
+			ret = [];
+
+		// Go through the array, translating each of the items to their new values
+		if ( isArrayLike( elems ) ) {
+			length = elems.length;
+			for ( ; i < length; i++ ) {
+				value = callback( elems[ i ], i, arg );
+
+				if ( value != null ) {
+					ret.push( value );
+				}
+			}
+
+		// Go through every key on the object,
+		} else {
+			for ( i in elems ) {
+				value = callback( elems[ i ], i, arg );
+
+				if ( value != null ) {
+					ret.push( value );
+				}
+			}
+		}
+
+		// Flatten any nested arrays
+		return flat( ret );
+	},
+
+	// A global GUID counter for objects
+	guid: 1,
+
+	// jQuery.support is not used in Core but other projects attach their
+	// properties to it so it needs to exist.
+	support: support
+} );
+
+if ( typeof Symbol === "function" ) {
+	jQuery.fn[ Symbol.iterator ] = arr[ Symbol.iterator ];
+}
+
+// Populate the class2type map
+jQuery.each( "Boolean Number String Function Array Date RegExp Object Error Symbol".split( " " ),
+	function( _i, name ) {
+		class2type[ "[object " + name + "]" ] = name.toLowerCase();
+	} );
+
+function isArrayLike( obj ) {
+
+	// Support: real iOS 8.2 only (not reproducible in simulator)
+	// `in` check used to prevent JIT error (gh-2145)
+	// hasOwn isn't used here due to false negatives
+	// regarding Nodelist length in IE
+	var length = !!obj && "length" in obj && obj.length,
+		type = toType( obj );
+
+	if ( isFunction( obj ) || isWindow( obj ) ) {
+		return false;
+	}
+
+	return type === "array" || length === 0 ||
+		typeof length === "number" && length > 0 && ( length - 1 ) in obj;
+}
+
+
+function nodeName( elem, name ) {
+
+	return elem.nodeName && elem.nodeName.toLowerCase() === name.toLowerCase();
+
+}
+var pop = arr.pop;
+
+
+var sort = arr.sort;
+
+
+var splice = arr.splice;
+
+
+var whitespace = "[\\x20\\t\\r\\n\\f]";
+
+
+var rtrimCSS = new RegExp(
+	"^" + whitespace + "+|((?:^|[^\\\\])(?:\\\\.)*)" + whitespace + "+$",
+	"g"
+);
+
+
+
+
+// Note: an element does not contain itself
+jQuery.contains = function( a, b ) {
+	var bup = b && b.parentNode;
+
+	return a === bup || !!( bup && bup.nodeType === 1 && (
+
+		// Support: IE 9 - 11+
+		// IE doesn't have `contains` on SVG.
+		a.contains ?
+			a.contains( bup ) :
+			a.compareDocumentPosition && a.compareDocumentPosition( bup ) & 16
+	) );
+};
+
+
+
+
+// CSS string/identifier serialization
+// https://drafts.csswg.org/cssom/#common-serializing-idioms
+var rcssescape = /([\0-\x1f\x7f]|^-?\d)|^-$|[^\x80-\uFFFF\w-]/g;
+
+function fcssescape( ch, asCodePoint ) {
+	if ( asCodePoint ) {
+
+		// U+0000 NULL becomes U+FFFD REPLACEMENT CHARACTER
+		if ( ch === "\0" ) {
+			return "\uFFFD";
+		}
+
+		// Control characters and (dependent upon position) numbers get escaped as code points
+		return ch.slice( 0, -1 ) + "\\" + ch.charCodeAt( ch.length - 1 ).toString( 16 ) + " ";
+	}
+
+	// Other potentially-special ASCII characters get backslash-escaped
+	return "\\" + ch;
+}
+
+jQuery.escapeSelector = function( sel ) {
+	return ( sel + "" ).replace( rcssescape, fcssescape );
+};
+
+
+
+
+var preferredDoc = document,
+	pushNative = push;
+
+( function() {
+
+var i,
+	Expr,
+	outermostContext,
+	sortInput,
+	hasDuplicate,
+	push = pushNative,
+
+	// Local document vars
+	document,
+	documentElement,
+	documentIsHTML,
+	rbuggyQSA,
+	matches,
+
+	// Instance-specific data
+	expando = jQuery.expando,
+	dirruns = 0,
+	done = 0,
+	classCache = createCache(),
+	tokenCache = createCache(),
+	compilerCache = createCache(),
+	nonnativeSelectorCache = createCache(),
+	sortOrder = function( a, b ) {
+		if ( a === b ) {
+			hasDuplicate = true;
+		}
+		return 0;
+	},
+
+	booleans = "checked|selected|async|autofocus|autoplay|controls|defer|disabled|hidden|ismap|" +
+		"loop|multiple|open|readonly|required|scoped",
+
+	// Regular expressions
+
+	// https://www.w3.org/TR/css-syntax-3/#ident-token-diagram
+	identifier = "(?:\\\\[\\da-fA-F]{1,6}" + whitespace +
+		"?|\\\\[^\\r\\n\\f]|[\\w-]|[^\0-\\x7f])+",
+
+	// Attribute selectors: https://www.w3.org/TR/selectors/#attribute-selectors
+	attributes = "\\[" + whitespace + "*(" + identifier + ")(?:" + whitespace +
+
+		// Operator (capture 2)
+		"*([*^$|!~]?=)" + whitespace +
+
+		// "Attribute values must be CSS identifiers [capture 5] or strings [capture 3 or capture 4]"
+		"*(?:'((?:\\\\.|[^\\\\'])*)'|\"((?:\\\\.|[^\\\\\"])*)\"|(" + identifier + "))|)" +
+		whitespace + "*\\]",
+
+	pseudos = ":(" + identifier + ")(?:\\((" +
+
+		// To reduce the number of selectors needing tokenize in the preFilter, prefer arguments:
+		// 1. quoted (capture 3; capture 4 or capture 5)
+		"('((?:\\\\.|[^\\\\'])*)'|\"((?:\\\\.|[^\\\\\"])*)\")|" +
+
+		// 2. simple (capture 6)
+		"((?:\\\\.|[^\\\\()[\\]]|" + attributes + ")*)|" +
+
+		// 3. anything else (capture 2)
+		".*" +
+		")\\)|)",
+
+	// Leading and non-escaped trailing whitespace, capturing some non-whitespace characters preceding the latter
+	rwhitespace = new RegExp( whitespace + "+", "g" ),
+
+	rcomma = new RegExp( "^" + whitespace + "*," + whitespace + "*" ),
+	rleadingCombinator = new RegExp( "^" + whitespace + "*([>+~]|" + whitespace + ")" +
+		whitespace + "*" ),
+	rdescend = new RegExp( whitespace + "|>" ),
+
+	rpseudo = new RegExp( pseudos ),
+	ridentifier = new RegExp( "^" + identifier + "$" ),
+
+	matchExpr = {
+		ID: new RegExp( "^#(" + identifier + ")" ),
+		CLASS: new RegExp( "^\\.(" + identifier + ")" ),
+		TAG: new RegExp( "^(" + identifier + "|[*])" ),
+		ATTR: new RegExp( "^" + attributes ),
+		PSEUDO: new RegExp( "^" + pseudos ),
+		CHILD: new RegExp(
+			"^:(only|first|last|nth|nth-last)-(child|of-type)(?:\\(" +
+				whitespace + "*(even|odd|(([+-]|)(\\d*)n|)" + whitespace + "*(?:([+-]|)" +
+				whitespace + "*(\\d+)|))" + whitespace + "*\\)|)", "i" ),
+		bool: new RegExp( "^(?:" + booleans + ")$", "i" ),
+
+		// For use in libraries implementing .is()
+		// We use this for POS matching in `select`
+		needsContext: new RegExp( "^" + whitespace +
+			"*[>+~]|:(even|odd|eq|gt|lt|nth|first|last)(?:\\(" + whitespace +
+			"*((?:-\\d)?\\d*)" + whitespace + "*\\)|)(?=[^-]|$)", "i" )
+	},
+
+	rinputs = /^(?:input|select|textarea|button)$/i,
+	rheader = /^h\d$/i,
+
+	// Easily-parseable/retrievable ID or TAG or CLASS selectors
+	rquickExpr = /^(?:#([\w-]+)|(\w+)|\.([\w-]+))$/,
+
+	rsibling = /[+~]/,
+
+	// CSS escapes
+	// https://www.w3.org/TR/CSS21/syndata.html#escaped-characters
+	runescape = new RegExp( "\\\\[\\da-fA-F]{1,6}" + whitespace +
+		"?|\\\\([^\\r\\n\\f])", "g" ),
+	funescape = function( escape, nonHex ) {
+		var high = "0x" + escape.slice( 1 ) - 0x10000;
+
+		if ( nonHex ) {
+
+			// Strip the backslash prefix from a non-hex escape sequence
+			return nonHex;
+		}
+
+		// Replace a hexadecimal escape sequence with the encoded Unicode code point
+		// Support: IE <=11+
+		// For values outside the Basic Multilingual Plane (BMP), manually construct a
+		// surrogate pair
+		return high < 0 ?
+			String.fromCharCode( high + 0x10000 ) :
+			String.fromCharCode( high >> 10 | 0xD800, high & 0x3FF | 0xDC00 );
+	},
+
+	// Used for iframes; see `setDocument`.
+	// Support: IE 9 - 11+, Edge 12 - 18+
+	// Removing the function wrapper causes a "Permission Denied"
+	// error in IE/Edge.
+	unloadHandler = function() {
+		setDocument();
+	},
+
+	inDisabledFieldset = addCombinator(
+		function( elem ) {
+			return elem.disabled === true && nodeName( elem, "fieldset" );
+		},
+		{ dir: "parentNode", next: "legend" }
+	);
+
+// Support: IE <=9 only
+// Accessing document.activeElement can throw unexpectedly
+// https://bugs.jquery.com/ticket/13393
+function safeActiveElement() {
+	try {
+		return document.activeElement;
+	} catch ( err ) { }
+}
+
+// Optimize for push.apply( _, NodeList )
+try {
+	push.apply(
+		( arr = slice.call( preferredDoc.childNodes ) ),
+		preferredDoc.childNodes
+	);
+
+	// Support: Android <=4.0
+	// Detect silently failing push.apply
+	// eslint-disable-next-line no-unused-expressions
+	arr[ preferredDoc.childNodes.length ].nodeType;
+} catch ( e ) {
+	push = {
+		apply: function( target, els ) {
+			pushNative.apply( target, slice.call( els ) );
+		},
+		call: function( target ) {
+			pushNative.apply( target, slice.call( arguments, 1 ) );
+		}
+	};
+}
+
+function find( selector, context, results, seed ) {
+	var m, i, elem, nid, match, groups, newSelector,
+		newContext = context && context.ownerDocument,
+
+		// nodeType defaults to 9, since context defaults to document
+		nodeType = context ? context.nodeType : 9;
+
+	results = results || [];
+
+	// Return early from calls with invalid selector or context
+	if ( typeof selector !== "string" || !selector ||
+		nodeType !== 1 && nodeType !== 9 && nodeType !== 11 ) {
+
+		return results;
+	}
+
+	// Try to shortcut find operations (as opposed to filters) in HTML documents
+	if ( !seed ) {
+		setDocument( context );
+		context = context || document;
+
+		if ( documentIsHTML ) {
+
+			// If the selector is sufficiently simple, try using a "get*By*" DOM method
+			// (excepting DocumentFragment context, where the methods don't exist)
+			if ( nodeType !== 11 && ( match = rquickExpr.exec( selector ) ) ) {
+
+				// ID selector
+				if ( ( m = match[ 1 ] ) ) {
+
+					// Document context
+					if ( nodeType === 9 ) {
+						if ( ( elem = context.getElementById( m ) ) ) {
+
+							// Support: IE 9 only
+							// getElementById can match elements by name instead of ID
+							if ( elem.id === m ) {
+								push.call( results, elem );
+								return results;
+							}
+						} else {
+							return results;
+						}
+
+					// Element context
+					} else {
+
+						// Support: IE 9 only
+						// getElementById can match elements by name instead of ID
+						if ( newContext && ( elem = newContext.getElementById( m ) ) &&
+							find.contains( context, elem ) &&
+							elem.id === m ) {
+
+							push.call( results, elem );
+							return results;
+						}
+					}
+
+				// Type selector
+				} else if ( match[ 2 ] ) {
+					push.apply( results, context.getElementsByTagName( selector ) );
+					return results;
+
+				// Class selector
+				} else if ( ( m = match[ 3 ] ) && context.getElementsByClassName ) {
+					push.apply( results, context.getElementsByClassName( m ) );
+					return results;
+				}
+			}
+
+			// Take advantage of querySelectorAll
+			if ( !nonnativeSelectorCache[ selector + " " ] &&
+				( !rbuggyQSA || !rbuggyQSA.test( selector ) ) ) {
+
+				newSelector = selector;
+				newContext = context;
+
+				// qSA considers elements outside a scoping root when evaluating child or
+				// descendant combinators, which is not what we want.
+				// In such cases, we work around the behavior by prefixing every selector in the
+				// list with an ID selector referencing the scope context.
+				// The technique has to be used as well when a leading combinator is used
+				// as such selectors are not recognized by querySelectorAll.
+				// Thanks to Andrew Dupont for this technique.
+				if ( nodeType === 1 &&
+					( rdescend.test( selector ) || rleadingCombinator.test( selector ) ) ) {
+
+					// Expand context for sibling selectors
+					newContext = rsibling.test( selector ) && testContext( context.parentNode ) ||
+						context;
+
+					// We can use :scope instead of the ID hack if the browser
+					// supports it & if we're not changing the context.
+					// Support: IE 11+, Edge 17 - 18+
+					// IE/Edge sometimes throw a "Permission denied" error when
+					// strict-comparing two documents; shallow comparisons work.
+					// eslint-disable-next-line eqeqeq
+					if ( newContext != context || !support.scope ) {
+
+						// Capture the context ID, setting it first if necessary
+						if ( ( nid = context.getAttribute( "id" ) ) ) {
+							nid = jQuery.escapeSelector( nid );
+						} else {
+							context.setAttribute( "id", ( nid = expando ) );
+						}
+					}
+
+					// Prefix every selector in the list
+					groups = tokenize( selector );
+					i = groups.length;
+					while ( i-- ) {
+						groups[ i ] = ( nid ? "#" + nid : ":scope" ) + " " +
+							toSelector( groups[ i ] );
+					}
+					newSelector = groups.join( "," );
+				}
+
+				try {
+					push.apply( results,
+						newContext.querySelectorAll( newSelector )
+					);
+					return results;
+				} catch ( qsaError ) {
+					nonnativeSelectorCache( selector, true );
+				} finally {
+					if ( nid === expando ) {
+						context.removeAttribute( "id" );
+					}
+				}
+			}
+		}
+	}
+
+	// All others
+	return select( selector.replace( rtrimCSS, "$1" ), context, results, seed );
+}
+
+/**
+ * Create key-value caches of limited size
+ * @returns {function(string, object)} Returns the Object data after storing it on itself with
+ *	property name the (space-suffixed) string and (if the cache is larger than Expr.cacheLength)
+ *	deleting the oldest entry
+ */
+function createCache() {
+	var keys = [];
+
+	function cache( key, value ) {
+
+		// Use (key + " ") to avoid collision with native prototype properties
+		// (see https://github.com/jquery/sizzle/issues/157)
+		if ( keys.push( key + " " ) > Expr.cacheLength ) {
+
+			// Only keep the most recent entries
+			delete cache[ keys.shift() ];
+		}
+		return ( cache[ key + " " ] = value );
+	}
+	return cache;
+}
+
+/**
+ * Mark a function for special use by jQuery selector module
+ * @param {Function} fn The function to mark
+ */
+function markFunction( fn ) {
+	fn[ expando ] = true;
+	return fn;
+}
+
+/**
+ * Support testing using an element
+ * @param {Function} fn Passed the created element and returns a boolean result
+ */
+function assert( fn ) {
+	var el = document.createElement( "fieldset" );
+
+	try {
+		return !!fn( el );
+	} catch ( e ) {
+		return false;
+	} finally {
+
+		// Remove from its parent by default
+		if ( el.parentNode ) {
+			el.parentNode.removeChild( el );
+		}
+
+		// release memory in IE
+		el = null;
+	}
+}
+
+/**
+ * Returns a function to use in pseudos for input types
+ * @param {String} type
+ */
+function createInputPseudo( type ) {
+	return function( elem ) {
+		return nodeName( elem, "input" ) && elem.type === type;
+	};
+}
+
+/**
+ * Returns a function to use in pseudos for buttons
+ * @param {String} type
+ */
+function createButtonPseudo( type ) {
+	return function( elem ) {
+		return ( nodeName( elem, "input" ) || nodeName( elem, "button" ) ) &&
+			elem.type === type;
+	};
+}
+
+/**
+ * Returns a function to use in pseudos for :enabled/:disabled
+ * @param {Boolean} disabled true for :disabled; false for :enabled
+ */
+function createDisabledPseudo( disabled ) {
+
+	// Known :disabled false positives: fieldset[disabled] > legend:nth-of-type(n+2) :can-disable
+	return function( elem ) {
+
+		// Only certain elements can match :enabled or :disabled
+		// https://html.spec.whatwg.org/multipage/scripting.html#selector-enabled
+		// https://html.spec.whatwg.org/multipage/scripting.html#selector-disabled
+		if ( "form" in elem ) {
+
+			// Check for inherited disabledness on relevant non-disabled elements:
+			// * listed form-associated elements in a disabled fieldset
+			//   https://html.spec.whatwg.org/multipage/forms.html#category-listed
+			//   https://html.spec.whatwg.org/multipage/forms.html#concept-fe-disabled
+			// * option elements in a disabled optgroup
+			//   https://html.spec.whatwg.org/multipage/forms.html#concept-option-disabled
+			// All such elements have a "form" property.
+			if ( elem.parentNode && elem.disabled === false ) {
+
+				// Option elements defer to a parent optgroup if present
+				if ( "label" in elem ) {
+					if ( "label" in elem.parentNode ) {
+						return elem.parentNode.disabled === disabled;
+					} else {
+						return elem.disabled === disabled;
+					}
+				}
+
+				// Support: IE 6 - 11+
+				// Use the isDisabled shortcut property to check for disabled fieldset ancestors
+				return elem.isDisabled === disabled ||
+
+					// Where there is no isDisabled, check manually
+					elem.isDisabled !== !disabled &&
+						inDisabledFieldset( elem ) === disabled;
+			}
+
+			return elem.disabled === disabled;
+
+		// Try to winnow out elements that can't be disabled before trusting the disabled property.
+		// Some victims get caught in our net (label, legend, menu, track), but it shouldn't
+		// even exist on them, let alone have a boolean value.
+		} else if ( "label" in elem ) {
+			return elem.disabled === disabled;
+		}
+
+		// Remaining elements are neither :enabled nor :disabled
+		return false;
+	};
+}
+
+/**
+ * Returns a function to use in pseudos for positionals
+ * @param {Function} fn
+ */
+function createPositionalPseudo( fn ) {
+	return markFunction( function( argument ) {
+		argument = +argument;
+		return markFunction( function( seed, matches ) {
+			var j,
+				matchIndexes = fn( [], seed.length, argument ),
+				i = matchIndexes.length;
+
+			// Match elements found at the specified indexes
+			while ( i-- ) {
+				if ( seed[ ( j = matchIndexes[ i ] ) ] ) {
+					seed[ j ] = !( matches[ j ] = seed[ j ] );
+				}
+			}
+		} );
+	} );
+}
+
+/**
+ * Checks a node for validity as a jQuery selector context
+ * @param {Element|Object=} context
+ * @returns {Element|Object|Boolean} The input node if acceptable, otherwise a falsy value
+ */
+function testContext( context ) {
+	return context && typeof context.getElementsByTagName !== "undefined" && context;
+}
+
+/**
+ * Sets document-related variables once based on the current document
+ * @param {Element|Object} [node] An element or document object to use to set the document
+ * @returns {Object} Returns the current document
+ */
+function setDocument( node ) {
+	var subWindow,
+		doc = node ? node.ownerDocument || node : preferredDoc;
+
+	// Return early if doc is invalid or already selected
+	// Support: IE 11+, Edge 17 - 18+
+	// IE/Edge sometimes throw a "Permission denied" error when strict-comparing
+	// two documents; shallow comparisons work.
+	// eslint-disable-next-line eqeqeq
+	if ( doc == document || doc.nodeType !== 9 || !doc.documentElement ) {
+		return document;
+	}
+
+	// Update global variables
+	document = doc;
+	documentElement = document.documentElement;
+	documentIsHTML = !jQuery.isXMLDoc( document );
+
+	// Support: iOS 7 only, IE 9 - 11+
+	// Older browsers didn't support unprefixed `matches`.
+	matches = documentElement.matches ||
+		documentElement.webkitMatchesSelector ||
+		documentElement.msMatchesSelector;
+
+	// Support: IE 9 - 11+, Edge 12 - 18+
+	// Accessing iframe documents after unload throws "permission denied" errors
+	// (see trac-13936).
+	// Limit the fix to IE & Edge Legacy; despite Edge 15+ implementing `matches`,
+	// all IE 9+ and Edge Legacy versions implement `msMatchesSelector` as well.
+	if ( documentElement.msMatchesSelector &&
+
+		// Support: IE 11+, Edge 17 - 18+
+		// IE/Edge sometimes throw a "Permission denied" error when strict-comparing
+		// two documents; shallow comparisons work.
+		// eslint-disable-next-line eqeqeq
+		preferredDoc != document &&
+		( subWindow = document.defaultView ) && subWindow.top !== subWindow ) {
+
+		// Support: IE 9 - 11+, Edge 12 - 18+
+		subWindow.addEventListener( "unload", unloadHandler );
+	}
+
+	// Support: IE <10
+	// Check if getElementById returns elements by name
+	// The broken getElementById methods don't pick up programmatically-set names,
+	// so use a roundabout getElementsByName test
+	support.getById = assert( function( el ) {
+		documentElement.appendChild( el ).id = jQuery.expando;
+		return !document.getElementsByName ||
+			!document.getElementsByName( jQuery.expando ).length;
+	} );
+
+	// Support: IE 9 only
+	// Check to see if it's possible to do matchesSelector
+	// on a disconnected node.
+	support.disconnectedMatch = assert( function( el ) {
+		return matches.call( el, "*" );
+	} );
+
+	// Support: IE 9 - 11+, Edge 12 - 18+
+	// IE/Edge don't support the :scope pseudo-class.
+	support.scope = assert( function() {
+		return document.querySelectorAll( ":scope" );
+	} );
+
+	// Support: Chrome 105 - 111 only, Safari 15.4 - 16.3 only
+	// Make sure the `:has()` argument is parsed unforgivingly.
+	// We include `*` in the test to detect buggy implementations that are
+	// _selectively_ forgiving (specifically when the list includes at least
+	// one valid selector).
+	// Note that we treat complete lack of support for `:has()` as if it were
+	// spec-compliant support, which is fine because use of `:has()` in such
+	// environments will fail in the qSA path and fall back to jQuery traversal
+	// anyway.
+	support.cssHas = assert( function() {
+		try {
+			document.querySelector( ":has(*,:jqfake)" );
+			return false;
+		} catch ( e ) {
+			return true;
+		}
+	} );
+
+	// ID filter and find
+	if ( support.getById ) {
+		Expr.filter.ID = function( id ) {
+			var attrId = id.replace( runescape, funescape );
+			return function( elem ) {
+				return elem.getAttribute( "id" ) === attrId;
+			};
+		};
+		Expr.find.ID = function( id, context ) {
+			if ( typeof context.getElementById !== "undefined" && documentIsHTML ) {
+				var elem = context.getElementById( id );
+				return elem ? [ elem ] : [];
+			}
+		};
+	} else {
+		Expr.filter.ID =  function( id ) {
+			var attrId = id.replace( runescape, funescape );
+			return function( elem ) {
+				var node = typeof elem.getAttributeNode !== "undefined" &&
+					elem.getAttributeNode( "id" );
+				return node && node.value === attrId;
+			};
+		};
+
+		// Support: IE 6 - 7 only
+		// getElementById is not reliable as a find shortcut
+		Expr.find.ID = function( id, context ) {
+			if ( typeof context.getElementById !== "undefined" && documentIsHTML ) {
+				var node, i, elems,
+					elem = context.getElementById( id );
+
+				if ( elem ) {
+
+					// Verify the id attribute
+					node = elem.getAttributeNode( "id" );
+					if ( node && node.value === id ) {
+						return [ elem ];
+					}
+
+					// Fall back on getElementsByName
+					elems = context.getElementsByName( id );
+					i = 0;
+					while ( ( elem = elems[ i++ ] ) ) {
+						node = elem.getAttributeNode( "id" );
+						if ( node && node.value === id ) {
+							return [ elem ];
+						}
+					}
+				}
+
+				return [];
+			}
+		};
+	}
+
+	// Tag
+	Expr.find.TAG = function( tag, context ) {
+		if ( typeof context.getElementsByTagName !== "undefined" ) {
+			return context.getElementsByTagName( tag );
+
+		// DocumentFragment nodes don't have gEBTN
+		} else {
+			return context.querySelectorAll( tag );
+		}
+	};
+
+	// Class
+	Expr.find.CLASS = function( className, context ) {
+		if ( typeof context.getElementsByClassName !== "undefined" && documentIsHTML ) {
+			return context.getElementsByClassName( className );
+		}
+	};
+
+	/* QSA/matchesSelector
+	---------------------------------------------------------------------- */
+
+	// QSA and matchesSelector support
+
+	rbuggyQSA = [];
+
+	// Build QSA regex
+	// Regex strategy adopted from Diego Perini
+	assert( function( el ) {
+
+		var input;
+
+		documentElement.appendChild( el ).innerHTML =
+			"<a id='" + expando + "' href='' disabled='disabled'></a>" +
+			"<select id='" + expando + "-\r\\' disabled='disabled'>" +
+			"<option selected=''></option></select>";
+
+		// Support: iOS <=7 - 8 only
+		// Boolean attributes and "value" are not treated correctly in some XML documents
+		if ( !el.querySelectorAll( "[selected]" ).length ) {
+			rbuggyQSA.push( "\\[" + whitespace + "*(?:value|" + booleans + ")" );
+		}
+
+		// Support: iOS <=7 - 8 only
+		if ( !el.querySelectorAll( "[id~=" + expando + "-]" ).length ) {
+			rbuggyQSA.push( "~=" );
+		}
+
+		// Support: iOS 8 only
+		// https://bugs.webkit.org/show_bug.cgi?id=136851
+		// In-page `selector#id sibling-combinator selector` fails
+		if ( !el.querySelectorAll( "a#" + expando + "+*" ).length ) {
+			rbuggyQSA.push( ".#.+[+~]" );
+		}
+
+		// Support: Chrome <=105+, Firefox <=104+, Safari <=15.4+
+		// In some of the document kinds, these selectors wouldn't work natively.
+		// This is probably OK but for backwards compatibility we want to maintain
+		// handling them through jQuery traversal in jQuery 3.x.
+		if ( !el.querySelectorAll( ":checked" ).length ) {
+			rbuggyQSA.push( ":checked" );
+		}
+
+		// Support: Windows 8 Native Apps
+		// The type and name attributes are restricted during .innerHTML assignment
+		input = document.createElement( "input" );
+		input.setAttribute( "type", "hidden" );
+		el.appendChild( input ).setAttribute( "name", "D" );
+
+		// Support: IE 9 - 11+
+		// IE's :disabled selector does not pick up the children of disabled fieldsets
+		// Support: Chrome <=105+, Firefox <=104+, Safari <=15.4+
+		// In some of the document kinds, these selectors wouldn't work natively.
+		// This is probably OK but for backwards compatibility we want to maintain
+		// handling them through jQuery traversal in jQuery 3.x.
+		documentElement.appendChild( el ).disabled = true;
+		if ( el.querySelectorAll( ":disabled" ).length !== 2 ) {
+			rbuggyQSA.push( ":enabled", ":disabled" );
+		}
+
+		// Support: IE 11+, Edge 15 - 18+
+		// IE 11/Edge don't find elements on a `[name='']` query in some cases.
+		// Adding a temporary attribute to the document before the selection works
+		// around the issue.
+		// Interestingly, IE 10 & older don't seem to have the issue.
+		input = document.createElement( "input" );
+		input.setAttribute( "name", "" );
+		el.appendChild( input );
+		if ( !el.querySelectorAll( "[name='']" ).length ) {
+			rbuggyQSA.push( "\\[" + whitespace + "*name" + whitespace + "*=" +
+				whitespace + "*(?:''|\"\")" );
+		}
+	} );
+
+	if ( !support.cssHas ) {
+
+		// Support: Chrome 105 - 110+, Safari 15.4 - 16.3+
+		// Our regular `try-catch` mechanism fails to detect natively-unsupported
+		// pseudo-classes inside `:has()` (such as `:has(:contains("Foo"))`)
+		// in browsers that parse the `:has()` argument as a forgiving selector list.
+		// https://drafts.csswg.org/selectors/#relational now requires the argument
+		// to be parsed unforgivingly, but browsers have not yet fully adjusted.
+		rbuggyQSA.push( ":has" );
+	}
+
+	rbuggyQSA = rbuggyQSA.length && new RegExp( rbuggyQSA.join( "|" ) );
+
+	/* Sorting
+	---------------------------------------------------------------------- */
+
+	// Document order sorting
+	sortOrder = function( a, b ) {
+
+		// Flag for duplicate removal
+		if ( a === b ) {
+			hasDuplicate = true;
+			return 0;
+		}
+
+		// Sort on method existence if only one input has compareDocumentPosition
+		var compare = !a.compareDocumentPosition - !b.compareDocumentPosition;
+		if ( compare ) {
+			return compare;
+		}
+
+		// Calculate position if both inputs belong to the same document
+		// Support: IE 11+, Edge 17 - 18+
+		// IE/Edge sometimes throw a "Permission denied" error when strict-comparing
+		// two documents; shallow comparisons work.
+		// eslint-disable-next-line eqeqeq
+		compare = ( a.ownerDocument || a ) == ( b.ownerDocument || b ) ?
+			a.compareDocumentPosition( b ) :
+
+			// Otherwise we know they are disconnected
+			1;
+
+		// Disconnected nodes
+		if ( compare & 1 ||
+			( !support.sortDetached && b.compareDocumentPosition( a ) === compare ) ) {
+
+			// Choose the first element that is related to our preferred document
+			// Support: IE 11+, Edge 17 - 18+
+			// IE/Edge sometimes throw a "Permission denied" error when strict-comparing
+			// two documents; shallow comparisons work.
+			// eslint-disable-next-line eqeqeq
+			if ( a === document || a.ownerDocument == preferredDoc &&
+				find.contains( preferredDoc, a ) ) {
+				return -1;
+			}
+
+			// Support: IE 11+, Edge 17 - 18+
+			// IE/Edge sometimes throw a "Permission denied" error when strict-comparing
+			// two documents; shallow comparisons work.
+			// eslint-disable-next-line eqeqeq
+			if ( b === document || b.ownerDocument == preferredDoc &&
+				find.contains( preferredDoc, b ) ) {
+				return 1;
+			}
+
+			// Maintain original order
+			return sortInput ?
+				( indexOf.call( sortInput, a ) - indexOf.call( sortInput, b ) ) :
+				0;
+		}
+
+		return compare & 4 ? -1 : 1;
+	};
+
+	return document;
+}
+
+find.matches = function( expr, elements ) {
+	return find( expr, null, null, elements );
+};
+
+find.matchesSelector = function( elem, expr ) {
+	setDocument( elem );
+
+	if ( documentIsHTML &&
+		!nonnativeSelectorCache[ expr + " " ] &&
+		( !rbuggyQSA || !rbuggyQSA.test( expr ) ) ) {
+
+		try {
+			var ret = matches.call( elem, expr );
+
+			// IE 9's matchesSelector returns false on disconnected nodes
+			if ( ret || support.disconnectedMatch ||
+
+					// As well, disconnected nodes are said to be in a document
+					// fragment in IE 9
+					elem.document && elem.document.nodeType !== 11 ) {
+				return ret;
+			}
+		} catch ( e ) {
+			nonnativeSelectorCache( expr, true );
+		}
+	}
+
+	return find( expr, document, null, [ elem ] ).length > 0;
+};
+
+find.contains = function( context, elem ) {
+
+	// Set document vars if needed
+	// Support: IE 11+, Edge 17 - 18+
+	// IE/Edge sometimes throw a "Permission denied" error when strict-comparing
+	// two documents; shallow comparisons work.
+	// eslint-disable-next-line eqeqeq
+	if ( ( context.ownerDocument || context ) != document ) {
+		setDocument( context );
+	}
+	return jQuery.contains( context, elem );
+};
+
+
+find.attr = function( elem, name ) {
+
+	// Set document vars if needed
+	// Support: IE 11+, Edge 17 - 18+
+	// IE/Edge sometimes throw a "Permission denied" error when strict-comparing
+	// two documents; shallow comparisons work.
+	// eslint-disable-next-line eqeqeq
+	if ( ( elem.ownerDocument || elem ) != document ) {
+		setDocument( elem );
+	}
+
+	var fn = Expr.attrHandle[ name.toLowerCase() ],
+
+		// Don't get fooled by Object.prototype properties (see trac-13807)
+		val = fn && hasOwn.call( Expr.attrHandle, name.toLowerCase() ) ?
+			fn( elem, name, !documentIsHTML ) :
+			undefined;
+
+	if ( val !== undefined ) {
+		return val;
+	}
+
+	return elem.getAttribute( name );
+};
+
+find.error = function( msg ) {
+	throw new Error( "Syntax error, unrecognized expression: " + msg );
+};
+
+/**
+ * Document sorting and removing duplicates
+ * @param {ArrayLike} results
+ */
+jQuery.uniqueSort = function( results ) {
+	var elem,
+		duplicates = [],
+		j = 0,
+		i = 0;
+
+	// Unless we *know* we can detect duplicates, assume their presence
+	//
+	// Support: Android <=4.0+
+	// Testing for detecting duplicates is unpredictable so instead assume we can't
+	// depend on duplicate detection in all browsers without a stable sort.
+	hasDuplicate = !support.sortStable;
+	sortInput = !support.sortStable && slice.call( results, 0 );
+	sort.call( results, sortOrder );
+
+	if ( hasDuplicate ) {
+		while ( ( elem = results[ i++ ] ) ) {
+			if ( elem === results[ i ] ) {
+				j = duplicates.push( i );
+			}
+		}
+		while ( j-- ) {
+			splice.call( results, duplicates[ j ], 1 );
+		}
+	}
+
+	// Clear input after sorting to release objects
+	// See https://github.com/jquery/sizzle/pull/225
+	sortInput = null;
+
+	return results;
+};
+
+jQuery.fn.uniqueSort = function() {
+	return this.pushStack( jQuery.uniqueSort( slice.apply( this ) ) );
+};
+
+Expr = jQuery.expr = {
+
+	// Can be adjusted by the user
+	cacheLength: 50,
+
+	createPseudo: markFunction,
+
+	match: matchExpr,
+
+	attrHandle: {},
+
+	find: {},
+
+	relative: {
+		">": { dir: "parentNode", first: true },
+		" ": { dir: "parentNode" },
+		"+": { dir: "previousSibling", first: true },
+		"~": { dir: "previousSibling" }
+	},
+
+	preFilter: {
+		ATTR: function( match ) {
+			match[ 1 ] = match[ 1 ].replace( runescape, funescape );
+
+			// Move the given value to match[3] whether quoted or unquoted
+			match[ 3 ] = ( match[ 3 ] || match[ 4 ] || match[ 5 ] || "" )
+				.replace( runescape, funescape );
+
+			if ( match[ 2 ] === "~=" ) {
+				match[ 3 ] = " " + match[ 3 ] + " ";
+			}
+
+			return match.slice( 0, 4 );
+		},
+
+		CHILD: function( match ) {
+
+			/* matches from matchExpr["CHILD"]
+				1 type (only|nth|...)
+				2 what (child|of-type)
+				3 argument (even|odd|\d*|\d*n([+-]\d+)?|...)
+				4 xn-component of xn+y argument ([+-]?\d*n|)
+				5 sign of xn-component
+				6 x of xn-component
+				7 sign of y-component
+				8 y of y-component
+			*/
+			match[ 1 ] = match[ 1 ].toLowerCase();
+
+			if ( match[ 1 ].slice( 0, 3 ) === "nth" ) {
+
+				// nth-* requires argument
+				if ( !match[ 3 ] ) {
+					find.error( match[ 0 ] );
+				}
+
+				// numeric x and y parameters for Expr.filter.CHILD
+				// remember that false/true cast respectively to 0/1
+				match[ 4 ] = +( match[ 4 ] ?
+					match[ 5 ] + ( match[ 6 ] || 1 ) :
+					2 * ( match[ 3 ] === "even" || match[ 3 ] === "odd" )
+				);
+				match[ 5 ] = +( ( match[ 7 ] + match[ 8 ] ) || match[ 3 ] === "odd" );
+
+			// other types prohibit arguments
+			} else if ( match[ 3 ] ) {
+				find.error( match[ 0 ] );
+			}
+
+			return match;
+		},
+
+		PSEUDO: function( match ) {
+			var excess,
+				unquoted = !match[ 6 ] && match[ 2 ];
+
+			if ( matchExpr.CHILD.test( match[ 0 ] ) ) {
+				return null;
+			}
+
+			// Accept quoted arguments as-is
+			if ( match[ 3 ] ) {
+				match[ 2 ] = match[ 4 ] || match[ 5 ] || "";
+
+			// Strip excess characters from unquoted arguments
+			} else if ( unquoted && rpseudo.test( unquoted ) &&
+
+				// Get excess from tokenize (recursively)
+				( excess = tokenize( unquoted, true ) ) &&
+
+				// advance to the next closing parenthesis
+				( excess = unquoted.indexOf( ")", unquoted.length - excess ) - unquoted.length ) ) {
+
+				// excess is a negative index
+				match[ 0 ] = match[ 0 ].slice( 0, excess );
+				match[ 2 ] = unquoted.slice( 0, excess );
+			}
+
+			// Return only captures needed by the pseudo filter method (type and argument)
+			return match.slice( 0, 3 );
+		}
+	},
+
+	filter: {
+
+		TAG: function( nodeNameSelector ) {
+			var expectedNodeName = nodeNameSelector.replace( runescape, funescape ).toLowerCase();
+			return nodeNameSelector === "*" ?
+				function() {
+					return true;
+				} :
+				function( elem ) {
+					return nodeName( elem, expectedNodeName );
+				};
+		},
+
+		CLASS: function( className ) {
+			var pattern = classCache[ className + " " ];
+
+			return pattern ||
+				( pattern = new RegExp( "(^|" + whitespace + ")" + className +
+					"(" + whitespace + "|$)" ) ) &&
+				classCache( className, function( elem ) {
+					return pattern.test(
+						typeof elem.className === "string" && elem.className ||
+							typeof elem.getAttribute !== "undefined" &&
+								elem.getAttribute( "class" ) ||
+							""
+					);
+				} );
+		},
+
+		ATTR: function( name, operator, check ) {
+			return function( elem ) {
+				var result = find.attr( elem, name );
+
+				if ( result == null ) {
+					return operator === "!=";
+				}
+				if ( !operator ) {
+					return true;
+				}
+
+				result += "";
+
+				if ( operator === "=" ) {
+					return result === check;
+				}
+				if ( operator === "!=" ) {
+					return result !== check;
+				}
+				if ( operator === "^=" ) {
+					return check && result.indexOf( check ) === 0;
+				}
+				if ( operator === "*=" ) {
+					return check && result.indexOf( check ) > -1;
+				}
+				if ( operator === "$=" ) {
+					return check && result.slice( -check.length ) === check;
+				}
+				if ( operator === "~=" ) {
+					return ( " " + result.replace( rwhitespace, " " ) + " " )
+						.indexOf( check ) > -1;
+				}
+				if ( operator === "|=" ) {
+					return result === check || result.slice( 0, check.length + 1 ) === check + "-";
+				}
+
+				return false;
+			};
+		},
+
+		CHILD: function( type, what, _argument, first, last ) {
+			var simple = type.slice( 0, 3 ) !== "nth",
+				forward = type.slice( -4 ) !== "last",
+				ofType = what === "of-type";
+
+			return first === 1 && last === 0 ?
+
+				// Shortcut for :nth-*(n)
+				function( elem ) {
+					return !!elem.parentNode;
+				} :
+
+				function( elem, _context, xml ) {
+					var cache, outerCache, node, nodeIndex, start,
+						dir = simple !== forward ? "nextSibling" : "previousSibling",
+						parent = elem.parentNode,
+						name = ofType && elem.nodeName.toLowerCase(),
+						useCache = !xml && !ofType,
+						diff = false;
+
+					if ( parent ) {
+
+						// :(first|last|only)-(child|of-type)
+						if ( simple ) {
+							while ( dir ) {
+								node = elem;
+								while ( ( node = node[ dir ] ) ) {
+									if ( ofType ?
+										nodeName( node, name ) :
+										node.nodeType === 1 ) {
+
+										return false;
+									}
+								}
+
+								// Reverse direction for :only-* (if we haven't yet done so)
+								start = dir = type === "only" && !start && "nextSibling";
+							}
+							return true;
+						}
+
+						start = [ forward ? parent.firstChild : parent.lastChild ];
+
+						// non-xml :nth-child(...) stores cache data on `parent`
+						if ( forward && useCache ) {
+
+							// Seek `elem` from a previously-cached index
+							outerCache = parent[ expando ] || ( parent[ expando ] = {} );
+							cache = outerCache[ type ] || [];
+							nodeIndex = cache[ 0 ] === dirruns && cache[ 1 ];
+							diff = nodeIndex && cache[ 2 ];
+							node = nodeIndex && parent.childNodes[ nodeIndex ];
+
+							while ( ( node = ++nodeIndex && node && node[ dir ] ||
+
+								// Fallback to seeking `elem` from the start
+								( diff = nodeIndex = 0 ) || start.pop() ) ) {
+
+								// When found, cache indexes on `parent` and break
+								if ( node.nodeType === 1 && ++diff && node === elem ) {
+									outerCache[ type ] = [ dirruns, nodeIndex, diff ];
+									break;
+								}
+							}
+
+						} else {
+
+							// Use previously-cached element index if available
+							if ( useCache ) {
+								outerCache = elem[ expando ] || ( elem[ expando ] = {} );
+								cache = outerCache[ type ] || [];
+								nodeIndex = cache[ 0 ] === dirruns && cache[ 1 ];
+								diff = nodeIndex;
+							}
+
+							// xml :nth-child(...)
+							// or :nth-last-child(...) or :nth(-last)?-of-type(...)
+							if ( diff === false ) {
+
+								// Use the same loop as above to seek `elem` from the start
+								while ( ( node = ++nodeIndex && node && node[ dir ] ||
+									( diff = nodeIndex = 0 ) || start.pop() ) ) {
+
+									if ( ( ofType ?
+										nodeName( node, name ) :
+										node.nodeType === 1 ) &&
+										++diff ) {
+
+										// Cache the index of each encountered element
+										if ( useCache ) {
+											outerCache = node[ expando ] ||
+												( node[ expando ] = {} );
+											outerCache[ type ] = [ dirruns, diff ];
+										}
+
+										if ( node === elem ) {
+											break;
+										}
+									}
+								}
+							}
+						}
+
+						// Incorporate the offset, then check against cycle size
+						diff -= last;
+						return diff === first || ( diff % first === 0 && diff / first >= 0 );
+					}
+				};
+		},
+
+		PSEUDO: function( pseudo, argument ) {
+
+			// pseudo-class names are case-insensitive
+			// https://www.w3.org/TR/selectors/#pseudo-classes
+			// Prioritize by case sensitivity in case custom pseudos are added with uppercase letters
+			// Remember that setFilters inherits from pseudos
+			var args,
+				fn = Expr.pseudos[ pseudo ] || Expr.setFilters[ pseudo.toLowerCase() ] ||
+					find.error( "unsupported pseudo: " + pseudo );
+
+			// The user may use createPseudo to indicate that
+			// arguments are needed to create the filter function
+			// just as jQuery does
+			if ( fn[ expando ] ) {
+				return fn( argument );
+			}
+
+			// But maintain support for old signatures
+			if ( fn.length > 1 ) {
+				args = [ pseudo, pseudo, "", argument ];
+				return Expr.setFilters.hasOwnProperty( pseudo.toLowerCase() ) ?
+					markFunction( function( seed, matches ) {
+						var idx,
+							matched = fn( seed, argument ),
+							i = matched.length;
+						while ( i-- ) {
+							idx = indexOf.call( seed, matched[ i ] );
+							seed[ idx ] = !( matches[ idx ] = matched[ i ] );
+						}
+					} ) :
+					function( elem ) {
+						return fn( elem, 0, args );
+					};
+			}
+
+			return fn;
+		}
+	},
+
+	pseudos: {
+
+		// Potentially complex pseudos
+		not: markFunction( function( selector ) {
+
+			// Trim the selector passed to compile
+			// to avoid treating leading and trailing
+			// spaces as combinators
+			var input = [],
+				results = [],
+				matcher = compile( selector.replace( rtrimCSS, "$1" ) );
+
+			return matcher[ expando ] ?
+				markFunction( function( seed, matches, _context, xml ) {
+					var elem,
+						unmatched = matcher( seed, null, xml, [] ),
+						i = seed.length;
+
+					// Match elements unmatched by `matcher`
+					while ( i-- ) {
+						if ( ( elem = unmatched[ i ] ) ) {
+							seed[ i ] = !( matches[ i ] = elem );
+						}
+					}
+				} ) :
+				function( elem, _context, xml ) {
+					input[ 0 ] = elem;
+					matcher( input, null, xml, results );
+
+					// Don't keep the element
+					// (see https://github.com/jquery/sizzle/issues/299)
+					input[ 0 ] = null;
+					return !results.pop();
+				};
+		} ),
+
+		has: markFunction( function( selector ) {
+			return function( elem ) {
+				return find( selector, elem ).length > 0;
+			};
+		} ),
+
+		contains: markFunction( function( text ) {
+			text = text.replace( runescape, funescape );
+			return function( elem ) {
+				return ( elem.textContent || jQuery.text( elem ) ).indexOf( text ) > -1;
+			};
+		} ),
+
+		// "Whether an element is represented by a :lang() selector
+		// is based solely on the element's language value
+		// being equal to the identifier C,
+		// or beginning with the identifier C immediately followed by "-".
+		// The matching of C against the element's language value is performed case-insensitively.
+		// The identifier C does not have to be a valid language name."
+		// https://www.w3.org/TR/selectors/#lang-pseudo
+		lang: markFunction( function( lang ) {
+
+			// lang value must be a valid identifier
+			if ( !ridentifier.test( lang || "" ) ) {
+				find.error( "unsupported lang: " + lang );
+			}
+			lang = lang.replace( runescape, funescape ).toLowerCase();
+			return function( elem ) {
+				var elemLang;
+				do {
+					if ( ( elemLang = documentIsHTML ?
+						elem.lang :
+						elem.getAttribute( "xml:lang" ) || elem.getAttribute( "lang" ) ) ) {
+
+						elemLang = elemLang.toLowerCase();
+						return elemLang === lang || elemLang.indexOf( lang + "-" ) === 0;
+					}
+				} while ( ( elem = elem.parentNode ) && elem.nodeType === 1 );
+				return false;
+			};
+		} ),
+
+		// Miscellaneous
+		target: function( elem ) {
+			var hash = window.location && window.location.hash;
+			return hash && hash.slice( 1 ) === elem.id;
+		},
+
+		root: function( elem ) {
+			return elem === documentElement;
+		},
+
+		focus: function( elem ) {
+			return elem === safeActiveElement() &&
+				document.hasFocus() &&
+				!!( elem.type || elem.href || ~elem.tabIndex );
+		},
+
+		// Boolean properties
+		enabled: createDisabledPseudo( false ),
+		disabled: createDisabledPseudo( true ),
+
+		checked: function( elem ) {
+
+			// In CSS3, :checked should return both checked and selected elements
+			// https://www.w3.org/TR/2011/REC-css3-selectors-20110929/#checked
+			return ( nodeName( elem, "input" ) && !!elem.checked ) ||
+				( nodeName( elem, "option" ) && !!elem.selected );
+		},
+
+		selected: function( elem ) {
+
+			// Support: IE <=11+
+			// Accessing the selectedIndex property
+			// forces the browser to treat the default option as
+			// selected when in an optgroup.
+			if ( elem.parentNode ) {
+				// eslint-disable-next-line no-unused-expressions
+				elem.parentNode.selectedIndex;
+			}
+
+			return elem.selected === true;
+		},
+
+		// Contents
+		empty: function( elem ) {
+
+			// https://www.w3.org/TR/selectors/#empty-pseudo
+			// :empty is negated by element (1) or content nodes (text: 3; cdata: 4; entity ref: 5),
+			//   but not by others (comment: 8; processing instruction: 7; etc.)
+			// nodeType < 6 works because attributes (2) do not appear as children
+			for ( elem = elem.firstChild; elem; elem = elem.nextSibling ) {
+				if ( elem.nodeType < 6 ) {
+					return false;
+				}
+			}
+			return true;
+		},
+
+		parent: function( elem ) {
+			return !Expr.pseudos.empty( elem );
+		},
+
+		// Element/input types
+		header: function( elem ) {
+			return rheader.test( elem.nodeName );
+		},
+
+		input: function( elem ) {
+			return rinputs.test( elem.nodeName );
+		},
+
+		button: function( elem ) {
+			return nodeName( elem, "input" ) && elem.type === "button" ||
+				nodeName( elem, "button" );
+		},
+
+		text: function( elem ) {
+			var attr;
+			return nodeName( elem, "input" ) && elem.type === "text" &&
+
+				// Support: IE <10 only
+				// New HTML5 attribute values (e.g., "search") appear
+				// with elem.type === "text"
+				( ( attr = elem.getAttribute( "type" ) ) == null ||
+					attr.toLowerCase() === "text" );
+		},
+
+		// Position-in-collection
+		first: createPositionalPseudo( function() {
+			return [ 0 ];
+		} ),
+
+		last: createPositionalPseudo( function( _matchIndexes, length ) {
+			return [ length - 1 ];
+		} ),
+
+		eq: createPositionalPseudo( function( _matchIndexes, length, argument ) {
+			return [ argument < 0 ? argument + length : argument ];
+		} ),
+
+		even: createPositionalPseudo( function( matchIndexes, length ) {
+			var i = 0;
+			for ( ; i < length; i += 2 ) {
+				matchIndexes.push( i );
+			}
+			return matchIndexes;
+		} ),
+
+		odd: createPositionalPseudo( function( matchIndexes, length ) {
+			var i = 1;
+			for ( ; i < length; i += 2 ) {
+				matchIndexes.push( i );
+			}
+			return matchIndexes;
+		} ),
+
+		lt: createPositionalPseudo( function( matchIndexes, length, argument ) {
+			var i;
+
+			if ( argument < 0 ) {
+				i = argument + length;
+			} else if ( argument > length ) {
+				i = length;
+			} else {
+				i = argument;
+			}
+
+			for ( ; --i >= 0; ) {
+				matchIndexes.push( i );
+			}
+			return matchIndexes;
+		} ),
+
+		gt: createPositionalPseudo( function( matchIndexes, length, argument ) {
+			var i = argument < 0 ? argument + length : argument;
+			for ( ; ++i < length; ) {
+				matchIndexes.push( i );
+			}
+			return matchIndexes;
+		} )
+	}
+};
+
+Expr.pseudos.nth = Expr.pseudos.eq;
+
+// Add button/input type pseudos
+for ( i in { radio: true, checkbox: true, file: true, password: true, image: true } ) {
+	Expr.pseudos[ i ] = createInputPseudo( i );
+}
+for ( i in { submit: true, reset: true } ) {
+	Expr.pseudos[ i ] = createButtonPseudo( i );
+}
+
+// Easy API for creating new setFilters
+function setFilters() {}
+setFilters.prototype = Expr.filters = Expr.pseudos;
+Expr.setFilters = new setFilters();
+
+function tokenize( selector, parseOnly ) {
+	var matched, match, tokens, type,
+		soFar, groups, preFilters,
+		cached = tokenCache[ selector + " " ];
+
+	if ( cached ) {
+		return parseOnly ? 0 : cached.slice( 0 );
+	}
+
+	soFar = selector;
+	groups = [];
+	preFilters = Expr.preFilter;
+
+	while ( soFar ) {
+
+		// Comma and first run
+		if ( !matched || ( match = rcomma.exec( soFar ) ) ) {
+			if ( match ) {
+
+				// Don't consume trailing commas as valid
+				soFar = soFar.slice( match[ 0 ].length ) || soFar;
+			}
+			groups.push( ( tokens = [] ) );
+		}
+
+		matched = false;
+
+		// Combinators
+		if ( ( match = rleadingCombinator.exec( soFar ) ) ) {
+			matched = match.shift();
+			tokens.push( {
+				value: matched,
+
+				// Cast descendant combinators to space
+				type: match[ 0 ].replace( rtrimCSS, " " )
+			} );
+			soFar = soFar.slice( matched.length );
+		}
+
+		// Filters
+		for ( type in Expr.filter ) {
+			if ( ( match = matchExpr[ type ].exec( soFar ) ) && ( !preFilters[ type ] ||
+				( match = preFilters[ type ]( match ) ) ) ) {
+				matched = match.shift();
+				tokens.push( {
+					value: matched,
+					type: type,
+					matches: match
+				} );
+				soFar = soFar.slice( matched.length );
+			}
+		}
+
+		if ( !matched ) {
+			break;
+		}
+	}
+
+	// Return the length of the invalid excess
+	// if we're just parsing
+	// Otherwise, throw an error or return tokens
+	if ( parseOnly ) {
+		return soFar.length;
+	}
+
+	return soFar ?
+		find.error( selector ) :
+
+		// Cache the tokens
+		tokenCache( selector, groups ).slice( 0 );
+}
+
+function toSelector( tokens ) {
+	var i = 0,
+		len = tokens.length,
+		selector = "";
+	for ( ; i < len; i++ ) {
+		selector += tokens[ i ].value;
+	}
+	return selector;
+}
+
+function addCombinator( matcher, combinator, base ) {
+	var dir = combinator.dir,
+		skip = combinator.next,
+		key = skip || dir,
+		checkNonElements = base && key === "parentNode",
+		doneName = done++;
+
+	return combinator.first ?
+
+		// Check against closest ancestor/preceding element
+		function( elem, context, xml ) {
+			while ( ( elem = elem[ dir ] ) ) {
+				if ( elem.nodeType === 1 || checkNonElements ) {
+					return matcher( elem, context, xml );
+				}
+			}
+			return false;
+		} :
+
+		// Check against all ancestor/preceding elements
+		function( elem, context, xml ) {
+			var oldCache, outerCache,
+				newCache = [ dirruns, doneName ];
+
+			// We can't set arbitrary data on XML nodes, so they don't benefit from combinator caching
+			if ( xml ) {
+				while ( ( elem = elem[ dir ] ) ) {
+					if ( elem.nodeType === 1 || checkNonElements ) {
+						if ( matcher( elem, context, xml ) ) {
+							return true;
+						}
+					}
+				}
+			} else {
+				while ( ( elem = elem[ dir ] ) ) {
+					if ( elem.nodeType === 1 || checkNonElements ) {
+						outerCache = elem[ expando ] || ( elem[ expando ] = {} );
+
+						if ( skip && nodeName( elem, skip ) ) {
+							elem = elem[ dir ] || elem;
+						} else if ( ( oldCache = outerCache[ key ] ) &&
+							oldCache[ 0 ] === dirruns && oldCache[ 1 ] === doneName ) {
+
+							// Assign to newCache so results back-propagate to previous elements
+							return ( newCache[ 2 ] = oldCache[ 2 ] );
+						} else {
+
+							// Reuse newcache so results back-propagate to previous elements
+							outerCache[ key ] = newCache;
+
+							// A match means we're done; a fail means we have to keep checking
+							if ( ( newCache[ 2 ] = matcher( elem, context, xml ) ) ) {
+								return true;
+							}
+						}
+					}
+				}
+			}
+			return false;
+		};
+}
+
+function elementMatcher( matchers ) {
+	return matchers.length > 1 ?
+		function( elem, context, xml ) {
+			var i = matchers.length;
+			while ( i-- ) {
+				if ( !matchers[ i ]( elem, context, xml ) ) {
+					return false;
+				}
+			}
+			return true;
+		} :
+		matchers[ 0 ];
+}
+
+function multipleContexts( selector, contexts, results ) {
+	var i = 0,
+		len = contexts.length;
+	for ( ; i < len; i++ ) {
+		find( selector, contexts[ i ], results );
+	}
+	return results;
+}
+
+function condense( unmatched, map, filter, context, xml ) {
+	var elem,
+		newUnmatched = [],
+		i = 0,
+		len = unmatched.length,
+		mapped = map != null;
+
+	for ( ; i < len; i++ ) {
+		if ( ( elem = unmatched[ i ] ) ) {
+			if ( !filter || filter( elem, context, xml ) ) {
+				newUnmatched.push( elem );
+				if ( mapped ) {
+					map.push( i );
+				}
+			}
+		}
+	}
+
+	return newUnmatched;
+}
+
+function setMatcher( preFilter, selector, matcher, postFilter, postFinder, postSelector ) {
+	if ( postFilter && !postFilter[ expando ] ) {
+		postFilter = setMatcher( postFilter );
+	}
+	if ( postFinder && !postFinder[ expando ] ) {
+		postFinder = setMatcher( postFinder, postSelector );
+	}
+	return markFunction( function( seed, results, context, xml ) {
+		var temp, i, elem, matcherOut,
+			preMap = [],
+			postMap = [],
+			preexisting = results.length,
+
+			// Get initial elements from seed or context
+			elems = seed ||
+				multipleContexts( selector || "*",
+					context.nodeType ? [ context ] : context, [] ),
+
+			// Prefilter to get matcher input, preserving a map for seed-results synchronization
+			matcherIn = preFilter && ( seed || !selector ) ?
+				condense( elems, preMap, preFilter, context, xml ) :
+				elems;
+
+		if ( matcher ) {
+
+			// If we have a postFinder, or filtered seed, or non-seed postFilter
+			// or preexisting results,
+			matcherOut = postFinder || ( seed ? preFilter : preexisting || postFilter ) ?
+
+				// ...intermediate processing is necessary
+				[] :
+
+				// ...otherwise use results directly
+				results;
+
+			// Find primary matches
+			matcher( matcherIn, matcherOut, context, xml );
+		} else {
+			matcherOut = matcherIn;
+		}
+
+		// Apply postFilter
+		if ( postFilter ) {
+			temp = condense( matcherOut, postMap );
+			postFilter( temp, [], context, xml );
+
+			// Un-match failing elements by moving them back to matcherIn
+			i = temp.length;
+			while ( i-- ) {
+				if ( ( elem = temp[ i ] ) ) {
+					matcherOut[ postMap[ i ] ] = !( matcherIn[ postMap[ i ] ] = elem );
+				}
+			}
+		}
+
+		if ( seed ) {
+			if ( postFinder || preFilter ) {
+				if ( postFinder ) {
+
+					// Get the final matcherOut by condensing this intermediate into postFinder contexts
+					temp = [];
+					i = matcherOut.length;
+					while ( i-- ) {
+						if ( ( elem = matcherOut[ i ] ) ) {
+
+							// Restore matcherIn since elem is not yet a final match
+							temp.push( ( matcherIn[ i ] = elem ) );
+						}
+					}
+					postFinder( null, ( matcherOut = [] ), temp, xml );
+				}
+
+				// Move matched elements from seed to results to keep them synchronized
+				i = matcherOut.length;
+				while ( i-- ) {
+					if ( ( elem = matcherOut[ i ] ) &&
+						( temp = postFinder ? indexOf.call( seed, elem ) : preMap[ i ] ) > -1 ) {
+
+						seed[ temp ] = !( results[ temp ] = elem );
+					}
+				}
+			}
+
+		// Add elements to results, through postFinder if defined
+		} else {
+			matcherOut = condense(
+				matcherOut === results ?
+					matcherOut.splice( preexisting, matcherOut.length ) :
+					matcherOut
+			);
+			if ( postFinder ) {
+				postFinder( null, results, matcherOut, xml );
+			} else {
+				push.apply( results, matcherOut );
+			}
+		}
+	} );
+}
+
+function matcherFromTokens( tokens ) {
+	var checkContext, matcher, j,
+		len = tokens.length,
+		leadingRelative = Expr.relative[ tokens[ 0 ].type ],
+		implicitRelative = leadingRelative || Expr.relative[ " " ],
+		i = leadingRelative ? 1 : 0,
+
+		// The foundational matcher ensures that elements are reachable from top-level context(s)
+		matchContext = addCombinator( function( elem ) {
+			return elem === checkContext;
+		}, implicitRelative, true ),
+		matchAnyContext = addCombinator( function( elem ) {
+			return indexOf.call( checkContext, elem ) > -1;
+		}, implicitRelative, true ),
+		matchers = [ function( elem, context, xml ) {
+
+			// Support: IE 11+, Edge 17 - 18+
+			// IE/Edge sometimes throw a "Permission denied" error when strict-comparing
+			// two documents; shallow comparisons work.
+			// eslint-disable-next-line eqeqeq
+			var ret = ( !leadingRelative && ( xml || context != outermostContext ) ) || (
+				( checkContext = context ).nodeType ?
+					matchContext( elem, context, xml ) :
+					matchAnyContext( elem, context, xml ) );
+
+			// Avoid hanging onto element
+			// (see https://github.com/jquery/sizzle/issues/299)
+			checkContext = null;
+			return ret;
+		} ];
+
+	for ( ; i < len; i++ ) {
+		if ( ( matcher = Expr.relative[ tokens[ i ].type ] ) ) {
+			matchers = [ addCombinator( elementMatcher( matchers ), matcher ) ];
+		} else {
+			matcher = Expr.filter[ tokens[ i ].type ].apply( null, tokens[ i ].matches );
+
+			// Return special upon seeing a positional matcher
+			if ( matcher[ expando ] ) {
+
+				// Find the next relative operator (if any) for proper handling
+				j = ++i;
+				for ( ; j < len; j++ ) {
+					if ( Expr.relative[ tokens[ j ].type ] ) {
+						break;
+					}
+				}
+				return setMatcher(
+					i > 1 && elementMatcher( matchers ),
+					i > 1 && toSelector(
+
+						// If the preceding token was a descendant combinator, insert an implicit any-element `*`
+						tokens.slice( 0, i - 1 )
+							.concat( { value: tokens[ i - 2 ].type === " " ? "*" : "" } )
+					).replace( rtrimCSS, "$1" ),
+					matcher,
+					i < j && matcherFromTokens( tokens.slice( i, j ) ),
+					j < len && matcherFromTokens( ( tokens = tokens.slice( j ) ) ),
+					j < len && toSelector( tokens )
+				);
+			}
+			matchers.push( matcher );
+		}
+	}
+
+	return elementMatcher( matchers );
+}
+
+function matcherFromGroupMatchers( elementMatchers, setMatchers ) {
+	var bySet = setMatchers.length > 0,
+		byElement = elementMatchers.length > 0,
+		superMatcher = function( seed, context, xml, results, outermost ) {
+			var elem, j, matcher,
+				matchedCount = 0,
+				i = "0",
+				unmatched = seed && [],
+				setMatched = [],
+				contextBackup = outermostContext,
+
+				// We must always have either seed elements or outermost context
+				elems = seed || byElement && Expr.find.TAG( "*", outermost ),
+
+				// Use integer dirruns iff this is the outermost matcher
+				dirrunsUnique = ( dirruns += contextBackup == null ? 1 : Math.random() || 0.1 ),
+				len = elems.length;
+
+			if ( outermost ) {
+
+				// Support: IE 11+, Edge 17 - 18+
+				// IE/Edge sometimes throw a "Permission denied" error when strict-comparing
+				// two documents; shallow comparisons work.
+				// eslint-disable-next-line eqeqeq
+				outermostContext = context == document || context || outermost;
+			}
+
+			// Add elements passing elementMatchers directly to results
+			// Support: iOS <=7 - 9 only
+			// Tolerate NodeList properties (IE: "length"; Safari: <number>) matching
+			// elements by id. (see trac-14142)
+			for ( ; i !== len && ( elem = elems[ i ] ) != null; i++ ) {
+				if ( byElement && elem ) {
+					j = 0;
+
+					// Support: IE 11+, Edge 17 - 18+
+					// IE/Edge sometimes throw a "Permission denied" error when strict-comparing
+					// two documents; shallow comparisons work.
+					// eslint-disable-next-line eqeqeq
+					if ( !context && elem.ownerDocument != document ) {
+						setDocument( elem );
+						xml = !documentIsHTML;
+					}
+					while ( ( matcher = elementMatchers[ j++ ] ) ) {
+						if ( matcher( elem, context || document, xml ) ) {
+							push.call( results, elem );
+							break;
+						}
+					}
+					if ( outermost ) {
+						dirruns = dirrunsUnique;
+					}
+				}
+
+				// Track unmatched elements for set filters
+				if ( bySet ) {
+
+					// They will have gone through all possible matchers
+					if ( ( elem = !matcher && elem ) ) {
+						matchedCount--;
+					}
+
+					// Lengthen the array for every element, matched or not
+					if ( seed ) {
+						unmatched.push( elem );
+					}
+				}
+			}
+
+			// `i` is now the count of elements visited above, and adding it to `matchedCount`
+			// makes the latter nonnegative.
+			matchedCount += i;
+
+			// Apply set filters to unmatched elements
+			// NOTE: This can be skipped if there are no unmatched elements (i.e., `matchedCount`
+			// equals `i`), unless we didn't visit _any_ elements in the above loop because we have
+			// no element matchers and no seed.
+			// Incrementing an initially-string "0" `i` allows `i` to remain a string only in that
+			// case, which will result in a "00" `matchedCount` that differs from `i` but is also
+			// numerically zero.
+			if ( bySet && i !== matchedCount ) {
+				j = 0;
+				while ( ( matcher = setMatchers[ j++ ] ) ) {
+					matcher( unmatched, setMatched, context, xml );
+				}
+
+				if ( seed ) {
+
+					// Reintegrate element matches to eliminate the need for sorting
+					if ( matchedCount > 0 ) {
+						while ( i-- ) {
+							if ( !( unmatched[ i ] || setMatched[ i ] ) ) {
+								setMatched[ i ] = pop.call( results );
+							}
+						}
+					}
+
+					// Discard index placeholder values to get only actual matches
+					setMatched = condense( setMatched );
+				}
+
+				// Add matches to results
+				push.apply( results, setMatched );
+
+				// Seedless set matches succeeding multiple successful matchers stipulate sorting
+				if ( outermost && !seed && setMatched.length > 0 &&
+					( matchedCount + setMatchers.length ) > 1 ) {
+
+					jQuery.uniqueSort( results );
+				}
+			}
+
+			// Override manipulation of globals by nested matchers
+			if ( outermost ) {
+				dirruns = dirrunsUnique;
+				outermostContext = contextBackup;
+			}
+
+			return unmatched;
+		};
+
+	return bySet ?
+		markFunction( superMatcher ) :
+		superMatcher;
+}
+
+function compile( selector, match /* Internal Use Only */ ) {
+	var i,
+		setMatchers = [],
+		elementMatchers = [],
+		cached = compilerCache[ selector + " " ];
+
+	if ( !cached ) {
+
+		// Generate a function of recursive functions that can be used to check each element
+		if ( !match ) {
+			match = tokenize( selector );
+		}
+		i = match.length;
+		while ( i-- ) {
+			cached = matcherFromTokens( match[ i ] );
+			if ( cached[ expando ] ) {
+				setMatchers.push( cached );
+			} else {
+				elementMatchers.push( cached );
+			}
+		}
+
+		// Cache the compiled function
+		cached = compilerCache( selector,
+			matcherFromGroupMatchers( elementMatchers, setMatchers ) );
+
+		// Save selector and tokenization
+		cached.selector = selector;
+	}
+	return cached;
+}
+
+/**
+ * A low-level selection function that works with jQuery's compiled
+ *  selector functions
+ * @param {String|Function} selector A selector or a pre-compiled
+ *  selector function built with jQuery selector compile
+ * @param {Element} context
+ * @param {Array} [results]
+ * @param {Array} [seed] A set of elements to match against
+ */
+function select( selector, context, results, seed ) {
+	var i, tokens, token, type, find,
+		compiled = typeof selector === "function" && selector,
+		match = !seed && tokenize( ( selector = compiled.selector || selector ) );
+
+	results = results || [];
+
+	// Try to minimize operations if there is only one selector in the list and no seed
+	// (the latter of which guarantees us context)
+	if ( match.length === 1 ) {
+
+		// Reduce context if the leading compound selector is an ID
+		tokens = match[ 0 ] = match[ 0 ].slice( 0 );
+		if ( tokens.length > 2 && ( token = tokens[ 0 ] ).type === "ID" &&
+				context.nodeType === 9 && documentIsHTML && Expr.relative[ tokens[ 1 ].type ] ) {
+
+			context = ( Expr.find.ID(
+				token.matches[ 0 ].replace( runescape, funescape ),
+				context
+			) || [] )[ 0 ];
+			if ( !context ) {
+				return results;
+
+			// Precompiled matchers will still verify ancestry, so step up a level
+			} else if ( compiled ) {
+				context = context.parentNode;
+			}
+
+			selector = selector.slice( tokens.shift().value.length );
+		}
+
+		// Fetch a seed set for right-to-left matching
+		i = matchExpr.needsContext.test( selector ) ? 0 : tokens.length;
+		while ( i-- ) {
+			token = tokens[ i ];
+
+			// Abort if we hit a combinator
+			if ( Expr.relative[ ( type = token.type ) ] ) {
+				break;
+			}
+			if ( ( find = Expr.find[ type ] ) ) {
+
+				// Search, expanding context for leading sibling combinators
+				if ( ( seed = find(
+					token.matches[ 0 ].replace( runescape, funescape ),
+					rsibling.test( tokens[ 0 ].type ) &&
+						testContext( context.parentNode ) || context
+				) ) ) {
+
+					// If seed is empty or no tokens remain, we can return early
+					tokens.splice( i, 1 );
+					selector = seed.length && toSelector( tokens );
+					if ( !selector ) {
+						push.apply( results, seed );
+						return results;
+					}
+
+					break;
+				}
+			}
+		}
+	}
+
+	// Compile and execute a filtering function if one is not provided
+	// Provide `match` to avoid retokenization if we modified the selector above
+	( compiled || compile( selector, match ) )(
+		seed,
+		context,
+		!documentIsHTML,
+		results,
+		!context || rsibling.test( selector ) && testContext( context.parentNode ) || context
+	);
+	return results;
+}
+
+// One-time assignments
+
+// Support: Android <=4.0 - 4.1+
+// Sort stability
+support.sortStable = expando.split( "" ).sort( sortOrder ).join( "" ) === expando;
+
+// Initialize against the default document
+setDocument();
+
+// Support: Android <=4.0 - 4.1+
+// Detached nodes confoundingly follow *each other*
+support.sortDetached = assert( function( el ) {
+
+	// Should return 1, but returns 4 (following)
+	return el.compareDocumentPosition( document.createElement( "fieldset" ) ) & 1;
+} );
+
+jQuery.find = find;
+
+// Deprecated
+jQuery.expr[ ":" ] = jQuery.expr.pseudos;
+jQuery.unique = jQuery.uniqueSort;
+
+// These have always been private, but they used to be documented as part of
+// Sizzle so let's maintain them for now for backwards compatibility purposes.
+find.compile = compile;
+find.select = select;
+find.setDocument = setDocument;
+find.tokenize = tokenize;
+
+find.escape = jQuery.escapeSelector;
+find.getText = jQuery.text;
+find.isXML = jQuery.isXMLDoc;
+find.selectors = jQuery.expr;
+find.support = jQuery.support;
+find.uniqueSort = jQuery.uniqueSort;
+
+	/* eslint-enable */
+
+} )();
+
+
+var dir = function( elem, dir, until ) {
+	var matched = [],
+		truncate = until !== undefined;
+
+	while ( ( elem = elem[ dir ] ) && elem.nodeType !== 9 ) {
+		if ( elem.nodeType === 1 ) {
+			if ( truncate && jQuery( elem ).is( until ) ) {
+				break;
+			}
+			matched.push( elem );
+		}
+	}
+	return matched;
+};
+
+
+var siblings = function( n, elem ) {
+	var matched = [];
+
+	for ( ; n; n = n.nextSibling ) {
+		if ( n.nodeType === 1 && n !== elem ) {
+			matched.push( n );
+		}
+	}
+
+	return matched;
+};
+
+
+var rneedsContext = jQuery.expr.match.needsContext;
+
+var rsingleTag = ( /^<([a-z][^\/\0>:\x20\t\r\n\f]*)[\x20\t\r\n\f]*\/?>(?:<\/\1>|)$/i );
+
+
+
+// Implement the identical functionality for filter and not
+function winnow( elements, qualifier, not ) {
+	if ( isFunction( qualifier ) ) {
+		return jQuery.grep( elements, function( elem, i ) {
+			return !!qualifier.call( elem, i, elem ) !== not;
+		} );
+	}
+
+	// Single element
+	if ( qualifier.nodeType ) {
+		return jQuery.grep( elements, function( elem ) {
+			return ( elem === qualifier ) !== not;
+		} );
+	}
+
+	// Arraylike of elements (jQuery, arguments, Array)
+	if ( typeof qualifier !== "string" ) {
+		return jQuery.grep( elements, function( elem ) {
+			return ( indexOf.call( qualifier, elem ) > -1 ) !== not;
+		} );
+	}
+
+	// Filtered directly for both simple and complex selectors
+	return jQuery.filter( qualifier, elements, not );
+}
+
+jQuery.filter = function( expr, elems, not ) {
+	var elem = elems[ 0 ];
+
+	if ( not ) {
+		expr = ":not(" + expr + ")";
+	}
+
+	if ( elems.length === 1 && elem.nodeType === 1 ) {
+		return jQuery.find.matchesSelector( elem, expr ) ? [ elem ] : [];
+	}
+
+	return jQuery.find.matches( expr, jQuery.grep( elems, function( elem ) {
+		return elem.nodeType === 1;
+	} ) );
+};
+
+jQuery.fn.extend( {
+	find: function( selector ) {
+		var i, ret,
+			len = this.length,
+			self = this;
+
+		if ( typeof selector !== "string" ) {
+			return this.pushStack( jQuery( selector ).filter( function() {
+				for ( i = 0; i < len; i++ ) {
+					if ( jQuery.contains( self[ i ], this ) ) {
+						return true;
+					}
+				}
+			} ) );
+		}
+
+		ret = this.pushStack( [] );
+
+		for ( i = 0; i < len; i++ ) {
+			jQuery.find( selector, self[ i ], ret );
+		}
+
+		return len > 1 ? jQuery.uniqueSort( ret ) : ret;
+	},
+	filter: function( selector ) {
+		return this.pushStack( winnow( this, selector || [], false ) );
+	},
+	not: function( selector ) {
+		return this.pushStack( winnow( this, selector || [], true ) );
+	},
+	is: function( selector ) {
+		return !!winnow(
+			this,
+
+			// If this is a positional/relative selector, check membership in the returned set
+			// so $("p:first").is("p:last") won't return true for a doc with two "p".
+			typeof selector === "string" && rneedsContext.test( selector ) ?
+				jQuery( selector ) :
+				selector || [],
+			false
+		).length;
+	}
+} );
+
+
+// Initialize a jQuery object
+
+
+// A central reference to the root jQuery(document)
+var rootjQuery,
+
+	// A simple way to check for HTML strings
+	// Prioritize #id over <tag> to avoid XSS via location.hash (trac-9521)
+	// Strict HTML recognition (trac-11290: must start with <)
+	// Shortcut simple #id case for speed
+	rquickExpr = /^(?:\s*(<[\w\W]+>)[^>]*|#([\w-]+))$/,
+
+	init = jQuery.fn.init = function( selector, context, root ) {
+		var match, elem;
+
+		// HANDLE: $(""), $(null), $(undefined), $(false)
+		if ( !selector ) {
+			return this;
+		}
+
+		// Method init() accepts an alternate rootjQuery
+		// so migrate can support jQuery.sub (gh-2101)
+		root = root || rootjQuery;
+
+		// Handle HTML strings
+		if ( typeof selector === "string" ) {
+			if ( selector[ 0 ] === "<" &&
+				selector[ selector.length - 1 ] === ">" &&
+				selector.length >= 3 ) {
+
+				// Assume that strings that start and end with <> are HTML and skip the regex check
+				match = [ null, selector, null ];
+
+			} else {
+				match = rquickExpr.exec( selector );
+			}
+
+			// Match html or make sure no context is specified for #id
+			if ( match && ( match[ 1 ] || !context ) ) {
+
+				// HANDLE: $(html) -> $(array)
+				if ( match[ 1 ] ) {
+					context = context instanceof jQuery ? context[ 0 ] : context;
+
+					// Option to run scripts is true for back-compat
+					// Intentionally let the error be thrown if parseHTML is not present
+					jQuery.merge( this, jQuery.parseHTML(
+						match[ 1 ],
+						context && context.nodeType ? context.ownerDocument || context : document,
+						true
+					) );
+
+					// HANDLE: $(html, props)
+					if ( rsingleTag.test( match[ 1 ] ) && jQuery.isPlainObject( context ) ) {
+						for ( match in context ) {
+
+							// Properties of context are called as methods if possible
+							if ( isFunction( this[ match ] ) ) {
+								this[ match ]( context[ match ] );
+
+							// ...and otherwise set as attributes
+							} else {
+								this.attr( match, context[ match ] );
+							}
+						}
+					}
+
+					return this;
+
+				// HANDLE: $(#id)
+				} else {
+					elem = document.getElementById( match[ 2 ] );
+
+					if ( elem ) {
+
+						// Inject the element directly into the jQuery object
+						this[ 0 ] = elem;
+						this.length = 1;
+					}
+					return this;
+				}
+
+			// HANDLE: $(expr, $(...))
+			} else if ( !context || context.jquery ) {
+				return ( context || root ).find( selector );
+
+			// HANDLE: $(expr, context)
+			// (which is just equivalent to: $(context).find(expr)
+			} else {
+				return this.constructor( context ).find( selector );
+			}
+
+		// HANDLE: $(DOMElement)
+		} else if ( selector.nodeType ) {
+			this[ 0 ] = selector;
+			this.length = 1;
+			return this;
+
+		// HANDLE: $(function)
+		// Shortcut for document ready
+		} else if ( isFunction( selector ) ) {
+			return root.ready !== undefined ?
+				root.ready( selector ) :
+
+				// Execute immediately if ready is not present
+				selector( jQuery );
+		}
+
+		return jQuery.makeArray( selector, this );
+	};
+
+// Give the init function the jQuery prototype for later instantiation
+init.prototype = jQuery.fn;
+
+// Initialize central reference
+rootjQuery = jQuery( document );
+
+
+var rparentsprev = /^(?:parents|prev(?:Until|All))/,
+
+	// Methods guaranteed to produce a unique set when starting from a unique set
+	guaranteedUnique = {
+		children: true,
+		contents: true,
+		next: true,
+		prev: true
+	};
+
+jQuery.fn.extend( {
+	has: function( target ) {
+		var targets = jQuery( target, this ),
+			l = targets.length;
+
+		return this.filter( function() {
+			var i = 0;
+			for ( ; i < l; i++ ) {
+				if ( jQuery.contains( this, targets[ i ] ) ) {
+					return true;
+				}
+			}
+		} );
+	},
+
+	closest: function( selectors, context ) {
+		var cur,
+			i = 0,
+			l = this.length,
+			matched = [],
+			targets = typeof selectors !== "string" && jQuery( selectors );
+
+		// Positional selectors never match, since there's no _selection_ context
+		if ( !rneedsContext.test( selectors ) ) {
+			for ( ; i < l; i++ ) {
+				for ( cur = this[ i ]; cur && cur !== context; cur = cur.parentNode ) {
+
+					// Always skip document fragments
+					if ( cur.nodeType < 11 && ( targets ?
+						targets.index( cur ) > -1 :
+
+						// Don't pass non-elements to jQuery#find
+						cur.nodeType === 1 &&
+							jQuery.find.matchesSelector( cur, selectors ) ) ) {
+
+						matched.push( cur );
+						break;
+					}
+				}
+			}
+		}
+
+		return this.pushStack( matched.length > 1 ? jQuery.uniqueSort( matched ) : matched );
+	},
+
+	// Determine the position of an element within the set
+	index: function( elem ) {
+
+		// No argument, return index in parent
+		if ( !elem ) {
+			return ( this[ 0 ] && this[ 0 ].parentNode ) ? this.first().prevAll().length : -1;
+		}
+
+		// Index in selector
+		if ( typeof elem === "string" ) {
+			return indexOf.call( jQuery( elem ), this[ 0 ] );
+		}
+
+		// Locate the position of the desired element
+		return indexOf.call( this,
+
+			// If it receives a jQuery object, the first element is used
+			elem.jquery ? elem[ 0 ] : elem
+		);
+	},
+
+	add: function( selector, context ) {
+		return this.pushStack(
+			jQuery.uniqueSort(
+				jQuery.merge( this.get(), jQuery( selector, context ) )
+			)
+		);
+	},
+
+	addBack: function( selector ) {
+		return this.add( selector == null ?
+			this.prevObject : this.prevObject.filter( selector )
+		);
+	}
+} );
+
+function sibling( cur, dir ) {
+	while ( ( cur = cur[ dir ] ) && cur.nodeType !== 1 ) {}
+	return cur;
+}
+
+jQuery.each( {
+	parent: function( elem ) {
+		var parent = elem.parentNode;
+		return parent && parent.nodeType !== 11 ? parent : null;
+	},
+	parents: function( elem ) {
+		return dir( elem, "parentNode" );
+	},
+	parentsUntil: function( elem, _i, until ) {
+		return dir( elem, "parentNode", until );
+	},
+	next: function( elem ) {
+		return sibling( elem, "nextSibling" );
+	},
+	prev: function( elem ) {
+		return sibling( elem, "previousSibling" );
+	},
+	nextAll: function( elem ) {
+		return dir( elem, "nextSibling" );
+	},
+	prevAll: function( elem ) {
+		return dir( elem, "previousSibling" );
+	},
+	nextUntil: function( elem, _i, until ) {
+		return dir( elem, "nextSibling", until );
+	},
+	prevUntil: function( elem, _i, until ) {
+		return dir( elem, "previousSibling", until );
+	},
+	siblings: function( elem ) {
+		return siblings( ( elem.parentNode || {} ).firstChild, elem );
+	},
+	children: function( elem ) {
+		return siblings( elem.firstChild );
+	},
+	contents: function( elem ) {
+		if ( elem.contentDocument != null &&
+
+			// Support: IE 11+
+			// <object> elements with no `data` attribute has an object
+			// `contentDocument` with a `null` prototype.
+			getProto( elem.contentDocument ) ) {
+
+			return elem.contentDocument;
+		}
+
+		// Support: IE 9 - 11 only, iOS 7 only, Android Browser <=4.3 only
+		// Treat the template element as a regular one in browsers that
+		// don't support it.
+		if ( nodeName( elem, "template" ) ) {
+			elem = elem.content || elem;
+		}
+
+		return jQuery.merge( [], elem.childNodes );
+	}
+}, function( name, fn ) {
+	jQuery.fn[ name ] = function( until, selector ) {
+		var matched = jQuery.map( this, fn, until );
+
+		if ( name.slice( -5 ) !== "Until" ) {
+			selector = until;
+		}
+
+		if ( selector && typeof selector === "string" ) {
+			matched = jQuery.filter( selector, matched );
+		}
+
+		if ( this.length > 1 ) {
+
+			// Remove duplicates
+			if ( !guaranteedUnique[ name ] ) {
+				jQuery.uniqueSort( matched );
+			}
+
+			// Reverse order for parents* and prev-derivatives
+			if ( rparentsprev.test( name ) ) {
+				matched.reverse();
+			}
+		}
+
+		return this.pushStack( matched );
+	};
+} );
+var rnothtmlwhite = ( /[^\x20\t\r\n\f]+/g );
+
+
+
+// Convert String-formatted options into Object-formatted ones
+function createOptions( options ) {
+	var object = {};
+	jQuery.each( options.match( rnothtmlwhite ) || [], function( _, flag ) {
+		object[ flag ] = true;
+	} );
+	return object;
+}
+
+/*
+ * Create a callback list using the following parameters:
+ *
+ *	options: an optional list of space-separated options that will change how
+ *			the callback list behaves or a more traditional option object
+ *
+ * By default a callback list will act like an event callback list and can be
+ * "fired" multiple times.
+ *
+ * Possible options:
+ *
+ *	once:			will ensure the callback list can only be fired once (like a Deferred)
+ *
+ *	memory:			will keep track of previous values and will call any callback added
+ *					after the list has been fired right away with the latest "memorized"
+ *					values (like a Deferred)
+ *
+ *	unique:			will ensure a callback can only be added once (no duplicate in the list)
+ *
+ *	stopOnFalse:	interrupt callings when a callback returns false
+ *
+ */
+jQuery.Callbacks = function( options ) {
+
+	// Convert options from String-formatted to Object-formatted if needed
+	// (we check in cache first)
+	options = typeof options === "string" ?
+		createOptions( options ) :
+		jQuery.extend( {}, options );
+
+	var // Flag to know if list is currently firing
+		firing,
+
+		// Last fire value for non-forgettable lists
+		memory,
+
+		// Flag to know if list was already fired
+		fired,
+
+		// Flag to prevent firing
+		locked,
+
+		// Actual callback list
+		list = [],
+
+		// Queue of execution data for repeatable lists
+		queue = [],
+
+		// Index of currently firing callback (modified by add/remove as needed)
+		firingIndex = -1,
+
+		// Fire callbacks
+		fire = function() {
+
+			// Enforce single-firing
+			locked = locked || options.once;
+
+			// Execute callbacks for all pending executions,
+			// respecting firingIndex overrides and runtime changes
+			fired = firing = true;
+			for ( ; queue.length; firingIndex = -1 ) {
+				memory = queue.shift();
+				while ( ++firingIndex < list.length ) {
+
+					// Run callback and check for early termination
+					if ( list[ firingIndex ].apply( memory[ 0 ], memory[ 1 ] ) === false &&
+						options.stopOnFalse ) {
+
+						// Jump to end and forget the data so .add doesn't re-fire
+						firingIndex = list.length;
+						memory = false;
+					}
+				}
+			}
+
+			// Forget the data if we're done with it
+			if ( !options.memory ) {
+				memory = false;
+			}
+
+			firing = false;
+
+			// Clean up if we're done firing for good
+			if ( locked ) {
+
+				// Keep an empty list if we have data for future add calls
+				if ( memory ) {
+					list = [];
+
+				// Otherwise, this object is spent
+				} else {
+					list = "";
+				}
+			}
+		},
+
+		// Actual Callbacks object
+		self = {
+
+			// Add a callback or a collection of callbacks to the list
+			add: function() {
+				if ( list ) {
+
+					// If we have memory from a past run, we should fire after adding
+					if ( memory && !firing ) {
+						firingIndex = list.length - 1;
+						queue.push( memory );
+					}
+
+					( function add( args ) {
+						jQuery.each( args, function( _, arg ) {
+							if ( isFunction( arg ) ) {
+								if ( !options.unique || !self.has( arg ) ) {
+									list.push( arg );
+								}
+							} else if ( arg && arg.length && toType( arg ) !== "string" ) {
+
+								// Inspect recursively
+								add( arg );
+							}
+						} );
+					} )( arguments );
+
+					if ( memory && !firing ) {
+						fire();
+					}
+				}
+				return this;
+			},
+
+			// Remove a callback from the list
+			remove: function() {
+				jQuery.each( arguments, function( _, arg ) {
+					var index;
+					while ( ( index = jQuery.inArray( arg, list, index ) ) > -1 ) {
+						list.splice( index, 1 );
+
+						// Handle firing indexes
+						if ( index <= firingIndex ) {
+							firingIndex--;
+						}
+					}
+				} );
+				return this;
+			},
+
+			// Check if a given callback is in the list.
+			// If no argument is given, return whether or not list has callbacks attached.
+			has: function( fn ) {
+				return fn ?
+					jQuery.inArray( fn, list ) > -1 :
+					list.length > 0;
+			},
+
+			// Remove all callbacks from the list
+			empty: function() {
+				if ( list ) {
+					list = [];
+				}
+				return this;
+			},
+
+			// Disable .fire and .add
+			// Abort any current/pending executions
+			// Clear all callbacks and values
+			disable: function() {
+				locked = queue = [];
+				list = memory = "";
+				return this;
+			},
+			disabled: function() {
+				return !list;
+			},
+
+			// Disable .fire
+			// Also disable .add unless we have memory (since it would have no effect)
+			// Abort any pending executions
+			lock: function() {
+				locked = queue = [];
+				if ( !memory && !firing ) {
+					list = memory = "";
+				}
+				return this;
+			},
+			locked: function() {
+				return !!locked;
+			},
+
+			// Call all callbacks with the given context and arguments
+			fireWith: function( context, args ) {
+				if ( !locked ) {
+					args = args || [];
+					args = [ context, args.slice ? args.slice() : args ];
+					queue.push( args );
+					if ( !firing ) {
+						fire();
+					}
+				}
+				return this;
+			},
+
+			// Call all the callbacks with the given arguments
+			fire: function() {
+				self.fireWith( this, arguments );
+				return this;
+			},
+
+			// To know if the callbacks have already been called at least once
+			fired: function() {
+				return !!fired;
+			}
+		};
+
+	return self;
+};
+
+
+function Identity( v ) {
+	return v;
+}
+function Thrower( ex ) {
+	throw ex;
+}
+
+function adoptValue( value, resolve, reject, noValue ) {
+	var method;
+
+	try {
+
+		// Check for promise aspect first to privilege synchronous behavior
+		if ( value && isFunction( ( method = value.promise ) ) ) {
+			method.call( value ).done( resolve ).fail( reject );
+
+		// Other thenables
+		} else if ( value && isFunction( ( method = value.then ) ) ) {
+			method.call( value, resolve, reject );
+
+		// Other non-thenables
+		} else {
+
+			// Control `resolve` arguments by letting Array#slice cast boolean `noValue` to integer:
+			// * false: [ value ].slice( 0 ) => resolve( value )
+			// * true: [ value ].slice( 1 ) => resolve()
+			resolve.apply( undefined, [ value ].slice( noValue ) );
+		}
+
+	// For Promises/A+, convert exceptions into rejections
+	// Since jQuery.when doesn't unwrap thenables, we can skip the extra checks appearing in
+	// Deferred#then to conditionally suppress rejection.
+	} catch ( value ) {
+
+		// Support: Android 4.0 only
+		// Strict mode functions invoked without .call/.apply get global-object context
+		reject.apply( undefined, [ value ] );
+	}
+}
+
+jQuery.extend( {
+
+	Deferred: function( func ) {
+		var tuples = [
+
+				// action, add listener, callbacks,
+				// ... .then handlers, argument index, [final state]
+				[ "notify", "progress", jQuery.Callbacks( "memory" ),
+					jQuery.Callbacks( "memory" ), 2 ],
+				[ "resolve", "done", jQuery.Callbacks( "once memory" ),
+					jQuery.Callbacks( "once memory" ), 0, "resolved" ],
+				[ "reject", "fail", jQuery.Callbacks( "once memory" ),
+					jQuery.Callbacks( "once memory" ), 1, "rejected" ]
+			],
+			state = "pending",
+			promise = {
+				state: function() {
+					return state;
+				},
+				always: function() {
+					deferred.done( arguments ).fail( arguments );
+					return this;
+				},
+				"catch": function( fn ) {
+					return promise.then( null, fn );
+				},
+
+				// Keep pipe for back-compat
+				pipe: function( /* fnDone, fnFail, fnProgress */ ) {
+					var fns = arguments;
+
+					return jQuery.Deferred( function( newDefer ) {
+						jQuery.each( tuples, function( _i, tuple ) {
+
+							// Map tuples (progress, done, fail) to arguments (done, fail, progress)
+							var fn = isFunction( fns[ tuple[ 4 ] ] ) && fns[ tuple[ 4 ] ];
+
+							// deferred.progress(function() { bind to newDefer or newDefer.notify })
+							// deferred.done(function() { bind to newDefer or newDefer.resolve })
+							// deferred.fail(function() { bind to newDefer or newDefer.reject })
+							deferred[ tuple[ 1 ] ]( function() {
+								var returned = fn && fn.apply( this, arguments );
+								if ( returned && isFunction( returned.promise ) ) {
+									returned.promise()
+										.progress( newDefer.notify )
+										.done( newDefer.resolve )
+										.fail( newDefer.reject );
+								} else {
+									newDefer[ tuple[ 0 ] + "With" ](
+										this,
+										fn ? [ returned ] : arguments
+									);
+								}
+							} );
+						} );
+						fns = null;
+					} ).promise();
+				},
+				then: function( onFulfilled, onRejected, onProgress ) {
+					var maxDepth = 0;
+					function resolve( depth, deferred, handler, special ) {
+						return function() {
+							var that = this,
+								args = arguments,
+								mightThrow = function() {
+									var returned, then;
+
+									// Support: Promises/A+ section 2.3.3.3.3
+									// https://promisesaplus.com/#point-59
+									// Ignore double-resolution attempts
+									if ( depth < maxDepth ) {
+										return;
+									}
+
+									returned = handler.apply( that, args );
+
+									// Support: Promises/A+ section 2.3.1
+									// https://promisesaplus.com/#point-48
+									if ( returned === deferred.promise() ) {
+										throw new TypeError( "Thenable self-resolution" );
+									}
+
+									// Support: Promises/A+ sections 2.3.3.1, 3.5
+									// https://promisesaplus.com/#point-54
+									// https://promisesaplus.com/#point-75
+									// Retrieve `then` only once
+									then = returned &&
+
+										// Support: Promises/A+ section 2.3.4
+										// https://promisesaplus.com/#point-64
+										// Only check objects and functions for thenability
+										( typeof returned === "object" ||
+											typeof returned === "function" ) &&
+										returned.then;
+
+									// Handle a returned thenable
+									if ( isFunction( then ) ) {
+
+										// Special processors (notify) just wait for resolution
+										if ( special ) {
+											then.call(
+												returned,
+												resolve( maxDepth, deferred, Identity, special ),
+												resolve( maxDepth, deferred, Thrower, special )
+											);
+
+										// Normal processors (resolve) also hook into progress
+										} else {
+
+											// ...and disregard older resolution values
+											maxDepth++;
+
+											then.call(
+												returned,
+												resolve( maxDepth, deferred, Identity, special ),
+												resolve( maxDepth, deferred, Thrower, special ),
+												resolve( maxDepth, deferred, Identity,
+													deferred.notifyWith )
+											);
+										}
+
+									// Handle all other returned values
+									} else {
+
+										// Only substitute handlers pass on context
+										// and multiple values (non-spec behavior)
+										if ( handler !== Identity ) {
+											that = undefined;
+											args = [ returned ];
+										}
+
+										// Process the value(s)
+										// Default process is resolve
+										( special || deferred.resolveWith )( that, args );
+									}
+								},
+
+								// Only normal processors (resolve) catch and reject exceptions
+								process = special ?
+									mightThrow :
+									function() {
+										try {
+											mightThrow();
+										} catch ( e ) {
+
+											if ( jQuery.Deferred.exceptionHook ) {
+												jQuery.Deferred.exceptionHook( e,
+													process.error );
+											}
+
+											// Support: Promises/A+ section 2.3.3.3.4.1
+											// https://promisesaplus.com/#point-61
+											// Ignore post-resolution exceptions
+											if ( depth + 1 >= maxDepth ) {
+
+												// Only substitute handlers pass on context
+												// and multiple values (non-spec behavior)
+												if ( handler !== Thrower ) {
+													that = undefined;
+													args = [ e ];
+												}
+
+												deferred.rejectWith( that, args );
+											}
+										}
+									};
+
+							// Support: Promises/A+ section 2.3.3.3.1
+							// https://promisesaplus.com/#point-57
+							// Re-resolve promises immediately to dodge false rejection from
+							// subsequent errors
+							if ( depth ) {
+								process();
+							} else {
+
+								// Call an optional hook to record the error, in case of exception
+								// since it's otherwise lost when execution goes async
+								if ( jQuery.Deferred.getErrorHook ) {
+									process.error = jQuery.Deferred.getErrorHook();
+
+								// The deprecated alias of the above. While the name suggests
+								// returning the stack, not an error instance, jQuery just passes
+								// it directly to `console.warn` so both will work; an instance
+								// just better cooperates with source maps.
+								} else if ( jQuery.Deferred.getStackHook ) {
+									process.error = jQuery.Deferred.getStackHook();
+								}
+								window.setTimeout( process );
+							}
+						};
+					}
+
+					return jQuery.Deferred( function( newDefer ) {
+
+						// progress_handlers.add( ... )
+						tuples[ 0 ][ 3 ].add(
+							resolve(
+								0,
+								newDefer,
+								isFunction( onProgress ) ?
+									onProgress :
+									Identity,
+								newDefer.notifyWith
+							)
+						);
+
+						// fulfilled_handlers.add( ... )
+						tuples[ 1 ][ 3 ].add(
+							resolve(
+								0,
+								newDefer,
+								isFunction( onFulfilled ) ?
+									onFulfilled :
+									Identity
+							)
+						);
+
+						// rejected_handlers.add( ... )
+						tuples[ 2 ][ 3 ].add(
+							resolve(
+								0,
+								newDefer,
+								isFunction( onRejected ) ?
+									onRejected :
+									Thrower
+							)
+						);
+					} ).promise();
+				},
+
+				// Get a promise for this deferred
+				// If obj is provided, the promise aspect is added to the object
+				promise: function( obj ) {
+					return obj != null ? jQuery.extend( obj, promise ) : promise;
+				}
+			},
+			deferred = {};
+
+		// Add list-specific methods
+		jQuery.each( tuples, function( i, tuple ) {
+			var list = tuple[ 2 ],
+				stateString = tuple[ 5 ];
+
+			// promise.progress = list.add
+			// promise.done = list.add
+			// promise.fail = list.add
+			promise[ tuple[ 1 ] ] = list.add;
+
+			// Handle state
+			if ( stateString ) {
+				list.add(
+					function() {
+
+						// state = "resolved" (i.e., fulfilled)
+						// state = "rejected"
+						state = stateString;
+					},
+
+					// rejected_callbacks.disable
+					// fulfilled_callbacks.disable
+					tuples[ 3 - i ][ 2 ].disable,
+
+					// rejected_handlers.disable
+					// fulfilled_handlers.disable
+					tuples[ 3 - i ][ 3 ].disable,
+
+					// progress_callbacks.lock
+					tuples[ 0 ][ 2 ].lock,
+
+					// progress_handlers.lock
+					tuples[ 0 ][ 3 ].lock
+				);
+			}
+
+			// progress_handlers.fire
+			// fulfilled_handlers.fire
+			// rejected_handlers.fire
+			list.add( tuple[ 3 ].fire );
+
+			// deferred.notify = function() { deferred.notifyWith(...) }
+			// deferred.resolve = function() { deferred.resolveWith(...) }
+			// deferred.reject = function() { deferred.rejectWith(...) }
+			deferred[ tuple[ 0 ] ] = function() {
+				deferred[ tuple[ 0 ] + "With" ]( this === deferred ? undefined : this, arguments );
+				return this;
+			};
+
+			// deferred.notifyWith = list.fireWith
+			// deferred.resolveWith = list.fireWith
+			// deferred.rejectWith = list.fireWith
+			deferred[ tuple[ 0 ] + "With" ] = list.fireWith;
+		} );
+
+		// Make the deferred a promise
+		promise.promise( deferred );
+
+		// Call given func if any
+		if ( func ) {
+			func.call( deferred, deferred );
+		}
+
+		// All done!
+		return deferred;
+	},
+
+	// Deferred helper
+	when: function( singleValue ) {
+		var
+
+			// count of uncompleted subordinates
+			remaining = arguments.length,
+
+			// count of unprocessed arguments
+			i = remaining,
+
+			// subordinate fulfillment data
+			resolveContexts = Array( i ),
+			resolveValues = slice.call( arguments ),
+
+			// the primary Deferred
+			primary = jQuery.Deferred(),
+
+			// subordinate callback factory
+			updateFunc = function( i ) {
+				return function( value ) {
+					resolveContexts[ i ] = this;
+					resolveValues[ i ] = arguments.length > 1 ? slice.call( arguments ) : value;
+					if ( !( --remaining ) ) {
+						primary.resolveWith( resolveContexts, resolveValues );
+					}
+				};
+			};
+
+		// Single- and empty arguments are adopted like Promise.resolve
+		if ( remaining <= 1 ) {
+			adoptValue( singleValue, primary.done( updateFunc( i ) ).resolve, primary.reject,
+				!remaining );
+
+			// Use .then() to unwrap secondary thenables (cf. gh-3000)
+			if ( primary.state() === "pending" ||
+				isFunction( resolveValues[ i ] && resolveValues[ i ].then ) ) {
+
+				return primary.then();
+			}
+		}
+
+		// Multiple arguments are aggregated like Promise.all array elements
+		while ( i-- ) {
+			adoptValue( resolveValues[ i ], updateFunc( i ), primary.reject );
+		}
+
+		return primary.promise();
+	}
+} );
+
+
+// These usually indicate a programmer mistake during development,
+// warn about them ASAP rather than swallowing them by default.
+var rerrorNames = /^(Eval|Internal|Range|Reference|Syntax|Type|URI)Error$/;
+
+// If `jQuery.Deferred.getErrorHook` is defined, `asyncError` is an error
+// captured before the async barrier to get the original error cause
+// which may otherwise be hidden.
+jQuery.Deferred.exceptionHook = function( error, asyncError ) {
+
+	// Support: IE 8 - 9 only
+	// Console exists when dev tools are open, which can happen at any time
+	if ( window.console && window.console.warn && error && rerrorNames.test( error.name ) ) {
+		window.console.warn( "jQuery.Deferred exception: " + error.message,
+			error.stack, asyncError );
+	}
+};
+
+
+
+
+jQuery.readyException = function( error ) {
+	window.setTimeout( function() {
+		throw error;
+	} );
+};
+
+
+
+
+// The deferred used on DOM ready
+var readyList = jQuery.Deferred();
+
+jQuery.fn.ready = function( fn ) {
+
+	readyList
+		.then( fn )
+
+		// Wrap jQuery.readyException in a function so that the lookup
+		// happens at the time of error handling instead of callback
+		// registration.
+		.catch( function( error ) {
+			jQuery.readyException( error );
+		} );
+
+	return this;
+};
+
+jQuery.extend( {
+
+	// Is the DOM ready to be used? Set to true once it occurs.
+	isReady: false,
+
+	// A counter to track how many items to wait for before
+	// the ready event fires. See trac-6781
+	readyWait: 1,
+
+	// Handle when the DOM is ready
+	ready: function( wait ) {
+
+		// Abort if there are pending holds or we're already ready
+		if ( wait === true ? --jQuery.readyWait : jQuery.isReady ) {
+			return;
+		}
+
+		// Remember that the DOM is ready
+		jQuery.isReady = true;
+
+		// If a normal DOM Ready event fired, decrement, and wait if need be
+		if ( wait !== true && --jQuery.readyWait > 0 ) {
+			return;
+		}
+
+		// If there are functions bound, to execute
+		readyList.resolveWith( document, [ jQuery ] );
+	}
+} );
+
+jQuery.ready.then = readyList.then;
+
+// The ready event handler and self cleanup method
+function completed() {
+	document.removeEventListener( "DOMContentLoaded", completed );
+	window.removeEventListener( "load", completed );
+	jQuery.ready();
+}
+
+// Catch cases where $(document).ready() is called
+// after the browser event has already occurred.
+// Support: IE <=9 - 10 only
+// Older IE sometimes signals "interactive" too soon
+if ( document.readyState === "complete" ||
+	( document.readyState !== "loading" && !document.documentElement.doScroll ) ) {
+
+	// Handle it asynchronously to allow scripts the opportunity to delay ready
+	window.setTimeout( jQuery.ready );
+
+} else {
+
+	// Use the handy event callback
+	document.addEventListener( "DOMContentLoaded", completed );
+
+	// A fallback to window.onload, that will always work
+	window.addEventListener( "load", completed );
+}
+
+
+
+
+// Multifunctional method to get and set values of a collection
+// The value/s can optionally be executed if it's a function
+var access = function( elems, fn, key, value, chainable, emptyGet, raw ) {
+	var i = 0,
+		len = elems.length,
+		bulk = key == null;
+
+	// Sets many values
+	if ( toType( key ) === "object" ) {
+		chainable = true;
+		for ( i in key ) {
+			access( elems, fn, i, key[ i ], true, emptyGet, raw );
+		}
+
+	// Sets one value
+	} else if ( value !== undefined ) {
+		chainable = true;
+
+		if ( !isFunction( value ) ) {
+			raw = true;
+		}
+
+		if ( bulk ) {
+
+			// Bulk operations run against the entire set
+			if ( raw ) {
+				fn.call( elems, value );
+				fn = null;
+
+			// ...except when executing function values
+			} else {
+				bulk = fn;
+				fn = function( elem, _key, value ) {
+					return bulk.call( jQuery( elem ), value );
+				};
+			}
+		}
+
+		if ( fn ) {
+			for ( ; i < len; i++ ) {
+				fn(
+					elems[ i ], key, raw ?
+						value :
+						value.call( elems[ i ], i, fn( elems[ i ], key ) )
+				);
+			}
+		}
+	}
+
+	if ( chainable ) {
+		return elems;
+	}
+
+	// Gets
+	if ( bulk ) {
+		return fn.call( elems );
+	}
+
+	return len ? fn( elems[ 0 ], key ) : emptyGet;
+};
+
+
+// Matches dashed string for camelizing
+var rmsPrefix = /^-ms-/,
+	rdashAlpha = /-([a-z])/g;
+
+// Used by camelCase as callback to replace()
+function fcamelCase( _all, letter ) {
+	return letter.toUpperCase();
+}
+
+// Convert dashed to camelCase; used by the css and data modules
+// Support: IE <=9 - 11, Edge 12 - 15
+// Microsoft forgot to hump their vendor prefix (trac-9572)
+function camelCase( string ) {
+	return string.replace( rmsPrefix, "ms-" ).replace( rdashAlpha, fcamelCase );
+}
+var acceptData = function( owner ) {
+
+	// Accepts only:
+	//  - Node
+	//    - Node.ELEMENT_NODE
+	//    - Node.DOCUMENT_NODE
+	//  - Object
+	//    - Any
+	return owner.nodeType === 1 || owner.nodeType === 9 || !( +owner.nodeType );
+};
+
+
+
+
+function Data() {
+	this.expando = jQuery.expando + Data.uid++;
+}
+
+Data.uid = 1;
+
+Data.prototype = {
+
+	cache: function( owner ) {
+
+		// Check if the owner object already has a cache
+		var value = owner[ this.expando ];
+
+		// If not, create one
+		if ( !value ) {
+			value = {};
+
+			// We can accept data for non-element nodes in modern browsers,
+			// but we should not, see trac-8335.
+			// Always return an empty object.
+			if ( acceptData( owner ) ) {
+
+				// If it is a node unlikely to be stringify-ed or looped over
+				// use plain assignment
+				if ( owner.nodeType ) {
+					owner[ this.expando ] = value;
+
+				// Otherwise secure it in a non-enumerable property
+				// configurable must be true to allow the property to be
+				// deleted when data is removed
+				} else {
+					Object.defineProperty( owner, this.expando, {
+						value: value,
+						configurable: true
+					} );
+				}
+			}
+		}
+
+		return value;
+	},
+	set: function( owner, data, value ) {
+		var prop,
+			cache = this.cache( owner );
+
+		// Handle: [ owner, key, value ] args
+		// Always use camelCase key (gh-2257)
+		if ( typeof data === "string" ) {
+			cache[ camelCase( data ) ] = value;
+
+		// Handle: [ owner, { properties } ] args
+		} else {
+
+			// Copy the properties one-by-one to the cache object
+			for ( prop in data ) {
+				cache[ camelCase( prop ) ] = data[ prop ];
+			}
+		}
+		return cache;
+	},
+	get: function( owner, key ) {
+		return key === undefined ?
+			this.cache( owner ) :
+
+			// Always use camelCase key (gh-2257)
+			owner[ this.expando ] && owner[ this.expando ][ camelCase( key ) ];
+	},
+	access: function( owner, key, value ) {
+
+		// In cases where either:
+		//
+		//   1. No key was specified
+		//   2. A string key was specified, but no value provided
+		//
+		// Take the "read" path and allow the get method to determine
+		// which value to return, respectively either:
+		//
+		//   1. The entire cache object
+		//   2. The data stored at the key
+		//
+		if ( key === undefined ||
+				( ( key && typeof key === "string" ) && value === undefined ) ) {
+
+			return this.get( owner, key );
+		}
+
+		// When the key is not a string, or both a key and value
+		// are specified, set or extend (existing objects) with either:
+		//
+		//   1. An object of properties
+		//   2. A key and value
+		//
+		this.set( owner, key, value );
+
+		// Since the "set" path can have two possible entry points
+		// return the expected data based on which path was taken[*]
+		return value !== undefined ? value : key;
+	},
+	remove: function( owner, key ) {
+		var i,
+			cache = owner[ this.expando ];
+
+		if ( cache === undefined ) {
+			return;
+		}
+
+		if ( key !== undefined ) {
+
+			// Support array or space separated string of keys
+			if ( Array.isArray( key ) ) {
+
+				// If key is an array of keys...
+				// We always set camelCase keys, so remove that.
+				key = key.map( camelCase );
+			} else {
+				key = camelCase( key );
+
+				// If a key with the spaces exists, use it.
+				// Otherwise, create an array by matching non-whitespace
+				key = key in cache ?
+					[ key ] :
+					( key.match( rnothtmlwhite ) || [] );
+			}
+
+			i = key.length;
+
+			while ( i-- ) {
+				delete cache[ key[ i ] ];
+			}
+		}
+
+		// Remove the expando if there's no more data
+		if ( key === undefined || jQuery.isEmptyObject( cache ) ) {
+
+			// Support: Chrome <=35 - 45
+			// Webkit & Blink performance suffers when deleting properties
+			// from DOM nodes, so set to undefined instead
+			// https://bugs.chromium.org/p/chromium/issues/detail?id=378607 (bug restricted)
+			if ( owner.nodeType ) {
+				owner[ this.expando ] = undefined;
+			} else {
+				delete owner[ this.expando ];
+			}
+		}
+	},
+	hasData: function( owner ) {
+		var cache = owner[ this.expando ];
+		return cache !== undefined && !jQuery.isEmptyObject( cache );
+	}
+};
+var dataPriv = new Data();
+
+var dataUser = new Data();
+
+
+
+//	Implementation Summary
+//
+//	1. Enforce API surface and semantic compatibility with 1.9.x branch
+//	2. Improve the module's maintainability by reducing the storage
+//		paths to a single mechanism.
+//	3. Use the same single mechanism to support "private" and "user" data.
+//	4. _Never_ expose "private" data to user code (TODO: Drop _data, _removeData)
+//	5. Avoid exposing implementation details on user objects (eg. expando properties)
+//	6. Provide a clear path for implementation upgrade to WeakMap in 2014
+
+var rbrace = /^(?:\{[\w\W]*\}|\[[\w\W]*\])$/,
+	rmultiDash = /[A-Z]/g;
+
+function getData( data ) {
+	if ( data === "true" ) {
+		return true;
+	}
+
+	if ( data === "false" ) {
+		return false;
+	}
+
+	if ( data === "null" ) {
+		return null;
+	}
+
+	// Only convert to a number if it doesn't change the string
+	if ( data === +data + "" ) {
+		return +data;
+	}
+
+	if ( rbrace.test( data ) ) {
+		return JSON.parse( data );
+	}
+
+	return data;
+}
+
+function dataAttr( elem, key, data ) {
+	var name;
+
+	// If nothing was found internally, try to fetch any
+	// data from the HTML5 data-* attribute
+	if ( data === undefined && elem.nodeType === 1 ) {
+		name = "data-" + key.replace( rmultiDash, "-$&" ).toLowerCase();
+		data = elem.getAttribute( name );
+
+		if ( typeof data === "string" ) {
+			try {
+				data = getData( data );
+			} catch ( e ) {}
+
+			// Make sure we set the data so it isn't changed later
+			dataUser.set( elem, key, data );
+		} else {
+			data = undefined;
+		}
+	}
+	return data;
+}
+
+jQuery.extend( {
+	hasData: function( elem ) {
+		return dataUser.hasData( elem ) || dataPriv.hasData( elem );
+	},
+
+	data: function( elem, name, data ) {
+		return dataUser.access( elem, name, data );
+	},
+
+	removeData: function( elem, name ) {
+		dataUser.remove( elem, name );
+	},
+
+	// TODO: Now that all calls to _data and _removeData have been replaced
+	// with direct calls to dataPriv methods, these can be deprecated.
+	_data: function( elem, name, data ) {
+		return dataPriv.access( elem, name, data );
+	},
+
+	_removeData: function( elem, name ) {
+		dataPriv.remove( elem, name );
+	}
+} );
+
+jQuery.fn.extend( {
+	data: function( key, value ) {
+		var i, name, data,
+			elem = this[ 0 ],
+			attrs = elem && elem.attributes;
+
+		// Gets all values
+		if ( key === undefined ) {
+			if ( this.length ) {
+				data = dataUser.get( elem );
+
+				if ( elem.nodeType === 1 && !dataPriv.get( elem, "hasDataAttrs" ) ) {
+					i = attrs.length;
+					while ( i-- ) {
+
+						// Support: IE 11 only
+						// The attrs elements can be null (trac-14894)
+						if ( attrs[ i ] ) {
+							name = attrs[ i ].name;
+							if ( name.indexOf( "data-" ) === 0 ) {
+								name = camelCase( name.slice( 5 ) );
+								dataAttr( elem, name, data[ name ] );
+							}
+						}
+					}
+					dataPriv.set( elem, "hasDataAttrs", true );
+				}
+			}
+
+			return data;
+		}
+
+		// Sets multiple values
+		if ( typeof key === "object" ) {
+			return this.each( function() {
+				dataUser.set( this, key );
+			} );
+		}
+
+		return access( this, function( value ) {
+			var data;
+
+			// The calling jQuery object (element matches) is not empty
+			// (and therefore has an element appears at this[ 0 ]) and the
+			// `value` parameter was not undefined. An empty jQuery object
+			// will result in `undefined` for elem = this[ 0 ] which will
+			// throw an exception if an attempt to read a data cache is made.
+			if ( elem && value === undefined ) {
+
+				// Attempt to get data from the cache
+				// The key will always be camelCased in Data
+				data = dataUser.get( elem, key );
+				if ( data !== undefined ) {
+					return data;
+				}
+
+				// Attempt to "discover" the data in
+				// HTML5 custom data-* attrs
+				data = dataAttr( elem, key );
+				if ( data !== undefined ) {
+					return data;
+				}
+
+				// We tried really hard, but the data doesn't exist.
+				return;
+			}
+
+			// Set the data...
+			this.each( function() {
+
+				// We always store the camelCased key
+				dataUser.set( this, key, value );
+			} );
+		}, null, value, arguments.length > 1, null, true );
+	},
+
+	removeData: function( key ) {
+		return this.each( function() {
+			dataUser.remove( this, key );
+		} );
+	}
+} );
+
+
+jQuery.extend( {
+	queue: function( elem, type, data ) {
+		var queue;
+
+		if ( elem ) {
+			type = ( type || "fx" ) + "queue";
+			queue = dataPriv.get( elem, type );
+
+			// Speed up dequeue by getting out quickly if this is just a lookup
+			if ( data ) {
+				if ( !queue || Array.isArray( data ) ) {
+					queue = dataPriv.access( elem, type, jQuery.makeArray( data ) );
+				} else {
+					queue.push( data );
+				}
+			}
+			return queue || [];
+		}
+	},
+
+	dequeue: function( elem, type ) {
+		type = type || "fx";
+
+		var queue = jQuery.queue( elem, type ),
+			startLength = queue.length,
+			fn = queue.shift(),
+			hooks = jQuery._queueHooks( elem, type ),
+			next = function() {
+				jQuery.dequeue( elem, type );
+			};
+
+		// If the fx queue is dequeued, always remove the progress sentinel
+		if ( fn === "inprogress" ) {
+			fn = queue.shift();
+			startLength--;
+		}
+
+		if ( fn ) {
+
+			// Add a progress sentinel to prevent the fx queue from being
+			// automatically dequeued
+			if ( type === "fx" ) {
+				queue.unshift( "inprogress" );
+			}
+
+			// Clear up the last queue stop function
+			delete hooks.stop;
+			fn.call( elem, next, hooks );
+		}
+
+		if ( !startLength && hooks ) {
+			hooks.empty.fire();
+		}
+	},
+
+	// Not public - generate a queueHooks object, or return the current one
+	_queueHooks: function( elem, type ) {
+		var key = type + "queueHooks";
+		return dataPriv.get( elem, key ) || dataPriv.access( elem, key, {
+			empty: jQuery.Callbacks( "once memory" ).add( function() {
+				dataPriv.remove( elem, [ type + "queue", key ] );
+			} )
+		} );
+	}
+} );
+
+jQuery.fn.extend( {
+	queue: function( type, data ) {
+		var setter = 2;
+
+		if ( typeof type !== "string" ) {
+			data = type;
+			type = "fx";
+			setter--;
+		}
+
+		if ( arguments.length < setter ) {
+			return jQuery.queue( this[ 0 ], type );
+		}
+
+		return data === undefined ?
+			this :
+			this.each( function() {
+				var queue = jQuery.queue( this, type, data );
+
+				// Ensure a hooks for this queue
+				jQuery._queueHooks( this, type );
+
+				if ( type === "fx" && queue[ 0 ] !== "inprogress" ) {
+					jQuery.dequeue( this, type );
+				}
+			} );
+	},
+	dequeue: function( type ) {
+		return this.each( function() {
+			jQuery.dequeue( this, type );
+		} );
+	},
+	clearQueue: function( type ) {
+		return this.queue( type || "fx", [] );
+	},
+
+	// Get a promise resolved when queues of a certain type
+	// are emptied (fx is the type by default)
+	promise: function( type, obj ) {
+		var tmp,
+			count = 1,
+			defer = jQuery.Deferred(),
+			elements = this,
+			i = this.length,
+			resolve = function() {
+				if ( !( --count ) ) {
+					defer.resolveWith( elements, [ elements ] );
+				}
+			};
+
+		if ( typeof type !== "string" ) {
+			obj = type;
+			type = undefined;
+		}
+		type = type || "fx";
+
+		while ( i-- ) {
+			tmp = dataPriv.get( elements[ i ], type + "queueHooks" );
+			if ( tmp && tmp.empty ) {
+				count++;
+				tmp.empty.add( resolve );
+			}
+		}
+		resolve();
+		return defer.promise( obj );
+	}
+} );
+var pnum = ( /[+-]?(?:\d*\.|)\d+(?:[eE][+-]?\d+|)/ ).source;
+
+var rcssNum = new RegExp( "^(?:([+-])=|)(" + pnum + ")([a-z%]*)$", "i" );
+
+
+var cssExpand = [ "Top", "Right", "Bottom", "Left" ];
+
+var documentElement = document.documentElement;
+
+
+
+	var isAttached = function( elem ) {
+			return jQuery.contains( elem.ownerDocument, elem );
+		},
+		composed = { composed: true };
+
+	// Support: IE 9 - 11+, Edge 12 - 18+, iOS 10.0 - 10.2 only
+	// Check attachment across shadow DOM boundaries when possible (gh-3504)
+	// Support: iOS 10.0-10.2 only
+	// Early iOS 10 versions support `attachShadow` but not `getRootNode`,
+	// leading to errors. We need to check for `getRootNode`.
+	if ( documentElement.getRootNode ) {
+		isAttached = function( elem ) {
+			return jQuery.contains( elem.ownerDocument, elem ) ||
+				elem.getRootNode( composed ) === elem.ownerDocument;
+		};
+	}
+var isHiddenWithinTree = function( elem, el ) {
+
+		// isHiddenWithinTree might be called from jQuery#filter function;
+		// in that case, element will be second argument
+		elem = el || elem;
+
+		// Inline style trumps all
+		return elem.style.display === "none" ||
+			elem.style.display === "" &&
+
+			// Otherwise, check computed style
+			// Support: Firefox <=43 - 45
+			// Disconnected elements can have computed display: none, so first confirm that elem is
+			// in the document.
+			isAttached( elem ) &&
+
+			jQuery.css( elem, "display" ) === "none";
+	};
+
+
+
+function adjustCSS( elem, prop, valueParts, tween ) {
+	var adjusted, scale,
+		maxIterations = 20,
+		currentValue = tween ?
+			function() {
+				return tween.cur();
+			} :
+			function() {
+				return jQuery.css( elem, prop, "" );
+			},
+		initial = currentValue(),
+		unit = valueParts && valueParts[ 3 ] || ( jQuery.cssNumber[ prop ] ? "" : "px" ),
+
+		// Starting value computation is required for potential unit mismatches
+		initialInUnit = elem.nodeType &&
+			( jQuery.cssNumber[ prop ] || unit !== "px" && +initial ) &&
+			rcssNum.exec( jQuery.css( elem, prop ) );
+
+	if ( initialInUnit && initialInUnit[ 3 ] !== unit ) {
+
+		// Support: Firefox <=54
+		// Halve the iteration target value to prevent interference from CSS upper bounds (gh-2144)
+		initial = initial / 2;
+
+		// Trust units reported by jQuery.css
+		unit = unit || initialInUnit[ 3 ];
+
+		// Iteratively approximate from a nonzero starting point
+		initialInUnit = +initial || 1;
+
+		while ( maxIterations-- ) {
+
+			// Evaluate and update our best guess (doubling guesses that zero out).
+			// Finish if the scale equals or crosses 1 (making the old*new product non-positive).
+			jQuery.style( elem, prop, initialInUnit + unit );
+			if ( ( 1 - scale ) * ( 1 - ( scale = currentValue() / initial || 0.5 ) ) <= 0 ) {
+				maxIterations = 0;
+			}
+			initialInUnit = initialInUnit / scale;
+
+		}
+
+		initialInUnit = initialInUnit * 2;
+		jQuery.style( elem, prop, initialInUnit + unit );
+
+		// Make sure we update the tween properties later on
+		valueParts = valueParts || [];
+	}
+
+	if ( valueParts ) {
+		initialInUnit = +initialInUnit || +initial || 0;
+
+		// Apply relative offset (+=/-=) if specified
+		adjusted = valueParts[ 1 ] ?
+			initialInUnit + ( valueParts[ 1 ] + 1 ) * valueParts[ 2 ] :
+			+valueParts[ 2 ];
+		if ( tween ) {
+			tween.unit = unit;
+			tween.start = initialInUnit;
+			tween.end = adjusted;
+		}
+	}
+	return adjusted;
+}
+
+
+var defaultDisplayMap = {};
+
+function getDefaultDisplay( elem ) {
+	var temp,
+		doc = elem.ownerDocument,
+		nodeName = elem.nodeName,
+		display = defaultDisplayMap[ nodeName ];
+
+	if ( display ) {
+		return display;
+	}
+
+	temp = doc.body.appendChild( doc.createElement( nodeName ) );
+	display = jQuery.css( temp, "display" );
+
+	temp.parentNode.removeChild( temp );
+
+	if ( display === "none" ) {
+		display = "block";
+	}
+	defaultDisplayMap[ nodeName ] = display;
+
+	return display;
+}
+
+function showHide( elements, show ) {
+	var display, elem,
+		values = [],
+		index = 0,
+		length = elements.length;
+
+	// Determine new display value for elements that need to change
+	for ( ; index < length; index++ ) {
+		elem = elements[ index ];
+		if ( !elem.style ) {
+			continue;
+		}
+
+		display = elem.style.display;
+		if ( show ) {
+
+			// Since we force visibility upon cascade-hidden elements, an immediate (and slow)
+			// check is required in this first loop unless we have a nonempty display value (either
+			// inline or about-to-be-restored)
+			if ( display === "none" ) {
+				values[ index ] = dataPriv.get( elem, "display" ) || null;
+				if ( !values[ index ] ) {
+					elem.style.display = "";
+				}
+			}
+			if ( elem.style.display === "" && isHiddenWithinTree( elem ) ) {
+				values[ index ] = getDefaultDisplay( elem );
+			}
+		} else {
+			if ( display !== "none" ) {
+				values[ index ] = "none";
+
+				// Remember what we're overwriting
+				dataPriv.set( elem, "display", display );
+			}
+		}
+	}
+
+	// Set the display of the elements in a second loop to avoid constant reflow
+	for ( index = 0; index < length; index++ ) {
+		if ( values[ index ] != null ) {
+			elements[ index ].style.display = values[ index ];
+		}
+	}
+
+	return elements;
+}
+
+jQuery.fn.extend( {
+	show: function() {
+		return showHide( this, true );
+	},
+	hide: function() {
+		return showHide( this );
+	},
+	toggle: function( state ) {
+		if ( typeof state === "boolean" ) {
+			return state ? this.show() : this.hide();
+		}
+
+		return this.each( function() {
+			if ( isHiddenWithinTree( this ) ) {
+				jQuery( this ).show();
+			} else {
+				jQuery( this ).hide();
+			}
+		} );
+	}
+} );
+var rcheckableType = ( /^(?:checkbox|radio)$/i );
+
+var rtagName = ( /<([a-z][^\/\0>\x20\t\r\n\f]*)/i );
+
+var rscriptType = ( /^$|^module$|\/(?:java|ecma)script/i );
+
+
+
+( function() {
+	var fragment = document.createDocumentFragment(),
+		div = fragment.appendChild( document.createElement( "div" ) ),
+		input = document.createElement( "input" );
+
+	// Support: Android 4.0 - 4.3 only
+	// Check state lost if the name is set (trac-11217)
+	// Support: Windows Web Apps (WWA)
+	// `name` and `type` must use .setAttribute for WWA (trac-14901)
+	input.setAttribute( "type", "radio" );
+	input.setAttribute( "checked", "checked" );
+	input.setAttribute( "name", "t" );
+
+	div.appendChild( input );
+
+	// Support: Android <=4.1 only
+	// Older WebKit doesn't clone checked state correctly in fragments
+	support.checkClone = div.cloneNode( true ).cloneNode( true ).lastChild.checked;
+
+	// Support: IE <=11 only
+	// Make sure textarea (and checkbox) defaultValue is properly cloned
+	div.innerHTML = "<textarea>x</textarea>";
+	support.noCloneChecked = !!div.cloneNode( true ).lastChild.defaultValue;
+
+	// Support: IE <=9 only
+	// IE <=9 replaces <option> tags with their contents when inserted outside of
+	// the select element.
+	div.innerHTML = "<option></option>";
+	support.option = !!div.lastChild;
+} )();
+
+
+// We have to close these tags to support XHTML (trac-13200)
+var wrapMap = {
+
+	// XHTML parsers do not magically insert elements in the
+	// same way that tag soup parsers do. So we cannot shorten
+	// this by omitting <tbody> or other required elements.
+	thead: [ 1, "<table>", "</table>" ],
+	col: [ 2, "<table><colgroup>", "</colgroup></table>" ],
+	tr: [ 2, "<table><tbody>", "</tbody></table>" ],
+	td: [ 3, "<table><tbody><tr>", "</tr></tbody></table>" ],
+
+	_default: [ 0, "", "" ]
+};
+
+wrapMap.tbody = wrapMap.tfoot = wrapMap.colgroup = wrapMap.caption = wrapMap.thead;
+wrapMap.th = wrapMap.td;
+
+// Support: IE <=9 only
+if ( !support.option ) {
+	wrapMap.optgroup = wrapMap.option = [ 1, "<select multiple='multiple'>", "</select>" ];
+}
+
+
+function getAll( context, tag ) {
+
+	// Support: IE <=9 - 11 only
+	// Use typeof to avoid zero-argument method invocation on host objects (trac-15151)
+	var ret;
+
+	if ( typeof context.getElementsByTagName !== "undefined" ) {
+		ret = context.getElementsByTagName( tag || "*" );
+
+	} else if ( typeof context.querySelectorAll !== "undefined" ) {
+		ret = context.querySelectorAll( tag || "*" );
+
+	} else {
+		ret = [];
+	}
+
+	if ( tag === undefined || tag && nodeName( context, tag ) ) {
+		return jQuery.merge( [ context ], ret );
+	}
+
+	return ret;
+}
+
+
+// Mark scripts as having already been evaluated
+function setGlobalEval( elems, refElements ) {
+	var i = 0,
+		l = elems.length;
+
+	for ( ; i < l; i++ ) {
+		dataPriv.set(
+			elems[ i ],
+			"globalEval",
+			!refElements || dataPriv.get( refElements[ i ], "globalEval" )
+		);
+	}
+}
+
+
+var rhtml = /<|&#?\w+;/;
+
+function buildFragment( elems, context, scripts, selection, ignored ) {
+	var elem, tmp, tag, wrap, attached, j,
+		fragment = context.createDocumentFragment(),
+		nodes = [],
+		i = 0,
+		l = elems.length;
+
+	for ( ; i < l; i++ ) {
+		elem = elems[ i ];
+
+		if ( elem || elem === 0 ) {
+
+			// Add nodes directly
+			if ( toType( elem ) === "object" ) {
+
+				// Support: Android <=4.0 only, PhantomJS 1 only
+				// push.apply(_, arraylike) throws on ancient WebKit
+				jQuery.merge( nodes, elem.nodeType ? [ elem ] : elem );
+
+			// Convert non-html into a text node
+			} else if ( !rhtml.test( elem ) ) {
+				nodes.push( context.createTextNode( elem ) );
+
+			// Convert html into DOM nodes
+			} else {
+				tmp = tmp || fragment.appendChild( context.createElement( "div" ) );
+
+				// Deserialize a standard representation
+				tag = ( rtagName.exec( elem ) || [ "", "" ] )[ 1 ].toLowerCase();
+				wrap = wrapMap[ tag ] || wrapMap._default;
+				tmp.innerHTML = wrap[ 1 ] + jQuery.htmlPrefilter( elem ) + wrap[ 2 ];
+
+				// Descend through wrappers to the right content
+				j = wrap[ 0 ];
+				while ( j-- ) {
+					tmp = tmp.lastChild;
+				}
+
+				// Support: Android <=4.0 only, PhantomJS 1 only
+				// push.apply(_, arraylike) throws on ancient WebKit
+				jQuery.merge( nodes, tmp.childNodes );
+
+				// Remember the top-level container
+				tmp = fragment.firstChild;
+
+				// Ensure the created nodes are orphaned (trac-12392)
+				tmp.textContent = "";
+			}
+		}
+	}
+
+	// Remove wrapper from fragment
+	fragment.textContent = "";
+
+	i = 0;
+	while ( ( elem = nodes[ i++ ] ) ) {
+
+		// Skip elements already in the context collection (trac-4087)
+		if ( selection && jQuery.inArray( elem, selection ) > -1 ) {
+			if ( ignored ) {
+				ignored.push( elem );
+			}
+			continue;
+		}
+
+		attached = isAttached( elem );
+
+		// Append to fragment
+		tmp = getAll( fragment.appendChild( elem ), "script" );
+
+		// Preserve script evaluation history
+		if ( attached ) {
+			setGlobalEval( tmp );
+		}
+
+		// Capture executables
+		if ( scripts ) {
+			j = 0;
+			while ( ( elem = tmp[ j++ ] ) ) {
+				if ( rscriptType.test( elem.type || "" ) ) {
+					scripts.push( elem );
+				}
+			}
+		}
+	}
+
+	return fragment;
+}
+
+
+var rtypenamespace = /^([^.]*)(?:\.(.+)|)/;
+
+function returnTrue() {
+	return true;
+}
+
+function returnFalse() {
+	return false;
+}
+
+function on( elem, types, selector, data, fn, one ) {
+	var origFn, type;
+
+	// Types can be a map of types/handlers
+	if ( typeof types === "object" ) {
+
+		// ( types-Object, selector, data )
+		if ( typeof selector !== "string" ) {
+
+			// ( types-Object, data )
+			data = data || selector;
+			selector = undefined;
+		}
+		for ( type in types ) {
+			on( elem, type, selector, data, types[ type ], one );
+		}
+		return elem;
+	}
+
+	if ( data == null && fn == null ) {
+
+		// ( types, fn )
+		fn = selector;
+		data = selector = undefined;
+	} else if ( fn == null ) {
+		if ( typeof selector === "string" ) {
+
+			// ( types, selector, fn )
+			fn = data;
+			data = undefined;
+		} else {
+
+			// ( types, data, fn )
+			fn = data;
+			data = selector;
+			selector = undefined;
+		}
+	}
+	if ( fn === false ) {
+		fn = returnFalse;
+	} else if ( !fn ) {
+		return elem;
+	}
+
+	if ( one === 1 ) {
+		origFn = fn;
+		fn = function( event ) {
+
+			// Can use an empty set, since event contains the info
+			jQuery().off( event );
+			return origFn.apply( this, arguments );
+		};
+
+		// Use same guid so caller can remove using origFn
+		fn.guid = origFn.guid || ( origFn.guid = jQuery.guid++ );
+	}
+	return elem.each( function() {
+		jQuery.event.add( this, types, fn, data, selector );
+	} );
+}
+
+/*
+ * Helper functions for managing events -- not part of the public interface.
+ * Props to Dean Edwards' addEvent library for many of the ideas.
+ */
+jQuery.event = {
+
+	global: {},
+
+	add: function( elem, types, handler, data, selector ) {
+
+		var handleObjIn, eventHandle, tmp,
+			events, t, handleObj,
+			special, handlers, type, namespaces, origType,
+			elemData = dataPriv.get( elem );
+
+		// Only attach events to objects that accept data
+		if ( !acceptData( elem ) ) {
+			return;
+		}
+
+		// Caller can pass in an object of custom data in lieu of the handler
+		if ( handler.handler ) {
+			handleObjIn = handler;
+			handler = handleObjIn.handler;
+			selector = handleObjIn.selector;
+		}
+
+		// Ensure that invalid selectors throw exceptions at attach time
+		// Evaluate against documentElement in case elem is a non-element node (e.g., document)
+		if ( selector ) {
+			jQuery.find.matchesSelector( documentElement, selector );
+		}
+
+		// Make sure that the handler has a unique ID, used to find/remove it later
+		if ( !handler.guid ) {
+			handler.guid = jQuery.guid++;
+		}
+
+		// Init the element's event structure and main handler, if this is the first
+		if ( !( events = elemData.events ) ) {
+			events = elemData.events = Object.create( null );
+		}
+		if ( !( eventHandle = elemData.handle ) ) {
+			eventHandle = elemData.handle = function( e ) {
+
+				// Discard the second event of a jQuery.event.trigger() and
+				// when an event is called after a page has unloaded
+				return typeof jQuery !== "undefined" && jQuery.event.triggered !== e.type ?
+					jQuery.event.dispatch.apply( elem, arguments ) : undefined;
+			};
+		}
+
+		// Handle multiple events separated by a space
+		types = ( types || "" ).match( rnothtmlwhite ) || [ "" ];
+		t = types.length;
+		while ( t-- ) {
+			tmp = rtypenamespace.exec( types[ t ] ) || [];
+			type = origType = tmp[ 1 ];
+			namespaces = ( tmp[ 2 ] || "" ).split( "." ).sort();
+
+			// There *must* be a type, no attaching namespace-only handlers
+			if ( !type ) {
+				continue;
+			}
+
+			// If event changes its type, use the special event handlers for the changed type
+			special = jQuery.event.special[ type ] || {};
+
+			// If selector defined, determine special event api type, otherwise given type
+			type = ( selector ? special.delegateType : special.bindType ) || type;
+
+			// Update special based on newly reset type
+			special = jQuery.event.special[ type ] || {};
+
+			// handleObj is passed to all event handlers
+			handleObj = jQuery.extend( {
+				type: type,
+				origType: origType,
+				data: data,
+				handler: handler,
+				guid: handler.guid,
+				selector: selector,
+				needsContext: selector && jQuery.expr.match.needsContext.test( selector ),
+				namespace: namespaces.join( "." )
+			}, handleObjIn );
+
+			// Init the event handler queue if we're the first
+			if ( !( handlers = events[ type ] ) ) {
+				handlers = events[ type ] = [];
+				handlers.delegateCount = 0;
+
+				// Only use addEventListener if the special events handler returns false
+				if ( !special.setup ||
+					special.setup.call( elem, data, namespaces, eventHandle ) === false ) {
+
+					if ( elem.addEventListener ) {
+						elem.addEventListener( type, eventHandle );
+					}
+				}
+			}
+
+			if ( special.add ) {
+				special.add.call( elem, handleObj );
+
+				if ( !handleObj.handler.guid ) {
+					handleObj.handler.guid = handler.guid;
+				}
+			}
+
+			// Add to the element's handler list, delegates in front
+			if ( selector ) {
+				handlers.splice( handlers.delegateCount++, 0, handleObj );
+			} else {
+				handlers.push( handleObj );
+			}
+
+			// Keep track of which events have ever been used, for event optimization
+			jQuery.event.global[ type ] = true;
+		}
+
+	},
+
+	// Detach an event or set of events from an element
+	remove: function( elem, types, handler, selector, mappedTypes ) {
+
+		var j, origCount, tmp,
+			events, t, handleObj,
+			special, handlers, type, namespaces, origType,
+			elemData = dataPriv.hasData( elem ) && dataPriv.get( elem );
+
+		if ( !elemData || !( events = elemData.events ) ) {
+			return;
+		}
+
+		// Once for each type.namespace in types; type may be omitted
+		types = ( types || "" ).match( rnothtmlwhite ) || [ "" ];
+		t = types.length;
+		while ( t-- ) {
+			tmp = rtypenamespace.exec( types[ t ] ) || [];
+			type = origType = tmp[ 1 ];
+			namespaces = ( tmp[ 2 ] || "" ).split( "." ).sort();
+
+			// Unbind all events (on this namespace, if provided) for the element
+			if ( !type ) {
+				for ( type in events ) {
+					jQuery.event.remove( elem, type + types[ t ], handler, selector, true );
+				}
+				continue;
+			}
+
+			special = jQuery.event.special[ type ] || {};
+			type = ( selector ? special.delegateType : special.bindType ) || type;
+			handlers = events[ type ] || [];
+			tmp = tmp[ 2 ] &&
+				new RegExp( "(^|\\.)" + namespaces.join( "\\.(?:.*\\.|)" ) + "(\\.|$)" );
+
+			// Remove matching events
+			origCount = j = handlers.length;
+			while ( j-- ) {
+				handleObj = handlers[ j ];
+
+				if ( ( mappedTypes || origType === handleObj.origType ) &&
+					( !handler || handler.guid === handleObj.guid ) &&
+					( !tmp || tmp.test( handleObj.namespace ) ) &&
+					( !selector || selector === handleObj.selector ||
+						selector === "**" && handleObj.selector ) ) {
+					handlers.splice( j, 1 );
+
+					if ( handleObj.selector ) {
+						handlers.delegateCount--;
+					}
+					if ( special.remove ) {
+						special.remove.call( elem, handleObj );
+					}
+				}
+			}
+
+			// Remove generic event handler if we removed something and no more handlers exist
+			// (avoids potential for endless recursion during removal of special event handlers)
+			if ( origCount && !handlers.length ) {
+				if ( !special.teardown ||
+					special.teardown.call( elem, namespaces, elemData.handle ) === false ) {
+
+					jQuery.removeEvent( elem, type, elemData.handle );
+				}
+
+				delete events[ type ];
+			}
+		}
+
+		// Remove data and the expando if it's no longer used
+		if ( jQuery.isEmptyObject( events ) ) {
+			dataPriv.remove( elem, "handle events" );
+		}
+	},
+
+	dispatch: function( nativeEvent ) {
+
+		var i, j, ret, matched, handleObj, handlerQueue,
+			args = new Array( arguments.length ),
+
+			// Make a writable jQuery.Event from the native event object
+			event = jQuery.event.fix( nativeEvent ),
+
+			handlers = (
+				dataPriv.get( this, "events" ) || Object.create( null )
+			)[ event.type ] || [],
+			special = jQuery.event.special[ event.type ] || {};
+
+		// Use the fix-ed jQuery.Event rather than the (read-only) native event
+		args[ 0 ] = event;
+
+		for ( i = 1; i < arguments.length; i++ ) {
+			args[ i ] = arguments[ i ];
+		}
+
+		event.delegateTarget = this;
+
+		// Call the preDispatch hook for the mapped type, and let it bail if desired
+		if ( special.preDispatch && special.preDispatch.call( this, event ) === false ) {
+			return;
+		}
+
+		// Determine handlers
+		handlerQueue = jQuery.event.handlers.call( this, event, handlers );
+
+		// Run delegates first; they may want to stop propagation beneath us
+		i = 0;
+		while ( ( matched = handlerQueue[ i++ ] ) && !event.isPropagationStopped() ) {
+			event.currentTarget = matched.elem;
+
+			j = 0;
+			while ( ( handleObj = matched.handlers[ j++ ] ) &&
+				!event.isImmediatePropagationStopped() ) {
+
+				// If the event is namespaced, then each handler is only invoked if it is
+				// specially universal or its namespaces are a superset of the event's.
+				if ( !event.rnamespace || handleObj.namespace === false ||
+					event.rnamespace.test( handleObj.namespace ) ) {
+
+					event.handleObj = handleObj;
+					event.data = handleObj.data;
+
+					ret = ( ( jQuery.event.special[ handleObj.origType ] || {} ).handle ||
+						handleObj.handler ).apply( matched.elem, args );
+
+					if ( ret !== undefined ) {
+						if ( ( event.result = ret ) === false ) {
+							event.preventDefault();
+							event.stopPropagation();
+						}
+					}
+				}
+			}
+		}
+
+		// Call the postDispatch hook for the mapped type
+		if ( special.postDispatch ) {
+			special.postDispatch.call( this, event );
+		}
+
+		return event.result;
+	},
+
+	handlers: function( event, handlers ) {
+		var i, handleObj, sel, matchedHandlers, matchedSelectors,
+			handlerQueue = [],
+			delegateCount = handlers.delegateCount,
+			cur = event.target;
+
+		// Find delegate handlers
+		if ( delegateCount &&
+
+			// Support: IE <=9
+			// Black-hole SVG <use> instance trees (trac-13180)
+			cur.nodeType &&
+
+			// Support: Firefox <=42
+			// Suppress spec-violating clicks indicating a non-primary pointer button (trac-3861)
+			// https://www.w3.org/TR/DOM-Level-3-Events/#event-type-click
+			// Support: IE 11 only
+			// ...but not arrow key "clicks" of radio inputs, which can have `button` -1 (gh-2343)
+			!( event.type === "click" && event.button >= 1 ) ) {
+
+			for ( ; cur !== this; cur = cur.parentNode || this ) {
+
+				// Don't check non-elements (trac-13208)
+				// Don't process clicks on disabled elements (trac-6911, trac-8165, trac-11382, trac-11764)
+				if ( cur.nodeType === 1 && !( event.type === "click" && cur.disabled === true ) ) {
+					matchedHandlers = [];
+					matchedSelectors = {};
+					for ( i = 0; i < delegateCount; i++ ) {
+						handleObj = handlers[ i ];
+
+						// Don't conflict with Object.prototype properties (trac-13203)
+						sel = handleObj.selector + " ";
+
+						if ( matchedSelectors[ sel ] === undefined ) {
+							matchedSelectors[ sel ] = handleObj.needsContext ?
+								jQuery( sel, this ).index( cur ) > -1 :
+								jQuery.find( sel, this, null, [ cur ] ).length;
+						}
+						if ( matchedSelectors[ sel ] ) {
+							matchedHandlers.push( handleObj );
+						}
+					}
+					if ( matchedHandlers.length ) {
+						handlerQueue.push( { elem: cur, handlers: matchedHandlers } );
+					}
+				}
+			}
+		}
+
+		// Add the remaining (directly-bound) handlers
+		cur = this;
+		if ( delegateCount < handlers.length ) {
+			handlerQueue.push( { elem: cur, handlers: handlers.slice( delegateCount ) } );
+		}
+
+		return handlerQueue;
+	},
+
+	addProp: function( name, hook ) {
+		Object.defineProperty( jQuery.Event.prototype, name, {
+			enumerable: true,
+			configurable: true,
+
+			get: isFunction( hook ) ?
+				function() {
+					if ( this.originalEvent ) {
+						return hook( this.originalEvent );
+					}
+				} :
+				function() {
+					if ( this.originalEvent ) {
+						return this.originalEvent[ name ];
+					}
+				},
+
+			set: function( value ) {
+				Object.defineProperty( this, name, {
+					enumerable: true,
+					configurable: true,
+					writable: true,
+					value: value
+				} );
+			}
+		} );
+	},
+
+	fix: function( originalEvent ) {
+		return originalEvent[ jQuery.expando ] ?
+			originalEvent :
+			new jQuery.Event( originalEvent );
+	},
+
+	special: {
+		load: {
+
+			// Prevent triggered image.load events from bubbling to window.load
+			noBubble: true
+		},
+		click: {
+
+			// Utilize native event to ensure correct state for checkable inputs
+			setup: function( data ) {
+
+				// For mutual compressibility with _default, replace `this` access with a local var.
+				// `|| data` is dead code meant only to preserve the variable through minification.
+				var el = this || data;
+
+				// Claim the first handler
+				if ( rcheckableType.test( el.type ) &&
+					el.click && nodeName( el, "input" ) ) {
+
+					// dataPriv.set( el, "click", ... )
+					leverageNative( el, "click", true );
+				}
+
+				// Return false to allow normal processing in the caller
+				return false;
+			},
+			trigger: function( data ) {
+
+				// For mutual compressibility with _default, replace `this` access with a local var.
+				// `|| data` is dead code meant only to preserve the variable through minification.
+				var el = this || data;
+
+				// Force setup before triggering a click
+				if ( rcheckableType.test( el.type ) &&
+					el.click && nodeName( el, "input" ) ) {
+
+					leverageNative( el, "click" );
+				}
+
+				// Return non-false to allow normal event-path propagation
+				return true;
+			},
+
+			// For cross-browser consistency, suppress native .click() on links
+			// Also prevent it if we're currently inside a leveraged native-event stack
+			_default: function( event ) {
+				var target = event.target;
+				return rcheckableType.test( target.type ) &&
+					target.click && nodeName( target, "input" ) &&
+					dataPriv.get( target, "click" ) ||
+					nodeName( target, "a" );
+			}
+		},
+
+		beforeunload: {
+			postDispatch: function( event ) {
+
+				// Support: Firefox 20+
+				// Firefox doesn't alert if the returnValue field is not set.
+				if ( event.result !== undefined && event.originalEvent ) {
+					event.originalEvent.returnValue = event.result;
+				}
+			}
+		}
+	}
+};
+
+// Ensure the presence of an event listener that handles manually-triggered
+// synthetic events by interrupting progress until reinvoked in response to
+// *native* events that it fires directly, ensuring that state changes have
+// already occurred before other listeners are invoked.
+function leverageNative( el, type, isSetup ) {
+
+	// Missing `isSetup` indicates a trigger call, which must force setup through jQuery.event.add
+	if ( !isSetup ) {
+		if ( dataPriv.get( el, type ) === undefined ) {
+			jQuery.event.add( el, type, returnTrue );
+		}
+		return;
+	}
+
+	// Register the controller as a special universal handler for all event namespaces
+	dataPriv.set( el, type, false );
+	jQuery.event.add( el, type, {
+		namespace: false,
+		handler: function( event ) {
+			var result,
+				saved = dataPriv.get( this, type );
+
+			if ( ( event.isTrigger & 1 ) && this[ type ] ) {
+
+				// Interrupt processing of the outer synthetic .trigger()ed event
+				if ( !saved ) {
+
+					// Store arguments for use when handling the inner native event
+					// There will always be at least one argument (an event object), so this array
+					// will not be confused with a leftover capture object.
+					saved = slice.call( arguments );
+					dataPriv.set( this, type, saved );
+
+					// Trigger the native event and capture its result
+					this[ type ]();
+					result = dataPriv.get( this, type );
+					dataPriv.set( this, type, false );
+
+					if ( saved !== result ) {
+
+						// Cancel the outer synthetic event
+						event.stopImmediatePropagation();
+						event.preventDefault();
+
+						return result;
+					}
+
+				// If this is an inner synthetic event for an event with a bubbling surrogate
+				// (focus or blur), assume that the surrogate already propagated from triggering
+				// the native event and prevent that from happening again here.
+				// This technically gets the ordering wrong w.r.t. to `.trigger()` (in which the
+				// bubbling surrogate propagates *after* the non-bubbling base), but that seems
+				// less bad than duplication.
+				} else if ( ( jQuery.event.special[ type ] || {} ).delegateType ) {
+					event.stopPropagation();
+				}
+
+			// If this is a native event triggered above, everything is now in order
+			// Fire an inner synthetic event with the original arguments
+			} else if ( saved ) {
+
+				// ...and capture the result
+				dataPriv.set( this, type, jQuery.event.trigger(
+					saved[ 0 ],
+					saved.slice( 1 ),
+					this
+				) );
+
+				// Abort handling of the native event by all jQuery handlers while allowing
+				// native handlers on the same element to run. On target, this is achieved
+				// by stopping immediate propagation just on the jQuery event. However,
+				// the native event is re-wrapped by a jQuery one on each level of the
+				// propagation so the only way to stop it for jQuery is to stop it for
+				// everyone via native `stopPropagation()`. This is not a problem for
+				// focus/blur which don't bubble, but it does also stop click on checkboxes
+				// and radios. We accept this limitation.
+				event.stopPropagation();
+				event.isImmediatePropagationStopped = returnTrue;
+			}
+		}
+	} );
+}
+
+jQuery.removeEvent = function( elem, type, handle ) {
+
+	// This "if" is needed for plain objects
+	if ( elem.removeEventListener ) {
+		elem.removeEventListener( type, handle );
+	}
+};
+
+jQuery.Event = function( src, props ) {
+
+	// Allow instantiation without the 'new' keyword
+	if ( !( this instanceof jQuery.Event ) ) {
+		return new jQuery.Event( src, props );
+	}
+
+	// Event object
+	if ( src && src.type ) {
+		this.originalEvent = src;
+		this.type = src.type;
+
+		// Events bubbling up the document may have been marked as prevented
+		// by a handler lower down the tree; reflect the correct value.
+		this.isDefaultPrevented = src.defaultPrevented ||
+				src.defaultPrevented === undefined &&
+
+				// Support: Android <=2.3 only
+				src.returnValue === false ?
+			returnTrue :
+			returnFalse;
+
+		// Create target properties
+		// Support: Safari <=6 - 7 only
+		// Target should not be a text node (trac-504, trac-13143)
+		this.target = ( src.target && src.target.nodeType === 3 ) ?
+			src.target.parentNode :
+			src.target;
+
+		this.currentTarget = src.currentTarget;
+		this.relatedTarget = src.relatedTarget;
+
+	// Event type
+	} else {
+		this.type = src;
+	}
+
+	// Put explicitly provided properties onto the event object
+	if ( props ) {
+		jQuery.extend( this, props );
+	}
+
+	// Create a timestamp if incoming event doesn't have one
+	this.timeStamp = src && src.timeStamp || Date.now();
+
+	// Mark it as fixed
+	this[ jQuery.expando ] = true;
+};
+
+// jQuery.Event is based on DOM3 Events as specified by the ECMAScript Language Binding
+// https://www.w3.org/TR/2003/WD-DOM-Level-3-Events-20030331/ecma-script-binding.html
+jQuery.Event.prototype = {
+	constructor: jQuery.Event,
+	isDefaultPrevented: returnFalse,
+	isPropagationStopped: returnFalse,
+	isImmediatePropagationStopped: returnFalse,
+	isSimulated: false,
+
+	preventDefault: function() {
+		var e = this.originalEvent;
+
+		this.isDefaultPrevented = returnTrue;
+
+		if ( e && !this.isSimulated ) {
+			e.preventDefault();
+		}
+	},
+	stopPropagation: function() {
+		var e = this.originalEvent;
+
+		this.isPropagationStopped = returnTrue;
+
+		if ( e && !this.isSimulated ) {
+			e.stopPropagation();
+		}
+	},
+	stopImmediatePropagation: function() {
+		var e = this.originalEvent;
+
+		this.isImmediatePropagationStopped = returnTrue;
+
+		if ( e && !this.isSimulated ) {
+			e.stopImmediatePropagation();
+		}
+
+		this.stopPropagation();
+	}
+};
+
+// Includes all common event props including KeyEvent and MouseEvent specific props
+jQuery.each( {
+	altKey: true,
+	bubbles: true,
+	cancelable: true,
+	changedTouches: true,
+	ctrlKey: true,
+	detail: true,
+	eventPhase: true,
+	metaKey: true,
+	pageX: true,
+	pageY: true,
+	shiftKey: true,
+	view: true,
+	"char": true,
+	code: true,
+	charCode: true,
+	key: true,
+	keyCode: true,
+	button: true,
+	buttons: true,
+	clientX: true,
+	clientY: true,
+	offsetX: true,
+	offsetY: true,
+	pointerId: true,
+	pointerType: true,
+	screenX: true,
+	screenY: true,
+	targetTouches: true,
+	toElement: true,
+	touches: true,
+	which: true
+}, jQuery.event.addProp );
+
+jQuery.each( { focus: "focusin", blur: "focusout" }, function( type, delegateType ) {
+
+	function focusMappedHandler( nativeEvent ) {
+		if ( document.documentMode ) {
+
+			// Support: IE 11+
+			// Attach a single focusin/focusout handler on the document while someone wants
+			// focus/blur. This is because the former are synchronous in IE while the latter
+			// are async. In other browsers, all those handlers are invoked synchronously.
+
+			// `handle` from private data would already wrap the event, but we need
+			// to change the `type` here.
+			var handle = dataPriv.get( this, "handle" ),
+				event = jQuery.event.fix( nativeEvent );
+			event.type = nativeEvent.type === "focusin" ? "focus" : "blur";
+			event.isSimulated = true;
+
+			// First, handle focusin/focusout
+			handle( nativeEvent );
+
+			// ...then, handle focus/blur
+			//
+			// focus/blur don't bubble while focusin/focusout do; simulate the former by only
+			// invoking the handler at the lower level.
+			if ( event.target === event.currentTarget ) {
+
+				// The setup part calls `leverageNative`, which, in turn, calls
+				// `jQuery.event.add`, so event handle will already have been set
+				// by this point.
+				handle( event );
+			}
+		} else {
+
+			// For non-IE browsers, attach a single capturing handler on the document
+			// while someone wants focusin/focusout.
+			jQuery.event.simulate( delegateType, nativeEvent.target,
+				jQuery.event.fix( nativeEvent ) );
+		}
+	}
+
+	jQuery.event.special[ type ] = {
+
+		// Utilize native event if possible so blur/focus sequence is correct
+		setup: function() {
+
+			var attaches;
+
+			// Claim the first handler
+			// dataPriv.set( this, "focus", ... )
+			// dataPriv.set( this, "blur", ... )
+			leverageNative( this, type, true );
+
+			if ( document.documentMode ) {
+
+				// Support: IE 9 - 11+
+				// We use the same native handler for focusin & focus (and focusout & blur)
+				// so we need to coordinate setup & teardown parts between those events.
+				// Use `delegateType` as the key as `type` is already used by `leverageNative`.
+				attaches = dataPriv.get( this, delegateType );
+				if ( !attaches ) {
+					this.addEventListener( delegateType, focusMappedHandler );
+				}
+				dataPriv.set( this, delegateType, ( attaches || 0 ) + 1 );
+			} else {
+
+				// Return false to allow normal processing in the caller
+				return false;
+			}
+		},
+		trigger: function() {
+
+			// Force setup before trigger
+			leverageNative( this, type );
+
+			// Return non-false to allow normal event-path propagation
+			return true;
+		},
+
+		teardown: function() {
+			var attaches;
+
+			if ( document.documentMode ) {
+				attaches = dataPriv.get( this, delegateType ) - 1;
+				if ( !attaches ) {
+					this.removeEventListener( delegateType, focusMappedHandler );
+					dataPriv.remove( this, delegateType );
+				} else {
+					dataPriv.set( this, delegateType, attaches );
+				}
+			} else {
+
+				// Return false to indicate standard teardown should be applied
+				return false;
+			}
+		},
+
+		// Suppress native focus or blur if we're currently inside
+		// a leveraged native-event stack
+		_default: function( event ) {
+			return dataPriv.get( event.target, type );
+		},
+
+		delegateType: delegateType
+	};
+
+	// Support: Firefox <=44
+	// Firefox doesn't have focus(in | out) events
+	// Related ticket - https://bugzilla.mozilla.org/show_bug.cgi?id=687787
+	//
+	// Support: Chrome <=48 - 49, Safari <=9.0 - 9.1
+	// focus(in | out) events fire after focus & blur events,
+	// which is spec violation - http://www.w3.org/TR/DOM-Level-3-Events/#events-focusevent-event-order
+	// Related ticket - https://bugs.chromium.org/p/chromium/issues/detail?id=449857
+	//
+	// Support: IE 9 - 11+
+	// To preserve relative focusin/focus & focusout/blur event order guaranteed on the 3.x branch,
+	// attach a single handler for both events in IE.
+	jQuery.event.special[ delegateType ] = {
+		setup: function() {
+
+			// Handle: regular nodes (via `this.ownerDocument`), window
+			// (via `this.document`) & document (via `this`).
+			var doc = this.ownerDocument || this.document || this,
+				dataHolder = document.documentMode ? this : doc,
+				attaches = dataPriv.get( dataHolder, delegateType );
+
+			// Support: IE 9 - 11+
+			// We use the same native handler for focusin & focus (and focusout & blur)
+			// so we need to coordinate setup & teardown parts between those events.
+			// Use `delegateType` as the key as `type` is already used by `leverageNative`.
+			if ( !attaches ) {
+				if ( document.documentMode ) {
+					this.addEventListener( delegateType, focusMappedHandler );
+				} else {
+					doc.addEventListener( type, focusMappedHandler, true );
+				}
+			}
+			dataPriv.set( dataHolder, delegateType, ( attaches || 0 ) + 1 );
+		},
+		teardown: function() {
+			var doc = this.ownerDocument || this.document || this,
+				dataHolder = document.documentMode ? this : doc,
+				attaches = dataPriv.get( dataHolder, delegateType ) - 1;
+
+			if ( !attaches ) {
+				if ( document.documentMode ) {
+					this.removeEventListener( delegateType, focusMappedHandler );
+				} else {
+					doc.removeEventListener( type, focusMappedHandler, true );
+				}
+				dataPriv.remove( dataHolder, delegateType );
+			} else {
+				dataPriv.set( dataHolder, delegateType, attaches );
+			}
+		}
+	};
+} );
+
+// Create mouseenter/leave events using mouseover/out and event-time checks
+// so that event delegation works in jQuery.
+// Do the same for pointerenter/pointerleave and pointerover/pointerout
+//
+// Support: Safari 7 only
+// Safari sends mouseenter too often; see:
+// https://bugs.chromium.org/p/chromium/issues/detail?id=470258
+// for the description of the bug (it existed in older Chrome versions as well).
+jQuery.each( {
+	mouseenter: "mouseover",
+	mouseleave: "mouseout",
+	pointerenter: "pointerover",
+	pointerleave: "pointerout"
+}, function( orig, fix ) {
+	jQuery.event.special[ orig ] = {
+		delegateType: fix,
+		bindType: fix,
+
+		handle: function( event ) {
+			var ret,
+				target = this,
+				related = event.relatedTarget,
+				handleObj = event.handleObj;
+
+			// For mouseenter/leave call the handler if related is outside the target.
+			// NB: No relatedTarget if the mouse left/entered the browser window
+			if ( !related || ( related !== target && !jQuery.contains( target, related ) ) ) {
+				event.type = handleObj.origType;
+				ret = handleObj.handler.apply( this, arguments );
+				event.type = fix;
+			}
+			return ret;
+		}
+	};
+} );
+
+jQuery.fn.extend( {
+
+	on: function( types, selector, data, fn ) {
+		return on( this, types, selector, data, fn );
+	},
+	one: function( types, selector, data, fn ) {
+		return on( this, types, selector, data, fn, 1 );
+	},
+	off: function( types, selector, fn ) {
+		var handleObj, type;
+		if ( types && types.preventDefault && types.handleObj ) {
+
+			// ( event )  dispatched jQuery.Event
+			handleObj = types.handleObj;
+			jQuery( types.delegateTarget ).off(
+				handleObj.namespace ?
+					handleObj.origType + "." + handleObj.namespace :
+					handleObj.origType,
+				handleObj.selector,
+				handleObj.handler
+			);
+			return this;
+		}
+		if ( typeof types === "object" ) {
+
+			// ( types-object [, selector] )
+			for ( type in types ) {
+				this.off( type, selector, types[ type ] );
+			}
+			return this;
+		}
+		if ( selector === false || typeof selector === "function" ) {
+
+			// ( types [, fn] )
+			fn = selector;
+			selector = undefined;
+		}
+		if ( fn === false ) {
+			fn = returnFalse;
+		}
+		return this.each( function() {
+			jQuery.event.remove( this, types, fn, selector );
+		} );
+	}
+} );
+
+
+var
+
+	// Support: IE <=10 - 11, Edge 12 - 13 only
+	// In IE/Edge using regex groups here causes severe slowdowns.
+	// See https://connect.microsoft.com/IE/feedback/details/1736512/
+	rnoInnerhtml = /<script|<style|<link/i,
+
+	// checked="checked" or checked
+	rchecked = /checked\s*(?:[^=]|=\s*.checked.)/i,
+
+	rcleanScript = /^\s*<!\[CDATA\[|\]\]>\s*$/g;
+
+// Prefer a tbody over its parent table for containing new rows
+function manipulationTarget( elem, content ) {
+	if ( nodeName( elem, "table" ) &&
+		nodeName( content.nodeType !== 11 ? content : content.firstChild, "tr" ) ) {
+
+		return jQuery( elem ).children( "tbody" )[ 0 ] || elem;
+	}
+
+	return elem;
+}
+
+// Replace/restore the type attribute of script elements for safe DOM manipulation
+function disableScript( elem ) {
+	elem.type = ( elem.getAttribute( "type" ) !== null ) + "/" + elem.type;
+	return elem;
+}
+function restoreScript( elem ) {
+	if ( ( elem.type || "" ).slice( 0, 5 ) === "true/" ) {
+		elem.type = elem.type.slice( 5 );
+	} else {
+		elem.removeAttribute( "type" );
+	}
+
+	return elem;
+}
+
+function cloneCopyEvent( src, dest ) {
+	var i, l, type, pdataOld, udataOld, udataCur, events;
+
+	if ( dest.nodeType !== 1 ) {
+		return;
+	}
+
+	// 1. Copy private data: events, handlers, etc.
+	if ( dataPriv.hasData( src ) ) {
+		pdataOld = dataPriv.get( src );
+		events = pdataOld.events;
+
+		if ( events ) {
+			dataPriv.remove( dest, "handle events" );
+
+			for ( type in events ) {
+				for ( i = 0, l = events[ type ].length; i < l; i++ ) {
+					jQuery.event.add( dest, type, events[ type ][ i ] );
+				}
+			}
+		}
+	}
+
+	// 2. Copy user data
+	if ( dataUser.hasData( src ) ) {
+		udataOld = dataUser.access( src );
+		udataCur = jQuery.extend( {}, udataOld );
+
+		dataUser.set( dest, udataCur );
+	}
+}
+
+// Fix IE bugs, see support tests
+function fixInput( src, dest ) {
+	var nodeName = dest.nodeName.toLowerCase();
+
+	// Fails to persist the checked state of a cloned checkbox or radio button.
+	if ( nodeName === "input" && rcheckableType.test( src.type ) ) {
+		dest.checked = src.checked;
+
+	// Fails to return the selected option to the default selected state when cloning options
+	} else if ( nodeName === "input" || nodeName === "textarea" ) {
+		dest.defaultValue = src.defaultValue;
+	}
+}
+
+function domManip( collection, args, callback, ignored ) {
+
+	// Flatten any nested arrays
+	args = flat( args );
+
+	var fragment, first, scripts, hasScripts, node, doc,
+		i = 0,
+		l = collection.length,
+		iNoClone = l - 1,
+		value = args[ 0 ],
+		valueIsFunction = isFunction( value );
+
+	// We can't cloneNode fragments that contain checked, in WebKit
+	if ( valueIsFunction ||
+			( l > 1 && typeof value === "string" &&
+				!support.checkClone && rchecked.test( value ) ) ) {
+		return collection.each( function( index ) {
+			var self = collection.eq( index );
+			if ( valueIsFunction ) {
+				args[ 0 ] = value.call( this, index, self.html() );
+			}
+			domManip( self, args, callback, ignored );
+		} );
+	}
+
+	if ( l ) {
+		fragment = buildFragment( args, collection[ 0 ].ownerDocument, false, collection, ignored );
+		first = fragment.firstChild;
+
+		if ( fragment.childNodes.length === 1 ) {
+			fragment = first;
+		}
+
+		// Require either new content or an interest in ignored elements to invoke the callback
+		if ( first || ignored ) {
+			scripts = jQuery.map( getAll( fragment, "script" ), disableScript );
+			hasScripts = scripts.length;
+
+			// Use the original fragment for the last item
+			// instead of the first because it can end up
+			// being emptied incorrectly in certain situations (trac-8070).
+			for ( ; i < l; i++ ) {
+				node = fragment;
+
+				if ( i !== iNoClone ) {
+					node = jQuery.clone( node, true, true );
+
+					// Keep references to cloned scripts for later restoration
+					if ( hasScripts ) {
+
+						// Support: Android <=4.0 only, PhantomJS 1 only
+						// push.apply(_, arraylike) throws on ancient WebKit
+						jQuery.merge( scripts, getAll( node, "script" ) );
+					}
+				}
+
+				callback.call( collection[ i ], node, i );
+			}
+
+			if ( hasScripts ) {
+				doc = scripts[ scripts.length - 1 ].ownerDocument;
+
+				// Re-enable scripts
+				jQuery.map( scripts, restoreScript );
+
+				// Evaluate executable scripts on first document insertion
+				for ( i = 0; i < hasScripts; i++ ) {
+					node = scripts[ i ];
+					if ( rscriptType.test( node.type || "" ) &&
+						!dataPriv.access( node, "globalEval" ) &&
+						jQuery.contains( doc, node ) ) {
+
+						if ( node.src && ( node.type || "" ).toLowerCase()  !== "module" ) {
+
+							// Optional AJAX dependency, but won't run scripts if not present
+							if ( jQuery._evalUrl && !node.noModule ) {
+								jQuery._evalUrl( node.src, {
+									nonce: node.nonce || node.getAttribute( "nonce" )
+								}, doc );
+							}
+						} else {
+
+							// Unwrap a CDATA section containing script contents. This shouldn't be
+							// needed as in XML documents they're already not visible when
+							// inspecting element contents and in HTML documents they have no
+							// meaning but we're preserving that logic for backwards compatibility.
+							// This will be removed completely in 4.0. See gh-4904.
+							DOMEval( node.textContent.replace( rcleanScript, "" ), node, doc );
+						}
+					}
+				}
+			}
+		}
+	}
+
+	return collection;
+}
+
+function remove( elem, selector, keepData ) {
+	var node,
+		nodes = selector ? jQuery.filter( selector, elem ) : elem,
+		i = 0;
+
+	for ( ; ( node = nodes[ i ] ) != null; i++ ) {
+		if ( !keepData && node.nodeType === 1 ) {
+			jQuery.cleanData( getAll( node ) );
+		}
+
+		if ( node.parentNode ) {
+			if ( keepData && isAttached( node ) ) {
+				setGlobalEval( getAll( node, "script" ) );
+			}
+			node.parentNode.removeChild( node );
+		}
+	}
+
+	return elem;
+}
+
+jQuery.extend( {
+	htmlPrefilter: function( html ) {
+		return html;
+	},
+
+	clone: function( elem, dataAndEvents, deepDataAndEvents ) {
+		var i, l, srcElements, destElements,
+			clone = elem.cloneNode( true ),
+			inPage = isAttached( elem );
+
+		// Fix IE cloning issues
+		if ( !support.noCloneChecked && ( elem.nodeType === 1 || elem.nodeType === 11 ) &&
+				!jQuery.isXMLDoc( elem ) ) {
+
+			// We eschew jQuery#find here for performance reasons:
+			// https://jsperf.com/getall-vs-sizzle/2
+			destElements = getAll( clone );
+			srcElements = getAll( elem );
+
+			for ( i = 0, l = srcElements.length; i < l; i++ ) {
+				fixInput( srcElements[ i ], destElements[ i ] );
+			}
+		}
+
+		// Copy the events from the original to the clone
+		if ( dataAndEvents ) {
+			if ( deepDataAndEvents ) {
+				srcElements = srcElements || getAll( elem );
+				destElements = destElements || getAll( clone );
+
+				for ( i = 0, l = srcElements.length; i < l; i++ ) {
+					cloneCopyEvent( srcElements[ i ], destElements[ i ] );
+				}
+			} else {
+				cloneCopyEvent( elem, clone );
+			}
+		}
+
+		// Preserve script evaluation history
+		destElements = getAll( clone, "script" );
+		if ( destElements.length > 0 ) {
+			setGlobalEval( destElements, !inPage && getAll( elem, "script" ) );
+		}
+
+		// Return the cloned set
+		return clone;
+	},
+
+	cleanData: function( elems ) {
+		var data, elem, type,
+			special = jQuery.event.special,
+			i = 0;
+
+		for ( ; ( elem = elems[ i ] ) !== undefined; i++ ) {
+			if ( acceptData( elem ) ) {
+				if ( ( data = elem[ dataPriv.expando ] ) ) {
+					if ( data.events ) {
+						for ( type in data.events ) {
+							if ( special[ type ] ) {
+								jQuery.event.remove( elem, type );
+
+							// This is a shortcut to avoid jQuery.event.remove's overhead
+							} else {
+								jQuery.removeEvent( elem, type, data.handle );
+							}
+						}
+					}
+
+					// Support: Chrome <=35 - 45+
+					// Assign undefined instead of using delete, see Data#remove
+					elem[ dataPriv.expando ] = undefined;
+				}
+				if ( elem[ dataUser.expando ] ) {
+
+					// Support: Chrome <=35 - 45+
+					// Assign undefined instead of using delete, see Data#remove
+					elem[ dataUser.expando ] = undefined;
+				}
+			}
+		}
+	}
+} );
+
+jQuery.fn.extend( {
+	detach: function( selector ) {
+		return remove( this, selector, true );
+	},
+
+	remove: function( selector ) {
+		return remove( this, selector );
+	},
+
+	text: function( value ) {
+		return access( this, function( value ) {
+			return value === undefined ?
+				jQuery.text( this ) :
+				this.empty().each( function() {
+					if ( this.nodeType === 1 || this.nodeType === 11 || this.nodeType === 9 ) {
+						this.textContent = value;
+					}
+				} );
+		}, null, value, arguments.length );
+	},
+
+	append: function() {
+		return domManip( this, arguments, function( elem ) {
+			if ( this.nodeType === 1 || this.nodeType === 11 || this.nodeType === 9 ) {
+				var target = manipulationTarget( this, elem );
+				target.appendChild( elem );
+			}
+		} );
+	},
+
+	prepend: function() {
+		return domManip( this, arguments, function( elem ) {
+			if ( this.nodeType === 1 || this.nodeType === 11 || this.nodeType === 9 ) {
+				var target = manipulationTarget( this, elem );
+				target.insertBefore( elem, target.firstChild );
+			}
+		} );
+	},
+
+	before: function() {
+		return domManip( this, arguments, function( elem ) {
+			if ( this.parentNode ) {
+				this.parentNode.insertBefore( elem, this );
+			}
+		} );
+	},
+
+	after: function() {
+		return domManip( this, arguments, function( elem ) {
+			if ( this.parentNode ) {
+				this.parentNode.insertBefore( elem, this.nextSibling );
+			}
+		} );
+	},
+
+	empty: function() {
+		var elem,
+			i = 0;
+
+		for ( ; ( elem = this[ i ] ) != null; i++ ) {
+			if ( elem.nodeType === 1 ) {
+
+				// Prevent memory leaks
+				jQuery.cleanData( getAll( elem, false ) );
+
+				// Remove any remaining nodes
+				elem.textContent = "";
+			}
+		}
+
+		return this;
+	},
+
+	clone: function( dataAndEvents, deepDataAndEvents ) {
+		dataAndEvents = dataAndEvents == null ? false : dataAndEvents;
+		deepDataAndEvents = deepDataAndEvents == null ? dataAndEvents : deepDataAndEvents;
+
+		return this.map( function() {
+			return jQuery.clone( this, dataAndEvents, deepDataAndEvents );
+		} );
+	},
+
+	html: function( value ) {
+		return access( this, function( value ) {
+			var elem = this[ 0 ] || {},
+				i = 0,
+				l = this.length;
+
+			if ( value === undefined && elem.nodeType === 1 ) {
+				return elem.innerHTML;
+			}
+
+			// See if we can take a shortcut and just use innerHTML
+			if ( typeof value === "string" && !rnoInnerhtml.test( value ) &&
+				!wrapMap[ ( rtagName.exec( value ) || [ "", "" ] )[ 1 ].toLowerCase() ] ) {
+
+				value = jQuery.htmlPrefilter( value );
+
+				try {
+					for ( ; i < l; i++ ) {
+						elem = this[ i ] || {};
+
+						// Remove element nodes and prevent memory leaks
+						if ( elem.nodeType === 1 ) {
+							jQuery.cleanData( getAll( elem, false ) );
+							elem.innerHTML = value;
+						}
+					}
+
+					elem = 0;
+
+				// If using innerHTML throws an exception, use the fallback method
+				} catch ( e ) {}
+			}
+
+			if ( elem ) {
+				this.empty().append( value );
+			}
+		}, null, value, arguments.length );
+	},
+
+	replaceWith: function() {
+		var ignored = [];
+
+		// Make the changes, replacing each non-ignored context element with the new content
+		return domManip( this, arguments, function( elem ) {
+			var parent = this.parentNode;
+
+			if ( jQuery.inArray( this, ignored ) < 0 ) {
+				jQuery.cleanData( getAll( this ) );
+				if ( parent ) {
+					parent.replaceChild( elem, this );
+				}
+			}
+
+		// Force callback invocation
+		}, ignored );
+	}
+} );
+
+jQuery.each( {
+	appendTo: "append",
+	prependTo: "prepend",
+	insertBefore: "before",
+	insertAfter: "after",
+	replaceAll: "replaceWith"
+}, function( name, original ) {
+	jQuery.fn[ name ] = function( selector ) {
+		var elems,
+			ret = [],
+			insert = jQuery( selector ),
+			last = insert.length - 1,
+			i = 0;
+
+		for ( ; i <= last; i++ ) {
+			elems = i === last ? this : this.clone( true );
+			jQuery( insert[ i ] )[ original ]( elems );
+
+			// Support: Android <=4.0 only, PhantomJS 1 only
+			// .get() because push.apply(_, arraylike) throws on ancient WebKit
+			push.apply( ret, elems.get() );
+		}
+
+		return this.pushStack( ret );
+	};
+} );
+var rnumnonpx = new RegExp( "^(" + pnum + ")(?!px)[a-z%]+$", "i" );
+
+var rcustomProp = /^--/;
+
+
+var getStyles = function( elem ) {
+
+		// Support: IE <=11 only, Firefox <=30 (trac-15098, trac-14150)
+		// IE throws on elements created in popups
+		// FF meanwhile throws on frame elements through "defaultView.getComputedStyle"
+		var view = elem.ownerDocument.defaultView;
+
+		if ( !view || !view.opener ) {
+			view = window;
+		}
+
+		return view.getComputedStyle( elem );
+	};
+
+var swap = function( elem, options, callback ) {
+	var ret, name,
+		old = {};
+
+	// Remember the old values, and insert the new ones
+	for ( name in options ) {
+		old[ name ] = elem.style[ name ];
+		elem.style[ name ] = options[ name ];
+	}
+
+	ret = callback.call( elem );
+
+	// Revert the old values
+	for ( name in options ) {
+		elem.style[ name ] = old[ name ];
+	}
+
+	return ret;
+};
+
+
+var rboxStyle = new RegExp( cssExpand.join( "|" ), "i" );
+
+
+
+( function() {
+
+	// Executing both pixelPosition & boxSizingReliable tests require only one layout
+	// so they're executed at the same time to save the second computation.
+	function computeStyleTests() {
+
+		// This is a singleton, we need to execute it only once
+		if ( !div ) {
+			return;
+		}
+
+		container.style.cssText = "position:absolute;left:-11111px;width:60px;" +
+			"margin-top:1px;padding:0;border:0";
+		div.style.cssText =
+			"position:relative;display:block;box-sizing:border-box;overflow:scroll;" +
+			"margin:auto;border:1px;padding:1px;" +
+			"width:60%;top:1%";
+		documentElement.appendChild( container ).appendChild( div );
+
+		var divStyle = window.getComputedStyle( div );
+		pixelPositionVal = divStyle.top !== "1%";
+
+		// Support: Android 4.0 - 4.3 only, Firefox <=3 - 44
+		reliableMarginLeftVal = roundPixelMeasures( divStyle.marginLeft ) === 12;
+
+		// Support: Android 4.0 - 4.3 only, Safari <=9.1 - 10.1, iOS <=7.0 - 9.3
+		// Some styles come back with percentage values, even though they shouldn't
+		div.style.right = "60%";
+		pixelBoxStylesVal = roundPixelMeasures( divStyle.right ) === 36;
+
+		// Support: IE 9 - 11 only
+		// Detect misreporting of content dimensions for box-sizing:border-box elements
+		boxSizingReliableVal = roundPixelMeasures( divStyle.width ) === 36;
+
+		// Support: IE 9 only
+		// Detect overflow:scroll screwiness (gh-3699)
+		// Support: Chrome <=64
+		// Don't get tricked when zoom affects offsetWidth (gh-4029)
+		div.style.position = "absolute";
+		scrollboxSizeVal = roundPixelMeasures( div.offsetWidth / 3 ) === 12;
+
+		documentElement.removeChild( container );
+
+		// Nullify the div so it wouldn't be stored in the memory and
+		// it will also be a sign that checks already performed
+		div = null;
+	}
+
+	function roundPixelMeasures( measure ) {
+		return Math.round( parseFloat( measure ) );
+	}
+
+	var pixelPositionVal, boxSizingReliableVal, scrollboxSizeVal, pixelBoxStylesVal,
+		reliableTrDimensionsVal, reliableMarginLeftVal,
+		container = document.createElement( "div" ),
+		div = document.createElement( "div" );
+
+	// Finish early in limited (non-browser) environments
+	if ( !div.style ) {
+		return;
+	}
+
+	// Support: IE <=9 - 11 only
+	// Style of cloned element affects source element cloned (trac-8908)
+	div.style.backgroundClip = "content-box";
+	div.cloneNode( true ).style.backgroundClip = "";
+	support.clearCloneStyle = div.style.backgroundClip === "content-box";
+
+	jQuery.extend( support, {
+		boxSizingReliable: function() {
+			computeStyleTests();
+			return boxSizingReliableVal;
+		},
+		pixelBoxStyles: function() {
+			computeStyleTests();
+			return pixelBoxStylesVal;
+		},
+		pixelPosition: function() {
+			computeStyleTests();
+			return pixelPositionVal;
+		},
+		reliableMarginLeft: function() {
+			computeStyleTests();
+			return reliableMarginLeftVal;
+		},
+		scrollboxSize: function() {
+			computeStyleTests();
+			return scrollboxSizeVal;
+		},
+
+		// Support: IE 9 - 11+, Edge 15 - 18+
+		// IE/Edge misreport `getComputedStyle` of table rows with width/height
+		// set in CSS while `offset*` properties report correct values.
+		// Behavior in IE 9 is more subtle than in newer versions & it passes
+		// some versions of this test; make sure not to make it pass there!
+		//
+		// Support: Firefox 70+
+		// Only Firefox includes border widths
+		// in computed dimensions. (gh-4529)
+		reliableTrDimensions: function() {
+			var table, tr, trChild, trStyle;
+			if ( reliableTrDimensionsVal == null ) {
+				table = document.createElement( "table" );
+				tr = document.createElement( "tr" );
+				trChild = document.createElement( "div" );
+
+				table.style.cssText = "position:absolute;left:-11111px;border-collapse:separate";
+				tr.style.cssText = "box-sizing:content-box;border:1px solid";
+
+				// Support: Chrome 86+
+				// Height set through cssText does not get applied.
+				// Computed height then comes back as 0.
+				tr.style.height = "1px";
+				trChild.style.height = "9px";
+
+				// Support: Android 8 Chrome 86+
+				// In our bodyBackground.html iframe,
+				// display for all div elements is set to "inline",
+				// which causes a problem only in Android 8 Chrome 86.
+				// Ensuring the div is `display: block`
+				// gets around this issue.
+				trChild.style.display = "block";
+
+				documentElement
+					.appendChild( table )
+					.appendChild( tr )
+					.appendChild( trChild );
+
+				trStyle = window.getComputedStyle( tr );
+				reliableTrDimensionsVal = ( parseInt( trStyle.height, 10 ) +
+					parseInt( trStyle.borderTopWidth, 10 ) +
+					parseInt( trStyle.borderBottomWidth, 10 ) ) === tr.offsetHeight;
+
+				documentElement.removeChild( table );
+			}
+			return reliableTrDimensionsVal;
+		}
+	} );
+} )();
+
+
+function curCSS( elem, name, computed ) {
+	var width, minWidth, maxWidth, ret,
+		isCustomProp = rcustomProp.test( name ),
+
+		// Support: Firefox 51+
+		// Retrieving style before computed somehow
+		// fixes an issue with getting wrong values
+		// on detached elements
+		style = elem.style;
+
+	computed = computed || getStyles( elem );
+
+	// getPropertyValue is needed for:
+	//   .css('filter') (IE 9 only, trac-12537)
+	//   .css('--customProperty) (gh-3144)
+	if ( computed ) {
+
+		// Support: IE <=9 - 11+
+		// IE only supports `"float"` in `getPropertyValue`; in computed styles
+		// it's only available as `"cssFloat"`. We no longer modify properties
+		// sent to `.css()` apart from camelCasing, so we need to check both.
+		// Normally, this would create difference in behavior: if
+		// `getPropertyValue` returns an empty string, the value returned
+		// by `.css()` would be `undefined`. This is usually the case for
+		// disconnected elements. However, in IE even disconnected elements
+		// with no styles return `"none"` for `getPropertyValue( "float" )`
+		ret = computed.getPropertyValue( name ) || computed[ name ];
+
+		if ( isCustomProp && ret ) {
+
+			// Support: Firefox 105+, Chrome <=105+
+			// Spec requires trimming whitespace for custom properties (gh-4926).
+			// Firefox only trims leading whitespace. Chrome just collapses
+			// both leading & trailing whitespace to a single space.
+			//
+			// Fall back to `undefined` if empty string returned.
+			// This collapses a missing definition with property defined
+			// and set to an empty string but there's no standard API
+			// allowing us to differentiate them without a performance penalty
+			// and returning `undefined` aligns with older jQuery.
+			//
+			// rtrimCSS treats U+000D CARRIAGE RETURN and U+000C FORM FEED
+			// as whitespace while CSS does not, but this is not a problem
+			// because CSS preprocessing replaces them with U+000A LINE FEED
+			// (which *is* CSS whitespace)
+			// https://www.w3.org/TR/css-syntax-3/#input-preprocessing
+			ret = ret.replace( rtrimCSS, "$1" ) || undefined;
+		}
+
+		if ( ret === "" && !isAttached( elem ) ) {
+			ret = jQuery.style( elem, name );
+		}
+
+		// A tribute to the "awesome hack by Dean Edwards"
+		// Android Browser returns percentage for some values,
+		// but width seems to be reliably pixels.
+		// This is against the CSSOM draft spec:
+		// https://drafts.csswg.org/cssom/#resolved-values
+		if ( !support.pixelBoxStyles() && rnumnonpx.test( ret ) && rboxStyle.test( name ) ) {
+
+			// Remember the original values
+			width = style.width;
+			minWidth = style.minWidth;
+			maxWidth = style.maxWidth;
+
+			// Put in the new values to get a computed value out
+			style.minWidth = style.maxWidth = style.width = ret;
+			ret = computed.width;
+
+			// Revert the changed values
+			style.width = width;
+			style.minWidth = minWidth;
+			style.maxWidth = maxWidth;
+		}
+	}
+
+	return ret !== undefined ?
+
+		// Support: IE <=9 - 11 only
+		// IE returns zIndex value as an integer.
+		ret + "" :
+		ret;
+}
+
+
+function addGetHookIf( conditionFn, hookFn ) {
+
+	// Define the hook, we'll check on the first run if it's really needed.
+	return {
+		get: function() {
+			if ( conditionFn() ) {
+
+				// Hook not needed (or it's not possible to use it due
+				// to missing dependency), remove it.
+				delete this.get;
+				return;
+			}
+
+			// Hook needed; redefine it so that the support test is not executed again.
+			return ( this.get = hookFn ).apply( this, arguments );
+		}
+	};
+}
+
+
+var cssPrefixes = [ "Webkit", "Moz", "ms" ],
+	emptyStyle = document.createElement( "div" ).style,
+	vendorProps = {};
+
+// Return a vendor-prefixed property or undefined
+function vendorPropName( name ) {
+
+	// Check for vendor prefixed names
+	var capName = name[ 0 ].toUpperCase() + name.slice( 1 ),
+		i = cssPrefixes.length;
+
+	while ( i-- ) {
+		name = cssPrefixes[ i ] + capName;
+		if ( name in emptyStyle ) {
+			return name;
+		}
+	}
+}
+
+// Return a potentially-mapped jQuery.cssProps or vendor prefixed property
+function finalPropName( name ) {
+	var final = jQuery.cssProps[ name ] || vendorProps[ name ];
+
+	if ( final ) {
+		return final;
+	}
+	if ( name in emptyStyle ) {
+		return name;
+	}
+	return vendorProps[ name ] = vendorPropName( name ) || name;
+}
+
+
+var
+
+	// Swappable if display is none or starts with table
+	// except "table", "table-cell", or "table-caption"
+	// See here for display values: https://developer.mozilla.org/en-US/docs/CSS/display
+	rdisplayswap = /^(none|table(?!-c[ea]).+)/,
+	cssShow = { position: "absolute", visibility: "hidden", display: "block" },
+	cssNormalTransform = {
+		letterSpacing: "0",
+		fontWeight: "400"
+	};
+
+function setPositiveNumber( _elem, value, subtract ) {
+
+	// Any relative (+/-) values have already been
+	// normalized at this point
+	var matches = rcssNum.exec( value );
+	return matches ?
+
+		// Guard against undefined "subtract", e.g., when used as in cssHooks
+		Math.max( 0, matches[ 2 ] - ( subtract || 0 ) ) + ( matches[ 3 ] || "px" ) :
+		value;
+}
+
+function boxModelAdjustment( elem, dimension, box, isBorderBox, styles, computedVal ) {
+	var i = dimension === "width" ? 1 : 0,
+		extra = 0,
+		delta = 0,
+		marginDelta = 0;
+
+	// Adjustment may not be necessary
+	if ( box === ( isBorderBox ? "border" : "content" ) ) {
+		return 0;
+	}
+
+	for ( ; i < 4; i += 2 ) {
+
+		// Both box models exclude margin
+		// Count margin delta separately to only add it after scroll gutter adjustment.
+		// This is needed to make negative margins work with `outerHeight( true )` (gh-3982).
+		if ( box === "margin" ) {
+			marginDelta += jQuery.css( elem, box + cssExpand[ i ], true, styles );
+		}
+
+		// If we get here with a content-box, we're seeking "padding" or "border" or "margin"
+		if ( !isBorderBox ) {
+
+			// Add padding
+			delta += jQuery.css( elem, "padding" + cssExpand[ i ], true, styles );
+
+			// For "border" or "margin", add border
+			if ( box !== "padding" ) {
+				delta += jQuery.css( elem, "border" + cssExpand[ i ] + "Width", true, styles );
+
+			// But still keep track of it otherwise
+			} else {
+				extra += jQuery.css( elem, "border" + cssExpand[ i ] + "Width", true, styles );
+			}
+
+		// If we get here with a border-box (content + padding + border), we're seeking "content" or
+		// "padding" or "margin"
+		} else {
+
+			// For "content", subtract padding
+			if ( box === "content" ) {
+				delta -= jQuery.css( elem, "padding" + cssExpand[ i ], true, styles );
+			}
+
+			// For "content" or "padding", subtract border
+			if ( box !== "margin" ) {
+				delta -= jQuery.css( elem, "border" + cssExpand[ i ] + "Width", true, styles );
+			}
+		}
+	}
+
+	// Account for positive content-box scroll gutter when requested by providing computedVal
+	if ( !isBorderBox && computedVal >= 0 ) {
+
+		// offsetWidth/offsetHeight is a rounded sum of content, padding, scroll gutter, and border
+		// Assuming integer scroll gutter, subtract the rest and round down
+		delta += Math.max( 0, Math.ceil(
+			elem[ "offset" + dimension[ 0 ].toUpperCase() + dimension.slice( 1 ) ] -
+			computedVal -
+			delta -
+			extra -
+			0.5
+
+		// If offsetWidth/offsetHeight is unknown, then we can't determine content-box scroll gutter
+		// Use an explicit zero to avoid NaN (gh-3964)
+		) ) || 0;
+	}
+
+	return delta + marginDelta;
+}
+
+function getWidthOrHeight( elem, dimension, extra ) {
+
+	// Start with computed style
+	var styles = getStyles( elem ),
+
+		// To avoid forcing a reflow, only fetch boxSizing if we need it (gh-4322).
+		// Fake content-box until we know it's needed to know the true value.
+		boxSizingNeeded = !support.boxSizingReliable() || extra,
+		isBorderBox = boxSizingNeeded &&
+			jQuery.css( elem, "boxSizing", false, styles ) === "border-box",
+		valueIsBorderBox = isBorderBox,
+
+		val = curCSS( elem, dimension, styles ),
+		offsetProp = "offset" + dimension[ 0 ].toUpperCase() + dimension.slice( 1 );
+
+	// Support: Firefox <=54
+	// Return a confounding non-pixel value or feign ignorance, as appropriate.
+	if ( rnumnonpx.test( val ) ) {
+		if ( !extra ) {
+			return val;
+		}
+		val = "auto";
+	}
+
+
+	// Support: IE 9 - 11 only
+	// Use offsetWidth/offsetHeight for when box sizing is unreliable.
+	// In those cases, the computed value can be trusted to be border-box.
+	if ( ( !support.boxSizingReliable() && isBorderBox ||
+
+		// Support: IE 10 - 11+, Edge 15 - 18+
+		// IE/Edge misreport `getComputedStyle` of table rows with width/height
+		// set in CSS while `offset*` properties report correct values.
+		// Interestingly, in some cases IE 9 doesn't suffer from this issue.
+		!support.reliableTrDimensions() && nodeName( elem, "tr" ) ||
+
+		// Fall back to offsetWidth/offsetHeight when value is "auto"
+		// This happens for inline elements with no explicit setting (gh-3571)
+		val === "auto" ||
+
+		// Support: Android <=4.1 - 4.3 only
+		// Also use offsetWidth/offsetHeight for misreported inline dimensions (gh-3602)
+		!parseFloat( val ) && jQuery.css( elem, "display", false, styles ) === "inline" ) &&
+
+		// Make sure the element is visible & connected
+		elem.getClientRects().length ) {
+
+		isBorderBox = jQuery.css( elem, "boxSizing", false, styles ) === "border-box";
+
+		// Where available, offsetWidth/offsetHeight approximate border box dimensions.
+		// Where not available (e.g., SVG), assume unreliable box-sizing and interpret the
+		// retrieved value as a content box dimension.
+		valueIsBorderBox = offsetProp in elem;
+		if ( valueIsBorderBox ) {
+			val = elem[ offsetProp ];
+		}
+	}
+
+	// Normalize "" and auto
+	val = parseFloat( val ) || 0;
+
+	// Adjust for the element's box model
+	return ( val +
+		boxModelAdjustment(
+			elem,
+			dimension,
+			extra || ( isBorderBox ? "border" : "content" ),
+			valueIsBorderBox,
+			styles,
+
+			// Provide the current computed size to request scroll gutter calculation (gh-3589)
+			val
+		)
+	) + "px";
+}
+
+jQuery.extend( {
+
+	// Add in style property hooks for overriding the default
+	// behavior of getting and setting a style property
+	cssHooks: {
+		opacity: {
+			get: function( elem, computed ) {
+				if ( computed ) {
+
+					// We should always get a number back from opacity
+					var ret = curCSS( elem, "opacity" );
+					return ret === "" ? "1" : ret;
+				}
+			}
+		}
+	},
+
+	// Don't automatically add "px" to these possibly-unitless properties
+	cssNumber: {
+		animationIterationCount: true,
+		aspectRatio: true,
+		borderImageSlice: true,
+		columnCount: true,
+		flexGrow: true,
+		flexShrink: true,
+		fontWeight: true,
+		gridArea: true,
+		gridColumn: true,
+		gridColumnEnd: true,
+		gridColumnStart: true,
+		gridRow: true,
+		gridRowEnd: true,
+		gridRowStart: true,
+		lineHeight: true,
+		opacity: true,
+		order: true,
+		orphans: true,
+		scale: true,
+		widows: true,
+		zIndex: true,
+		zoom: true,
+
+		// SVG-related
+		fillOpacity: true,
+		floodOpacity: true,
+		stopOpacity: true,
+		strokeMiterlimit: true,
+		strokeOpacity: true
+	},
+
+	// Add in properties whose names you wish to fix before
+	// setting or getting the value
+	cssProps: {},
+
+	// Get and set the style property on a DOM Node
+	style: function( elem, name, value, extra ) {
+
+		// Don't set styles on text and comment nodes
+		if ( !elem || elem.nodeType === 3 || elem.nodeType === 8 || !elem.style ) {
+			return;
+		}
+
+		// Make sure that we're working with the right name
+		var ret, type, hooks,
+			origName = camelCase( name ),
+			isCustomProp = rcustomProp.test( name ),
+			style = elem.style;
+
+		// Make sure that we're working with the right name. We don't
+		// want to query the value if it is a CSS custom property
+		// since they are user-defined.
+		if ( !isCustomProp ) {
+			name = finalPropName( origName );
+		}
+
+		// Gets hook for the prefixed version, then unprefixed version
+		hooks = jQuery.cssHooks[ name ] || jQuery.cssHooks[ origName ];
+
+		// Check if we're setting a value
+		if ( value !== undefined ) {
+			type = typeof value;
+
+			// Convert "+=" or "-=" to relative numbers (trac-7345)
+			if ( type === "string" && ( ret = rcssNum.exec( value ) ) && ret[ 1 ] ) {
+				value = adjustCSS( elem, name, ret );
+
+				// Fixes bug trac-9237
+				type = "number";
+			}
+
+			// Make sure that null and NaN values aren't set (trac-7116)
+			if ( value == null || value !== value ) {
+				return;
+			}
+
+			// If a number was passed in, add the unit (except for certain CSS properties)
+			// The isCustomProp check can be removed in jQuery 4.0 when we only auto-append
+			// "px" to a few hardcoded values.
+			if ( type === "number" && !isCustomProp ) {
+				value += ret && ret[ 3 ] || ( jQuery.cssNumber[ origName ] ? "" : "px" );
+			}
+
+			// background-* props affect original clone's values
+			if ( !support.clearCloneStyle && value === "" && name.indexOf( "background" ) === 0 ) {
+				style[ name ] = "inherit";
+			}
+
+			// If a hook was provided, use that value, otherwise just set the specified value
+			if ( !hooks || !( "set" in hooks ) ||
+				( value = hooks.set( elem, value, extra ) ) !== undefined ) {
+
+				if ( isCustomProp ) {
+					style.setProperty( name, value );
+				} else {
+					style[ name ] = value;
+				}
+			}
+
+		} else {
+
+			// If a hook was provided get the non-computed value from there
+			if ( hooks && "get" in hooks &&
+				( ret = hooks.get( elem, false, extra ) ) !== undefined ) {
+
+				return ret;
+			}
+
+			// Otherwise just get the value from the style object
+			return style[ name ];
+		}
+	},
+
+	css: function( elem, name, extra, styles ) {
+		var val, num, hooks,
+			origName = camelCase( name ),
+			isCustomProp = rcustomProp.test( name );
+
+		// Make sure that we're working with the right name. We don't
+		// want to modify the value if it is a CSS custom property
+		// since they are user-defined.
+		if ( !isCustomProp ) {
+			name = finalPropName( origName );
+		}
+
+		// Try prefixed name followed by the unprefixed name
+		hooks = jQuery.cssHooks[ name ] || jQuery.cssHooks[ origName ];
+
+		// If a hook was provided get the computed value from there
+		if ( hooks && "get" in hooks ) {
+			val = hooks.get( elem, true, extra );
+		}
+
+		// Otherwise, if a way to get the computed value exists, use that
+		if ( val === undefined ) {
+			val = curCSS( elem, name, styles );
+		}
+
+		// Convert "normal" to computed value
+		if ( val === "normal" && name in cssNormalTransform ) {
+			val = cssNormalTransform[ name ];
+		}
+
+		// Make numeric if forced or a qualifier was provided and val looks numeric
+		if ( extra === "" || extra ) {
+			num = parseFloat( val );
+			return extra === true || isFinite( num ) ? num || 0 : val;
+		}
+
+		return val;
+	}
+} );
+
+jQuery.each( [ "height", "width" ], function( _i, dimension ) {
+	jQuery.cssHooks[ dimension ] = {
+		get: function( elem, computed, extra ) {
+			if ( computed ) {
+
+				// Certain elements can have dimension info if we invisibly show them
+				// but it must have a current display style that would benefit
+				return rdisplayswap.test( jQuery.css( elem, "display" ) ) &&
+
+					// Support: Safari 8+
+					// Table columns in Safari have non-zero offsetWidth & zero
+					// getBoundingClientRect().width unless display is changed.
+					// Support: IE <=11 only
+					// Running getBoundingClientRect on a disconnected node
+					// in IE throws an error.
+					( !elem.getClientRects().length || !elem.getBoundingClientRect().width ) ?
+					swap( elem, cssShow, function() {
+						return getWidthOrHeight( elem, dimension, extra );
+					} ) :
+					getWidthOrHeight( elem, dimension, extra );
+			}
+		},
+
+		set: function( elem, value, extra ) {
+			var matches,
+				styles = getStyles( elem ),
+
+				// Only read styles.position if the test has a chance to fail
+				// to avoid forcing a reflow.
+				scrollboxSizeBuggy = !support.scrollboxSize() &&
+					styles.position === "absolute",
+
+				// To avoid forcing a reflow, only fetch boxSizing if we need it (gh-3991)
+				boxSizingNeeded = scrollboxSizeBuggy || extra,
+				isBorderBox = boxSizingNeeded &&
+					jQuery.css( elem, "boxSizing", false, styles ) === "border-box",
+				subtract = extra ?
+					boxModelAdjustment(
+						elem,
+						dimension,
+						extra,
+						isBorderBox,
+						styles
+					) :
+					0;
+
+			// Account for unreliable border-box dimensions by comparing offset* to computed and
+			// faking a content-box to get border and padding (gh-3699)
+			if ( isBorderBox && scrollboxSizeBuggy ) {
+				subtract -= Math.ceil(
+					elem[ "offset" + dimension[ 0 ].toUpperCase() + dimension.slice( 1 ) ] -
+					parseFloat( styles[ dimension ] ) -
+					boxModelAdjustment( elem, dimension, "border", false, styles ) -
+					0.5
+				);
+			}
+
+			// Convert to pixels if value adjustment is needed
+			if ( subtract && ( matches = rcssNum.exec( value ) ) &&
+				( matches[ 3 ] || "px" ) !== "px" ) {
+
+				elem.style[ dimension ] = value;
+				value = jQuery.css( elem, dimension );
+			}
+
+			return setPositiveNumber( elem, value, subtract );
+		}
+	};
+} );
+
+jQuery.cssHooks.marginLeft = addGetHookIf( support.reliableMarginLeft,
+	function( elem, computed ) {
+		if ( computed ) {
+			return ( parseFloat( curCSS( elem, "marginLeft" ) ) ||
+				elem.getBoundingClientRect().left -
+					swap( elem, { marginLeft: 0 }, function() {
+						return elem.getBoundingClientRect().left;
+					} )
+			) + "px";
+		}
+	}
+);
+
+// These hooks are used by animate to expand properties
+jQuery.each( {
+	margin: "",
+	padding: "",
+	border: "Width"
+}, function( prefix, suffix ) {
+	jQuery.cssHooks[ prefix + suffix ] = {
+		expand: function( value ) {
+			var i = 0,
+				expanded = {},
+
+				// Assumes a single number if not a string
+				parts = typeof value === "string" ? value.split( " " ) : [ value ];
+
+			for ( ; i < 4; i++ ) {
+				expanded[ prefix + cssExpand[ i ] + suffix ] =
+					parts[ i ] || parts[ i - 2 ] || parts[ 0 ];
+			}
+
+			return expanded;
+		}
+	};
+
+	if ( prefix !== "margin" ) {
+		jQuery.cssHooks[ prefix + suffix ].set = setPositiveNumber;
+	}
+} );
+
+jQuery.fn.extend( {
+	css: function( name, value ) {
+		return access( this, function( elem, name, value ) {
+			var styles, len,
+				map = {},
+				i = 0;
+
+			if ( Array.isArray( name ) ) {
+				styles = getStyles( elem );
+				len = name.length;
+
+				for ( ; i < len; i++ ) {
+					map[ name[ i ] ] = jQuery.css( elem, name[ i ], false, styles );
+				}
+
+				return map;
+			}
+
+			return value !== undefined ?
+				jQuery.style( elem, name, value ) :
+				jQuery.css( elem, name );
+		}, name, value, arguments.length > 1 );
+	}
+} );
+
+
+function Tween( elem, options, prop, end, easing ) {
+	return new Tween.prototype.init( elem, options, prop, end, easing );
+}
+jQuery.Tween = Tween;
+
+Tween.prototype = {
+	constructor: Tween,
+	init: function( elem, options, prop, end, easing, unit ) {
+		this.elem = elem;
+		this.prop = prop;
+		this.easing = easing || jQuery.easing._default;
+		this.options = options;
+		this.start = this.now = this.cur();
+		this.end = end;
+		this.unit = unit || ( jQuery.cssNumber[ prop ] ? "" : "px" );
+	},
+	cur: function() {
+		var hooks = Tween.propHooks[ this.prop ];
+
+		return hooks && hooks.get ?
+			hooks.get( this ) :
+			Tween.propHooks._default.get( this );
+	},
+	run: function( percent ) {
+		var eased,
+			hooks = Tween.propHooks[ this.prop ];
+
+		if ( this.options.duration ) {
+			this.pos = eased = jQuery.easing[ this.easing ](
+				percent, this.options.duration * percent, 0, 1, this.options.duration
+			);
+		} else {
+			this.pos = eased = percent;
+		}
+		this.now = ( this.end - this.start ) * eased + this.start;
+
+		if ( this.options.step ) {
+			this.options.step.call( this.elem, this.now, this );
+		}
+
+		if ( hooks && hooks.set ) {
+			hooks.set( this );
+		} else {
+			Tween.propHooks._default.set( this );
+		}
+		return this;
+	}
+};
+
+Tween.prototype.init.prototype = Tween.prototype;
+
+Tween.propHooks = {
+	_default: {
+		get: function( tween ) {
+			var result;
+
+			// Use a property on the element directly when it is not a DOM element,
+			// or when there is no matching style property that exists.
+			if ( tween.elem.nodeType !== 1 ||
+				tween.elem[ tween.prop ] != null && tween.elem.style[ tween.prop ] == null ) {
+				return tween.elem[ tween.prop ];
+			}
+
+			// Passing an empty string as a 3rd parameter to .css will automatically
+			// attempt a parseFloat and fallback to a string if the parse fails.
+			// Simple values such as "10px" are parsed to Float;
+			// complex values such as "rotate(1rad)" are returned as-is.
+			result = jQuery.css( tween.elem, tween.prop, "" );
+
+			// Empty strings, null, undefined and "auto" are converted to 0.
+			return !result || result === "auto" ? 0 : result;
+		},
+		set: function( tween ) {
+
+			// Use step hook for back compat.
+			// Use cssHook if its there.
+			// Use .style if available and use plain properties where available.
+			if ( jQuery.fx.step[ tween.prop ] ) {
+				jQuery.fx.step[ tween.prop ]( tween );
+			} else if ( tween.elem.nodeType === 1 && (
+				jQuery.cssHooks[ tween.prop ] ||
+					tween.elem.style[ finalPropName( tween.prop ) ] != null ) ) {
+				jQuery.style( tween.elem, tween.prop, tween.now + tween.unit );
+			} else {
+				tween.elem[ tween.prop ] = tween.now;
+			}
+		}
+	}
+};
+
+// Support: IE <=9 only
+// Panic based approach to setting things on disconnected nodes
+Tween.propHooks.scrollTop = Tween.propHooks.scrollLeft = {
+	set: function( tween ) {
+		if ( tween.elem.nodeType && tween.elem.parentNode ) {
+			tween.elem[ tween.prop ] = tween.now;
+		}
+	}
+};
+
+jQuery.easing = {
+	linear: function( p ) {
+		return p;
+	},
+	swing: function( p ) {
+		return 0.5 - Math.cos( p * Math.PI ) / 2;
+	},
+	_default: "swing"
+};
+
+jQuery.fx = Tween.prototype.init;
+
+// Back compat <1.8 extension point
+jQuery.fx.step = {};
+
+
+
+
+var
+	fxNow, inProgress,
+	rfxtypes = /^(?:toggle|show|hide)$/,
+	rrun = /queueHooks$/;
+
+function schedule() {
+	if ( inProgress ) {
+		if ( document.hidden === false && window.requestAnimationFrame ) {
+			window.requestAnimationFrame( schedule );
+		} else {
+			window.setTimeout( schedule, jQuery.fx.interval );
+		}
+
+		jQuery.fx.tick();
+	}
+}
+
+// Animations created synchronously will run synchronously
+function createFxNow() {
+	window.setTimeout( function() {
+		fxNow = undefined;
+	} );
+	return ( fxNow = Date.now() );
+}
+
+// Generate parameters to create a standard animation
+function genFx( type, includeWidth ) {
+	var which,
+		i = 0,
+		attrs = { height: type };
+
+	// If we include width, step value is 1 to do all cssExpand values,
+	// otherwise step value is 2 to skip over Left and Right
+	includeWidth = includeWidth ? 1 : 0;
+	for ( ; i < 4; i += 2 - includeWidth ) {
+		which = cssExpand[ i ];
+		attrs[ "margin" + which ] = attrs[ "padding" + which ] = type;
+	}
+
+	if ( includeWidth ) {
+		attrs.opacity = attrs.width = type;
+	}
+
+	return attrs;
+}
+
+function createTween( value, prop, animation ) {
+	var tween,
+		collection = ( Animation.tweeners[ prop ] || [] ).concat( Animation.tweeners[ "*" ] ),
+		index = 0,
+		length = collection.length;
+	for ( ; index < length; index++ ) {
+		if ( ( tween = collection[ index ].call( animation, prop, value ) ) ) {
+
+			// We're done with this property
+			return tween;
+		}
+	}
+}
+
+function defaultPrefilter( elem, props, opts ) {
+	var prop, value, toggle, hooks, oldfire, propTween, restoreDisplay, display,
+		isBox = "width" in props || "height" in props,
+		anim = this,
+		orig = {},
+		style = elem.style,
+		hidden = elem.nodeType && isHiddenWithinTree( elem ),
+		dataShow = dataPriv.get( elem, "fxshow" );
+
+	// Queue-skipping animations hijack the fx hooks
+	if ( !opts.queue ) {
+		hooks = jQuery._queueHooks( elem, "fx" );
+		if ( hooks.unqueued == null ) {
+			hooks.unqueued = 0;
+			oldfire = hooks.empty.fire;
+			hooks.empty.fire = function() {
+				if ( !hooks.unqueued ) {
+					oldfire();
+				}
+			};
+		}
+		hooks.unqueued++;
+
+		anim.always( function() {
+
+			// Ensure the complete handler is called before this completes
+			anim.always( function() {
+				hooks.unqueued--;
+				if ( !jQuery.queue( elem, "fx" ).length ) {
+					hooks.empty.fire();
+				}
+			} );
+		} );
+	}
+
+	// Detect show/hide animations
+	for ( prop in props ) {
+		value = props[ prop ];
+		if ( rfxtypes.test( value ) ) {
+			delete props[ prop ];
+			toggle = toggle || value === "toggle";
+			if ( value === ( hidden ? "hide" : "show" ) ) {
+
+				// Pretend to be hidden if this is a "show" and
+				// there is still data from a stopped show/hide
+				if ( value === "show" && dataShow && dataShow[ prop ] !== undefined ) {
+					hidden = true;
+
+				// Ignore all other no-op show/hide data
+				} else {
+					continue;
+				}
+			}
+			orig[ prop ] = dataShow && dataShow[ prop ] || jQuery.style( elem, prop );
+		}
+	}
+
+	// Bail out if this is a no-op like .hide().hide()
+	propTween = !jQuery.isEmptyObject( props );
+	if ( !propTween && jQuery.isEmptyObject( orig ) ) {
+		return;
+	}
+
+	// Restrict "overflow" and "display" styles during box animations
+	if ( isBox && elem.nodeType === 1 ) {
+
+		// Support: IE <=9 - 11, Edge 12 - 15
+		// Record all 3 overflow attributes because IE does not infer the shorthand
+		// from identically-valued overflowX and overflowY and Edge just mirrors
+		// the overflowX value there.
+		opts.overflow = [ style.overflow, style.overflowX, style.overflowY ];
+
+		// Identify a display type, preferring old show/hide data over the CSS cascade
+		restoreDisplay = dataShow && dataShow.display;
+		if ( restoreDisplay == null ) {
+			restoreDisplay = dataPriv.get( elem, "display" );
+		}
+		display = jQuery.css( elem, "display" );
+		if ( display === "none" ) {
+			if ( restoreDisplay ) {
+				display = restoreDisplay;
+			} else {
+
+				// Get nonempty value(s) by temporarily forcing visibility
+				showHide( [ elem ], true );
+				restoreDisplay = elem.style.display || restoreDisplay;
+				display = jQuery.css( elem, "display" );
+				showHide( [ elem ] );
+			}
+		}
+
+		// Animate inline elements as inline-block
+		if ( display === "inline" || display === "inline-block" && restoreDisplay != null ) {
+			if ( jQuery.css( elem, "float" ) === "none" ) {
+
+				// Restore the original display value at the end of pure show/hide animations
+				if ( !propTween ) {
+					anim.done( function() {
+						style.display = restoreDisplay;
+					} );
+					if ( restoreDisplay == null ) {
+						display = style.display;
+						restoreDisplay = display === "none" ? "" : display;
+					}
+				}
+				style.display = "inline-block";
+			}
+		}
+	}
+
+	if ( opts.overflow ) {
+		style.overflow = "hidden";
+		anim.always( function() {
+			style.overflow = opts.overflow[ 0 ];
+			style.overflowX = opts.overflow[ 1 ];
+			style.overflowY = opts.overflow[ 2 ];
+		} );
+	}
+
+	// Implement show/hide animations
+	propTween = false;
+	for ( prop in orig ) {
+
+		// General show/hide setup for this element animation
+		if ( !propTween ) {
+			if ( dataShow ) {
+				if ( "hidden" in dataShow ) {
+					hidden = dataShow.hidden;
+				}
+			} else {
+				dataShow = dataPriv.access( elem, "fxshow", { display: restoreDisplay } );
+			}
+
+			// Store hidden/visible for toggle so `.stop().toggle()` "reverses"
+			if ( toggle ) {
+				dataShow.hidden = !hidden;
+			}
+
+			// Show elements before animating them
+			if ( hidden ) {
+				showHide( [ elem ], true );
+			}
+
+			/* eslint-disable no-loop-func */
+
+			anim.done( function() {
+
+				/* eslint-enable no-loop-func */
+
+				// The final step of a "hide" animation is actually hiding the element
+				if ( !hidden ) {
+					showHide( [ elem ] );
+				}
+				dataPriv.remove( elem, "fxshow" );
+				for ( prop in orig ) {
+					jQuery.style( elem, prop, orig[ prop ] );
+				}
+			} );
+		}
+
+		// Per-property setup
+		propTween = createTween( hidden ? dataShow[ prop ] : 0, prop, anim );
+		if ( !( prop in dataShow ) ) {
+			dataShow[ prop ] = propTween.start;
+			if ( hidden ) {
+				propTween.end = propTween.start;
+				propTween.start = 0;
+			}
+		}
+	}
+}
+
+function propFilter( props, specialEasing ) {
+	var index, name, easing, value, hooks;
+
+	// camelCase, specialEasing and expand cssHook pass
+	for ( index in props ) {
+		name = camelCase( index );
+		easing = specialEasing[ name ];
+		value = props[ index ];
+		if ( Array.isArray( value ) ) {
+			easing = value[ 1 ];
+			value = props[ index ] = value[ 0 ];
+		}
+
+		if ( index !== name ) {
+			props[ name ] = value;
+			delete props[ index ];
+		}
+
+		hooks = jQuery.cssHooks[ name ];
+		if ( hooks && "expand" in hooks ) {
+			value = hooks.expand( value );
+			delete props[ name ];
+
+			// Not quite $.extend, this won't overwrite existing keys.
+			// Reusing 'index' because we have the correct "name"
+			for ( index in value ) {
+				if ( !( index in props ) ) {
+					props[ index ] = value[ index ];
+					specialEasing[ index ] = easing;
+				}
+			}
+		} else {
+			specialEasing[ name ] = easing;
+		}
+	}
+}
+
+function Animation( elem, properties, options ) {
+	var result,
+		stopped,
+		index = 0,
+		length = Animation.prefilters.length,
+		deferred = jQuery.Deferred().always( function() {
+
+			// Don't match elem in the :animated selector
+			delete tick.elem;
+		} ),
+		tick = function() {
+			if ( stopped ) {
+				return false;
+			}
+			var currentTime = fxNow || createFxNow(),
+				remaining = Math.max( 0, animation.startTime + animation.duration - currentTime ),
+
+				// Support: Android 2.3 only
+				// Archaic crash bug won't allow us to use `1 - ( 0.5 || 0 )` (trac-12497)
+				temp = remaining / animation.duration || 0,
+				percent = 1 - temp,
+				index = 0,
+				length = animation.tweens.length;
+
+			for ( ; index < length; index++ ) {
+				animation.tweens[ index ].run( percent );
+			}
+
+			deferred.notifyWith( elem, [ animation, percent, remaining ] );
+
+			// If there's more to do, yield
+			if ( percent < 1 && length ) {
+				return remaining;
+			}
+
+			// If this was an empty animation, synthesize a final progress notification
+			if ( !length ) {
+				deferred.notifyWith( elem, [ animation, 1, 0 ] );
+			}
+
+			// Resolve the animation and report its conclusion
+			deferred.resolveWith( elem, [ animation ] );
+			return false;
+		},
+		animation = deferred.promise( {
+			elem: elem,
+			props: jQuery.extend( {}, properties ),
+			opts: jQuery.extend( true, {
+				specialEasing: {},
+				easing: jQuery.easing._default
+			}, options ),
+			originalProperties: properties,
+			originalOptions: options,
+			startTime: fxNow || createFxNow(),
+			duration: options.duration,
+			tweens: [],
+			createTween: function( prop, end ) {
+				var tween = jQuery.Tween( elem, animation.opts, prop, end,
+					animation.opts.specialEasing[ prop ] || animation.opts.easing );
+				animation.tweens.push( tween );
+				return tween;
+			},
+			stop: function( gotoEnd ) {
+				var index = 0,
+
+					// If we are going to the end, we want to run all the tweens
+					// otherwise we skip this part
+					length = gotoEnd ? animation.tweens.length : 0;
+				if ( stopped ) {
+					return this;
+				}
+				stopped = true;
+				for ( ; index < length; index++ ) {
+					animation.tweens[ index ].run( 1 );
+				}
+
+				// Resolve when we played the last frame; otherwise, reject
+				if ( gotoEnd ) {
+					deferred.notifyWith( elem, [ animation, 1, 0 ] );
+					deferred.resolveWith( elem, [ animation, gotoEnd ] );
+				} else {
+					deferred.rejectWith( elem, [ animation, gotoEnd ] );
+				}
+				return this;
+			}
+		} ),
+		props = animation.props;
+
+	propFilter( props, animation.opts.specialEasing );
+
+	for ( ; index < length; index++ ) {
+		result = Animation.prefilters[ index ].call( animation, elem, props, animation.opts );
+		if ( result ) {
+			if ( isFunction( result.stop ) ) {
+				jQuery._queueHooks( animation.elem, animation.opts.queue ).stop =
+					result.stop.bind( result );
+			}
+			return result;
+		}
+	}
+
+	jQuery.map( props, createTween, animation );
+
+	if ( isFunction( animation.opts.start ) ) {
+		animation.opts.start.call( elem, animation );
+	}
+
+	// Attach callbacks from options
+	animation
+		.progress( animation.opts.progress )
+		.done( animation.opts.done, animation.opts.complete )
+		.fail( animation.opts.fail )
+		.always( animation.opts.always );
+
+	jQuery.fx.timer(
+		jQuery.extend( tick, {
+			elem: elem,
+			anim: animation,
+			queue: animation.opts.queue
+		} )
+	);
+
+	return animation;
+}
+
+jQuery.Animation = jQuery.extend( Animation, {
+
+	tweeners: {
+		"*": [ function( prop, value ) {
+			var tween = this.createTween( prop, value );
+			adjustCSS( tween.elem, prop, rcssNum.exec( value ), tween );
+			return tween;
+		} ]
+	},
+
+	tweener: function( props, callback ) {
+		if ( isFunction( props ) ) {
+			callback = props;
+			props = [ "*" ];
+		} else {
+			props = props.match( rnothtmlwhite );
+		}
+
+		var prop,
+			index = 0,
+			length = props.length;
+
+		for ( ; index < length; index++ ) {
+			prop = props[ index ];
+			Animation.tweeners[ prop ] = Animation.tweeners[ prop ] || [];
+			Animation.tweeners[ prop ].unshift( callback );
+		}
+	},
+
+	prefilters: [ defaultPrefilter ],
+
+	prefilter: function( callback, prepend ) {
+		if ( prepend ) {
+			Animation.prefilters.unshift( callback );
+		} else {
+			Animation.prefilters.push( callback );
+		}
+	}
+} );
+
+jQuery.speed = function( speed, easing, fn ) {
+	var opt = speed && typeof speed === "object" ? jQuery.extend( {}, speed ) : {
+		complete: fn || !fn && easing ||
+			isFunction( speed ) && speed,
+		duration: speed,
+		easing: fn && easing || easing && !isFunction( easing ) && easing
+	};
+
+	// Go to the end state if fx are off
+	if ( jQuery.fx.off ) {
+		opt.duration = 0;
+
+	} else {
+		if ( typeof opt.duration !== "number" ) {
+			if ( opt.duration in jQuery.fx.speeds ) {
+				opt.duration = jQuery.fx.speeds[ opt.duration ];
+
+			} else {
+				opt.duration = jQuery.fx.speeds._default;
+			}
+		}
+	}
+
+	// Normalize opt.queue - true/undefined/null -> "fx"
+	if ( opt.queue == null || opt.queue === true ) {
+		opt.queue = "fx";
+	}
+
+	// Queueing
+	opt.old = opt.complete;
+
+	opt.complete = function() {
+		if ( isFunction( opt.old ) ) {
+			opt.old.call( this );
+		}
+
+		if ( opt.queue ) {
+			jQuery.dequeue( this, opt.queue );
+		}
+	};
+
+	return opt;
+};
+
+jQuery.fn.extend( {
+	fadeTo: function( speed, to, easing, callback ) {
+
+		// Show any hidden elements after setting opacity to 0
+		return this.filter( isHiddenWithinTree ).css( "opacity", 0 ).show()
+
+			// Animate to the value specified
+			.end().animate( { opacity: to }, speed, easing, callback );
+	},
+	animate: function( prop, speed, easing, callback ) {
+		var empty = jQuery.isEmptyObject( prop ),
+			optall = jQuery.speed( speed, easing, callback ),
+			doAnimation = function() {
+
+				// Operate on a copy of prop so per-property easing won't be lost
+				var anim = Animation( this, jQuery.extend( {}, prop ), optall );
+
+				// Empty animations, or finishing resolves immediately
+				if ( empty || dataPriv.get( this, "finish" ) ) {
+					anim.stop( true );
+				}
+			};
+
+		doAnimation.finish = doAnimation;
+
+		return empty || optall.queue === false ?
+			this.each( doAnimation ) :
+			this.queue( optall.queue, doAnimation );
+	},
+	stop: function( type, clearQueue, gotoEnd ) {
+		var stopQueue = function( hooks ) {
+			var stop = hooks.stop;
+			delete hooks.stop;
+			stop( gotoEnd );
+		};
+
+		if ( typeof type !== "string" ) {
+			gotoEnd = clearQueue;
+			clearQueue = type;
+			type = undefined;
+		}
+		if ( clearQueue ) {
+			this.queue( type || "fx", [] );
+		}
+
+		return this.each( function() {
+			var dequeue = true,
+				index = type != null && type + "queueHooks",
+				timers = jQuery.timers,
+				data = dataPriv.get( this );
+
+			if ( index ) {
+				if ( data[ index ] && data[ index ].stop ) {
+					stopQueue( data[ index ] );
+				}
+			} else {
+				for ( index in data ) {
+					if ( data[ index ] && data[ index ].stop && rrun.test( index ) ) {
+						stopQueue( data[ index ] );
+					}
+				}
+			}
+
+			for ( index = timers.length; index--; ) {
+				if ( timers[ index ].elem === this &&
+					( type == null || timers[ index ].queue === type ) ) {
+
+					timers[ index ].anim.stop( gotoEnd );
+					dequeue = false;
+					timers.splice( index, 1 );
+				}
+			}
+
+			// Start the next in the queue if the last step wasn't forced.
+			// Timers currently will call their complete callbacks, which
+			// will dequeue but only if they were gotoEnd.
+			if ( dequeue || !gotoEnd ) {
+				jQuery.dequeue( this, type );
+			}
+		} );
+	},
+	finish: function( type ) {
+		if ( type !== false ) {
+			type = type || "fx";
+		}
+		return this.each( function() {
+			var index,
+				data = dataPriv.get( this ),
+				queue = data[ type + "queue" ],
+				hooks = data[ type + "queueHooks" ],
+				timers = jQuery.timers,
+				length = queue ? queue.length : 0;
+
+			// Enable finishing flag on private data
+			data.finish = true;
+
+			// Empty the queue first
+			jQuery.queue( this, type, [] );
+
+			if ( hooks && hooks.stop ) {
+				hooks.stop.call( this, true );
+			}
+
+			// Look for any active animations, and finish them
+			for ( index = timers.length; index--; ) {
+				if ( timers[ index ].elem === this && timers[ index ].queue === type ) {
+					timers[ index ].anim.stop( true );
+					timers.splice( index, 1 );
+				}
+			}
+
+			// Look for any animations in the old queue and finish them
+			for ( index = 0; index < length; index++ ) {
+				if ( queue[ index ] && queue[ index ].finish ) {
+					queue[ index ].finish.call( this );
+				}
+			}
+
+			// Turn off finishing flag
+			delete data.finish;
+		} );
+	}
+} );
+
+jQuery.each( [ "toggle", "show", "hide" ], function( _i, name ) {
+	var cssFn = jQuery.fn[ name ];
+	jQuery.fn[ name ] = function( speed, easing, callback ) {
+		return speed == null || typeof speed === "boolean" ?
+			cssFn.apply( this, arguments ) :
+			this.animate( genFx( name, true ), speed, easing, callback );
+	};
+} );
+
+// Generate shortcuts for custom animations
+jQuery.each( {
+	slideDown: genFx( "show" ),
+	slideUp: genFx( "hide" ),
+	slideToggle: genFx( "toggle" ),
+	fadeIn: { opacity: "show" },
+	fadeOut: { opacity: "hide" },
+	fadeToggle: { opacity: "toggle" }
+}, function( name, props ) {
+	jQuery.fn[ name ] = function( speed, easing, callback ) {
+		return this.animate( props, speed, easing, callback );
+	};
+} );
+
+jQuery.timers = [];
+jQuery.fx.tick = function() {
+	var timer,
+		i = 0,
+		timers = jQuery.timers;
+
+	fxNow = Date.now();
+
+	for ( ; i < timers.length; i++ ) {
+		timer = timers[ i ];
+
+		// Run the timer and safely remove it when done (allowing for external removal)
+		if ( !timer() && timers[ i ] === timer ) {
+			timers.splice( i--, 1 );
+		}
+	}
+
+	if ( !timers.length ) {
+		jQuery.fx.stop();
+	}
+	fxNow = undefined;
+};
+
+jQuery.fx.timer = function( timer ) {
+	jQuery.timers.push( timer );
+	jQuery.fx.start();
+};
+
+jQuery.fx.interval = 13;
+jQuery.fx.start = function() {
+	if ( inProgress ) {
+		return;
+	}
+
+	inProgress = true;
+	schedule();
+};
+
+jQuery.fx.stop = function() {
+	inProgress = null;
+};
+
+jQuery.fx.speeds = {
+	slow: 600,
+	fast: 200,
+
+	// Default speed
+	_default: 400
+};
+
+
+// Based off of the plugin by Clint Helfers, with permission.
+jQuery.fn.delay = function( time, type ) {
+	time = jQuery.fx ? jQuery.fx.speeds[ time ] || time : time;
+	type = type || "fx";
+
+	return this.queue( type, function( next, hooks ) {
+		var timeout = window.setTimeout( next, time );
+		hooks.stop = function() {
+			window.clearTimeout( timeout );
+		};
+	} );
+};
+
+
+( function() {
+	var input = document.createElement( "input" ),
+		select = document.createElement( "select" ),
+		opt = select.appendChild( document.createElement( "option" ) );
+
+	input.type = "checkbox";
+
+	// Support: Android <=4.3 only
+	// Default value for a checkbox should be "on"
+	support.checkOn = input.value !== "";
+
+	// Support: IE <=11 only
+	// Must access selectedIndex to make default options select
+	support.optSelected = opt.selected;
+
+	// Support: IE <=11 only
+	// An input loses its value after becoming a radio
+	input = document.createElement( "input" );
+	input.value = "t";
+	input.type = "radio";
+	support.radioValue = input.value === "t";
+} )();
+
+
+var boolHook,
+	attrHandle = jQuery.expr.attrHandle;
+
+jQuery.fn.extend( {
+	attr: function( name, value ) {
+		return access( this, jQuery.attr, name, value, arguments.length > 1 );
+	},
+
+	removeAttr: function( name ) {
+		return this.each( function() {
+			jQuery.removeAttr( this, name );
+		} );
+	}
+} );
+
+jQuery.extend( {
+	attr: function( elem, name, value ) {
+		var ret, hooks,
+			nType = elem.nodeType;
+
+		// Don't get/set attributes on text, comment and attribute nodes
+		if ( nType === 3 || nType === 8 || nType === 2 ) {
+			return;
+		}
+
+		// Fallback to prop when attributes are not supported
+		if ( typeof elem.getAttribute === "undefined" ) {
+			return jQuery.prop( elem, name, value );
+		}
+
+		// Attribute hooks are determined by the lowercase version
+		// Grab necessary hook if one is defined
+		if ( nType !== 1 || !jQuery.isXMLDoc( elem ) ) {
+			hooks = jQuery.attrHooks[ name.toLowerCase() ] ||
+				( jQuery.expr.match.bool.test( name ) ? boolHook : undefined );
+		}
+
+		if ( value !== undefined ) {
+			if ( value === null ) {
+				jQuery.removeAttr( elem, name );
+				return;
+			}
+
+			if ( hooks && "set" in hooks &&
+				( ret = hooks.set( elem, value, name ) ) !== undefined ) {
+				return ret;
+			}
+
+			elem.setAttribute( name, value + "" );
+			return value;
+		}
+
+		if ( hooks && "get" in hooks && ( ret = hooks.get( elem, name ) ) !== null ) {
+			return ret;
+		}
+
+		ret = jQuery.find.attr( elem, name );
+
+		// Non-existent attributes return null, we normalize to undefined
+		return ret == null ? undefined : ret;
+	},
+
+	attrHooks: {
+		type: {
+			set: function( elem, value ) {
+				if ( !support.radioValue && value === "radio" &&
+					nodeName( elem, "input" ) ) {
+					var val = elem.value;
+					elem.setAttribute( "type", value );
+					if ( val ) {
+						elem.value = val;
+					}
+					return value;
+				}
+			}
+		}
+	},
+
+	removeAttr: function( elem, value ) {
+		var name,
+			i = 0,
+
+			// Attribute names can contain non-HTML whitespace characters
+			// https://html.spec.whatwg.org/multipage/syntax.html#attributes-2
+			attrNames = value && value.match( rnothtmlwhite );
+
+		if ( attrNames && elem.nodeType === 1 ) {
+			while ( ( name = attrNames[ i++ ] ) ) {
+				elem.removeAttribute( name );
+			}
+		}
+	}
+} );
+
+// Hooks for boolean attributes
+boolHook = {
+	set: function( elem, value, name ) {
+		if ( value === false ) {
+
+			// Remove boolean attributes when set to false
+			jQuery.removeAttr( elem, name );
+		} else {
+			elem.setAttribute( name, name );
+		}
+		return name;
+	}
+};
+
+jQuery.each( jQuery.expr.match.bool.source.match( /\w+/g ), function( _i, name ) {
+	var getter = attrHandle[ name ] || jQuery.find.attr;
+
+	attrHandle[ name ] = function( elem, name, isXML ) {
+		var ret, handle,
+			lowercaseName = name.toLowerCase();
+
+		if ( !isXML ) {
+
+			// Avoid an infinite loop by temporarily removing this function from the getter
+			handle = attrHandle[ lowercaseName ];
+			attrHandle[ lowercaseName ] = ret;
+			ret = getter( elem, name, isXML ) != null ?
+				lowercaseName :
+				null;
+			attrHandle[ lowercaseName ] = handle;
+		}
+		return ret;
+	};
+} );
+
+
+
+
+var rfocusable = /^(?:input|select|textarea|button)$/i,
+	rclickable = /^(?:a|area)$/i;
+
+jQuery.fn.extend( {
+	prop: function( name, value ) {
+		return access( this, jQuery.prop, name, value, arguments.length > 1 );
+	},
+
+	removeProp: function( name ) {
+		return this.each( function() {
+			delete this[ jQuery.propFix[ name ] || name ];
+		} );
+	}
+} );
+
+jQuery.extend( {
+	prop: function( elem, name, value ) {
+		var ret, hooks,
+			nType = elem.nodeType;
+
+		// Don't get/set properties on text, comment and attribute nodes
+		if ( nType === 3 || nType === 8 || nType === 2 ) {
+			return;
+		}
+
+		if ( nType !== 1 || !jQuery.isXMLDoc( elem ) ) {
+
+			// Fix name and attach hooks
+			name = jQuery.propFix[ name ] || name;
+			hooks = jQuery.propHooks[ name ];
+		}
+
+		if ( value !== undefined ) {
+			if ( hooks && "set" in hooks &&
+				( ret = hooks.set( elem, value, name ) ) !== undefined ) {
+				return ret;
+			}
+
+			return ( elem[ name ] = value );
+		}
+
+		if ( hooks && "get" in hooks && ( ret = hooks.get( elem, name ) ) !== null ) {
+			return ret;
+		}
+
+		return elem[ name ];
+	},
+
+	propHooks: {
+		tabIndex: {
+			get: function( elem ) {
+
+				// Support: IE <=9 - 11 only
+				// elem.tabIndex doesn't always return the
+				// correct value when it hasn't been explicitly set
+				// Use proper attribute retrieval (trac-12072)
+				var tabindex = jQuery.find.attr( elem, "tabindex" );
+
+				if ( tabindex ) {
+					return parseInt( tabindex, 10 );
+				}
+
+				if (
+					rfocusable.test( elem.nodeName ) ||
+					rclickable.test( elem.nodeName ) &&
+					elem.href
+				) {
+					return 0;
+				}
+
+				return -1;
+			}
+		}
+	},
+
+	propFix: {
+		"for": "htmlFor",
+		"class": "className"
+	}
+} );
+
+// Support: IE <=11 only
+// Accessing the selectedIndex property
+// forces the browser to respect setting selected
+// on the option
+// The getter ensures a default option is selected
+// when in an optgroup
+// eslint rule "no-unused-expressions" is disabled for this code
+// since it considers such accessions noop
+if ( !support.optSelected ) {
+	jQuery.propHooks.selected = {
+		get: function( elem ) {
+
+			/* eslint no-unused-expressions: "off" */
+
+			var parent = elem.parentNode;
+			if ( parent && parent.parentNode ) {
+				parent.parentNode.selectedIndex;
+			}
+			return null;
+		},
+		set: function( elem ) {
+
+			/* eslint no-unused-expressions: "off" */
+
+			var parent = elem.parentNode;
+			if ( parent ) {
+				parent.selectedIndex;
+
+				if ( parent.parentNode ) {
+					parent.parentNode.selectedIndex;
+				}
+			}
+		}
+	};
+}
+
+jQuery.each( [
+	"tabIndex",
+	"readOnly",
+	"maxLength",
+	"cellSpacing",
+	"cellPadding",
+	"rowSpan",
+	"colSpan",
+	"useMap",
+	"frameBorder",
+	"contentEditable"
+], function() {
+	jQuery.propFix[ this.toLowerCase() ] = this;
+} );
+
+
+
+
+	// Strip and collapse whitespace according to HTML spec
+	// https://infra.spec.whatwg.org/#strip-and-collapse-ascii-whitespace
+	function stripAndCollapse( value ) {
+		var tokens = value.match( rnothtmlwhite ) || [];
+		return tokens.join( " " );
+	}
+
+
+function getClass( elem ) {
+	return elem.getAttribute && elem.getAttribute( "class" ) || "";
+}
+
+function classesToArray( value ) {
+	if ( Array.isArray( value ) ) {
+		return value;
+	}
+	if ( typeof value === "string" ) {
+		return value.match( rnothtmlwhite ) || [];
+	}
+	return [];
+}
+
+jQuery.fn.extend( {
+	addClass: function( value ) {
+		var classNames, cur, curValue, className, i, finalValue;
+
+		if ( isFunction( value ) ) {
+			return this.each( function( j ) {
+				jQuery( this ).addClass( value.call( this, j, getClass( this ) ) );
+			} );
+		}
+
+		classNames = classesToArray( value );
+
+		if ( classNames.length ) {
+			return this.each( function() {
+				curValue = getClass( this );
+				cur = this.nodeType === 1 && ( " " + stripAndCollapse( curValue ) + " " );
+
+				if ( cur ) {
+					for ( i = 0; i < classNames.length; i++ ) {
+						className = classNames[ i ];
+						if ( cur.indexOf( " " + className + " " ) < 0 ) {
+							cur += className + " ";
+						}
+					}
+
+					// Only assign if different to avoid unneeded rendering.
+					finalValue = stripAndCollapse( cur );
+					if ( curValue !== finalValue ) {
+						this.setAttribute( "class", finalValue );
+					}
+				}
+			} );
+		}
+
+		return this;
+	},
+
+	removeClass: function( value ) {
+		var classNames, cur, curValue, className, i, finalValue;
+
+		if ( isFunction( value ) ) {
+			return this.each( function( j ) {
+				jQuery( this ).removeClass( value.call( this, j, getClass( this ) ) );
+			} );
+		}
+
+		if ( !arguments.length ) {
+			return this.attr( "class", "" );
+		}
+
+		classNames = classesToArray( value );
+
+		if ( classNames.length ) {
+			return this.each( function() {
+				curValue = getClass( this );
+
+				// This expression is here for better compressibility (see addClass)
+				cur = this.nodeType === 1 && ( " " + stripAndCollapse( curValue ) + " " );
+
+				if ( cur ) {
+					for ( i = 0; i < classNames.length; i++ ) {
+						className = classNames[ i ];
+
+						// Remove *all* instances
+						while ( cur.indexOf( " " + className + " " ) > -1 ) {
+							cur = cur.replace( " " + className + " ", " " );
+						}
+					}
+
+					// Only assign if different to avoid unneeded rendering.
+					finalValue = stripAndCollapse( cur );
+					if ( curValue !== finalValue ) {
+						this.setAttribute( "class", finalValue );
+					}
+				}
+			} );
+		}
+
+		return this;
+	},
+
+	toggleClass: function( value, stateVal ) {
+		var classNames, className, i, self,
+			type = typeof value,
+			isValidValue = type === "string" || Array.isArray( value );
+
+		if ( isFunction( value ) ) {
+			return this.each( function( i ) {
+				jQuery( this ).toggleClass(
+					value.call( this, i, getClass( this ), stateVal ),
+					stateVal
+				);
+			} );
+		}
+
+		if ( typeof stateVal === "boolean" && isValidValue ) {
+			return stateVal ? this.addClass( value ) : this.removeClass( value );
+		}
+
+		classNames = classesToArray( value );
+
+		return this.each( function() {
+			if ( isValidValue ) {
+
+				// Toggle individual class names
+				self = jQuery( this );
+
+				for ( i = 0; i < classNames.length; i++ ) {
+					className = classNames[ i ];
+
+					// Check each className given, space separated list
+					if ( self.hasClass( className ) ) {
+						self.removeClass( className );
+					} else {
+						self.addClass( className );
+					}
+				}
+
+			// Toggle whole class name
+			} else if ( value === undefined || type === "boolean" ) {
+				className = getClass( this );
+				if ( className ) {
+
+					// Store className if set
+					dataPriv.set( this, "__className__", className );
+				}
+
+				// If the element has a class name or if we're passed `false`,
+				// then remove the whole classname (if there was one, the above saved it).
+				// Otherwise bring back whatever was previously saved (if anything),
+				// falling back to the empty string if nothing was stored.
+				if ( this.setAttribute ) {
+					this.setAttribute( "class",
+						className || value === false ?
+							"" :
+							dataPriv.get( this, "__className__" ) || ""
+					);
+				}
+			}
+		} );
+	},
+
+	hasClass: function( selector ) {
+		var className, elem,
+			i = 0;
+
+		className = " " + selector + " ";
+		while ( ( elem = this[ i++ ] ) ) {
+			if ( elem.nodeType === 1 &&
+				( " " + stripAndCollapse( getClass( elem ) ) + " " ).indexOf( className ) > -1 ) {
+				return true;
+			}
+		}
+
+		return false;
+	}
+} );
+
+
+
+
+var rreturn = /\r/g;
+
+jQuery.fn.extend( {
+	val: function( value ) {
+		var hooks, ret, valueIsFunction,
+			elem = this[ 0 ];
+
+		if ( !arguments.length ) {
+			if ( elem ) {
+				hooks = jQuery.valHooks[ elem.type ] ||
+					jQuery.valHooks[ elem.nodeName.toLowerCase() ];
+
+				if ( hooks &&
+					"get" in hooks &&
+					( ret = hooks.get( elem, "value" ) ) !== undefined
+				) {
+					return ret;
+				}
+
+				ret = elem.value;
+
+				// Handle most common string cases
+				if ( typeof ret === "string" ) {
+					return ret.replace( rreturn, "" );
+				}
+
+				// Handle cases where value is null/undef or number
+				return ret == null ? "" : ret;
+			}
+
+			return;
+		}
+
+		valueIsFunction = isFunction( value );
+
+		return this.each( function( i ) {
+			var val;
+
+			if ( this.nodeType !== 1 ) {
+				return;
+			}
+
+			if ( valueIsFunction ) {
+				val = value.call( this, i, jQuery( this ).val() );
+			} else {
+				val = value;
+			}
+
+			// Treat null/undefined as ""; convert numbers to string
+			if ( val == null ) {
+				val = "";
+
+			} else if ( typeof val === "number" ) {
+				val += "";
+
+			} else if ( Array.isArray( val ) ) {
+				val = jQuery.map( val, function( value ) {
+					return value == null ? "" : value + "";
+				} );
+			}
+
+			hooks = jQuery.valHooks[ this.type ] || jQuery.valHooks[ this.nodeName.toLowerCase() ];
+
+			// If set returns undefined, fall back to normal setting
+			if ( !hooks || !( "set" in hooks ) || hooks.set( this, val, "value" ) === undefined ) {
+				this.value = val;
+			}
+		} );
+	}
+} );
+
+jQuery.extend( {
+	valHooks: {
+		option: {
+			get: function( elem ) {
+
+				var val = jQuery.find.attr( elem, "value" );
+				return val != null ?
+					val :
+
+					// Support: IE <=10 - 11 only
+					// option.text throws exceptions (trac-14686, trac-14858)
+					// Strip and collapse whitespace
+					// https://html.spec.whatwg.org/#strip-and-collapse-whitespace
+					stripAndCollapse( jQuery.text( elem ) );
+			}
+		},
+		select: {
+			get: function( elem ) {
+				var value, option, i,
+					options = elem.options,
+					index = elem.selectedIndex,
+					one = elem.type === "select-one",
+					values = one ? null : [],
+					max = one ? index + 1 : options.length;
+
+				if ( index < 0 ) {
+					i = max;
+
+				} else {
+					i = one ? index : 0;
+				}
+
+				// Loop through all the selected options
+				for ( ; i < max; i++ ) {
+					option = options[ i ];
+
+					// Support: IE <=9 only
+					// IE8-9 doesn't update selected after form reset (trac-2551)
+					if ( ( option.selected || i === index ) &&
+
+							// Don't return options that are disabled or in a disabled optgroup
+							!option.disabled &&
+							( !option.parentNode.disabled ||
+								!nodeName( option.parentNode, "optgroup" ) ) ) {
+
+						// Get the specific value for the option
+						value = jQuery( option ).val();
+
+						// We don't need an array for one selects
+						if ( one ) {
+							return value;
+						}
+
+						// Multi-Selects return an array
+						values.push( value );
+					}
+				}
+
+				return values;
+			},
+
+			set: function( elem, value ) {
+				var optionSet, option,
+					options = elem.options,
+					values = jQuery.makeArray( value ),
+					i = options.length;
+
+				while ( i-- ) {
+					option = options[ i ];
+
+					/* eslint-disable no-cond-assign */
+
+					if ( option.selected =
+						jQuery.inArray( jQuery.valHooks.option.get( option ), values ) > -1
+					) {
+						optionSet = true;
+					}
+
+					/* eslint-enable no-cond-assign */
+				}
+
+				// Force browsers to behave consistently when non-matching value is set
+				if ( !optionSet ) {
+					elem.selectedIndex = -1;
+				}
+				return values;
+			}
+		}
+	}
+} );
+
+// Radios and checkboxes getter/setter
+jQuery.each( [ "radio", "checkbox" ], function() {
+	jQuery.valHooks[ this ] = {
+		set: function( elem, value ) {
+			if ( Array.isArray( value ) ) {
+				return ( elem.checked = jQuery.inArray( jQuery( elem ).val(), value ) > -1 );
+			}
+		}
+	};
+	if ( !support.checkOn ) {
+		jQuery.valHooks[ this ].get = function( elem ) {
+			return elem.getAttribute( "value" ) === null ? "on" : elem.value;
+		};
+	}
+} );
+
+
+
+
+// Return jQuery for attributes-only inclusion
+var location = window.location;
+
+var nonce = { guid: Date.now() };
+
+var rquery = ( /\?/ );
+
+
+
+// Cross-browser xml parsing
+jQuery.parseXML = function( data ) {
+	var xml, parserErrorElem;
+	if ( !data || typeof data !== "string" ) {
+		return null;
+	}
+
+	// Support: IE 9 - 11 only
+	// IE throws on parseFromString with invalid input.
+	try {
+		xml = ( new window.DOMParser() ).parseFromString( data, "text/xml" );
+	} catch ( e ) {}
+
+	parserErrorElem = xml && xml.getElementsByTagName( "parsererror" )[ 0 ];
+	if ( !xml || parserErrorElem ) {
+		jQuery.error( "Invalid XML: " + (
+			parserErrorElem ?
+				jQuery.map( parserErrorElem.childNodes, function( el ) {
+					return el.textContent;
+				} ).join( "\n" ) :
+				data
+		) );
+	}
+	return xml;
+};
+
+
+var rfocusMorph = /^(?:focusinfocus|focusoutblur)$/,
+	stopPropagationCallback = function( e ) {
+		e.stopPropagation();
+	};
+
+jQuery.extend( jQuery.event, {
+
+	trigger: function( event, data, elem, onlyHandlers ) {
+
+		var i, cur, tmp, bubbleType, ontype, handle, special, lastElement,
+			eventPath = [ elem || document ],
+			type = hasOwn.call( event, "type" ) ? event.type : event,
+			namespaces = hasOwn.call( event, "namespace" ) ? event.namespace.split( "." ) : [];
+
+		cur = lastElement = tmp = elem = elem || document;
+
+		// Don't do events on text and comment nodes
+		if ( elem.nodeType === 3 || elem.nodeType === 8 ) {
+			return;
+		}
+
+		// focus/blur morphs to focusin/out; ensure we're not firing them right now
+		if ( rfocusMorph.test( type + jQuery.event.triggered ) ) {
+			return;
+		}
+
+		if ( type.indexOf( "." ) > -1 ) {
+
+			// Namespaced trigger; create a regexp to match event type in handle()
+			namespaces = type.split( "." );
+			type = namespaces.shift();
+			namespaces.sort();
+		}
+		ontype = type.indexOf( ":" ) < 0 && "on" + type;
+
+		// Caller can pass in a jQuery.Event object, Object, or just an event type string
+		event = event[ jQuery.expando ] ?
+			event :
+			new jQuery.Event( type, typeof event === "object" && event );
+
+		// Trigger bitmask: & 1 for native handlers; & 2 for jQuery (always true)
+		event.isTrigger = onlyHandlers ? 2 : 3;
+		event.namespace = namespaces.join( "." );
+		event.rnamespace = event.namespace ?
+			new RegExp( "(^|\\.)" + namespaces.join( "\\.(?:.*\\.|)" ) + "(\\.|$)" ) :
+			null;
+
+		// Clean up the event in case it is being reused
+		event.result = undefined;
+		if ( !event.target ) {
+			event.target = elem;
+		}
+
+		// Clone any incoming data and prepend the event, creating the handler arg list
+		data = data == null ?
+			[ event ] :
+			jQuery.makeArray( data, [ event ] );
+
+		// Allow special events to draw outside the lines
+		special = jQuery.event.special[ type ] || {};
+		if ( !onlyHandlers && special.trigger && special.trigger.apply( elem, data ) === false ) {
+			return;
+		}
+
+		// Determine event propagation path in advance, per W3C events spec (trac-9951)
+		// Bubble up to document, then to window; watch for a global ownerDocument var (trac-9724)
+		if ( !onlyHandlers && !special.noBubble && !isWindow( elem ) ) {
+
+			bubbleType = special.delegateType || type;
+			if ( !rfocusMorph.test( bubbleType + type ) ) {
+				cur = cur.parentNode;
+			}
+			for ( ; cur; cur = cur.parentNode ) {
+				eventPath.push( cur );
+				tmp = cur;
+			}
+
+			// Only add window if we got to document (e.g., not plain obj or detached DOM)
+			if ( tmp === ( elem.ownerDocument || document ) ) {
+				eventPath.push( tmp.defaultView || tmp.parentWindow || window );
+			}
+		}
+
+		// Fire handlers on the event path
+		i = 0;
+		while ( ( cur = eventPath[ i++ ] ) && !event.isPropagationStopped() ) {
+			lastElement = cur;
+			event.type = i > 1 ?
+				bubbleType :
+				special.bindType || type;
+
+			// jQuery handler
+			handle = ( dataPriv.get( cur, "events" ) || Object.create( null ) )[ event.type ] &&
+				dataPriv.get( cur, "handle" );
+			if ( handle ) {
+				handle.apply( cur, data );
+			}
+
+			// Native handler
+			handle = ontype && cur[ ontype ];
+			if ( handle && handle.apply && acceptData( cur ) ) {
+				event.result = handle.apply( cur, data );
+				if ( event.result === false ) {
+					event.preventDefault();
+				}
+			}
+		}
+		event.type = type;
+
+		// If nobody prevented the default action, do it now
+		if ( !onlyHandlers && !event.isDefaultPrevented() ) {
+
+			if ( ( !special._default ||
+				special._default.apply( eventPath.pop(), data ) === false ) &&
+				acceptData( elem ) ) {
+
+				// Call a native DOM method on the target with the same name as the event.
+				// Don't do default actions on window, that's where global variables be (trac-6170)
+				if ( ontype && isFunction( elem[ type ] ) && !isWindow( elem ) ) {
+
+					// Don't re-trigger an onFOO event when we call its FOO() method
+					tmp = elem[ ontype ];
+
+					if ( tmp ) {
+						elem[ ontype ] = null;
+					}
+
+					// Prevent re-triggering of the same event, since we already bubbled it above
+					jQuery.event.triggered = type;
+
+					if ( event.isPropagationStopped() ) {
+						lastElement.addEventListener( type, stopPropagationCallback );
+					}
+
+					elem[ type ]();
+
+					if ( event.isPropagationStopped() ) {
+						lastElement.removeEventListener( type, stopPropagationCallback );
+					}
+
+					jQuery.event.triggered = undefined;
+
+					if ( tmp ) {
+						elem[ ontype ] = tmp;
+					}
+				}
+			}
+		}
+
+		return event.result;
+	},
+
+	// Piggyback on a donor event to simulate a different one
+	// Used only for `focus(in | out)` events
+	simulate: function( type, elem, event ) {
+		var e = jQuery.extend(
+			new jQuery.Event(),
+			event,
+			{
+				type: type,
+				isSimulated: true
+			}
+		);
+
+		jQuery.event.trigger( e, null, elem );
+	}
+
+} );
+
+jQuery.fn.extend( {
+
+	trigger: function( type, data ) {
+		return this.each( function() {
+			jQuery.event.trigger( type, data, this );
+		} );
+	},
+	triggerHandler: function( type, data ) {
+		var elem = this[ 0 ];
+		if ( elem ) {
+			return jQuery.event.trigger( type, data, elem, true );
+		}
+	}
+} );
+
+
+var
+	rbracket = /\[\]$/,
+	rCRLF = /\r?\n/g,
+	rsubmitterTypes = /^(?:submit|button|image|reset|file)$/i,
+	rsubmittable = /^(?:input|select|textarea|keygen)/i;
+
+function buildParams( prefix, obj, traditional, add ) {
+	var name;
+
+	if ( Array.isArray( obj ) ) {
+
+		// Serialize array item.
+		jQuery.each( obj, function( i, v ) {
+			if ( traditional || rbracket.test( prefix ) ) {
+
+				// Treat each array item as a scalar.
+				add( prefix, v );
+
+			} else {
+
+				// Item is non-scalar (array or object), encode its numeric index.
+				buildParams(
+					prefix + "[" + ( typeof v === "object" && v != null ? i : "" ) + "]",
+					v,
+					traditional,
+					add
+				);
+			}
+		} );
+
+	} else if ( !traditional && toType( obj ) === "object" ) {
+
+		// Serialize object item.
+		for ( name in obj ) {
+			buildParams( prefix + "[" + name + "]", obj[ name ], traditional, add );
+		}
+
+	} else {
+
+		// Serialize scalar item.
+		add( prefix, obj );
+	}
+}
+
+// Serialize an array of form elements or a set of
+// key/values into a query string
+jQuery.param = function( a, traditional ) {
+	var prefix,
+		s = [],
+		add = function( key, valueOrFunction ) {
+
+			// If value is a function, invoke it and use its return value
+			var value = isFunction( valueOrFunction ) ?
+				valueOrFunction() :
+				valueOrFunction;
+
+			s[ s.length ] = encodeURIComponent( key ) + "=" +
+				encodeURIComponent( value == null ? "" : value );
+		};
+
+	if ( a == null ) {
+		return "";
+	}
+
+	// If an array was passed in, assume that it is an array of form elements.
+	if ( Array.isArray( a ) || ( a.jquery && !jQuery.isPlainObject( a ) ) ) {
+
+		// Serialize the form elements
+		jQuery.each( a, function() {
+			add( this.name, this.value );
+		} );
+
+	} else {
+
+		// If traditional, encode the "old" way (the way 1.3.2 or older
+		// did it), otherwise encode params recursively.
+		for ( prefix in a ) {
+			buildParams( prefix, a[ prefix ], traditional, add );
+		}
+	}
+
+	// Return the resulting serialization
+	return s.join( "&" );
+};
+
+jQuery.fn.extend( {
+	serialize: function() {
+		return jQuery.param( this.serializeArray() );
+	},
+	serializeArray: function() {
+		return this.map( function() {
+
+			// Can add propHook for "elements" to filter or add form elements
+			var elements = jQuery.prop( this, "elements" );
+			return elements ? jQuery.makeArray( elements ) : this;
+		} ).filter( function() {
+			var type = this.type;
+
+			// Use .is( ":disabled" ) so that fieldset[disabled] works
+			return this.name && !jQuery( this ).is( ":disabled" ) &&
+				rsubmittable.test( this.nodeName ) && !rsubmitterTypes.test( type ) &&
+				( this.checked || !rcheckableType.test( type ) );
+		} ).map( function( _i, elem ) {
+			var val = jQuery( this ).val();
+
+			if ( val == null ) {
+				return null;
+			}
+
+			if ( Array.isArray( val ) ) {
+				return jQuery.map( val, function( val ) {
+					return { name: elem.name, value: val.replace( rCRLF, "\r\n" ) };
+				} );
+			}
+
+			return { name: elem.name, value: val.replace( rCRLF, "\r\n" ) };
+		} ).get();
+	}
+} );
+
+
+var
+	r20 = /%20/g,
+	rhash = /#.*$/,
+	rantiCache = /([?&])_=[^&]*/,
+	rheaders = /^(.*?):[ \t]*([^\r\n]*)$/mg,
+
+	// trac-7653, trac-8125, trac-8152: local protocol detection
+	rlocalProtocol = /^(?:about|app|app-storage|.+-extension|file|res|widget):$/,
+	rnoContent = /^(?:GET|HEAD)$/,
+	rprotocol = /^\/\//,
+
+	/* Prefilters
+	 * 1) They are useful to introduce custom dataTypes (see ajax/jsonp.js for an example)
+	 * 2) These are called:
+	 *    - BEFORE asking for a transport
+	 *    - AFTER param serialization (s.data is a string if s.processData is true)
+	 * 3) key is the dataType
+	 * 4) the catchall symbol "*" can be used
+	 * 5) execution will start with transport dataType and THEN continue down to "*" if needed
+	 */
+	prefilters = {},
+
+	/* Transports bindings
+	 * 1) key is the dataType
+	 * 2) the catchall symbol "*" can be used
+	 * 3) selection will start with transport dataType and THEN go to "*" if needed
+	 */
+	transports = {},
+
+	// Avoid comment-prolog char sequence (trac-10098); must appease lint and evade compression
+	allTypes = "*/".concat( "*" ),
+
+	// Anchor tag for parsing the document origin
+	originAnchor = document.createElement( "a" );
+
+originAnchor.href = location.href;
+
+// Base "constructor" for jQuery.ajaxPrefilter and jQuery.ajaxTransport
+function addToPrefiltersOrTransports( structure ) {
+
+	// dataTypeExpression is optional and defaults to "*"
+	return function( dataTypeExpression, func ) {
+
+		if ( typeof dataTypeExpression !== "string" ) {
+			func = dataTypeExpression;
+			dataTypeExpression = "*";
+		}
+
+		var dataType,
+			i = 0,
+			dataTypes = dataTypeExpression.toLowerCase().match( rnothtmlwhite ) || [];
+
+		if ( isFunction( func ) ) {
+
+			// For each dataType in the dataTypeExpression
+			while ( ( dataType = dataTypes[ i++ ] ) ) {
+
+				// Prepend if requested
+				if ( dataType[ 0 ] === "+" ) {
+					dataType = dataType.slice( 1 ) || "*";
+					( structure[ dataType ] = structure[ dataType ] || [] ).unshift( func );
+
+				// Otherwise append
+				} else {
+					( structure[ dataType ] = structure[ dataType ] || [] ).push( func );
+				}
+			}
+		}
+	};
+}
+
+// Base inspection function for prefilters and transports
+function inspectPrefiltersOrTransports( structure, options, originalOptions, jqXHR ) {
+
+	var inspected = {},
+		seekingTransport = ( structure === transports );
+
+	function inspect( dataType ) {
+		var selected;
+		inspected[ dataType ] = true;
+		jQuery.each( structure[ dataType ] || [], function( _, prefilterOrFactory ) {
+			var dataTypeOrTransport = prefilterOrFactory( options, originalOptions, jqXHR );
+			if ( typeof dataTypeOrTransport === "string" &&
+				!seekingTransport && !inspected[ dataTypeOrTransport ] ) {
+
+				options.dataTypes.unshift( dataTypeOrTransport );
+				inspect( dataTypeOrTransport );
+				return false;
+			} else if ( seekingTransport ) {
+				return !( selected = dataTypeOrTransport );
+			}
+		} );
+		return selected;
+	}
+
+	return inspect( options.dataTypes[ 0 ] ) || !inspected[ "*" ] && inspect( "*" );
+}
+
+// A special extend for ajax options
+// that takes "flat" options (not to be deep extended)
+// Fixes trac-9887
+function ajaxExtend( target, src ) {
+	var key, deep,
+		flatOptions = jQuery.ajaxSettings.flatOptions || {};
+
+	for ( key in src ) {
+		if ( src[ key ] !== undefined ) {
+			( flatOptions[ key ] ? target : ( deep || ( deep = {} ) ) )[ key ] = src[ key ];
+		}
+	}
+	if ( deep ) {
+		jQuery.extend( true, target, deep );
+	}
+
+	return target;
+}
+
+/* Handles responses to an ajax request:
+ * - finds the right dataType (mediates between content-type and expected dataType)
+ * - returns the corresponding response
+ */
+function ajaxHandleResponses( s, jqXHR, responses ) {
+
+	var ct, type, finalDataType, firstDataType,
+		contents = s.contents,
+		dataTypes = s.dataTypes;
+
+	// Remove auto dataType and get content-type in the process
+	while ( dataTypes[ 0 ] === "*" ) {
+		dataTypes.shift();
+		if ( ct === undefined ) {
+			ct = s.mimeType || jqXHR.getResponseHeader( "Content-Type" );
+		}
+	}
+
+	// Check if we're dealing with a known content-type
+	if ( ct ) {
+		for ( type in contents ) {
+			if ( contents[ type ] && contents[ type ].test( ct ) ) {
+				dataTypes.unshift( type );
+				break;
+			}
+		}
+	}
+
+	// Check to see if we have a response for the expected dataType
+	if ( dataTypes[ 0 ] in responses ) {
+		finalDataType = dataTypes[ 0 ];
+	} else {
+
+		// Try convertible dataTypes
+		for ( type in responses ) {
+			if ( !dataTypes[ 0 ] || s.converters[ type + " " + dataTypes[ 0 ] ] ) {
+				finalDataType = type;
+				break;
+			}
+			if ( !firstDataType ) {
+				firstDataType = type;
+			}
+		}
+
+		// Or just use first one
+		finalDataType = finalDataType || firstDataType;
+	}
+
+	// If we found a dataType
+	// We add the dataType to the list if needed
+	// and return the corresponding response
+	if ( finalDataType ) {
+		if ( finalDataType !== dataTypes[ 0 ] ) {
+			dataTypes.unshift( finalDataType );
+		}
+		return responses[ finalDataType ];
+	}
+}
+
+/* Chain conversions given the request and the original response
+ * Also sets the responseXXX fields on the jqXHR instance
+ */
+function ajaxConvert( s, response, jqXHR, isSuccess ) {
+	var conv2, current, conv, tmp, prev,
+		converters = {},
+
+		// Work with a copy of dataTypes in case we need to modify it for conversion
+		dataTypes = s.dataTypes.slice();
+
+	// Create converters map with lowercased keys
+	if ( dataTypes[ 1 ] ) {
+		for ( conv in s.converters ) {
+			converters[ conv.toLowerCase() ] = s.converters[ conv ];
+		}
+	}
+
+	current = dataTypes.shift();
+
+	// Convert to each sequential dataType
+	while ( current ) {
+
+		if ( s.responseFields[ current ] ) {
+			jqXHR[ s.responseFields[ current ] ] = response;
+		}
+
+		// Apply the dataFilter if provided
+		if ( !prev && isSuccess && s.dataFilter ) {
+			response = s.dataFilter( response, s.dataType );
+		}
+
+		prev = current;
+		current = dataTypes.shift();
+
+		if ( current ) {
+
+			// There's only work to do if current dataType is non-auto
+			if ( current === "*" ) {
+
+				current = prev;
+
+			// Convert response if prev dataType is non-auto and differs from current
+			} else if ( prev !== "*" && prev !== current ) {
+
+				// Seek a direct converter
+				conv = converters[ prev + " " + current ] || converters[ "* " + current ];
+
+				// If none found, seek a pair
+				if ( !conv ) {
+					for ( conv2 in converters ) {
+
+						// If conv2 outputs current
+						tmp = conv2.split( " " );
+						if ( tmp[ 1 ] === current ) {
+
+							// If prev can be converted to accepted input
+							conv = converters[ prev + " " + tmp[ 0 ] ] ||
+								converters[ "* " + tmp[ 0 ] ];
+							if ( conv ) {
+
+								// Condense equivalence converters
+								if ( conv === true ) {
+									conv = converters[ conv2 ];
+
+								// Otherwise, insert the intermediate dataType
+								} else if ( converters[ conv2 ] !== true ) {
+									current = tmp[ 0 ];
+									dataTypes.unshift( tmp[ 1 ] );
+								}
+								break;
+							}
+						}
+					}
+				}
+
+				// Apply converter (if not an equivalence)
+				if ( conv !== true ) {
+
+					// Unless errors are allowed to bubble, catch and return them
+					if ( conv && s.throws ) {
+						response = conv( response );
+					} else {
+						try {
+							response = conv( response );
+						} catch ( e ) {
+							return {
+								state: "parsererror",
+								error: conv ? e : "No conversion from " + prev + " to " + current
+							};
+						}
+					}
+				}
+			}
+		}
+	}
+
+	return { state: "success", data: response };
+}
+
+jQuery.extend( {
+
+	// Counter for holding the number of active queries
+	active: 0,
+
+	// Last-Modified header cache for next request
+	lastModified: {},
+	etag: {},
+
+	ajaxSettings: {
+		url: location.href,
+		type: "GET",
+		isLocal: rlocalProtocol.test( location.protocol ),
+		global: true,
+		processData: true,
+		async: true,
+		contentType: "application/x-www-form-urlencoded; charset=UTF-8",
+
+		/*
+		timeout: 0,
+		data: null,
+		dataType: null,
+		username: null,
+		password: null,
+		cache: null,
+		throws: false,
+		traditional: false,
+		headers: {},
+		*/
+
+		accepts: {
+			"*": allTypes,
+			text: "text/plain",
+			html: "text/html",
+			xml: "application/xml, text/xml",
+			json: "application/json, text/javascript"
+		},
+
+		contents: {
+			xml: /\bxml\b/,
+			html: /\bhtml/,
+			json: /\bjson\b/
+		},
+
+		responseFields: {
+			xml: "responseXML",
+			text: "responseText",
+			json: "responseJSON"
+		},
+
+		// Data converters
+		// Keys separate source (or catchall "*") and destination types with a single space
+		converters: {
+
+			// Convert anything to text
+			"* text": String,
+
+			// Text to html (true = no transformation)
+			"text html": true,
+
+			// Evaluate text as a json expression
+			"text json": JSON.parse,
+
+			// Parse text as xml
+			"text xml": jQuery.parseXML
+		},
+
+		// For options that shouldn't be deep extended:
+		// you can add your own custom options here if
+		// and when you create one that shouldn't be
+		// deep extended (see ajaxExtend)
+		flatOptions: {
+			url: true,
+			context: true
+		}
+	},
+
+	// Creates a full fledged settings object into target
+	// with both ajaxSettings and settings fields.
+	// If target is omitted, writes into ajaxSettings.
+	ajaxSetup: function( target, settings ) {
+		return settings ?
+
+			// Building a settings object
+			ajaxExtend( ajaxExtend( target, jQuery.ajaxSettings ), settings ) :
+
+			// Extending ajaxSettings
+			ajaxExtend( jQuery.ajaxSettings, target );
+	},
+
+	ajaxPrefilter: addToPrefiltersOrTransports( prefilters ),
+	ajaxTransport: addToPrefiltersOrTransports( transports ),
+
+	// Main method
+	ajax: function( url, options ) {
+
+		// If url is an object, simulate pre-1.5 signature
+		if ( typeof url === "object" ) {
+			options = url;
+			url = undefined;
+		}
+
+		// Force options to be an object
+		options = options || {};
+
+		var transport,
+
+			// URL without anti-cache param
+			cacheURL,
+
+			// Response headers
+			responseHeadersString,
+			responseHeaders,
+
+			// timeout handle
+			timeoutTimer,
+
+			// Url cleanup var
+			urlAnchor,
+
+			// Request state (becomes false upon send and true upon completion)
+			completed,
+
+			// To know if global events are to be dispatched
+			fireGlobals,
+
+			// Loop variable
+			i,
+
+			// uncached part of the url
+			uncached,
+
+			// Create the final options object
+			s = jQuery.ajaxSetup( {}, options ),
+
+			// Callbacks context
+			callbackContext = s.context || s,
+
+			// Context for global events is callbackContext if it is a DOM node or jQuery collection
+			globalEventContext = s.context &&
+				( callbackContext.nodeType || callbackContext.jquery ) ?
+				jQuery( callbackContext ) :
+				jQuery.event,
+
+			// Deferreds
+			deferred = jQuery.Deferred(),
+			completeDeferred = jQuery.Callbacks( "once memory" ),
+
+			// Status-dependent callbacks
+			statusCode = s.statusCode || {},
+
+			// Headers (they are sent all at once)
+			requestHeaders = {},
+			requestHeadersNames = {},
+
+			// Default abort message
+			strAbort = "canceled",
+
+			// Fake xhr
+			jqXHR = {
+				readyState: 0,
+
+				// Builds headers hashtable if needed
+				getResponseHeader: function( key ) {
+					var match;
+					if ( completed ) {
+						if ( !responseHeaders ) {
+							responseHeaders = {};
+							while ( ( match = rheaders.exec( responseHeadersString ) ) ) {
+								responseHeaders[ match[ 1 ].toLowerCase() + " " ] =
+									( responseHeaders[ match[ 1 ].toLowerCase() + " " ] || [] )
+										.concat( match[ 2 ] );
+							}
+						}
+						match = responseHeaders[ key.toLowerCase() + " " ];
+					}
+					return match == null ? null : match.join( ", " );
+				},
+
+				// Raw string
+				getAllResponseHeaders: function() {
+					return completed ? responseHeadersString : null;
+				},
+
+				// Caches the header
+				setRequestHeader: function( name, value ) {
+					if ( completed == null ) {
+						name = requestHeadersNames[ name.toLowerCase() ] =
+							requestHeadersNames[ name.toLowerCase() ] || name;
+						requestHeaders[ name ] = value;
+					}
+					return this;
+				},
+
+				// Overrides response content-type header
+				overrideMimeType: function( type ) {
+					if ( completed == null ) {
+						s.mimeType = type;
+					}
+					return this;
+				},
+
+				// Status-dependent callbacks
+				statusCode: function( map ) {
+					var code;
+					if ( map ) {
+						if ( completed ) {
+
+							// Execute the appropriate callbacks
+							jqXHR.always( map[ jqXHR.status ] );
+						} else {
+
+							// Lazy-add the new callbacks in a way that preserves old ones
+							for ( code in map ) {
+								statusCode[ code ] = [ statusCode[ code ], map[ code ] ];
+							}
+						}
+					}
+					return this;
+				},
+
+				// Cancel the request
+				abort: function( statusText ) {
+					var finalText = statusText || strAbort;
+					if ( transport ) {
+						transport.abort( finalText );
+					}
+					done( 0, finalText );
+					return this;
+				}
+			};
+
+		// Attach deferreds
+		deferred.promise( jqXHR );
+
+		// Add protocol if not provided (prefilters might expect it)
+		// Handle falsy url in the settings object (trac-10093: consistency with old signature)
+		// We also use the url parameter if available
+		s.url = ( ( url || s.url || location.href ) + "" )
+			.replace( rprotocol, location.protocol + "//" );
+
+		// Alias method option to type as per ticket trac-12004
+		s.type = options.method || options.type || s.method || s.type;
+
+		// Extract dataTypes list
+		s.dataTypes = ( s.dataType || "*" ).toLowerCase().match( rnothtmlwhite ) || [ "" ];
+
+		// A cross-domain request is in order when the origin doesn't match the current origin.
+		if ( s.crossDomain == null ) {
+			urlAnchor = document.createElement( "a" );
+
+			// Support: IE <=8 - 11, Edge 12 - 15
+			// IE throws exception on accessing the href property if url is malformed,
+			// e.g. http://example.com:80x/
+			try {
+				urlAnchor.href = s.url;
+
+				// Support: IE <=8 - 11 only
+				// Anchor's host property isn't correctly set when s.url is relative
+				urlAnchor.href = urlAnchor.href;
+				s.crossDomain = originAnchor.protocol + "//" + originAnchor.host !==
+					urlAnchor.protocol + "//" + urlAnchor.host;
+			} catch ( e ) {
+
+				// If there is an error parsing the URL, assume it is crossDomain,
+				// it can be rejected by the transport if it is invalid
+				s.crossDomain = true;
+			}
+		}
+
+		// Convert data if not already a string
+		if ( s.data && s.processData && typeof s.data !== "string" ) {
+			s.data = jQuery.param( s.data, s.traditional );
+		}
+
+		// Apply prefilters
+		inspectPrefiltersOrTransports( prefilters, s, options, jqXHR );
+
+		// If request was aborted inside a prefilter, stop there
+		if ( completed ) {
+			return jqXHR;
+		}
+
+		// We can fire global events as of now if asked to
+		// Don't fire events if jQuery.event is undefined in an AMD-usage scenario (trac-15118)
+		fireGlobals = jQuery.event && s.global;
+
+		// Watch for a new set of requests
+		if ( fireGlobals && jQuery.active++ === 0 ) {
+			jQuery.event.trigger( "ajaxStart" );
+		}
+
+		// Uppercase the type
+		s.type = s.type.toUpperCase();
+
+		// Determine if request has content
+		s.hasContent = !rnoContent.test( s.type );
+
+		// Save the URL in case we're toying with the If-Modified-Since
+		// and/or If-None-Match header later on
+		// Remove hash to simplify url manipulation
+		cacheURL = s.url.replace( rhash, "" );
+
+		// More options handling for requests with no content
+		if ( !s.hasContent ) {
+
+			// Remember the hash so we can put it back
+			uncached = s.url.slice( cacheURL.length );
+
+			// If data is available and should be processed, append data to url
+			if ( s.data && ( s.processData || typeof s.data === "string" ) ) {
+				cacheURL += ( rquery.test( cacheURL ) ? "&" : "?" ) + s.data;
+
+				// trac-9682: remove data so that it's not used in an eventual retry
+				delete s.data;
+			}
+
+			// Add or update anti-cache param if needed
+			if ( s.cache === false ) {
+				cacheURL = cacheURL.replace( rantiCache, "$1" );
+				uncached = ( rquery.test( cacheURL ) ? "&" : "?" ) + "_=" + ( nonce.guid++ ) +
+					uncached;
+			}
+
+			// Put hash and anti-cache on the URL that will be requested (gh-1732)
+			s.url = cacheURL + uncached;
+
+		// Change '%20' to '+' if this is encoded form body content (gh-2658)
+		} else if ( s.data && s.processData &&
+			( s.contentType || "" ).indexOf( "application/x-www-form-urlencoded" ) === 0 ) {
+			s.data = s.data.replace( r20, "+" );
+		}
+
+		// Set the If-Modified-Since and/or If-None-Match header, if in ifModified mode.
+		if ( s.ifModified ) {
+			if ( jQuery.lastModified[ cacheURL ] ) {
+				jqXHR.setRequestHeader( "If-Modified-Since", jQuery.lastModified[ cacheURL ] );
+			}
+			if ( jQuery.etag[ cacheURL ] ) {
+				jqXHR.setRequestHeader( "If-None-Match", jQuery.etag[ cacheURL ] );
+			}
+		}
+
+		// Set the correct header, if data is being sent
+		if ( s.data && s.hasContent && s.contentType !== false || options.contentType ) {
+			jqXHR.setRequestHeader( "Content-Type", s.contentType );
+		}
+
+		// Set the Accepts header for the server, depending on the dataType
+		jqXHR.setRequestHeader(
+			"Accept",
+			s.dataTypes[ 0 ] && s.accepts[ s.dataTypes[ 0 ] ] ?
+				s.accepts[ s.dataTypes[ 0 ] ] +
+					( s.dataTypes[ 0 ] !== "*" ? ", " + allTypes + "; q=0.01" : "" ) :
+				s.accepts[ "*" ]
+		);
+
+		// Check for headers option
+		for ( i in s.headers ) {
+			jqXHR.setRequestHeader( i, s.headers[ i ] );
+		}
+
+		// Allow custom headers/mimetypes and early abort
+		if ( s.beforeSend &&
+			( s.beforeSend.call( callbackContext, jqXHR, s ) === false || completed ) ) {
+
+			// Abort if not done already and return
+			return jqXHR.abort();
+		}
+
+		// Aborting is no longer a cancellation
+		strAbort = "abort";
+
+		// Install callbacks on deferreds
+		completeDeferred.add( s.complete );
+		jqXHR.done( s.success );
+		jqXHR.fail( s.error );
+
+		// Get transport
+		transport = inspectPrefiltersOrTransports( transports, s, options, jqXHR );
+
+		// If no transport, we auto-abort
+		if ( !transport ) {
+			done( -1, "No Transport" );
+		} else {
+			jqXHR.readyState = 1;
+
+			// Send global event
+			if ( fireGlobals ) {
+				globalEventContext.trigger( "ajaxSend", [ jqXHR, s ] );
+			}
+
+			// If request was aborted inside ajaxSend, stop there
+			if ( completed ) {
+				return jqXHR;
+			}
+
+			// Timeout
+			if ( s.async && s.timeout > 0 ) {
+				timeoutTimer = window.setTimeout( function() {
+					jqXHR.abort( "timeout" );
+				}, s.timeout );
+			}
+
+			try {
+				completed = false;
+				transport.send( requestHeaders, done );
+			} catch ( e ) {
+
+				// Rethrow post-completion exceptions
+				if ( completed ) {
+					throw e;
+				}
+
+				// Propagate others as results
+				done( -1, e );
+			}
+		}
+
+		// Callback for when everything is done
+		function done( status, nativeStatusText, responses, headers ) {
+			var isSuccess, success, error, response, modified,
+				statusText = nativeStatusText;
+
+			// Ignore repeat invocations
+			if ( completed ) {
+				return;
+			}
+
+			completed = true;
+
+			// Clear timeout if it exists
+			if ( timeoutTimer ) {
+				window.clearTimeout( timeoutTimer );
+			}
+
+			// Dereference transport for early garbage collection
+			// (no matter how long the jqXHR object will be used)
+			transport = undefined;
+
+			// Cache response headers
+			responseHeadersString = headers || "";
+
+			// Set readyState
+			jqXHR.readyState = status > 0 ? 4 : 0;
+
+			// Determine if successful
+			isSuccess = status >= 200 && status < 300 || status === 304;
+
+			// Get response data
+			if ( responses ) {
+				response = ajaxHandleResponses( s, jqXHR, responses );
+			}
+
+			// Use a noop converter for missing script but not if jsonp
+			if ( !isSuccess &&
+				jQuery.inArray( "script", s.dataTypes ) > -1 &&
+				jQuery.inArray( "json", s.dataTypes ) < 0 ) {
+				s.converters[ "text script" ] = function() {};
+			}
+
+			// Convert no matter what (that way responseXXX fields are always set)
+			response = ajaxConvert( s, response, jqXHR, isSuccess );
+
+			// If successful, handle type chaining
+			if ( isSuccess ) {
+
+				// Set the If-Modified-Since and/or If-None-Match header, if in ifModified mode.
+				if ( s.ifModified ) {
+					modified = jqXHR.getResponseHeader( "Last-Modified" );
+					if ( modified ) {
+						jQuery.lastModified[ cacheURL ] = modified;
+					}
+					modified = jqXHR.getResponseHeader( "etag" );
+					if ( modified ) {
+						jQuery.etag[ cacheURL ] = modified;
+					}
+				}
+
+				// if no content
+				if ( status === 204 || s.type === "HEAD" ) {
+					statusText = "nocontent";
+
+				// if not modified
+				} else if ( status === 304 ) {
+					statusText = "notmodified";
+
+				// If we have data, let's convert it
+				} else {
+					statusText = response.state;
+					success = response.data;
+					error = response.error;
+					isSuccess = !error;
+				}
+			} else {
+
+				// Extract error from statusText and normalize for non-aborts
+				error = statusText;
+				if ( status || !statusText ) {
+					statusText = "error";
+					if ( status < 0 ) {
+						status = 0;
+					}
+				}
+			}
+
+			// Set data for the fake xhr object
+			jqXHR.status = status;
+			jqXHR.statusText = ( nativeStatusText || statusText ) + "";
+
+			// Success/Error
+			if ( isSuccess ) {
+				deferred.resolveWith( callbackContext, [ success, statusText, jqXHR ] );
+			} else {
+				deferred.rejectWith( callbackContext, [ jqXHR, statusText, error ] );
+			}
+
+			// Status-dependent callbacks
+			jqXHR.statusCode( statusCode );
+			statusCode = undefined;
+
+			if ( fireGlobals ) {
+				globalEventContext.trigger( isSuccess ? "ajaxSuccess" : "ajaxError",
+					[ jqXHR, s, isSuccess ? success : error ] );
+			}
+
+			// Complete
+			completeDeferred.fireWith( callbackContext, [ jqXHR, statusText ] );
+
+			if ( fireGlobals ) {
+				globalEventContext.trigger( "ajaxComplete", [ jqXHR, s ] );
+
+				// Handle the global AJAX counter
+				if ( !( --jQuery.active ) ) {
+					jQuery.event.trigger( "ajaxStop" );
+				}
+			}
+		}
+
+		return jqXHR;
+	},
+
+	getJSON: function( url, data, callback ) {
+		return jQuery.get( url, data, callback, "json" );
+	},
+
+	getScript: function( url, callback ) {
+		return jQuery.get( url, undefined, callback, "script" );
+	}
+} );
+
+jQuery.each( [ "get", "post" ], function( _i, method ) {
+	jQuery[ method ] = function( url, data, callback, type ) {
+
+		// Shift arguments if data argument was omitted
+		if ( isFunction( data ) ) {
+			type = type || callback;
+			callback = data;
+			data = undefined;
+		}
+
+		// The url can be an options object (which then must have .url)
+		return jQuery.ajax( jQuery.extend( {
+			url: url,
+			type: method,
+			dataType: type,
+			data: data,
+			success: callback
+		}, jQuery.isPlainObject( url ) && url ) );
+	};
+} );
+
+jQuery.ajaxPrefilter( function( s ) {
+	var i;
+	for ( i in s.headers ) {
+		if ( i.toLowerCase() === "content-type" ) {
+			s.contentType = s.headers[ i ] || "";
+		}
+	}
+} );
+
+
+jQuery._evalUrl = function( url, options, doc ) {
+	return jQuery.ajax( {
+		url: url,
+
+		// Make this explicit, since user can override this through ajaxSetup (trac-11264)
+		type: "GET",
+		dataType: "script",
+		cache: true,
+		async: false,
+		global: false,
+
+		// Only evaluate the response if it is successful (gh-4126)
+		// dataFilter is not invoked for failure responses, so using it instead
+		// of the default converter is kludgy but it works.
+		converters: {
+			"text script": function() {}
+		},
+		dataFilter: function( response ) {
+			jQuery.globalEval( response, options, doc );
+		}
+	} );
+};
+
+
+jQuery.fn.extend( {
+	wrapAll: function( html ) {
+		var wrap;
+
+		if ( this[ 0 ] ) {
+			if ( isFunction( html ) ) {
+				html = html.call( this[ 0 ] );
+			}
+
+			// The elements to wrap the target around
+			wrap = jQuery( html, this[ 0 ].ownerDocument ).eq( 0 ).clone( true );
+
+			if ( this[ 0 ].parentNode ) {
+				wrap.insertBefore( this[ 0 ] );
+			}
+
+			wrap.map( function() {
+				var elem = this;
+
+				while ( elem.firstElementChild ) {
+					elem = elem.firstElementChild;
+				}
+
+				return elem;
+			} ).append( this );
+		}
+
+		return this;
+	},
+
+	wrapInner: function( html ) {
+		if ( isFunction( html ) ) {
+			return this.each( function( i ) {
+				jQuery( this ).wrapInner( html.call( this, i ) );
+			} );
+		}
+
+		return this.each( function() {
+			var self = jQuery( this ),
+				contents = self.contents();
+
+			if ( contents.length ) {
+				contents.wrapAll( html );
+
+			} else {
+				self.append( html );
+			}
+		} );
+	},
+
+	wrap: function( html ) {
+		var htmlIsFunction = isFunction( html );
+
+		return this.each( function( i ) {
+			jQuery( this ).wrapAll( htmlIsFunction ? html.call( this, i ) : html );
+		} );
+	},
+
+	unwrap: function( selector ) {
+		this.parent( selector ).not( "body" ).each( function() {
+			jQuery( this ).replaceWith( this.childNodes );
+		} );
+		return this;
+	}
+} );
+
+
+jQuery.expr.pseudos.hidden = function( elem ) {
+	return !jQuery.expr.pseudos.visible( elem );
+};
+jQuery.expr.pseudos.visible = function( elem ) {
+	return !!( elem.offsetWidth || elem.offsetHeight || elem.getClientRects().length );
+};
+
+
+
+
+jQuery.ajaxSettings.xhr = function() {
+	try {
+		return new window.XMLHttpRequest();
+	} catch ( e ) {}
+};
+
+var xhrSuccessStatus = {
+
+		// File protocol always yields status code 0, assume 200
+		0: 200,
+
+		// Support: IE <=9 only
+		// trac-1450: sometimes IE returns 1223 when it should be 204
+		1223: 204
+	},
+	xhrSupported = jQuery.ajaxSettings.xhr();
+
+support.cors = !!xhrSupported && ( "withCredentials" in xhrSupported );
+support.ajax = xhrSupported = !!xhrSupported;
+
+jQuery.ajaxTransport( function( options ) {
+	var callback, errorCallback;
+
+	// Cross domain only allowed if supported through XMLHttpRequest
+	if ( support.cors || xhrSupported && !options.crossDomain ) {
+		return {
+			send: function( headers, complete ) {
+				var i,
+					xhr = options.xhr();
+
+				xhr.open(
+					options.type,
+					options.url,
+					options.async,
+					options.username,
+					options.password
+				);
+
+				// Apply custom fields if provided
+				if ( options.xhrFields ) {
+					for ( i in options.xhrFields ) {
+						xhr[ i ] = options.xhrFields[ i ];
+					}
+				}
+
+				// Override mime type if needed
+				if ( options.mimeType && xhr.overrideMimeType ) {
+					xhr.overrideMimeType( options.mimeType );
+				}
+
+				// X-Requested-With header
+				// For cross-domain requests, seeing as conditions for a preflight are
+				// akin to a jigsaw puzzle, we simply never set it to be sure.
+				// (it can always be set on a per-request basis or even using ajaxSetup)
+				// For same-domain requests, won't change header if already provided.
+				if ( !options.crossDomain && !headers[ "X-Requested-With" ] ) {
+					headers[ "X-Requested-With" ] = "XMLHttpRequest";
+				}
+
+				// Set headers
+				for ( i in headers ) {
+					xhr.setRequestHeader( i, headers[ i ] );
+				}
+
+				// Callback
+				callback = function( type ) {
+					return function() {
+						if ( callback ) {
+							callback = errorCallback = xhr.onload =
+								xhr.onerror = xhr.onabort = xhr.ontimeout =
+									xhr.onreadystatechange = null;
+
+							if ( type === "abort" ) {
+								xhr.abort();
+							} else if ( type === "error" ) {
+
+								// Support: IE <=9 only
+								// On a manual native abort, IE9 throws
+								// errors on any property access that is not readyState
+								if ( typeof xhr.status !== "number" ) {
+									complete( 0, "error" );
+								} else {
+									complete(
+
+										// File: protocol always yields status 0; see trac-8605, trac-14207
+										xhr.status,
+										xhr.statusText
+									);
+								}
+							} else {
+								complete(
+									xhrSuccessStatus[ xhr.status ] || xhr.status,
+									xhr.statusText,
+
+									// Support: IE <=9 only
+									// IE9 has no XHR2 but throws on binary (trac-11426)
+									// For XHR2 non-text, let the caller handle it (gh-2498)
+									( xhr.responseType || "text" ) !== "text"  ||
+									typeof xhr.responseText !== "string" ?
+										{ binary: xhr.response } :
+										{ text: xhr.responseText },
+									xhr.getAllResponseHeaders()
+								);
+							}
+						}
+					};
+				};
+
+				// Listen to events
+				xhr.onload = callback();
+				errorCallback = xhr.onerror = xhr.ontimeout = callback( "error" );
+
+				// Support: IE 9 only
+				// Use onreadystatechange to replace onabort
+				// to handle uncaught aborts
+				if ( xhr.onabort !== undefined ) {
+					xhr.onabort = errorCallback;
+				} else {
+					xhr.onreadystatechange = function() {
+
+						// Check readyState before timeout as it changes
+						if ( xhr.readyState === 4 ) {
+
+							// Allow onerror to be called first,
+							// but that will not handle a native abort
+							// Also, save errorCallback to a variable
+							// as xhr.onerror cannot be accessed
+							window.setTimeout( function() {
+								if ( callback ) {
+									errorCallback();
+								}
+							} );
+						}
+					};
+				}
+
+				// Create the abort callback
+				callback = callback( "abort" );
+
+				try {
+
+					// Do send the request (this may raise an exception)
+					xhr.send( options.hasContent && options.data || null );
+				} catch ( e ) {
+
+					// trac-14683: Only rethrow if this hasn't been notified as an error yet
+					if ( callback ) {
+						throw e;
+					}
+				}
+			},
+
+			abort: function() {
+				if ( callback ) {
+					callback();
+				}
+			}
+		};
+	}
+} );
+
+
+
+
+// Prevent auto-execution of scripts when no explicit dataType was provided (See gh-2432)
+jQuery.ajaxPrefilter( function( s ) {
+	if ( s.crossDomain ) {
+		s.contents.script = false;
+	}
+} );
+
+// Install script dataType
+jQuery.ajaxSetup( {
+	accepts: {
+		script: "text/javascript, application/javascript, " +
+			"application/ecmascript, application/x-ecmascript"
+	},
+	contents: {
+		script: /\b(?:java|ecma)script\b/
+	},
+	converters: {
+		"text script": function( text ) {
+			jQuery.globalEval( text );
+			return text;
+		}
+	}
+} );
+
+// Handle cache's special case and crossDomain
+jQuery.ajaxPrefilter( "script", function( s ) {
+	if ( s.cache === undefined ) {
+		s.cache = false;
+	}
+	if ( s.crossDomain ) {
+		s.type = "GET";
+	}
+} );
+
+// Bind script tag hack transport
+jQuery.ajaxTransport( "script", function( s ) {
+
+	// This transport only deals with cross domain or forced-by-attrs requests
+	if ( s.crossDomain || s.scriptAttrs ) {
+		var script, callback;
+		return {
+			send: function( _, complete ) {
+				script = jQuery( "<script>" )
+					.attr( s.scriptAttrs || {} )
+					.prop( { charset: s.scriptCharset, src: s.url } )
+					.on( "load error", callback = function( evt ) {
+						script.remove();
+						callback = null;
+						if ( evt ) {
+							complete( evt.type === "error" ? 404 : 200, evt.type );
+						}
+					} );
+
+				// Use native DOM manipulation to avoid our domManip AJAX trickery
+				document.head.appendChild( script[ 0 ] );
+			},
+			abort: function() {
+				if ( callback ) {
+					callback();
+				}
+			}
+		};
+	}
+} );
+
+
+
+
+var oldCallbacks = [],
+	rjsonp = /(=)\?(?=&|$)|\?\?/;
+
+// Default jsonp settings
+jQuery.ajaxSetup( {
+	jsonp: "callback",
+	jsonpCallback: function() {
+		var callback = oldCallbacks.pop() || ( jQuery.expando + "_" + ( nonce.guid++ ) );
+		this[ callback ] = true;
+		return callback;
+	}
+} );
+
+// Detect, normalize options and install callbacks for jsonp requests
+jQuery.ajaxPrefilter( "json jsonp", function( s, originalSettings, jqXHR ) {
+
+	var callbackName, overwritten, responseContainer,
+		jsonProp = s.jsonp !== false && ( rjsonp.test( s.url ) ?
+			"url" :
+			typeof s.data === "string" &&
+				( s.contentType || "" )
+					.indexOf( "application/x-www-form-urlencoded" ) === 0 &&
+				rjsonp.test( s.data ) && "data"
+		);
+
+	// Handle iff the expected data type is "jsonp" or we have a parameter to set
+	if ( jsonProp || s.dataTypes[ 0 ] === "jsonp" ) {
+
+		// Get callback name, remembering preexisting value associated with it
+		callbackName = s.jsonpCallback = isFunction( s.jsonpCallback ) ?
+			s.jsonpCallback() :
+			s.jsonpCallback;
+
+		// Insert callback into url or form data
+		if ( jsonProp ) {
+			s[ jsonProp ] = s[ jsonProp ].replace( rjsonp, "$1" + callbackName );
+		} else if ( s.jsonp !== false ) {
+			s.url += ( rquery.test( s.url ) ? "&" : "?" ) + s.jsonp + "=" + callbackName;
+		}
+
+		// Use data converter to retrieve json after script execution
+		s.converters[ "script json" ] = function() {
+			if ( !responseContainer ) {
+				jQuery.error( callbackName + " was not called" );
+			}
+			return responseContainer[ 0 ];
+		};
+
+		// Force json dataType
+		s.dataTypes[ 0 ] = "json";
+
+		// Install callback
+		overwritten = window[ callbackName ];
+		window[ callbackName ] = function() {
+			responseContainer = arguments;
+		};
+
+		// Clean-up function (fires after converters)
+		jqXHR.always( function() {
+
+			// If previous value didn't exist - remove it
+			if ( overwritten === undefined ) {
+				jQuery( window ).removeProp( callbackName );
+
+			// Otherwise restore preexisting value
+			} else {
+				window[ callbackName ] = overwritten;
+			}
+
+			// Save back as free
+			if ( s[ callbackName ] ) {
+
+				// Make sure that re-using the options doesn't screw things around
+				s.jsonpCallback = originalSettings.jsonpCallback;
+
+				// Save the callback name for future use
+				oldCallbacks.push( callbackName );
+			}
+
+			// Call if it was a function and we have a response
+			if ( responseContainer && isFunction( overwritten ) ) {
+				overwritten( responseContainer[ 0 ] );
+			}
+
+			responseContainer = overwritten = undefined;
+		} );
+
+		// Delegate to script
+		return "script";
+	}
+} );
+
+
+
+
+// Support: Safari 8 only
+// In Safari 8 documents created via document.implementation.createHTMLDocument
+// collapse sibling forms: the second one becomes a child of the first one.
+// Because of that, this security measure has to be disabled in Safari 8.
+// https://bugs.webkit.org/show_bug.cgi?id=137337
+support.createHTMLDocument = ( function() {
+	var body = document.implementation.createHTMLDocument( "" ).body;
+	body.innerHTML = "<form></form><form></form>";
+	return body.childNodes.length === 2;
+} )();
+
+
+// Argument "data" should be string of html
+// context (optional): If specified, the fragment will be created in this context,
+// defaults to document
+// keepScripts (optional): If true, will include scripts passed in the html string
+jQuery.parseHTML = function( data, context, keepScripts ) {
+	if ( typeof data !== "string" ) {
+		return [];
+	}
+	if ( typeof context === "boolean" ) {
+		keepScripts = context;
+		context = false;
+	}
+
+	var base, parsed, scripts;
+
+	if ( !context ) {
+
+		// Stop scripts or inline event handlers from being executed immediately
+		// by using document.implementation
+		if ( support.createHTMLDocument ) {
+			context = document.implementation.createHTMLDocument( "" );
+
+			// Set the base href for the created document
+			// so any parsed elements with URLs
+			// are based on the document's URL (gh-2965)
+			base = context.createElement( "base" );
+			base.href = document.location.href;
+			context.head.appendChild( base );
+		} else {
+			context = document;
+		}
+	}
+
+	parsed = rsingleTag.exec( data );
+	scripts = !keepScripts && [];
+
+	// Single tag
+	if ( parsed ) {
+		return [ context.createElement( parsed[ 1 ] ) ];
+	}
+
+	parsed = buildFragment( [ data ], context, scripts );
+
+	if ( scripts && scripts.length ) {
+		jQuery( scripts ).remove();
+	}
+
+	return jQuery.merge( [], parsed.childNodes );
+};
+
+
+/**
+ * Load a url into a page
+ */
+jQuery.fn.load = function( url, params, callback ) {
+	var selector, type, response,
+		self = this,
+		off = url.indexOf( " " );
+
+	if ( off > -1 ) {
+		selector = stripAndCollapse( url.slice( off ) );
+		url = url.slice( 0, off );
+	}
+
+	// If it's a function
+	if ( isFunction( params ) ) {
+
+		// We assume that it's the callback
+		callback = params;
+		params = undefined;
+
+	// Otherwise, build a param string
+	} else if ( params && typeof params === "object" ) {
+		type = "POST";
+	}
+
+	// If we have elements to modify, make the request
+	if ( self.length > 0 ) {
+		jQuery.ajax( {
+			url: url,
+
+			// If "type" variable is undefined, then "GET" method will be used.
+			// Make value of this field explicit since
+			// user can override it through ajaxSetup method
+			type: type || "GET",
+			dataType: "html",
+			data: params
+		} ).done( function( responseText ) {
+
+			// Save response for use in complete callback
+			response = arguments;
+
+			self.html( selector ?
+
+				// If a selector was specified, locate the right elements in a dummy div
+				// Exclude scripts to avoid IE 'Permission Denied' errors
+				jQuery( "<div>" ).append( jQuery.parseHTML( responseText ) ).find( selector ) :
+
+				// Otherwise use the full result
+				responseText );
+
+		// If the request succeeds, this function gets "data", "status", "jqXHR"
+		// but they are ignored because response was set above.
+		// If it fails, this function gets "jqXHR", "status", "error"
+		} ).always( callback && function( jqXHR, status ) {
+			self.each( function() {
+				callback.apply( this, response || [ jqXHR.responseText, status, jqXHR ] );
+			} );
+		} );
+	}
+
+	return this;
+};
+
+
+
+
+jQuery.expr.pseudos.animated = function( elem ) {
+	return jQuery.grep( jQuery.timers, function( fn ) {
+		return elem === fn.elem;
+	} ).length;
+};
+
+
+
+
+jQuery.offset = {
+	setOffset: function( elem, options, i ) {
+		var curPosition, curLeft, curCSSTop, curTop, curOffset, curCSSLeft, calculatePosition,
+			position = jQuery.css( elem, "position" ),
+			curElem = jQuery( elem ),
+			props = {};
+
+		// Set position first, in-case top/left are set even on static elem
+		if ( position === "static" ) {
+			elem.style.position = "relative";
+		}
+
+		curOffset = curElem.offset();
+		curCSSTop = jQuery.css( elem, "top" );
+		curCSSLeft = jQuery.css( elem, "left" );
+		calculatePosition = ( position === "absolute" || position === "fixed" ) &&
+			( curCSSTop + curCSSLeft ).indexOf( "auto" ) > -1;
+
+		// Need to be able to calculate position if either
+		// top or left is auto and position is either absolute or fixed
+		if ( calculatePosition ) {
+			curPosition = curElem.position();
+			curTop = curPosition.top;
+			curLeft = curPosition.left;
+
+		} else {
+			curTop = parseFloat( curCSSTop ) || 0;
+			curLeft = parseFloat( curCSSLeft ) || 0;
+		}
+
+		if ( isFunction( options ) ) {
+
+			// Use jQuery.extend here to allow modification of coordinates argument (gh-1848)
+			options = options.call( elem, i, jQuery.extend( {}, curOffset ) );
+		}
+
+		if ( options.top != null ) {
+			props.top = ( options.top - curOffset.top ) + curTop;
+		}
+		if ( options.left != null ) {
+			props.left = ( options.left - curOffset.left ) + curLeft;
+		}
+
+		if ( "using" in options ) {
+			options.using.call( elem, props );
+
+		} else {
+			curElem.css( props );
+		}
+	}
+};
+
+jQuery.fn.extend( {
+
+	// offset() relates an element's border box to the document origin
+	offset: function( options ) {
+
+		// Preserve chaining for setter
+		if ( arguments.length ) {
+			return options === undefined ?
+				this :
+				this.each( function( i ) {
+					jQuery.offset.setOffset( this, options, i );
+				} );
+		}
+
+		var rect, win,
+			elem = this[ 0 ];
+
+		if ( !elem ) {
+			return;
+		}
+
+		// Return zeros for disconnected and hidden (display: none) elements (gh-2310)
+		// Support: IE <=11 only
+		// Running getBoundingClientRect on a
+		// disconnected node in IE throws an error
+		if ( !elem.getClientRects().length ) {
+			return { top: 0, left: 0 };
+		}
+
+		// Get document-relative position by adding viewport scroll to viewport-relative gBCR
+		rect = elem.getBoundingClientRect();
+		win = elem.ownerDocument.defaultView;
+		return {
+			top: rect.top + win.pageYOffset,
+			left: rect.left + win.pageXOffset
+		};
+	},
+
+	// position() relates an element's margin box to its offset parent's padding box
+	// This corresponds to the behavior of CSS absolute positioning
+	position: function() {
+		if ( !this[ 0 ] ) {
+			return;
+		}
+
+		var offsetParent, offset, doc,
+			elem = this[ 0 ],
+			parentOffset = { top: 0, left: 0 };
+
+		// position:fixed elements are offset from the viewport, which itself always has zero offset
+		if ( jQuery.css( elem, "position" ) === "fixed" ) {
+
+			// Assume position:fixed implies availability of getBoundingClientRect
+			offset = elem.getBoundingClientRect();
+
+		} else {
+			offset = this.offset();
+
+			// Account for the *real* offset parent, which can be the document or its root element
+			// when a statically positioned element is identified
+			doc = elem.ownerDocument;
+			offsetParent = elem.offsetParent || doc.documentElement;
+			while ( offsetParent &&
+				( offsetParent === doc.body || offsetParent === doc.documentElement ) &&
+				jQuery.css( offsetParent, "position" ) === "static" ) {
+
+				offsetParent = offsetParent.parentNode;
+			}
+			if ( offsetParent && offsetParent !== elem && offsetParent.nodeType === 1 ) {
+
+				// Incorporate borders into its offset, since they are outside its content origin
+				parentOffset = jQuery( offsetParent ).offset();
+				parentOffset.top += jQuery.css( offsetParent, "borderTopWidth", true );
+				parentOffset.left += jQuery.css( offsetParent, "borderLeftWidth", true );
+			}
+		}
+
+		// Subtract parent offsets and element margins
+		return {
+			top: offset.top - parentOffset.top - jQuery.css( elem, "marginTop", true ),
+			left: offset.left - parentOffset.left - jQuery.css( elem, "marginLeft", true )
+		};
+	},
+
+	// This method will return documentElement in the following cases:
+	// 1) For the element inside the iframe without offsetParent, this method will return
+	//    documentElement of the parent window
+	// 2) For the hidden or detached element
+	// 3) For body or html element, i.e. in case of the html node - it will return itself
+	//
+	// but those exceptions were never presented as a real life use-cases
+	// and might be considered as more preferable results.
+	//
+	// This logic, however, is not guaranteed and can change at any point in the future
+	offsetParent: function() {
+		return this.map( function() {
+			var offsetParent = this.offsetParent;
+
+			while ( offsetParent && jQuery.css( offsetParent, "position" ) === "static" ) {
+				offsetParent = offsetParent.offsetParent;
+			}
+
+			return offsetParent || documentElement;
+		} );
+	}
+} );
+
+// Create scrollLeft and scrollTop methods
+jQuery.each( { scrollLeft: "pageXOffset", scrollTop: "pageYOffset" }, function( method, prop ) {
+	var top = "pageYOffset" === prop;
+
+	jQuery.fn[ method ] = function( val ) {
+		return access( this, function( elem, method, val ) {
+
+			// Coalesce documents and windows
+			var win;
+			if ( isWindow( elem ) ) {
+				win = elem;
+			} else if ( elem.nodeType === 9 ) {
+				win = elem.defaultView;
+			}
+
+			if ( val === undefined ) {
+				return win ? win[ prop ] : elem[ method ];
+			}
+
+			if ( win ) {
+				win.scrollTo(
+					!top ? val : win.pageXOffset,
+					top ? val : win.pageYOffset
+				);
+
+			} else {
+				elem[ method ] = val;
+			}
+		}, method, val, arguments.length );
+	};
+} );
+
+// Support: Safari <=7 - 9.1, Chrome <=37 - 49
+// Add the top/left cssHooks using jQuery.fn.position
+// Webkit bug: https://bugs.webkit.org/show_bug.cgi?id=29084
+// Blink bug: https://bugs.chromium.org/p/chromium/issues/detail?id=589347
+// getComputedStyle returns percent when specified for top/left/bottom/right;
+// rather than make the css module depend on the offset module, just check for it here
+jQuery.each( [ "top", "left" ], function( _i, prop ) {
+	jQuery.cssHooks[ prop ] = addGetHookIf( support.pixelPosition,
+		function( elem, computed ) {
+			if ( computed ) {
+				computed = curCSS( elem, prop );
+
+				// If curCSS returns percentage, fallback to offset
+				return rnumnonpx.test( computed ) ?
+					jQuery( elem ).position()[ prop ] + "px" :
+					computed;
+			}
+		}
+	);
+} );
+
+
+// Create innerHeight, innerWidth, height, width, outerHeight and outerWidth methods
+jQuery.each( { Height: "height", Width: "width" }, function( name, type ) {
+	jQuery.each( {
+		padding: "inner" + name,
+		content: type,
+		"": "outer" + name
+	}, function( defaultExtra, funcName ) {
+
+		// Margin is only for outerHeight, outerWidth
+		jQuery.fn[ funcName ] = function( margin, value ) {
+			var chainable = arguments.length && ( defaultExtra || typeof margin !== "boolean" ),
+				extra = defaultExtra || ( margin === true || value === true ? "margin" : "border" );
+
+			return access( this, function( elem, type, value ) {
+				var doc;
+
+				if ( isWindow( elem ) ) {
+
+					// $( window ).outerWidth/Height return w/h including scrollbars (gh-1729)
+					return funcName.indexOf( "outer" ) === 0 ?
+						elem[ "inner" + name ] :
+						elem.document.documentElement[ "client" + name ];
+				}
+
+				// Get document width or height
+				if ( elem.nodeType === 9 ) {
+					doc = elem.documentElement;
+
+					// Either scroll[Width/Height] or offset[Width/Height] or client[Width/Height],
+					// whichever is greatest
+					return Math.max(
+						elem.body[ "scroll" + name ], doc[ "scroll" + name ],
+						elem.body[ "offset" + name ], doc[ "offset" + name ],
+						doc[ "client" + name ]
+					);
+				}
+
+				return value === undefined ?
+
+					// Get width or height on the element, requesting but not forcing parseFloat
+					jQuery.css( elem, type, extra ) :
+
+					// Set width or height on the element
+					jQuery.style( elem, type, value, extra );
+			}, type, chainable ? margin : undefined, chainable );
+		};
+	} );
+} );
+
+
+jQuery.each( [
+	"ajaxStart",
+	"ajaxStop",
+	"ajaxComplete",
+	"ajaxError",
+	"ajaxSuccess",
+	"ajaxSend"
+], function( _i, type ) {
+	jQuery.fn[ type ] = function( fn ) {
+		return this.on( type, fn );
+	};
+} );
+
+
+
+
+jQuery.fn.extend( {
+
+	bind: function( types, data, fn ) {
+		return this.on( types, null, data, fn );
+	},
+	unbind: function( types, fn ) {
+		return this.off( types, null, fn );
+	},
+
+	delegate: function( selector, types, data, fn ) {
+		return this.on( types, selector, data, fn );
+	},
+	undelegate: function( selector, types, fn ) {
+
+		// ( namespace ) or ( selector, types [, fn] )
+		return arguments.length === 1 ?
+			this.off( selector, "**" ) :
+			this.off( types, selector || "**", fn );
+	},
+
+	hover: function( fnOver, fnOut ) {
+		return this
+			.on( "mouseenter", fnOver )
+			.on( "mouseleave", fnOut || fnOver );
+	}
+} );
+
+jQuery.each(
+	( "blur focus focusin focusout resize scroll click dblclick " +
+	"mousedown mouseup mousemove mouseover mouseout mouseenter mouseleave " +
+	"change select submit keydown keypress keyup contextmenu" ).split( " " ),
+	function( _i, name ) {
+
+		// Handle event binding
+		jQuery.fn[ name ] = function( data, fn ) {
+			return arguments.length > 0 ?
+				this.on( name, null, data, fn ) :
+				this.trigger( name );
+		};
+	}
+);
+
+
+
+
+// Support: Android <=4.0 only
+// Make sure we trim BOM and NBSP
+// Require that the "whitespace run" starts from a non-whitespace
+// to avoid O(N^2) behavior when the engine would try matching "\s+$" at each space position.
+var rtrim = /^[\s\uFEFF\xA0]+|([^\s\uFEFF\xA0])[\s\uFEFF\xA0]+$/g;
+
+// Bind a function to a context, optionally partially applying any
+// arguments.
+// jQuery.proxy is deprecated to promote standards (specifically Function#bind)
+// However, it is not slated for removal any time soon
+jQuery.proxy = function( fn, context ) {
+	var tmp, args, proxy;
+
+	if ( typeof context === "string" ) {
+		tmp = fn[ context ];
+		context = fn;
+		fn = tmp;
+	}
+
+	// Quick check to determine if target is callable, in the spec
+	// this throws a TypeError, but we will just return undefined.
+	if ( !isFunction( fn ) ) {
+		return undefined;
+	}
+
+	// Simulated bind
+	args = slice.call( arguments, 2 );
+	proxy = function() {
+		return fn.apply( context || this, args.concat( slice.call( arguments ) ) );
+	};
+
+	// Set the guid of unique handler to the same of original handler, so it can be removed
+	proxy.guid = fn.guid = fn.guid || jQuery.guid++;
+
+	return proxy;
+};
+
+jQuery.holdReady = function( hold ) {
+	if ( hold ) {
+		jQuery.readyWait++;
+	} else {
+		jQuery.ready( true );
+	}
+};
+jQuery.isArray = Array.isArray;
+jQuery.parseJSON = JSON.parse;
+jQuery.nodeName = nodeName;
+jQuery.isFunction = isFunction;
+jQuery.isWindow = isWindow;
+jQuery.camelCase = camelCase;
+jQuery.type = toType;
+
+jQuery.now = Date.now;
+
+jQuery.isNumeric = function( obj ) {
+
+	// As of jQuery 3.0, isNumeric is limited to
+	// strings and numbers (primitives or objects)
+	// that can be coerced to finite numbers (gh-2662)
+	var type = jQuery.type( obj );
+	return ( type === "number" || type === "string" ) &&
+
+		// parseFloat NaNs numeric-cast false positives ("")
+		// ...but misinterprets leading-number strings, particularly hex literals ("0x...")
+		// subtraction forces infinities to NaN
+		!isNaN( obj - parseFloat( obj ) );
+};
+
+jQuery.trim = function( text ) {
+	return text == null ?
+		"" :
+		( text + "" ).replace( rtrim, "$1" );
+};
+
+
+
+// Register as a named AMD module, since jQuery can be concatenated with other
+// files that may use define, but not via a proper concatenation script that
+// understands anonymous AMD modules. A named AMD is safest and most robust
+// way to register. Lowercase jquery is used because AMD module names are
+// derived from file names, and jQuery is normally delivered in a lowercase
+// file name. Do this after creating the global so that if an AMD module wants
+// to call noConflict to hide this version of jQuery, it will work.
+
+// Note that for maximum portability, libraries that are not jQuery should
+// declare themselves as anonymous modules, and avoid setting a global if an
+// AMD loader is present. jQuery is a special case. For more information, see
+// https://github.com/jrburke/requirejs/wiki/Updating-existing-libraries#wiki-anon
+
+if ( typeof define === "function" && define.amd ) {
+	define( "jquery", [], function() {
+		return jQuery;
+	} );
+}
+
+
+
+
+var
+
+	// Map over jQuery in case of overwrite
+	_jQuery = window.jQuery,
+
+	// Map over the $ in case of overwrite
+	_$ = window.$;
+
+jQuery.noConflict = function( deep ) {
+	if ( window.$ === jQuery ) {
+		window.$ = _$;
+	}
+
+	if ( deep && window.jQuery === jQuery ) {
+		window.jQuery = _jQuery;
+	}
+
+	return jQuery;
+};
+
+// Expose jQuery and $ identifiers, even in AMD
+// (trac-7102#comment:10, https://github.com/jquery/jquery/pull/557)
+// and CommonJS for browser emulators (trac-13566)
+if ( typeof noGlobal === "undefined" ) {
+	window.jQuery = window.$ = jQuery;
+}
+
+
+
+
+return jQuery;
+} );
diff --git a/src/BCards.Web/wwwroot/lib/jquery/jquery.min.js b/src/BCards.Web/wwwroot/lib/jquery/jquery.min.js
new file mode 100644
index 0000000..7f37b5d
--- /dev/null
+++ b/src/BCards.Web/wwwroot/lib/jquery/jquery.min.js
@@ -0,0 +1,2 @@
+/*! jQuery v3.7.1 | (c) OpenJS Foundation and other contributors | jquery.org/license */
+!function(e,t){"use strict";"object"==typeof module&&"object"==typeof module.exports?module.exports=e.document?t(e,!0):function(e){if(!e.document)throw new Error("jQuery requires a window with a document");return t(e)}:t(e)}("undefined"!=typeof window?window:this,function(ie,e){"use strict";var oe=[],r=Object.getPrototypeOf,ae=oe.slice,g=oe.flat?function(e){return oe.flat.call(e)}:function(e){return oe.concat.apply([],e)},s=oe.push,se=oe.indexOf,n={},i=n.toString,ue=n.hasOwnProperty,o=ue.toString,a=o.call(Object),le={},v=function(e){return"function"==typeof e&&"number"!=typeof e.nodeType&&"function"!=typeof e.item},y=function(e){return null!=e&&e===e.window},C=ie.document,u={type:!0,src:!0,nonce:!0,noModule:!0};function m(e,t,n){var r,i,o=(n=n||C).createElement("script");if(o.text=e,t)for(r in u)(i=t[r]||t.getAttribute&&t.getAttribute(r))&&o.setAttribute(r,i);n.head.appendChild(o).parentNode.removeChild(o)}function x(e){return null==e?e+"":"object"==typeof e||"function"==typeof e?n[i.call(e)]||"object":typeof e}var t="3.7.1",l=/HTML$/i,ce=function(e,t){return new ce.fn.init(e,t)};function c(e){var t=!!e&&"length"in e&&e.length,n=x(e);return!v(e)&&!y(e)&&("array"===n||0===t||"number"==typeof t&&0<t&&t-1 in e)}function fe(e,t){return e.nodeName&&e.nodeName.toLowerCase()===t.toLowerCase()}ce.fn=ce.prototype={jquery:t,constructor:ce,length:0,toArray:function(){return ae.call(this)},get:function(e){return null==e?ae.call(this):e<0?this[e+this.length]:this[e]},pushStack:function(e){var t=ce.merge(this.constructor(),e);return t.prevObject=this,t},each:function(e){return ce.each(this,e)},map:function(n){return this.pushStack(ce.map(this,function(e,t){return n.call(e,t,e)}))},slice:function(){return this.pushStack(ae.apply(this,arguments))},first:function(){return this.eq(0)},last:function(){return this.eq(-1)},even:function(){return this.pushStack(ce.grep(this,function(e,t){return(t+1)%2}))},odd:function(){return this.pushStack(ce.grep(this,function(e,t){return t%2}))},eq:function(e){var t=this.length,n=+e+(e<0?t:0);return this.pushStack(0<=n&&n<t?[this[n]]:[])},end:function(){return this.prevObject||this.constructor()},push:s,sort:oe.sort,splice:oe.splice},ce.extend=ce.fn.extend=function(){var e,t,n,r,i,o,a=arguments[0]||{},s=1,u=arguments.length,l=!1;for("boolean"==typeof a&&(l=a,a=arguments[s]||{},s++),"object"==typeof a||v(a)||(a={}),s===u&&(a=this,s--);s<u;s++)if(null!=(e=arguments[s]))for(t in e)r=e[t],"__proto__"!==t&&a!==r&&(l&&r&&(ce.isPlainObject(r)||(i=Array.isArray(r)))?(n=a[t],o=i&&!Array.isArray(n)?[]:i||ce.isPlainObject(n)?n:{},i=!1,a[t]=ce.extend(l,o,r)):void 0!==r&&(a[t]=r));return a},ce.extend({expando:"jQuery"+(t+Math.random()).replace(/\D/g,""),isReady:!0,error:function(e){throw new Error(e)},noop:function(){},isPlainObject:function(e){var t,n;return!(!e||"[object Object]"!==i.call(e))&&(!(t=r(e))||"function"==typeof(n=ue.call(t,"constructor")&&t.constructor)&&o.call(n)===a)},isEmptyObject:function(e){var t;for(t in e)return!1;return!0},globalEval:function(e,t,n){m(e,{nonce:t&&t.nonce},n)},each:function(e,t){var n,r=0;if(c(e)){for(n=e.length;r<n;r++)if(!1===t.call(e[r],r,e[r]))break}else for(r in e)if(!1===t.call(e[r],r,e[r]))break;return e},text:function(e){var t,n="",r=0,i=e.nodeType;if(!i)while(t=e[r++])n+=ce.text(t);return 1===i||11===i?e.textContent:9===i?e.documentElement.textContent:3===i||4===i?e.nodeValue:n},makeArray:function(e,t){var n=t||[];return null!=e&&(c(Object(e))?ce.merge(n,"string"==typeof e?[e]:e):s.call(n,e)),n},inArray:function(e,t,n){return null==t?-1:se.call(t,e,n)},isXMLDoc:function(e){var t=e&&e.namespaceURI,n=e&&(e.ownerDocument||e).documentElement;return!l.test(t||n&&n.nodeName||"HTML")},merge:function(e,t){for(var n=+t.length,r=0,i=e.length;r<n;r++)e[i++]=t[r];return e.length=i,e},grep:function(e,t,n){for(var r=[],i=0,o=e.length,a=!n;i<o;i++)!t(e[i],i)!==a&&r.push(e[i]);return r},map:function(e,t,n){var r,i,o=0,a=[];if(c(e))for(r=e.length;o<r;o++)null!=(i=t(e[o],o,n))&&a.push(i);else for(o in e)null!=(i=t(e[o],o,n))&&a.push(i);return g(a)},guid:1,support:le}),"function"==typeof Symbol&&(ce.fn[Symbol.iterator]=oe[Symbol.iterator]),ce.each("Boolean Number String Function Array Date RegExp Object Error Symbol".split(" "),function(e,t){n["[object "+t+"]"]=t.toLowerCase()});var pe=oe.pop,de=oe.sort,he=oe.splice,ge="[\\x20\\t\\r\\n\\f]",ve=new RegExp("^"+ge+"+|((?:^|[^\\\\])(?:\\\\.)*)"+ge+"+$","g");ce.contains=function(e,t){var n=t&&t.parentNode;return e===n||!(!n||1!==n.nodeType||!(e.contains?e.contains(n):e.compareDocumentPosition&&16&e.compareDocumentPosition(n)))};var f=/([\0-\x1f\x7f]|^-?\d)|^-$|[^\x80-\uFFFF\w-]/g;function p(e,t){return t?"\0"===e?"\ufffd":e.slice(0,-1)+"\\"+e.charCodeAt(e.length-1).toString(16)+" ":"\\"+e}ce.escapeSelector=function(e){return(e+"").replace(f,p)};var ye=C,me=s;!function(){var e,b,w,o,a,T,r,C,d,i,k=me,S=ce.expando,E=0,n=0,s=W(),c=W(),u=W(),h=W(),l=function(e,t){return e===t&&(a=!0),0},f="checked|selected|async|autofocus|autoplay|controls|defer|disabled|hidden|ismap|loop|multiple|open|readonly|required|scoped",t="(?:\\\\[\\da-fA-F]{1,6}"+ge+"?|\\\\[^\\r\\n\\f]|[\\w-]|[^\0-\\x7f])+",p="\\["+ge+"*("+t+")(?:"+ge+"*([*^$|!~]?=)"+ge+"*(?:'((?:\\\\.|[^\\\\'])*)'|\"((?:\\\\.|[^\\\\\"])*)\"|("+t+"))|)"+ge+"*\\]",g=":("+t+")(?:\\((('((?:\\\\.|[^\\\\'])*)'|\"((?:\\\\.|[^\\\\\"])*)\")|((?:\\\\.|[^\\\\()[\\]]|"+p+")*)|.*)\\)|)",v=new RegExp(ge+"+","g"),y=new RegExp("^"+ge+"*,"+ge+"*"),m=new RegExp("^"+ge+"*([>+~]|"+ge+")"+ge+"*"),x=new RegExp(ge+"|>"),j=new RegExp(g),A=new RegExp("^"+t+"$"),D={ID:new RegExp("^#("+t+")"),CLASS:new RegExp("^\\.("+t+")"),TAG:new RegExp("^("+t+"|[*])"),ATTR:new RegExp("^"+p),PSEUDO:new RegExp("^"+g),CHILD:new RegExp("^:(only|first|last|nth|nth-last)-(child|of-type)(?:\\("+ge+"*(even|odd|(([+-]|)(\\d*)n|)"+ge+"*(?:([+-]|)"+ge+"*(\\d+)|))"+ge+"*\\)|)","i"),bool:new RegExp("^(?:"+f+")$","i"),needsContext:new RegExp("^"+ge+"*[>+~]|:(even|odd|eq|gt|lt|nth|first|last)(?:\\("+ge+"*((?:-\\d)?\\d*)"+ge+"*\\)|)(?=[^-]|$)","i")},N=/^(?:input|select|textarea|button)$/i,q=/^h\d$/i,L=/^(?:#([\w-]+)|(\w+)|\.([\w-]+))$/,H=/[+~]/,O=new RegExp("\\\\[\\da-fA-F]{1,6}"+ge+"?|\\\\([^\\r\\n\\f])","g"),P=function(e,t){var n="0x"+e.slice(1)-65536;return t||(n<0?String.fromCharCode(n+65536):String.fromCharCode(n>>10|55296,1023&n|56320))},M=function(){V()},R=J(function(e){return!0===e.disabled&&fe(e,"fieldset")},{dir:"parentNode",next:"legend"});try{k.apply(oe=ae.call(ye.childNodes),ye.childNodes),oe[ye.childNodes.length].nodeType}catch(e){k={apply:function(e,t){me.apply(e,ae.call(t))},call:function(e){me.apply(e,ae.call(arguments,1))}}}function I(t,e,n,r){var i,o,a,s,u,l,c,f=e&&e.ownerDocument,p=e?e.nodeType:9;if(n=n||[],"string"!=typeof t||!t||1!==p&&9!==p&&11!==p)return n;if(!r&&(V(e),e=e||T,C)){if(11!==p&&(u=L.exec(t)))if(i=u[1]){if(9===p){if(!(a=e.getElementById(i)))return n;if(a.id===i)return k.call(n,a),n}else if(f&&(a=f.getElementById(i))&&I.contains(e,a)&&a.id===i)return k.call(n,a),n}else{if(u[2])return k.apply(n,e.getElementsByTagName(t)),n;if((i=u[3])&&e.getElementsByClassName)return k.apply(n,e.getElementsByClassName(i)),n}if(!(h[t+" "]||d&&d.test(t))){if(c=t,f=e,1===p&&(x.test(t)||m.test(t))){(f=H.test(t)&&U(e.parentNode)||e)==e&&le.scope||((s=e.getAttribute("id"))?s=ce.escapeSelector(s):e.setAttribute("id",s=S)),o=(l=Y(t)).length;while(o--)l[o]=(s?"#"+s:":scope")+" "+Q(l[o]);c=l.join(",")}try{return k.apply(n,f.querySelectorAll(c)),n}catch(e){h(t,!0)}finally{s===S&&e.removeAttribute("id")}}}return re(t.replace(ve,"$1"),e,n,r)}function W(){var r=[];return function e(t,n){return r.push(t+" ")>b.cacheLength&&delete e[r.shift()],e[t+" "]=n}}function F(e){return e[S]=!0,e}function $(e){var t=T.createElement("fieldset");try{return!!e(t)}catch(e){return!1}finally{t.parentNode&&t.parentNode.removeChild(t),t=null}}function B(t){return function(e){return fe(e,"input")&&e.type===t}}function _(t){return function(e){return(fe(e,"input")||fe(e,"button"))&&e.type===t}}function z(t){return function(e){return"form"in e?e.parentNode&&!1===e.disabled?"label"in e?"label"in e.parentNode?e.parentNode.disabled===t:e.disabled===t:e.isDisabled===t||e.isDisabled!==!t&&R(e)===t:e.disabled===t:"label"in e&&e.disabled===t}}function X(a){return F(function(o){return o=+o,F(function(e,t){var n,r=a([],e.length,o),i=r.length;while(i--)e[n=r[i]]&&(e[n]=!(t[n]=e[n]))})})}function U(e){return e&&"undefined"!=typeof e.getElementsByTagName&&e}function V(e){var t,n=e?e.ownerDocument||e:ye;return n!=T&&9===n.nodeType&&n.documentElement&&(r=(T=n).documentElement,C=!ce.isXMLDoc(T),i=r.matches||r.webkitMatchesSelector||r.msMatchesSelector,r.msMatchesSelector&&ye!=T&&(t=T.defaultView)&&t.top!==t&&t.addEventListener("unload",M),le.getById=$(function(e){return r.appendChild(e).id=ce.expando,!T.getElementsByName||!T.getElementsByName(ce.expando).length}),le.disconnectedMatch=$(function(e){return i.call(e,"*")}),le.scope=$(function(){return T.querySelectorAll(":scope")}),le.cssHas=$(function(){try{return T.querySelector(":has(*,:jqfake)"),!1}catch(e){return!0}}),le.getById?(b.filter.ID=function(e){var t=e.replace(O,P);return function(e){return e.getAttribute("id")===t}},b.find.ID=function(e,t){if("undefined"!=typeof t.getElementById&&C){var n=t.getElementById(e);return n?[n]:[]}}):(b.filter.ID=function(e){var n=e.replace(O,P);return function(e){var t="undefined"!=typeof e.getAttributeNode&&e.getAttributeNode("id");return t&&t.value===n}},b.find.ID=function(e,t){if("undefined"!=typeof t.getElementById&&C){var n,r,i,o=t.getElementById(e);if(o){if((n=o.getAttributeNode("id"))&&n.value===e)return[o];i=t.getElementsByName(e),r=0;while(o=i[r++])if((n=o.getAttributeNode("id"))&&n.value===e)return[o]}return[]}}),b.find.TAG=function(e,t){return"undefined"!=typeof t.getElementsByTagName?t.getElementsByTagName(e):t.querySelectorAll(e)},b.find.CLASS=function(e,t){if("undefined"!=typeof t.getElementsByClassName&&C)return t.getElementsByClassName(e)},d=[],$(function(e){var t;r.appendChild(e).innerHTML="<a id='"+S+"' href='' disabled='disabled'></a><select id='"+S+"-\r\\' disabled='disabled'><option selected=''></option></select>",e.querySelectorAll("[selected]").length||d.push("\\["+ge+"*(?:value|"+f+")"),e.querySelectorAll("[id~="+S+"-]").length||d.push("~="),e.querySelectorAll("a#"+S+"+*").length||d.push(".#.+[+~]"),e.querySelectorAll(":checked").length||d.push(":checked"),(t=T.createElement("input")).setAttribute("type","hidden"),e.appendChild(t).setAttribute("name","D"),r.appendChild(e).disabled=!0,2!==e.querySelectorAll(":disabled").length&&d.push(":enabled",":disabled"),(t=T.createElement("input")).setAttribute("name",""),e.appendChild(t),e.querySelectorAll("[name='']").length||d.push("\\["+ge+"*name"+ge+"*="+ge+"*(?:''|\"\")")}),le.cssHas||d.push(":has"),d=d.length&&new RegExp(d.join("|")),l=function(e,t){if(e===t)return a=!0,0;var n=!e.compareDocumentPosition-!t.compareDocumentPosition;return n||(1&(n=(e.ownerDocument||e)==(t.ownerDocument||t)?e.compareDocumentPosition(t):1)||!le.sortDetached&&t.compareDocumentPosition(e)===n?e===T||e.ownerDocument==ye&&I.contains(ye,e)?-1:t===T||t.ownerDocument==ye&&I.contains(ye,t)?1:o?se.call(o,e)-se.call(o,t):0:4&n?-1:1)}),T}for(e in I.matches=function(e,t){return I(e,null,null,t)},I.matchesSelector=function(e,t){if(V(e),C&&!h[t+" "]&&(!d||!d.test(t)))try{var n=i.call(e,t);if(n||le.disconnectedMatch||e.document&&11!==e.document.nodeType)return n}catch(e){h(t,!0)}return 0<I(t,T,null,[e]).length},I.contains=function(e,t){return(e.ownerDocument||e)!=T&&V(e),ce.contains(e,t)},I.attr=function(e,t){(e.ownerDocument||e)!=T&&V(e);var n=b.attrHandle[t.toLowerCase()],r=n&&ue.call(b.attrHandle,t.toLowerCase())?n(e,t,!C):void 0;return void 0!==r?r:e.getAttribute(t)},I.error=function(e){throw new Error("Syntax error, unrecognized expression: "+e)},ce.uniqueSort=function(e){var t,n=[],r=0,i=0;if(a=!le.sortStable,o=!le.sortStable&&ae.call(e,0),de.call(e,l),a){while(t=e[i++])t===e[i]&&(r=n.push(i));while(r--)he.call(e,n[r],1)}return o=null,e},ce.fn.uniqueSort=function(){return this.pushStack(ce.uniqueSort(ae.apply(this)))},(b=ce.expr={cacheLength:50,createPseudo:F,match:D,attrHandle:{},find:{},relative:{">":{dir:"parentNode",first:!0}," ":{dir:"parentNode"},"+":{dir:"previousSibling",first:!0},"~":{dir:"previousSibling"}},preFilter:{ATTR:function(e){return e[1]=e[1].replace(O,P),e[3]=(e[3]||e[4]||e[5]||"").replace(O,P),"~="===e[2]&&(e[3]=" "+e[3]+" "),e.slice(0,4)},CHILD:function(e){return e[1]=e[1].toLowerCase(),"nth"===e[1].slice(0,3)?(e[3]||I.error(e[0]),e[4]=+(e[4]?e[5]+(e[6]||1):2*("even"===e[3]||"odd"===e[3])),e[5]=+(e[7]+e[8]||"odd"===e[3])):e[3]&&I.error(e[0]),e},PSEUDO:function(e){var t,n=!e[6]&&e[2];return D.CHILD.test(e[0])?null:(e[3]?e[2]=e[4]||e[5]||"":n&&j.test(n)&&(t=Y(n,!0))&&(t=n.indexOf(")",n.length-t)-n.length)&&(e[0]=e[0].slice(0,t),e[2]=n.slice(0,t)),e.slice(0,3))}},filter:{TAG:function(e){var t=e.replace(O,P).toLowerCase();return"*"===e?function(){return!0}:function(e){return fe(e,t)}},CLASS:function(e){var t=s[e+" "];return t||(t=new RegExp("(^|"+ge+")"+e+"("+ge+"|$)"))&&s(e,function(e){return t.test("string"==typeof e.className&&e.className||"undefined"!=typeof e.getAttribute&&e.getAttribute("class")||"")})},ATTR:function(n,r,i){return function(e){var t=I.attr(e,n);return null==t?"!="===r:!r||(t+="","="===r?t===i:"!="===r?t!==i:"^="===r?i&&0===t.indexOf(i):"*="===r?i&&-1<t.indexOf(i):"$="===r?i&&t.slice(-i.length)===i:"~="===r?-1<(" "+t.replace(v," ")+" ").indexOf(i):"|="===r&&(t===i||t.slice(0,i.length+1)===i+"-"))}},CHILD:function(d,e,t,h,g){var v="nth"!==d.slice(0,3),y="last"!==d.slice(-4),m="of-type"===e;return 1===h&&0===g?function(e){return!!e.parentNode}:function(e,t,n){var r,i,o,a,s,u=v!==y?"nextSibling":"previousSibling",l=e.parentNode,c=m&&e.nodeName.toLowerCase(),f=!n&&!m,p=!1;if(l){if(v){while(u){o=e;while(o=o[u])if(m?fe(o,c):1===o.nodeType)return!1;s=u="only"===d&&!s&&"nextSibling"}return!0}if(s=[y?l.firstChild:l.lastChild],y&&f){p=(a=(r=(i=l[S]||(l[S]={}))[d]||[])[0]===E&&r[1])&&r[2],o=a&&l.childNodes[a];while(o=++a&&o&&o[u]||(p=a=0)||s.pop())if(1===o.nodeType&&++p&&o===e){i[d]=[E,a,p];break}}else if(f&&(p=a=(r=(i=e[S]||(e[S]={}))[d]||[])[0]===E&&r[1]),!1===p)while(o=++a&&o&&o[u]||(p=a=0)||s.pop())if((m?fe(o,c):1===o.nodeType)&&++p&&(f&&((i=o[S]||(o[S]={}))[d]=[E,p]),o===e))break;return(p-=g)===h||p%h==0&&0<=p/h}}},PSEUDO:function(e,o){var t,a=b.pseudos[e]||b.setFilters[e.toLowerCase()]||I.error("unsupported pseudo: "+e);return a[S]?a(o):1<a.length?(t=[e,e,"",o],b.setFilters.hasOwnProperty(e.toLowerCase())?F(function(e,t){var n,r=a(e,o),i=r.length;while(i--)e[n=se.call(e,r[i])]=!(t[n]=r[i])}):function(e){return a(e,0,t)}):a}},pseudos:{not:F(function(e){var r=[],i=[],s=ne(e.replace(ve,"$1"));return s[S]?F(function(e,t,n,r){var i,o=s(e,null,r,[]),a=e.length;while(a--)(i=o[a])&&(e[a]=!(t[a]=i))}):function(e,t,n){return r[0]=e,s(r,null,n,i),r[0]=null,!i.pop()}}),has:F(function(t){return function(e){return 0<I(t,e).length}}),contains:F(function(t){return t=t.replace(O,P),function(e){return-1<(e.textContent||ce.text(e)).indexOf(t)}}),lang:F(function(n){return A.test(n||"")||I.error("unsupported lang: "+n),n=n.replace(O,P).toLowerCase(),function(e){var t;do{if(t=C?e.lang:e.getAttribute("xml:lang")||e.getAttribute("lang"))return(t=t.toLowerCase())===n||0===t.indexOf(n+"-")}while((e=e.parentNode)&&1===e.nodeType);return!1}}),target:function(e){var t=ie.location&&ie.location.hash;return t&&t.slice(1)===e.id},root:function(e){return e===r},focus:function(e){return e===function(){try{return T.activeElement}catch(e){}}()&&T.hasFocus()&&!!(e.type||e.href||~e.tabIndex)},enabled:z(!1),disabled:z(!0),checked:function(e){return fe(e,"input")&&!!e.checked||fe(e,"option")&&!!e.selected},selected:function(e){return e.parentNode&&e.parentNode.selectedIndex,!0===e.selected},empty:function(e){for(e=e.firstChild;e;e=e.nextSibling)if(e.nodeType<6)return!1;return!0},parent:function(e){return!b.pseudos.empty(e)},header:function(e){return q.test(e.nodeName)},input:function(e){return N.test(e.nodeName)},button:function(e){return fe(e,"input")&&"button"===e.type||fe(e,"button")},text:function(e){var t;return fe(e,"input")&&"text"===e.type&&(null==(t=e.getAttribute("type"))||"text"===t.toLowerCase())},first:X(function(){return[0]}),last:X(function(e,t){return[t-1]}),eq:X(function(e,t,n){return[n<0?n+t:n]}),even:X(function(e,t){for(var n=0;n<t;n+=2)e.push(n);return e}),odd:X(function(e,t){for(var n=1;n<t;n+=2)e.push(n);return e}),lt:X(function(e,t,n){var r;for(r=n<0?n+t:t<n?t:n;0<=--r;)e.push(r);return e}),gt:X(function(e,t,n){for(var r=n<0?n+t:n;++r<t;)e.push(r);return e})}}).pseudos.nth=b.pseudos.eq,{radio:!0,checkbox:!0,file:!0,password:!0,image:!0})b.pseudos[e]=B(e);for(e in{submit:!0,reset:!0})b.pseudos[e]=_(e);function G(){}function Y(e,t){var n,r,i,o,a,s,u,l=c[e+" "];if(l)return t?0:l.slice(0);a=e,s=[],u=b.preFilter;while(a){for(o in n&&!(r=y.exec(a))||(r&&(a=a.slice(r[0].length)||a),s.push(i=[])),n=!1,(r=m.exec(a))&&(n=r.shift(),i.push({value:n,type:r[0].replace(ve," ")}),a=a.slice(n.length)),b.filter)!(r=D[o].exec(a))||u[o]&&!(r=u[o](r))||(n=r.shift(),i.push({value:n,type:o,matches:r}),a=a.slice(n.length));if(!n)break}return t?a.length:a?I.error(e):c(e,s).slice(0)}function Q(e){for(var t=0,n=e.length,r="";t<n;t++)r+=e[t].value;return r}function J(a,e,t){var s=e.dir,u=e.next,l=u||s,c=t&&"parentNode"===l,f=n++;return e.first?function(e,t,n){while(e=e[s])if(1===e.nodeType||c)return a(e,t,n);return!1}:function(e,t,n){var r,i,o=[E,f];if(n){while(e=e[s])if((1===e.nodeType||c)&&a(e,t,n))return!0}else while(e=e[s])if(1===e.nodeType||c)if(i=e[S]||(e[S]={}),u&&fe(e,u))e=e[s]||e;else{if((r=i[l])&&r[0]===E&&r[1]===f)return o[2]=r[2];if((i[l]=o)[2]=a(e,t,n))return!0}return!1}}function K(i){return 1<i.length?function(e,t,n){var r=i.length;while(r--)if(!i[r](e,t,n))return!1;return!0}:i[0]}function Z(e,t,n,r,i){for(var o,a=[],s=0,u=e.length,l=null!=t;s<u;s++)(o=e[s])&&(n&&!n(o,r,i)||(a.push(o),l&&t.push(s)));return a}function ee(d,h,g,v,y,e){return v&&!v[S]&&(v=ee(v)),y&&!y[S]&&(y=ee(y,e)),F(function(e,t,n,r){var i,o,a,s,u=[],l=[],c=t.length,f=e||function(e,t,n){for(var r=0,i=t.length;r<i;r++)I(e,t[r],n);return n}(h||"*",n.nodeType?[n]:n,[]),p=!d||!e&&h?f:Z(f,u,d,n,r);if(g?g(p,s=y||(e?d:c||v)?[]:t,n,r):s=p,v){i=Z(s,l),v(i,[],n,r),o=i.length;while(o--)(a=i[o])&&(s[l[o]]=!(p[l[o]]=a))}if(e){if(y||d){if(y){i=[],o=s.length;while(o--)(a=s[o])&&i.push(p[o]=a);y(null,s=[],i,r)}o=s.length;while(o--)(a=s[o])&&-1<(i=y?se.call(e,a):u[o])&&(e[i]=!(t[i]=a))}}else s=Z(s===t?s.splice(c,s.length):s),y?y(null,t,s,r):k.apply(t,s)})}function te(e){for(var i,t,n,r=e.length,o=b.relative[e[0].type],a=o||b.relative[" "],s=o?1:0,u=J(function(e){return e===i},a,!0),l=J(function(e){return-1<se.call(i,e)},a,!0),c=[function(e,t,n){var r=!o&&(n||t!=w)||((i=t).nodeType?u(e,t,n):l(e,t,n));return i=null,r}];s<r;s++)if(t=b.relative[e[s].type])c=[J(K(c),t)];else{if((t=b.filter[e[s].type].apply(null,e[s].matches))[S]){for(n=++s;n<r;n++)if(b.relative[e[n].type])break;return ee(1<s&&K(c),1<s&&Q(e.slice(0,s-1).concat({value:" "===e[s-2].type?"*":""})).replace(ve,"$1"),t,s<n&&te(e.slice(s,n)),n<r&&te(e=e.slice(n)),n<r&&Q(e))}c.push(t)}return K(c)}function ne(e,t){var n,v,y,m,x,r,i=[],o=[],a=u[e+" "];if(!a){t||(t=Y(e)),n=t.length;while(n--)(a=te(t[n]))[S]?i.push(a):o.push(a);(a=u(e,(v=o,m=0<(y=i).length,x=0<v.length,r=function(e,t,n,r,i){var o,a,s,u=0,l="0",c=e&&[],f=[],p=w,d=e||x&&b.find.TAG("*",i),h=E+=null==p?1:Math.random()||.1,g=d.length;for(i&&(w=t==T||t||i);l!==g&&null!=(o=d[l]);l++){if(x&&o){a=0,t||o.ownerDocument==T||(V(o),n=!C);while(s=v[a++])if(s(o,t||T,n)){k.call(r,o);break}i&&(E=h)}m&&((o=!s&&o)&&u--,e&&c.push(o))}if(u+=l,m&&l!==u){a=0;while(s=y[a++])s(c,f,t,n);if(e){if(0<u)while(l--)c[l]||f[l]||(f[l]=pe.call(r));f=Z(f)}k.apply(r,f),i&&!e&&0<f.length&&1<u+y.length&&ce.uniqueSort(r)}return i&&(E=h,w=p),c},m?F(r):r))).selector=e}return a}function re(e,t,n,r){var i,o,a,s,u,l="function"==typeof e&&e,c=!r&&Y(e=l.selector||e);if(n=n||[],1===c.length){if(2<(o=c[0]=c[0].slice(0)).length&&"ID"===(a=o[0]).type&&9===t.nodeType&&C&&b.relative[o[1].type]){if(!(t=(b.find.ID(a.matches[0].replace(O,P),t)||[])[0]))return n;l&&(t=t.parentNode),e=e.slice(o.shift().value.length)}i=D.needsContext.test(e)?0:o.length;while(i--){if(a=o[i],b.relative[s=a.type])break;if((u=b.find[s])&&(r=u(a.matches[0].replace(O,P),H.test(o[0].type)&&U(t.parentNode)||t))){if(o.splice(i,1),!(e=r.length&&Q(o)))return k.apply(n,r),n;break}}}return(l||ne(e,c))(r,t,!C,n,!t||H.test(e)&&U(t.parentNode)||t),n}G.prototype=b.filters=b.pseudos,b.setFilters=new G,le.sortStable=S.split("").sort(l).join("")===S,V(),le.sortDetached=$(function(e){return 1&e.compareDocumentPosition(T.createElement("fieldset"))}),ce.find=I,ce.expr[":"]=ce.expr.pseudos,ce.unique=ce.uniqueSort,I.compile=ne,I.select=re,I.setDocument=V,I.tokenize=Y,I.escape=ce.escapeSelector,I.getText=ce.text,I.isXML=ce.isXMLDoc,I.selectors=ce.expr,I.support=ce.support,I.uniqueSort=ce.uniqueSort}();var d=function(e,t,n){var r=[],i=void 0!==n;while((e=e[t])&&9!==e.nodeType)if(1===e.nodeType){if(i&&ce(e).is(n))break;r.push(e)}return r},h=function(e,t){for(var n=[];e;e=e.nextSibling)1===e.nodeType&&e!==t&&n.push(e);return n},b=ce.expr.match.needsContext,w=/^<([a-z][^\/\0>:\x20\t\r\n\f]*)[\x20\t\r\n\f]*\/?>(?:<\/\1>|)$/i;function T(e,n,r){return v(n)?ce.grep(e,function(e,t){return!!n.call(e,t,e)!==r}):n.nodeType?ce.grep(e,function(e){return e===n!==r}):"string"!=typeof n?ce.grep(e,function(e){return-1<se.call(n,e)!==r}):ce.filter(n,e,r)}ce.filter=function(e,t,n){var r=t[0];return n&&(e=":not("+e+")"),1===t.length&&1===r.nodeType?ce.find.matchesSelector(r,e)?[r]:[]:ce.find.matches(e,ce.grep(t,function(e){return 1===e.nodeType}))},ce.fn.extend({find:function(e){var t,n,r=this.length,i=this;if("string"!=typeof e)return this.pushStack(ce(e).filter(function(){for(t=0;t<r;t++)if(ce.contains(i[t],this))return!0}));for(n=this.pushStack([]),t=0;t<r;t++)ce.find(e,i[t],n);return 1<r?ce.uniqueSort(n):n},filter:function(e){return this.pushStack(T(this,e||[],!1))},not:function(e){return this.pushStack(T(this,e||[],!0))},is:function(e){return!!T(this,"string"==typeof e&&b.test(e)?ce(e):e||[],!1).length}});var k,S=/^(?:\s*(<[\w\W]+>)[^>]*|#([\w-]+))$/;(ce.fn.init=function(e,t,n){var r,i;if(!e)return this;if(n=n||k,"string"==typeof e){if(!(r="<"===e[0]&&">"===e[e.length-1]&&3<=e.length?[null,e,null]:S.exec(e))||!r[1]&&t)return!t||t.jquery?(t||n).find(e):this.constructor(t).find(e);if(r[1]){if(t=t instanceof ce?t[0]:t,ce.merge(this,ce.parseHTML(r[1],t&&t.nodeType?t.ownerDocument||t:C,!0)),w.test(r[1])&&ce.isPlainObject(t))for(r in t)v(this[r])?this[r](t[r]):this.attr(r,t[r]);return this}return(i=C.getElementById(r[2]))&&(this[0]=i,this.length=1),this}return e.nodeType?(this[0]=e,this.length=1,this):v(e)?void 0!==n.ready?n.ready(e):e(ce):ce.makeArray(e,this)}).prototype=ce.fn,k=ce(C);var E=/^(?:parents|prev(?:Until|All))/,j={children:!0,contents:!0,next:!0,prev:!0};function A(e,t){while((e=e[t])&&1!==e.nodeType);return e}ce.fn.extend({has:function(e){var t=ce(e,this),n=t.length;return this.filter(function(){for(var e=0;e<n;e++)if(ce.contains(this,t[e]))return!0})},closest:function(e,t){var n,r=0,i=this.length,o=[],a="string"!=typeof e&&ce(e);if(!b.test(e))for(;r<i;r++)for(n=this[r];n&&n!==t;n=n.parentNode)if(n.nodeType<11&&(a?-1<a.index(n):1===n.nodeType&&ce.find.matchesSelector(n,e))){o.push(n);break}return this.pushStack(1<o.length?ce.uniqueSort(o):o)},index:function(e){return e?"string"==typeof e?se.call(ce(e),this[0]):se.call(this,e.jquery?e[0]:e):this[0]&&this[0].parentNode?this.first().prevAll().length:-1},add:function(e,t){return this.pushStack(ce.uniqueSort(ce.merge(this.get(),ce(e,t))))},addBack:function(e){return this.add(null==e?this.prevObject:this.prevObject.filter(e))}}),ce.each({parent:function(e){var t=e.parentNode;return t&&11!==t.nodeType?t:null},parents:function(e){return d(e,"parentNode")},parentsUntil:function(e,t,n){return d(e,"parentNode",n)},next:function(e){return A(e,"nextSibling")},prev:function(e){return A(e,"previousSibling")},nextAll:function(e){return d(e,"nextSibling")},prevAll:function(e){return d(e,"previousSibling")},nextUntil:function(e,t,n){return d(e,"nextSibling",n)},prevUntil:function(e,t,n){return d(e,"previousSibling",n)},siblings:function(e){return h((e.parentNode||{}).firstChild,e)},children:function(e){return h(e.firstChild)},contents:function(e){return null!=e.contentDocument&&r(e.contentDocument)?e.contentDocument:(fe(e,"template")&&(e=e.content||e),ce.merge([],e.childNodes))}},function(r,i){ce.fn[r]=function(e,t){var n=ce.map(this,i,e);return"Until"!==r.slice(-5)&&(t=e),t&&"string"==typeof t&&(n=ce.filter(t,n)),1<this.length&&(j[r]||ce.uniqueSort(n),E.test(r)&&n.reverse()),this.pushStack(n)}});var D=/[^\x20\t\r\n\f]+/g;function N(e){return e}function q(e){throw e}function L(e,t,n,r){var i;try{e&&v(i=e.promise)?i.call(e).done(t).fail(n):e&&v(i=e.then)?i.call(e,t,n):t.apply(void 0,[e].slice(r))}catch(e){n.apply(void 0,[e])}}ce.Callbacks=function(r){var e,n;r="string"==typeof r?(e=r,n={},ce.each(e.match(D)||[],function(e,t){n[t]=!0}),n):ce.extend({},r);var i,t,o,a,s=[],u=[],l=-1,c=function(){for(a=a||r.once,o=i=!0;u.length;l=-1){t=u.shift();while(++l<s.length)!1===s[l].apply(t[0],t[1])&&r.stopOnFalse&&(l=s.length,t=!1)}r.memory||(t=!1),i=!1,a&&(s=t?[]:"")},f={add:function(){return s&&(t&&!i&&(l=s.length-1,u.push(t)),function n(e){ce.each(e,function(e,t){v(t)?r.unique&&f.has(t)||s.push(t):t&&t.length&&"string"!==x(t)&&n(t)})}(arguments),t&&!i&&c()),this},remove:function(){return ce.each(arguments,function(e,t){var n;while(-1<(n=ce.inArray(t,s,n)))s.splice(n,1),n<=l&&l--}),this},has:function(e){return e?-1<ce.inArray(e,s):0<s.length},empty:function(){return s&&(s=[]),this},disable:function(){return a=u=[],s=t="",this},disabled:function(){return!s},lock:function(){return a=u=[],t||i||(s=t=""),this},locked:function(){return!!a},fireWith:function(e,t){return a||(t=[e,(t=t||[]).slice?t.slice():t],u.push(t),i||c()),this},fire:function(){return f.fireWith(this,arguments),this},fired:function(){return!!o}};return f},ce.extend({Deferred:function(e){var o=[["notify","progress",ce.Callbacks("memory"),ce.Callbacks("memory"),2],["resolve","done",ce.Callbacks("once memory"),ce.Callbacks("once memory"),0,"resolved"],["reject","fail",ce.Callbacks("once memory"),ce.Callbacks("once memory"),1,"rejected"]],i="pending",a={state:function(){return i},always:function(){return s.done(arguments).fail(arguments),this},"catch":function(e){return a.then(null,e)},pipe:function(){var i=arguments;return ce.Deferred(function(r){ce.each(o,function(e,t){var n=v(i[t[4]])&&i[t[4]];s[t[1]](function(){var e=n&&n.apply(this,arguments);e&&v(e.promise)?e.promise().progress(r.notify).done(r.resolve).fail(r.reject):r[t[0]+"With"](this,n?[e]:arguments)})}),i=null}).promise()},then:function(t,n,r){var u=0;function l(i,o,a,s){return function(){var n=this,r=arguments,e=function(){var e,t;if(!(i<u)){if((e=a.apply(n,r))===o.promise())throw new TypeError("Thenable self-resolution");t=e&&("object"==typeof e||"function"==typeof e)&&e.then,v(t)?s?t.call(e,l(u,o,N,s),l(u,o,q,s)):(u++,t.call(e,l(u,o,N,s),l(u,o,q,s),l(u,o,N,o.notifyWith))):(a!==N&&(n=void 0,r=[e]),(s||o.resolveWith)(n,r))}},t=s?e:function(){try{e()}catch(e){ce.Deferred.exceptionHook&&ce.Deferred.exceptionHook(e,t.error),u<=i+1&&(a!==q&&(n=void 0,r=[e]),o.rejectWith(n,r))}};i?t():(ce.Deferred.getErrorHook?t.error=ce.Deferred.getErrorHook():ce.Deferred.getStackHook&&(t.error=ce.Deferred.getStackHook()),ie.setTimeout(t))}}return ce.Deferred(function(e){o[0][3].add(l(0,e,v(r)?r:N,e.notifyWith)),o[1][3].add(l(0,e,v(t)?t:N)),o[2][3].add(l(0,e,v(n)?n:q))}).promise()},promise:function(e){return null!=e?ce.extend(e,a):a}},s={};return ce.each(o,function(e,t){var n=t[2],r=t[5];a[t[1]]=n.add,r&&n.add(function(){i=r},o[3-e][2].disable,o[3-e][3].disable,o[0][2].lock,o[0][3].lock),n.add(t[3].fire),s[t[0]]=function(){return s[t[0]+"With"](this===s?void 0:this,arguments),this},s[t[0]+"With"]=n.fireWith}),a.promise(s),e&&e.call(s,s),s},when:function(e){var n=arguments.length,t=n,r=Array(t),i=ae.call(arguments),o=ce.Deferred(),a=function(t){return function(e){r[t]=this,i[t]=1<arguments.length?ae.call(arguments):e,--n||o.resolveWith(r,i)}};if(n<=1&&(L(e,o.done(a(t)).resolve,o.reject,!n),"pending"===o.state()||v(i[t]&&i[t].then)))return o.then();while(t--)L(i[t],a(t),o.reject);return o.promise()}});var H=/^(Eval|Internal|Range|Reference|Syntax|Type|URI)Error$/;ce.Deferred.exceptionHook=function(e,t){ie.console&&ie.console.warn&&e&&H.test(e.name)&&ie.console.warn("jQuery.Deferred exception: "+e.message,e.stack,t)},ce.readyException=function(e){ie.setTimeout(function(){throw e})};var O=ce.Deferred();function P(){C.removeEventListener("DOMContentLoaded",P),ie.removeEventListener("load",P),ce.ready()}ce.fn.ready=function(e){return O.then(e)["catch"](function(e){ce.readyException(e)}),this},ce.extend({isReady:!1,readyWait:1,ready:function(e){(!0===e?--ce.readyWait:ce.isReady)||(ce.isReady=!0)!==e&&0<--ce.readyWait||O.resolveWith(C,[ce])}}),ce.ready.then=O.then,"complete"===C.readyState||"loading"!==C.readyState&&!C.documentElement.doScroll?ie.setTimeout(ce.ready):(C.addEventListener("DOMContentLoaded",P),ie.addEventListener("load",P));var M=function(e,t,n,r,i,o,a){var s=0,u=e.length,l=null==n;if("object"===x(n))for(s in i=!0,n)M(e,t,s,n[s],!0,o,a);else if(void 0!==r&&(i=!0,v(r)||(a=!0),l&&(a?(t.call(e,r),t=null):(l=t,t=function(e,t,n){return l.call(ce(e),n)})),t))for(;s<u;s++)t(e[s],n,a?r:r.call(e[s],s,t(e[s],n)));return i?e:l?t.call(e):u?t(e[0],n):o},R=/^-ms-/,I=/-([a-z])/g;function W(e,t){return t.toUpperCase()}function F(e){return e.replace(R,"ms-").replace(I,W)}var $=function(e){return 1===e.nodeType||9===e.nodeType||!+e.nodeType};function B(){this.expando=ce.expando+B.uid++}B.uid=1,B.prototype={cache:function(e){var t=e[this.expando];return t||(t={},$(e)&&(e.nodeType?e[this.expando]=t:Object.defineProperty(e,this.expando,{value:t,configurable:!0}))),t},set:function(e,t,n){var r,i=this.cache(e);if("string"==typeof t)i[F(t)]=n;else for(r in t)i[F(r)]=t[r];return i},get:function(e,t){return void 0===t?this.cache(e):e[this.expando]&&e[this.expando][F(t)]},access:function(e,t,n){return void 0===t||t&&"string"==typeof t&&void 0===n?this.get(e,t):(this.set(e,t,n),void 0!==n?n:t)},remove:function(e,t){var n,r=e[this.expando];if(void 0!==r){if(void 0!==t){n=(t=Array.isArray(t)?t.map(F):(t=F(t))in r?[t]:t.match(D)||[]).length;while(n--)delete r[t[n]]}(void 0===t||ce.isEmptyObject(r))&&(e.nodeType?e[this.expando]=void 0:delete e[this.expando])}},hasData:function(e){var t=e[this.expando];return void 0!==t&&!ce.isEmptyObject(t)}};var _=new B,z=new B,X=/^(?:\{[\w\W]*\}|\[[\w\W]*\])$/,U=/[A-Z]/g;function V(e,t,n){var r,i;if(void 0===n&&1===e.nodeType)if(r="data-"+t.replace(U,"-$&").toLowerCase(),"string"==typeof(n=e.getAttribute(r))){try{n="true"===(i=n)||"false"!==i&&("null"===i?null:i===+i+""?+i:X.test(i)?JSON.parse(i):i)}catch(e){}z.set(e,t,n)}else n=void 0;return n}ce.extend({hasData:function(e){return z.hasData(e)||_.hasData(e)},data:function(e,t,n){return z.access(e,t,n)},removeData:function(e,t){z.remove(e,t)},_data:function(e,t,n){return _.access(e,t,n)},_removeData:function(e,t){_.remove(e,t)}}),ce.fn.extend({data:function(n,e){var t,r,i,o=this[0],a=o&&o.attributes;if(void 0===n){if(this.length&&(i=z.get(o),1===o.nodeType&&!_.get(o,"hasDataAttrs"))){t=a.length;while(t--)a[t]&&0===(r=a[t].name).indexOf("data-")&&(r=F(r.slice(5)),V(o,r,i[r]));_.set(o,"hasDataAttrs",!0)}return i}return"object"==typeof n?this.each(function(){z.set(this,n)}):M(this,function(e){var t;if(o&&void 0===e)return void 0!==(t=z.get(o,n))?t:void 0!==(t=V(o,n))?t:void 0;this.each(function(){z.set(this,n,e)})},null,e,1<arguments.length,null,!0)},removeData:function(e){return this.each(function(){z.remove(this,e)})}}),ce.extend({queue:function(e,t,n){var r;if(e)return t=(t||"fx")+"queue",r=_.get(e,t),n&&(!r||Array.isArray(n)?r=_.access(e,t,ce.makeArray(n)):r.push(n)),r||[]},dequeue:function(e,t){t=t||"fx";var n=ce.queue(e,t),r=n.length,i=n.shift(),o=ce._queueHooks(e,t);"inprogress"===i&&(i=n.shift(),r--),i&&("fx"===t&&n.unshift("inprogress"),delete o.stop,i.call(e,function(){ce.dequeue(e,t)},o)),!r&&o&&o.empty.fire()},_queueHooks:function(e,t){var n=t+"queueHooks";return _.get(e,n)||_.access(e,n,{empty:ce.Callbacks("once memory").add(function(){_.remove(e,[t+"queue",n])})})}}),ce.fn.extend({queue:function(t,n){var e=2;return"string"!=typeof t&&(n=t,t="fx",e--),arguments.length<e?ce.queue(this[0],t):void 0===n?this:this.each(function(){var e=ce.queue(this,t,n);ce._queueHooks(this,t),"fx"===t&&"inprogress"!==e[0]&&ce.dequeue(this,t)})},dequeue:function(e){return this.each(function(){ce.dequeue(this,e)})},clearQueue:function(e){return this.queue(e||"fx",[])},promise:function(e,t){var n,r=1,i=ce.Deferred(),o=this,a=this.length,s=function(){--r||i.resolveWith(o,[o])};"string"!=typeof e&&(t=e,e=void 0),e=e||"fx";while(a--)(n=_.get(o[a],e+"queueHooks"))&&n.empty&&(r++,n.empty.add(s));return s(),i.promise(t)}});var G=/[+-]?(?:\d*\.|)\d+(?:[eE][+-]?\d+|)/.source,Y=new RegExp("^(?:([+-])=|)("+G+")([a-z%]*)$","i"),Q=["Top","Right","Bottom","Left"],J=C.documentElement,K=function(e){return ce.contains(e.ownerDocument,e)},Z={composed:!0};J.getRootNode&&(K=function(e){return ce.contains(e.ownerDocument,e)||e.getRootNode(Z)===e.ownerDocument});var ee=function(e,t){return"none"===(e=t||e).style.display||""===e.style.display&&K(e)&&"none"===ce.css(e,"display")};function te(e,t,n,r){var i,o,a=20,s=r?function(){return r.cur()}:function(){return ce.css(e,t,"")},u=s(),l=n&&n[3]||(ce.cssNumber[t]?"":"px"),c=e.nodeType&&(ce.cssNumber[t]||"px"!==l&&+u)&&Y.exec(ce.css(e,t));if(c&&c[3]!==l){u/=2,l=l||c[3],c=+u||1;while(a--)ce.style(e,t,c+l),(1-o)*(1-(o=s()/u||.5))<=0&&(a=0),c/=o;c*=2,ce.style(e,t,c+l),n=n||[]}return n&&(c=+c||+u||0,i=n[1]?c+(n[1]+1)*n[2]:+n[2],r&&(r.unit=l,r.start=c,r.end=i)),i}var ne={};function re(e,t){for(var n,r,i,o,a,s,u,l=[],c=0,f=e.length;c<f;c++)(r=e[c]).style&&(n=r.style.display,t?("none"===n&&(l[c]=_.get(r,"display")||null,l[c]||(r.style.display="")),""===r.style.display&&ee(r)&&(l[c]=(u=a=o=void 0,a=(i=r).ownerDocument,s=i.nodeName,(u=ne[s])||(o=a.body.appendChild(a.createElement(s)),u=ce.css(o,"display"),o.parentNode.removeChild(o),"none"===u&&(u="block"),ne[s]=u)))):"none"!==n&&(l[c]="none",_.set(r,"display",n)));for(c=0;c<f;c++)null!=l[c]&&(e[c].style.display=l[c]);return e}ce.fn.extend({show:function(){return re(this,!0)},hide:function(){return re(this)},toggle:function(e){return"boolean"==typeof e?e?this.show():this.hide():this.each(function(){ee(this)?ce(this).show():ce(this).hide()})}});var xe,be,we=/^(?:checkbox|radio)$/i,Te=/<([a-z][^\/\0>\x20\t\r\n\f]*)/i,Ce=/^$|^module$|\/(?:java|ecma)script/i;xe=C.createDocumentFragment().appendChild(C.createElement("div")),(be=C.createElement("input")).setAttribute("type","radio"),be.setAttribute("checked","checked"),be.setAttribute("name","t"),xe.appendChild(be),le.checkClone=xe.cloneNode(!0).cloneNode(!0).lastChild.checked,xe.innerHTML="<textarea>x</textarea>",le.noCloneChecked=!!xe.cloneNode(!0).lastChild.defaultValue,xe.innerHTML="<option></option>",le.option=!!xe.lastChild;var ke={thead:[1,"<table>","</table>"],col:[2,"<table><colgroup>","</colgroup></table>"],tr:[2,"<table><tbody>","</tbody></table>"],td:[3,"<table><tbody><tr>","</tr></tbody></table>"],_default:[0,"",""]};function Se(e,t){var n;return n="undefined"!=typeof e.getElementsByTagName?e.getElementsByTagName(t||"*"):"undefined"!=typeof e.querySelectorAll?e.querySelectorAll(t||"*"):[],void 0===t||t&&fe(e,t)?ce.merge([e],n):n}function Ee(e,t){for(var n=0,r=e.length;n<r;n++)_.set(e[n],"globalEval",!t||_.get(t[n],"globalEval"))}ke.tbody=ke.tfoot=ke.colgroup=ke.caption=ke.thead,ke.th=ke.td,le.option||(ke.optgroup=ke.option=[1,"<select multiple='multiple'>","</select>"]);var je=/<|&#?\w+;/;function Ae(e,t,n,r,i){for(var o,a,s,u,l,c,f=t.createDocumentFragment(),p=[],d=0,h=e.length;d<h;d++)if((o=e[d])||0===o)if("object"===x(o))ce.merge(p,o.nodeType?[o]:o);else if(je.test(o)){a=a||f.appendChild(t.createElement("div")),s=(Te.exec(o)||["",""])[1].toLowerCase(),u=ke[s]||ke._default,a.innerHTML=u[1]+ce.htmlPrefilter(o)+u[2],c=u[0];while(c--)a=a.lastChild;ce.merge(p,a.childNodes),(a=f.firstChild).textContent=""}else p.push(t.createTextNode(o));f.textContent="",d=0;while(o=p[d++])if(r&&-1<ce.inArray(o,r))i&&i.push(o);else if(l=K(o),a=Se(f.appendChild(o),"script"),l&&Ee(a),n){c=0;while(o=a[c++])Ce.test(o.type||"")&&n.push(o)}return f}var De=/^([^.]*)(?:\.(.+)|)/;function Ne(){return!0}function qe(){return!1}function Le(e,t,n,r,i,o){var a,s;if("object"==typeof t){for(s in"string"!=typeof n&&(r=r||n,n=void 0),t)Le(e,s,n,r,t[s],o);return e}if(null==r&&null==i?(i=n,r=n=void 0):null==i&&("string"==typeof n?(i=r,r=void 0):(i=r,r=n,n=void 0)),!1===i)i=qe;else if(!i)return e;return 1===o&&(a=i,(i=function(e){return ce().off(e),a.apply(this,arguments)}).guid=a.guid||(a.guid=ce.guid++)),e.each(function(){ce.event.add(this,t,i,r,n)})}function He(e,r,t){t?(_.set(e,r,!1),ce.event.add(e,r,{namespace:!1,handler:function(e){var t,n=_.get(this,r);if(1&e.isTrigger&&this[r]){if(n)(ce.event.special[r]||{}).delegateType&&e.stopPropagation();else if(n=ae.call(arguments),_.set(this,r,n),this[r](),t=_.get(this,r),_.set(this,r,!1),n!==t)return e.stopImmediatePropagation(),e.preventDefault(),t}else n&&(_.set(this,r,ce.event.trigger(n[0],n.slice(1),this)),e.stopPropagation(),e.isImmediatePropagationStopped=Ne)}})):void 0===_.get(e,r)&&ce.event.add(e,r,Ne)}ce.event={global:{},add:function(t,e,n,r,i){var o,a,s,u,l,c,f,p,d,h,g,v=_.get(t);if($(t)){n.handler&&(n=(o=n).handler,i=o.selector),i&&ce.find.matchesSelector(J,i),n.guid||(n.guid=ce.guid++),(u=v.events)||(u=v.events=Object.create(null)),(a=v.handle)||(a=v.handle=function(e){return"undefined"!=typeof ce&&ce.event.triggered!==e.type?ce.event.dispatch.apply(t,arguments):void 0}),l=(e=(e||"").match(D)||[""]).length;while(l--)d=g=(s=De.exec(e[l])||[])[1],h=(s[2]||"").split(".").sort(),d&&(f=ce.event.special[d]||{},d=(i?f.delegateType:f.bindType)||d,f=ce.event.special[d]||{},c=ce.extend({type:d,origType:g,data:r,handler:n,guid:n.guid,selector:i,needsContext:i&&ce.expr.match.needsContext.test(i),namespace:h.join(".")},o),(p=u[d])||((p=u[d]=[]).delegateCount=0,f.setup&&!1!==f.setup.call(t,r,h,a)||t.addEventListener&&t.addEventListener(d,a)),f.add&&(f.add.call(t,c),c.handler.guid||(c.handler.guid=n.guid)),i?p.splice(p.delegateCount++,0,c):p.push(c),ce.event.global[d]=!0)}},remove:function(e,t,n,r,i){var o,a,s,u,l,c,f,p,d,h,g,v=_.hasData(e)&&_.get(e);if(v&&(u=v.events)){l=(t=(t||"").match(D)||[""]).length;while(l--)if(d=g=(s=De.exec(t[l])||[])[1],h=(s[2]||"").split(".").sort(),d){f=ce.event.special[d]||{},p=u[d=(r?f.delegateType:f.bindType)||d]||[],s=s[2]&&new RegExp("(^|\\.)"+h.join("\\.(?:.*\\.|)")+"(\\.|$)"),a=o=p.length;while(o--)c=p[o],!i&&g!==c.origType||n&&n.guid!==c.guid||s&&!s.test(c.namespace)||r&&r!==c.selector&&("**"!==r||!c.selector)||(p.splice(o,1),c.selector&&p.delegateCount--,f.remove&&f.remove.call(e,c));a&&!p.length&&(f.teardown&&!1!==f.teardown.call(e,h,v.handle)||ce.removeEvent(e,d,v.handle),delete u[d])}else for(d in u)ce.event.remove(e,d+t[l],n,r,!0);ce.isEmptyObject(u)&&_.remove(e,"handle events")}},dispatch:function(e){var t,n,r,i,o,a,s=new Array(arguments.length),u=ce.event.fix(e),l=(_.get(this,"events")||Object.create(null))[u.type]||[],c=ce.event.special[u.type]||{};for(s[0]=u,t=1;t<arguments.length;t++)s[t]=arguments[t];if(u.delegateTarget=this,!c.preDispatch||!1!==c.preDispatch.call(this,u)){a=ce.event.handlers.call(this,u,l),t=0;while((i=a[t++])&&!u.isPropagationStopped()){u.currentTarget=i.elem,n=0;while((o=i.handlers[n++])&&!u.isImmediatePropagationStopped())u.rnamespace&&!1!==o.namespace&&!u.rnamespace.test(o.namespace)||(u.handleObj=o,u.data=o.data,void 0!==(r=((ce.event.special[o.origType]||{}).handle||o.handler).apply(i.elem,s))&&!1===(u.result=r)&&(u.preventDefault(),u.stopPropagation()))}return c.postDispatch&&c.postDispatch.call(this,u),u.result}},handlers:function(e,t){var n,r,i,o,a,s=[],u=t.delegateCount,l=e.target;if(u&&l.nodeType&&!("click"===e.type&&1<=e.button))for(;l!==this;l=l.parentNode||this)if(1===l.nodeType&&("click"!==e.type||!0!==l.disabled)){for(o=[],a={},n=0;n<u;n++)void 0===a[i=(r=t[n]).selector+" "]&&(a[i]=r.needsContext?-1<ce(i,this).index(l):ce.find(i,this,null,[l]).length),a[i]&&o.push(r);o.length&&s.push({elem:l,handlers:o})}return l=this,u<t.length&&s.push({elem:l,handlers:t.slice(u)}),s},addProp:function(t,e){Object.defineProperty(ce.Event.prototype,t,{enumerable:!0,configurable:!0,get:v(e)?function(){if(this.originalEvent)return e(this.originalEvent)}:function(){if(this.originalEvent)return this.originalEvent[t]},set:function(e){Object.defineProperty(this,t,{enumerable:!0,configurable:!0,writable:!0,value:e})}})},fix:function(e){return e[ce.expando]?e:new ce.Event(e)},special:{load:{noBubble:!0},click:{setup:function(e){var t=this||e;return we.test(t.type)&&t.click&&fe(t,"input")&&He(t,"click",!0),!1},trigger:function(e){var t=this||e;return we.test(t.type)&&t.click&&fe(t,"input")&&He(t,"click"),!0},_default:function(e){var t=e.target;return we.test(t.type)&&t.click&&fe(t,"input")&&_.get(t,"click")||fe(t,"a")}},beforeunload:{postDispatch:function(e){void 0!==e.result&&e.originalEvent&&(e.originalEvent.returnValue=e.result)}}}},ce.removeEvent=function(e,t,n){e.removeEventListener&&e.removeEventListener(t,n)},ce.Event=function(e,t){if(!(this instanceof ce.Event))return new ce.Event(e,t);e&&e.type?(this.originalEvent=e,this.type=e.type,this.isDefaultPrevented=e.defaultPrevented||void 0===e.defaultPrevented&&!1===e.returnValue?Ne:qe,this.target=e.target&&3===e.target.nodeType?e.target.parentNode:e.target,this.currentTarget=e.currentTarget,this.relatedTarget=e.relatedTarget):this.type=e,t&&ce.extend(this,t),this.timeStamp=e&&e.timeStamp||Date.now(),this[ce.expando]=!0},ce.Event.prototype={constructor:ce.Event,isDefaultPrevented:qe,isPropagationStopped:qe,isImmediatePropagationStopped:qe,isSimulated:!1,preventDefault:function(){var e=this.originalEvent;this.isDefaultPrevented=Ne,e&&!this.isSimulated&&e.preventDefault()},stopPropagation:function(){var e=this.originalEvent;this.isPropagationStopped=Ne,e&&!this.isSimulated&&e.stopPropagation()},stopImmediatePropagation:function(){var e=this.originalEvent;this.isImmediatePropagationStopped=Ne,e&&!this.isSimulated&&e.stopImmediatePropagation(),this.stopPropagation()}},ce.each({altKey:!0,bubbles:!0,cancelable:!0,changedTouches:!0,ctrlKey:!0,detail:!0,eventPhase:!0,metaKey:!0,pageX:!0,pageY:!0,shiftKey:!0,view:!0,"char":!0,code:!0,charCode:!0,key:!0,keyCode:!0,button:!0,buttons:!0,clientX:!0,clientY:!0,offsetX:!0,offsetY:!0,pointerId:!0,pointerType:!0,screenX:!0,screenY:!0,targetTouches:!0,toElement:!0,touches:!0,which:!0},ce.event.addProp),ce.each({focus:"focusin",blur:"focusout"},function(r,i){function o(e){if(C.documentMode){var t=_.get(this,"handle"),n=ce.event.fix(e);n.type="focusin"===e.type?"focus":"blur",n.isSimulated=!0,t(e),n.target===n.currentTarget&&t(n)}else ce.event.simulate(i,e.target,ce.event.fix(e))}ce.event.special[r]={setup:function(){var e;if(He(this,r,!0),!C.documentMode)return!1;(e=_.get(this,i))||this.addEventListener(i,o),_.set(this,i,(e||0)+1)},trigger:function(){return He(this,r),!0},teardown:function(){var e;if(!C.documentMode)return!1;(e=_.get(this,i)-1)?_.set(this,i,e):(this.removeEventListener(i,o),_.remove(this,i))},_default:function(e){return _.get(e.target,r)},delegateType:i},ce.event.special[i]={setup:function(){var e=this.ownerDocument||this.document||this,t=C.documentMode?this:e,n=_.get(t,i);n||(C.documentMode?this.addEventListener(i,o):e.addEventListener(r,o,!0)),_.set(t,i,(n||0)+1)},teardown:function(){var e=this.ownerDocument||this.document||this,t=C.documentMode?this:e,n=_.get(t,i)-1;n?_.set(t,i,n):(C.documentMode?this.removeEventListener(i,o):e.removeEventListener(r,o,!0),_.remove(t,i))}}}),ce.each({mouseenter:"mouseover",mouseleave:"mouseout",pointerenter:"pointerover",pointerleave:"pointerout"},function(e,i){ce.event.special[e]={delegateType:i,bindType:i,handle:function(e){var t,n=e.relatedTarget,r=e.handleObj;return n&&(n===this||ce.contains(this,n))||(e.type=r.origType,t=r.handler.apply(this,arguments),e.type=i),t}}}),ce.fn.extend({on:function(e,t,n,r){return Le(this,e,t,n,r)},one:function(e,t,n,r){return Le(this,e,t,n,r,1)},off:function(e,t,n){var r,i;if(e&&e.preventDefault&&e.handleObj)return r=e.handleObj,ce(e.delegateTarget).off(r.namespace?r.origType+"."+r.namespace:r.origType,r.selector,r.handler),this;if("object"==typeof e){for(i in e)this.off(i,t,e[i]);return this}return!1!==t&&"function"!=typeof t||(n=t,t=void 0),!1===n&&(n=qe),this.each(function(){ce.event.remove(this,e,n,t)})}});var Oe=/<script|<style|<link/i,Pe=/checked\s*(?:[^=]|=\s*.checked.)/i,Me=/^\s*<!\[CDATA\[|\]\]>\s*$/g;function Re(e,t){return fe(e,"table")&&fe(11!==t.nodeType?t:t.firstChild,"tr")&&ce(e).children("tbody")[0]||e}function Ie(e){return e.type=(null!==e.getAttribute("type"))+"/"+e.type,e}function We(e){return"true/"===(e.type||"").slice(0,5)?e.type=e.type.slice(5):e.removeAttribute("type"),e}function Fe(e,t){var n,r,i,o,a,s;if(1===t.nodeType){if(_.hasData(e)&&(s=_.get(e).events))for(i in _.remove(t,"handle events"),s)for(n=0,r=s[i].length;n<r;n++)ce.event.add(t,i,s[i][n]);z.hasData(e)&&(o=z.access(e),a=ce.extend({},o),z.set(t,a))}}function $e(n,r,i,o){r=g(r);var e,t,a,s,u,l,c=0,f=n.length,p=f-1,d=r[0],h=v(d);if(h||1<f&&"string"==typeof d&&!le.checkClone&&Pe.test(d))return n.each(function(e){var t=n.eq(e);h&&(r[0]=d.call(this,e,t.html())),$e(t,r,i,o)});if(f&&(t=(e=Ae(r,n[0].ownerDocument,!1,n,o)).firstChild,1===e.childNodes.length&&(e=t),t||o)){for(s=(a=ce.map(Se(e,"script"),Ie)).length;c<f;c++)u=e,c!==p&&(u=ce.clone(u,!0,!0),s&&ce.merge(a,Se(u,"script"))),i.call(n[c],u,c);if(s)for(l=a[a.length-1].ownerDocument,ce.map(a,We),c=0;c<s;c++)u=a[c],Ce.test(u.type||"")&&!_.access(u,"globalEval")&&ce.contains(l,u)&&(u.src&&"module"!==(u.type||"").toLowerCase()?ce._evalUrl&&!u.noModule&&ce._evalUrl(u.src,{nonce:u.nonce||u.getAttribute("nonce")},l):m(u.textContent.replace(Me,""),u,l))}return n}function Be(e,t,n){for(var r,i=t?ce.filter(t,e):e,o=0;null!=(r=i[o]);o++)n||1!==r.nodeType||ce.cleanData(Se(r)),r.parentNode&&(n&&K(r)&&Ee(Se(r,"script")),r.parentNode.removeChild(r));return e}ce.extend({htmlPrefilter:function(e){return e},clone:function(e,t,n){var r,i,o,a,s,u,l,c=e.cloneNode(!0),f=K(e);if(!(le.noCloneChecked||1!==e.nodeType&&11!==e.nodeType||ce.isXMLDoc(e)))for(a=Se(c),r=0,i=(o=Se(e)).length;r<i;r++)s=o[r],u=a[r],void 0,"input"===(l=u.nodeName.toLowerCase())&&we.test(s.type)?u.checked=s.checked:"input"!==l&&"textarea"!==l||(u.defaultValue=s.defaultValue);if(t)if(n)for(o=o||Se(e),a=a||Se(c),r=0,i=o.length;r<i;r++)Fe(o[r],a[r]);else Fe(e,c);return 0<(a=Se(c,"script")).length&&Ee(a,!f&&Se(e,"script")),c},cleanData:function(e){for(var t,n,r,i=ce.event.special,o=0;void 0!==(n=e[o]);o++)if($(n)){if(t=n[_.expando]){if(t.events)for(r in t.events)i[r]?ce.event.remove(n,r):ce.removeEvent(n,r,t.handle);n[_.expando]=void 0}n[z.expando]&&(n[z.expando]=void 0)}}}),ce.fn.extend({detach:function(e){return Be(this,e,!0)},remove:function(e){return Be(this,e)},text:function(e){return M(this,function(e){return void 0===e?ce.text(this):this.empty().each(function(){1!==this.nodeType&&11!==this.nodeType&&9!==this.nodeType||(this.textContent=e)})},null,e,arguments.length)},append:function(){return $e(this,arguments,function(e){1!==this.nodeType&&11!==this.nodeType&&9!==this.nodeType||Re(this,e).appendChild(e)})},prepend:function(){return $e(this,arguments,function(e){if(1===this.nodeType||11===this.nodeType||9===this.nodeType){var t=Re(this,e);t.insertBefore(e,t.firstChild)}})},before:function(){return $e(this,arguments,function(e){this.parentNode&&this.parentNode.insertBefore(e,this)})},after:function(){return $e(this,arguments,function(e){this.parentNode&&this.parentNode.insertBefore(e,this.nextSibling)})},empty:function(){for(var e,t=0;null!=(e=this[t]);t++)1===e.nodeType&&(ce.cleanData(Se(e,!1)),e.textContent="");return this},clone:function(e,t){return e=null!=e&&e,t=null==t?e:t,this.map(function(){return ce.clone(this,e,t)})},html:function(e){return M(this,function(e){var t=this[0]||{},n=0,r=this.length;if(void 0===e&&1===t.nodeType)return t.innerHTML;if("string"==typeof e&&!Oe.test(e)&&!ke[(Te.exec(e)||["",""])[1].toLowerCase()]){e=ce.htmlPrefilter(e);try{for(;n<r;n++)1===(t=this[n]||{}).nodeType&&(ce.cleanData(Se(t,!1)),t.innerHTML=e);t=0}catch(e){}}t&&this.empty().append(e)},null,e,arguments.length)},replaceWith:function(){var n=[];return $e(this,arguments,function(e){var t=this.parentNode;ce.inArray(this,n)<0&&(ce.cleanData(Se(this)),t&&t.replaceChild(e,this))},n)}}),ce.each({appendTo:"append",prependTo:"prepend",insertBefore:"before",insertAfter:"after",replaceAll:"replaceWith"},function(e,a){ce.fn[e]=function(e){for(var t,n=[],r=ce(e),i=r.length-1,o=0;o<=i;o++)t=o===i?this:this.clone(!0),ce(r[o])[a](t),s.apply(n,t.get());return this.pushStack(n)}});var _e=new RegExp("^("+G+")(?!px)[a-z%]+$","i"),ze=/^--/,Xe=function(e){var t=e.ownerDocument.defaultView;return t&&t.opener||(t=ie),t.getComputedStyle(e)},Ue=function(e,t,n){var r,i,o={};for(i in t)o[i]=e.style[i],e.style[i]=t[i];for(i in r=n.call(e),t)e.style[i]=o[i];return r},Ve=new RegExp(Q.join("|"),"i");function Ge(e,t,n){var r,i,o,a,s=ze.test(t),u=e.style;return(n=n||Xe(e))&&(a=n.getPropertyValue(t)||n[t],s&&a&&(a=a.replace(ve,"$1")||void 0),""!==a||K(e)||(a=ce.style(e,t)),!le.pixelBoxStyles()&&_e.test(a)&&Ve.test(t)&&(r=u.width,i=u.minWidth,o=u.maxWidth,u.minWidth=u.maxWidth=u.width=a,a=n.width,u.width=r,u.minWidth=i,u.maxWidth=o)),void 0!==a?a+"":a}function Ye(e,t){return{get:function(){if(!e())return(this.get=t).apply(this,arguments);delete this.get}}}!function(){function e(){if(l){u.style.cssText="position:absolute;left:-11111px;width:60px;margin-top:1px;padding:0;border:0",l.style.cssText="position:relative;display:block;box-sizing:border-box;overflow:scroll;margin:auto;border:1px;padding:1px;width:60%;top:1%",J.appendChild(u).appendChild(l);var e=ie.getComputedStyle(l);n="1%"!==e.top,s=12===t(e.marginLeft),l.style.right="60%",o=36===t(e.right),r=36===t(e.width),l.style.position="absolute",i=12===t(l.offsetWidth/3),J.removeChild(u),l=null}}function t(e){return Math.round(parseFloat(e))}var n,r,i,o,a,s,u=C.createElement("div"),l=C.createElement("div");l.style&&(l.style.backgroundClip="content-box",l.cloneNode(!0).style.backgroundClip="",le.clearCloneStyle="content-box"===l.style.backgroundClip,ce.extend(le,{boxSizingReliable:function(){return e(),r},pixelBoxStyles:function(){return e(),o},pixelPosition:function(){return e(),n},reliableMarginLeft:function(){return e(),s},scrollboxSize:function(){return e(),i},reliableTrDimensions:function(){var e,t,n,r;return null==a&&(e=C.createElement("table"),t=C.createElement("tr"),n=C.createElement("div"),e.style.cssText="position:absolute;left:-11111px;border-collapse:separate",t.style.cssText="box-sizing:content-box;border:1px solid",t.style.height="1px",n.style.height="9px",n.style.display="block",J.appendChild(e).appendChild(t).appendChild(n),r=ie.getComputedStyle(t),a=parseInt(r.height,10)+parseInt(r.borderTopWidth,10)+parseInt(r.borderBottomWidth,10)===t.offsetHeight,J.removeChild(e)),a}}))}();var Qe=["Webkit","Moz","ms"],Je=C.createElement("div").style,Ke={};function Ze(e){var t=ce.cssProps[e]||Ke[e];return t||(e in Je?e:Ke[e]=function(e){var t=e[0].toUpperCase()+e.slice(1),n=Qe.length;while(n--)if((e=Qe[n]+t)in Je)return e}(e)||e)}var et=/^(none|table(?!-c[ea]).+)/,tt={position:"absolute",visibility:"hidden",display:"block"},nt={letterSpacing:"0",fontWeight:"400"};function rt(e,t,n){var r=Y.exec(t);return r?Math.max(0,r[2]-(n||0))+(r[3]||"px"):t}function it(e,t,n,r,i,o){var a="width"===t?1:0,s=0,u=0,l=0;if(n===(r?"border":"content"))return 0;for(;a<4;a+=2)"margin"===n&&(l+=ce.css(e,n+Q[a],!0,i)),r?("content"===n&&(u-=ce.css(e,"padding"+Q[a],!0,i)),"margin"!==n&&(u-=ce.css(e,"border"+Q[a]+"Width",!0,i))):(u+=ce.css(e,"padding"+Q[a],!0,i),"padding"!==n?u+=ce.css(e,"border"+Q[a]+"Width",!0,i):s+=ce.css(e,"border"+Q[a]+"Width",!0,i));return!r&&0<=o&&(u+=Math.max(0,Math.ceil(e["offset"+t[0].toUpperCase()+t.slice(1)]-o-u-s-.5))||0),u+l}function ot(e,t,n){var r=Xe(e),i=(!le.boxSizingReliable()||n)&&"border-box"===ce.css(e,"boxSizing",!1,r),o=i,a=Ge(e,t,r),s="offset"+t[0].toUpperCase()+t.slice(1);if(_e.test(a)){if(!n)return a;a="auto"}return(!le.boxSizingReliable()&&i||!le.reliableTrDimensions()&&fe(e,"tr")||"auto"===a||!parseFloat(a)&&"inline"===ce.css(e,"display",!1,r))&&e.getClientRects().length&&(i="border-box"===ce.css(e,"boxSizing",!1,r),(o=s in e)&&(a=e[s])),(a=parseFloat(a)||0)+it(e,t,n||(i?"border":"content"),o,r,a)+"px"}function at(e,t,n,r,i){return new at.prototype.init(e,t,n,r,i)}ce.extend({cssHooks:{opacity:{get:function(e,t){if(t){var n=Ge(e,"opacity");return""===n?"1":n}}}},cssNumber:{animationIterationCount:!0,aspectRatio:!0,borderImageSlice:!0,columnCount:!0,flexGrow:!0,flexShrink:!0,fontWeight:!0,gridArea:!0,gridColumn:!0,gridColumnEnd:!0,gridColumnStart:!0,gridRow:!0,gridRowEnd:!0,gridRowStart:!0,lineHeight:!0,opacity:!0,order:!0,orphans:!0,scale:!0,widows:!0,zIndex:!0,zoom:!0,fillOpacity:!0,floodOpacity:!0,stopOpacity:!0,strokeMiterlimit:!0,strokeOpacity:!0},cssProps:{},style:function(e,t,n,r){if(e&&3!==e.nodeType&&8!==e.nodeType&&e.style){var i,o,a,s=F(t),u=ze.test(t),l=e.style;if(u||(t=Ze(s)),a=ce.cssHooks[t]||ce.cssHooks[s],void 0===n)return a&&"get"in a&&void 0!==(i=a.get(e,!1,r))?i:l[t];"string"===(o=typeof n)&&(i=Y.exec(n))&&i[1]&&(n=te(e,t,i),o="number"),null!=n&&n==n&&("number"!==o||u||(n+=i&&i[3]||(ce.cssNumber[s]?"":"px")),le.clearCloneStyle||""!==n||0!==t.indexOf("background")||(l[t]="inherit"),a&&"set"in a&&void 0===(n=a.set(e,n,r))||(u?l.setProperty(t,n):l[t]=n))}},css:function(e,t,n,r){var i,o,a,s=F(t);return ze.test(t)||(t=Ze(s)),(a=ce.cssHooks[t]||ce.cssHooks[s])&&"get"in a&&(i=a.get(e,!0,n)),void 0===i&&(i=Ge(e,t,r)),"normal"===i&&t in nt&&(i=nt[t]),""===n||n?(o=parseFloat(i),!0===n||isFinite(o)?o||0:i):i}}),ce.each(["height","width"],function(e,u){ce.cssHooks[u]={get:function(e,t,n){if(t)return!et.test(ce.css(e,"display"))||e.getClientRects().length&&e.getBoundingClientRect().width?ot(e,u,n):Ue(e,tt,function(){return ot(e,u,n)})},set:function(e,t,n){var r,i=Xe(e),o=!le.scrollboxSize()&&"absolute"===i.position,a=(o||n)&&"border-box"===ce.css(e,"boxSizing",!1,i),s=n?it(e,u,n,a,i):0;return a&&o&&(s-=Math.ceil(e["offset"+u[0].toUpperCase()+u.slice(1)]-parseFloat(i[u])-it(e,u,"border",!1,i)-.5)),s&&(r=Y.exec(t))&&"px"!==(r[3]||"px")&&(e.style[u]=t,t=ce.css(e,u)),rt(0,t,s)}}}),ce.cssHooks.marginLeft=Ye(le.reliableMarginLeft,function(e,t){if(t)return(parseFloat(Ge(e,"marginLeft"))||e.getBoundingClientRect().left-Ue(e,{marginLeft:0},function(){return e.getBoundingClientRect().left}))+"px"}),ce.each({margin:"",padding:"",border:"Width"},function(i,o){ce.cssHooks[i+o]={expand:function(e){for(var t=0,n={},r="string"==typeof e?e.split(" "):[e];t<4;t++)n[i+Q[t]+o]=r[t]||r[t-2]||r[0];return n}},"margin"!==i&&(ce.cssHooks[i+o].set=rt)}),ce.fn.extend({css:function(e,t){return M(this,function(e,t,n){var r,i,o={},a=0;if(Array.isArray(t)){for(r=Xe(e),i=t.length;a<i;a++)o[t[a]]=ce.css(e,t[a],!1,r);return o}return void 0!==n?ce.style(e,t,n):ce.css(e,t)},e,t,1<arguments.length)}}),((ce.Tween=at).prototype={constructor:at,init:function(e,t,n,r,i,o){this.elem=e,this.prop=n,this.easing=i||ce.easing._default,this.options=t,this.start=this.now=this.cur(),this.end=r,this.unit=o||(ce.cssNumber[n]?"":"px")},cur:function(){var e=at.propHooks[this.prop];return e&&e.get?e.get(this):at.propHooks._default.get(this)},run:function(e){var t,n=at.propHooks[this.prop];return this.options.duration?this.pos=t=ce.easing[this.easing](e,this.options.duration*e,0,1,this.options.duration):this.pos=t=e,this.now=(this.end-this.start)*t+this.start,this.options.step&&this.options.step.call(this.elem,this.now,this),n&&n.set?n.set(this):at.propHooks._default.set(this),this}}).init.prototype=at.prototype,(at.propHooks={_default:{get:function(e){var t;return 1!==e.elem.nodeType||null!=e.elem[e.prop]&&null==e.elem.style[e.prop]?e.elem[e.prop]:(t=ce.css(e.elem,e.prop,""))&&"auto"!==t?t:0},set:function(e){ce.fx.step[e.prop]?ce.fx.step[e.prop](e):1!==e.elem.nodeType||!ce.cssHooks[e.prop]&&null==e.elem.style[Ze(e.prop)]?e.elem[e.prop]=e.now:ce.style(e.elem,e.prop,e.now+e.unit)}}}).scrollTop=at.propHooks.scrollLeft={set:function(e){e.elem.nodeType&&e.elem.parentNode&&(e.elem[e.prop]=e.now)}},ce.easing={linear:function(e){return e},swing:function(e){return.5-Math.cos(e*Math.PI)/2},_default:"swing"},ce.fx=at.prototype.init,ce.fx.step={};var st,ut,lt,ct,ft=/^(?:toggle|show|hide)$/,pt=/queueHooks$/;function dt(){ut&&(!1===C.hidden&&ie.requestAnimationFrame?ie.requestAnimationFrame(dt):ie.setTimeout(dt,ce.fx.interval),ce.fx.tick())}function ht(){return ie.setTimeout(function(){st=void 0}),st=Date.now()}function gt(e,t){var n,r=0,i={height:e};for(t=t?1:0;r<4;r+=2-t)i["margin"+(n=Q[r])]=i["padding"+n]=e;return t&&(i.opacity=i.width=e),i}function vt(e,t,n){for(var r,i=(yt.tweeners[t]||[]).concat(yt.tweeners["*"]),o=0,a=i.length;o<a;o++)if(r=i[o].call(n,t,e))return r}function yt(o,e,t){var n,a,r=0,i=yt.prefilters.length,s=ce.Deferred().always(function(){delete u.elem}),u=function(){if(a)return!1;for(var e=st||ht(),t=Math.max(0,l.startTime+l.duration-e),n=1-(t/l.duration||0),r=0,i=l.tweens.length;r<i;r++)l.tweens[r].run(n);return s.notifyWith(o,[l,n,t]),n<1&&i?t:(i||s.notifyWith(o,[l,1,0]),s.resolveWith(o,[l]),!1)},l=s.promise({elem:o,props:ce.extend({},e),opts:ce.extend(!0,{specialEasing:{},easing:ce.easing._default},t),originalProperties:e,originalOptions:t,startTime:st||ht(),duration:t.duration,tweens:[],createTween:function(e,t){var n=ce.Tween(o,l.opts,e,t,l.opts.specialEasing[e]||l.opts.easing);return l.tweens.push(n),n},stop:function(e){var t=0,n=e?l.tweens.length:0;if(a)return this;for(a=!0;t<n;t++)l.tweens[t].run(1);return e?(s.notifyWith(o,[l,1,0]),s.resolveWith(o,[l,e])):s.rejectWith(o,[l,e]),this}}),c=l.props;for(!function(e,t){var n,r,i,o,a;for(n in e)if(i=t[r=F(n)],o=e[n],Array.isArray(o)&&(i=o[1],o=e[n]=o[0]),n!==r&&(e[r]=o,delete e[n]),(a=ce.cssHooks[r])&&"expand"in a)for(n in o=a.expand(o),delete e[r],o)n in e||(e[n]=o[n],t[n]=i);else t[r]=i}(c,l.opts.specialEasing);r<i;r++)if(n=yt.prefilters[r].call(l,o,c,l.opts))return v(n.stop)&&(ce._queueHooks(l.elem,l.opts.queue).stop=n.stop.bind(n)),n;return ce.map(c,vt,l),v(l.opts.start)&&l.opts.start.call(o,l),l.progress(l.opts.progress).done(l.opts.done,l.opts.complete).fail(l.opts.fail).always(l.opts.always),ce.fx.timer(ce.extend(u,{elem:o,anim:l,queue:l.opts.queue})),l}ce.Animation=ce.extend(yt,{tweeners:{"*":[function(e,t){var n=this.createTween(e,t);return te(n.elem,e,Y.exec(t),n),n}]},tweener:function(e,t){v(e)?(t=e,e=["*"]):e=e.match(D);for(var n,r=0,i=e.length;r<i;r++)n=e[r],yt.tweeners[n]=yt.tweeners[n]||[],yt.tweeners[n].unshift(t)},prefilters:[function(e,t,n){var r,i,o,a,s,u,l,c,f="width"in t||"height"in t,p=this,d={},h=e.style,g=e.nodeType&&ee(e),v=_.get(e,"fxshow");for(r in n.queue||(null==(a=ce._queueHooks(e,"fx")).unqueued&&(a.unqueued=0,s=a.empty.fire,a.empty.fire=function(){a.unqueued||s()}),a.unqueued++,p.always(function(){p.always(function(){a.unqueued--,ce.queue(e,"fx").length||a.empty.fire()})})),t)if(i=t[r],ft.test(i)){if(delete t[r],o=o||"toggle"===i,i===(g?"hide":"show")){if("show"!==i||!v||void 0===v[r])continue;g=!0}d[r]=v&&v[r]||ce.style(e,r)}if((u=!ce.isEmptyObject(t))||!ce.isEmptyObject(d))for(r in f&&1===e.nodeType&&(n.overflow=[h.overflow,h.overflowX,h.overflowY],null==(l=v&&v.display)&&(l=_.get(e,"display")),"none"===(c=ce.css(e,"display"))&&(l?c=l:(re([e],!0),l=e.style.display||l,c=ce.css(e,"display"),re([e]))),("inline"===c||"inline-block"===c&&null!=l)&&"none"===ce.css(e,"float")&&(u||(p.done(function(){h.display=l}),null==l&&(c=h.display,l="none"===c?"":c)),h.display="inline-block")),n.overflow&&(h.overflow="hidden",p.always(function(){h.overflow=n.overflow[0],h.overflowX=n.overflow[1],h.overflowY=n.overflow[2]})),u=!1,d)u||(v?"hidden"in v&&(g=v.hidden):v=_.access(e,"fxshow",{display:l}),o&&(v.hidden=!g),g&&re([e],!0),p.done(function(){for(r in g||re([e]),_.remove(e,"fxshow"),d)ce.style(e,r,d[r])})),u=vt(g?v[r]:0,r,p),r in v||(v[r]=u.start,g&&(u.end=u.start,u.start=0))}],prefilter:function(e,t){t?yt.prefilters.unshift(e):yt.prefilters.push(e)}}),ce.speed=function(e,t,n){var r=e&&"object"==typeof e?ce.extend({},e):{complete:n||!n&&t||v(e)&&e,duration:e,easing:n&&t||t&&!v(t)&&t};return ce.fx.off?r.duration=0:"number"!=typeof r.duration&&(r.duration in ce.fx.speeds?r.duration=ce.fx.speeds[r.duration]:r.duration=ce.fx.speeds._default),null!=r.queue&&!0!==r.queue||(r.queue="fx"),r.old=r.complete,r.complete=function(){v(r.old)&&r.old.call(this),r.queue&&ce.dequeue(this,r.queue)},r},ce.fn.extend({fadeTo:function(e,t,n,r){return this.filter(ee).css("opacity",0).show().end().animate({opacity:t},e,n,r)},animate:function(t,e,n,r){var i=ce.isEmptyObject(t),o=ce.speed(e,n,r),a=function(){var e=yt(this,ce.extend({},t),o);(i||_.get(this,"finish"))&&e.stop(!0)};return a.finish=a,i||!1===o.queue?this.each(a):this.queue(o.queue,a)},stop:function(i,e,o){var a=function(e){var t=e.stop;delete e.stop,t(o)};return"string"!=typeof i&&(o=e,e=i,i=void 0),e&&this.queue(i||"fx",[]),this.each(function(){var e=!0,t=null!=i&&i+"queueHooks",n=ce.timers,r=_.get(this);if(t)r[t]&&r[t].stop&&a(r[t]);else for(t in r)r[t]&&r[t].stop&&pt.test(t)&&a(r[t]);for(t=n.length;t--;)n[t].elem!==this||null!=i&&n[t].queue!==i||(n[t].anim.stop(o),e=!1,n.splice(t,1));!e&&o||ce.dequeue(this,i)})},finish:function(a){return!1!==a&&(a=a||"fx"),this.each(function(){var e,t=_.get(this),n=t[a+"queue"],r=t[a+"queueHooks"],i=ce.timers,o=n?n.length:0;for(t.finish=!0,ce.queue(this,a,[]),r&&r.stop&&r.stop.call(this,!0),e=i.length;e--;)i[e].elem===this&&i[e].queue===a&&(i[e].anim.stop(!0),i.splice(e,1));for(e=0;e<o;e++)n[e]&&n[e].finish&&n[e].finish.call(this);delete t.finish})}}),ce.each(["toggle","show","hide"],function(e,r){var i=ce.fn[r];ce.fn[r]=function(e,t,n){return null==e||"boolean"==typeof e?i.apply(this,arguments):this.animate(gt(r,!0),e,t,n)}}),ce.each({slideDown:gt("show"),slideUp:gt("hide"),slideToggle:gt("toggle"),fadeIn:{opacity:"show"},fadeOut:{opacity:"hide"},fadeToggle:{opacity:"toggle"}},function(e,r){ce.fn[e]=function(e,t,n){return this.animate(r,e,t,n)}}),ce.timers=[],ce.fx.tick=function(){var e,t=0,n=ce.timers;for(st=Date.now();t<n.length;t++)(e=n[t])()||n[t]!==e||n.splice(t--,1);n.length||ce.fx.stop(),st=void 0},ce.fx.timer=function(e){ce.timers.push(e),ce.fx.start()},ce.fx.interval=13,ce.fx.start=function(){ut||(ut=!0,dt())},ce.fx.stop=function(){ut=null},ce.fx.speeds={slow:600,fast:200,_default:400},ce.fn.delay=function(r,e){return r=ce.fx&&ce.fx.speeds[r]||r,e=e||"fx",this.queue(e,function(e,t){var n=ie.setTimeout(e,r);t.stop=function(){ie.clearTimeout(n)}})},lt=C.createElement("input"),ct=C.createElement("select").appendChild(C.createElement("option")),lt.type="checkbox",le.checkOn=""!==lt.value,le.optSelected=ct.selected,(lt=C.createElement("input")).value="t",lt.type="radio",le.radioValue="t"===lt.value;var mt,xt=ce.expr.attrHandle;ce.fn.extend({attr:function(e,t){return M(this,ce.attr,e,t,1<arguments.length)},removeAttr:function(e){return this.each(function(){ce.removeAttr(this,e)})}}),ce.extend({attr:function(e,t,n){var r,i,o=e.nodeType;if(3!==o&&8!==o&&2!==o)return"undefined"==typeof e.getAttribute?ce.prop(e,t,n):(1===o&&ce.isXMLDoc(e)||(i=ce.attrHooks[t.toLowerCase()]||(ce.expr.match.bool.test(t)?mt:void 0)),void 0!==n?null===n?void ce.removeAttr(e,t):i&&"set"in i&&void 0!==(r=i.set(e,n,t))?r:(e.setAttribute(t,n+""),n):i&&"get"in i&&null!==(r=i.get(e,t))?r:null==(r=ce.find.attr(e,t))?void 0:r)},attrHooks:{type:{set:function(e,t){if(!le.radioValue&&"radio"===t&&fe(e,"input")){var n=e.value;return e.setAttribute("type",t),n&&(e.value=n),t}}}},removeAttr:function(e,t){var n,r=0,i=t&&t.match(D);if(i&&1===e.nodeType)while(n=i[r++])e.removeAttribute(n)}}),mt={set:function(e,t,n){return!1===t?ce.removeAttr(e,n):e.setAttribute(n,n),n}},ce.each(ce.expr.match.bool.source.match(/\w+/g),function(e,t){var a=xt[t]||ce.find.attr;xt[t]=function(e,t,n){var r,i,o=t.toLowerCase();return n||(i=xt[o],xt[o]=r,r=null!=a(e,t,n)?o:null,xt[o]=i),r}});var bt=/^(?:input|select|textarea|button)$/i,wt=/^(?:a|area)$/i;function Tt(e){return(e.match(D)||[]).join(" ")}function Ct(e){return e.getAttribute&&e.getAttribute("class")||""}function kt(e){return Array.isArray(e)?e:"string"==typeof e&&e.match(D)||[]}ce.fn.extend({prop:function(e,t){return M(this,ce.prop,e,t,1<arguments.length)},removeProp:function(e){return this.each(function(){delete this[ce.propFix[e]||e]})}}),ce.extend({prop:function(e,t,n){var r,i,o=e.nodeType;if(3!==o&&8!==o&&2!==o)return 1===o&&ce.isXMLDoc(e)||(t=ce.propFix[t]||t,i=ce.propHooks[t]),void 0!==n?i&&"set"in i&&void 0!==(r=i.set(e,n,t))?r:e[t]=n:i&&"get"in i&&null!==(r=i.get(e,t))?r:e[t]},propHooks:{tabIndex:{get:function(e){var t=ce.find.attr(e,"tabindex");return t?parseInt(t,10):bt.test(e.nodeName)||wt.test(e.nodeName)&&e.href?0:-1}}},propFix:{"for":"htmlFor","class":"className"}}),le.optSelected||(ce.propHooks.selected={get:function(e){var t=e.parentNode;return t&&t.parentNode&&t.parentNode.selectedIndex,null},set:function(e){var t=e.parentNode;t&&(t.selectedIndex,t.parentNode&&t.parentNode.selectedIndex)}}),ce.each(["tabIndex","readOnly","maxLength","cellSpacing","cellPadding","rowSpan","colSpan","useMap","frameBorder","contentEditable"],function(){ce.propFix[this.toLowerCase()]=this}),ce.fn.extend({addClass:function(t){var e,n,r,i,o,a;return v(t)?this.each(function(e){ce(this).addClass(t.call(this,e,Ct(this)))}):(e=kt(t)).length?this.each(function(){if(r=Ct(this),n=1===this.nodeType&&" "+Tt(r)+" "){for(o=0;o<e.length;o++)i=e[o],n.indexOf(" "+i+" ")<0&&(n+=i+" ");a=Tt(n),r!==a&&this.setAttribute("class",a)}}):this},removeClass:function(t){var e,n,r,i,o,a;return v(t)?this.each(function(e){ce(this).removeClass(t.call(this,e,Ct(this)))}):arguments.length?(e=kt(t)).length?this.each(function(){if(r=Ct(this),n=1===this.nodeType&&" "+Tt(r)+" "){for(o=0;o<e.length;o++){i=e[o];while(-1<n.indexOf(" "+i+" "))n=n.replace(" "+i+" "," ")}a=Tt(n),r!==a&&this.setAttribute("class",a)}}):this:this.attr("class","")},toggleClass:function(t,n){var e,r,i,o,a=typeof t,s="string"===a||Array.isArray(t);return v(t)?this.each(function(e){ce(this).toggleClass(t.call(this,e,Ct(this),n),n)}):"boolean"==typeof n&&s?n?this.addClass(t):this.removeClass(t):(e=kt(t),this.each(function(){if(s)for(o=ce(this),i=0;i<e.length;i++)r=e[i],o.hasClass(r)?o.removeClass(r):o.addClass(r);else void 0!==t&&"boolean"!==a||((r=Ct(this))&&_.set(this,"__className__",r),this.setAttribute&&this.setAttribute("class",r||!1===t?"":_.get(this,"__className__")||""))}))},hasClass:function(e){var t,n,r=0;t=" "+e+" ";while(n=this[r++])if(1===n.nodeType&&-1<(" "+Tt(Ct(n))+" ").indexOf(t))return!0;return!1}});var St=/\r/g;ce.fn.extend({val:function(n){var r,e,i,t=this[0];return arguments.length?(i=v(n),this.each(function(e){var t;1===this.nodeType&&(null==(t=i?n.call(this,e,ce(this).val()):n)?t="":"number"==typeof t?t+="":Array.isArray(t)&&(t=ce.map(t,function(e){return null==e?"":e+""})),(r=ce.valHooks[this.type]||ce.valHooks[this.nodeName.toLowerCase()])&&"set"in r&&void 0!==r.set(this,t,"value")||(this.value=t))})):t?(r=ce.valHooks[t.type]||ce.valHooks[t.nodeName.toLowerCase()])&&"get"in r&&void 0!==(e=r.get(t,"value"))?e:"string"==typeof(e=t.value)?e.replace(St,""):null==e?"":e:void 0}}),ce.extend({valHooks:{option:{get:function(e){var t=ce.find.attr(e,"value");return null!=t?t:Tt(ce.text(e))}},select:{get:function(e){var t,n,r,i=e.options,o=e.selectedIndex,a="select-one"===e.type,s=a?null:[],u=a?o+1:i.length;for(r=o<0?u:a?o:0;r<u;r++)if(((n=i[r]).selected||r===o)&&!n.disabled&&(!n.parentNode.disabled||!fe(n.parentNode,"optgroup"))){if(t=ce(n).val(),a)return t;s.push(t)}return s},set:function(e,t){var n,r,i=e.options,o=ce.makeArray(t),a=i.length;while(a--)((r=i[a]).selected=-1<ce.inArray(ce.valHooks.option.get(r),o))&&(n=!0);return n||(e.selectedIndex=-1),o}}}}),ce.each(["radio","checkbox"],function(){ce.valHooks[this]={set:function(e,t){if(Array.isArray(t))return e.checked=-1<ce.inArray(ce(e).val(),t)}},le.checkOn||(ce.valHooks[this].get=function(e){return null===e.getAttribute("value")?"on":e.value})});var Et=ie.location,jt={guid:Date.now()},At=/\?/;ce.parseXML=function(e){var t,n;if(!e||"string"!=typeof e)return null;try{t=(new ie.DOMParser).parseFromString(e,"text/xml")}catch(e){}return n=t&&t.getElementsByTagName("parsererror")[0],t&&!n||ce.error("Invalid XML: "+(n?ce.map(n.childNodes,function(e){return e.textContent}).join("\n"):e)),t};var Dt=/^(?:focusinfocus|focusoutblur)$/,Nt=function(e){e.stopPropagation()};ce.extend(ce.event,{trigger:function(e,t,n,r){var i,o,a,s,u,l,c,f,p=[n||C],d=ue.call(e,"type")?e.type:e,h=ue.call(e,"namespace")?e.namespace.split("."):[];if(o=f=a=n=n||C,3!==n.nodeType&&8!==n.nodeType&&!Dt.test(d+ce.event.triggered)&&(-1<d.indexOf(".")&&(d=(h=d.split(".")).shift(),h.sort()),u=d.indexOf(":")<0&&"on"+d,(e=e[ce.expando]?e:new ce.Event(d,"object"==typeof e&&e)).isTrigger=r?2:3,e.namespace=h.join("."),e.rnamespace=e.namespace?new RegExp("(^|\\.)"+h.join("\\.(?:.*\\.|)")+"(\\.|$)"):null,e.result=void 0,e.target||(e.target=n),t=null==t?[e]:ce.makeArray(t,[e]),c=ce.event.special[d]||{},r||!c.trigger||!1!==c.trigger.apply(n,t))){if(!r&&!c.noBubble&&!y(n)){for(s=c.delegateType||d,Dt.test(s+d)||(o=o.parentNode);o;o=o.parentNode)p.push(o),a=o;a===(n.ownerDocument||C)&&p.push(a.defaultView||a.parentWindow||ie)}i=0;while((o=p[i++])&&!e.isPropagationStopped())f=o,e.type=1<i?s:c.bindType||d,(l=(_.get(o,"events")||Object.create(null))[e.type]&&_.get(o,"handle"))&&l.apply(o,t),(l=u&&o[u])&&l.apply&&$(o)&&(e.result=l.apply(o,t),!1===e.result&&e.preventDefault());return e.type=d,r||e.isDefaultPrevented()||c._default&&!1!==c._default.apply(p.pop(),t)||!$(n)||u&&v(n[d])&&!y(n)&&((a=n[u])&&(n[u]=null),ce.event.triggered=d,e.isPropagationStopped()&&f.addEventListener(d,Nt),n[d](),e.isPropagationStopped()&&f.removeEventListener(d,Nt),ce.event.triggered=void 0,a&&(n[u]=a)),e.result}},simulate:function(e,t,n){var r=ce.extend(new ce.Event,n,{type:e,isSimulated:!0});ce.event.trigger(r,null,t)}}),ce.fn.extend({trigger:function(e,t){return this.each(function(){ce.event.trigger(e,t,this)})},triggerHandler:function(e,t){var n=this[0];if(n)return ce.event.trigger(e,t,n,!0)}});var qt=/\[\]$/,Lt=/\r?\n/g,Ht=/^(?:submit|button|image|reset|file)$/i,Ot=/^(?:input|select|textarea|keygen)/i;function Pt(n,e,r,i){var t;if(Array.isArray(e))ce.each(e,function(e,t){r||qt.test(n)?i(n,t):Pt(n+"["+("object"==typeof t&&null!=t?e:"")+"]",t,r,i)});else if(r||"object"!==x(e))i(n,e);else for(t in e)Pt(n+"["+t+"]",e[t],r,i)}ce.param=function(e,t){var n,r=[],i=function(e,t){var n=v(t)?t():t;r[r.length]=encodeURIComponent(e)+"="+encodeURIComponent(null==n?"":n)};if(null==e)return"";if(Array.isArray(e)||e.jquery&&!ce.isPlainObject(e))ce.each(e,function(){i(this.name,this.value)});else for(n in e)Pt(n,e[n],t,i);return r.join("&")},ce.fn.extend({serialize:function(){return ce.param(this.serializeArray())},serializeArray:function(){return this.map(function(){var e=ce.prop(this,"elements");return e?ce.makeArray(e):this}).filter(function(){var e=this.type;return this.name&&!ce(this).is(":disabled")&&Ot.test(this.nodeName)&&!Ht.test(e)&&(this.checked||!we.test(e))}).map(function(e,t){var n=ce(this).val();return null==n?null:Array.isArray(n)?ce.map(n,function(e){return{name:t.name,value:e.replace(Lt,"\r\n")}}):{name:t.name,value:n.replace(Lt,"\r\n")}}).get()}});var Mt=/%20/g,Rt=/#.*$/,It=/([?&])_=[^&]*/,Wt=/^(.*?):[ \t]*([^\r\n]*)$/gm,Ft=/^(?:GET|HEAD)$/,$t=/^\/\//,Bt={},_t={},zt="*/".concat("*"),Xt=C.createElement("a");function Ut(o){return function(e,t){"string"!=typeof e&&(t=e,e="*");var n,r=0,i=e.toLowerCase().match(D)||[];if(v(t))while(n=i[r++])"+"===n[0]?(n=n.slice(1)||"*",(o[n]=o[n]||[]).unshift(t)):(o[n]=o[n]||[]).push(t)}}function Vt(t,i,o,a){var s={},u=t===_t;function l(e){var r;return s[e]=!0,ce.each(t[e]||[],function(e,t){var n=t(i,o,a);return"string"!=typeof n||u||s[n]?u?!(r=n):void 0:(i.dataTypes.unshift(n),l(n),!1)}),r}return l(i.dataTypes[0])||!s["*"]&&l("*")}function Gt(e,t){var n,r,i=ce.ajaxSettings.flatOptions||{};for(n in t)void 0!==t[n]&&((i[n]?e:r||(r={}))[n]=t[n]);return r&&ce.extend(!0,e,r),e}Xt.href=Et.href,ce.extend({active:0,lastModified:{},etag:{},ajaxSettings:{url:Et.href,type:"GET",isLocal:/^(?:about|app|app-storage|.+-extension|file|res|widget):$/.test(Et.protocol),global:!0,processData:!0,async:!0,contentType:"application/x-www-form-urlencoded; charset=UTF-8",accepts:{"*":zt,text:"text/plain",html:"text/html",xml:"application/xml, text/xml",json:"application/json, text/javascript"},contents:{xml:/\bxml\b/,html:/\bhtml/,json:/\bjson\b/},responseFields:{xml:"responseXML",text:"responseText",json:"responseJSON"},converters:{"* text":String,"text html":!0,"text json":JSON.parse,"text xml":ce.parseXML},flatOptions:{url:!0,context:!0}},ajaxSetup:function(e,t){return t?Gt(Gt(e,ce.ajaxSettings),t):Gt(ce.ajaxSettings,e)},ajaxPrefilter:Ut(Bt),ajaxTransport:Ut(_t),ajax:function(e,t){"object"==typeof e&&(t=e,e=void 0),t=t||{};var c,f,p,n,d,r,h,g,i,o,v=ce.ajaxSetup({},t),y=v.context||v,m=v.context&&(y.nodeType||y.jquery)?ce(y):ce.event,x=ce.Deferred(),b=ce.Callbacks("once memory"),w=v.statusCode||{},a={},s={},u="canceled",T={readyState:0,getResponseHeader:function(e){var t;if(h){if(!n){n={};while(t=Wt.exec(p))n[t[1].toLowerCase()+" "]=(n[t[1].toLowerCase()+" "]||[]).concat(t[2])}t=n[e.toLowerCase()+" "]}return null==t?null:t.join(", ")},getAllResponseHeaders:function(){return h?p:null},setRequestHeader:function(e,t){return null==h&&(e=s[e.toLowerCase()]=s[e.toLowerCase()]||e,a[e]=t),this},overrideMimeType:function(e){return null==h&&(v.mimeType=e),this},statusCode:function(e){var t;if(e)if(h)T.always(e[T.status]);else for(t in e)w[t]=[w[t],e[t]];return this},abort:function(e){var t=e||u;return c&&c.abort(t),l(0,t),this}};if(x.promise(T),v.url=((e||v.url||Et.href)+"").replace($t,Et.protocol+"//"),v.type=t.method||t.type||v.method||v.type,v.dataTypes=(v.dataType||"*").toLowerCase().match(D)||[""],null==v.crossDomain){r=C.createElement("a");try{r.href=v.url,r.href=r.href,v.crossDomain=Xt.protocol+"//"+Xt.host!=r.protocol+"//"+r.host}catch(e){v.crossDomain=!0}}if(v.data&&v.processData&&"string"!=typeof v.data&&(v.data=ce.param(v.data,v.traditional)),Vt(Bt,v,t,T),h)return T;for(i in(g=ce.event&&v.global)&&0==ce.active++&&ce.event.trigger("ajaxStart"),v.type=v.type.toUpperCase(),v.hasContent=!Ft.test(v.type),f=v.url.replace(Rt,""),v.hasContent?v.data&&v.processData&&0===(v.contentType||"").indexOf("application/x-www-form-urlencoded")&&(v.data=v.data.replace(Mt,"+")):(o=v.url.slice(f.length),v.data&&(v.processData||"string"==typeof v.data)&&(f+=(At.test(f)?"&":"?")+v.data,delete v.data),!1===v.cache&&(f=f.replace(It,"$1"),o=(At.test(f)?"&":"?")+"_="+jt.guid+++o),v.url=f+o),v.ifModified&&(ce.lastModified[f]&&T.setRequestHeader("If-Modified-Since",ce.lastModified[f]),ce.etag[f]&&T.setRequestHeader("If-None-Match",ce.etag[f])),(v.data&&v.hasContent&&!1!==v.contentType||t.contentType)&&T.setRequestHeader("Content-Type",v.contentType),T.setRequestHeader("Accept",v.dataTypes[0]&&v.accepts[v.dataTypes[0]]?v.accepts[v.dataTypes[0]]+("*"!==v.dataTypes[0]?", "+zt+"; q=0.01":""):v.accepts["*"]),v.headers)T.setRequestHeader(i,v.headers[i]);if(v.beforeSend&&(!1===v.beforeSend.call(y,T,v)||h))return T.abort();if(u="abort",b.add(v.complete),T.done(v.success),T.fail(v.error),c=Vt(_t,v,t,T)){if(T.readyState=1,g&&m.trigger("ajaxSend",[T,v]),h)return T;v.async&&0<v.timeout&&(d=ie.setTimeout(function(){T.abort("timeout")},v.timeout));try{h=!1,c.send(a,l)}catch(e){if(h)throw e;l(-1,e)}}else l(-1,"No Transport");function l(e,t,n,r){var i,o,a,s,u,l=t;h||(h=!0,d&&ie.clearTimeout(d),c=void 0,p=r||"",T.readyState=0<e?4:0,i=200<=e&&e<300||304===e,n&&(s=function(e,t,n){var r,i,o,a,s=e.contents,u=e.dataTypes;while("*"===u[0])u.shift(),void 0===r&&(r=e.mimeType||t.getResponseHeader("Content-Type"));if(r)for(i in s)if(s[i]&&s[i].test(r)){u.unshift(i);break}if(u[0]in n)o=u[0];else{for(i in n){if(!u[0]||e.converters[i+" "+u[0]]){o=i;break}a||(a=i)}o=o||a}if(o)return o!==u[0]&&u.unshift(o),n[o]}(v,T,n)),!i&&-1<ce.inArray("script",v.dataTypes)&&ce.inArray("json",v.dataTypes)<0&&(v.converters["text script"]=function(){}),s=function(e,t,n,r){var i,o,a,s,u,l={},c=e.dataTypes.slice();if(c[1])for(a in e.converters)l[a.toLowerCase()]=e.converters[a];o=c.shift();while(o)if(e.responseFields[o]&&(n[e.responseFields[o]]=t),!u&&r&&e.dataFilter&&(t=e.dataFilter(t,e.dataType)),u=o,o=c.shift())if("*"===o)o=u;else if("*"!==u&&u!==o){if(!(a=l[u+" "+o]||l["* "+o]))for(i in l)if((s=i.split(" "))[1]===o&&(a=l[u+" "+s[0]]||l["* "+s[0]])){!0===a?a=l[i]:!0!==l[i]&&(o=s[0],c.unshift(s[1]));break}if(!0!==a)if(a&&e["throws"])t=a(t);else try{t=a(t)}catch(e){return{state:"parsererror",error:a?e:"No conversion from "+u+" to "+o}}}return{state:"success",data:t}}(v,s,T,i),i?(v.ifModified&&((u=T.getResponseHeader("Last-Modified"))&&(ce.lastModified[f]=u),(u=T.getResponseHeader("etag"))&&(ce.etag[f]=u)),204===e||"HEAD"===v.type?l="nocontent":304===e?l="notmodified":(l=s.state,o=s.data,i=!(a=s.error))):(a=l,!e&&l||(l="error",e<0&&(e=0))),T.status=e,T.statusText=(t||l)+"",i?x.resolveWith(y,[o,l,T]):x.rejectWith(y,[T,l,a]),T.statusCode(w),w=void 0,g&&m.trigger(i?"ajaxSuccess":"ajaxError",[T,v,i?o:a]),b.fireWith(y,[T,l]),g&&(m.trigger("ajaxComplete",[T,v]),--ce.active||ce.event.trigger("ajaxStop")))}return T},getJSON:function(e,t,n){return ce.get(e,t,n,"json")},getScript:function(e,t){return ce.get(e,void 0,t,"script")}}),ce.each(["get","post"],function(e,i){ce[i]=function(e,t,n,r){return v(t)&&(r=r||n,n=t,t=void 0),ce.ajax(ce.extend({url:e,type:i,dataType:r,data:t,success:n},ce.isPlainObject(e)&&e))}}),ce.ajaxPrefilter(function(e){var t;for(t in e.headers)"content-type"===t.toLowerCase()&&(e.contentType=e.headers[t]||"")}),ce._evalUrl=function(e,t,n){return ce.ajax({url:e,type:"GET",dataType:"script",cache:!0,async:!1,global:!1,converters:{"text script":function(){}},dataFilter:function(e){ce.globalEval(e,t,n)}})},ce.fn.extend({wrapAll:function(e){var t;return this[0]&&(v(e)&&(e=e.call(this[0])),t=ce(e,this[0].ownerDocument).eq(0).clone(!0),this[0].parentNode&&t.insertBefore(this[0]),t.map(function(){var e=this;while(e.firstElementChild)e=e.firstElementChild;return e}).append(this)),this},wrapInner:function(n){return v(n)?this.each(function(e){ce(this).wrapInner(n.call(this,e))}):this.each(function(){var e=ce(this),t=e.contents();t.length?t.wrapAll(n):e.append(n)})},wrap:function(t){var n=v(t);return this.each(function(e){ce(this).wrapAll(n?t.call(this,e):t)})},unwrap:function(e){return this.parent(e).not("body").each(function(){ce(this).replaceWith(this.childNodes)}),this}}),ce.expr.pseudos.hidden=function(e){return!ce.expr.pseudos.visible(e)},ce.expr.pseudos.visible=function(e){return!!(e.offsetWidth||e.offsetHeight||e.getClientRects().length)},ce.ajaxSettings.xhr=function(){try{return new ie.XMLHttpRequest}catch(e){}};var Yt={0:200,1223:204},Qt=ce.ajaxSettings.xhr();le.cors=!!Qt&&"withCredentials"in Qt,le.ajax=Qt=!!Qt,ce.ajaxTransport(function(i){var o,a;if(le.cors||Qt&&!i.crossDomain)return{send:function(e,t){var n,r=i.xhr();if(r.open(i.type,i.url,i.async,i.username,i.password),i.xhrFields)for(n in i.xhrFields)r[n]=i.xhrFields[n];for(n in i.mimeType&&r.overrideMimeType&&r.overrideMimeType(i.mimeType),i.crossDomain||e["X-Requested-With"]||(e["X-Requested-With"]="XMLHttpRequest"),e)r.setRequestHeader(n,e[n]);o=function(e){return function(){o&&(o=a=r.onload=r.onerror=r.onabort=r.ontimeout=r.onreadystatechange=null,"abort"===e?r.abort():"error"===e?"number"!=typeof r.status?t(0,"error"):t(r.status,r.statusText):t(Yt[r.status]||r.status,r.statusText,"text"!==(r.responseType||"text")||"string"!=typeof r.responseText?{binary:r.response}:{text:r.responseText},r.getAllResponseHeaders()))}},r.onload=o(),a=r.onerror=r.ontimeout=o("error"),void 0!==r.onabort?r.onabort=a:r.onreadystatechange=function(){4===r.readyState&&ie.setTimeout(function(){o&&a()})},o=o("abort");try{r.send(i.hasContent&&i.data||null)}catch(e){if(o)throw e}},abort:function(){o&&o()}}}),ce.ajaxPrefilter(function(e){e.crossDomain&&(e.contents.script=!1)}),ce.ajaxSetup({accepts:{script:"text/javascript, application/javascript, application/ecmascript, application/x-ecmascript"},contents:{script:/\b(?:java|ecma)script\b/},converters:{"text script":function(e){return ce.globalEval(e),e}}}),ce.ajaxPrefilter("script",function(e){void 0===e.cache&&(e.cache=!1),e.crossDomain&&(e.type="GET")}),ce.ajaxTransport("script",function(n){var r,i;if(n.crossDomain||n.scriptAttrs)return{send:function(e,t){r=ce("<script>").attr(n.scriptAttrs||{}).prop({charset:n.scriptCharset,src:n.url}).on("load error",i=function(e){r.remove(),i=null,e&&t("error"===e.type?404:200,e.type)}),C.head.appendChild(r[0])},abort:function(){i&&i()}}});var Jt,Kt=[],Zt=/(=)\?(?=&|$)|\?\?/;ce.ajaxSetup({jsonp:"callback",jsonpCallback:function(){var e=Kt.pop()||ce.expando+"_"+jt.guid++;return this[e]=!0,e}}),ce.ajaxPrefilter("json jsonp",function(e,t,n){var r,i,o,a=!1!==e.jsonp&&(Zt.test(e.url)?"url":"string"==typeof e.data&&0===(e.contentType||"").indexOf("application/x-www-form-urlencoded")&&Zt.test(e.data)&&"data");if(a||"jsonp"===e.dataTypes[0])return r=e.jsonpCallback=v(e.jsonpCallback)?e.jsonpCallback():e.jsonpCallback,a?e[a]=e[a].replace(Zt,"$1"+r):!1!==e.jsonp&&(e.url+=(At.test(e.url)?"&":"?")+e.jsonp+"="+r),e.converters["script json"]=function(){return o||ce.error(r+" was not called"),o[0]},e.dataTypes[0]="json",i=ie[r],ie[r]=function(){o=arguments},n.always(function(){void 0===i?ce(ie).removeProp(r):ie[r]=i,e[r]&&(e.jsonpCallback=t.jsonpCallback,Kt.push(r)),o&&v(i)&&i(o[0]),o=i=void 0}),"script"}),le.createHTMLDocument=((Jt=C.implementation.createHTMLDocument("").body).innerHTML="<form></form><form></form>",2===Jt.childNodes.length),ce.parseHTML=function(e,t,n){return"string"!=typeof e?[]:("boolean"==typeof t&&(n=t,t=!1),t||(le.createHTMLDocument?((r=(t=C.implementation.createHTMLDocument("")).createElement("base")).href=C.location.href,t.head.appendChild(r)):t=C),o=!n&&[],(i=w.exec(e))?[t.createElement(i[1])]:(i=Ae([e],t,o),o&&o.length&&ce(o).remove(),ce.merge([],i.childNodes)));var r,i,o},ce.fn.load=function(e,t,n){var r,i,o,a=this,s=e.indexOf(" ");return-1<s&&(r=Tt(e.slice(s)),e=e.slice(0,s)),v(t)?(n=t,t=void 0):t&&"object"==typeof t&&(i="POST"),0<a.length&&ce.ajax({url:e,type:i||"GET",dataType:"html",data:t}).done(function(e){o=arguments,a.html(r?ce("<div>").append(ce.parseHTML(e)).find(r):e)}).always(n&&function(e,t){a.each(function(){n.apply(this,o||[e.responseText,t,e])})}),this},ce.expr.pseudos.animated=function(t){return ce.grep(ce.timers,function(e){return t===e.elem}).length},ce.offset={setOffset:function(e,t,n){var r,i,o,a,s,u,l=ce.css(e,"position"),c=ce(e),f={};"static"===l&&(e.style.position="relative"),s=c.offset(),o=ce.css(e,"top"),u=ce.css(e,"left"),("absolute"===l||"fixed"===l)&&-1<(o+u).indexOf("auto")?(a=(r=c.position()).top,i=r.left):(a=parseFloat(o)||0,i=parseFloat(u)||0),v(t)&&(t=t.call(e,n,ce.extend({},s))),null!=t.top&&(f.top=t.top-s.top+a),null!=t.left&&(f.left=t.left-s.left+i),"using"in t?t.using.call(e,f):c.css(f)}},ce.fn.extend({offset:function(t){if(arguments.length)return void 0===t?this:this.each(function(e){ce.offset.setOffset(this,t,e)});var e,n,r=this[0];return r?r.getClientRects().length?(e=r.getBoundingClientRect(),n=r.ownerDocument.defaultView,{top:e.top+n.pageYOffset,left:e.left+n.pageXOffset}):{top:0,left:0}:void 0},position:function(){if(this[0]){var e,t,n,r=this[0],i={top:0,left:0};if("fixed"===ce.css(r,"position"))t=r.getBoundingClientRect();else{t=this.offset(),n=r.ownerDocument,e=r.offsetParent||n.documentElement;while(e&&(e===n.body||e===n.documentElement)&&"static"===ce.css(e,"position"))e=e.parentNode;e&&e!==r&&1===e.nodeType&&((i=ce(e).offset()).top+=ce.css(e,"borderTopWidth",!0),i.left+=ce.css(e,"borderLeftWidth",!0))}return{top:t.top-i.top-ce.css(r,"marginTop",!0),left:t.left-i.left-ce.css(r,"marginLeft",!0)}}},offsetParent:function(){return this.map(function(){var e=this.offsetParent;while(e&&"static"===ce.css(e,"position"))e=e.offsetParent;return e||J})}}),ce.each({scrollLeft:"pageXOffset",scrollTop:"pageYOffset"},function(t,i){var o="pageYOffset"===i;ce.fn[t]=function(e){return M(this,function(e,t,n){var r;if(y(e)?r=e:9===e.nodeType&&(r=e.defaultView),void 0===n)return r?r[i]:e[t];r?r.scrollTo(o?r.pageXOffset:n,o?n:r.pageYOffset):e[t]=n},t,e,arguments.length)}}),ce.each(["top","left"],function(e,n){ce.cssHooks[n]=Ye(le.pixelPosition,function(e,t){if(t)return t=Ge(e,n),_e.test(t)?ce(e).position()[n]+"px":t})}),ce.each({Height:"height",Width:"width"},function(a,s){ce.each({padding:"inner"+a,content:s,"":"outer"+a},function(r,o){ce.fn[o]=function(e,t){var n=arguments.length&&(r||"boolean"!=typeof e),i=r||(!0===e||!0===t?"margin":"border");return M(this,function(e,t,n){var r;return y(e)?0===o.indexOf("outer")?e["inner"+a]:e.document.documentElement["client"+a]:9===e.nodeType?(r=e.documentElement,Math.max(e.body["scroll"+a],r["scroll"+a],e.body["offset"+a],r["offset"+a],r["client"+a])):void 0===n?ce.css(e,t,i):ce.style(e,t,n,i)},s,n?e:void 0,n)}})}),ce.each(["ajaxStart","ajaxStop","ajaxComplete","ajaxError","ajaxSuccess","ajaxSend"],function(e,t){ce.fn[t]=function(e){return this.on(t,e)}}),ce.fn.extend({bind:function(e,t,n){return this.on(e,null,t,n)},unbind:function(e,t){return this.off(e,null,t)},delegate:function(e,t,n,r){return this.on(t,e,n,r)},undelegate:function(e,t,n){return 1===arguments.length?this.off(e,"**"):this.off(t,e||"**",n)},hover:function(e,t){return this.on("mouseenter",e).on("mouseleave",t||e)}}),ce.each("blur focus focusin focusout resize scroll click dblclick mousedown mouseup mousemove mouseover mouseout mouseenter mouseleave change select submit keydown keypress keyup contextmenu".split(" "),function(e,n){ce.fn[n]=function(e,t){return 0<arguments.length?this.on(n,null,e,t):this.trigger(n)}});var en=/^[\s\uFEFF\xA0]+|([^\s\uFEFF\xA0])[\s\uFEFF\xA0]+$/g;ce.proxy=function(e,t){var n,r,i;if("string"==typeof t&&(n=e[t],t=e,e=n),v(e))return r=ae.call(arguments,2),(i=function(){return e.apply(t||this,r.concat(ae.call(arguments)))}).guid=e.guid=e.guid||ce.guid++,i},ce.holdReady=function(e){e?ce.readyWait++:ce.ready(!0)},ce.isArray=Array.isArray,ce.parseJSON=JSON.parse,ce.nodeName=fe,ce.isFunction=v,ce.isWindow=y,ce.camelCase=F,ce.type=x,ce.now=Date.now,ce.isNumeric=function(e){var t=ce.type(e);return("number"===t||"string"===t)&&!isNaN(e-parseFloat(e))},ce.trim=function(e){return null==e?"":(e+"").replace(en,"$1")},"function"==typeof define&&define.amd&&define("jquery",[],function(){return ce});var tn=ie.jQuery,nn=ie.$;return ce.noConflict=function(e){return ie.$===ce&&(ie.$=nn),e&&ie.jQuery===ce&&(ie.jQuery=tn),ce},"undefined"==typeof e&&(ie.jQuery=ie.$=ce),ce});
diff --git a/tests/BCards.Tests/BCards.Tests.csproj b/tests/BCards.Tests/BCards.Tests.csproj
new file mode 100644
index 0000000..a694d05
--- /dev/null
+++ b/tests/BCards.Tests/BCards.Tests.csproj
@@ -0,0 +1,30 @@
+<Project Sdk="Microsoft.NET.Sdk">
+
+  <PropertyGroup>
+    <TargetFramework>net8.0</TargetFramework>
+    <ImplicitUsings>enable</ImplicitUsings>
+    <Nullable>enable</Nullable>
+    <IsPackable>false</IsPackable>
+    <IsTestProject>true</IsTestProject>
+  </PropertyGroup>
+
+  <ItemGroup>
+    <PackageReference Include="Microsoft.NET.Test.Sdk" Version="17.9.0" />
+    <PackageReference Include="xunit" Version="2.6.6" />
+    <PackageReference Include="xunit.runner.visualstudio" Version="2.5.6">
+      <IncludeAssets>runtime; build; native; contentfiles; analyzers; buildtransitive</IncludeAssets>
+      <PrivateAssets>all</PrivateAssets>
+    </PackageReference>
+    <PackageReference Include="coverlet.collector" Version="6.0.1">
+      <IncludeAssets>runtime; build; native; contentfiles; analyzers; buildtransitive</IncludeAssets>
+      <PrivateAssets>all</PrivateAssets>
+    </PackageReference>
+    <PackageReference Include="Moq" Version="4.20.70" />
+    <PackageReference Include="Microsoft.AspNetCore.Mvc.Testing" Version="8.0.4" />
+  </ItemGroup>
+
+  <ItemGroup>
+    <ProjectReference Include="..\..\src\BCards.Web\BCards.Web.csproj" />
+  </ItemGroup>
+
+</Project>
\ No newline at end of file